test/dummy/tmp/cache/assets/development/sprockets/d16461dfcae4b782f721ebd81e4f8740 in carnival-0.0.55 vs test/dummy/tmp/cache/assets/development/sprockets/d16461dfcae4b782f721ebd81e4f8740 in carnival-0.0.56
- old
+ new
@@ -1,26 +1,14981 @@
-{I"
-class:ETI"ProcessedAsset; FI"logical_path; TI"carnival/admin.js; TI"
pathname; TI"6/project/app/assets/javascripts/carnival/admin.js; TI"content_type; TI"application/javascript; TI"
-mtime; Tl+6SI"length; TiI"digest; TI"%150a6cef3468e52f0303792b59165fec; FI"source; TI"
+{I"
+class:ETI"BundledAsset; FI"logical_path; TI"carnival/admin.js; TI"
pathname; TI"6/project/app/assets/javascripts/carnival/admin.js; FI"content_type; TI"application/javascript; TI"
+mtime; Tl+ SI"length; Ti?I"digest; TI"%72a3f84553569ed59f7fa2800219690e; FI"source; TI"?/*!
+ * jQuery JavaScript Library v1.11.0
+ * http://jquery.com/
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ *
+ * Copyright 2005, 2014 jQuery Foundation, Inc. and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: 2014-01-23T21:02Z
+ */
+(function( global, factory ) {
+ if ( typeof module === "object" && typeof module.exports === "object" ) {
+ // For CommonJS and CommonJS-like environments where a proper window is present,
+ // execute the factory and get jQuery
+ // For environments that do not inherently posses a window with a document
+ // (such as Node.js), expose a jQuery-making factory as module.exports
+ // This accentuates the need for the creation of a real window
+ // e.g. var jQuery = require("jquery")(window);
+ // See ticket #14549 for more info
+ module.exports = global.document ?
+ factory( global, true ) :
+ function( w ) {
+ if ( !w.document ) {
+ throw new Error( "jQuery requires a window with a document" );
+ }
+ return factory( w );
+ };
+ } else {
+ factory( global );
+ }
+// Pass this if window is not defined yet
+}(typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
+// Can't do this because several apps including ASP.NET trace
+// the stack via arguments.caller.callee and Firefox dies if
+// you try to trace through "use strict" call chains. (#13335)
+// Support: Firefox 18+
+//
+var deletedIds = [];
+var slice = deletedIds.slice;
+var concat = deletedIds.concat;
+var push = deletedIds.push;
-; TI"dependency_digest; TI"%0a456ea2d854fb934a49b70c5c602660; FI"required_paths; T[I"h/home/vagrant/.rvm/gems/ruby-2.0.0-p353/gems/jquery-rails-3.1.0/vendor/assets/javascripts/jquery.js; FI"l/home/vagrant/.rvm/gems/ruby-2.0.0-p353/gems/jquery-rails-3.1.0/vendor/assets/javascripts/jquery_ujs.js; FI"O/project/app/assets/javascripts/carnival/external/jquery.dataTables.min.js; TI"E/project/app/assets/javascripts/carnival/external/jquery.noty.js; TI"M/project/app/assets/javascripts/carnival/external/jquery.colorbox-min.js; TI"T/project/app/assets/javascripts/carnival/external/jquery-ui-1.9.1.custom.min.js; TI"G/project/app/assets/javascripts/carnival/external/chosen.jquery.js; TI"U/project/app/assets/javascripts/carnival/external/perfect-scrollbar-0.4.6.min.js; TI"e/project/app/assets/javascripts/carnival/external/perfect-scrollbar-0.4.6.with-mousewheel.min.js; TI"I/project/app/assets/javascripts/carnival/external/jquery.fancybox.js; TI"</project/app/assets/javascripts/carnival/vizir_admin.js; TI"6/project/app/assets/javascripts/carnival/admin.js; TI"dependency_paths; T[{I" path; TI"6/project/app/assets/javascripts/carnival/admin.js; TI"
-mtime; TI"2014-03-29T16:06:39+00:00; TI"digest; TI"%76379ab249f7dcc1dfd741fbb91df2bd; F{I" path; TI"h/home/vagrant/.rvm/gems/ruby-2.0.0-p353/gems/jquery-rails-3.1.0/vendor/assets/javascripts/jquery.js; FI"
-mtime; TI"2014-04-28T03:27:40+00:00; TI"digest; TI"%b7548618ed2fe3b21bee32af606b9cd3; F{I" path; TI"l/home/vagrant/.rvm/gems/ruby-2.0.0-p353/gems/jquery-rails-3.1.0/vendor/assets/javascripts/jquery_ujs.js; FI"
-mtime; TI"2014-04-28T03:27:40+00:00; TI"digest; TI"%089a77e75c08f00779d8879d2e3a2738; F{I" path; TI"O/project/app/assets/javascripts/carnival/external/jquery.dataTables.min.js; TI"
-mtime; TI"2014-03-03T19:29:03+00:00; TI"digest; T"%9fe58c678eb8bcecfabcbac3bee2f286{I" path; TI"E/project/app/assets/javascripts/carnival/external/jquery.noty.js; TI"
-mtime; TI"2014-03-03T19:29:03+00:00; TI"digest; T"%3de1aad35ea85f0450c514200e995bb8{I" path; TI"M/project/app/assets/javascripts/carnival/external/jquery.colorbox-min.js; TI"
-mtime; TI"2014-03-03T19:29:03+00:00; TI"digest; T"%b6facb4342cb999c0ca17802aa3651ca{I" path; TI"T/project/app/assets/javascripts/carnival/external/jquery-ui-1.9.1.custom.min.js; TI"
-mtime; TI"2014-03-03T19:29:03+00:00; TI"digest; T"%62e31804c6847aa6a82a27a71bf7bc94{I" path; TI"G/project/app/assets/javascripts/carnival/external/chosen.jquery.js; TI"
-mtime; TI"2014-03-03T19:29:03+00:00; TI"digest; T"%870a752ed5cc8029764956f0a96216c3{I" path; TI"U/project/app/assets/javascripts/carnival/external/perfect-scrollbar-0.4.6.min.js; TI"
-mtime; TI"2014-03-03T19:29:03+00:00; TI"digest; T"%03a1ec45949b98fcbd1943e5876cedc5{I" path; TI"e/project/app/assets/javascripts/carnival/external/perfect-scrollbar-0.4.6.with-mousewheel.min.js; TI"
-mtime; TI"2014-03-03T19:29:03+00:00; TI"digest; T"%8a00c4957d152a721c8f269cc048c0b7{I" path; TI"I/project/app/assets/javascripts/carnival/external/jquery.fancybox.js; TI"
-mtime; TI"2013-06-14T05:12:28+00:00; TI"digest; T"%5e8c80665d8ac765614f7dcf16abbfcd{I" path; TI"</project/app/assets/javascripts/carnival/vizir_admin.js; TI"
-mtime; TI"2014-04-19T15:45:52+00:00; TI"digest; T"%e64cc4577b4019ab6d46bedf3ec5eeabI"
_version; TI"%9bd74cab6f8cd17bb7b52df6002861bd; F
+var indexOf = deletedIds.indexOf;
+
+var class2type = {};
+
+var toString = class2type.toString;
+
+var hasOwn = class2type.hasOwnProperty;
+
+var trim = "".trim;
+
+var support = {};
+
+
+
+var
+ version = "1.11.0",
+
+ // Define a local copy of jQuery
+ jQuery = function( selector, context ) {
+ // The jQuery object is actually just the init constructor 'enhanced'
+ // Need init if jQuery is called (just allow error to be thrown if not included)
+ return new jQuery.fn.init( selector, context );
+ },
+
+ // Make sure we trim BOM and NBSP (here's looking at you, Safari 5.0 and IE)
+ rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,
+
+ // Matches dashed string for camelizing
+ rmsPrefix = /^-ms-/,
+ rdashAlpha = /-([\da-z])/gi,
+
+ // Used by jQuery.camelCase as callback to replace()
+ fcamelCase = function( all, letter ) {
+ return letter.toUpperCase();
+ };
+
+jQuery.fn = jQuery.prototype = {
+ // The current version of jQuery being used
+ jquery: version,
+
+ constructor: jQuery,
+
+ // Start with an empty selector
+ selector: "",
+
+ // The default length of a jQuery object is 0
+ length: 0,
+
+ toArray: function() {
+ return slice.call( this );
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function( num ) {
+ return num != null ?
+
+ // Return a 'clean' array
+ ( num < 0 ? this[ num + this.length ] : this[ num ] ) :
+
+ // Return just the object
+ slice.call( this );
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function( elems ) {
+
+ // Build a new jQuery matched element set
+ var ret = jQuery.merge( this.constructor(), elems );
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+ ret.context = this.context;
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Execute a callback for every element in the matched set.
+ // (You can seed the arguments with an array of args, but this is
+ // only used internally.)
+ each: function( callback, args ) {
+ return jQuery.each( this, callback, args );
+ },
+
+ map: function( callback ) {
+ return this.pushStack( jQuery.map(this, function( elem, i ) {
+ return callback.call( elem, i, elem );
+ }));
+ },
+
+ slice: function() {
+ return this.pushStack( slice.apply( this, arguments ) );
+ },
+
+ first: function() {
+ return this.eq( 0 );
+ },
+
+ last: function() {
+ return this.eq( -1 );
+ },
+
+ eq: function( i ) {
+ var len = this.length,
+ j = +i + ( i < 0 ? len : 0 );
+ return this.pushStack( j >= 0 && j < len ? [ this[j] ] : [] );
+ },
+
+ end: function() {
+ return this.prevObject || this.constructor(null);
+ },
+
+ // For internal use only.
+ // Behaves like an Array's method, not like a jQuery method.
+ push: push,
+ sort: deletedIds.sort,
+ splice: deletedIds.splice
+};
+
+jQuery.extend = jQuery.fn.extend = function() {
+ var src, copyIsArray, copy, name, options, clone,
+ target = arguments[0] || {},
+ i = 1,
+ length = arguments.length,
+ deep = false;
+
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+
+ // skip the boolean and the target
+ target = arguments[ i ] || {};
+ i++;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+ target = {};
+ }
+
+ // extend jQuery itself if only one argument is passed
+ if ( i === length ) {
+ target = this;
+ i--;
+ }
+
+ for ( ; i < length; i++ ) {
+ // Only deal with non-null/undefined values
+ if ( (options = arguments[ i ]) != null ) {
+ // Extend the base object
+ for ( name in options ) {
+ src = target[ name ];
+ copy = options[ name ];
+
+ // Prevent never-ending loop
+ if ( target === copy ) {
+ continue;
+ }
+
+ // Recurse if we're merging plain objects or arrays
+ if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
+ if ( copyIsArray ) {
+ copyIsArray = false;
+ clone = src && jQuery.isArray(src) ? src : [];
+
+ } else {
+ clone = src && jQuery.isPlainObject(src) ? src : {};
+ }
+
+ // Never move original objects, clone them
+ target[ name ] = jQuery.extend( deep, clone, copy );
+
+ // Don't bring in undefined values
+ } else if ( copy !== undefined ) {
+ target[ name ] = copy;
+ }
+ }
+ }
+ }
+
+ // Return the modified object
+ return target;
+};
+
+jQuery.extend({
+ // Unique for each copy of jQuery on the page
+ expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
+
+ // Assume jQuery is ready without the ready module
+ isReady: true,
+
+ error: function( msg ) {
+ throw new Error( msg );
+ },
+
+ noop: function() {},
+
+ // See test/unit/core.js for details concerning isFunction.
+ // Since version 1.3, DOM methods and functions like alert
+ // aren't supported. They return false on IE (#2968).
+ isFunction: function( obj ) {
+ return jQuery.type(obj) === "function";
+ },
+
+ isArray: Array.isArray || function( obj ) {
+ return jQuery.type(obj) === "array";
+ },
+
+ isWindow: function( obj ) {
+ /* jshint eqeqeq: false */
+ return obj != null && obj == obj.window;
+ },
+
+ isNumeric: function( obj ) {
+ // parseFloat NaNs numeric-cast false positives (null|true|false|"")
+ // ...but misinterprets leading-number strings, particularly hex literals ("0x...")
+ // subtraction forces infinities to NaN
+ return obj - parseFloat( obj ) >= 0;
+ },
+
+ isEmptyObject: function( obj ) {
+ var name;
+ for ( name in obj ) {
+ return false;
+ }
+ return true;
+ },
+
+ isPlainObject: function( obj ) {
+ var key;
+
+ // Must be an Object.
+ // Because of IE, we also have to check the presence of the constructor property.
+ // Make sure that DOM nodes and window objects don't pass through, as well
+ if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
+ return false;
+ }
+
+ try {
+ // Not own constructor property must be Object
+ if ( obj.constructor &&
+ !hasOwn.call(obj, "constructor") &&
+ !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
+ return false;
+ }
+ } catch ( e ) {
+ // IE8,9 Will throw exceptions on certain host objects #9897
+ return false;
+ }
+
+ // Support: IE<9
+ // Handle iteration over inherited properties before own properties.
+ if ( support.ownLast ) {
+ for ( key in obj ) {
+ return hasOwn.call( obj, key );
+ }
+ }
+
+ // Own properties are enumerated firstly, so to speed up,
+ // if last one is own, then all properties are own.
+ for ( key in obj ) {}
+
+ return key === undefined || hasOwn.call( obj, key );
+ },
+
+ type: function( obj ) {
+ if ( obj == null ) {
+ return obj + "";
+ }
+ return typeof obj === "object" || typeof obj === "function" ?
+ class2type[ toString.call(obj) ] || "object" :
+ typeof obj;
+ },
+
+ // Evaluates a script in a global context
+ // Workarounds based on findings by Jim Driscoll
+ // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
+ globalEval: function( data ) {
+ if ( data && jQuery.trim( data ) ) {
+ // We use execScript on Internet Explorer
+ // We use an anonymous function so that context is window
+ // rather than jQuery in Firefox
+ ( window.execScript || function( data ) {
+ window[ "eval" ].call( window, data );
+ } )( data );
+ }
+ },
+
+ // Convert dashed to camelCase; used by the css and data modules
+ // Microsoft forgot to hump their vendor prefix (#9572)
+ camelCase: function( string ) {
+ return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
+ },
+
+ nodeName: function( elem, name ) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
+ },
+
+ // args is for internal usage only
+ each: function( obj, callback, args ) {
+ var value,
+ i = 0,
+ length = obj.length,
+ isArray = isArraylike( obj );
+
+ if ( args ) {
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback.apply( obj[ i ], args );
+
+ if ( value === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( i in obj ) {
+ value = callback.apply( obj[ i ], args );
+
+ if ( value === false ) {
+ break;
+ }
+ }
+ }
+
+ // A special, fast, case for the most common use of each
+ } else {
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback.call( obj[ i ], i, obj[ i ] );
+
+ if ( value === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( i in obj ) {
+ value = callback.call( obj[ i ], i, obj[ i ] );
+
+ if ( value === false ) {
+ break;
+ }
+ }
+ }
+ }
+
+ return obj;
+ },
+
+ // Use native String.trim function wherever possible
+ trim: trim && !trim.call("\uFEFF\xA0") ?
+ function( text ) {
+ return text == null ?
+ "" :
+ trim.call( text );
+ } :
+
+ // Otherwise use our own trimming functionality
+ function( text ) {
+ return text == null ?
+ "" :
+ ( text + "" ).replace( rtrim, "" );
+ },
+
+ // results is for internal usage only
+ makeArray: function( arr, results ) {
+ var ret = results || [];
+
+ if ( arr != null ) {
+ if ( isArraylike( Object(arr) ) ) {
+ jQuery.merge( ret,
+ typeof arr === "string" ?
+ [ arr ] : arr
+ );
+ } else {
+ push.call( ret, arr );
+ }
+ }
+
+ return ret;
+ },
+
+ inArray: function( elem, arr, i ) {
+ var len;
+
+ if ( arr ) {
+ if ( indexOf ) {
+ return indexOf.call( arr, elem, i );
+ }
+
+ len = arr.length;
+ i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0;
+
+ for ( ; i < len; i++ ) {
+ // Skip accessing in sparse arrays
+ if ( i in arr && arr[ i ] === elem ) {
+ return i;
+ }
+ }
+ }
+
+ return -1;
+ },
+
+ merge: function( first, second ) {
+ var len = +second.length,
+ j = 0,
+ i = first.length;
+
+ while ( j < len ) {
+ first[ i++ ] = second[ j++ ];
+ }
+
+ // Support: IE<9
+ // Workaround casting of .length to NaN on otherwise arraylike objects (e.g., NodeLists)
+ if ( len !== len ) {
+ while ( second[j] !== undefined ) {
+ first[ i++ ] = second[ j++ ];
+ }
+ }
+
+ first.length = i;
+
+ return first;
+ },
+
+ grep: function( elems, callback, invert ) {
+ var callbackInverse,
+ matches = [],
+ i = 0,
+ length = elems.length,
+ callbackExpect = !invert;
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( ; i < length; i++ ) {
+ callbackInverse = !callback( elems[ i ], i );
+ if ( callbackInverse !== callbackExpect ) {
+ matches.push( elems[ i ] );
+ }
+ }
+
+ return matches;
+ },
+
+ // arg is for internal usage only
+ map: function( elems, callback, arg ) {
+ var value,
+ i = 0,
+ length = elems.length,
+ isArray = isArraylike( elems ),
+ ret = [];
+
+ // Go through the array, translating each of the items to their new values
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret.push( value );
+ }
+ }
+
+ // Go through every key on the object,
+ } else {
+ for ( i in elems ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret.push( value );
+ }
+ }
+ }
+
+ // Flatten any nested arrays
+ return concat.apply( [], ret );
+ },
+
+ // A global GUID counter for objects
+ guid: 1,
+
+ // Bind a function to a context, optionally partially applying any
+ // arguments.
+ proxy: function( fn, context ) {
+ var args, proxy, tmp;
+
+ if ( typeof context === "string" ) {
+ tmp = fn[ context ];
+ context = fn;
+ fn = tmp;
+ }
+
+ // Quick check to determine if target is callable, in the spec
+ // this throws a TypeError, but we will just return undefined.
+ if ( !jQuery.isFunction( fn ) ) {
+ return undefined;
+ }
+
+ // Simulated bind
+ args = slice.call( arguments, 2 );
+ proxy = function() {
+ return fn.apply( context || this, args.concat( slice.call( arguments ) ) );
+ };
+
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ proxy.guid = fn.guid = fn.guid || jQuery.guid++;
+
+ return proxy;
+ },
+
+ now: function() {
+ return +( new Date() );
+ },
+
+ // jQuery.support is not used in Core but other projects attach their
+ // properties to it so it needs to exist.
+ support: support
+});
+
+// Populate the class2type map
+jQuery.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function(i, name) {
+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
+});
+
+function isArraylike( obj ) {
+ var length = obj.length,
+ type = jQuery.type( obj );
+
+ if ( type === "function" || jQuery.isWindow( obj ) ) {
+ return false;
+ }
+
+ if ( obj.nodeType === 1 && length ) {
+ return true;
+ }
+
+ return type === "array" || length === 0 ||
+ typeof length === "number" && length > 0 && ( length - 1 ) in obj;
+}
+var Sizzle =
+/*!
+ * Sizzle CSS Selector Engine v1.10.16
+ * http://sizzlejs.com/
+ *
+ * Copyright 2013 jQuery Foundation, Inc. and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: 2014-01-13
+ */
+(function( window ) {
+
+var i,
+ support,
+ Expr,
+ getText,
+ isXML,
+ compile,
+ outermostContext,
+ sortInput,
+ hasDuplicate,
+
+ // Local document vars
+ setDocument,
+ document,
+ docElem,
+ documentIsHTML,
+ rbuggyQSA,
+ rbuggyMatches,
+ matches,
+ contains,
+
+ // Instance-specific data
+ expando = "sizzle" + -(new Date()),
+ preferredDoc = window.document,
+ dirruns = 0,
+ done = 0,
+ classCache = createCache(),
+ tokenCache = createCache(),
+ compilerCache = createCache(),
+ sortOrder = function( a, b ) {
+ if ( a === b ) {
+ hasDuplicate = true;
+ }
+ return 0;
+ },
+
+ // General-purpose constants
+ strundefined = typeof undefined,
+ MAX_NEGATIVE = 1 << 31,
+
+ // Instance methods
+ hasOwn = ({}).hasOwnProperty,
+ arr = [],
+ pop = arr.pop,
+ push_native = arr.push,
+ push = arr.push,
+ slice = arr.slice,
+ // Use a stripped-down indexOf if we can't use a native one
+ indexOf = arr.indexOf || function( elem ) {
+ var i = 0,
+ len = this.length;
+ for ( ; i < len; i++ ) {
+ if ( this[i] === elem ) {
+ return i;
+ }
+ }
+ return -1;
+ },
+
+ booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",
+
+ // Regular expressions
+
+ // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace
+ whitespace = "[\\x20\\t\\r\\n\\f]",
+ // http://www.w3.org/TR/css3-syntax/#characters
+ characterEncoding = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",
+
+ // Loosely modeled on CSS identifier characters
+ // An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors
+ // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
+ identifier = characterEncoding.replace( "w", "w#" ),
+
+ // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors
+ attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace +
+ "*(?:([*^$|!~]?=)" + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]",
+
+ // Prefer arguments quoted,
+ // then not containing pseudos/brackets,
+ // then attribute selectors/non-parenthetical expressions,
+ // then anything else
+ // These preferences are here to reduce the number of selectors
+ // needing tokenize in the PSEUDO preFilter
+ pseudos = ":(" + characterEncoding + ")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|" + attributes.replace( 3, 8 ) + ")*)|.*)\\)|)",
+
+ // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+ rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
+
+ rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
+ rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ),
+
+ rattributeQuotes = new RegExp( "=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g" ),
+
+ rpseudo = new RegExp( pseudos ),
+ ridentifier = new RegExp( "^" + identifier + "$" ),
+
+ matchExpr = {
+ "ID": new RegExp( "^#(" + characterEncoding + ")" ),
+ "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ),
+ "TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ),
+ "ATTR": new RegExp( "^" + attributes ),
+ "PSEUDO": new RegExp( "^" + pseudos ),
+ "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
+ "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
+ "*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+ "bool": new RegExp( "^(?:" + booleans + ")$", "i" ),
+ // For use in libraries implementing .is()
+ // We use this for POS matching in `select`
+ "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
+ whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
+ },
+
+ rinputs = /^(?:input|select|textarea|button)$/i,
+ rheader = /^h\d$/i,
+
+ rnative = /^[^{]+\{\s*\[native \w/,
+
+ // Easily-parseable/retrievable ID or TAG or CLASS selectors
+ rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
+
+ rsibling = /[+~]/,
+ rescape = /'|\\/g,
+
+ // CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
+ runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ),
+ funescape = function( _, escaped, escapedWhitespace ) {
+ var high = "0x" + escaped - 0x10000;
+ // NaN means non-codepoint
+ // Support: Firefox
+ // Workaround erroneous numeric interpretation of +"0x"
+ return high !== high || escapedWhitespace ?
+ escaped :
+ high < 0 ?
+ // BMP codepoint
+ String.fromCharCode( high + 0x10000 ) :
+ // Supplemental Plane codepoint (surrogate pair)
+ String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
+ };
+
+// Optimize for push.apply( _, NodeList )
+try {
+ push.apply(
+ (arr = slice.call( preferredDoc.childNodes )),
+ preferredDoc.childNodes
+ );
+ // Support: Android<4.0
+ // Detect silently failing push.apply
+ arr[ preferredDoc.childNodes.length ].nodeType;
+} catch ( e ) {
+ push = { apply: arr.length ?
+
+ // Leverage slice if possible
+ function( target, els ) {
+ push_native.apply( target, slice.call(els) );
+ } :
+
+ // Support: IE<9
+ // Otherwise append directly
+ function( target, els ) {
+ var j = target.length,
+ i = 0;
+ // Can't trust NodeList.length
+ while ( (target[j++] = els[i++]) ) {}
+ target.length = j - 1;
+ }
+ };
+}
+
+function Sizzle( selector, context, results, seed ) {
+ var match, elem, m, nodeType,
+ // QSA vars
+ i, groups, old, nid, newContext, newSelector;
+
+ if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) {
+ setDocument( context );
+ }
+
+ context = context || document;
+ results = results || [];
+
+ if ( !selector || typeof selector !== "string" ) {
+ return results;
+ }
+
+ if ( (nodeType = context.nodeType) !== 1 && nodeType !== 9 ) {
+ return [];
+ }
+
+ if ( documentIsHTML && !seed ) {
+
+ // Shortcuts
+ if ( (match = rquickExpr.exec( selector )) ) {
+ // Speed-up: Sizzle("#ID")
+ if ( (m = match[1]) ) {
+ if ( nodeType === 9 ) {
+ elem = context.getElementById( m );
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document (jQuery #6963)
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE, Opera, and Webkit return items
+ // by name instead of ID
+ if ( elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ } else {
+ return results;
+ }
+ } else {
+ // Context is not a document
+ if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) &&
+ contains( context, elem ) && elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ }
+
+ // Speed-up: Sizzle("TAG")
+ } else if ( match[2] ) {
+ push.apply( results, context.getElementsByTagName( selector ) );
+ return results;
+
+ // Speed-up: Sizzle(".CLASS")
+ } else if ( (m = match[3]) && support.getElementsByClassName && context.getElementsByClassName ) {
+ push.apply( results, context.getElementsByClassName( m ) );
+ return results;
+ }
+ }
+
+ // QSA path
+ if ( support.qsa && (!rbuggyQSA || !rbuggyQSA.test( selector )) ) {
+ nid = old = expando;
+ newContext = context;
+ newSelector = nodeType === 9 && selector;
+
+ // qSA works strangely on Element-rooted queries
+ // We can work around this by specifying an extra ID on the root
+ // and working up from there (Thanks to Andrew Dupont for the technique)
+ // IE 8 doesn't work on object elements
+ if ( nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
+ groups = tokenize( selector );
+
+ if ( (old = context.getAttribute("id")) ) {
+ nid = old.replace( rescape, "\\$&" );
+ } else {
+ context.setAttribute( "id", nid );
+ }
+ nid = "[id='" + nid + "'] ";
+
+ i = groups.length;
+ while ( i-- ) {
+ groups[i] = nid + toSelector( groups[i] );
+ }
+ newContext = rsibling.test( selector ) && testContext( context.parentNode ) || context;
+ newSelector = groups.join(",");
+ }
+
+ if ( newSelector ) {
+ try {
+ push.apply( results,
+ newContext.querySelectorAll( newSelector )
+ );
+ return results;
+ } catch(qsaError) {
+ } finally {
+ if ( !old ) {
+ context.removeAttribute("id");
+ }
+ }
+ }
+ }
+ }
+
+ // All others
+ return select( selector.replace( rtrim, "$1" ), context, results, seed );
+}
+
+/**
+ * Create key-value caches of limited size
+ * @returns {Function(string, Object)} Returns the Object data after storing it on itself with
+ * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
+ * deleting the oldest entry
+ */
+function createCache() {
+ var keys = [];
+
+ function cache( key, value ) {
+ // Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
+ if ( keys.push( key + " " ) > Expr.cacheLength ) {
+ // Only keep the most recent entries
+ delete cache[ keys.shift() ];
+ }
+ return (cache[ key + " " ] = value);
+ }
+ return cache;
+}
+
+/**
+ * Mark a function for special use by Sizzle
+ * @param {Function} fn The function to mark
+ */
+function markFunction( fn ) {
+ fn[ expando ] = true;
+ return fn;
+}
+
+/**
+ * Support testing using an element
+ * @param {Function} fn Passed the created div and expects a boolean result
+ */
+function assert( fn ) {
+ var div = document.createElement("div");
+
+ try {
+ return !!fn( div );
+ } catch (e) {
+ return false;
+ } finally {
+ // Remove from its parent by default
+ if ( div.parentNode ) {
+ div.parentNode.removeChild( div );
+ }
+ // release memory in IE
+ div = null;
+ }
+}
+
+/**
+ * Adds the same handler for all of the specified attrs
+ * @param {String} attrs Pipe-separated list of attributes
+ * @param {Function} handler The method that will be applied
+ */
+function addHandle( attrs, handler ) {
+ var arr = attrs.split("|"),
+ i = attrs.length;
+
+ while ( i-- ) {
+ Expr.attrHandle[ arr[i] ] = handler;
+ }
+}
+
+/**
+ * Checks document order of two siblings
+ * @param {Element} a
+ * @param {Element} b
+ * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
+ */
+function siblingCheck( a, b ) {
+ var cur = b && a,
+ diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
+ ( ~b.sourceIndex || MAX_NEGATIVE ) -
+ ( ~a.sourceIndex || MAX_NEGATIVE );
+
+ // Use IE sourceIndex if available on both nodes
+ if ( diff ) {
+ return diff;
+ }
+
+ // Check if b follows a
+ if ( cur ) {
+ while ( (cur = cur.nextSibling) ) {
+ if ( cur === b ) {
+ return -1;
+ }
+ }
+ }
+
+ return a ? 1 : -1;
+}
+
+/**
+ * Returns a function to use in pseudos for input types
+ * @param {String} type
+ */
+function createInputPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === type;
+ };
+}
+
+/**
+ * Returns a function to use in pseudos for buttons
+ * @param {String} type
+ */
+function createButtonPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && elem.type === type;
+ };
+}
+
+/**
+ * Returns a function to use in pseudos for positionals
+ * @param {Function} fn
+ */
+function createPositionalPseudo( fn ) {
+ return markFunction(function( argument ) {
+ argument = +argument;
+ return markFunction(function( seed, matches ) {
+ var j,
+ matchIndexes = fn( [], seed.length, argument ),
+ i = matchIndexes.length;
+
+ // Match elements found at the specified indexes
+ while ( i-- ) {
+ if ( seed[ (j = matchIndexes[i]) ] ) {
+ seed[j] = !(matches[j] = seed[j]);
+ }
+ }
+ });
+ });
+}
+
+/**
+ * Checks a node for validity as a Sizzle context
+ * @param {Element|Object=} context
+ * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
+ */
+function testContext( context ) {
+ return context && typeof context.getElementsByTagName !== strundefined && context;
+}
+
+// Expose support vars for convenience
+support = Sizzle.support = {};
+
+/**
+ * Detects XML nodes
+ * @param {Element|Object} elem An element or a document
+ * @returns {Boolean} True iff elem is a non-HTML XML node
+ */
+isXML = Sizzle.isXML = function( elem ) {
+ // documentElement is verified for cases where it doesn't yet exist
+ // (such as loading iframes in IE - #4833)
+ var documentElement = elem && (elem.ownerDocument || elem).documentElement;
+ return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+/**
+ * Sets document-related variables once based on the current document
+ * @param {Element|Object} [doc] An element or document object to use to set the document
+ * @returns {Object} Returns the current document
+ */
+setDocument = Sizzle.setDocument = function( node ) {
+ var hasCompare,
+ doc = node ? node.ownerDocument || node : preferredDoc,
+ parent = doc.defaultView;
+
+ // If no document and documentElement is available, return
+ if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) {
+ return document;
+ }
+
+ // Set our document
+ document = doc;
+ docElem = doc.documentElement;
+
+ // Support tests
+ documentIsHTML = !isXML( doc );
+
+ // Support: IE>8
+ // If iframe document is assigned to "document" variable and if iframe has been reloaded,
+ // IE will throw "permission denied" error when accessing "document" variable, see jQuery #13936
+ // IE6-8 do not support the defaultView property so parent will be undefined
+ if ( parent && parent !== parent.top ) {
+ // IE11 does not have attachEvent, so all must suffer
+ if ( parent.addEventListener ) {
+ parent.addEventListener( "unload", function() {
+ setDocument();
+ }, false );
+ } else if ( parent.attachEvent ) {
+ parent.attachEvent( "onunload", function() {
+ setDocument();
+ });
+ }
+ }
+
+ /* Attributes
+ ---------------------------------------------------------------------- */
+
+ // Support: IE<8
+ // Verify that getAttribute really returns attributes and not properties (excepting IE8 booleans)
+ support.attributes = assert(function( div ) {
+ div.className = "i";
+ return !div.getAttribute("className");
+ });
+
+ /* getElement(s)By*
+ ---------------------------------------------------------------------- */
+
+ // Check if getElementsByTagName("*") returns only elements
+ support.getElementsByTagName = assert(function( div ) {
+ div.appendChild( doc.createComment("") );
+ return !div.getElementsByTagName("*").length;
+ });
+
+ // Check if getElementsByClassName can be trusted
+ support.getElementsByClassName = rnative.test( doc.getElementsByClassName ) && assert(function( div ) {
+ div.innerHTML = "<div class='a'></div><div class='a i'></div>";
+
+ // Support: Safari<4
+ // Catch class over-caching
+ div.firstChild.className = "i";
+ // Support: Opera<10
+ // Catch gEBCN failure to find non-leading classes
+ return div.getElementsByClassName("i").length === 2;
+ });
+
+ // Support: IE<10
+ // Check if getElementById returns elements by name
+ // The broken getElementById methods don't pick up programatically-set names,
+ // so use a roundabout getElementsByName test
+ support.getById = assert(function( div ) {
+ docElem.appendChild( div ).id = expando;
+ return !doc.getElementsByName || !doc.getElementsByName( expando ).length;
+ });
+
+ // ID find and filter
+ if ( support.getById ) {
+ Expr.find["ID"] = function( id, context ) {
+ if ( typeof context.getElementById !== strundefined && documentIsHTML ) {
+ var m = context.getElementById( id );
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ return m && m.parentNode ? [m] : [];
+ }
+ };
+ Expr.filter["ID"] = function( id ) {
+ var attrId = id.replace( runescape, funescape );
+ return function( elem ) {
+ return elem.getAttribute("id") === attrId;
+ };
+ };
+ } else {
+ // Support: IE6/7
+ // getElementById is not reliable as a find shortcut
+ delete Expr.find["ID"];
+
+ Expr.filter["ID"] = function( id ) {
+ var attrId = id.replace( runescape, funescape );
+ return function( elem ) {
+ var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id");
+ return node && node.value === attrId;
+ };
+ };
+ }
+
+ // Tag
+ Expr.find["TAG"] = support.getElementsByTagName ?
+ function( tag, context ) {
+ if ( typeof context.getElementsByTagName !== strundefined ) {
+ return context.getElementsByTagName( tag );
+ }
+ } :
+ function( tag, context ) {
+ var elem,
+ tmp = [],
+ i = 0,
+ results = context.getElementsByTagName( tag );
+
+ // Filter out possible comments
+ if ( tag === "*" ) {
+ while ( (elem = results[i++]) ) {
+ if ( elem.nodeType === 1 ) {
+ tmp.push( elem );
+ }
+ }
+
+ return tmp;
+ }
+ return results;
+ };
+
+ // Class
+ Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) {
+ if ( typeof context.getElementsByClassName !== strundefined && documentIsHTML ) {
+ return context.getElementsByClassName( className );
+ }
+ };
+
+ /* QSA/matchesSelector
+ ---------------------------------------------------------------------- */
+
+ // QSA and matchesSelector support
+
+ // matchesSelector(:active) reports false when true (IE9/Opera 11.5)
+ rbuggyMatches = [];
+
+ // qSa(:focus) reports false when true (Chrome 21)
+ // We allow this because of a bug in IE8/9 that throws an error
+ // whenever `document.activeElement` is accessed on an iframe
+ // So, we allow :focus to pass through QSA all the time to avoid the IE error
+ // See http://bugs.jquery.com/ticket/13378
+ rbuggyQSA = [];
+
+ if ( (support.qsa = rnative.test( doc.querySelectorAll )) ) {
+ // Build QSA regex
+ // Regex strategy adopted from Diego Perini
+ assert(function( div ) {
+ // Select is set to empty string on purpose
+ // This is to test IE's treatment of not explicitly
+ // setting a boolean content attribute,
+ // since its presence should be enough
+ // http://bugs.jquery.com/ticket/12359
+ div.innerHTML = "<select t=''><option selected=''></option></select>";
+
+ // Support: IE8, Opera 10-12
+ // Nothing should be selected when empty strings follow ^= or $= or *=
+ if ( div.querySelectorAll("[t^='']").length ) {
+ rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" );
+ }
+
+ // Support: IE8
+ // Boolean attributes and "value" are not treated correctly
+ if ( !div.querySelectorAll("[selected]").length ) {
+ rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" );
+ }
+
+ // Webkit/Opera - :checked should return selected option elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ // IE8 throws error here and will not see later tests
+ if ( !div.querySelectorAll(":checked").length ) {
+ rbuggyQSA.push(":checked");
+ }
+ });
+
+ assert(function( div ) {
+ // Support: Windows 8 Native Apps
+ // The type and name attributes are restricted during .innerHTML assignment
+ var input = doc.createElement("input");
+ input.setAttribute( "type", "hidden" );
+ div.appendChild( input ).setAttribute( "name", "D" );
+
+ // Support: IE8
+ // Enforce case-sensitivity of name attribute
+ if ( div.querySelectorAll("[name=d]").length ) {
+ rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" );
+ }
+
+ // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
+ // IE8 throws error here and will not see later tests
+ if ( !div.querySelectorAll(":enabled").length ) {
+ rbuggyQSA.push( ":enabled", ":disabled" );
+ }
+
+ // Opera 10-11 does not throw on post-comma invalid pseudos
+ div.querySelectorAll("*,:x");
+ rbuggyQSA.push(",.*:");
+ });
+ }
+
+ if ( (support.matchesSelector = rnative.test( (matches = docElem.webkitMatchesSelector ||
+ docElem.mozMatchesSelector ||
+ docElem.oMatchesSelector ||
+ docElem.msMatchesSelector) )) ) {
+
+ assert(function( div ) {
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9)
+ support.disconnectedMatch = matches.call( div, "div" );
+
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ matches.call( div, "[s!='']:x" );
+ rbuggyMatches.push( "!=", pseudos );
+ });
+ }
+
+ rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") );
+ rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") );
+
+ /* Contains
+ ---------------------------------------------------------------------- */
+ hasCompare = rnative.test( docElem.compareDocumentPosition );
+
+ // Element contains another
+ // Purposefully does not implement inclusive descendent
+ // As in, an element does not contain itself
+ contains = hasCompare || rnative.test( docElem.contains ) ?
+ function( a, b ) {
+ var adown = a.nodeType === 9 ? a.documentElement : a,
+ bup = b && b.parentNode;
+ return a === bup || !!( bup && bup.nodeType === 1 && (
+ adown.contains ?
+ adown.contains( bup ) :
+ a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
+ ));
+ } :
+ function( a, b ) {
+ if ( b ) {
+ while ( (b = b.parentNode) ) {
+ if ( b === a ) {
+ return true;
+ }
+ }
+ }
+ return false;
+ };
+
+ /* Sorting
+ ---------------------------------------------------------------------- */
+
+ // Document order sorting
+ sortOrder = hasCompare ?
+ function( a, b ) {
+
+ // Flag for duplicate removal
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ // Sort on method existence if only one input has compareDocumentPosition
+ var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
+ if ( compare ) {
+ return compare;
+ }
+
+ // Calculate position if both inputs belong to the same document
+ compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ?
+ a.compareDocumentPosition( b ) :
+
+ // Otherwise we know they are disconnected
+ 1;
+
+ // Disconnected nodes
+ if ( compare & 1 ||
+ (!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) {
+
+ // Choose the first element that is related to our preferred document
+ if ( a === doc || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) {
+ return -1;
+ }
+ if ( b === doc || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) {
+ return 1;
+ }
+
+ // Maintain original order
+ return sortInput ?
+ ( indexOf.call( sortInput, a ) - indexOf.call( sortInput, b ) ) :
+ 0;
+ }
+
+ return compare & 4 ? -1 : 1;
+ } :
+ function( a, b ) {
+ // Exit early if the nodes are identical
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ var cur,
+ i = 0,
+ aup = a.parentNode,
+ bup = b.parentNode,
+ ap = [ a ],
+ bp = [ b ];
+
+ // Parentless nodes are either documents or disconnected
+ if ( !aup || !bup ) {
+ return a === doc ? -1 :
+ b === doc ? 1 :
+ aup ? -1 :
+ bup ? 1 :
+ sortInput ?
+ ( indexOf.call( sortInput, a ) - indexOf.call( sortInput, b ) ) :
+ 0;
+
+ // If the nodes are siblings, we can do a quick check
+ } else if ( aup === bup ) {
+ return siblingCheck( a, b );
+ }
+
+ // Otherwise we need full lists of their ancestors for comparison
+ cur = a;
+ while ( (cur = cur.parentNode) ) {
+ ap.unshift( cur );
+ }
+ cur = b;
+ while ( (cur = cur.parentNode) ) {
+ bp.unshift( cur );
+ }
+
+ // Walk down the tree looking for a discrepancy
+ while ( ap[i] === bp[i] ) {
+ i++;
+ }
+
+ return i ?
+ // Do a sibling check if the nodes have a common ancestor
+ siblingCheck( ap[i], bp[i] ) :
+
+ // Otherwise nodes in our document sort first
+ ap[i] === preferredDoc ? -1 :
+ bp[i] === preferredDoc ? 1 :
+ 0;
+ };
+
+ return doc;
+};
+
+Sizzle.matches = function( expr, elements ) {
+ return Sizzle( expr, null, null, elements );
+};
+
+Sizzle.matchesSelector = function( elem, expr ) {
+ // Set document vars if needed
+ if ( ( elem.ownerDocument || elem ) !== document ) {
+ setDocument( elem );
+ }
+
+ // Make sure that attribute selectors are quoted
+ expr = expr.replace( rattributeQuotes, "='$1']" );
+
+ if ( support.matchesSelector && documentIsHTML &&
+ ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&
+ ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {
+
+ try {
+ var ret = matches.call( elem, expr );
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if ( ret || support.disconnectedMatch ||
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9
+ elem.document && elem.document.nodeType !== 11 ) {
+ return ret;
+ }
+ } catch(e) {}
+ }
+
+ return Sizzle( expr, document, null, [elem] ).length > 0;
+};
+
+Sizzle.contains = function( context, elem ) {
+ // Set document vars if needed
+ if ( ( context.ownerDocument || context ) !== document ) {
+ setDocument( context );
+ }
+ return contains( context, elem );
+};
+
+Sizzle.attr = function( elem, name ) {
+ // Set document vars if needed
+ if ( ( elem.ownerDocument || elem ) !== document ) {
+ setDocument( elem );
+ }
+
+ var fn = Expr.attrHandle[ name.toLowerCase() ],
+ // Don't get fooled by Object.prototype properties (jQuery #13807)
+ val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
+ fn( elem, name, !documentIsHTML ) :
+ undefined;
+
+ return val !== undefined ?
+ val :
+ support.attributes || !documentIsHTML ?
+ elem.getAttribute( name ) :
+ (val = elem.getAttributeNode(name)) && val.specified ?
+ val.value :
+ null;
+};
+
+Sizzle.error = function( msg ) {
+ throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+/**
+ * Document sorting and removing duplicates
+ * @param {ArrayLike} results
+ */
+Sizzle.uniqueSort = function( results ) {
+ var elem,
+ duplicates = [],
+ j = 0,
+ i = 0;
+
+ // Unless we *know* we can detect duplicates, assume their presence
+ hasDuplicate = !support.detectDuplicates;
+ sortInput = !support.sortStable && results.slice( 0 );
+ results.sort( sortOrder );
+
+ if ( hasDuplicate ) {
+ while ( (elem = results[i++]) ) {
+ if ( elem === results[ i ] ) {
+ j = duplicates.push( i );
+ }
+ }
+ while ( j-- ) {
+ results.splice( duplicates[ j ], 1 );
+ }
+ }
+
+ // Clear input after sorting to release objects
+ // See https://github.com/jquery/sizzle/pull/225
+ sortInput = null;
+
+ return results;
+};
+
+/**
+ * Utility function for retrieving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+getText = Sizzle.getText = function( elem ) {
+ var node,
+ ret = "",
+ i = 0,
+ nodeType = elem.nodeType;
+
+ if ( !nodeType ) {
+ // If no nodeType, this is expected to be an array
+ while ( (node = elem[i++]) ) {
+ // Do not traverse comment nodes
+ ret += getText( node );
+ }
+ } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
+ // Use textContent for elements
+ // innerText usage removed for consistency of new lines (jQuery #11153)
+ if ( typeof elem.textContent === "string" ) {
+ return elem.textContent;
+ } else {
+ // Traverse its children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ ret += getText( elem );
+ }
+ }
+ } else if ( nodeType === 3 || nodeType === 4 ) {
+ return elem.nodeValue;
+ }
+ // Do not include comment or processing instruction nodes
+
+ return ret;
+};
+
+Expr = Sizzle.selectors = {
+
+ // Can be adjusted by the user
+ cacheLength: 50,
+
+ createPseudo: markFunction,
+
+ match: matchExpr,
+
+ attrHandle: {},
+
+ find: {},
+
+ relative: {
+ ">": { dir: "parentNode", first: true },
+ " ": { dir: "parentNode" },
+ "+": { dir: "previousSibling", first: true },
+ "~": { dir: "previousSibling" }
+ },
+
+ preFilter: {
+ "ATTR": function( match ) {
+ match[1] = match[1].replace( runescape, funescape );
+
+ // Move the given value to match[3] whether quoted or unquoted
+ match[3] = ( match[4] || match[5] || "" ).replace( runescape, funescape );
+
+ if ( match[2] === "~=" ) {
+ match[3] = " " + match[3] + " ";
+ }
+
+ return match.slice( 0, 4 );
+ },
+
+ "CHILD": function( match ) {
+ /* matches from matchExpr["CHILD"]
+ 1 type (only|nth|...)
+ 2 what (child|of-type)
+ 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+ 4 xn-component of xn+y argument ([+-]?\d*n|)
+ 5 sign of xn-component
+ 6 x of xn-component
+ 7 sign of y-component
+ 8 y of y-component
+ */
+ match[1] = match[1].toLowerCase();
+
+ if ( match[1].slice( 0, 3 ) === "nth" ) {
+ // nth-* requires argument
+ if ( !match[3] ) {
+ Sizzle.error( match[0] );
+ }
+
+ // numeric x and y parameters for Expr.filter.CHILD
+ // remember that false/true cast respectively to 0/1
+ match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) );
+ match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" );
+
+ // other types prohibit arguments
+ } else if ( match[3] ) {
+ Sizzle.error( match[0] );
+ }
+
+ return match;
+ },
+
+ "PSEUDO": function( match ) {
+ var excess,
+ unquoted = !match[5] && match[2];
+
+ if ( matchExpr["CHILD"].test( match[0] ) ) {
+ return null;
+ }
+
+ // Accept quoted arguments as-is
+ if ( match[3] && match[4] !== undefined ) {
+ match[2] = match[4];
+
+ // Strip excess characters from unquoted arguments
+ } else if ( unquoted && rpseudo.test( unquoted ) &&
+ // Get excess from tokenize (recursively)
+ (excess = tokenize( unquoted, true )) &&
+ // advance to the next closing parenthesis
+ (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) {
+
+ // excess is a negative index
+ match[0] = match[0].slice( 0, excess );
+ match[2] = unquoted.slice( 0, excess );
+ }
+
+ // Return only captures needed by the pseudo filter method (type and argument)
+ return match.slice( 0, 3 );
+ }
+ },
+
+ filter: {
+
+ "TAG": function( nodeNameSelector ) {
+ var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
+ return nodeNameSelector === "*" ?
+ function() { return true; } :
+ function( elem ) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
+ };
+ },
+
+ "CLASS": function( className ) {
+ var pattern = classCache[ className + " " ];
+
+ return pattern ||
+ (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) &&
+ classCache( className, function( elem ) {
+ return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== strundefined && elem.getAttribute("class") || "" );
+ });
+ },
+
+ "ATTR": function( name, operator, check ) {
+ return function( elem ) {
+ var result = Sizzle.attr( elem, name );
+
+ if ( result == null ) {
+ return operator === "!=";
+ }
+ if ( !operator ) {
+ return true;
+ }
+
+ result += "";
+
+ return operator === "=" ? result === check :
+ operator === "!=" ? result !== check :
+ operator === "^=" ? check && result.indexOf( check ) === 0 :
+ operator === "*=" ? check && result.indexOf( check ) > -1 :
+ operator === "$=" ? check && result.slice( -check.length ) === check :
+ operator === "~=" ? ( " " + result + " " ).indexOf( check ) > -1 :
+ operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" :
+ false;
+ };
+ },
+
+ "CHILD": function( type, what, argument, first, last ) {
+ var simple = type.slice( 0, 3 ) !== "nth",
+ forward = type.slice( -4 ) !== "last",
+ ofType = what === "of-type";
+
+ return first === 1 && last === 0 ?
+
+ // Shortcut for :nth-*(n)
+ function( elem ) {
+ return !!elem.parentNode;
+ } :
+
+ function( elem, context, xml ) {
+ var cache, outerCache, node, diff, nodeIndex, start,
+ dir = simple !== forward ? "nextSibling" : "previousSibling",
+ parent = elem.parentNode,
+ name = ofType && elem.nodeName.toLowerCase(),
+ useCache = !xml && !ofType;
+
+ if ( parent ) {
+
+ // :(first|last|only)-(child|of-type)
+ if ( simple ) {
+ while ( dir ) {
+ node = elem;
+ while ( (node = node[ dir ]) ) {
+ if ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) {
+ return false;
+ }
+ }
+ // Reverse direction for :only-* (if we haven't yet done so)
+ start = dir = type === "only" && !start && "nextSibling";
+ }
+ return true;
+ }
+
+ start = [ forward ? parent.firstChild : parent.lastChild ];
+
+ // non-xml :nth-child(...) stores cache data on `parent`
+ if ( forward && useCache ) {
+ // Seek `elem` from a previously-cached index
+ outerCache = parent[ expando ] || (parent[ expando ] = {});
+ cache = outerCache[ type ] || [];
+ nodeIndex = cache[0] === dirruns && cache[1];
+ diff = cache[0] === dirruns && cache[2];
+ node = nodeIndex && parent.childNodes[ nodeIndex ];
+
+ while ( (node = ++nodeIndex && node && node[ dir ] ||
+
+ // Fallback to seeking `elem` from the start
+ (diff = nodeIndex = 0) || start.pop()) ) {
+
+ // When found, cache indexes on `parent` and break
+ if ( node.nodeType === 1 && ++diff && node === elem ) {
+ outerCache[ type ] = [ dirruns, nodeIndex, diff ];
+ break;
+ }
+ }
+
+ // Use previously-cached element index if available
+ } else if ( useCache && (cache = (elem[ expando ] || (elem[ expando ] = {}))[ type ]) && cache[0] === dirruns ) {
+ diff = cache[1];
+
+ // xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...)
+ } else {
+ // Use the same loop as above to seek `elem` from the start
+ while ( (node = ++nodeIndex && node && node[ dir ] ||
+ (diff = nodeIndex = 0) || start.pop()) ) {
+
+ if ( ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) && ++diff ) {
+ // Cache the index of each encountered element
+ if ( useCache ) {
+ (node[ expando ] || (node[ expando ] = {}))[ type ] = [ dirruns, diff ];
+ }
+
+ if ( node === elem ) {
+ break;
+ }
+ }
+ }
+ }
+
+ // Incorporate the offset, then check against cycle size
+ diff -= last;
+ return diff === first || ( diff % first === 0 && diff / first >= 0 );
+ }
+ };
+ },
+
+ "PSEUDO": function( pseudo, argument ) {
+ // pseudo-class names are case-insensitive
+ // http://www.w3.org/TR/selectors/#pseudo-classes
+ // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+ // Remember that setFilters inherits from pseudos
+ var args,
+ fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
+ Sizzle.error( "unsupported pseudo: " + pseudo );
+
+ // The user may use createPseudo to indicate that
+ // arguments are needed to create the filter function
+ // just as Sizzle does
+ if ( fn[ expando ] ) {
+ return fn( argument );
+ }
+
+ // But maintain support for old signatures
+ if ( fn.length > 1 ) {
+ args = [ pseudo, pseudo, "", argument ];
+ return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
+ markFunction(function( seed, matches ) {
+ var idx,
+ matched = fn( seed, argument ),
+ i = matched.length;
+ while ( i-- ) {
+ idx = indexOf.call( seed, matched[i] );
+ seed[ idx ] = !( matches[ idx ] = matched[i] );
+ }
+ }) :
+ function( elem ) {
+ return fn( elem, 0, args );
+ };
+ }
+
+ return fn;
+ }
+ },
+
+ pseudos: {
+ // Potentially complex pseudos
+ "not": markFunction(function( selector ) {
+ // Trim the selector passed to compile
+ // to avoid treating leading and trailing
+ // spaces as combinators
+ var input = [],
+ results = [],
+ matcher = compile( selector.replace( rtrim, "$1" ) );
+
+ return matcher[ expando ] ?
+ markFunction(function( seed, matches, context, xml ) {
+ var elem,
+ unmatched = matcher( seed, null, xml, [] ),
+ i = seed.length;
+
+ // Match elements unmatched by `matcher`
+ while ( i-- ) {
+ if ( (elem = unmatched[i]) ) {
+ seed[i] = !(matches[i] = elem);
+ }
+ }
+ }) :
+ function( elem, context, xml ) {
+ input[0] = elem;
+ matcher( input, null, xml, results );
+ return !results.pop();
+ };
+ }),
+
+ "has": markFunction(function( selector ) {
+ return function( elem ) {
+ return Sizzle( selector, elem ).length > 0;
+ };
+ }),
+
+ "contains": markFunction(function( text ) {
+ return function( elem ) {
+ return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;
+ };
+ }),
+
+ // "Whether an element is represented by a :lang() selector
+ // is based solely on the element's language value
+ // being equal to the identifier C,
+ // or beginning with the identifier C immediately followed by "-".
+ // The matching of C against the element's language value is performed case-insensitively.
+ // The identifier C does not have to be a valid language name."
+ // http://www.w3.org/TR/selectors/#lang-pseudo
+ "lang": markFunction( function( lang ) {
+ // lang value must be a valid identifier
+ if ( !ridentifier.test(lang || "") ) {
+ Sizzle.error( "unsupported lang: " + lang );
+ }
+ lang = lang.replace( runescape, funescape ).toLowerCase();
+ return function( elem ) {
+ var elemLang;
+ do {
+ if ( (elemLang = documentIsHTML ?
+ elem.lang :
+ elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) {
+
+ elemLang = elemLang.toLowerCase();
+ return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
+ }
+ } while ( (elem = elem.parentNode) && elem.nodeType === 1 );
+ return false;
+ };
+ }),
+
+ // Miscellaneous
+ "target": function( elem ) {
+ var hash = window.location && window.location.hash;
+ return hash && hash.slice( 1 ) === elem.id;
+ },
+
+ "root": function( elem ) {
+ return elem === docElem;
+ },
+
+ "focus": function( elem ) {
+ return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
+ },
+
+ // Boolean properties
+ "enabled": function( elem ) {
+ return elem.disabled === false;
+ },
+
+ "disabled": function( elem ) {
+ return elem.disabled === true;
+ },
+
+ "checked": function( elem ) {
+ // In CSS3, :checked should return both checked and selected elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ var nodeName = elem.nodeName.toLowerCase();
+ return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
+ },
+
+ "selected": function( elem ) {
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ if ( elem.parentNode ) {
+ elem.parentNode.selectedIndex;
+ }
+
+ return elem.selected === true;
+ },
+
+ // Contents
+ "empty": function( elem ) {
+ // http://www.w3.org/TR/selectors/#empty-pseudo
+ // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
+ // but not by others (comment: 8; processing instruction: 7; etc.)
+ // nodeType < 6 works because attributes (2) do not appear as children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ if ( elem.nodeType < 6 ) {
+ return false;
+ }
+ }
+ return true;
+ },
+
+ "parent": function( elem ) {
+ return !Expr.pseudos["empty"]( elem );
+ },
+
+ // Element/input types
+ "header": function( elem ) {
+ return rheader.test( elem.nodeName );
+ },
+
+ "input": function( elem ) {
+ return rinputs.test( elem.nodeName );
+ },
+
+ "button": function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === "button" || name === "button";
+ },
+
+ "text": function( elem ) {
+ var attr;
+ return elem.nodeName.toLowerCase() === "input" &&
+ elem.type === "text" &&
+
+ // Support: IE<8
+ // New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
+ ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" );
+ },
+
+ // Position-in-collection
+ "first": createPositionalPseudo(function() {
+ return [ 0 ];
+ }),
+
+ "last": createPositionalPseudo(function( matchIndexes, length ) {
+ return [ length - 1 ];
+ }),
+
+ "eq": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ return [ argument < 0 ? argument + length : argument ];
+ }),
+
+ "even": createPositionalPseudo(function( matchIndexes, length ) {
+ var i = 0;
+ for ( ; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "odd": createPositionalPseudo(function( matchIndexes, length ) {
+ var i = 1;
+ for ( ; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "lt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ var i = argument < 0 ? argument + length : argument;
+ for ( ; --i >= 0; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "gt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ var i = argument < 0 ? argument + length : argument;
+ for ( ; ++i < length; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ })
+ }
+};
+
+Expr.pseudos["nth"] = Expr.pseudos["eq"];
+
+// Add button/input type pseudos
+for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
+ Expr.pseudos[ i ] = createInputPseudo( i );
+}
+for ( i in { submit: true, reset: true } ) {
+ Expr.pseudos[ i ] = createButtonPseudo( i );
+}
+
+// Easy API for creating new setFilters
+function setFilters() {}
+setFilters.prototype = Expr.filters = Expr.pseudos;
+Expr.setFilters = new setFilters();
+
+function tokenize( selector, parseOnly ) {
+ var matched, match, tokens, type,
+ soFar, groups, preFilters,
+ cached = tokenCache[ selector + " " ];
+
+ if ( cached ) {
+ return parseOnly ? 0 : cached.slice( 0 );
+ }
+
+ soFar = selector;
+ groups = [];
+ preFilters = Expr.preFilter;
+
+ while ( soFar ) {
+
+ // Comma and first run
+ if ( !matched || (match = rcomma.exec( soFar )) ) {
+ if ( match ) {
+ // Don't consume trailing commas as valid
+ soFar = soFar.slice( match[0].length ) || soFar;
+ }
+ groups.push( (tokens = []) );
+ }
+
+ matched = false;
+
+ // Combinators
+ if ( (match = rcombinators.exec( soFar )) ) {
+ matched = match.shift();
+ tokens.push({
+ value: matched,
+ // Cast descendant combinators to space
+ type: match[0].replace( rtrim, " " )
+ });
+ soFar = soFar.slice( matched.length );
+ }
+
+ // Filters
+ for ( type in Expr.filter ) {
+ if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||
+ (match = preFilters[ type ]( match ))) ) {
+ matched = match.shift();
+ tokens.push({
+ value: matched,
+ type: type,
+ matches: match
+ });
+ soFar = soFar.slice( matched.length );
+ }
+ }
+
+ if ( !matched ) {
+ break;
+ }
+ }
+
+ // Return the length of the invalid excess
+ // if we're just parsing
+ // Otherwise, throw an error or return tokens
+ return parseOnly ?
+ soFar.length :
+ soFar ?
+ Sizzle.error( selector ) :
+ // Cache the tokens
+ tokenCache( selector, groups ).slice( 0 );
+}
+
+function toSelector( tokens ) {
+ var i = 0,
+ len = tokens.length,
+ selector = "";
+ for ( ; i < len; i++ ) {
+ selector += tokens[i].value;
+ }
+ return selector;
+}
+
+function addCombinator( matcher, combinator, base ) {
+ var dir = combinator.dir,
+ checkNonElements = base && dir === "parentNode",
+ doneName = done++;
+
+ return combinator.first ?
+ // Check against closest ancestor/preceding element
+ function( elem, context, xml ) {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ return matcher( elem, context, xml );
+ }
+ }
+ } :
+
+ // Check against all ancestor/preceding elements
+ function( elem, context, xml ) {
+ var oldCache, outerCache,
+ newCache = [ dirruns, doneName ];
+
+ // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching
+ if ( xml ) {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ if ( matcher( elem, context, xml ) ) {
+ return true;
+ }
+ }
+ }
+ } else {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ outerCache = elem[ expando ] || (elem[ expando ] = {});
+ if ( (oldCache = outerCache[ dir ]) &&
+ oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
+
+ // Assign to newCache so results back-propagate to previous elements
+ return (newCache[ 2 ] = oldCache[ 2 ]);
+ } else {
+ // Reuse newcache so results back-propagate to previous elements
+ outerCache[ dir ] = newCache;
+
+ // A match means we're done; a fail means we have to keep checking
+ if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) {
+ return true;
+ }
+ }
+ }
+ }
+ }
+ };
+}
+
+function elementMatcher( matchers ) {
+ return matchers.length > 1 ?
+ function( elem, context, xml ) {
+ var i = matchers.length;
+ while ( i-- ) {
+ if ( !matchers[i]( elem, context, xml ) ) {
+ return false;
+ }
+ }
+ return true;
+ } :
+ matchers[0];
+}
+
+function condense( unmatched, map, filter, context, xml ) {
+ var elem,
+ newUnmatched = [],
+ i = 0,
+ len = unmatched.length,
+ mapped = map != null;
+
+ for ( ; i < len; i++ ) {
+ if ( (elem = unmatched[i]) ) {
+ if ( !filter || filter( elem, context, xml ) ) {
+ newUnmatched.push( elem );
+ if ( mapped ) {
+ map.push( i );
+ }
+ }
+ }
+ }
+
+ return newUnmatched;
+}
+
+function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
+ if ( postFilter && !postFilter[ expando ] ) {
+ postFilter = setMatcher( postFilter );
+ }
+ if ( postFinder && !postFinder[ expando ] ) {
+ postFinder = setMatcher( postFinder, postSelector );
+ }
+ return markFunction(function( seed, results, context, xml ) {
+ var temp, i, elem,
+ preMap = [],
+ postMap = [],
+ preexisting = results.length,
+
+ // Get initial elements from seed or context
+ elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ),
+
+ // Prefilter to get matcher input, preserving a map for seed-results synchronization
+ matcherIn = preFilter && ( seed || !selector ) ?
+ condense( elems, preMap, preFilter, context, xml ) :
+ elems,
+
+ matcherOut = matcher ?
+ // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
+ postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+ // ...intermediate processing is necessary
+ [] :
+
+ // ...otherwise use results directly
+ results :
+ matcherIn;
+
+ // Find primary matches
+ if ( matcher ) {
+ matcher( matcherIn, matcherOut, context, xml );
+ }
+
+ // Apply postFilter
+ if ( postFilter ) {
+ temp = condense( matcherOut, postMap );
+ postFilter( temp, [], context, xml );
+
+ // Un-match failing elements by moving them back to matcherIn
+ i = temp.length;
+ while ( i-- ) {
+ if ( (elem = temp[i]) ) {
+ matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);
+ }
+ }
+ }
+
+ if ( seed ) {
+ if ( postFinder || preFilter ) {
+ if ( postFinder ) {
+ // Get the final matcherOut by condensing this intermediate into postFinder contexts
+ temp = [];
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( (elem = matcherOut[i]) ) {
+ // Restore matcherIn since elem is not yet a final match
+ temp.push( (matcherIn[i] = elem) );
+ }
+ }
+ postFinder( null, (matcherOut = []), temp, xml );
+ }
+
+ // Move matched elements from seed to results to keep them synchronized
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( (elem = matcherOut[i]) &&
+ (temp = postFinder ? indexOf.call( seed, elem ) : preMap[i]) > -1 ) {
+
+ seed[temp] = !(results[temp] = elem);
+ }
+ }
+ }
+
+ // Add elements to results, through postFinder if defined
+ } else {
+ matcherOut = condense(
+ matcherOut === results ?
+ matcherOut.splice( preexisting, matcherOut.length ) :
+ matcherOut
+ );
+ if ( postFinder ) {
+ postFinder( null, results, matcherOut, xml );
+ } else {
+ push.apply( results, matcherOut );
+ }
+ }
+ });
+}
+
+function matcherFromTokens( tokens ) {
+ var checkContext, matcher, j,
+ len = tokens.length,
+ leadingRelative = Expr.relative[ tokens[0].type ],
+ implicitRelative = leadingRelative || Expr.relative[" "],
+ i = leadingRelative ? 1 : 0,
+
+ // The foundational matcher ensures that elements are reachable from top-level context(s)
+ matchContext = addCombinator( function( elem ) {
+ return elem === checkContext;
+ }, implicitRelative, true ),
+ matchAnyContext = addCombinator( function( elem ) {
+ return indexOf.call( checkContext, elem ) > -1;
+ }, implicitRelative, true ),
+ matchers = [ function( elem, context, xml ) {
+ return ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
+ (checkContext = context).nodeType ?
+ matchContext( elem, context, xml ) :
+ matchAnyContext( elem, context, xml ) );
+ } ];
+
+ for ( ; i < len; i++ ) {
+ if ( (matcher = Expr.relative[ tokens[i].type ]) ) {
+ matchers = [ addCombinator(elementMatcher( matchers ), matcher) ];
+ } else {
+ matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );
+
+ // Return special upon seeing a positional matcher
+ if ( matcher[ expando ] ) {
+ // Find the next relative operator (if any) for proper handling
+ j = ++i;
+ for ( ; j < len; j++ ) {
+ if ( Expr.relative[ tokens[j].type ] ) {
+ break;
+ }
+ }
+ return setMatcher(
+ i > 1 && elementMatcher( matchers ),
+ i > 1 && toSelector(
+ // If the preceding token was a descendant combinator, insert an implicit any-element `*`
+ tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" })
+ ).replace( rtrim, "$1" ),
+ matcher,
+ i < j && matcherFromTokens( tokens.slice( i, j ) ),
+ j < len && matcherFromTokens( (tokens = tokens.slice( j )) ),
+ j < len && toSelector( tokens )
+ );
+ }
+ matchers.push( matcher );
+ }
+ }
+
+ return elementMatcher( matchers );
+}
+
+function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
+ var bySet = setMatchers.length > 0,
+ byElement = elementMatchers.length > 0,
+ superMatcher = function( seed, context, xml, results, outermost ) {
+ var elem, j, matcher,
+ matchedCount = 0,
+ i = "0",
+ unmatched = seed && [],
+ setMatched = [],
+ contextBackup = outermostContext,
+ // We must always have either seed elements or outermost context
+ elems = seed || byElement && Expr.find["TAG"]( "*", outermost ),
+ // Use integer dirruns iff this is the outermost matcher
+ dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),
+ len = elems.length;
+
+ if ( outermost ) {
+ outermostContext = context !== document && context;
+ }
+
+ // Add elements passing elementMatchers directly to results
+ // Keep `i` a string if there are no elements so `matchedCount` will be "00" below
+ // Support: IE<9, Safari
+ // Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id
+ for ( ; i !== len && (elem = elems[i]) != null; i++ ) {
+ if ( byElement && elem ) {
+ j = 0;
+ while ( (matcher = elementMatchers[j++]) ) {
+ if ( matcher( elem, context, xml ) ) {
+ results.push( elem );
+ break;
+ }
+ }
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ }
+ }
+
+ // Track unmatched elements for set filters
+ if ( bySet ) {
+ // They will have gone through all possible matchers
+ if ( (elem = !matcher && elem) ) {
+ matchedCount--;
+ }
+
+ // Lengthen the array for every element, matched or not
+ if ( seed ) {
+ unmatched.push( elem );
+ }
+ }
+ }
+
+ // Apply set filters to unmatched elements
+ matchedCount += i;
+ if ( bySet && i !== matchedCount ) {
+ j = 0;
+ while ( (matcher = setMatchers[j++]) ) {
+ matcher( unmatched, setMatched, context, xml );
+ }
+
+ if ( seed ) {
+ // Reintegrate element matches to eliminate the need for sorting
+ if ( matchedCount > 0 ) {
+ while ( i-- ) {
+ if ( !(unmatched[i] || setMatched[i]) ) {
+ setMatched[i] = pop.call( results );
+ }
+ }
+ }
+
+ // Discard index placeholder values to get only actual matches
+ setMatched = condense( setMatched );
+ }
+
+ // Add matches to results
+ push.apply( results, setMatched );
+
+ // Seedless set matches succeeding multiple successful matchers stipulate sorting
+ if ( outermost && !seed && setMatched.length > 0 &&
+ ( matchedCount + setMatchers.length ) > 1 ) {
+
+ Sizzle.uniqueSort( results );
+ }
+ }
+
+ // Override manipulation of globals by nested matchers
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ outermostContext = contextBackup;
+ }
+
+ return unmatched;
+ };
+
+ return bySet ?
+ markFunction( superMatcher ) :
+ superMatcher;
+}
+
+compile = Sizzle.compile = function( selector, group /* Internal Use Only */ ) {
+ var i,
+ setMatchers = [],
+ elementMatchers = [],
+ cached = compilerCache[ selector + " " ];
+
+ if ( !cached ) {
+ // Generate a function of recursive functions that can be used to check each element
+ if ( !group ) {
+ group = tokenize( selector );
+ }
+ i = group.length;
+ while ( i-- ) {
+ cached = matcherFromTokens( group[i] );
+ if ( cached[ expando ] ) {
+ setMatchers.push( cached );
+ } else {
+ elementMatchers.push( cached );
+ }
+ }
+
+ // Cache the compiled function
+ cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );
+ }
+ return cached;
+};
+
+function multipleContexts( selector, contexts, results ) {
+ var i = 0,
+ len = contexts.length;
+ for ( ; i < len; i++ ) {
+ Sizzle( selector, contexts[i], results );
+ }
+ return results;
+}
+
+function select( selector, context, results, seed ) {
+ var i, tokens, token, type, find,
+ match = tokenize( selector );
+
+ if ( !seed ) {
+ // Try to minimize operations if there is only one group
+ if ( match.length === 1 ) {
+
+ // Take a shortcut and set the context if the root selector is an ID
+ tokens = match[0] = match[0].slice( 0 );
+ if ( tokens.length > 2 && (token = tokens[0]).type === "ID" &&
+ support.getById && context.nodeType === 9 && documentIsHTML &&
+ Expr.relative[ tokens[1].type ] ) {
+
+ context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0];
+ if ( !context ) {
+ return results;
+ }
+ selector = selector.slice( tokens.shift().value.length );
+ }
+
+ // Fetch a seed set for right-to-left matching
+ i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length;
+ while ( i-- ) {
+ token = tokens[i];
+
+ // Abort if we hit a combinator
+ if ( Expr.relative[ (type = token.type) ] ) {
+ break;
+ }
+ if ( (find = Expr.find[ type ]) ) {
+ // Search, expanding context for leading sibling combinators
+ if ( (seed = find(
+ token.matches[0].replace( runescape, funescape ),
+ rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context
+ )) ) {
+
+ // If seed is empty or no tokens remain, we can return early
+ tokens.splice( i, 1 );
+ selector = seed.length && toSelector( tokens );
+ if ( !selector ) {
+ push.apply( results, seed );
+ return results;
+ }
+
+ break;
+ }
+ }
+ }
+ }
+ }
+
+ // Compile and execute a filtering function
+ // Provide `match` to avoid retokenization if we modified the selector above
+ compile( selector, match )(
+ seed,
+ context,
+ !documentIsHTML,
+ results,
+ rsibling.test( selector ) && testContext( context.parentNode ) || context
+ );
+ return results;
+}
+
+// One-time assignments
+
+// Sort stability
+support.sortStable = expando.split("").sort( sortOrder ).join("") === expando;
+
+// Support: Chrome<14
+// Always assume duplicates if they aren't passed to the comparison function
+support.detectDuplicates = !!hasDuplicate;
+
+// Initialize against the default document
+setDocument();
+
+// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
+// Detached nodes confoundingly follow *each other*
+support.sortDetached = assert(function( div1 ) {
+ // Should return 1, but returns 4 (following)
+ return div1.compareDocumentPosition( document.createElement("div") ) & 1;
+});
+
+// Support: IE<8
+// Prevent attribute/property "interpolation"
+// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+if ( !assert(function( div ) {
+ div.innerHTML = "<a href='#'></a>";
+ return div.firstChild.getAttribute("href") === "#" ;
+}) ) {
+ addHandle( "type|href|height|width", function( elem, name, isXML ) {
+ if ( !isXML ) {
+ return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 );
+ }
+ });
+}
+
+// Support: IE<9
+// Use defaultValue in place of getAttribute("value")
+if ( !support.attributes || !assert(function( div ) {
+ div.innerHTML = "<input/>";
+ div.firstChild.setAttribute( "value", "" );
+ return div.firstChild.getAttribute( "value" ) === "";
+}) ) {
+ addHandle( "value", function( elem, name, isXML ) {
+ if ( !isXML && elem.nodeName.toLowerCase() === "input" ) {
+ return elem.defaultValue;
+ }
+ });
+}
+
+// Support: IE<9
+// Use getAttributeNode to fetch booleans when getAttribute lies
+if ( !assert(function( div ) {
+ return div.getAttribute("disabled") == null;
+}) ) {
+ addHandle( booleans, function( elem, name, isXML ) {
+ var val;
+ if ( !isXML ) {
+ return elem[ name ] === true ? name.toLowerCase() :
+ (val = elem.getAttributeNode( name )) && val.specified ?
+ val.value :
+ null;
+ }
+ });
+}
+
+return Sizzle;
+
+})( window );
+
+
+
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.pseudos;
+jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+
+
+
+var rneedsContext = jQuery.expr.match.needsContext;
+
+var rsingleTag = (/^<(\w+)\s*\/?>(?:<\/\1>|)$/);
+
+
+
+var risSimple = /^.[^:#\[\.,]*$/;
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, not ) {
+ if ( jQuery.isFunction( qualifier ) ) {
+ return jQuery.grep( elements, function( elem, i ) {
+ /* jshint -W018 */
+ return !!qualifier.call( elem, i, elem ) !== not;
+ });
+
+ }
+
+ if ( qualifier.nodeType ) {
+ return jQuery.grep( elements, function( elem ) {
+ return ( elem === qualifier ) !== not;
+ });
+
+ }
+
+ if ( typeof qualifier === "string" ) {
+ if ( risSimple.test( qualifier ) ) {
+ return jQuery.filter( qualifier, elements, not );
+ }
+
+ qualifier = jQuery.filter( qualifier, elements );
+ }
+
+ return jQuery.grep( elements, function( elem ) {
+ return ( jQuery.inArray( elem, qualifier ) >= 0 ) !== not;
+ });
+}
+
+jQuery.filter = function( expr, elems, not ) {
+ var elem = elems[ 0 ];
+
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
+
+ return elems.length === 1 && elem.nodeType === 1 ?
+ jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [] :
+ jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
+ return elem.nodeType === 1;
+ }));
+};
+
+jQuery.fn.extend({
+ find: function( selector ) {
+ var i,
+ ret = [],
+ self = this,
+ len = self.length;
+
+ if ( typeof selector !== "string" ) {
+ return this.pushStack( jQuery( selector ).filter(function() {
+ for ( i = 0; i < len; i++ ) {
+ if ( jQuery.contains( self[ i ], this ) ) {
+ return true;
+ }
+ }
+ }) );
+ }
+
+ for ( i = 0; i < len; i++ ) {
+ jQuery.find( selector, self[ i ], ret );
+ }
+
+ // Needed because $( selector, context ) becomes $( context ).find( selector )
+ ret = this.pushStack( len > 1 ? jQuery.unique( ret ) : ret );
+ ret.selector = this.selector ? this.selector + " " + selector : selector;
+ return ret;
+ },
+ filter: function( selector ) {
+ return this.pushStack( winnow(this, selector || [], false) );
+ },
+ not: function( selector ) {
+ return this.pushStack( winnow(this, selector || [], true) );
+ },
+ is: function( selector ) {
+ return !!winnow(
+ this,
+
+ // If this is a positional/relative selector, check membership in the returned set
+ // so $("p:first").is("p:last") won't return true for a doc with two "p".
+ typeof selector === "string" && rneedsContext.test( selector ) ?
+ jQuery( selector ) :
+ selector || [],
+ false
+ ).length;
+ }
+});
+
+
+// Initialize a jQuery object
+
+
+// A central reference to the root jQuery(document)
+var rootjQuery,
+
+ // Use the correct document accordingly with window argument (sandbox)
+ document = window.document,
+
+ // A simple way to check for HTML strings
+ // Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
+ // Strict HTML recognition (#11290: must start with <)
+ rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,
+
+ init = jQuery.fn.init = function( selector, context ) {
+ var match, elem;
+
+ // HANDLE: $(""), $(null), $(undefined), $(false)
+ if ( !selector ) {
+ return this;
+ }
+
+ // Handle HTML strings
+ if ( typeof selector === "string" ) {
+ if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) {
+ // Assume that strings that start and end with <> are HTML and skip the regex check
+ match = [ null, selector, null ];
+
+ } else {
+ match = rquickExpr.exec( selector );
+ }
+
+ // Match html or make sure no context is specified for #id
+ if ( match && (match[1] || !context) ) {
+
+ // HANDLE: $(html) -> $(array)
+ if ( match[1] ) {
+ context = context instanceof jQuery ? context[0] : context;
+
+ // scripts is true for back-compat
+ // Intentionally let the error be thrown if parseHTML is not present
+ jQuery.merge( this, jQuery.parseHTML(
+ match[1],
+ context && context.nodeType ? context.ownerDocument || context : document,
+ true
+ ) );
+
+ // HANDLE: $(html, props)
+ if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) {
+ for ( match in context ) {
+ // Properties of context are called as methods if possible
+ if ( jQuery.isFunction( this[ match ] ) ) {
+ this[ match ]( context[ match ] );
+
+ // ...and otherwise set as attributes
+ } else {
+ this.attr( match, context[ match ] );
+ }
+ }
+ }
+
+ return this;
+
+ // HANDLE: $(#id)
+ } else {
+ elem = document.getElementById( match[2] );
+
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem.id !== match[2] ) {
+ return rootjQuery.find( selector );
+ }
+
+ // Otherwise, we inject the element directly into the jQuery object
+ this.length = 1;
+ this[0] = elem;
+ }
+
+ this.context = document;
+ this.selector = selector;
+ return this;
+ }
+
+ // HANDLE: $(expr, $(...))
+ } else if ( !context || context.jquery ) {
+ return ( context || rootjQuery ).find( selector );
+
+ // HANDLE: $(expr, context)
+ // (which is just equivalent to: $(context).find(expr)
+ } else {
+ return this.constructor( context ).find( selector );
+ }
+
+ // HANDLE: $(DOMElement)
+ } else if ( selector.nodeType ) {
+ this.context = this[0] = selector;
+ this.length = 1;
+ return this;
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if ( jQuery.isFunction( selector ) ) {
+ return typeof rootjQuery.ready !== "undefined" ?
+ rootjQuery.ready( selector ) :
+ // Execute immediately if ready is not present
+ selector( jQuery );
+ }
+
+ if ( selector.selector !== undefined ) {
+ this.selector = selector.selector;
+ this.context = selector.context;
+ }
+
+ return jQuery.makeArray( selector, this );
+ };
+
+// Give the init function the jQuery prototype for later instantiation
+init.prototype = jQuery.fn;
+
+// Initialize central reference
+rootjQuery = jQuery( document );
+
+
+var rparentsprev = /^(?:parents|prev(?:Until|All))/,
+ // methods guaranteed to produce a unique set when starting from a unique set
+ guaranteedUnique = {
+ children: true,
+ contents: true,
+ next: true,
+ prev: true
+ };
+
+jQuery.extend({
+ dir: function( elem, dir, until ) {
+ var matched = [],
+ cur = elem[ dir ];
+
+ while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
+ if ( cur.nodeType === 1 ) {
+ matched.push( cur );
+ }
+ cur = cur[dir];
+ }
+ return matched;
+ },
+
+ sibling: function( n, elem ) {
+ var r = [];
+
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType === 1 && n !== elem ) {
+ r.push( n );
+ }
+ }
+
+ return r;
+ }
+});
+
+jQuery.fn.extend({
+ has: function( target ) {
+ var i,
+ targets = jQuery( target, this ),
+ len = targets.length;
+
+ return this.filter(function() {
+ for ( i = 0; i < len; i++ ) {
+ if ( jQuery.contains( this, targets[i] ) ) {
+ return true;
+ }
+ }
+ });
+ },
+
+ closest: function( selectors, context ) {
+ var cur,
+ i = 0,
+ l = this.length,
+ matched = [],
+ pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ?
+ jQuery( selectors, context || this.context ) :
+ 0;
+
+ for ( ; i < l; i++ ) {
+ for ( cur = this[i]; cur && cur !== context; cur = cur.parentNode ) {
+ // Always skip document fragments
+ if ( cur.nodeType < 11 && (pos ?
+ pos.index(cur) > -1 :
+
+ // Don't pass non-elements to Sizzle
+ cur.nodeType === 1 &&
+ jQuery.find.matchesSelector(cur, selectors)) ) {
+
+ matched.push( cur );
+ break;
+ }
+ }
+ }
+
+ return this.pushStack( matched.length > 1 ? jQuery.unique( matched ) : matched );
+ },
+
+ // Determine the position of an element within
+ // the matched set of elements
+ index: function( elem ) {
+
+ // No argument, return index in parent
+ if ( !elem ) {
+ return ( this[0] && this[0].parentNode ) ? this.first().prevAll().length : -1;
+ }
+
+ // index in selector
+ if ( typeof elem === "string" ) {
+ return jQuery.inArray( this[0], jQuery( elem ) );
+ }
+
+ // Locate the position of the desired element
+ return jQuery.inArray(
+ // If it receives a jQuery object, the first element is used
+ elem.jquery ? elem[0] : elem, this );
+ },
+
+ add: function( selector, context ) {
+ return this.pushStack(
+ jQuery.unique(
+ jQuery.merge( this.get(), jQuery( selector, context ) )
+ )
+ );
+ },
+
+ addBack: function( selector ) {
+ return this.add( selector == null ?
+ this.prevObject : this.prevObject.filter(selector)
+ );
+ }
+});
+
+function sibling( cur, dir ) {
+ do {
+ cur = cur[ dir ];
+ } while ( cur && cur.nodeType !== 1 );
+
+ return cur;
+}
+
+jQuery.each({
+ parent: function( elem ) {
+ var parent = elem.parentNode;
+ return parent && parent.nodeType !== 11 ? parent : null;
+ },
+ parents: function( elem ) {
+ return jQuery.dir( elem, "parentNode" );
+ },
+ parentsUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "parentNode", until );
+ },
+ next: function( elem ) {
+ return sibling( elem, "nextSibling" );
+ },
+ prev: function( elem ) {
+ return sibling( elem, "previousSibling" );
+ },
+ nextAll: function( elem ) {
+ return jQuery.dir( elem, "nextSibling" );
+ },
+ prevAll: function( elem ) {
+ return jQuery.dir( elem, "previousSibling" );
+ },
+ nextUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "nextSibling", until );
+ },
+ prevUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "previousSibling", until );
+ },
+ siblings: function( elem ) {
+ return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem );
+ },
+ children: function( elem ) {
+ return jQuery.sibling( elem.firstChild );
+ },
+ contents: function( elem ) {
+ return jQuery.nodeName( elem, "iframe" ) ?
+ elem.contentDocument || elem.contentWindow.document :
+ jQuery.merge( [], elem.childNodes );
+ }
+}, function( name, fn ) {
+ jQuery.fn[ name ] = function( until, selector ) {
+ var ret = jQuery.map( this, fn, until );
+
+ if ( name.slice( -5 ) !== "Until" ) {
+ selector = until;
+ }
+
+ if ( selector && typeof selector === "string" ) {
+ ret = jQuery.filter( selector, ret );
+ }
+
+ if ( this.length > 1 ) {
+ // Remove duplicates
+ if ( !guaranteedUnique[ name ] ) {
+ ret = jQuery.unique( ret );
+ }
+
+ // Reverse order for parents* and prev-derivatives
+ if ( rparentsprev.test( name ) ) {
+ ret = ret.reverse();
+ }
+ }
+
+ return this.pushStack( ret );
+ };
+});
+var rnotwhite = (/\S+/g);
+
+
+
+// String to Object options format cache
+var optionsCache = {};
+
+// Convert String-formatted options into Object-formatted ones and store in cache
+function createOptions( options ) {
+ var object = optionsCache[ options ] = {};
+ jQuery.each( options.match( rnotwhite ) || [], function( _, flag ) {
+ object[ flag ] = true;
+ });
+ return object;
+}
+
+/*
+ * Create a callback list using the following parameters:
+ *
+ * options: an optional list of space-separated options that will change how
+ * the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ * once: will ensure the callback list can only be fired once (like a Deferred)
+ *
+ * memory: will keep track of previous values and will call any callback added
+ * after the list has been fired right away with the latest "memorized"
+ * values (like a Deferred)
+ *
+ * unique: will ensure a callback can only be added once (no duplicate in the list)
+ *
+ * stopOnFalse: interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( options ) {
+
+ // Convert options from String-formatted to Object-formatted if needed
+ // (we check in cache first)
+ options = typeof options === "string" ?
+ ( optionsCache[ options ] || createOptions( options ) ) :
+ jQuery.extend( {}, options );
+
+ var // Flag to know if list is currently firing
+ firing,
+ // Last fire value (for non-forgettable lists)
+ memory,
+ // Flag to know if list was already fired
+ fired,
+ // End of the loop when firing
+ firingLength,
+ // Index of currently firing callback (modified by remove if needed)
+ firingIndex,
+ // First callback to fire (used internally by add and fireWith)
+ firingStart,
+ // Actual callback list
+ list = [],
+ // Stack of fire calls for repeatable lists
+ stack = !options.once && [],
+ // Fire callbacks
+ fire = function( data ) {
+ memory = options.memory && data;
+ fired = true;
+ firingIndex = firingStart || 0;
+ firingStart = 0;
+ firingLength = list.length;
+ firing = true;
+ for ( ; list && firingIndex < firingLength; firingIndex++ ) {
+ if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) {
+ memory = false; // To prevent further calls using add
+ break;
+ }
+ }
+ firing = false;
+ if ( list ) {
+ if ( stack ) {
+ if ( stack.length ) {
+ fire( stack.shift() );
+ }
+ } else if ( memory ) {
+ list = [];
+ } else {
+ self.disable();
+ }
+ }
+ },
+ // Actual Callbacks object
+ self = {
+ // Add a callback or a collection of callbacks to the list
+ add: function() {
+ if ( list ) {
+ // First, we save the current length
+ var start = list.length;
+ (function add( args ) {
+ jQuery.each( args, function( _, arg ) {
+ var type = jQuery.type( arg );
+ if ( type === "function" ) {
+ if ( !options.unique || !self.has( arg ) ) {
+ list.push( arg );
+ }
+ } else if ( arg && arg.length && type !== "string" ) {
+ // Inspect recursively
+ add( arg );
+ }
+ });
+ })( arguments );
+ // Do we need to add the callbacks to the
+ // current firing batch?
+ if ( firing ) {
+ firingLength = list.length;
+ // With memory, if we're not firing then
+ // we should call right away
+ } else if ( memory ) {
+ firingStart = start;
+ fire( memory );
+ }
+ }
+ return this;
+ },
+ // Remove a callback from the list
+ remove: function() {
+ if ( list ) {
+ jQuery.each( arguments, function( _, arg ) {
+ var index;
+ while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
+ list.splice( index, 1 );
+ // Handle firing indexes
+ if ( firing ) {
+ if ( index <= firingLength ) {
+ firingLength--;
+ }
+ if ( index <= firingIndex ) {
+ firingIndex--;
+ }
+ }
+ }
+ });
+ }
+ return this;
+ },
+ // Check if a given callback is in the list.
+ // If no argument is given, return whether or not list has callbacks attached.
+ has: function( fn ) {
+ return fn ? jQuery.inArray( fn, list ) > -1 : !!( list && list.length );
+ },
+ // Remove all callbacks from the list
+ empty: function() {
+ list = [];
+ firingLength = 0;
+ return this;
+ },
+ // Have the list do nothing anymore
+ disable: function() {
+ list = stack = memory = undefined;
+ return this;
+ },
+ // Is it disabled?
+ disabled: function() {
+ return !list;
+ },
+ // Lock the list in its current state
+ lock: function() {
+ stack = undefined;
+ if ( !memory ) {
+ self.disable();
+ }
+ return this;
+ },
+ // Is it locked?
+ locked: function() {
+ return !stack;
+ },
+ // Call all callbacks with the given context and arguments
+ fireWith: function( context, args ) {
+ if ( list && ( !fired || stack ) ) {
+ args = args || [];
+ args = [ context, args.slice ? args.slice() : args ];
+ if ( firing ) {
+ stack.push( args );
+ } else {
+ fire( args );
+ }
+ }
+ return this;
+ },
+ // Call all the callbacks with the given arguments
+ fire: function() {
+ self.fireWith( this, arguments );
+ return this;
+ },
+ // To know if the callbacks have already been called at least once
+ fired: function() {
+ return !!fired;
+ }
+ };
+
+ return self;
+};
+
+
+jQuery.extend({
+
+ Deferred: function( func ) {
+ var tuples = [
+ // action, add listener, listener list, final state
+ [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ],
+ [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ],
+ [ "notify", "progress", jQuery.Callbacks("memory") ]
+ ],
+ state = "pending",
+ promise = {
+ state: function() {
+ return state;
+ },
+ always: function() {
+ deferred.done( arguments ).fail( arguments );
+ return this;
+ },
+ then: function( /* fnDone, fnFail, fnProgress */ ) {
+ var fns = arguments;
+ return jQuery.Deferred(function( newDefer ) {
+ jQuery.each( tuples, function( i, tuple ) {
+ var fn = jQuery.isFunction( fns[ i ] ) && fns[ i ];
+ // deferred[ done | fail | progress ] for forwarding actions to newDefer
+ deferred[ tuple[1] ](function() {
+ var returned = fn && fn.apply( this, arguments );
+ if ( returned && jQuery.isFunction( returned.promise ) ) {
+ returned.promise()
+ .done( newDefer.resolve )
+ .fail( newDefer.reject )
+ .progress( newDefer.notify );
+ } else {
+ newDefer[ tuple[ 0 ] + "With" ]( this === promise ? newDefer.promise() : this, fn ? [ returned ] : arguments );
+ }
+ });
+ });
+ fns = null;
+ }).promise();
+ },
+ // Get a promise for this deferred
+ // If obj is provided, the promise aspect is added to the object
+ promise: function( obj ) {
+ return obj != null ? jQuery.extend( obj, promise ) : promise;
+ }
+ },
+ deferred = {};
+
+ // Keep pipe for back-compat
+ promise.pipe = promise.then;
+
+ // Add list-specific methods
+ jQuery.each( tuples, function( i, tuple ) {
+ var list = tuple[ 2 ],
+ stateString = tuple[ 3 ];
+
+ // promise[ done | fail | progress ] = list.add
+ promise[ tuple[1] ] = list.add;
+
+ // Handle state
+ if ( stateString ) {
+ list.add(function() {
+ // state = [ resolved | rejected ]
+ state = stateString;
+
+ // [ reject_list | resolve_list ].disable; progress_list.lock
+ }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock );
+ }
+
+ // deferred[ resolve | reject | notify ]
+ deferred[ tuple[0] ] = function() {
+ deferred[ tuple[0] + "With" ]( this === deferred ? promise : this, arguments );
+ return this;
+ };
+ deferred[ tuple[0] + "With" ] = list.fireWith;
+ });
+
+ // Make the deferred a promise
+ promise.promise( deferred );
+
+ // Call given func if any
+ if ( func ) {
+ func.call( deferred, deferred );
+ }
+
+ // All done!
+ return deferred;
+ },
+
+ // Deferred helper
+ when: function( subordinate /* , ..., subordinateN */ ) {
+ var i = 0,
+ resolveValues = slice.call( arguments ),
+ length = resolveValues.length,
+
+ // the count of uncompleted subordinates
+ remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0,
+
+ // the master Deferred. If resolveValues consist of only a single Deferred, just use that.
+ deferred = remaining === 1 ? subordinate : jQuery.Deferred(),
+
+ // Update function for both resolve and progress values
+ updateFunc = function( i, contexts, values ) {
+ return function( value ) {
+ contexts[ i ] = this;
+ values[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
+ if ( values === progressValues ) {
+ deferred.notifyWith( contexts, values );
+
+ } else if ( !(--remaining) ) {
+ deferred.resolveWith( contexts, values );
+ }
+ };
+ },
+
+ progressValues, progressContexts, resolveContexts;
+
+ // add listeners to Deferred subordinates; treat others as resolved
+ if ( length > 1 ) {
+ progressValues = new Array( length );
+ progressContexts = new Array( length );
+ resolveContexts = new Array( length );
+ for ( ; i < length; i++ ) {
+ if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) {
+ resolveValues[ i ].promise()
+ .done( updateFunc( i, resolveContexts, resolveValues ) )
+ .fail( deferred.reject )
+ .progress( updateFunc( i, progressContexts, progressValues ) );
+ } else {
+ --remaining;
+ }
+ }
+ }
+
+ // if we're not waiting on anything, resolve the master
+ if ( !remaining ) {
+ deferred.resolveWith( resolveContexts, resolveValues );
+ }
+
+ return deferred.promise();
+ }
+});
+
+
+// The deferred used on DOM ready
+var readyList;
+
+jQuery.fn.ready = function( fn ) {
+ // Add the callback
+ jQuery.ready.promise().done( fn );
+
+ return this;
+};
+
+jQuery.extend({
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+
+ // Hold (or release) the ready event
+ holdReady: function( hold ) {
+ if ( hold ) {
+ jQuery.readyWait++;
+ } else {
+ jQuery.ready( true );
+ }
+ },
+
+ // Handle when the DOM is ready
+ ready: function( wait ) {
+
+ // Abort if there are pending holds or we're already ready
+ if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
+ return;
+ }
+
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( !document.body ) {
+ return setTimeout( jQuery.ready );
+ }
+
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if ( wait !== true && --jQuery.readyWait > 0 ) {
+ return;
+ }
+
+ // If there are functions bound, to execute
+ readyList.resolveWith( document, [ jQuery ] );
+
+ // Trigger any bound ready events
+ if ( jQuery.fn.trigger ) {
+ jQuery( document ).trigger("ready").off("ready");
+ }
+ }
+});
+
+/**
+ * Clean-up method for dom ready events
+ */
+function detach() {
+ if ( document.addEventListener ) {
+ document.removeEventListener( "DOMContentLoaded", completed, false );
+ window.removeEventListener( "load", completed, false );
+
+ } else {
+ document.detachEvent( "onreadystatechange", completed );
+ window.detachEvent( "onload", completed );
+ }
+}
+
+/**
+ * The ready event handler and self cleanup method
+ */
+function completed() {
+ // readyState === "complete" is good enough for us to call the dom ready in oldIE
+ if ( document.addEventListener || event.type === "load" || document.readyState === "complete" ) {
+ detach();
+ jQuery.ready();
+ }
+}
+
+jQuery.ready.promise = function( obj ) {
+ if ( !readyList ) {
+
+ readyList = jQuery.Deferred();
+
+ // Catch cases where $(document).ready() is called after the browser event has already occurred.
+ // we once tried to use readyState "interactive" here, but it caused issues like the one
+ // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15
+ if ( document.readyState === "complete" ) {
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ setTimeout( jQuery.ready );
+
+ // Standards-based browsers support DOMContentLoaded
+ } else if ( document.addEventListener ) {
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", completed, false );
+
+ // A fallback to window.onload, that will always work
+ window.addEventListener( "load", completed, false );
+
+ // If IE event model is used
+ } else {
+ // Ensure firing before onload, maybe late but safe also for iframes
+ document.attachEvent( "onreadystatechange", completed );
+
+ // A fallback to window.onload, that will always work
+ window.attachEvent( "onload", completed );
+
+ // If IE and not a frame
+ // continually check to see if the document is ready
+ var top = false;
+
+ try {
+ top = window.frameElement == null && document.documentElement;
+ } catch(e) {}
+
+ if ( top && top.doScroll ) {
+ (function doScrollCheck() {
+ if ( !jQuery.isReady ) {
+
+ try {
+ // Use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ top.doScroll("left");
+ } catch(e) {
+ return setTimeout( doScrollCheck, 50 );
+ }
+
+ // detach all dom ready events
+ detach();
+
+ // and execute any waiting functions
+ jQuery.ready();
+ }
+ })();
+ }
+ }
+ }
+ return readyList.promise( obj );
+};
+
+
+var strundefined = typeof undefined;
+
+
+
+// Support: IE<9
+// Iteration over object's inherited properties before its own
+var i;
+for ( i in jQuery( support ) ) {
+ break;
+}
+support.ownLast = i !== "0";
+
+// Note: most support tests are defined in their respective modules.
+// false until the test is run
+support.inlineBlockNeedsLayout = false;
+
+jQuery(function() {
+ // We need to execute this one support test ASAP because we need to know
+ // if body.style.zoom needs to be set.
+
+ var container, div,
+ body = document.getElementsByTagName("body")[0];
+
+ if ( !body ) {
+ // Return for frameset docs that don't have a body
+ return;
+ }
+
+ // Setup
+ container = document.createElement( "div" );
+ container.style.cssText = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px";
+
+ div = document.createElement( "div" );
+ body.appendChild( container ).appendChild( div );
+
+ if ( typeof div.style.zoom !== strundefined ) {
+ // Support: IE<8
+ // Check if natively block-level elements act like inline-block
+ // elements when setting their display to 'inline' and giving
+ // them layout
+ div.style.cssText = "border:0;margin:0;width:1px;padding:1px;display:inline;zoom:1";
+
+ if ( (support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 )) ) {
+ // Prevent IE 6 from affecting layout for positioned elements #11048
+ // Prevent IE from shrinking the body in IE 7 mode #12869
+ // Support: IE<8
+ body.style.zoom = 1;
+ }
+ }
+
+ body.removeChild( container );
+
+ // Null elements to avoid leaks in IE
+ container = div = null;
+});
+
+
+
+
+(function() {
+ var div = document.createElement( "div" );
+
+ // Execute the test only if not already executed in another module.
+ if (support.deleteExpando == null) {
+ // Support: IE<9
+ support.deleteExpando = true;
+ try {
+ delete div.test;
+ } catch( e ) {
+ support.deleteExpando = false;
+ }
+ }
+
+ // Null elements to avoid leaks in IE.
+ div = null;
+})();
+
+
+/**
+ * Determines whether an object can have data
+ */
+jQuery.acceptData = function( elem ) {
+ var noData = jQuery.noData[ (elem.nodeName + " ").toLowerCase() ],
+ nodeType = +elem.nodeType || 1;
+
+ // Do not set data on non-element DOM nodes because it will not be cleared (#8335).
+ return nodeType !== 1 && nodeType !== 9 ?
+ false :
+
+ // Nodes accept data unless otherwise specified; rejection can be conditional
+ !noData || noData !== true && elem.getAttribute("classid") === noData;
+};
+
+
+var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
+ rmultiDash = /([A-Z])/g;
+
+function dataAttr( elem, key, data ) {
+ // If nothing was found internally, try to fetch any
+ // data from the HTML5 data-* attribute
+ if ( data === undefined && elem.nodeType === 1 ) {
+
+ var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase();
+
+ data = elem.getAttribute( name );
+
+ if ( typeof data === "string" ) {
+ try {
+ data = data === "true" ? true :
+ data === "false" ? false :
+ data === "null" ? null :
+ // Only convert to a number if it doesn't change the string
+ +data + "" === data ? +data :
+ rbrace.test( data ) ? jQuery.parseJSON( data ) :
+ data;
+ } catch( e ) {}
+
+ // Make sure we set the data so it isn't changed later
+ jQuery.data( elem, key, data );
+
+ } else {
+ data = undefined;
+ }
+ }
+
+ return data;
+}
+
+// checks a cache object for emptiness
+function isEmptyDataObject( obj ) {
+ var name;
+ for ( name in obj ) {
+
+ // if the public data object is empty, the private is still empty
+ if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) {
+ continue;
+ }
+ if ( name !== "toJSON" ) {
+ return false;
+ }
+ }
+
+ return true;
+}
+
+function internalData( elem, name, data, pvt /* Internal Use Only */ ) {
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var ret, thisCache,
+ internalKey = jQuery.expando,
+
+ // We have to handle DOM nodes and JS objects differently because IE6-7
+ // can't GC object references properly across the DOM-JS boundary
+ isNode = elem.nodeType,
+
+ // Only DOM nodes need the global jQuery cache; JS object data is
+ // attached directly to the object so GC can occur automatically
+ cache = isNode ? jQuery.cache : elem,
+
+ // Only defining an ID for JS objects if its cache already exists allows
+ // the code to shortcut on the same path as a DOM node with no cache
+ id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey;
+
+ // Avoid doing any more work than we need to when trying to get data on an
+ // object that has no data at all
+ if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && data === undefined && typeof name === "string" ) {
+ return;
+ }
+
+ if ( !id ) {
+ // Only DOM nodes need a new unique ID for each element since their data
+ // ends up in the global cache
+ if ( isNode ) {
+ id = elem[ internalKey ] = deletedIds.pop() || jQuery.guid++;
+ } else {
+ id = internalKey;
+ }
+ }
+
+ if ( !cache[ id ] ) {
+ // Avoid exposing jQuery metadata on plain JS objects when the object
+ // is serialized using JSON.stringify
+ cache[ id ] = isNode ? {} : { toJSON: jQuery.noop };
+ }
+
+ // An object can be passed to jQuery.data instead of a key/value pair; this gets
+ // shallow copied over onto the existing cache
+ if ( typeof name === "object" || typeof name === "function" ) {
+ if ( pvt ) {
+ cache[ id ] = jQuery.extend( cache[ id ], name );
+ } else {
+ cache[ id ].data = jQuery.extend( cache[ id ].data, name );
+ }
+ }
+
+ thisCache = cache[ id ];
+
+ // jQuery data() is stored in a separate object inside the object's internal data
+ // cache in order to avoid key collisions between internal data and user-defined
+ // data.
+ if ( !pvt ) {
+ if ( !thisCache.data ) {
+ thisCache.data = {};
+ }
+
+ thisCache = thisCache.data;
+ }
+
+ if ( data !== undefined ) {
+ thisCache[ jQuery.camelCase( name ) ] = data;
+ }
+
+ // Check for both converted-to-camel and non-converted data property names
+ // If a data property was specified
+ if ( typeof name === "string" ) {
+
+ // First Try to find as-is property data
+ ret = thisCache[ name ];
+
+ // Test for null|undefined property data
+ if ( ret == null ) {
+
+ // Try to find the camelCased property
+ ret = thisCache[ jQuery.camelCase( name ) ];
+ }
+ } else {
+ ret = thisCache;
+ }
+
+ return ret;
+}
+
+function internalRemoveData( elem, name, pvt ) {
+ if ( !jQuery.acceptData( elem ) ) {
+ return;
+ }
+
+ var thisCache, i,
+ isNode = elem.nodeType,
+
+ // See jQuery.data for more information
+ cache = isNode ? jQuery.cache : elem,
+ id = isNode ? elem[ jQuery.expando ] : jQuery.expando;
+
+ // If there is already no cache entry for this object, there is no
+ // purpose in continuing
+ if ( !cache[ id ] ) {
+ return;
+ }
+
+ if ( name ) {
+
+ thisCache = pvt ? cache[ id ] : cache[ id ].data;
+
+ if ( thisCache ) {
+
+ // Support array or space separated string names for data keys
+ if ( !jQuery.isArray( name ) ) {
+
+ // try the string as a key before any manipulation
+ if ( name in thisCache ) {
+ name = [ name ];
+ } else {
+
+ // split the camel cased version by spaces unless a key with the spaces exists
+ name = jQuery.camelCase( name );
+ if ( name in thisCache ) {
+ name = [ name ];
+ } else {
+ name = name.split(" ");
+ }
+ }
+ } else {
+ // If "name" is an array of keys...
+ // When data is initially created, via ("key", "val") signature,
+ // keys will be converted to camelCase.
+ // Since there is no way to tell _how_ a key was added, remove
+ // both plain key and camelCase key. #12786
+ // This will only penalize the array argument path.
+ name = name.concat( jQuery.map( name, jQuery.camelCase ) );
+ }
+
+ i = name.length;
+ while ( i-- ) {
+ delete thisCache[ name[i] ];
+ }
+
+ // If there is no data left in the cache, we want to continue
+ // and let the cache object itself get destroyed
+ if ( pvt ? !isEmptyDataObject(thisCache) : !jQuery.isEmptyObject(thisCache) ) {
+ return;
+ }
+ }
+ }
+
+ // See jQuery.data for more information
+ if ( !pvt ) {
+ delete cache[ id ].data;
+
+ // Don't destroy the parent cache unless the internal data object
+ // had been the only thing left in it
+ if ( !isEmptyDataObject( cache[ id ] ) ) {
+ return;
+ }
+ }
+
+ // Destroy the cache
+ if ( isNode ) {
+ jQuery.cleanData( [ elem ], true );
+
+ // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080)
+ /* jshint eqeqeq: false */
+ } else if ( support.deleteExpando || cache != cache.window ) {
+ /* jshint eqeqeq: true */
+ delete cache[ id ];
+
+ // When all else fails, null
+ } else {
+ cache[ id ] = null;
+ }
+}
+
+jQuery.extend({
+ cache: {},
+
+ // The following elements (space-suffixed to avoid Object.prototype collisions)
+ // throw uncatchable exceptions if you attempt to set expando properties
+ noData: {
+ "applet ": true,
+ "embed ": true,
+ // ...but Flash objects (which have this classid) *can* handle expandos
+ "object ": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"
+ },
+
+ hasData: function( elem ) {
+ elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
+ return !!elem && !isEmptyDataObject( elem );
+ },
+
+ data: function( elem, name, data ) {
+ return internalData( elem, name, data );
+ },
+
+ removeData: function( elem, name ) {
+ return internalRemoveData( elem, name );
+ },
+
+ // For internal use only.
+ _data: function( elem, name, data ) {
+ return internalData( elem, name, data, true );
+ },
+
+ _removeData: function( elem, name ) {
+ return internalRemoveData( elem, name, true );
+ }
+});
+
+jQuery.fn.extend({
+ data: function( key, value ) {
+ var i, name, data,
+ elem = this[0],
+ attrs = elem && elem.attributes;
+
+ // Special expections of .data basically thwart jQuery.access,
+ // so implement the relevant behavior ourselves
+
+ // Gets all values
+ if ( key === undefined ) {
+ if ( this.length ) {
+ data = jQuery.data( elem );
+
+ if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) {
+ i = attrs.length;
+ while ( i-- ) {
+ name = attrs[i].name;
+
+ if ( name.indexOf("data-") === 0 ) {
+ name = jQuery.camelCase( name.slice(5) );
+
+ dataAttr( elem, name, data[ name ] );
+ }
+ }
+ jQuery._data( elem, "parsedAttrs", true );
+ }
+ }
+
+ return data;
+ }
+
+ // Sets multiple values
+ if ( typeof key === "object" ) {
+ return this.each(function() {
+ jQuery.data( this, key );
+ });
+ }
+
+ return arguments.length > 1 ?
+
+ // Sets one value
+ this.each(function() {
+ jQuery.data( this, key, value );
+ }) :
+
+ // Gets one value
+ // Try to fetch any internally stored data first
+ elem ? dataAttr( elem, key, jQuery.data( elem, key ) ) : undefined;
+ },
+
+ removeData: function( key ) {
+ return this.each(function() {
+ jQuery.removeData( this, key );
+ });
+ }
+});
+
+
+jQuery.extend({
+ queue: function( elem, type, data ) {
+ var queue;
+
+ if ( elem ) {
+ type = ( type || "fx" ) + "queue";
+ queue = jQuery._data( elem, type );
+
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if ( data ) {
+ if ( !queue || jQuery.isArray(data) ) {
+ queue = jQuery._data( elem, type, jQuery.makeArray(data) );
+ } else {
+ queue.push( data );
+ }
+ }
+ return queue || [];
+ }
+ },
+
+ dequeue: function( elem, type ) {
+ type = type || "fx";
+
+ var queue = jQuery.queue( elem, type ),
+ startLength = queue.length,
+ fn = queue.shift(),
+ hooks = jQuery._queueHooks( elem, type ),
+ next = function() {
+ jQuery.dequeue( elem, type );
+ };
+
+ // If the fx queue is dequeued, always remove the progress sentinel
+ if ( fn === "inprogress" ) {
+ fn = queue.shift();
+ startLength--;
+ }
+
+ if ( fn ) {
+
+ // Add a progress sentinel to prevent the fx queue from being
+ // automatically dequeued
+ if ( type === "fx" ) {
+ queue.unshift( "inprogress" );
+ }
+
+ // clear up the last queue stop function
+ delete hooks.stop;
+ fn.call( elem, next, hooks );
+ }
+
+ if ( !startLength && hooks ) {
+ hooks.empty.fire();
+ }
+ },
+
+ // not intended for public consumption - generates a queueHooks object, or returns the current one
+ _queueHooks: function( elem, type ) {
+ var key = type + "queueHooks";
+ return jQuery._data( elem, key ) || jQuery._data( elem, key, {
+ empty: jQuery.Callbacks("once memory").add(function() {
+ jQuery._removeData( elem, type + "queue" );
+ jQuery._removeData( elem, key );
+ })
+ });
+ }
+});
+
+jQuery.fn.extend({
+ queue: function( type, data ) {
+ var setter = 2;
+
+ if ( typeof type !== "string" ) {
+ data = type;
+ type = "fx";
+ setter--;
+ }
+
+ if ( arguments.length < setter ) {
+ return jQuery.queue( this[0], type );
+ }
+
+ return data === undefined ?
+ this :
+ this.each(function() {
+ var queue = jQuery.queue( this, type, data );
+
+ // ensure a hooks for this queue
+ jQuery._queueHooks( this, type );
+
+ if ( type === "fx" && queue[0] !== "inprogress" ) {
+ jQuery.dequeue( this, type );
+ }
+ });
+ },
+ dequeue: function( type ) {
+ return this.each(function() {
+ jQuery.dequeue( this, type );
+ });
+ },
+ clearQueue: function( type ) {
+ return this.queue( type || "fx", [] );
+ },
+ // Get a promise resolved when queues of a certain type
+ // are emptied (fx is the type by default)
+ promise: function( type, obj ) {
+ var tmp,
+ count = 1,
+ defer = jQuery.Deferred(),
+ elements = this,
+ i = this.length,
+ resolve = function() {
+ if ( !( --count ) ) {
+ defer.resolveWith( elements, [ elements ] );
+ }
+ };
+
+ if ( typeof type !== "string" ) {
+ obj = type;
+ type = undefined;
+ }
+ type = type || "fx";
+
+ while ( i-- ) {
+ tmp = jQuery._data( elements[ i ], type + "queueHooks" );
+ if ( tmp && tmp.empty ) {
+ count++;
+ tmp.empty.add( resolve );
+ }
+ }
+ resolve();
+ return defer.promise( obj );
+ }
+});
+var pnum = (/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/).source;
+
+var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
+
+var isHidden = function( elem, el ) {
+ // isHidden might be called from jQuery#filter function;
+ // in that case, element will be second argument
+ elem = el || elem;
+ return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem );
+ };
+
+
+
+// Multifunctional method to get and set values of a collection
+// The value/s can optionally be executed if it's a function
+var access = jQuery.access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
+ var i = 0,
+ length = elems.length,
+ bulk = key == null;
+
+ // Sets many values
+ if ( jQuery.type( key ) === "object" ) {
+ chainable = true;
+ for ( i in key ) {
+ jQuery.access( elems, fn, i, key[i], true, emptyGet, raw );
+ }
+
+ // Sets one value
+ } else if ( value !== undefined ) {
+ chainable = true;
+
+ if ( !jQuery.isFunction( value ) ) {
+ raw = true;
+ }
+
+ if ( bulk ) {
+ // Bulk operations run against the entire set
+ if ( raw ) {
+ fn.call( elems, value );
+ fn = null;
+
+ // ...except when executing function values
+ } else {
+ bulk = fn;
+ fn = function( elem, key, value ) {
+ return bulk.call( jQuery( elem ), value );
+ };
+ }
+ }
+
+ if ( fn ) {
+ for ( ; i < length; i++ ) {
+ fn( elems[i], key, raw ? value : value.call( elems[i], i, fn( elems[i], key ) ) );
+ }
+ }
+ }
+
+ return chainable ?
+ elems :
+
+ // Gets
+ bulk ?
+ fn.call( elems ) :
+ length ? fn( elems[0], key ) : emptyGet;
+};
+var rcheckableType = (/^(?:checkbox|radio)$/i);
+
+
+
+(function() {
+ var fragment = document.createDocumentFragment(),
+ div = document.createElement("div"),
+ input = document.createElement("input");
+
+ // Setup
+ div.setAttribute( "className", "t" );
+ div.innerHTML = " <link/><table></table><a href='/a'>a</a>";
+
+ // IE strips leading whitespace when .innerHTML is used
+ support.leadingWhitespace = div.firstChild.nodeType === 3;
+
+ // Make sure that tbody elements aren't automatically inserted
+ // IE will insert them into empty tables
+ support.tbody = !div.getElementsByTagName( "tbody" ).length;
+
+ // Make sure that link elements get serialized correctly by innerHTML
+ // This requires a wrapper element in IE
+ support.htmlSerialize = !!div.getElementsByTagName( "link" ).length;
+
+ // Makes sure cloning an html5 element does not cause problems
+ // Where outerHTML is undefined, this still works
+ support.html5Clone =
+ document.createElement( "nav" ).cloneNode( true ).outerHTML !== "<:nav></:nav>";
+
+ // Check if a disconnected checkbox will retain its checked
+ // value of true after appended to the DOM (IE6/7)
+ input.type = "checkbox";
+ input.checked = true;
+ fragment.appendChild( input );
+ support.appendChecked = input.checked;
+
+ // Make sure textarea (and checkbox) defaultValue is properly cloned
+ // Support: IE6-IE11+
+ div.innerHTML = "<textarea>x</textarea>";
+ support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
+
+ // #11217 - WebKit loses check when the name is after the checked attribute
+ fragment.appendChild( div );
+ div.innerHTML = "<input type='radio' checked='checked' name='t'/>";
+
+ // Support: Safari 5.1, iOS 5.1, Android 4.x, Android 2.3
+ // old WebKit doesn't clone checked state correctly in fragments
+ support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+ // Support: IE<9
+ // Opera does not clone events (and typeof div.attachEvent === undefined).
+ // IE9-10 clones events bound via attachEvent, but they don't trigger with .click()
+ support.noCloneEvent = true;
+ if ( div.attachEvent ) {
+ div.attachEvent( "onclick", function() {
+ support.noCloneEvent = false;
+ });
+
+ div.cloneNode( true ).click();
+ }
+
+ // Execute the test only if not already executed in another module.
+ if (support.deleteExpando == null) {
+ // Support: IE<9
+ support.deleteExpando = true;
+ try {
+ delete div.test;
+ } catch( e ) {
+ support.deleteExpando = false;
+ }
+ }
+
+ // Null elements to avoid leaks in IE.
+ fragment = div = input = null;
+})();
+
+
+(function() {
+ var i, eventName,
+ div = document.createElement( "div" );
+
+ // Support: IE<9 (lack submit/change bubble), Firefox 23+ (lack focusin event)
+ for ( i in { submit: true, change: true, focusin: true }) {
+ eventName = "on" + i;
+
+ if ( !(support[ i + "Bubbles" ] = eventName in window) ) {
+ // Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP)
+ div.setAttribute( eventName, "t" );
+ support[ i + "Bubbles" ] = div.attributes[ eventName ].expando === false;
+ }
+ }
+
+ // Null elements to avoid leaks in IE.
+ div = null;
+})();
+
+
+var rformElems = /^(?:input|select|textarea)$/i,
+ rkeyEvent = /^key/,
+ rmouseEvent = /^(?:mouse|contextmenu)|click/,
+ rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+ rtypenamespace = /^([^.]*)(?:\.(.+)|)$/;
+
+function returnTrue() {
+ return true;
+}
+
+function returnFalse() {
+ return false;
+}
+
+function safeActiveElement() {
+ try {
+ return document.activeElement;
+ } catch ( err ) { }
+}
+
+/*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+jQuery.event = {
+
+ global: {},
+
+ add: function( elem, types, handler, data, selector ) {
+ var tmp, events, t, handleObjIn,
+ special, eventHandle, handleObj,
+ handlers, type, namespaces, origType,
+ elemData = jQuery._data( elem );
+
+ // Don't attach events to noData or text/comment nodes (but allow plain objects)
+ if ( !elemData ) {
+ return;
+ }
+
+ // Caller can pass in an object of custom data in lieu of the handler
+ if ( handler.handler ) {
+ handleObjIn = handler;
+ handler = handleObjIn.handler;
+ selector = handleObjIn.selector;
+ }
+
+ // Make sure that the handler has a unique ID, used to find/remove it later
+ if ( !handler.guid ) {
+ handler.guid = jQuery.guid++;
+ }
+
+ // Init the element's event structure and main handler, if this is the first
+ if ( !(events = elemData.events) ) {
+ events = elemData.events = {};
+ }
+ if ( !(eventHandle = elemData.handle) ) {
+ eventHandle = elemData.handle = function( e ) {
+ // Discard the second event of a jQuery.event.trigger() and
+ // when an event is called after a page has unloaded
+ return typeof jQuery !== strundefined && (!e || jQuery.event.triggered !== e.type) ?
+ jQuery.event.dispatch.apply( eventHandle.elem, arguments ) :
+ undefined;
+ };
+ // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events
+ eventHandle.elem = elem;
+ }
+
+ // Handle multiple events separated by a space
+ types = ( types || "" ).match( rnotwhite ) || [ "" ];
+ t = types.length;
+ while ( t-- ) {
+ tmp = rtypenamespace.exec( types[t] ) || [];
+ type = origType = tmp[1];
+ namespaces = ( tmp[2] || "" ).split( "." ).sort();
+
+ // There *must* be a type, no attaching namespace-only handlers
+ if ( !type ) {
+ continue;
+ }
+
+ // If event changes its type, use the special event handlers for the changed type
+ special = jQuery.event.special[ type ] || {};
+
+ // If selector defined, determine special event api type, otherwise given type
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+
+ // Update special based on newly reset type
+ special = jQuery.event.special[ type ] || {};
+
+ // handleObj is passed to all event handlers
+ handleObj = jQuery.extend({
+ type: type,
+ origType: origType,
+ data: data,
+ handler: handler,
+ guid: handler.guid,
+ selector: selector,
+ needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
+ namespace: namespaces.join(".")
+ }, handleObjIn );
+
+ // Init the event handler queue if we're the first
+ if ( !(handlers = events[ type ]) ) {
+ handlers = events[ type ] = [];
+ handlers.delegateCount = 0;
+
+ // Only use addEventListener/attachEvent if the special events handler returns false
+ if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+ // Bind the global event handler to the element
+ if ( elem.addEventListener ) {
+ elem.addEventListener( type, eventHandle, false );
+
+ } else if ( elem.attachEvent ) {
+ elem.attachEvent( "on" + type, eventHandle );
+ }
+ }
+ }
+
+ if ( special.add ) {
+ special.add.call( elem, handleObj );
+
+ if ( !handleObj.handler.guid ) {
+ handleObj.handler.guid = handler.guid;
+ }
+ }
+
+ // Add to the element's handler list, delegates in front
+ if ( selector ) {
+ handlers.splice( handlers.delegateCount++, 0, handleObj );
+ } else {
+ handlers.push( handleObj );
+ }
+
+ // Keep track of which events have ever been used, for event optimization
+ jQuery.event.global[ type ] = true;
+ }
+
+ // Nullify elem to prevent memory leaks in IE
+ elem = null;
+ },
+
+ // Detach an event or set of events from an element
+ remove: function( elem, types, handler, selector, mappedTypes ) {
+ var j, handleObj, tmp,
+ origCount, t, events,
+ special, handlers, type,
+ namespaces, origType,
+ elemData = jQuery.hasData( elem ) && jQuery._data( elem );
+
+ if ( !elemData || !(events = elemData.events) ) {
+ return;
+ }
+
+ // Once for each type.namespace in types; type may be omitted
+ types = ( types || "" ).match( rnotwhite ) || [ "" ];
+ t = types.length;
+ while ( t-- ) {
+ tmp = rtypenamespace.exec( types[t] ) || [];
+ type = origType = tmp[1];
+ namespaces = ( tmp[2] || "" ).split( "." ).sort();
+
+ // Unbind all events (on this namespace, if provided) for the element
+ if ( !type ) {
+ for ( type in events ) {
+ jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
+ }
+ continue;
+ }
+
+ special = jQuery.event.special[ type ] || {};
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+ handlers = events[ type ] || [];
+ tmp = tmp[2] && new RegExp( "(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)" );
+
+ // Remove matching events
+ origCount = j = handlers.length;
+ while ( j-- ) {
+ handleObj = handlers[ j ];
+
+ if ( ( mappedTypes || origType === handleObj.origType ) &&
+ ( !handler || handler.guid === handleObj.guid ) &&
+ ( !tmp || tmp.test( handleObj.namespace ) ) &&
+ ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) {
+ handlers.splice( j, 1 );
+
+ if ( handleObj.selector ) {
+ handlers.delegateCount--;
+ }
+ if ( special.remove ) {
+ special.remove.call( elem, handleObj );
+ }
+ }
+ }
+
+ // Remove generic event handler if we removed something and no more handlers exist
+ // (avoids potential for endless recursion during removal of special event handlers)
+ if ( origCount && !handlers.length ) {
+ if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
+ jQuery.removeEvent( elem, type, elemData.handle );
+ }
+
+ delete events[ type ];
+ }
+ }
+
+ // Remove the expando if it's no longer used
+ if ( jQuery.isEmptyObject( events ) ) {
+ delete elemData.handle;
+
+ // removeData also checks for emptiness and clears the expando if empty
+ // so use it instead of delete
+ jQuery._removeData( elem, "events" );
+ }
+ },
+
+ trigger: function( event, data, elem, onlyHandlers ) {
+ var handle, ontype, cur,
+ bubbleType, special, tmp, i,
+ eventPath = [ elem || document ],
+ type = hasOwn.call( event, "type" ) ? event.type : event,
+ namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split(".") : [];
+
+ cur = tmp = elem = elem || document;
+
+ // Don't do events on text and comment nodes
+ if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return;
+ }
+
+ // focus/blur morphs to focusin/out; ensure we're not firing them right now
+ if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
+ return;
+ }
+
+ if ( type.indexOf(".") >= 0 ) {
+ // Namespaced trigger; create a regexp to match event type in handle()
+ namespaces = type.split(".");
+ type = namespaces.shift();
+ namespaces.sort();
+ }
+ ontype = type.indexOf(":") < 0 && "on" + type;
+
+ // Caller can pass in a jQuery.Event object, Object, or just an event type string
+ event = event[ jQuery.expando ] ?
+ event :
+ new jQuery.Event( type, typeof event === "object" && event );
+
+ // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
+ event.isTrigger = onlyHandlers ? 2 : 3;
+ event.namespace = namespaces.join(".");
+ event.namespace_re = event.namespace ?
+ new RegExp( "(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)" ) :
+ null;
+
+ // Clean up the event in case it is being reused
+ event.result = undefined;
+ if ( !event.target ) {
+ event.target = elem;
+ }
+
+ // Clone any incoming data and prepend the event, creating the handler arg list
+ data = data == null ?
+ [ event ] :
+ jQuery.makeArray( data, [ event ] );
+
+ // Allow special events to draw outside the lines
+ special = jQuery.event.special[ type ] || {};
+ if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
+ return;
+ }
+
+ // Determine event propagation path in advance, per W3C events spec (#9951)
+ // Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
+ if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {
+
+ bubbleType = special.delegateType || type;
+ if ( !rfocusMorph.test( bubbleType + type ) ) {
+ cur = cur.parentNode;
+ }
+ for ( ; cur; cur = cur.parentNode ) {
+ eventPath.push( cur );
+ tmp = cur;
+ }
+
+ // Only add window if we got to document (e.g., not plain obj or detached DOM)
+ if ( tmp === (elem.ownerDocument || document) ) {
+ eventPath.push( tmp.defaultView || tmp.parentWindow || window );
+ }
+ }
+
+ // Fire handlers on the event path
+ i = 0;
+ while ( (cur = eventPath[i++]) && !event.isPropagationStopped() ) {
+
+ event.type = i > 1 ?
+ bubbleType :
+ special.bindType || type;
+
+ // jQuery handler
+ handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" );
+ if ( handle ) {
+ handle.apply( cur, data );
+ }
+
+ // Native handler
+ handle = ontype && cur[ ontype ];
+ if ( handle && handle.apply && jQuery.acceptData( cur ) ) {
+ event.result = handle.apply( cur, data );
+ if ( event.result === false ) {
+ event.preventDefault();
+ }
+ }
+ }
+ event.type = type;
+
+ // If nobody prevented the default action, do it now
+ if ( !onlyHandlers && !event.isDefaultPrevented() ) {
+
+ if ( (!special._default || special._default.apply( eventPath.pop(), data ) === false) &&
+ jQuery.acceptData( elem ) ) {
+
+ // Call a native DOM method on the target with the same name name as the event.
+ // Can't use an .isFunction() check here because IE6/7 fails that test.
+ // Don't do default actions on window, that's where global variables be (#6170)
+ if ( ontype && elem[ type ] && !jQuery.isWindow( elem ) ) {
+
+ // Don't re-trigger an onFOO event when we call its FOO() method
+ tmp = elem[ ontype ];
+
+ if ( tmp ) {
+ elem[ ontype ] = null;
+ }
+
+ // Prevent re-triggering of the same event, since we already bubbled it above
+ jQuery.event.triggered = type;
+ try {
+ elem[ type ]();
+ } catch ( e ) {
+ // IE<9 dies on focus/blur to hidden element (#1486,#12518)
+ // only reproducible on winXP IE8 native, not IE9 in IE8 mode
+ }
+ jQuery.event.triggered = undefined;
+
+ if ( tmp ) {
+ elem[ ontype ] = tmp;
+ }
+ }
+ }
+ }
+
+ return event.result;
+ },
+
+ dispatch: function( event ) {
+
+ // Make a writable jQuery.Event from the native event object
+ event = jQuery.event.fix( event );
+
+ var i, ret, handleObj, matched, j,
+ handlerQueue = [],
+ args = slice.call( arguments ),
+ handlers = ( jQuery._data( this, "events" ) || {} )[ event.type ] || [],
+ special = jQuery.event.special[ event.type ] || {};
+
+ // Use the fix-ed jQuery.Event rather than the (read-only) native event
+ args[0] = event;
+ event.delegateTarget = this;
+
+ // Call the preDispatch hook for the mapped type, and let it bail if desired
+ if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
+ return;
+ }
+
+ // Determine handlers
+ handlerQueue = jQuery.event.handlers.call( this, event, handlers );
+
+ // Run delegates first; they may want to stop propagation beneath us
+ i = 0;
+ while ( (matched = handlerQueue[ i++ ]) && !event.isPropagationStopped() ) {
+ event.currentTarget = matched.elem;
+
+ j = 0;
+ while ( (handleObj = matched.handlers[ j++ ]) && !event.isImmediatePropagationStopped() ) {
+
+ // Triggered event must either 1) have no namespace, or
+ // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace).
+ if ( !event.namespace_re || event.namespace_re.test( handleObj.namespace ) ) {
+
+ event.handleObj = handleObj;
+ event.data = handleObj.data;
+
+ ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler )
+ .apply( matched.elem, args );
+
+ if ( ret !== undefined ) {
+ if ( (event.result = ret) === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+ }
+ }
+ }
+
+ // Call the postDispatch hook for the mapped type
+ if ( special.postDispatch ) {
+ special.postDispatch.call( this, event );
+ }
+
+ return event.result;
+ },
+
+ handlers: function( event, handlers ) {
+ var sel, handleObj, matches, i,
+ handlerQueue = [],
+ delegateCount = handlers.delegateCount,
+ cur = event.target;
+
+ // Find delegate handlers
+ // Black-hole SVG <use> instance trees (#13180)
+ // Avoid non-left-click bubbling in Firefox (#3861)
+ if ( delegateCount && cur.nodeType && (!event.button || event.type !== "click") ) {
+
+ /* jshint eqeqeq: false */
+ for ( ; cur != this; cur = cur.parentNode || this ) {
+ /* jshint eqeqeq: true */
+
+ // Don't check non-elements (#13208)
+ // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
+ if ( cur.nodeType === 1 && (cur.disabled !== true || event.type !== "click") ) {
+ matches = [];
+ for ( i = 0; i < delegateCount; i++ ) {
+ handleObj = handlers[ i ];
+
+ // Don't conflict with Object.prototype properties (#13203)
+ sel = handleObj.selector + " ";
+
+ if ( matches[ sel ] === undefined ) {
+ matches[ sel ] = handleObj.needsContext ?
+ jQuery( sel, this ).index( cur ) >= 0 :
+ jQuery.find( sel, this, null, [ cur ] ).length;
+ }
+ if ( matches[ sel ] ) {
+ matches.push( handleObj );
+ }
+ }
+ if ( matches.length ) {
+ handlerQueue.push({ elem: cur, handlers: matches });
+ }
+ }
+ }
+ }
+
+ // Add the remaining (directly-bound) handlers
+ if ( delegateCount < handlers.length ) {
+ handlerQueue.push({ elem: this, handlers: handlers.slice( delegateCount ) });
+ }
+
+ return handlerQueue;
+ },
+
+ fix: function( event ) {
+ if ( event[ jQuery.expando ] ) {
+ return event;
+ }
+
+ // Create a writable copy of the event object and normalize some properties
+ var i, prop, copy,
+ type = event.type,
+ originalEvent = event,
+ fixHook = this.fixHooks[ type ];
+
+ if ( !fixHook ) {
+ this.fixHooks[ type ] = fixHook =
+ rmouseEvent.test( type ) ? this.mouseHooks :
+ rkeyEvent.test( type ) ? this.keyHooks :
+ {};
+ }
+ copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props;
+
+ event = new jQuery.Event( originalEvent );
+
+ i = copy.length;
+ while ( i-- ) {
+ prop = copy[ i ];
+ event[ prop ] = originalEvent[ prop ];
+ }
+
+ // Support: IE<9
+ // Fix target property (#1925)
+ if ( !event.target ) {
+ event.target = originalEvent.srcElement || document;
+ }
+
+ // Support: Chrome 23+, Safari?
+ // Target should not be a text node (#504, #13143)
+ if ( event.target.nodeType === 3 ) {
+ event.target = event.target.parentNode;
+ }
+
+ // Support: IE<9
+ // For mouse/key events, metaKey==false if it's undefined (#3368, #11328)
+ event.metaKey = !!event.metaKey;
+
+ return fixHook.filter ? fixHook.filter( event, originalEvent ) : event;
+ },
+
+ // Includes some event props shared by KeyEvent and MouseEvent
+ props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),
+
+ fixHooks: {},
+
+ keyHooks: {
+ props: "char charCode key keyCode".split(" "),
+ filter: function( event, original ) {
+
+ // Add which for key events
+ if ( event.which == null ) {
+ event.which = original.charCode != null ? original.charCode : original.keyCode;
+ }
+
+ return event;
+ }
+ },
+
+ mouseHooks: {
+ props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
+ filter: function( event, original ) {
+ var body, eventDoc, doc,
+ button = original.button,
+ fromElement = original.fromElement;
+
+ // Calculate pageX/Y if missing and clientX/Y available
+ if ( event.pageX == null && original.clientX != null ) {
+ eventDoc = event.target.ownerDocument || document;
+ doc = eventDoc.documentElement;
+ body = eventDoc.body;
+
+ event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 );
+ event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 );
+ }
+
+ // Add relatedTarget, if necessary
+ if ( !event.relatedTarget && fromElement ) {
+ event.relatedTarget = fromElement === event.target ? original.toElement : fromElement;
+ }
+
+ // Add which for click: 1 === left; 2 === middle; 3 === right
+ // Note: button is not normalized, so don't use it
+ if ( !event.which && button !== undefined ) {
+ event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) );
+ }
+
+ return event;
+ }
+ },
+
+ special: {
+ load: {
+ // Prevent triggered image.load events from bubbling to window.load
+ noBubble: true
+ },
+ focus: {
+ // Fire native event if possible so blur/focus sequence is correct
+ trigger: function() {
+ if ( this !== safeActiveElement() && this.focus ) {
+ try {
+ this.focus();
+ return false;
+ } catch ( e ) {
+ // Support: IE<9
+ // If we error on focus to hidden element (#1486, #12518),
+ // let .trigger() run the handlers
+ }
+ }
+ },
+ delegateType: "focusin"
+ },
+ blur: {
+ trigger: function() {
+ if ( this === safeActiveElement() && this.blur ) {
+ this.blur();
+ return false;
+ }
+ },
+ delegateType: "focusout"
+ },
+ click: {
+ // For checkbox, fire native event so checked state will be right
+ trigger: function() {
+ if ( jQuery.nodeName( this, "input" ) && this.type === "checkbox" && this.click ) {
+ this.click();
+ return false;
+ }
+ },
+
+ // For cross-browser consistency, don't fire native .click() on links
+ _default: function( event ) {
+ return jQuery.nodeName( event.target, "a" );
+ }
+ },
+
+ beforeunload: {
+ postDispatch: function( event ) {
+
+ // Even when returnValue equals to undefined Firefox will still show alert
+ if ( event.result !== undefined ) {
+ event.originalEvent.returnValue = event.result;
+ }
+ }
+ }
+ },
+
+ simulate: function( type, elem, event, bubble ) {
+ // Piggyback on a donor event to simulate a different one.
+ // Fake originalEvent to avoid donor's stopPropagation, but if the
+ // simulated event prevents default then we do the same on the donor.
+ var e = jQuery.extend(
+ new jQuery.Event(),
+ event,
+ {
+ type: type,
+ isSimulated: true,
+ originalEvent: {}
+ }
+ );
+ if ( bubble ) {
+ jQuery.event.trigger( e, null, elem );
+ } else {
+ jQuery.event.dispatch.call( elem, e );
+ }
+ if ( e.isDefaultPrevented() ) {
+ event.preventDefault();
+ }
+ }
+};
+
+jQuery.removeEvent = document.removeEventListener ?
+ function( elem, type, handle ) {
+ if ( elem.removeEventListener ) {
+ elem.removeEventListener( type, handle, false );
+ }
+ } :
+ function( elem, type, handle ) {
+ var name = "on" + type;
+
+ if ( elem.detachEvent ) {
+
+ // #8545, #7054, preventing memory leaks for custom events in IE6-8
+ // detachEvent needed property on element, by name of that event, to properly expose it to GC
+ if ( typeof elem[ name ] === strundefined ) {
+ elem[ name ] = null;
+ }
+
+ elem.detachEvent( name, handle );
+ }
+ };
+
+jQuery.Event = function( src, props ) {
+ // Allow instantiation without the 'new' keyword
+ if ( !(this instanceof jQuery.Event) ) {
+ return new jQuery.Event( src, props );
+ }
+
+ // Event object
+ if ( src && src.type ) {
+ this.originalEvent = src;
+ this.type = src.type;
+
+ // Events bubbling up the document may have been marked as prevented
+ // by a handler lower down the tree; reflect the correct value.
+ this.isDefaultPrevented = src.defaultPrevented ||
+ src.defaultPrevented === undefined && (
+ // Support: IE < 9
+ src.returnValue === false ||
+ // Support: Android < 4.0
+ src.getPreventDefault && src.getPreventDefault() ) ?
+ returnTrue :
+ returnFalse;
+
+ // Event type
+ } else {
+ this.type = src;
+ }
+
+ // Put explicitly provided properties onto the event object
+ if ( props ) {
+ jQuery.extend( this, props );
+ }
+
+ // Create a timestamp if incoming event doesn't have one
+ this.timeStamp = src && src.timeStamp || jQuery.now();
+
+ // Mark it as fixed
+ this[ jQuery.expando ] = true;
+};
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse,
+
+ preventDefault: function() {
+ var e = this.originalEvent;
+
+ this.isDefaultPrevented = returnTrue;
+ if ( !e ) {
+ return;
+ }
+
+ // If preventDefault exists, run it on the original event
+ if ( e.preventDefault ) {
+ e.preventDefault();
+
+ // Support: IE
+ // Otherwise set the returnValue property of the original event to false
+ } else {
+ e.returnValue = false;
+ }
+ },
+ stopPropagation: function() {
+ var e = this.originalEvent;
+
+ this.isPropagationStopped = returnTrue;
+ if ( !e ) {
+ return;
+ }
+ // If stopPropagation exists, run it on the original event
+ if ( e.stopPropagation ) {
+ e.stopPropagation();
+ }
+
+ // Support: IE
+ // Set the cancelBubble property of the original event to true
+ e.cancelBubble = true;
+ },
+ stopImmediatePropagation: function() {
+ this.isImmediatePropagationStopped = returnTrue;
+ this.stopPropagation();
+ }
+};
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+jQuery.each({
+ mouseenter: "mouseover",
+ mouseleave: "mouseout"
+}, function( orig, fix ) {
+ jQuery.event.special[ orig ] = {
+ delegateType: fix,
+ bindType: fix,
+
+ handle: function( event ) {
+ var ret,
+ target = this,
+ related = event.relatedTarget,
+ handleObj = event.handleObj;
+
+ // For mousenter/leave call the handler if related is outside the target.
+ // NB: No relatedTarget if the mouse left/entered the browser window
+ if ( !related || (related !== target && !jQuery.contains( target, related )) ) {
+ event.type = handleObj.origType;
+ ret = handleObj.handler.apply( this, arguments );
+ event.type = fix;
+ }
+ return ret;
+ }
+ };
+});
+
+// IE submit delegation
+if ( !support.submitBubbles ) {
+
+ jQuery.event.special.submit = {
+ setup: function() {
+ // Only need this for delegated form submit events
+ if ( jQuery.nodeName( this, "form" ) ) {
+ return false;
+ }
+
+ // Lazy-add a submit handler when a descendant form may potentially be submitted
+ jQuery.event.add( this, "click._submit keypress._submit", function( e ) {
+ // Node name check avoids a VML-related crash in IE (#9807)
+ var elem = e.target,
+ form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined;
+ if ( form && !jQuery._data( form, "submitBubbles" ) ) {
+ jQuery.event.add( form, "submit._submit", function( event ) {
+ event._submit_bubble = true;
+ });
+ jQuery._data( form, "submitBubbles", true );
+ }
+ });
+ // return undefined since we don't need an event listener
+ },
+
+ postDispatch: function( event ) {
+ // If form was submitted by the user, bubble the event up the tree
+ if ( event._submit_bubble ) {
+ delete event._submit_bubble;
+ if ( this.parentNode && !event.isTrigger ) {
+ jQuery.event.simulate( "submit", this.parentNode, event, true );
+ }
+ }
+ },
+
+ teardown: function() {
+ // Only need this for delegated form submit events
+ if ( jQuery.nodeName( this, "form" ) ) {
+ return false;
+ }
+
+ // Remove delegated handlers; cleanData eventually reaps submit handlers attached above
+ jQuery.event.remove( this, "._submit" );
+ }
+ };
+}
+
+// IE change delegation and checkbox/radio fix
+if ( !support.changeBubbles ) {
+
+ jQuery.event.special.change = {
+
+ setup: function() {
+
+ if ( rformElems.test( this.nodeName ) ) {
+ // IE doesn't fire change on a check/radio until blur; trigger it on click
+ // after a propertychange. Eat the blur-change in special.change.handle.
+ // This still fires onchange a second time for check/radio after blur.
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ jQuery.event.add( this, "propertychange._change", function( event ) {
+ if ( event.originalEvent.propertyName === "checked" ) {
+ this._just_changed = true;
+ }
+ });
+ jQuery.event.add( this, "click._change", function( event ) {
+ if ( this._just_changed && !event.isTrigger ) {
+ this._just_changed = false;
+ }
+ // Allow triggered, simulated change events (#11500)
+ jQuery.event.simulate( "change", this, event, true );
+ });
+ }
+ return false;
+ }
+ // Delegated event; lazy-add a change handler on descendant inputs
+ jQuery.event.add( this, "beforeactivate._change", function( e ) {
+ var elem = e.target;
+
+ if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "changeBubbles" ) ) {
+ jQuery.event.add( elem, "change._change", function( event ) {
+ if ( this.parentNode && !event.isSimulated && !event.isTrigger ) {
+ jQuery.event.simulate( "change", this.parentNode, event, true );
+ }
+ });
+ jQuery._data( elem, "changeBubbles", true );
+ }
+ });
+ },
+
+ handle: function( event ) {
+ var elem = event.target;
+
+ // Swallow native change events from checkbox/radio, we already triggered them above
+ if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) {
+ return event.handleObj.handler.apply( this, arguments );
+ }
+ },
+
+ teardown: function() {
+ jQuery.event.remove( this, "._change" );
+
+ return !rformElems.test( this.nodeName );
+ }
+ };
+}
+
+// Create "bubbling" focus and blur events
+if ( !support.focusinBubbles ) {
+ jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+
+ // Attach a single capturing handler on the document while someone wants focusin/focusout
+ var handler = function( event ) {
+ jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true );
+ };
+
+ jQuery.event.special[ fix ] = {
+ setup: function() {
+ var doc = this.ownerDocument || this,
+ attaches = jQuery._data( doc, fix );
+
+ if ( !attaches ) {
+ doc.addEventListener( orig, handler, true );
+ }
+ jQuery._data( doc, fix, ( attaches || 0 ) + 1 );
+ },
+ teardown: function() {
+ var doc = this.ownerDocument || this,
+ attaches = jQuery._data( doc, fix ) - 1;
+
+ if ( !attaches ) {
+ doc.removeEventListener( orig, handler, true );
+ jQuery._removeData( doc, fix );
+ } else {
+ jQuery._data( doc, fix, attaches );
+ }
+ }
+ };
+ });
+}
+
+jQuery.fn.extend({
+
+ on: function( types, selector, data, fn, /*INTERNAL*/ one ) {
+ var type, origFn;
+
+ // Types can be a map of types/handlers
+ if ( typeof types === "object" ) {
+ // ( types-Object, selector, data )
+ if ( typeof selector !== "string" ) {
+ // ( types-Object, data )
+ data = data || selector;
+ selector = undefined;
+ }
+ for ( type in types ) {
+ this.on( type, selector, data, types[ type ], one );
+ }
+ return this;
+ }
+
+ if ( data == null && fn == null ) {
+ // ( types, fn )
+ fn = selector;
+ data = selector = undefined;
+ } else if ( fn == null ) {
+ if ( typeof selector === "string" ) {
+ // ( types, selector, fn )
+ fn = data;
+ data = undefined;
+ } else {
+ // ( types, data, fn )
+ fn = data;
+ data = selector;
+ selector = undefined;
+ }
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ } else if ( !fn ) {
+ return this;
+ }
+
+ if ( one === 1 ) {
+ origFn = fn;
+ fn = function( event ) {
+ // Can use an empty set, since event contains the info
+ jQuery().off( event );
+ return origFn.apply( this, arguments );
+ };
+ // Use same guid so caller can remove using origFn
+ fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+ }
+ return this.each( function() {
+ jQuery.event.add( this, types, fn, data, selector );
+ });
+ },
+ one: function( types, selector, data, fn ) {
+ return this.on( types, selector, data, fn, 1 );
+ },
+ off: function( types, selector, fn ) {
+ var handleObj, type;
+ if ( types && types.preventDefault && types.handleObj ) {
+ // ( event ) dispatched jQuery.Event
+ handleObj = types.handleObj;
+ jQuery( types.delegateTarget ).off(
+ handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType,
+ handleObj.selector,
+ handleObj.handler
+ );
+ return this;
+ }
+ if ( typeof types === "object" ) {
+ // ( types-object [, selector] )
+ for ( type in types ) {
+ this.off( type, selector, types[ type ] );
+ }
+ return this;
+ }
+ if ( selector === false || typeof selector === "function" ) {
+ // ( types [, fn] )
+ fn = selector;
+ selector = undefined;
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ }
+ return this.each(function() {
+ jQuery.event.remove( this, types, fn, selector );
+ });
+ },
+
+ trigger: function( type, data ) {
+ return this.each(function() {
+ jQuery.event.trigger( type, data, this );
+ });
+ },
+ triggerHandler: function( type, data ) {
+ var elem = this[0];
+ if ( elem ) {
+ return jQuery.event.trigger( type, data, elem, true );
+ }
+ }
+});
+
+
+function createSafeFragment( document ) {
+ var list = nodeNames.split( "|" ),
+ safeFrag = document.createDocumentFragment();
+
+ if ( safeFrag.createElement ) {
+ while ( list.length ) {
+ safeFrag.createElement(
+ list.pop()
+ );
+ }
+ }
+ return safeFrag;
+}
+
+var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" +
+ "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",
+ rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g,
+ rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"),
+ rleadingWhitespace = /^\s+/,
+ rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,
+ rtagName = /<([\w:]+)/,
+ rtbody = /<tbody/i,
+ rhtml = /<|&#?\w+;/,
+ rnoInnerhtml = /<(?:script|style|link)/i,
+ // checked="checked" or checked
+ rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+ rscriptType = /^$|\/(?:java|ecma)script/i,
+ rscriptTypeMasked = /^true\/(.*)/,
+ rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,
+
+ // We have to close these tags to support XHTML (#13200)
+ wrapMap = {
+ option: [ 1, "<select multiple='multiple'>", "</select>" ],
+ legend: [ 1, "<fieldset>", "</fieldset>" ],
+ area: [ 1, "<map>", "</map>" ],
+ param: [ 1, "<object>", "</object>" ],
+ thead: [ 1, "<table>", "</table>" ],
+ tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+ col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+ td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+
+ // IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags,
+ // unless wrapped in a div with non-breaking characters in front of it.
+ _default: support.htmlSerialize ? [ 0, "", "" ] : [ 1, "X<div>", "</div>" ]
+ },
+ safeFragment = createSafeFragment( document ),
+ fragmentDiv = safeFragment.appendChild( document.createElement("div") );
+
+wrapMap.optgroup = wrapMap.option;
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+function getAll( context, tag ) {
+ var elems, elem,
+ i = 0,
+ found = typeof context.getElementsByTagName !== strundefined ? context.getElementsByTagName( tag || "*" ) :
+ typeof context.querySelectorAll !== strundefined ? context.querySelectorAll( tag || "*" ) :
+ undefined;
+
+ if ( !found ) {
+ for ( found = [], elems = context.childNodes || context; (elem = elems[i]) != null; i++ ) {
+ if ( !tag || jQuery.nodeName( elem, tag ) ) {
+ found.push( elem );
+ } else {
+ jQuery.merge( found, getAll( elem, tag ) );
+ }
+ }
+ }
+
+ return tag === undefined || tag && jQuery.nodeName( context, tag ) ?
+ jQuery.merge( [ context ], found ) :
+ found;
+}
+
+// Used in buildFragment, fixes the defaultChecked property
+function fixDefaultChecked( elem ) {
+ if ( rcheckableType.test( elem.type ) ) {
+ elem.defaultChecked = elem.checked;
+ }
+}
+
+// Support: IE<8
+// Manipulating tables requires a tbody
+function manipulationTarget( elem, content ) {
+ return jQuery.nodeName( elem, "table" ) &&
+ jQuery.nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ?
+
+ elem.getElementsByTagName("tbody")[0] ||
+ elem.appendChild( elem.ownerDocument.createElement("tbody") ) :
+ elem;
+}
+
+// Replace/restore the type attribute of script elements for safe DOM manipulation
+function disableScript( elem ) {
+ elem.type = (jQuery.find.attr( elem, "type" ) !== null) + "/" + elem.type;
+ return elem;
+}
+function restoreScript( elem ) {
+ var match = rscriptTypeMasked.exec( elem.type );
+ if ( match ) {
+ elem.type = match[1];
+ } else {
+ elem.removeAttribute("type");
+ }
+ return elem;
+}
+
+// Mark scripts as having already been evaluated
+function setGlobalEval( elems, refElements ) {
+ var elem,
+ i = 0;
+ for ( ; (elem = elems[i]) != null; i++ ) {
+ jQuery._data( elem, "globalEval", !refElements || jQuery._data( refElements[i], "globalEval" ) );
+ }
+}
+
+function cloneCopyEvent( src, dest ) {
+
+ if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
+ return;
+ }
+
+ var type, i, l,
+ oldData = jQuery._data( src ),
+ curData = jQuery._data( dest, oldData ),
+ events = oldData.events;
+
+ if ( events ) {
+ delete curData.handle;
+ curData.events = {};
+
+ for ( type in events ) {
+ for ( i = 0, l = events[ type ].length; i < l; i++ ) {
+ jQuery.event.add( dest, type, events[ type ][ i ] );
+ }
+ }
+ }
+
+ // make the cloned public data object a copy from the original
+ if ( curData.data ) {
+ curData.data = jQuery.extend( {}, curData.data );
+ }
+}
+
+function fixCloneNodeIssues( src, dest ) {
+ var nodeName, e, data;
+
+ // We do not need to do anything for non-Elements
+ if ( dest.nodeType !== 1 ) {
+ return;
+ }
+
+ nodeName = dest.nodeName.toLowerCase();
+
+ // IE6-8 copies events bound via attachEvent when using cloneNode.
+ if ( !support.noCloneEvent && dest[ jQuery.expando ] ) {
+ data = jQuery._data( dest );
+
+ for ( e in data.events ) {
+ jQuery.removeEvent( dest, e, data.handle );
+ }
+
+ // Event data gets referenced instead of copied if the expando gets copied too
+ dest.removeAttribute( jQuery.expando );
+ }
+
+ // IE blanks contents when cloning scripts, and tries to evaluate newly-set text
+ if ( nodeName === "script" && dest.text !== src.text ) {
+ disableScript( dest ).text = src.text;
+ restoreScript( dest );
+
+ // IE6-10 improperly clones children of object elements using classid.
+ // IE10 throws NoModificationAllowedError if parent is null, #12132.
+ } else if ( nodeName === "object" ) {
+ if ( dest.parentNode ) {
+ dest.outerHTML = src.outerHTML;
+ }
+
+ // This path appears unavoidable for IE9. When cloning an object
+ // element in IE9, the outerHTML strategy above is not sufficient.
+ // If the src has innerHTML and the destination does not,
+ // copy the src.innerHTML into the dest.innerHTML. #10324
+ if ( support.html5Clone && ( src.innerHTML && !jQuery.trim(dest.innerHTML) ) ) {
+ dest.innerHTML = src.innerHTML;
+ }
+
+ } else if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
+ // IE6-8 fails to persist the checked state of a cloned checkbox
+ // or radio button. Worse, IE6-7 fail to give the cloned element
+ // a checked appearance if the defaultChecked value isn't also set
+
+ dest.defaultChecked = dest.checked = src.checked;
+
+ // IE6-7 get confused and end up setting the value of a cloned
+ // checkbox/radio button to an empty string instead of "on"
+ if ( dest.value !== src.value ) {
+ dest.value = src.value;
+ }
+
+ // IE6-8 fails to return the selected option to the default selected
+ // state when cloning options
+ } else if ( nodeName === "option" ) {
+ dest.defaultSelected = dest.selected = src.defaultSelected;
+
+ // IE6-8 fails to set the defaultValue to the correct value when
+ // cloning other types of input fields
+ } else if ( nodeName === "input" || nodeName === "textarea" ) {
+ dest.defaultValue = src.defaultValue;
+ }
+}
+
+jQuery.extend({
+ clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+ var destElements, node, clone, i, srcElements,
+ inPage = jQuery.contains( elem.ownerDocument, elem );
+
+ if ( support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) {
+ clone = elem.cloneNode( true );
+
+ // IE<=8 does not properly clone detached, unknown element nodes
+ } else {
+ fragmentDiv.innerHTML = elem.outerHTML;
+ fragmentDiv.removeChild( clone = fragmentDiv.firstChild );
+ }
+
+ if ( (!support.noCloneEvent || !support.noCloneChecked) &&
+ (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
+
+ // We eschew Sizzle here for performance reasons: http://jsperf.com/getall-vs-sizzle/2
+ destElements = getAll( clone );
+ srcElements = getAll( elem );
+
+ // Fix all IE cloning issues
+ for ( i = 0; (node = srcElements[i]) != null; ++i ) {
+ // Ensure that the destination node is not null; Fixes #9587
+ if ( destElements[i] ) {
+ fixCloneNodeIssues( node, destElements[i] );
+ }
+ }
+ }
+
+ // Copy the events from the original to the clone
+ if ( dataAndEvents ) {
+ if ( deepDataAndEvents ) {
+ srcElements = srcElements || getAll( elem );
+ destElements = destElements || getAll( clone );
+
+ for ( i = 0; (node = srcElements[i]) != null; i++ ) {
+ cloneCopyEvent( node, destElements[i] );
+ }
+ } else {
+ cloneCopyEvent( elem, clone );
+ }
+ }
+
+ // Preserve script evaluation history
+ destElements = getAll( clone, "script" );
+ if ( destElements.length > 0 ) {
+ setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
+ }
+
+ destElements = srcElements = node = null;
+
+ // Return the cloned set
+ return clone;
+ },
+
+ buildFragment: function( elems, context, scripts, selection ) {
+ var j, elem, contains,
+ tmp, tag, tbody, wrap,
+ l = elems.length,
+
+ // Ensure a safe fragment
+ safe = createSafeFragment( context ),
+
+ nodes = [],
+ i = 0;
+
+ for ( ; i < l; i++ ) {
+ elem = elems[ i ];
+
+ if ( elem || elem === 0 ) {
+
+ // Add nodes directly
+ if ( jQuery.type( elem ) === "object" ) {
+ jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
+
+ // Convert non-html into a text node
+ } else if ( !rhtml.test( elem ) ) {
+ nodes.push( context.createTextNode( elem ) );
+
+ // Convert html into DOM nodes
+ } else {
+ tmp = tmp || safe.appendChild( context.createElement("div") );
+
+ // Deserialize a standard representation
+ tag = (rtagName.exec( elem ) || [ "", "" ])[ 1 ].toLowerCase();
+ wrap = wrapMap[ tag ] || wrapMap._default;
+
+ tmp.innerHTML = wrap[1] + elem.replace( rxhtmlTag, "<$1></$2>" ) + wrap[2];
+
+ // Descend through wrappers to the right content
+ j = wrap[0];
+ while ( j-- ) {
+ tmp = tmp.lastChild;
+ }
+
+ // Manually add leading whitespace removed by IE
+ if ( !support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+ nodes.push( context.createTextNode( rleadingWhitespace.exec( elem )[0] ) );
+ }
+
+ // Remove IE's autoinserted <tbody> from table fragments
+ if ( !support.tbody ) {
+
+ // String was a <table>, *may* have spurious <tbody>
+ elem = tag === "table" && !rtbody.test( elem ) ?
+ tmp.firstChild :
+
+ // String was a bare <thead> or <tfoot>
+ wrap[1] === "<table>" && !rtbody.test( elem ) ?
+ tmp :
+ 0;
+
+ j = elem && elem.childNodes.length;
+ while ( j-- ) {
+ if ( jQuery.nodeName( (tbody = elem.childNodes[j]), "tbody" ) && !tbody.childNodes.length ) {
+ elem.removeChild( tbody );
+ }
+ }
+ }
+
+ jQuery.merge( nodes, tmp.childNodes );
+
+ // Fix #12392 for WebKit and IE > 9
+ tmp.textContent = "";
+
+ // Fix #12392 for oldIE
+ while ( tmp.firstChild ) {
+ tmp.removeChild( tmp.firstChild );
+ }
+
+ // Remember the top-level container for proper cleanup
+ tmp = safe.lastChild;
+ }
+ }
+ }
+
+ // Fix #11356: Clear elements from fragment
+ if ( tmp ) {
+ safe.removeChild( tmp );
+ }
+
+ // Reset defaultChecked for any radios and checkboxes
+ // about to be appended to the DOM in IE 6/7 (#8060)
+ if ( !support.appendChecked ) {
+ jQuery.grep( getAll( nodes, "input" ), fixDefaultChecked );
+ }
+
+ i = 0;
+ while ( (elem = nodes[ i++ ]) ) {
+
+ // #4087 - If origin and destination elements are the same, and this is
+ // that element, do not do anything
+ if ( selection && jQuery.inArray( elem, selection ) !== -1 ) {
+ continue;
+ }
+
+ contains = jQuery.contains( elem.ownerDocument, elem );
+
+ // Append to fragment
+ tmp = getAll( safe.appendChild( elem ), "script" );
+
+ // Preserve script evaluation history
+ if ( contains ) {
+ setGlobalEval( tmp );
+ }
+
+ // Capture executables
+ if ( scripts ) {
+ j = 0;
+ while ( (elem = tmp[ j++ ]) ) {
+ if ( rscriptType.test( elem.type || "" ) ) {
+ scripts.push( elem );
+ }
+ }
+ }
+ }
+
+ tmp = null;
+
+ return safe;
+ },
+
+ cleanData: function( elems, /* internal */ acceptData ) {
+ var elem, type, id, data,
+ i = 0,
+ internalKey = jQuery.expando,
+ cache = jQuery.cache,
+ deleteExpando = support.deleteExpando,
+ special = jQuery.event.special;
+
+ for ( ; (elem = elems[i]) != null; i++ ) {
+ if ( acceptData || jQuery.acceptData( elem ) ) {
+
+ id = elem[ internalKey ];
+ data = id && cache[ id ];
+
+ if ( data ) {
+ if ( data.events ) {
+ for ( type in data.events ) {
+ if ( special[ type ] ) {
+ jQuery.event.remove( elem, type );
+
+ // This is a shortcut to avoid jQuery.event.remove's overhead
+ } else {
+ jQuery.removeEvent( elem, type, data.handle );
+ }
+ }
+ }
+
+ // Remove cache only if it was not already removed by jQuery.event.remove
+ if ( cache[ id ] ) {
+
+ delete cache[ id ];
+
+ // IE does not allow us to delete expando properties from nodes,
+ // nor does it have a removeAttribute function on Document nodes;
+ // we must handle all of these cases
+ if ( deleteExpando ) {
+ delete elem[ internalKey ];
+
+ } else if ( typeof elem.removeAttribute !== strundefined ) {
+ elem.removeAttribute( internalKey );
+
+ } else {
+ elem[ internalKey ] = null;
+ }
+
+ deletedIds.push( id );
+ }
+ }
+ }
+ }
+ }
+});
+
+jQuery.fn.extend({
+ text: function( value ) {
+ return access( this, function( value ) {
+ return value === undefined ?
+ jQuery.text( this ) :
+ this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) );
+ }, null, value, arguments.length );
+ },
+
+ append: function() {
+ return this.domManip( arguments, function( elem ) {
+ if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+ var target = manipulationTarget( this, elem );
+ target.appendChild( elem );
+ }
+ });
+ },
+
+ prepend: function() {
+ return this.domManip( arguments, function( elem ) {
+ if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+ var target = manipulationTarget( this, elem );
+ target.insertBefore( elem, target.firstChild );
+ }
+ });
+ },
+
+ before: function() {
+ return this.domManip( arguments, function( elem ) {
+ if ( this.parentNode ) {
+ this.parentNode.insertBefore( elem, this );
+ }
+ });
+ },
+
+ after: function() {
+ return this.domManip( arguments, function( elem ) {
+ if ( this.parentNode ) {
+ this.parentNode.insertBefore( elem, this.nextSibling );
+ }
+ });
+ },
+
+ remove: function( selector, keepData /* Internal Use Only */ ) {
+ var elem,
+ elems = selector ? jQuery.filter( selector, this ) : this,
+ i = 0;
+
+ for ( ; (elem = elems[i]) != null; i++ ) {
+
+ if ( !keepData && elem.nodeType === 1 ) {
+ jQuery.cleanData( getAll( elem ) );
+ }
+
+ if ( elem.parentNode ) {
+ if ( keepData && jQuery.contains( elem.ownerDocument, elem ) ) {
+ setGlobalEval( getAll( elem, "script" ) );
+ }
+ elem.parentNode.removeChild( elem );
+ }
+ }
+
+ return this;
+ },
+
+ empty: function() {
+ var elem,
+ i = 0;
+
+ for ( ; (elem = this[i]) != null; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( getAll( elem, false ) );
+ }
+
+ // Remove any remaining nodes
+ while ( elem.firstChild ) {
+ elem.removeChild( elem.firstChild );
+ }
+
+ // If this is a select, ensure that it displays empty (#12336)
+ // Support: IE<9
+ if ( elem.options && jQuery.nodeName( elem, "select" ) ) {
+ elem.options.length = 0;
+ }
+ }
+
+ return this;
+ },
+
+ clone: function( dataAndEvents, deepDataAndEvents ) {
+ dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+ deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+ return this.map(function() {
+ return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+ });
+ },
+
+ html: function( value ) {
+ return access( this, function( value ) {
+ var elem = this[ 0 ] || {},
+ i = 0,
+ l = this.length;
+
+ if ( value === undefined ) {
+ return elem.nodeType === 1 ?
+ elem.innerHTML.replace( rinlinejQuery, "" ) :
+ undefined;
+ }
+
+ // See if we can take a shortcut and just use innerHTML
+ if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
+ ( support.htmlSerialize || !rnoshimcache.test( value ) ) &&
+ ( support.leadingWhitespace || !rleadingWhitespace.test( value ) ) &&
+ !wrapMap[ (rtagName.exec( value ) || [ "", "" ])[ 1 ].toLowerCase() ] ) {
+
+ value = value.replace( rxhtmlTag, "<$1></$2>" );
+
+ try {
+ for (; i < l; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ elem = this[i] || {};
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( getAll( elem, false ) );
+ elem.innerHTML = value;
+ }
+ }
+
+ elem = 0;
+
+ // If using innerHTML throws an exception, use the fallback method
+ } catch(e) {}
+ }
+
+ if ( elem ) {
+ this.empty().append( value );
+ }
+ }, null, value, arguments.length );
+ },
+
+ replaceWith: function() {
+ var arg = arguments[ 0 ];
+
+ // Make the changes, replacing each context element with the new content
+ this.domManip( arguments, function( elem ) {
+ arg = this.parentNode;
+
+ jQuery.cleanData( getAll( this ) );
+
+ if ( arg ) {
+ arg.replaceChild( elem, this );
+ }
+ });
+
+ // Force removal if there was no new content (e.g., from empty arguments)
+ return arg && (arg.length || arg.nodeType) ? this : this.remove();
+ },
+
+ detach: function( selector ) {
+ return this.remove( selector, true );
+ },
+
+ domManip: function( args, callback ) {
+
+ // Flatten any nested arrays
+ args = concat.apply( [], args );
+
+ var first, node, hasScripts,
+ scripts, doc, fragment,
+ i = 0,
+ l = this.length,
+ set = this,
+ iNoClone = l - 1,
+ value = args[0],
+ isFunction = jQuery.isFunction( value );
+
+ // We can't cloneNode fragments that contain checked, in WebKit
+ if ( isFunction ||
+ ( l > 1 && typeof value === "string" &&
+ !support.checkClone && rchecked.test( value ) ) ) {
+ return this.each(function( index ) {
+ var self = set.eq( index );
+ if ( isFunction ) {
+ args[0] = value.call( this, index, self.html() );
+ }
+ self.domManip( args, callback );
+ });
+ }
+
+ if ( l ) {
+ fragment = jQuery.buildFragment( args, this[ 0 ].ownerDocument, false, this );
+ first = fragment.firstChild;
+
+ if ( fragment.childNodes.length === 1 ) {
+ fragment = first;
+ }
+
+ if ( first ) {
+ scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
+ hasScripts = scripts.length;
+
+ // Use the original fragment for the last item instead of the first because it can end up
+ // being emptied incorrectly in certain situations (#8070).
+ for ( ; i < l; i++ ) {
+ node = fragment;
+
+ if ( i !== iNoClone ) {
+ node = jQuery.clone( node, true, true );
+
+ // Keep references to cloned scripts for later restoration
+ if ( hasScripts ) {
+ jQuery.merge( scripts, getAll( node, "script" ) );
+ }
+ }
+
+ callback.call( this[i], node, i );
+ }
+
+ if ( hasScripts ) {
+ doc = scripts[ scripts.length - 1 ].ownerDocument;
+
+ // Reenable scripts
+ jQuery.map( scripts, restoreScript );
+
+ // Evaluate executable scripts on first document insertion
+ for ( i = 0; i < hasScripts; i++ ) {
+ node = scripts[ i ];
+ if ( rscriptType.test( node.type || "" ) &&
+ !jQuery._data( node, "globalEval" ) && jQuery.contains( doc, node ) ) {
+
+ if ( node.src ) {
+ // Optional AJAX dependency, but won't run scripts if not present
+ if ( jQuery._evalUrl ) {
+ jQuery._evalUrl( node.src );
+ }
+ } else {
+ jQuery.globalEval( ( node.text || node.textContent || node.innerHTML || "" ).replace( rcleanScript, "" ) );
+ }
+ }
+ }
+ }
+
+ // Fix #11809: Avoid leaking memory
+ fragment = first = null;
+ }
+ }
+
+ return this;
+ }
+});
+
+jQuery.each({
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+}, function( name, original ) {
+ jQuery.fn[ name ] = function( selector ) {
+ var elems,
+ i = 0,
+ ret = [],
+ insert = jQuery( selector ),
+ last = insert.length - 1;
+
+ for ( ; i <= last; i++ ) {
+ elems = i === last ? this : this.clone(true);
+ jQuery( insert[i] )[ original ]( elems );
+
+ // Modern browsers can apply jQuery collections as arrays, but oldIE needs a .get()
+ push.apply( ret, elems.get() );
+ }
+
+ return this.pushStack( ret );
+ };
+});
+
+
+var iframe,
+ elemdisplay = {};
+
+/**
+ * Retrieve the actual display of a element
+ * @param {String} name nodeName of the element
+ * @param {Object} doc Document object
+ */
+// Called only from within defaultDisplay
+function actualDisplay( name, doc ) {
+ var elem = jQuery( doc.createElement( name ) ).appendTo( doc.body ),
+
+ // getDefaultComputedStyle might be reliably used only on attached element
+ display = window.getDefaultComputedStyle ?
+
+ // Use of this method is a temporary fix (more like optmization) until something better comes along,
+ // since it was removed from specification and supported only in FF
+ window.getDefaultComputedStyle( elem[ 0 ] ).display : jQuery.css( elem[ 0 ], "display" );
+
+ // We don't have any data stored on the element,
+ // so use "detach" method as fast way to get rid of the element
+ elem.detach();
+
+ return display;
+}
+
+/**
+ * Try to determine the default display value of an element
+ * @param {String} nodeName
+ */
+function defaultDisplay( nodeName ) {
+ var doc = document,
+ display = elemdisplay[ nodeName ];
+
+ if ( !display ) {
+ display = actualDisplay( nodeName, doc );
+
+ // If the simple way fails, read from inside an iframe
+ if ( display === "none" || !display ) {
+
+ // Use the already-created iframe if possible
+ iframe = (iframe || jQuery( "<iframe frameborder='0' width='0' height='0'/>" )).appendTo( doc.documentElement );
+
+ // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse
+ doc = ( iframe[ 0 ].contentWindow || iframe[ 0 ].contentDocument ).document;
+
+ // Support: IE
+ doc.write();
+ doc.close();
+
+ display = actualDisplay( nodeName, doc );
+ iframe.detach();
+ }
+
+ // Store the correct default display
+ elemdisplay[ nodeName ] = display;
+ }
+
+ return display;
+}
+
+
+(function() {
+ var a, shrinkWrapBlocksVal,
+ div = document.createElement( "div" ),
+ divReset =
+ "-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;" +
+ "display:block;padding:0;margin:0;border:0";
+
+ // Setup
+ div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
+ a = div.getElementsByTagName( "a" )[ 0 ];
+
+ a.style.cssText = "float:left;opacity:.5";
+
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ // Use a regex to work around a WebKit issue. See #5145
+ support.opacity = /^0.5/.test( a.style.opacity );
+
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ support.cssFloat = !!a.style.cssFloat;
+
+ div.style.backgroundClip = "content-box";
+ div.cloneNode( true ).style.backgroundClip = "";
+ support.clearCloneStyle = div.style.backgroundClip === "content-box";
+
+ // Null elements to avoid leaks in IE.
+ a = div = null;
+
+ support.shrinkWrapBlocks = function() {
+ var body, container, div, containerStyles;
+
+ if ( shrinkWrapBlocksVal == null ) {
+ body = document.getElementsByTagName( "body" )[ 0 ];
+ if ( !body ) {
+ // Test fired too early or in an unsupported environment, exit.
+ return;
+ }
+
+ containerStyles = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px";
+ container = document.createElement( "div" );
+ div = document.createElement( "div" );
+
+ body.appendChild( container ).appendChild( div );
+
+ // Will be changed later if needed.
+ shrinkWrapBlocksVal = false;
+
+ if ( typeof div.style.zoom !== strundefined ) {
+ // Support: IE6
+ // Check if elements with layout shrink-wrap their children
+ div.style.cssText = divReset + ";width:1px;padding:1px;zoom:1";
+ div.innerHTML = "<div></div>";
+ div.firstChild.style.width = "5px";
+ shrinkWrapBlocksVal = div.offsetWidth !== 3;
+ }
+
+ body.removeChild( container );
+
+ // Null elements to avoid leaks in IE.
+ body = container = div = null;
+ }
+
+ return shrinkWrapBlocksVal;
+ };
+
+})();
+var rmargin = (/^margin/);
+
+var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" );
+
+
+
+var getStyles, curCSS,
+ rposition = /^(top|right|bottom|left)$/;
+
+if ( window.getComputedStyle ) {
+ getStyles = function( elem ) {
+ return elem.ownerDocument.defaultView.getComputedStyle( elem, null );
+ };
+
+ curCSS = function( elem, name, computed ) {
+ var width, minWidth, maxWidth, ret,
+ style = elem.style;
+
+ computed = computed || getStyles( elem );
+
+ // getPropertyValue is only needed for .css('filter') in IE9, see #12537
+ ret = computed ? computed.getPropertyValue( name ) || computed[ name ] : undefined;
+
+ if ( computed ) {
+
+ if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) {
+ ret = jQuery.style( elem, name );
+ }
+
+ // A tribute to the "awesome hack by Dean Edwards"
+ // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right
+ // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels
+ // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values
+ if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) {
+
+ // Remember the original values
+ width = style.width;
+ minWidth = style.minWidth;
+ maxWidth = style.maxWidth;
+
+ // Put in the new values to get a computed value out
+ style.minWidth = style.maxWidth = style.width = ret;
+ ret = computed.width;
+
+ // Revert the changed values
+ style.width = width;
+ style.minWidth = minWidth;
+ style.maxWidth = maxWidth;
+ }
+ }
+
+ // Support: IE
+ // IE returns zIndex value as an integer.
+ return ret === undefined ?
+ ret :
+ ret + "";
+ };
+} else if ( document.documentElement.currentStyle ) {
+ getStyles = function( elem ) {
+ return elem.currentStyle;
+ };
+
+ curCSS = function( elem, name, computed ) {
+ var left, rs, rsLeft, ret,
+ style = elem.style;
+
+ computed = computed || getStyles( elem );
+ ret = computed ? computed[ name ] : undefined;
+
+ // Avoid setting ret to empty string here
+ // so we don't default to auto
+ if ( ret == null && style && style[ name ] ) {
+ ret = style[ name ];
+ }
+
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ // but not position css attributes, as those are proportional to the parent element instead
+ // and we can't measure the parent instead because it might trigger a "stacking dolls" problem
+ if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) {
+
+ // Remember the original values
+ left = style.left;
+ rs = elem.runtimeStyle;
+ rsLeft = rs && rs.left;
+
+ // Put in the new values to get a computed value out
+ if ( rsLeft ) {
+ rs.left = elem.currentStyle.left;
+ }
+ style.left = name === "fontSize" ? "1em" : ret;
+ ret = style.pixelLeft + "px";
+
+ // Revert the changed values
+ style.left = left;
+ if ( rsLeft ) {
+ rs.left = rsLeft;
+ }
+ }
+
+ // Support: IE
+ // IE returns zIndex value as an integer.
+ return ret === undefined ?
+ ret :
+ ret + "" || "auto";
+ };
+}
+
+
+
+
+function addGetHookIf( conditionFn, hookFn ) {
+ // Define the hook, we'll check on the first run if it's really needed.
+ return {
+ get: function() {
+ var condition = conditionFn();
+
+ if ( condition == null ) {
+ // The test was not ready at this point; screw the hook this time
+ // but check again when needed next time.
+ return;
+ }
+
+ if ( condition ) {
+ // Hook not needed (or it's not possible to use it due to missing dependency),
+ // remove it.
+ // Since there are no other hooks for marginRight, remove the whole object.
+ delete this.get;
+ return;
+ }
+
+ // Hook needed; redefine it so that the support test is not executed again.
+
+ return (this.get = hookFn).apply( this, arguments );
+ }
+ };
+}
+
+
+(function() {
+ var a, reliableHiddenOffsetsVal, boxSizingVal, boxSizingReliableVal,
+ pixelPositionVal, reliableMarginRightVal,
+ div = document.createElement( "div" ),
+ containerStyles = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px",
+ divReset =
+ "-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;" +
+ "display:block;padding:0;margin:0;border:0";
+
+ // Setup
+ div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
+ a = div.getElementsByTagName( "a" )[ 0 ];
+
+ a.style.cssText = "float:left;opacity:.5";
+
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ // Use a regex to work around a WebKit issue. See #5145
+ support.opacity = /^0.5/.test( a.style.opacity );
+
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ support.cssFloat = !!a.style.cssFloat;
+
+ div.style.backgroundClip = "content-box";
+ div.cloneNode( true ).style.backgroundClip = "";
+ support.clearCloneStyle = div.style.backgroundClip === "content-box";
+
+ // Null elements to avoid leaks in IE.
+ a = div = null;
+
+ jQuery.extend(support, {
+ reliableHiddenOffsets: function() {
+ if ( reliableHiddenOffsetsVal != null ) {
+ return reliableHiddenOffsetsVal;
+ }
+
+ var container, tds, isSupported,
+ div = document.createElement( "div" ),
+ body = document.getElementsByTagName( "body" )[ 0 ];
+
+ if ( !body ) {
+ // Return for frameset docs that don't have a body
+ return;
+ }
+
+ // Setup
+ div.setAttribute( "className", "t" );
+ div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
+
+ container = document.createElement( "div" );
+ container.style.cssText = containerStyles;
+
+ body.appendChild( container ).appendChild( div );
+
+ // Support: IE8
+ // Check if table cells still have offsetWidth/Height when they are set
+ // to display:none and there are still other visible table cells in a
+ // table row; if so, offsetWidth/Height are not reliable for use when
+ // determining if an element has been hidden directly using
+ // display:none (it is still safe to use offsets if a parent element is
+ // hidden; don safety goggles and see bug #4512 for more information).
+ div.innerHTML = "<table><tr><td></td><td>t</td></tr></table>";
+ tds = div.getElementsByTagName( "td" );
+ tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none";
+ isSupported = ( tds[ 0 ].offsetHeight === 0 );
+
+ tds[ 0 ].style.display = "";
+ tds[ 1 ].style.display = "none";
+
+ // Support: IE8
+ // Check if empty table cells still have offsetWidth/Height
+ reliableHiddenOffsetsVal = isSupported && ( tds[ 0 ].offsetHeight === 0 );
+
+ body.removeChild( container );
+
+ // Null elements to avoid leaks in IE.
+ div = body = null;
+
+ return reliableHiddenOffsetsVal;
+ },
+
+ boxSizing: function() {
+ if ( boxSizingVal == null ) {
+ computeStyleTests();
+ }
+ return boxSizingVal;
+ },
+
+ boxSizingReliable: function() {
+ if ( boxSizingReliableVal == null ) {
+ computeStyleTests();
+ }
+ return boxSizingReliableVal;
+ },
+
+ pixelPosition: function() {
+ if ( pixelPositionVal == null ) {
+ computeStyleTests();
+ }
+ return pixelPositionVal;
+ },
+
+ reliableMarginRight: function() {
+ var body, container, div, marginDiv;
+
+ // Use window.getComputedStyle because jsdom on node.js will break without it.
+ if ( reliableMarginRightVal == null && window.getComputedStyle ) {
+ body = document.getElementsByTagName( "body" )[ 0 ];
+ if ( !body ) {
+ // Test fired too early or in an unsupported environment, exit.
+ return;
+ }
+
+ container = document.createElement( "div" );
+ div = document.createElement( "div" );
+ container.style.cssText = containerStyles;
+
+ body.appendChild( container ).appendChild( div );
+
+ // Check if div with explicit width and no margin-right incorrectly
+ // gets computed margin-right based on width of container. (#3333)
+ // Fails in WebKit before Feb 2011 nightlies
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ marginDiv = div.appendChild( document.createElement( "div" ) );
+ marginDiv.style.cssText = div.style.cssText = divReset;
+ marginDiv.style.marginRight = marginDiv.style.width = "0";
+ div.style.width = "1px";
+
+ reliableMarginRightVal =
+ !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight );
+
+ body.removeChild( container );
+ }
+
+ return reliableMarginRightVal;
+ }
+ });
+
+ function computeStyleTests() {
+ var container, div,
+ body = document.getElementsByTagName( "body" )[ 0 ];
+
+ if ( !body ) {
+ // Test fired too early or in an unsupported environment, exit.
+ return;
+ }
+
+ container = document.createElement( "div" );
+ div = document.createElement( "div" );
+ container.style.cssText = containerStyles;
+
+ body.appendChild( container ).appendChild( div );
+
+ div.style.cssText =
+ "-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;" +
+ "position:absolute;display:block;padding:1px;border:1px;width:4px;" +
+ "margin-top:1%;top:1%";
+
+ // Workaround failing boxSizing test due to offsetWidth returning wrong value
+ // with some non-1 values of body zoom, ticket #13543
+ jQuery.swap( body, body.style.zoom != null ? { zoom: 1 } : {}, function() {
+ boxSizingVal = div.offsetWidth === 4;
+ });
+
+ // Will be changed later if needed.
+ boxSizingReliableVal = true;
+ pixelPositionVal = false;
+ reliableMarginRightVal = true;
+
+ // Use window.getComputedStyle because jsdom on node.js will break without it.
+ if ( window.getComputedStyle ) {
+ pixelPositionVal = ( window.getComputedStyle( div, null ) || {} ).top !== "1%";
+ boxSizingReliableVal =
+ ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px";
+ }
+
+ body.removeChild( container );
+
+ // Null elements to avoid leaks in IE.
+ div = body = null;
+ }
+
+})();
+
+
+// A method for quickly swapping in/out CSS properties to get correct calculations.
+jQuery.swap = function( elem, options, callback, args ) {
+ var ret, name,
+ old = {};
+
+ // Remember the old values, and insert the new ones
+ for ( name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ ret = callback.apply( elem, args || [] );
+
+ // Revert the old values
+ for ( name in options ) {
+ elem.style[ name ] = old[ name ];
+ }
+
+ return ret;
+};
+
+
+var
+ ralpha = /alpha\([^)]*\)/i,
+ ropacity = /opacity\s*=\s*([^)]*)/,
+
+ // swappable if display is none or starts with table except "table", "table-cell", or "table-caption"
+ // see here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
+ rdisplayswap = /^(none|table(?!-c[ea]).+)/,
+ rnumsplit = new RegExp( "^(" + pnum + ")(.*)$", "i" ),
+ rrelNum = new RegExp( "^([+-])=(" + pnum + ")", "i" ),
+
+ cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+ cssNormalTransform = {
+ letterSpacing: 0,
+ fontWeight: 400
+ },
+
+ cssPrefixes = [ "Webkit", "O", "Moz", "ms" ];
+
+
+// return a css property mapped to a potentially vendor prefixed property
+function vendorPropName( style, name ) {
+
+ // shortcut for names that are not vendor prefixed
+ if ( name in style ) {
+ return name;
+ }
+
+ // check for vendor prefixed names
+ var capName = name.charAt(0).toUpperCase() + name.slice(1),
+ origName = name,
+ i = cssPrefixes.length;
+
+ while ( i-- ) {
+ name = cssPrefixes[ i ] + capName;
+ if ( name in style ) {
+ return name;
+ }
+ }
+
+ return origName;
+}
+
+function showHide( elements, show ) {
+ var display, elem, hidden,
+ values = [],
+ index = 0,
+ length = elements.length;
+
+ for ( ; index < length; index++ ) {
+ elem = elements[ index ];
+ if ( !elem.style ) {
+ continue;
+ }
+
+ values[ index ] = jQuery._data( elem, "olddisplay" );
+ display = elem.style.display;
+ if ( show ) {
+ // Reset the inline display of this element to learn if it is
+ // being hidden by cascaded rules or not
+ if ( !values[ index ] && display === "none" ) {
+ elem.style.display = "";
+ }
+
+ // Set elements which have been overridden with display: none
+ // in a stylesheet to whatever the default browser style is
+ // for such an element
+ if ( elem.style.display === "" && isHidden( elem ) ) {
+ values[ index ] = jQuery._data( elem, "olddisplay", defaultDisplay(elem.nodeName) );
+ }
+ } else {
+
+ if ( !values[ index ] ) {
+ hidden = isHidden( elem );
+
+ if ( display && display !== "none" || !hidden ) {
+ jQuery._data( elem, "olddisplay", hidden ? display : jQuery.css( elem, "display" ) );
+ }
+ }
+ }
+ }
+
+ // Set the display of most of the elements in a second loop
+ // to avoid the constant reflow
+ for ( index = 0; index < length; index++ ) {
+ elem = elements[ index ];
+ if ( !elem.style ) {
+ continue;
+ }
+ if ( !show || elem.style.display === "none" || elem.style.display === "" ) {
+ elem.style.display = show ? values[ index ] || "" : "none";
+ }
+ }
+
+ return elements;
+}
+
+function setPositiveNumber( elem, value, subtract ) {
+ var matches = rnumsplit.exec( value );
+ return matches ?
+ // Guard against undefined "subtract", e.g., when used as in cssHooks
+ Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) :
+ value;
+}
+
+function augmentWidthOrHeight( elem, name, extra, isBorderBox, styles ) {
+ var i = extra === ( isBorderBox ? "border" : "content" ) ?
+ // If we already have the right measurement, avoid augmentation
+ 4 :
+ // Otherwise initialize for horizontal or vertical properties
+ name === "width" ? 1 : 0,
+
+ val = 0;
+
+ for ( ; i < 4; i += 2 ) {
+ // both box models exclude margin, so add it if we want it
+ if ( extra === "margin" ) {
+ val += jQuery.css( elem, extra + cssExpand[ i ], true, styles );
+ }
+
+ if ( isBorderBox ) {
+ // border-box includes padding, so remove it if we want content
+ if ( extra === "content" ) {
+ val -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+ }
+
+ // at this point, extra isn't border nor margin, so remove border
+ if ( extra !== "margin" ) {
+ val -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+ }
+ } else {
+ // at this point, extra isn't content, so add padding
+ val += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+
+ // at this point, extra isn't content nor padding, so add border
+ if ( extra !== "padding" ) {
+ val += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+ }
+ }
+ }
+
+ return val;
+}
+
+function getWidthOrHeight( elem, name, extra ) {
+
+ // Start with offset property, which is equivalent to the border-box value
+ var valueIsBorderBox = true,
+ val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
+ styles = getStyles( elem ),
+ isBorderBox = support.boxSizing() && jQuery.css( elem, "boxSizing", false, styles ) === "border-box";
+
+ // some non-html elements return undefined for offsetWidth, so check for null/undefined
+ // svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285
+ // MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668
+ if ( val <= 0 || val == null ) {
+ // Fall back to computed then uncomputed css if necessary
+ val = curCSS( elem, name, styles );
+ if ( val < 0 || val == null ) {
+ val = elem.style[ name ];
+ }
+
+ // Computed unit is not pixels. Stop here and return.
+ if ( rnumnonpx.test(val) ) {
+ return val;
+ }
+
+ // we need the check for style in case a browser which returns unreliable values
+ // for getComputedStyle silently falls back to the reliable elem.style
+ valueIsBorderBox = isBorderBox && ( support.boxSizingReliable() || val === elem.style[ name ] );
+
+ // Normalize "", auto, and prepare for extra
+ val = parseFloat( val ) || 0;
+ }
+
+ // use the active box-sizing model to add/subtract irrelevant styles
+ return ( val +
+ augmentWidthOrHeight(
+ elem,
+ name,
+ extra || ( isBorderBox ? "border" : "content" ),
+ valueIsBorderBox,
+ styles
+ )
+ ) + "px";
+}
+
+jQuery.extend({
+ // Add in style property hooks for overriding the default
+ // behavior of getting and setting a style property
+ cssHooks: {
+ opacity: {
+ get: function( elem, computed ) {
+ if ( computed ) {
+ // We should always get a number back from opacity
+ var ret = curCSS( elem, "opacity" );
+ return ret === "" ? "1" : ret;
+ }
+ }
+ }
+ },
+
+ // Don't automatically add "px" to these possibly-unitless properties
+ cssNumber: {
+ "columnCount": true,
+ "fillOpacity": true,
+ "fontWeight": true,
+ "lineHeight": true,
+ "opacity": true,
+ "order": true,
+ "orphans": true,
+ "widows": true,
+ "zIndex": true,
+ "zoom": true
+ },
+
+ // Add in properties whose names you wish to fix before
+ // setting or getting the value
+ cssProps: {
+ // normalize float css property
+ "float": support.cssFloat ? "cssFloat" : "styleFloat"
+ },
+
+ // Get and set the style property on a DOM Node
+ style: function( elem, name, value, extra ) {
+ // Don't set styles on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+ return;
+ }
+
+ // Make sure that we're working with the right name
+ var ret, type, hooks,
+ origName = jQuery.camelCase( name ),
+ style = elem.style;
+
+ name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) );
+
+ // gets hook for the prefixed version
+ // followed by the unprefixed version
+ hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+ // Check if we're setting a value
+ if ( value !== undefined ) {
+ type = typeof value;
+
+ // convert relative number strings (+= or -=) to relative numbers. #7345
+ if ( type === "string" && (ret = rrelNum.exec( value )) ) {
+ value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) );
+ // Fixes bug #9237
+ type = "number";
+ }
+
+ // Make sure that null and NaN values aren't set. See: #7116
+ if ( value == null || value !== value ) {
+ return;
+ }
+
+ // If a number was passed in, add 'px' to the (except for certain CSS properties)
+ if ( type === "number" && !jQuery.cssNumber[ origName ] ) {
+ value += "px";
+ }
+
+ // Fixes #8908, it can be done more correctly by specifing setters in cssHooks,
+ // but it would mean to define eight (for every problematic property) identical functions
+ if ( !support.clearCloneStyle && value === "" && name.indexOf("background") === 0 ) {
+ style[ name ] = "inherit";
+ }
+
+ // If a hook was provided, use that value, otherwise just set the specified value
+ if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) {
+
+ // Support: IE
+ // Swallow errors from 'invalid' CSS values (#5509)
+ try {
+ // Support: Chrome, Safari
+ // Setting style to blank string required to delete "style: x !important;"
+ style[ name ] = "";
+ style[ name ] = value;
+ } catch(e) {}
+ }
+
+ } else {
+ // If a hook was provided get the non-computed value from there
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
+ return ret;
+ }
+
+ // Otherwise just get the value from the style object
+ return style[ name ];
+ }
+ },
+
+ css: function( elem, name, extra, styles ) {
+ var num, val, hooks,
+ origName = jQuery.camelCase( name );
+
+ // Make sure that we're working with the right name
+ name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) );
+
+ // gets hook for the prefixed version
+ // followed by the unprefixed version
+ hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+ // If a hook was provided get the computed value from there
+ if ( hooks && "get" in hooks ) {
+ val = hooks.get( elem, true, extra );
+ }
+
+ // Otherwise, if a way to get the computed value exists, use that
+ if ( val === undefined ) {
+ val = curCSS( elem, name, styles );
+ }
+
+ //convert "normal" to computed value
+ if ( val === "normal" && name in cssNormalTransform ) {
+ val = cssNormalTransform[ name ];
+ }
+
+ // Return, converting to number if forced or a qualifier was provided and val looks numeric
+ if ( extra === "" || extra ) {
+ num = parseFloat( val );
+ return extra === true || jQuery.isNumeric( num ) ? num || 0 : val;
+ }
+ return val;
+ }
+});
+
+jQuery.each([ "height", "width" ], function( i, name ) {
+ jQuery.cssHooks[ name ] = {
+ get: function( elem, computed, extra ) {
+ if ( computed ) {
+ // certain elements can have dimension info if we invisibly show them
+ // however, it must have a current display style that would benefit from this
+ return elem.offsetWidth === 0 && rdisplayswap.test( jQuery.css( elem, "display" ) ) ?
+ jQuery.swap( elem, cssShow, function() {
+ return getWidthOrHeight( elem, name, extra );
+ }) :
+ getWidthOrHeight( elem, name, extra );
+ }
+ },
+
+ set: function( elem, value, extra ) {
+ var styles = extra && getStyles( elem );
+ return setPositiveNumber( elem, value, extra ?
+ augmentWidthOrHeight(
+ elem,
+ name,
+ extra,
+ support.boxSizing() && jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+ styles
+ ) : 0
+ );
+ }
+ };
+});
+
+if ( !support.opacity ) {
+ jQuery.cssHooks.opacity = {
+ get: function( elem, computed ) {
+ // IE uses filters for opacity
+ return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ?
+ ( 0.01 * parseFloat( RegExp.$1 ) ) + "" :
+ computed ? "1" : "";
+ },
+
+ set: function( elem, value ) {
+ var style = elem.style,
+ currentStyle = elem.currentStyle,
+ opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "",
+ filter = currentStyle && currentStyle.filter || style.filter || "";
+
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ style.zoom = 1;
+
+ // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652
+ // if value === "", then remove inline opacity #12685
+ if ( ( value >= 1 || value === "" ) &&
+ jQuery.trim( filter.replace( ralpha, "" ) ) === "" &&
+ style.removeAttribute ) {
+
+ // Setting style.filter to null, "" & " " still leave "filter:" in the cssText
+ // if "filter:" is present at all, clearType is disabled, we want to avoid this
+ // style.removeAttribute is IE Only, but so apparently is this code path...
+ style.removeAttribute( "filter" );
+
+ // if there is no filter style applied in a css rule or unset inline opacity, we are done
+ if ( value === "" || currentStyle && !currentStyle.filter ) {
+ return;
+ }
+ }
+
+ // otherwise, set new filter values
+ style.filter = ralpha.test( filter ) ?
+ filter.replace( ralpha, opacity ) :
+ filter + " " + opacity;
+ }
+ };
+}
+
+jQuery.cssHooks.marginRight = addGetHookIf( support.reliableMarginRight,
+ function( elem, computed ) {
+ if ( computed ) {
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ // Work around by temporarily setting element display to inline-block
+ return jQuery.swap( elem, { "display": "inline-block" },
+ curCSS, [ elem, "marginRight" ] );
+ }
+ }
+);
+
+// These hooks are used by animate to expand properties
+jQuery.each({
+ margin: "",
+ padding: "",
+ border: "Width"
+}, function( prefix, suffix ) {
+ jQuery.cssHooks[ prefix + suffix ] = {
+ expand: function( value ) {
+ var i = 0,
+ expanded = {},
+
+ // assumes a single number if not a string
+ parts = typeof value === "string" ? value.split(" ") : [ value ];
+
+ for ( ; i < 4; i++ ) {
+ expanded[ prefix + cssExpand[ i ] + suffix ] =
+ parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
+ }
+
+ return expanded;
+ }
+ };
+
+ if ( !rmargin.test( prefix ) ) {
+ jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
+ }
+});
+
+jQuery.fn.extend({
+ css: function( name, value ) {
+ return access( this, function( elem, name, value ) {
+ var styles, len,
+ map = {},
+ i = 0;
+
+ if ( jQuery.isArray( name ) ) {
+ styles = getStyles( elem );
+ len = name.length;
+
+ for ( ; i < len; i++ ) {
+ map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
+ }
+
+ return map;
+ }
+
+ return value !== undefined ?
+ jQuery.style( elem, name, value ) :
+ jQuery.css( elem, name );
+ }, name, value, arguments.length > 1 );
+ },
+ show: function() {
+ return showHide( this, true );
+ },
+ hide: function() {
+ return showHide( this );
+ },
+ toggle: function( state ) {
+ if ( typeof state === "boolean" ) {
+ return state ? this.show() : this.hide();
+ }
+
+ return this.each(function() {
+ if ( isHidden( this ) ) {
+ jQuery( this ).show();
+ } else {
+ jQuery( this ).hide();
+ }
+ });
+ }
+});
+
+
+function Tween( elem, options, prop, end, easing ) {
+ return new Tween.prototype.init( elem, options, prop, end, easing );
+}
+jQuery.Tween = Tween;
+
+Tween.prototype = {
+ constructor: Tween,
+ init: function( elem, options, prop, end, easing, unit ) {
+ this.elem = elem;
+ this.prop = prop;
+ this.easing = easing || "swing";
+ this.options = options;
+ this.start = this.now = this.cur();
+ this.end = end;
+ this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+ },
+ cur: function() {
+ var hooks = Tween.propHooks[ this.prop ];
+
+ return hooks && hooks.get ?
+ hooks.get( this ) :
+ Tween.propHooks._default.get( this );
+ },
+ run: function( percent ) {
+ var eased,
+ hooks = Tween.propHooks[ this.prop ];
+
+ if ( this.options.duration ) {
+ this.pos = eased = jQuery.easing[ this.easing ](
+ percent, this.options.duration * percent, 0, 1, this.options.duration
+ );
+ } else {
+ this.pos = eased = percent;
+ }
+ this.now = ( this.end - this.start ) * eased + this.start;
+
+ if ( this.options.step ) {
+ this.options.step.call( this.elem, this.now, this );
+ }
+
+ if ( hooks && hooks.set ) {
+ hooks.set( this );
+ } else {
+ Tween.propHooks._default.set( this );
+ }
+ return this;
+ }
+};
+
+Tween.prototype.init.prototype = Tween.prototype;
+
+Tween.propHooks = {
+ _default: {
+ get: function( tween ) {
+ var result;
+
+ if ( tween.elem[ tween.prop ] != null &&
+ (!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) {
+ return tween.elem[ tween.prop ];
+ }
+
+ // passing an empty string as a 3rd parameter to .css will automatically
+ // attempt a parseFloat and fallback to a string if the parse fails
+ // so, simple values such as "10px" are parsed to Float.
+ // complex values such as "rotate(1rad)" are returned as is.
+ result = jQuery.css( tween.elem, tween.prop, "" );
+ // Empty strings, null, undefined and "auto" are converted to 0.
+ return !result || result === "auto" ? 0 : result;
+ },
+ set: function( tween ) {
+ // use step hook for back compat - use cssHook if its there - use .style if its
+ // available and use plain properties where available
+ if ( jQuery.fx.step[ tween.prop ] ) {
+ jQuery.fx.step[ tween.prop ]( tween );
+ } else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) {
+ jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
+ } else {
+ tween.elem[ tween.prop ] = tween.now;
+ }
+ }
+ }
+};
+
+// Support: IE <=9
+// Panic based approach to setting things on disconnected nodes
+
+Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
+ set: function( tween ) {
+ if ( tween.elem.nodeType && tween.elem.parentNode ) {
+ tween.elem[ tween.prop ] = tween.now;
+ }
+ }
+};
+
+jQuery.easing = {
+ linear: function( p ) {
+ return p;
+ },
+ swing: function( p ) {
+ return 0.5 - Math.cos( p * Math.PI ) / 2;
+ }
+};
+
+jQuery.fx = Tween.prototype.init;
+
+// Back Compat <1.8 extension point
+jQuery.fx.step = {};
+
+
+
+
+var
+ fxNow, timerId,
+ rfxtypes = /^(?:toggle|show|hide)$/,
+ rfxnum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ),
+ rrun = /queueHooks$/,
+ animationPrefilters = [ defaultPrefilter ],
+ tweeners = {
+ "*": [ function( prop, value ) {
+ var tween = this.createTween( prop, value ),
+ target = tween.cur(),
+ parts = rfxnum.exec( value ),
+ unit = parts && parts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ),
+
+ // Starting value computation is required for potential unit mismatches
+ start = ( jQuery.cssNumber[ prop ] || unit !== "px" && +target ) &&
+ rfxnum.exec( jQuery.css( tween.elem, prop ) ),
+ scale = 1,
+ maxIterations = 20;
+
+ if ( start && start[ 3 ] !== unit ) {
+ // Trust units reported by jQuery.css
+ unit = unit || start[ 3 ];
+
+ // Make sure we update the tween properties later on
+ parts = parts || [];
+
+ // Iteratively approximate from a nonzero starting point
+ start = +target || 1;
+
+ do {
+ // If previous iteration zeroed out, double until we get *something*
+ // Use a string for doubling factor so we don't accidentally see scale as unchanged below
+ scale = scale || ".5";
+
+ // Adjust and apply
+ start = start / scale;
+ jQuery.style( tween.elem, prop, start + unit );
+
+ // Update scale, tolerating zero or NaN from tween.cur()
+ // And breaking the loop if scale is unchanged or perfect, or if we've just had enough
+ } while ( scale !== (scale = tween.cur() / target) && scale !== 1 && --maxIterations );
+ }
+
+ // Update tween properties
+ if ( parts ) {
+ start = tween.start = +start || +target || 0;
+ tween.unit = unit;
+ // If a +=/-= token was provided, we're doing a relative animation
+ tween.end = parts[ 1 ] ?
+ start + ( parts[ 1 ] + 1 ) * parts[ 2 ] :
+ +parts[ 2 ];
+ }
+
+ return tween;
+ } ]
+ };
+
+// Animations created synchronously will run synchronously
+function createFxNow() {
+ setTimeout(function() {
+ fxNow = undefined;
+ });
+ return ( fxNow = jQuery.now() );
+}
+
+// Generate parameters to create a standard animation
+function genFx( type, includeWidth ) {
+ var which,
+ attrs = { height: type },
+ i = 0;
+
+ // if we include width, step value is 1 to do all cssExpand values,
+ // if we don't include width, step value is 2 to skip over Left and Right
+ includeWidth = includeWidth ? 1 : 0;
+ for ( ; i < 4 ; i += 2 - includeWidth ) {
+ which = cssExpand[ i ];
+ attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
+ }
+
+ if ( includeWidth ) {
+ attrs.opacity = attrs.width = type;
+ }
+
+ return attrs;
+}
+
+function createTween( value, prop, animation ) {
+ var tween,
+ collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ),
+ index = 0,
+ length = collection.length;
+ for ( ; index < length; index++ ) {
+ if ( (tween = collection[ index ].call( animation, prop, value )) ) {
+
+ // we're done with this property
+ return tween;
+ }
+ }
+}
+
+function defaultPrefilter( elem, props, opts ) {
+ /* jshint validthis: true */
+ var prop, value, toggle, tween, hooks, oldfire, display, dDisplay,
+ anim = this,
+ orig = {},
+ style = elem.style,
+ hidden = elem.nodeType && isHidden( elem ),
+ dataShow = jQuery._data( elem, "fxshow" );
+
+ // handle queue: false promises
+ if ( !opts.queue ) {
+ hooks = jQuery._queueHooks( elem, "fx" );
+ if ( hooks.unqueued == null ) {
+ hooks.unqueued = 0;
+ oldfire = hooks.empty.fire;
+ hooks.empty.fire = function() {
+ if ( !hooks.unqueued ) {
+ oldfire();
+ }
+ };
+ }
+ hooks.unqueued++;
+
+ anim.always(function() {
+ // doing this makes sure that the complete handler will be called
+ // before this completes
+ anim.always(function() {
+ hooks.unqueued--;
+ if ( !jQuery.queue( elem, "fx" ).length ) {
+ hooks.empty.fire();
+ }
+ });
+ });
+ }
+
+ // height/width overflow pass
+ if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) {
+ // Make sure that nothing sneaks out
+ // Record all 3 overflow attributes because IE does not
+ // change the overflow attribute when overflowX and
+ // overflowY are set to the same value
+ opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
+
+ // Set display property to inline-block for height/width
+ // animations on inline elements that are having width/height animated
+ display = jQuery.css( elem, "display" );
+ dDisplay = defaultDisplay( elem.nodeName );
+ if ( display === "none" ) {
+ display = dDisplay;
+ }
+ if ( display === "inline" &&
+ jQuery.css( elem, "float" ) === "none" ) {
+
+ // inline-level elements accept inline-block;
+ // block-level elements need to be inline with layout
+ if ( !support.inlineBlockNeedsLayout || dDisplay === "inline" ) {
+ style.display = "inline-block";
+ } else {
+ style.zoom = 1;
+ }
+ }
+ }
+
+ if ( opts.overflow ) {
+ style.overflow = "hidden";
+ if ( !support.shrinkWrapBlocks() ) {
+ anim.always(function() {
+ style.overflow = opts.overflow[ 0 ];
+ style.overflowX = opts.overflow[ 1 ];
+ style.overflowY = opts.overflow[ 2 ];
+ });
+ }
+ }
+
+ // show/hide pass
+ for ( prop in props ) {
+ value = props[ prop ];
+ if ( rfxtypes.exec( value ) ) {
+ delete props[ prop ];
+ toggle = toggle || value === "toggle";
+ if ( value === ( hidden ? "hide" : "show" ) ) {
+
+ // If there is dataShow left over from a stopped hide or show and we are going to proceed with show, we should pretend to be hidden
+ if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) {
+ hidden = true;
+ } else {
+ continue;
+ }
+ }
+ orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop );
+ }
+ }
+
+ if ( !jQuery.isEmptyObject( orig ) ) {
+ if ( dataShow ) {
+ if ( "hidden" in dataShow ) {
+ hidden = dataShow.hidden;
+ }
+ } else {
+ dataShow = jQuery._data( elem, "fxshow", {} );
+ }
+
+ // store state if its toggle - enables .stop().toggle() to "reverse"
+ if ( toggle ) {
+ dataShow.hidden = !hidden;
+ }
+ if ( hidden ) {
+ jQuery( elem ).show();
+ } else {
+ anim.done(function() {
+ jQuery( elem ).hide();
+ });
+ }
+ anim.done(function() {
+ var prop;
+ jQuery._removeData( elem, "fxshow" );
+ for ( prop in orig ) {
+ jQuery.style( elem, prop, orig[ prop ] );
+ }
+ });
+ for ( prop in orig ) {
+ tween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );
+
+ if ( !( prop in dataShow ) ) {
+ dataShow[ prop ] = tween.start;
+ if ( hidden ) {
+ tween.end = tween.start;
+ tween.start = prop === "width" || prop === "height" ? 1 : 0;
+ }
+ }
+ }
+ }
+}
+
+function propFilter( props, specialEasing ) {
+ var index, name, easing, value, hooks;
+
+ // camelCase, specialEasing and expand cssHook pass
+ for ( index in props ) {
+ name = jQuery.camelCase( index );
+ easing = specialEasing[ name ];
+ value = props[ index ];
+ if ( jQuery.isArray( value ) ) {
+ easing = value[ 1 ];
+ value = props[ index ] = value[ 0 ];
+ }
+
+ if ( index !== name ) {
+ props[ name ] = value;
+ delete props[ index ];
+ }
+
+ hooks = jQuery.cssHooks[ name ];
+ if ( hooks && "expand" in hooks ) {
+ value = hooks.expand( value );
+ delete props[ name ];
+
+ // not quite $.extend, this wont overwrite keys already present.
+ // also - reusing 'index' from above because we have the correct "name"
+ for ( index in value ) {
+ if ( !( index in props ) ) {
+ props[ index ] = value[ index ];
+ specialEasing[ index ] = easing;
+ }
+ }
+ } else {
+ specialEasing[ name ] = easing;
+ }
+ }
+}
+
+function Animation( elem, properties, options ) {
+ var result,
+ stopped,
+ index = 0,
+ length = animationPrefilters.length,
+ deferred = jQuery.Deferred().always( function() {
+ // don't match elem in the :animated selector
+ delete tick.elem;
+ }),
+ tick = function() {
+ if ( stopped ) {
+ return false;
+ }
+ var currentTime = fxNow || createFxNow(),
+ remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
+ // archaic crash bug won't allow us to use 1 - ( 0.5 || 0 ) (#12497)
+ temp = remaining / animation.duration || 0,
+ percent = 1 - temp,
+ index = 0,
+ length = animation.tweens.length;
+
+ for ( ; index < length ; index++ ) {
+ animation.tweens[ index ].run( percent );
+ }
+
+ deferred.notifyWith( elem, [ animation, percent, remaining ]);
+
+ if ( percent < 1 && length ) {
+ return remaining;
+ } else {
+ deferred.resolveWith( elem, [ animation ] );
+ return false;
+ }
+ },
+ animation = deferred.promise({
+ elem: elem,
+ props: jQuery.extend( {}, properties ),
+ opts: jQuery.extend( true, { specialEasing: {} }, options ),
+ originalProperties: properties,
+ originalOptions: options,
+ startTime: fxNow || createFxNow(),
+ duration: options.duration,
+ tweens: [],
+ createTween: function( prop, end ) {
+ var tween = jQuery.Tween( elem, animation.opts, prop, end,
+ animation.opts.specialEasing[ prop ] || animation.opts.easing );
+ animation.tweens.push( tween );
+ return tween;
+ },
+ stop: function( gotoEnd ) {
+ var index = 0,
+ // if we are going to the end, we want to run all the tweens
+ // otherwise we skip this part
+ length = gotoEnd ? animation.tweens.length : 0;
+ if ( stopped ) {
+ return this;
+ }
+ stopped = true;
+ for ( ; index < length ; index++ ) {
+ animation.tweens[ index ].run( 1 );
+ }
+
+ // resolve when we played the last frame
+ // otherwise, reject
+ if ( gotoEnd ) {
+ deferred.resolveWith( elem, [ animation, gotoEnd ] );
+ } else {
+ deferred.rejectWith( elem, [ animation, gotoEnd ] );
+ }
+ return this;
+ }
+ }),
+ props = animation.props;
+
+ propFilter( props, animation.opts.specialEasing );
+
+ for ( ; index < length ; index++ ) {
+ result = animationPrefilters[ index ].call( animation, elem, props, animation.opts );
+ if ( result ) {
+ return result;
+ }
+ }
+
+ jQuery.map( props, createTween, animation );
+
+ if ( jQuery.isFunction( animation.opts.start ) ) {
+ animation.opts.start.call( elem, animation );
+ }
+
+ jQuery.fx.timer(
+ jQuery.extend( tick, {
+ elem: elem,
+ anim: animation,
+ queue: animation.opts.queue
+ })
+ );
+
+ // attach callbacks from options
+ return animation.progress( animation.opts.progress )
+ .done( animation.opts.done, animation.opts.complete )
+ .fail( animation.opts.fail )
+ .always( animation.opts.always );
+}
+
+jQuery.Animation = jQuery.extend( Animation, {
+ tweener: function( props, callback ) {
+ if ( jQuery.isFunction( props ) ) {
+ callback = props;
+ props = [ "*" ];
+ } else {
+ props = props.split(" ");
+ }
+
+ var prop,
+ index = 0,
+ length = props.length;
+
+ for ( ; index < length ; index++ ) {
+ prop = props[ index ];
+ tweeners[ prop ] = tweeners[ prop ] || [];
+ tweeners[ prop ].unshift( callback );
+ }
+ },
+
+ prefilter: function( callback, prepend ) {
+ if ( prepend ) {
+ animationPrefilters.unshift( callback );
+ } else {
+ animationPrefilters.push( callback );
+ }
+ }
+});
+
+jQuery.speed = function( speed, easing, fn ) {
+ var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
+ complete: fn || !fn && easing ||
+ jQuery.isFunction( speed ) && speed,
+ duration: speed,
+ easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing
+ };
+
+ opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+ opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default;
+
+ // normalize opt.queue - true/undefined/null -> "fx"
+ if ( opt.queue == null || opt.queue === true ) {
+ opt.queue = "fx";
+ }
+
+ // Queueing
+ opt.old = opt.complete;
+
+ opt.complete = function() {
+ if ( jQuery.isFunction( opt.old ) ) {
+ opt.old.call( this );
+ }
+
+ if ( opt.queue ) {
+ jQuery.dequeue( this, opt.queue );
+ }
+ };
+
+ return opt;
+};
+
+jQuery.fn.extend({
+ fadeTo: function( speed, to, easing, callback ) {
+
+ // show any hidden elements after setting opacity to 0
+ return this.filter( isHidden ).css( "opacity", 0 ).show()
+
+ // animate to the value specified
+ .end().animate({ opacity: to }, speed, easing, callback );
+ },
+ animate: function( prop, speed, easing, callback ) {
+ var empty = jQuery.isEmptyObject( prop ),
+ optall = jQuery.speed( speed, easing, callback ),
+ doAnimation = function() {
+ // Operate on a copy of prop so per-property easing won't be lost
+ var anim = Animation( this, jQuery.extend( {}, prop ), optall );
+
+ // Empty animations, or finishing resolves immediately
+ if ( empty || jQuery._data( this, "finish" ) ) {
+ anim.stop( true );
+ }
+ };
+ doAnimation.finish = doAnimation;
+
+ return empty || optall.queue === false ?
+ this.each( doAnimation ) :
+ this.queue( optall.queue, doAnimation );
+ },
+ stop: function( type, clearQueue, gotoEnd ) {
+ var stopQueue = function( hooks ) {
+ var stop = hooks.stop;
+ delete hooks.stop;
+ stop( gotoEnd );
+ };
+
+ if ( typeof type !== "string" ) {
+ gotoEnd = clearQueue;
+ clearQueue = type;
+ type = undefined;
+ }
+ if ( clearQueue && type !== false ) {
+ this.queue( type || "fx", [] );
+ }
+
+ return this.each(function() {
+ var dequeue = true,
+ index = type != null && type + "queueHooks",
+ timers = jQuery.timers,
+ data = jQuery._data( this );
+
+ if ( index ) {
+ if ( data[ index ] && data[ index ].stop ) {
+ stopQueue( data[ index ] );
+ }
+ } else {
+ for ( index in data ) {
+ if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
+ stopQueue( data[ index ] );
+ }
+ }
+ }
+
+ for ( index = timers.length; index--; ) {
+ if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) {
+ timers[ index ].anim.stop( gotoEnd );
+ dequeue = false;
+ timers.splice( index, 1 );
+ }
+ }
+
+ // start the next in the queue if the last step wasn't forced
+ // timers currently will call their complete callbacks, which will dequeue
+ // but only if they were gotoEnd
+ if ( dequeue || !gotoEnd ) {
+ jQuery.dequeue( this, type );
+ }
+ });
+ },
+ finish: function( type ) {
+ if ( type !== false ) {
+ type = type || "fx";
+ }
+ return this.each(function() {
+ var index,
+ data = jQuery._data( this ),
+ queue = data[ type + "queue" ],
+ hooks = data[ type + "queueHooks" ],
+ timers = jQuery.timers,
+ length = queue ? queue.length : 0;
+
+ // enable finishing flag on private data
+ data.finish = true;
+
+ // empty the queue first
+ jQuery.queue( this, type, [] );
+
+ if ( hooks && hooks.stop ) {
+ hooks.stop.call( this, true );
+ }
+
+ // look for any active animations, and finish them
+ for ( index = timers.length; index--; ) {
+ if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
+ timers[ index ].anim.stop( true );
+ timers.splice( index, 1 );
+ }
+ }
+
+ // look for any animations in the old queue and finish them
+ for ( index = 0; index < length; index++ ) {
+ if ( queue[ index ] && queue[ index ].finish ) {
+ queue[ index ].finish.call( this );
+ }
+ }
+
+ // turn off finishing flag
+ delete data.finish;
+ });
+ }
+});
+
+jQuery.each([ "toggle", "show", "hide" ], function( i, name ) {
+ var cssFn = jQuery.fn[ name ];
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return speed == null || typeof speed === "boolean" ?
+ cssFn.apply( this, arguments ) :
+ this.animate( genFx( name, true ), speed, easing, callback );
+ };
+});
+
+// Generate shortcuts for custom animations
+jQuery.each({
+ slideDown: genFx("show"),
+ slideUp: genFx("hide"),
+ slideToggle: genFx("toggle"),
+ fadeIn: { opacity: "show" },
+ fadeOut: { opacity: "hide" },
+ fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return this.animate( props, speed, easing, callback );
+ };
+});
+
+jQuery.timers = [];
+jQuery.fx.tick = function() {
+ var timer,
+ timers = jQuery.timers,
+ i = 0;
+
+ fxNow = jQuery.now();
+
+ for ( ; i < timers.length; i++ ) {
+ timer = timers[ i ];
+ // Checks the timer has not already been removed
+ if ( !timer() && timers[ i ] === timer ) {
+ timers.splice( i--, 1 );
+ }
+ }
+
+ if ( !timers.length ) {
+ jQuery.fx.stop();
+ }
+ fxNow = undefined;
+};
+
+jQuery.fx.timer = function( timer ) {
+ jQuery.timers.push( timer );
+ if ( timer() ) {
+ jQuery.fx.start();
+ } else {
+ jQuery.timers.pop();
+ }
+};
+
+jQuery.fx.interval = 13;
+
+jQuery.fx.start = function() {
+ if ( !timerId ) {
+ timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval );
+ }
+};
+
+jQuery.fx.stop = function() {
+ clearInterval( timerId );
+ timerId = null;
+};
+
+jQuery.fx.speeds = {
+ slow: 600,
+ fast: 200,
+ // Default speed
+ _default: 400
+};
+
+
+// Based off of the plugin by Clint Helfers, with permission.
+// http://blindsignals.com/index.php/2009/07/jquery-delay/
+jQuery.fn.delay = function( time, type ) {
+ time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
+ type = type || "fx";
+
+ return this.queue( type, function( next, hooks ) {
+ var timeout = setTimeout( next, time );
+ hooks.stop = function() {
+ clearTimeout( timeout );
+ };
+ });
+};
+
+
+(function() {
+ var a, input, select, opt,
+ div = document.createElement("div" );
+
+ // Setup
+ div.setAttribute( "className", "t" );
+ div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
+ a = div.getElementsByTagName("a")[ 0 ];
+
+ // First batch of tests.
+ select = document.createElement("select");
+ opt = select.appendChild( document.createElement("option") );
+ input = div.getElementsByTagName("input")[ 0 ];
+
+ a.style.cssText = "top:1px";
+
+ // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
+ support.getSetAttribute = div.className !== "t";
+
+ // Get the style information from getAttribute
+ // (IE uses .cssText instead)
+ support.style = /top/.test( a.getAttribute("style") );
+
+ // Make sure that URLs aren't manipulated
+ // (IE normalizes it by default)
+ support.hrefNormalized = a.getAttribute("href") === "/a";
+
+ // Check the default checkbox/radio value ("" on WebKit; "on" elsewhere)
+ support.checkOn = !!input.value;
+
+ // Make sure that a selected-by-default option has a working selected property.
+ // (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+ support.optSelected = opt.selected;
+
+ // Tests for enctype support on a form (#6743)
+ support.enctype = !!document.createElement("form").enctype;
+
+ // Make sure that the options inside disabled selects aren't marked as disabled
+ // (WebKit marks them as disabled)
+ select.disabled = true;
+ support.optDisabled = !opt.disabled;
+
+ // Support: IE8 only
+ // Check if we can trust getAttribute("value")
+ input = document.createElement( "input" );
+ input.setAttribute( "value", "" );
+ support.input = input.getAttribute( "value" ) === "";
+
+ // Check if an input maintains its value after becoming a radio
+ input.value = "t";
+ input.setAttribute( "type", "radio" );
+ support.radioValue = input.value === "t";
+
+ // Null elements to avoid leaks in IE.
+ a = input = select = opt = div = null;
+})();
+
+
+var rreturn = /\r/g;
+
+jQuery.fn.extend({
+ val: function( value ) {
+ var hooks, ret, isFunction,
+ elem = this[0];
+
+ if ( !arguments.length ) {
+ if ( elem ) {
+ hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ];
+
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) {
+ return ret;
+ }
+
+ ret = elem.value;
+
+ return typeof ret === "string" ?
+ // handle most common string cases
+ ret.replace(rreturn, "") :
+ // handle cases where value is null/undef or number
+ ret == null ? "" : ret;
+ }
+
+ return;
+ }
+
+ isFunction = jQuery.isFunction( value );
+
+ return this.each(function( i ) {
+ var val;
+
+ if ( this.nodeType !== 1 ) {
+ return;
+ }
+
+ if ( isFunction ) {
+ val = value.call( this, i, jQuery( this ).val() );
+ } else {
+ val = value;
+ }
+
+ // Treat null/undefined as ""; convert numbers to string
+ if ( val == null ) {
+ val = "";
+ } else if ( typeof val === "number" ) {
+ val += "";
+ } else if ( jQuery.isArray( val ) ) {
+ val = jQuery.map( val, function( value ) {
+ return value == null ? "" : value + "";
+ });
+ }
+
+ hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
+
+ // If set returns undefined, fall back to normal setting
+ if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) {
+ this.value = val;
+ }
+ });
+ }
+});
+
+jQuery.extend({
+ valHooks: {
+ option: {
+ get: function( elem ) {
+ var val = jQuery.find.attr( elem, "value" );
+ return val != null ?
+ val :
+ jQuery.text( elem );
+ }
+ },
+ select: {
+ get: function( elem ) {
+ var value, option,
+ options = elem.options,
+ index = elem.selectedIndex,
+ one = elem.type === "select-one" || index < 0,
+ values = one ? null : [],
+ max = one ? index + 1 : options.length,
+ i = index < 0 ?
+ max :
+ one ? index : 0;
+
+ // Loop through all the selected options
+ for ( ; i < max; i++ ) {
+ option = options[ i ];
+
+ // oldIE doesn't update selected after form reset (#2551)
+ if ( ( option.selected || i === index ) &&
+ // Don't return options that are disabled or in a disabled optgroup
+ ( support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null ) &&
+ ( !option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) {
+
+ // Get the specific value for the option
+ value = jQuery( option ).val();
+
+ // We don't need an array for one selects
+ if ( one ) {
+ return value;
+ }
+
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
+
+ return values;
+ },
+
+ set: function( elem, value ) {
+ var optionSet, option,
+ options = elem.options,
+ values = jQuery.makeArray( value ),
+ i = options.length;
+
+ while ( i-- ) {
+ option = options[ i ];
+
+ if ( jQuery.inArray( jQuery.valHooks.option.get( option ), values ) >= 0 ) {
+
+ // Support: IE6
+ // When new option element is added to select box we need to
+ // force reflow of newly added node in order to workaround delay
+ // of initialization properties
+ try {
+ option.selected = optionSet = true;
+
+ } catch ( _ ) {
+
+ // Will be executed only in IE6
+ option.scrollHeight;
+ }
+
+ } else {
+ option.selected = false;
+ }
+ }
+
+ // Force browsers to behave consistently when non-matching value is set
+ if ( !optionSet ) {
+ elem.selectedIndex = -1;
+ }
+
+ return options;
+ }
+ }
+ }
+});
+
+// Radios and checkboxes getter/setter
+jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = {
+ set: function( elem, value ) {
+ if ( jQuery.isArray( value ) ) {
+ return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 );
+ }
+ }
+ };
+ if ( !support.checkOn ) {
+ jQuery.valHooks[ this ].get = function( elem ) {
+ // Support: Webkit
+ // "" is returned instead of "on" if a value isn't specified
+ return elem.getAttribute("value") === null ? "on" : elem.value;
+ };
+ }
+});
+
+
+
+
+var nodeHook, boolHook,
+ attrHandle = jQuery.expr.attrHandle,
+ ruseDefault = /^(?:checked|selected)$/i,
+ getSetAttribute = support.getSetAttribute,
+ getSetInput = support.input;
+
+jQuery.fn.extend({
+ attr: function( name, value ) {
+ return access( this, jQuery.attr, name, value, arguments.length > 1 );
+ },
+
+ removeAttr: function( name ) {
+ return this.each(function() {
+ jQuery.removeAttr( this, name );
+ });
+ }
+});
+
+jQuery.extend({
+ attr: function( elem, name, value ) {
+ var hooks, ret,
+ nType = elem.nodeType;
+
+ // don't get/set attributes on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ // Fallback to prop when attributes are not supported
+ if ( typeof elem.getAttribute === strundefined ) {
+ return jQuery.prop( elem, name, value );
+ }
+
+ // All attributes are lowercase
+ // Grab necessary hook if one is defined
+ if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+ name = name.toLowerCase();
+ hooks = jQuery.attrHooks[ name ] ||
+ ( jQuery.expr.match.bool.test( name ) ? boolHook : nodeHook );
+ }
+
+ if ( value !== undefined ) {
+
+ if ( value === null ) {
+ jQuery.removeAttr( elem, name );
+
+ } else if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ elem.setAttribute( name, value + "" );
+ return value;
+ }
+
+ } else if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) {
+ return ret;
+
+ } else {
+ ret = jQuery.find.attr( elem, name );
+
+ // Non-existent attributes return null, we normalize to undefined
+ return ret == null ?
+ undefined :
+ ret;
+ }
+ },
+
+ removeAttr: function( elem, value ) {
+ var name, propName,
+ i = 0,
+ attrNames = value && value.match( rnotwhite );
+
+ if ( attrNames && elem.nodeType === 1 ) {
+ while ( (name = attrNames[i++]) ) {
+ propName = jQuery.propFix[ name ] || name;
+
+ // Boolean attributes get special treatment (#10870)
+ if ( jQuery.expr.match.bool.test( name ) ) {
+ // Set corresponding property to false
+ if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) {
+ elem[ propName ] = false;
+ // Support: IE<9
+ // Also clear defaultChecked/defaultSelected (if appropriate)
+ } else {
+ elem[ jQuery.camelCase( "default-" + name ) ] =
+ elem[ propName ] = false;
+ }
+
+ // See #9699 for explanation of this approach (setting first, then removal)
+ } else {
+ jQuery.attr( elem, name, "" );
+ }
+
+ elem.removeAttribute( getSetAttribute ? name : propName );
+ }
+ }
+ },
+
+ attrHooks: {
+ type: {
+ set: function( elem, value ) {
+ if ( !support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) {
+ // Setting the type on a radio button after the value resets the value in IE6-9
+ // Reset value to default in case type is set after value during creation
+ var val = elem.value;
+ elem.setAttribute( "type", value );
+ if ( val ) {
+ elem.value = val;
+ }
+ return value;
+ }
+ }
+ }
+ }
+});
+
+// Hook for boolean attributes
+boolHook = {
+ set: function( elem, value, name ) {
+ if ( value === false ) {
+ // Remove boolean attributes when set to false
+ jQuery.removeAttr( elem, name );
+ } else if ( getSetInput && getSetAttribute || !ruseDefault.test( name ) ) {
+ // IE<8 needs the *property* name
+ elem.setAttribute( !getSetAttribute && jQuery.propFix[ name ] || name, name );
+
+ // Use defaultChecked and defaultSelected for oldIE
+ } else {
+ elem[ jQuery.camelCase( "default-" + name ) ] = elem[ name ] = true;
+ }
+
+ return name;
+ }
+};
+
+// Retrieve booleans specially
+jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) {
+
+ var getter = attrHandle[ name ] || jQuery.find.attr;
+
+ attrHandle[ name ] = getSetInput && getSetAttribute || !ruseDefault.test( name ) ?
+ function( elem, name, isXML ) {
+ var ret, handle;
+ if ( !isXML ) {
+ // Avoid an infinite loop by temporarily removing this function from the getter
+ handle = attrHandle[ name ];
+ attrHandle[ name ] = ret;
+ ret = getter( elem, name, isXML ) != null ?
+ name.toLowerCase() :
+ null;
+ attrHandle[ name ] = handle;
+ }
+ return ret;
+ } :
+ function( elem, name, isXML ) {
+ if ( !isXML ) {
+ return elem[ jQuery.camelCase( "default-" + name ) ] ?
+ name.toLowerCase() :
+ null;
+ }
+ };
+});
+
+// fix oldIE attroperties
+if ( !getSetInput || !getSetAttribute ) {
+ jQuery.attrHooks.value = {
+ set: function( elem, value, name ) {
+ if ( jQuery.nodeName( elem, "input" ) ) {
+ // Does not return so that setAttribute is also used
+ elem.defaultValue = value;
+ } else {
+ // Use nodeHook if defined (#1954); otherwise setAttribute is fine
+ return nodeHook && nodeHook.set( elem, value, name );
+ }
+ }
+ };
+}
+
+// IE6/7 do not support getting/setting some attributes with get/setAttribute
+if ( !getSetAttribute ) {
+
+ // Use this for any attribute in IE6/7
+ // This fixes almost every IE6/7 issue
+ nodeHook = {
+ set: function( elem, value, name ) {
+ // Set the existing or create a new attribute node
+ var ret = elem.getAttributeNode( name );
+ if ( !ret ) {
+ elem.setAttributeNode(
+ (ret = elem.ownerDocument.createAttribute( name ))
+ );
+ }
+
+ ret.value = value += "";
+
+ // Break association with cloned elements by also using setAttribute (#9646)
+ if ( name === "value" || value === elem.getAttribute( name ) ) {
+ return value;
+ }
+ }
+ };
+
+ // Some attributes are constructed with empty-string values when not defined
+ attrHandle.id = attrHandle.name = attrHandle.coords =
+ function( elem, name, isXML ) {
+ var ret;
+ if ( !isXML ) {
+ return (ret = elem.getAttributeNode( name )) && ret.value !== "" ?
+ ret.value :
+ null;
+ }
+ };
+
+ // Fixing value retrieval on a button requires this module
+ jQuery.valHooks.button = {
+ get: function( elem, name ) {
+ var ret = elem.getAttributeNode( name );
+ if ( ret && ret.specified ) {
+ return ret.value;
+ }
+ },
+ set: nodeHook.set
+ };
+
+ // Set contenteditable to false on removals(#10429)
+ // Setting to empty string throws an error as an invalid value
+ jQuery.attrHooks.contenteditable = {
+ set: function( elem, value, name ) {
+ nodeHook.set( elem, value === "" ? false : value, name );
+ }
+ };
+
+ // Set width and height to auto instead of 0 on empty string( Bug #8150 )
+ // This is for removals
+ jQuery.each([ "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = {
+ set: function( elem, value ) {
+ if ( value === "" ) {
+ elem.setAttribute( name, "auto" );
+ return value;
+ }
+ }
+ };
+ });
+}
+
+if ( !support.style ) {
+ jQuery.attrHooks.style = {
+ get: function( elem ) {
+ // Return undefined in the case of empty string
+ // Note: IE uppercases css property names, but if we were to .toLowerCase()
+ // .cssText, that would destroy case senstitivity in URL's, like in "background"
+ return elem.style.cssText || undefined;
+ },
+ set: function( elem, value ) {
+ return ( elem.style.cssText = value + "" );
+ }
+ };
+}
+
+
+
+
+var rfocusable = /^(?:input|select|textarea|button|object)$/i,
+ rclickable = /^(?:a|area)$/i;
+
+jQuery.fn.extend({
+ prop: function( name, value ) {
+ return access( this, jQuery.prop, name, value, arguments.length > 1 );
+ },
+
+ removeProp: function( name ) {
+ name = jQuery.propFix[ name ] || name;
+ return this.each(function() {
+ // try/catch handles cases where IE balks (such as removing a property on window)
+ try {
+ this[ name ] = undefined;
+ delete this[ name ];
+ } catch( e ) {}
+ });
+ }
+});
+
+jQuery.extend({
+ propFix: {
+ "for": "htmlFor",
+ "class": "className"
+ },
+
+ prop: function( elem, name, value ) {
+ var ret, hooks, notxml,
+ nType = elem.nodeType;
+
+ // don't get/set properties on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
+
+ if ( notxml ) {
+ // Fix name and attach hooks
+ name = jQuery.propFix[ name ] || name;
+ hooks = jQuery.propHooks[ name ];
+ }
+
+ if ( value !== undefined ) {
+ return hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ?
+ ret :
+ ( elem[ name ] = value );
+
+ } else {
+ return hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ?
+ ret :
+ elem[ name ];
+ }
+ },
+
+ propHooks: {
+ tabIndex: {
+ get: function( elem ) {
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ // Use proper attribute retrieval(#12072)
+ var tabindex = jQuery.find.attr( elem, "tabindex" );
+
+ return tabindex ?
+ parseInt( tabindex, 10 ) :
+ rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+ 0 :
+ -1;
+ }
+ }
+ }
+});
+
+// Some attributes require a special call on IE
+// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+if ( !support.hrefNormalized ) {
+ // href/src property should get the full normalized URL (#10299/#12915)
+ jQuery.each([ "href", "src" ], function( i, name ) {
+ jQuery.propHooks[ name ] = {
+ get: function( elem ) {
+ return elem.getAttribute( name, 4 );
+ }
+ };
+ });
+}
+
+// Support: Safari, IE9+
+// mis-reports the default selected property of an option
+// Accessing the parent's selectedIndex property fixes it
+if ( !support.optSelected ) {
+ jQuery.propHooks.selected = {
+ get: function( elem ) {
+ var parent = elem.parentNode;
+
+ if ( parent ) {
+ parent.selectedIndex;
+
+ // Make sure that it also works with optgroups, see #5701
+ if ( parent.parentNode ) {
+ parent.parentNode.selectedIndex;
+ }
+ }
+ return null;
+ }
+ };
+}
+
+jQuery.each([
+ "tabIndex",
+ "readOnly",
+ "maxLength",
+ "cellSpacing",
+ "cellPadding",
+ "rowSpan",
+ "colSpan",
+ "useMap",
+ "frameBorder",
+ "contentEditable"
+], function() {
+ jQuery.propFix[ this.toLowerCase() ] = this;
+});
+
+// IE6/7 call enctype encoding
+if ( !support.enctype ) {
+ jQuery.propFix.enctype = "encoding";
+}
+
+
+
+
+var rclass = /[\t\r\n\f]/g;
+
+jQuery.fn.extend({
+ addClass: function( value ) {
+ var classes, elem, cur, clazz, j, finalValue,
+ i = 0,
+ len = this.length,
+ proceed = typeof value === "string" && value;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).addClass( value.call( this, j, this.className ) );
+ });
+ }
+
+ if ( proceed ) {
+ // The disjunction here is for better compressibility (see removeClass)
+ classes = ( value || "" ).match( rnotwhite ) || [];
+
+ for ( ; i < len; i++ ) {
+ elem = this[ i ];
+ cur = elem.nodeType === 1 && ( elem.className ?
+ ( " " + elem.className + " " ).replace( rclass, " " ) :
+ " "
+ );
+
+ if ( cur ) {
+ j = 0;
+ while ( (clazz = classes[j++]) ) {
+ if ( cur.indexOf( " " + clazz + " " ) < 0 ) {
+ cur += clazz + " ";
+ }
+ }
+
+ // only assign if different to avoid unneeded rendering.
+ finalValue = jQuery.trim( cur );
+ if ( elem.className !== finalValue ) {
+ elem.className = finalValue;
+ }
+ }
+ }
+ }
+
+ return this;
+ },
+
+ removeClass: function( value ) {
+ var classes, elem, cur, clazz, j, finalValue,
+ i = 0,
+ len = this.length,
+ proceed = arguments.length === 0 || typeof value === "string" && value;
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( j ) {
+ jQuery( this ).removeClass( value.call( this, j, this.className ) );
+ });
+ }
+ if ( proceed ) {
+ classes = ( value || "" ).match( rnotwhite ) || [];
+
+ for ( ; i < len; i++ ) {
+ elem = this[ i ];
+ // This expression is here for better compressibility (see addClass)
+ cur = elem.nodeType === 1 && ( elem.className ?
+ ( " " + elem.className + " " ).replace( rclass, " " ) :
+ ""
+ );
+
+ if ( cur ) {
+ j = 0;
+ while ( (clazz = classes[j++]) ) {
+ // Remove *all* instances
+ while ( cur.indexOf( " " + clazz + " " ) >= 0 ) {
+ cur = cur.replace( " " + clazz + " ", " " );
+ }
+ }
+
+ // only assign if different to avoid unneeded rendering.
+ finalValue = value ? jQuery.trim( cur ) : "";
+ if ( elem.className !== finalValue ) {
+ elem.className = finalValue;
+ }
+ }
+ }
+ }
+
+ return this;
+ },
+
+ toggleClass: function( value, stateVal ) {
+ var type = typeof value;
+
+ if ( typeof stateVal === "boolean" && type === "string" ) {
+ return stateVal ? this.addClass( value ) : this.removeClass( value );
+ }
+
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function( i ) {
+ jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal );
+ });
+ }
+
+ return this.each(function() {
+ if ( type === "string" ) {
+ // toggle individual class names
+ var className,
+ i = 0,
+ self = jQuery( this ),
+ classNames = value.match( rnotwhite ) || [];
+
+ while ( (className = classNames[ i++ ]) ) {
+ // check each className given, space separated list
+ if ( self.hasClass( className ) ) {
+ self.removeClass( className );
+ } else {
+ self.addClass( className );
+ }
+ }
+
+ // Toggle whole class name
+ } else if ( type === strundefined || type === "boolean" ) {
+ if ( this.className ) {
+ // store className if set
+ jQuery._data( this, "__className__", this.className );
+ }
+
+ // If the element has a class name or if we're passed "false",
+ // then remove the whole classname (if there was one, the above saved it).
+ // Otherwise bring back whatever was previously saved (if anything),
+ // falling back to the empty string if nothing was stored.
+ this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
+ }
+ });
+ },
+
+ hasClass: function( selector ) {
+ var className = " " + selector + " ",
+ i = 0,
+ l = this.length;
+ for ( ; i < l; i++ ) {
+ if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+});
+
+
+
+
+// Return jQuery for attributes-only inclusion
+
+
+jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+ "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) {
+
+ // Handle event binding
+ jQuery.fn[ name ] = function( data, fn ) {
+ return arguments.length > 0 ?
+ this.on( name, null, data, fn ) :
+ this.trigger( name );
+ };
+});
+
+jQuery.fn.extend({
+ hover: function( fnOver, fnOut ) {
+ return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+ },
+
+ bind: function( types, data, fn ) {
+ return this.on( types, null, data, fn );
+ },
+ unbind: function( types, fn ) {
+ return this.off( types, null, fn );
+ },
+
+ delegate: function( selector, types, data, fn ) {
+ return this.on( types, selector, data, fn );
+ },
+ undelegate: function( selector, types, fn ) {
+ // ( namespace ) or ( selector, types [, fn] )
+ return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn );
+ }
+});
+
+
+var nonce = jQuery.now();
+
+var rquery = (/\?/);
+
+
+
+var rvalidtokens = /(,)|(\[|{)|(}|])|"(?:[^"\\\r\n]|\\["\\\/bfnrt]|\\u[\da-fA-F]{4})*"\s*:?|true|false|null|-?(?!0\d)\d+(?:\.\d+|)(?:[eE][+-]?\d+|)/g;
+
+jQuery.parseJSON = function( data ) {
+ // Attempt to parse using the native JSON parser first
+ if ( window.JSON && window.JSON.parse ) {
+ // Support: Android 2.3
+ // Workaround failure to string-cast null input
+ return window.JSON.parse( data + "" );
+ }
+
+ var requireNonComma,
+ depth = null,
+ str = jQuery.trim( data + "" );
+
+ // Guard against invalid (and possibly dangerous) input by ensuring that nothing remains
+ // after removing valid tokens
+ return str && !jQuery.trim( str.replace( rvalidtokens, function( token, comma, open, close ) {
+
+ // Force termination if we see a misplaced comma
+ if ( requireNonComma && comma ) {
+ depth = 0;
+ }
+
+ // Perform no more replacements after returning to outermost depth
+ if ( depth === 0 ) {
+ return token;
+ }
+
+ // Commas must not follow "[", "{", or ","
+ requireNonComma = open || comma;
+
+ // Determine new depth
+ // array/object open ("[" or "{"): depth += true - false (increment)
+ // array/object close ("]" or "}"): depth += false - true (decrement)
+ // other cases ("," or primitive): depth += true - true (numeric cast)
+ depth += !close - !open;
+
+ // Remove this token
+ return "";
+ }) ) ?
+ ( Function( "return " + str ) )() :
+ jQuery.error( "Invalid JSON: " + data );
+};
+
+
+// Cross-browser xml parsing
+jQuery.parseXML = function( data ) {
+ var xml, tmp;
+ if ( !data || typeof data !== "string" ) {
+ return null;
+ }
+ try {
+ if ( window.DOMParser ) { // Standard
+ tmp = new DOMParser();
+ xml = tmp.parseFromString( data, "text/xml" );
+ } else { // IE
+ xml = new ActiveXObject( "Microsoft.XMLDOM" );
+ xml.async = "false";
+ xml.loadXML( data );
+ }
+ } catch( e ) {
+ xml = undefined;
+ }
+ if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) {
+ jQuery.error( "Invalid XML: " + data );
+ }
+ return xml;
+};
+
+
+var
+ // Document location
+ ajaxLocParts,
+ ajaxLocation,
+
+ rhash = /#.*$/,
+ rts = /([?&])_=[^&]*/,
+ rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
+ // #7653, #8125, #8152: local protocol detection
+ rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
+ rnoContent = /^(?:GET|HEAD)$/,
+ rprotocol = /^\/\//,
+ rurl = /^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/,
+
+ /* Prefilters
+ * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+ * 2) These are called:
+ * - BEFORE asking for a transport
+ * - AFTER param serialization (s.data is a string if s.processData is true)
+ * 3) key is the dataType
+ * 4) the catchall symbol "*" can be used
+ * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+ */
+ prefilters = {},
+
+ /* Transports bindings
+ * 1) key is the dataType
+ * 2) the catchall symbol "*" can be used
+ * 3) selection will start with transport dataType and THEN go to "*" if needed
+ */
+ transports = {},
+
+ // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
+ allTypes = "*/".concat("*");
+
+// #8138, IE may throw an exception when accessing
+// a field from window.location if document.domain has been set
+try {
+ ajaxLocation = location.href;
+} catch( e ) {
+ // Use the href attribute of an A element
+ // since IE will modify it given document.location
+ ajaxLocation = document.createElement( "a" );
+ ajaxLocation.href = "";
+ ajaxLocation = ajaxLocation.href;
+}
+
+// Segment location into parts
+ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+ // dataTypeExpression is optional and defaults to "*"
+ return function( dataTypeExpression, func ) {
+
+ if ( typeof dataTypeExpression !== "string" ) {
+ func = dataTypeExpression;
+ dataTypeExpression = "*";
+ }
+
+ var dataType,
+ i = 0,
+ dataTypes = dataTypeExpression.toLowerCase().match( rnotwhite ) || [];
+
+ if ( jQuery.isFunction( func ) ) {
+ // For each dataType in the dataTypeExpression
+ while ( (dataType = dataTypes[i++]) ) {
+ // Prepend if requested
+ if ( dataType.charAt( 0 ) === "+" ) {
+ dataType = dataType.slice( 1 ) || "*";
+ (structure[ dataType ] = structure[ dataType ] || []).unshift( func );
+
+ // Otherwise append
+ } else {
+ (structure[ dataType ] = structure[ dataType ] || []).push( func );
+ }
+ }
+ }
+ };
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
+
+ var inspected = {},
+ seekingTransport = ( structure === transports );
+
+ function inspect( dataType ) {
+ var selected;
+ inspected[ dataType ] = true;
+ jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {
+ var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
+ if ( typeof dataTypeOrTransport === "string" && !seekingTransport && !inspected[ dataTypeOrTransport ] ) {
+ options.dataTypes.unshift( dataTypeOrTransport );
+ inspect( dataTypeOrTransport );
+ return false;
+ } else if ( seekingTransport ) {
+ return !( selected = dataTypeOrTransport );
+ }
+ });
+ return selected;
+ }
+
+ return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" );
+}
+
+// A special extend for ajax options
+// that takes "flat" options (not to be deep extended)
+// Fixes #9887
+function ajaxExtend( target, src ) {
+ var deep, key,
+ flatOptions = jQuery.ajaxSettings.flatOptions || {};
+
+ for ( key in src ) {
+ if ( src[ key ] !== undefined ) {
+ ( flatOptions[ key ] ? target : ( deep || (deep = {}) ) )[ key ] = src[ key ];
+ }
+ }
+ if ( deep ) {
+ jQuery.extend( true, target, deep );
+ }
+
+ return target;
+}
+
+/* Handles responses to an ajax request:
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+ var firstDataType, ct, finalDataType, type,
+ contents = s.contents,
+ dataTypes = s.dataTypes;
+
+ // Remove auto dataType and get content-type in the process
+ while ( dataTypes[ 0 ] === "*" ) {
+ dataTypes.shift();
+ if ( ct === undefined ) {
+ ct = s.mimeType || jqXHR.getResponseHeader("Content-Type");
+ }
+ }
+
+ // Check if we're dealing with a known content-type
+ if ( ct ) {
+ for ( type in contents ) {
+ if ( contents[ type ] && contents[ type ].test( ct ) ) {
+ dataTypes.unshift( type );
+ break;
+ }
+ }
+ }
+
+ // Check to see if we have a response for the expected dataType
+ if ( dataTypes[ 0 ] in responses ) {
+ finalDataType = dataTypes[ 0 ];
+ } else {
+ // Try convertible dataTypes
+ for ( type in responses ) {
+ if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
+ finalDataType = type;
+ break;
+ }
+ if ( !firstDataType ) {
+ firstDataType = type;
+ }
+ }
+ // Or just use first one
+ finalDataType = finalDataType || firstDataType;
+ }
+
+ // If we found a dataType
+ // We add the dataType to the list if needed
+ // and return the corresponding response
+ if ( finalDataType ) {
+ if ( finalDataType !== dataTypes[ 0 ] ) {
+ dataTypes.unshift( finalDataType );
+ }
+ return responses[ finalDataType ];
+ }
+}
+
+/* Chain conversions given the request and the original response
+ * Also sets the responseXXX fields on the jqXHR instance
+ */
+function ajaxConvert( s, response, jqXHR, isSuccess ) {
+ var conv2, current, conv, tmp, prev,
+ converters = {},
+ // Work with a copy of dataTypes in case we need to modify it for conversion
+ dataTypes = s.dataTypes.slice();
+
+ // Create converters map with lowercased keys
+ if ( dataTypes[ 1 ] ) {
+ for ( conv in s.converters ) {
+ converters[ conv.toLowerCase() ] = s.converters[ conv ];
+ }
+ }
+
+ current = dataTypes.shift();
+
+ // Convert to each sequential dataType
+ while ( current ) {
+
+ if ( s.responseFields[ current ] ) {
+ jqXHR[ s.responseFields[ current ] ] = response;
+ }
+
+ // Apply the dataFilter if provided
+ if ( !prev && isSuccess && s.dataFilter ) {
+ response = s.dataFilter( response, s.dataType );
+ }
+
+ prev = current;
+ current = dataTypes.shift();
+
+ if ( current ) {
+
+ // There's only work to do if current dataType is non-auto
+ if ( current === "*" ) {
+
+ current = prev;
+
+ // Convert response if prev dataType is non-auto and differs from current
+ } else if ( prev !== "*" && prev !== current ) {
+
+ // Seek a direct converter
+ conv = converters[ prev + " " + current ] || converters[ "* " + current ];
+
+ // If none found, seek a pair
+ if ( !conv ) {
+ for ( conv2 in converters ) {
+
+ // If conv2 outputs current
+ tmp = conv2.split( " " );
+ if ( tmp[ 1 ] === current ) {
+
+ // If prev can be converted to accepted input
+ conv = converters[ prev + " " + tmp[ 0 ] ] ||
+ converters[ "* " + tmp[ 0 ] ];
+ if ( conv ) {
+ // Condense equivalence converters
+ if ( conv === true ) {
+ conv = converters[ conv2 ];
+
+ // Otherwise, insert the intermediate dataType
+ } else if ( converters[ conv2 ] !== true ) {
+ current = tmp[ 0 ];
+ dataTypes.unshift( tmp[ 1 ] );
+ }
+ break;
+ }
+ }
+ }
+ }
+
+ // Apply converter (if not an equivalence)
+ if ( conv !== true ) {
+
+ // Unless errors are allowed to bubble, catch and return them
+ if ( conv && s[ "throws" ] ) {
+ response = conv( response );
+ } else {
+ try {
+ response = conv( response );
+ } catch ( e ) {
+ return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current };
+ }
+ }
+ }
+ }
+ }
+ }
+
+ return { state: "success", data: response };
+}
+
+jQuery.extend({
+
+ // Counter for holding the number of active queries
+ active: 0,
+
+ // Last-Modified header cache for next request
+ lastModified: {},
+ etag: {},
+
+ ajaxSettings: {
+ url: ajaxLocation,
+ type: "GET",
+ isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
+ global: true,
+ processData: true,
+ async: true,
+ contentType: "application/x-www-form-urlencoded; charset=UTF-8",
+ /*
+ timeout: 0,
+ data: null,
+ dataType: null,
+ username: null,
+ password: null,
+ cache: null,
+ throws: false,
+ traditional: false,
+ headers: {},
+ */
+
+ accepts: {
+ "*": allTypes,
+ text: "text/plain",
+ html: "text/html",
+ xml: "application/xml, text/xml",
+ json: "application/json, text/javascript"
+ },
+
+ contents: {
+ xml: /xml/,
+ html: /html/,
+ json: /json/
+ },
+
+ responseFields: {
+ xml: "responseXML",
+ text: "responseText",
+ json: "responseJSON"
+ },
+
+ // Data converters
+ // Keys separate source (or catchall "*") and destination types with a single space
+ converters: {
+
+ // Convert anything to text
+ "* text": String,
+
+ // Text to html (true = no transformation)
+ "text html": true,
+
+ // Evaluate text as a json expression
+ "text json": jQuery.parseJSON,
+
+ // Parse text as xml
+ "text xml": jQuery.parseXML
+ },
+
+ // For options that shouldn't be deep extended:
+ // you can add your own custom options here if
+ // and when you create one that shouldn't be
+ // deep extended (see ajaxExtend)
+ flatOptions: {
+ url: true,
+ context: true
+ }
+ },
+
+ // Creates a full fledged settings object into target
+ // with both ajaxSettings and settings fields.
+ // If target is omitted, writes into ajaxSettings.
+ ajaxSetup: function( target, settings ) {
+ return settings ?
+
+ // Building a settings object
+ ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
+
+ // Extending ajaxSettings
+ ajaxExtend( jQuery.ajaxSettings, target );
+ },
+
+ ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+ ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+ // Main method
+ ajax: function( url, options ) {
+
+ // If url is an object, simulate pre-1.5 signature
+ if ( typeof url === "object" ) {
+ options = url;
+ url = undefined;
+ }
+
+ // Force options to be an object
+ options = options || {};
+
+ var // Cross-domain detection vars
+ parts,
+ // Loop variable
+ i,
+ // URL without anti-cache param
+ cacheURL,
+ // Response headers as string
+ responseHeadersString,
+ // timeout handle
+ timeoutTimer,
+
+ // To know if global events are to be dispatched
+ fireGlobals,
+
+ transport,
+ // Response headers
+ responseHeaders,
+ // Create the final options object
+ s = jQuery.ajaxSetup( {}, options ),
+ // Callbacks context
+ callbackContext = s.context || s,
+ // Context for global events is callbackContext if it is a DOM node or jQuery collection
+ globalEventContext = s.context && ( callbackContext.nodeType || callbackContext.jquery ) ?
+ jQuery( callbackContext ) :
+ jQuery.event,
+ // Deferreds
+ deferred = jQuery.Deferred(),
+ completeDeferred = jQuery.Callbacks("once memory"),
+ // Status-dependent callbacks
+ statusCode = s.statusCode || {},
+ // Headers (they are sent all at once)
+ requestHeaders = {},
+ requestHeadersNames = {},
+ // The jqXHR state
+ state = 0,
+ // Default abort message
+ strAbort = "canceled",
+ // Fake xhr
+ jqXHR = {
+ readyState: 0,
+
+ // Builds headers hashtable if needed
+ getResponseHeader: function( key ) {
+ var match;
+ if ( state === 2 ) {
+ if ( !responseHeaders ) {
+ responseHeaders = {};
+ while ( (match = rheaders.exec( responseHeadersString )) ) {
+ responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
+ }
+ }
+ match = responseHeaders[ key.toLowerCase() ];
+ }
+ return match == null ? null : match;
+ },
+
+ // Raw string
+ getAllResponseHeaders: function() {
+ return state === 2 ? responseHeadersString : null;
+ },
+
+ // Caches the header
+ setRequestHeader: function( name, value ) {
+ var lname = name.toLowerCase();
+ if ( !state ) {
+ name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
+ requestHeaders[ name ] = value;
+ }
+ return this;
+ },
+
+ // Overrides response content-type header
+ overrideMimeType: function( type ) {
+ if ( !state ) {
+ s.mimeType = type;
+ }
+ return this;
+ },
+
+ // Status-dependent callbacks
+ statusCode: function( map ) {
+ var code;
+ if ( map ) {
+ if ( state < 2 ) {
+ for ( code in map ) {
+ // Lazy-add the new callback in a way that preserves old ones
+ statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
+ }
+ } else {
+ // Execute the appropriate callbacks
+ jqXHR.always( map[ jqXHR.status ] );
+ }
+ }
+ return this;
+ },
+
+ // Cancel the request
+ abort: function( statusText ) {
+ var finalText = statusText || strAbort;
+ if ( transport ) {
+ transport.abort( finalText );
+ }
+ done( 0, finalText );
+ return this;
+ }
+ };
+
+ // Attach deferreds
+ deferred.promise( jqXHR ).complete = completeDeferred.add;
+ jqXHR.success = jqXHR.done;
+ jqXHR.error = jqXHR.fail;
+
+ // Remove hash character (#7531: and string promotion)
+ // Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
+ // Handle falsy url in the settings object (#10093: consistency with old signature)
+ // We also use the url parameter if available
+ s.url = ( ( url || s.url || ajaxLocation ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
+
+ // Alias method option to type as per ticket #12004
+ s.type = options.method || options.type || s.method || s.type;
+
+ // Extract dataTypes list
+ s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().match( rnotwhite ) || [ "" ];
+
+ // A cross-domain request is in order when we have a protocol:host:port mismatch
+ if ( s.crossDomain == null ) {
+ parts = rurl.exec( s.url.toLowerCase() );
+ s.crossDomain = !!( parts &&
+ ( parts[ 1 ] !== ajaxLocParts[ 1 ] || parts[ 2 ] !== ajaxLocParts[ 2 ] ||
+ ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? "80" : "443" ) ) !==
+ ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? "80" : "443" ) ) )
+ );
+ }
+
+ // Convert data if not already a string
+ if ( s.data && s.processData && typeof s.data !== "string" ) {
+ s.data = jQuery.param( s.data, s.traditional );
+ }
+
+ // Apply prefilters
+ inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+ // If request was aborted inside a prefilter, stop there
+ if ( state === 2 ) {
+ return jqXHR;
+ }
+
+ // We can fire global events as of now if asked to
+ fireGlobals = s.global;
+
+ // Watch for a new set of requests
+ if ( fireGlobals && jQuery.active++ === 0 ) {
+ jQuery.event.trigger("ajaxStart");
+ }
+
+ // Uppercase the type
+ s.type = s.type.toUpperCase();
+
+ // Determine if request has content
+ s.hasContent = !rnoContent.test( s.type );
+
+ // Save the URL in case we're toying with the If-Modified-Since
+ // and/or If-None-Match header later on
+ cacheURL = s.url;
+
+ // More options handling for requests with no content
+ if ( !s.hasContent ) {
+
+ // If data is available, append data to url
+ if ( s.data ) {
+ cacheURL = ( s.url += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data );
+ // #9682: remove data so that it's not used in an eventual retry
+ delete s.data;
+ }
+
+ // Add anti-cache in url if needed
+ if ( s.cache === false ) {
+ s.url = rts.test( cacheURL ) ?
+
+ // If there is already a '_' parameter, set its value
+ cacheURL.replace( rts, "$1_=" + nonce++ ) :
+
+ // Otherwise add one to the end
+ cacheURL + ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + nonce++;
+ }
+ }
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ if ( jQuery.lastModified[ cacheURL ] ) {
+ jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
+ }
+ if ( jQuery.etag[ cacheURL ] ) {
+ jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
+ }
+ }
+
+ // Set the correct header, if data is being sent
+ if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+ jqXHR.setRequestHeader( "Content-Type", s.contentType );
+ }
+
+ // Set the Accepts header for the server, depending on the dataType
+ jqXHR.setRequestHeader(
+ "Accept",
+ s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
+ s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+ s.accepts[ "*" ]
+ );
+
+ // Check for headers option
+ for ( i in s.headers ) {
+ jqXHR.setRequestHeader( i, s.headers[ i ] );
+ }
+
+ // Allow custom headers/mimetypes and early abort
+ if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
+ // Abort if not done already and return
+ return jqXHR.abort();
+ }
+
+ // aborting is no longer a cancellation
+ strAbort = "abort";
+
+ // Install callbacks on deferreds
+ for ( i in { success: 1, error: 1, complete: 1 } ) {
+ jqXHR[ i ]( s[ i ] );
+ }
+
+ // Get transport
+ transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+ // If no transport, we auto-abort
+ if ( !transport ) {
+ done( -1, "No Transport" );
+ } else {
+ jqXHR.readyState = 1;
+
+ // Send global event
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+ }
+ // Timeout
+ if ( s.async && s.timeout > 0 ) {
+ timeoutTimer = setTimeout(function() {
+ jqXHR.abort("timeout");
+ }, s.timeout );
+ }
+
+ try {
+ state = 1;
+ transport.send( requestHeaders, done );
+ } catch ( e ) {
+ // Propagate exception as error if not done
+ if ( state < 2 ) {
+ done( -1, e );
+ // Simply rethrow otherwise
+ } else {
+ throw e;
+ }
+ }
+ }
+
+ // Callback for when everything is done
+ function done( status, nativeStatusText, responses, headers ) {
+ var isSuccess, success, error, response, modified,
+ statusText = nativeStatusText;
+
+ // Called once
+ if ( state === 2 ) {
+ return;
+ }
+
+ // State is "done" now
+ state = 2;
+
+ // Clear timeout if it exists
+ if ( timeoutTimer ) {
+ clearTimeout( timeoutTimer );
+ }
+
+ // Dereference transport for early garbage collection
+ // (no matter how long the jqXHR object will be used)
+ transport = undefined;
+
+ // Cache response headers
+ responseHeadersString = headers || "";
+
+ // Set readyState
+ jqXHR.readyState = status > 0 ? 4 : 0;
+
+ // Determine if successful
+ isSuccess = status >= 200 && status < 300 || status === 304;
+
+ // Get response data
+ if ( responses ) {
+ response = ajaxHandleResponses( s, jqXHR, responses );
+ }
+
+ // Convert no matter what (that way responseXXX fields are always set)
+ response = ajaxConvert( s, response, jqXHR, isSuccess );
+
+ // If successful, handle type chaining
+ if ( isSuccess ) {
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ modified = jqXHR.getResponseHeader("Last-Modified");
+ if ( modified ) {
+ jQuery.lastModified[ cacheURL ] = modified;
+ }
+ modified = jqXHR.getResponseHeader("etag");
+ if ( modified ) {
+ jQuery.etag[ cacheURL ] = modified;
+ }
+ }
+
+ // if no content
+ if ( status === 204 || s.type === "HEAD" ) {
+ statusText = "nocontent";
+
+ // if not modified
+ } else if ( status === 304 ) {
+ statusText = "notmodified";
+
+ // If we have data, let's convert it
+ } else {
+ statusText = response.state;
+ success = response.data;
+ error = response.error;
+ isSuccess = !error;
+ }
+ } else {
+ // We extract error from statusText
+ // then normalize statusText and status for non-aborts
+ error = statusText;
+ if ( status || !statusText ) {
+ statusText = "error";
+ if ( status < 0 ) {
+ status = 0;
+ }
+ }
+ }
+
+ // Set data for the fake xhr object
+ jqXHR.status = status;
+ jqXHR.statusText = ( nativeStatusText || statusText ) + "";
+
+ // Success/Error
+ if ( isSuccess ) {
+ deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+ } else {
+ deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+ }
+
+ // Status-dependent callbacks
+ jqXHR.statusCode( statusCode );
+ statusCode = undefined;
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
+ [ jqXHR, s, isSuccess ? success : error ] );
+ }
+
+ // Complete
+ completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
+ // Handle the global AJAX counter
+ if ( !( --jQuery.active ) ) {
+ jQuery.event.trigger("ajaxStop");
+ }
+ }
+ }
+
+ return jqXHR;
+ },
+
+ getJSON: function( url, data, callback ) {
+ return jQuery.get( url, data, callback, "json" );
+ },
+
+ getScript: function( url, callback ) {
+ return jQuery.get( url, undefined, callback, "script" );
+ }
+});
+
+jQuery.each( [ "get", "post" ], function( i, method ) {
+ jQuery[ method ] = function( url, data, callback, type ) {
+ // shift arguments if data argument was omitted
+ if ( jQuery.isFunction( data ) ) {
+ type = type || callback;
+ callback = data;
+ data = undefined;
+ }
+
+ return jQuery.ajax({
+ url: url,
+ type: method,
+ dataType: type,
+ data: data,
+ success: callback
+ });
+ };
+});
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( [ "ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend" ], function( i, type ) {
+ jQuery.fn[ type ] = function( fn ) {
+ return this.on( type, fn );
+ };
+});
+
+
+jQuery._evalUrl = function( url ) {
+ return jQuery.ajax({
+ url: url,
+ type: "GET",
+ dataType: "script",
+ async: false,
+ global: false,
+ "throws": true
+ });
+};
+
+
+jQuery.fn.extend({
+ wrapAll: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapAll( html.call(this, i) );
+ });
+ }
+
+ if ( this[0] ) {
+ // The elements to wrap the target around
+ var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
+
+ if ( this[0].parentNode ) {
+ wrap.insertBefore( this[0] );
+ }
+
+ wrap.map(function() {
+ var elem = this;
+
+ while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+ elem = elem.firstChild;
+ }
+
+ return elem;
+ }).append( this );
+ }
+
+ return this;
+ },
+
+ wrapInner: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapInner( html.call(this, i) );
+ });
+ }
+
+ return this.each(function() {
+ var self = jQuery( this ),
+ contents = self.contents();
+
+ if ( contents.length ) {
+ contents.wrapAll( html );
+
+ } else {
+ self.append( html );
+ }
+ });
+ },
+
+ wrap: function( html ) {
+ var isFunction = jQuery.isFunction( html );
+
+ return this.each(function(i) {
+ jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html );
+ });
+ },
+
+ unwrap: function() {
+ return this.parent().each(function() {
+ if ( !jQuery.nodeName( this, "body" ) ) {
+ jQuery( this ).replaceWith( this.childNodes );
+ }
+ }).end();
+ }
+});
+
+
+jQuery.expr.filters.hidden = function( elem ) {
+ // Support: Opera <= 12.12
+ // Opera reports offsetWidths and offsetHeights less than zero on some elements
+ return elem.offsetWidth <= 0 && elem.offsetHeight <= 0 ||
+ (!support.reliableHiddenOffsets() &&
+ ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none");
+};
+
+jQuery.expr.filters.visible = function( elem ) {
+ return !jQuery.expr.filters.hidden( elem );
+};
+
+
+
+
+var r20 = /%20/g,
+ rbracket = /\[\]$/,
+ rCRLF = /\r?\n/g,
+ rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
+ rsubmittable = /^(?:input|select|textarea|keygen)/i;
+
+function buildParams( prefix, obj, traditional, add ) {
+ var name;
+
+ if ( jQuery.isArray( obj ) ) {
+ // Serialize array item.
+ jQuery.each( obj, function( i, v ) {
+ if ( traditional || rbracket.test( prefix ) ) {
+ // Treat each array item as a scalar.
+ add( prefix, v );
+
+ } else {
+ // Item is non-scalar (array or object), encode its numeric index.
+ buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add );
+ }
+ });
+
+ } else if ( !traditional && jQuery.type( obj ) === "object" ) {
+ // Serialize object item.
+ for ( name in obj ) {
+ buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+ }
+
+ } else {
+ // Serialize scalar item.
+ add( prefix, obj );
+ }
+}
+
+// Serialize an array of form elements or a set of
+// key/values into a query string
+jQuery.param = function( a, traditional ) {
+ var prefix,
+ s = [],
+ add = function( key, value ) {
+ // If value is a function, invoke it and return its value
+ value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value );
+ s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
+ };
+
+ // Set traditional to true for jQuery <= 1.3.2 behavior.
+ if ( traditional === undefined ) {
+ traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
+ }
+
+ // If an array was passed in, assume that it is an array of form elements.
+ if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+ // Serialize the form elements
+ jQuery.each( a, function() {
+ add( this.name, this.value );
+ });
+
+ } else {
+ // If traditional, encode the "old" way (the way 1.3.2 or older
+ // did it), otherwise encode params recursively.
+ for ( prefix in a ) {
+ buildParams( prefix, a[ prefix ], traditional, add );
+ }
+ }
+
+ // Return the resulting serialization
+ return s.join( "&" ).replace( r20, "+" );
+};
+
+jQuery.fn.extend({
+ serialize: function() {
+ return jQuery.param( this.serializeArray() );
+ },
+ serializeArray: function() {
+ return this.map(function() {
+ // Can add propHook for "elements" to filter or add form elements
+ var elements = jQuery.prop( this, "elements" );
+ return elements ? jQuery.makeArray( elements ) : this;
+ })
+ .filter(function() {
+ var type = this.type;
+ // Use .is(":disabled") so that fieldset[disabled] works
+ return this.name && !jQuery( this ).is( ":disabled" ) &&
+ rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
+ ( this.checked || !rcheckableType.test( type ) );
+ })
+ .map(function( i, elem ) {
+ var val = jQuery( this ).val();
+
+ return val == null ?
+ null :
+ jQuery.isArray( val ) ?
+ jQuery.map( val, function( val ) {
+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }) :
+ { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ }).get();
+ }
+});
+
+
+// Create the request object
+// (This is still attached to ajaxSettings for backward compatibility)
+jQuery.ajaxSettings.xhr = window.ActiveXObject !== undefined ?
+ // Support: IE6+
+ function() {
+
+ // XHR cannot access local files, always use ActiveX for that case
+ return !this.isLocal &&
+
+ // Support: IE7-8
+ // oldIE XHR does not support non-RFC2616 methods (#13240)
+ // See http://msdn.microsoft.com/en-us/library/ie/ms536648(v=vs.85).aspx
+ // and http://www.w3.org/Protocols/rfc2616/rfc2616-sec9.html#sec9
+ // Although this check for six methods instead of eight
+ // since IE also does not support "trace" and "connect"
+ /^(get|post|head|put|delete|options)$/i.test( this.type ) &&
+
+ createStandardXHR() || createActiveXHR();
+ } :
+ // For all other browsers, use the standard XMLHttpRequest object
+ createStandardXHR;
+
+var xhrId = 0,
+ xhrCallbacks = {},
+ xhrSupported = jQuery.ajaxSettings.xhr();
+
+// Support: IE<10
+// Open requests must be manually aborted on unload (#5280)
+if ( window.ActiveXObject ) {
+ jQuery( window ).on( "unload", function() {
+ for ( var key in xhrCallbacks ) {
+ xhrCallbacks[ key ]( undefined, true );
+ }
+ });
+}
+
+// Determine support properties
+support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
+xhrSupported = support.ajax = !!xhrSupported;
+
+// Create transport if the browser can provide an xhr
+if ( xhrSupported ) {
+
+ jQuery.ajaxTransport(function( options ) {
+ // Cross domain only allowed if supported through XMLHttpRequest
+ if ( !options.crossDomain || support.cors ) {
+
+ var callback;
+
+ return {
+ send: function( headers, complete ) {
+ var i,
+ xhr = options.xhr(),
+ id = ++xhrId;
+
+ // Open the socket
+ xhr.open( options.type, options.url, options.async, options.username, options.password );
+
+ // Apply custom fields if provided
+ if ( options.xhrFields ) {
+ for ( i in options.xhrFields ) {
+ xhr[ i ] = options.xhrFields[ i ];
+ }
+ }
+
+ // Override mime type if needed
+ if ( options.mimeType && xhr.overrideMimeType ) {
+ xhr.overrideMimeType( options.mimeType );
+ }
+
+ // X-Requested-With header
+ // For cross-domain requests, seeing as conditions for a preflight are
+ // akin to a jigsaw puzzle, we simply never set it to be sure.
+ // (it can always be set on a per-request basis or even using ajaxSetup)
+ // For same-domain requests, won't change header if already provided.
+ if ( !options.crossDomain && !headers["X-Requested-With"] ) {
+ headers["X-Requested-With"] = "XMLHttpRequest";
+ }
+
+ // Set headers
+ for ( i in headers ) {
+ // Support: IE<9
+ // IE's ActiveXObject throws a 'Type Mismatch' exception when setting
+ // request header to a null-value.
+ //
+ // To keep consistent with other XHR implementations, cast the value
+ // to string and ignore `undefined`.
+ if ( headers[ i ] !== undefined ) {
+ xhr.setRequestHeader( i, headers[ i ] + "" );
+ }
+ }
+
+ // Do send the request
+ // This may raise an exception which is actually
+ // handled in jQuery.ajax (so no try/catch here)
+ xhr.send( ( options.hasContent && options.data ) || null );
+
+ // Listener
+ callback = function( _, isAbort ) {
+ var status, statusText, responses;
+
+ // Was never called and is aborted or complete
+ if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
+ // Clean up
+ delete xhrCallbacks[ id ];
+ callback = undefined;
+ xhr.onreadystatechange = jQuery.noop;
+
+ // Abort manually if needed
+ if ( isAbort ) {
+ if ( xhr.readyState !== 4 ) {
+ xhr.abort();
+ }
+ } else {
+ responses = {};
+ status = xhr.status;
+
+ // Support: IE<10
+ // Accessing binary-data responseText throws an exception
+ // (#11426)
+ if ( typeof xhr.responseText === "string" ) {
+ responses.text = xhr.responseText;
+ }
+
+ // Firefox throws an exception when accessing
+ // statusText for faulty cross-domain requests
+ try {
+ statusText = xhr.statusText;
+ } catch( e ) {
+ // We normalize with Webkit giving an empty statusText
+ statusText = "";
+ }
+
+ // Filter status for non standard behaviors
+
+ // If the request is local and we have data: assume a success
+ // (success with no data won't get notified, that's the best we
+ // can do given current implementations)
+ if ( !status && options.isLocal && !options.crossDomain ) {
+ status = responses.text ? 200 : 404;
+ // IE - #1450: sometimes returns 1223 when it should be 204
+ } else if ( status === 1223 ) {
+ status = 204;
+ }
+ }
+ }
+
+ // Call complete if needed
+ if ( responses ) {
+ complete( status, statusText, responses, xhr.getAllResponseHeaders() );
+ }
+ };
+
+ if ( !options.async ) {
+ // if we're in sync mode we fire the callback
+ callback();
+ } else if ( xhr.readyState === 4 ) {
+ // (IE6 & IE7) if it's in cache and has been
+ // retrieved directly we need to fire the callback
+ setTimeout( callback );
+ } else {
+ // Add to the list of active xhr callbacks
+ xhr.onreadystatechange = xhrCallbacks[ id ] = callback;
+ }
+ },
+
+ abort: function() {
+ if ( callback ) {
+ callback( undefined, true );
+ }
+ }
+ };
+ }
+ });
+}
+
+// Functions to create xhrs
+function createStandardXHR() {
+ try {
+ return new window.XMLHttpRequest();
+ } catch( e ) {}
+}
+
+function createActiveXHR() {
+ try {
+ return new window.ActiveXObject( "Microsoft.XMLHTTP" );
+ } catch( e ) {}
+}
+
+
+
+
+// Install script dataType
+jQuery.ajaxSetup({
+ accepts: {
+ script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
+ },
+ contents: {
+ script: /(?:java|ecma)script/
+ },
+ converters: {
+ "text script": function( text ) {
+ jQuery.globalEval( text );
+ return text;
+ }
+ }
+});
+
+// Handle cache's special case and global
+jQuery.ajaxPrefilter( "script", function( s ) {
+ if ( s.cache === undefined ) {
+ s.cache = false;
+ }
+ if ( s.crossDomain ) {
+ s.type = "GET";
+ s.global = false;
+ }
+});
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function(s) {
+
+ // This transport only deals with cross domain requests
+ if ( s.crossDomain ) {
+
+ var script,
+ head = document.head || jQuery("head")[0] || document.documentElement;
+
+ return {
+
+ send: function( _, callback ) {
+
+ script = document.createElement("script");
+
+ script.async = true;
+
+ if ( s.scriptCharset ) {
+ script.charset = s.scriptCharset;
+ }
+
+ script.src = s.url;
+
+ // Attach handlers for all browsers
+ script.onload = script.onreadystatechange = function( _, isAbort ) {
+
+ if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) {
+
+ // Handle memory leak in IE
+ script.onload = script.onreadystatechange = null;
+
+ // Remove the script
+ if ( script.parentNode ) {
+ script.parentNode.removeChild( script );
+ }
+
+ // Dereference the script
+ script = null;
+
+ // Callback if not abort
+ if ( !isAbort ) {
+ callback( 200, "success" );
+ }
+ }
+ };
+
+ // Circumvent IE6 bugs with base elements (#2709 and #4378) by prepending
+ // Use native DOM manipulation to avoid our domManip AJAX trickery
+ head.insertBefore( script, head.firstChild );
+ },
+
+ abort: function() {
+ if ( script ) {
+ script.onload( undefined, true );
+ }
+ }
+ };
+ }
+});
+
+
+
+
+var oldCallbacks = [],
+ rjsonp = /(=)\?(?=&|$)|\?\?/;
+
+// Default jsonp settings
+jQuery.ajaxSetup({
+ jsonp: "callback",
+ jsonpCallback: function() {
+ var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) );
+ this[ callback ] = true;
+ return callback;
+ }
+});
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+ var callbackName, overwritten, responseContainer,
+ jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
+ "url" :
+ typeof s.data === "string" && !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") && rjsonp.test( s.data ) && "data"
+ );
+
+ // Handle iff the expected data type is "jsonp" or we have a parameter to set
+ if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) {
+
+ // Get callback name, remembering preexisting value associated with it
+ callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ?
+ s.jsonpCallback() :
+ s.jsonpCallback;
+
+ // Insert callback into url or form data
+ if ( jsonProp ) {
+ s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
+ } else if ( s.jsonp !== false ) {
+ s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
+ }
+
+ // Use data converter to retrieve json after script execution
+ s.converters["script json"] = function() {
+ if ( !responseContainer ) {
+ jQuery.error( callbackName + " was not called" );
+ }
+ return responseContainer[ 0 ];
+ };
+
+ // force json dataType
+ s.dataTypes[ 0 ] = "json";
+
+ // Install callback
+ overwritten = window[ callbackName ];
+ window[ callbackName ] = function() {
+ responseContainer = arguments;
+ };
+
+ // Clean-up function (fires after converters)
+ jqXHR.always(function() {
+ // Restore preexisting value
+ window[ callbackName ] = overwritten;
+
+ // Save back as free
+ if ( s[ callbackName ] ) {
+ // make sure that re-using the options doesn't screw things around
+ s.jsonpCallback = originalSettings.jsonpCallback;
+
+ // save the callback name for future use
+ oldCallbacks.push( callbackName );
+ }
+
+ // Call if it was a function and we have a response
+ if ( responseContainer && jQuery.isFunction( overwritten ) ) {
+ overwritten( responseContainer[ 0 ] );
+ }
+
+ responseContainer = overwritten = undefined;
+ });
+
+ // Delegate to script
+ return "script";
+ }
+});
+
+
+
+
+// data: string of html
+// context (optional): If specified, the fragment will be created in this context, defaults to document
+// keepScripts (optional): If true, will include scripts passed in the html string
+jQuery.parseHTML = function( data, context, keepScripts ) {
+ if ( !data || typeof data !== "string" ) {
+ return null;
+ }
+ if ( typeof context === "boolean" ) {
+ keepScripts = context;
+ context = false;
+ }
+ context = context || document;
+
+ var parsed = rsingleTag.exec( data ),
+ scripts = !keepScripts && [];
+
+ // Single tag
+ if ( parsed ) {
+ return [ context.createElement( parsed[1] ) ];
+ }
+
+ parsed = jQuery.buildFragment( [ data ], context, scripts );
+
+ if ( scripts && scripts.length ) {
+ jQuery( scripts ).remove();
+ }
+
+ return jQuery.merge( [], parsed.childNodes );
+};
+
+
+// Keep a copy of the old load method
+var _load = jQuery.fn.load;
+
+/**
+ * Load a url into a page
+ */
+jQuery.fn.load = function( url, params, callback ) {
+ if ( typeof url !== "string" && _load ) {
+ return _load.apply( this, arguments );
+ }
+
+ var selector, response, type,
+ self = this,
+ off = url.indexOf(" ");
+
+ if ( off >= 0 ) {
+ selector = url.slice( off, url.length );
+ url = url.slice( 0, off );
+ }
+
+ // If it's a function
+ if ( jQuery.isFunction( params ) ) {
+
+ // We assume that it's the callback
+ callback = params;
+ params = undefined;
+
+ // Otherwise, build a param string
+ } else if ( params && typeof params === "object" ) {
+ type = "POST";
+ }
+
+ // If we have elements to modify, make the request
+ if ( self.length > 0 ) {
+ jQuery.ajax({
+ url: url,
+
+ // if "type" variable is undefined, then "GET" method will be used
+ type: type,
+ dataType: "html",
+ data: params
+ }).done(function( responseText ) {
+
+ // Save response for use in complete callback
+ response = arguments;
+
+ self.html( selector ?
+
+ // If a selector was specified, locate the right elements in a dummy div
+ // Exclude scripts to avoid IE 'Permission Denied' errors
+ jQuery("<div>").append( jQuery.parseHTML( responseText ) ).find( selector ) :
+
+ // Otherwise use the full result
+ responseText );
+
+ }).complete( callback && function( jqXHR, status ) {
+ self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] );
+ });
+ }
+
+ return this;
+};
+
+
+
+
+jQuery.expr.filters.animated = function( elem ) {
+ return jQuery.grep(jQuery.timers, function( fn ) {
+ return elem === fn.elem;
+ }).length;
+};
+
+
+
+
+
+var docElem = window.document.documentElement;
+
+/**
+ * Gets a window from an element
+ */
+function getWindow( elem ) {
+ return jQuery.isWindow( elem ) ?
+ elem :
+ elem.nodeType === 9 ?
+ elem.defaultView || elem.parentWindow :
+ false;
+}
+
+jQuery.offset = {
+ setOffset: function( elem, options, i ) {
+ var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
+ position = jQuery.css( elem, "position" ),
+ curElem = jQuery( elem ),
+ props = {};
+
+ // set position first, in-case top/left are set even on static elem
+ if ( position === "static" ) {
+ elem.style.position = "relative";
+ }
+
+ curOffset = curElem.offset();
+ curCSSTop = jQuery.css( elem, "top" );
+ curCSSLeft = jQuery.css( elem, "left" );
+ calculatePosition = ( position === "absolute" || position === "fixed" ) &&
+ jQuery.inArray("auto", [ curCSSTop, curCSSLeft ] ) > -1;
+
+ // need to be able to calculate position if either top or left is auto and position is either absolute or fixed
+ if ( calculatePosition ) {
+ curPosition = curElem.position();
+ curTop = curPosition.top;
+ curLeft = curPosition.left;
+ } else {
+ curTop = parseFloat( curCSSTop ) || 0;
+ curLeft = parseFloat( curCSSLeft ) || 0;
+ }
+
+ if ( jQuery.isFunction( options ) ) {
+ options = options.call( elem, i, curOffset );
+ }
+
+ if ( options.top != null ) {
+ props.top = ( options.top - curOffset.top ) + curTop;
+ }
+ if ( options.left != null ) {
+ props.left = ( options.left - curOffset.left ) + curLeft;
+ }
+
+ if ( "using" in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ }
+};
+
+jQuery.fn.extend({
+ offset: function( options ) {
+ if ( arguments.length ) {
+ return options === undefined ?
+ this :
+ this.each(function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ });
+ }
+
+ var docElem, win,
+ box = { top: 0, left: 0 },
+ elem = this[ 0 ],
+ doc = elem && elem.ownerDocument;
+
+ if ( !doc ) {
+ return;
+ }
+
+ docElem = doc.documentElement;
+
+ // Make sure it's not a disconnected DOM node
+ if ( !jQuery.contains( docElem, elem ) ) {
+ return box;
+ }
+
+ // If we don't have gBCR, just use 0,0 rather than error
+ // BlackBerry 5, iOS 3 (original iPhone)
+ if ( typeof elem.getBoundingClientRect !== strundefined ) {
+ box = elem.getBoundingClientRect();
+ }
+ win = getWindow( doc );
+ return {
+ top: box.top + ( win.pageYOffset || docElem.scrollTop ) - ( docElem.clientTop || 0 ),
+ left: box.left + ( win.pageXOffset || docElem.scrollLeft ) - ( docElem.clientLeft || 0 )
+ };
+ },
+
+ position: function() {
+ if ( !this[ 0 ] ) {
+ return;
+ }
+
+ var offsetParent, offset,
+ parentOffset = { top: 0, left: 0 },
+ elem = this[ 0 ];
+
+ // fixed elements are offset from window (parentOffset = {top:0, left: 0}, because it is its only offset parent
+ if ( jQuery.css( elem, "position" ) === "fixed" ) {
+ // we assume that getBoundingClientRect is available when computed position is fixed
+ offset = elem.getBoundingClientRect();
+ } else {
+ // Get *real* offsetParent
+ offsetParent = this.offsetParent();
+
+ // Get correct offsets
+ offset = this.offset();
+ if ( !jQuery.nodeName( offsetParent[ 0 ], "html" ) ) {
+ parentOffset = offsetParent.offset();
+ }
+
+ // Add offsetParent borders
+ parentOffset.top += jQuery.css( offsetParent[ 0 ], "borderTopWidth", true );
+ parentOffset.left += jQuery.css( offsetParent[ 0 ], "borderLeftWidth", true );
+ }
+
+ // Subtract parent offsets and element margins
+ // note: when an element has margin: auto the offsetLeft and marginLeft
+ // are the same in Safari causing offset.left to incorrectly be 0
+ return {
+ top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ),
+ left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true)
+ };
+ },
+
+ offsetParent: function() {
+ return this.map(function() {
+ var offsetParent = this.offsetParent || docElem;
+
+ while ( offsetParent && ( !jQuery.nodeName( offsetParent, "html" ) && jQuery.css( offsetParent, "position" ) === "static" ) ) {
+ offsetParent = offsetParent.offsetParent;
+ }
+ return offsetParent || docElem;
+ });
+ }
+});
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) {
+ var top = /Y/.test( prop );
+
+ jQuery.fn[ method ] = function( val ) {
+ return access( this, function( elem, method, val ) {
+ var win = getWindow( elem );
+
+ if ( val === undefined ) {
+ return win ? (prop in win) ? win[ prop ] :
+ win.document.documentElement[ method ] :
+ elem[ method ];
+ }
+
+ if ( win ) {
+ win.scrollTo(
+ !top ? val : jQuery( win ).scrollLeft(),
+ top ? val : jQuery( win ).scrollTop()
+ );
+
+ } else {
+ elem[ method ] = val;
+ }
+ }, method, val, arguments.length, null );
+ };
+});
+
+// Add the top/left cssHooks using jQuery.fn.position
+// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
+// getComputedStyle returns percent when specified for top/left/bottom/right
+// rather than make the css module depend on the offset module, we just check for it here
+jQuery.each( [ "top", "left" ], function( i, prop ) {
+ jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,
+ function( elem, computed ) {
+ if ( computed ) {
+ computed = curCSS( elem, prop );
+ // if curCSS returns percentage, fallback to offset
+ return rnumnonpx.test( computed ) ?
+ jQuery( elem ).position()[ prop ] + "px" :
+ computed;
+ }
+ }
+ );
+});
+
+
+// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
+jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
+ jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) {
+ // margin is only for outerHeight, outerWidth
+ jQuery.fn[ funcName ] = function( margin, value ) {
+ var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
+ extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
+
+ return access( this, function( elem, type, value ) {
+ var doc;
+
+ if ( jQuery.isWindow( elem ) ) {
+ // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there
+ // isn't a whole lot we can do. See pull request at this URL for discussion:
+ // https://github.com/jquery/jquery/pull/764
+ return elem.document.documentElement[ "client" + name ];
+ }
+
+ // Get document width or height
+ if ( elem.nodeType === 9 ) {
+ doc = elem.documentElement;
+
+ // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest
+ // unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it.
+ return Math.max(
+ elem.body[ "scroll" + name ], doc[ "scroll" + name ],
+ elem.body[ "offset" + name ], doc[ "offset" + name ],
+ doc[ "client" + name ]
+ );
+ }
+
+ return value === undefined ?
+ // Get width or height on the element, requesting but not forcing parseFloat
+ jQuery.css( elem, type, extra ) :
+
+ // Set width or height on the element
+ jQuery.style( elem, type, value, extra );
+ }, type, chainable ? margin : undefined, chainable, null );
+ };
+ });
+});
+
+
+// The number of elements contained in the matched element set
+jQuery.fn.size = function() {
+ return this.length;
+};
+
+jQuery.fn.andSelf = jQuery.fn.addBack;
+
+
+
+
+// Register as a named AMD module, since jQuery can be concatenated with other
+// files that may use define, but not via a proper concatenation script that
+// understands anonymous AMD modules. A named AMD is safest and most robust
+// way to register. Lowercase jquery is used because AMD module names are
+// derived from file names, and jQuery is normally delivered in a lowercase
+// file name. Do this after creating the global so that if an AMD module wants
+// to call noConflict to hide this version of jQuery, it will work.
+if ( typeof define === "function" && define.amd ) {
+ define( "jquery", [], function() {
+ return jQuery;
+ });
+}
+
+
+
+
+var
+ // Map over jQuery in case of overwrite
+ _jQuery = window.jQuery,
+
+ // Map over the $ in case of overwrite
+ _$ = window.$;
+
+jQuery.noConflict = function( deep ) {
+ if ( window.$ === jQuery ) {
+ window.$ = _$;
+ }
+
+ if ( deep && window.jQuery === jQuery ) {
+ window.jQuery = _jQuery;
+ }
+
+ return jQuery;
+};
+
+// Expose jQuery and $ identifiers, even in
+// AMD (#7102#comment:10, https://github.com/jquery/jquery/pull/557)
+// and CommonJS for browser emulators (#13566)
+if ( typeof noGlobal === strundefined ) {
+ window.jQuery = window.$ = jQuery;
+}
+
+
+
+
+return jQuery;
+
+}));
+(function($, undefined) {
+
+/**
+ * Unobtrusive scripting adapter for jQuery
+ * https://github.com/rails/jquery-ujs
+ *
+ * Requires jQuery 1.7.0 or later.
+ *
+ * Released under the MIT license
+ *
+ */
+
+ // Cut down on the number of issues from people inadvertently including jquery_ujs twice
+ // by detecting and raising an error when it happens.
+ if ( $.rails !== undefined ) {
+ $.error('jquery-ujs has already been loaded!');
+ }
+
+ // Shorthand to make it a little easier to call public rails functions from within rails.js
+ var rails;
+ var $document = $(document);
+
+ $.rails = rails = {
+ // Link elements bound by jquery-ujs
+ linkClickSelector: 'a[data-confirm], a[data-method], a[data-remote], a[data-disable-with]',
+
+ // Button elements bound by jquery-ujs
+ buttonClickSelector: 'button[data-remote]',
+
+ // Select elements bound by jquery-ujs
+ inputChangeSelector: 'select[data-remote], input[data-remote], textarea[data-remote]',
+
+ // Form elements bound by jquery-ujs
+ formSubmitSelector: 'form',
+
+ // Form input elements bound by jquery-ujs
+ formInputClickSelector: 'form input[type=submit], form input[type=image], form button[type=submit], form button:not([type])',
+
+ // Form input elements disabled during form submission
+ disableSelector: 'input[data-disable-with], button[data-disable-with], textarea[data-disable-with]',
+
+ // Form input elements re-enabled after form submission
+ enableSelector: 'input[data-disable-with]:disabled, button[data-disable-with]:disabled, textarea[data-disable-with]:disabled',
+
+ // Form required input elements
+ requiredInputSelector: 'input[name][required]:not([disabled]),textarea[name][required]:not([disabled])',
+
+ // Form file input elements
+ fileInputSelector: 'input[type=file]',
+
+ // Link onClick disable selector with possible reenable after remote submission
+ linkDisableSelector: 'a[data-disable-with]',
+
+ // Make sure that every Ajax request sends the CSRF token
+ CSRFProtection: function(xhr) {
+ var token = $('meta[name="csrf-token"]').attr('content');
+ if (token) xhr.setRequestHeader('X-CSRF-Token', token);
+ },
+
+ // making sure that all forms have actual up-to-date token(cached forms contain old one)
+ refreshCSRFTokens: function(){
+ var csrfToken = $('meta[name=csrf-token]').attr('content');
+ var csrfParam = $('meta[name=csrf-param]').attr('content');
+ $('form input[name="' + csrfParam + '"]').val(csrfToken);
+ },
+
+ // Triggers an event on an element and returns false if the event result is false
+ fire: function(obj, name, data) {
+ var event = $.Event(name);
+ obj.trigger(event, data);
+ return event.result !== false;
+ },
+
+ // Default confirm dialog, may be overridden with custom confirm dialog in $.rails.confirm
+ confirm: function(message) {
+ return confirm(message);
+ },
+
+ // Default ajax function, may be overridden with custom function in $.rails.ajax
+ ajax: function(options) {
+ return $.ajax(options);
+ },
+
+ // Default way to get an element's href. May be overridden at $.rails.href.
+ href: function(element) {
+ return element.attr('href');
+ },
+
+ // Submits "remote" forms and links with ajax
+ handleRemote: function(element) {
+ var method, url, data, elCrossDomain, crossDomain, withCredentials, dataType, options;
+
+ if (rails.fire(element, 'ajax:before')) {
+ elCrossDomain = element.data('cross-domain');
+ crossDomain = elCrossDomain === undefined ? null : elCrossDomain;
+ withCredentials = element.data('with-credentials') || null;
+ dataType = element.data('type') || ($.ajaxSettings && $.ajaxSettings.dataType);
+
+ if (element.is('form')) {
+ method = element.attr('method');
+ url = element.attr('action');
+ data = element.serializeArray();
+ // memoized value from clicked submit button
+ var button = element.data('ujs:submit-button');
+ if (button) {
+ data.push(button);
+ element.data('ujs:submit-button', null);
+ }
+ } else if (element.is(rails.inputChangeSelector)) {
+ method = element.data('method');
+ url = element.data('url');
+ data = element.serialize();
+ if (element.data('params')) data = data + "&" + element.data('params');
+ } else if (element.is(rails.buttonClickSelector)) {
+ method = element.data('method') || 'get';
+ url = element.data('url');
+ data = element.serialize();
+ if (element.data('params')) data = data + "&" + element.data('params');
+ } else {
+ method = element.data('method');
+ url = rails.href(element);
+ data = element.data('params') || null;
+ }
+
+ options = {
+ type: method || 'GET', data: data, dataType: dataType,
+ // stopping the "ajax:beforeSend" event will cancel the ajax request
+ beforeSend: function(xhr, settings) {
+ if (settings.dataType === undefined) {
+ xhr.setRequestHeader('accept', '*/*;q=0.5, ' + settings.accepts.script);
+ }
+ return rails.fire(element, 'ajax:beforeSend', [xhr, settings]);
+ },
+ success: function(data, status, xhr) {
+ element.trigger('ajax:success', [data, status, xhr]);
+ },
+ complete: function(xhr, status) {
+ element.trigger('ajax:complete', [xhr, status]);
+ },
+ error: function(xhr, status, error) {
+ element.trigger('ajax:error', [xhr, status, error]);
+ },
+ crossDomain: crossDomain
+ };
+
+ // There is no withCredentials for IE6-8 when
+ // "Enable native XMLHTTP support" is disabled
+ if (withCredentials) {
+ options.xhrFields = {
+ withCredentials: withCredentials
+ };
+ }
+
+ // Only pass url to `ajax` options if not blank
+ if (url) { options.url = url; }
+
+ var jqxhr = rails.ajax(options);
+ element.trigger('ajax:send', jqxhr);
+ return jqxhr;
+ } else {
+ return false;
+ }
+ },
+
+ // Handles "data-method" on links such as:
+ // <a href="/users/5" data-method="delete" rel="nofollow" data-confirm="Are you sure?">Delete</a>
+ handleMethod: function(link) {
+ var href = rails.href(link),
+ method = link.data('method'),
+ target = link.attr('target'),
+ csrfToken = $('meta[name=csrf-token]').attr('content'),
+ csrfParam = $('meta[name=csrf-param]').attr('content'),
+ form = $('<form method="post" action="' + href + '"></form>'),
+ metadataInput = '<input name="_method" value="' + method + '" type="hidden" />';
+
+ if (csrfParam !== undefined && csrfToken !== undefined) {
+ metadataInput += '<input name="' + csrfParam + '" value="' + csrfToken + '" type="hidden" />';
+ }
+
+ if (target) { form.attr('target', target); }
+
+ form.hide().append(metadataInput).appendTo('body');
+ form.submit();
+ },
+
+ /* Disables form elements:
+ - Caches element value in 'ujs:enable-with' data store
+ - Replaces element text with value of 'data-disable-with' attribute
+ - Sets disabled property to true
+ */
+ disableFormElements: function(form) {
+ form.find(rails.disableSelector).each(function() {
+ var element = $(this), method = element.is('button') ? 'html' : 'val';
+ element.data('ujs:enable-with', element[method]());
+ element[method](element.data('disable-with'));
+ element.prop('disabled', true);
+ });
+ },
+
+ /* Re-enables disabled form elements:
+ - Replaces element text with cached value from 'ujs:enable-with' data store (created in `disableFormElements`)
+ - Sets disabled property to false
+ */
+ enableFormElements: function(form) {
+ form.find(rails.enableSelector).each(function() {
+ var element = $(this), method = element.is('button') ? 'html' : 'val';
+ if (element.data('ujs:enable-with')) element[method](element.data('ujs:enable-with'));
+ element.prop('disabled', false);
+ });
+ },
+
+ /* For 'data-confirm' attribute:
+ - Fires `confirm` event
+ - Shows the confirmation dialog
+ - Fires the `confirm:complete` event
+
+ Returns `true` if no function stops the chain and user chose yes; `false` otherwise.
+ Attaching a handler to the element's `confirm` event that returns a `falsy` value cancels the confirmation dialog.
+ Attaching a handler to the element's `confirm:complete` event that returns a `falsy` value makes this function
+ return false. The `confirm:complete` event is fired whether or not the user answered true or false to the dialog.
+ */
+ allowAction: function(element) {
+ var message = element.data('confirm'),
+ answer = false, callback;
+ if (!message) { return true; }
+
+ if (rails.fire(element, 'confirm')) {
+ answer = rails.confirm(message);
+ callback = rails.fire(element, 'confirm:complete', [answer]);
+ }
+ return answer && callback;
+ },
+
+ // Helper function which checks for blank inputs in a form that match the specified CSS selector
+ blankInputs: function(form, specifiedSelector, nonBlank) {
+ var inputs = $(), input, valueToCheck,
+ selector = specifiedSelector || 'input,textarea',
+ allInputs = form.find(selector);
+
+ allInputs.each(function() {
+ input = $(this);
+ valueToCheck = input.is('input[type=checkbox],input[type=radio]') ? input.is(':checked') : input.val();
+ // If nonBlank and valueToCheck are both truthy, or nonBlank and valueToCheck are both falsey
+ if (!valueToCheck === !nonBlank) {
+
+ // Don't count unchecked required radio if other radio with same name is checked
+ if (input.is('input[type=radio]') && allInputs.filter('input[type=radio]:checked[name="' + input.attr('name') + '"]').length) {
+ return true; // Skip to next input
+ }
+
+ inputs = inputs.add(input);
+ }
+ });
+ return inputs.length ? inputs : false;
+ },
+
+ // Helper function which checks for non-blank inputs in a form that match the specified CSS selector
+ nonBlankInputs: function(form, specifiedSelector) {
+ return rails.blankInputs(form, specifiedSelector, true); // true specifies nonBlank
+ },
+
+ // Helper function, needed to provide consistent behavior in IE
+ stopEverything: function(e) {
+ $(e.target).trigger('ujs:everythingStopped');
+ e.stopImmediatePropagation();
+ return false;
+ },
+
+ // replace element's html with the 'data-disable-with' after storing original html
+ // and prevent clicking on it
+ disableElement: function(element) {
+ element.data('ujs:enable-with', element.html()); // store enabled state
+ element.html(element.data('disable-with')); // set to disabled state
+ element.bind('click.railsDisable', function(e) { // prevent further clicking
+ return rails.stopEverything(e);
+ });
+ },
+
+ // restore element to its original state which was disabled by 'disableElement' above
+ enableElement: function(element) {
+ if (element.data('ujs:enable-with') !== undefined) {
+ element.html(element.data('ujs:enable-with')); // set to old enabled state
+ element.removeData('ujs:enable-with'); // clean up cache
+ }
+ element.unbind('click.railsDisable'); // enable element
+ }
+
+ };
+
+ if (rails.fire($document, 'rails:attachBindings')) {
+
+ $.ajaxPrefilter(function(options, originalOptions, xhr){ if ( !options.crossDomain ) { rails.CSRFProtection(xhr); }});
+
+ $document.delegate(rails.linkDisableSelector, 'ajax:complete', function() {
+ rails.enableElement($(this));
+ });
+
+ $document.delegate(rails.linkClickSelector, 'click.rails', function(e) {
+ var link = $(this), method = link.data('method'), data = link.data('params'), metaClick = e.metaKey || e.ctrlKey;
+ if (!rails.allowAction(link)) return rails.stopEverything(e);
+
+ if (!metaClick && link.is(rails.linkDisableSelector)) rails.disableElement(link);
+
+ if (link.data('remote') !== undefined) {
+ if (metaClick && (!method || method === 'GET') && !data) { return true; }
+
+ var handleRemote = rails.handleRemote(link);
+ // response from rails.handleRemote() will either be false or a deferred object promise.
+ if (handleRemote === false) {
+ rails.enableElement(link);
+ } else {
+ handleRemote.error( function() { rails.enableElement(link); } );
+ }
+ return false;
+
+ } else if (link.data('method')) {
+ rails.handleMethod(link);
+ return false;
+ }
+ });
+
+ $document.delegate(rails.buttonClickSelector, 'click.rails', function(e) {
+ var button = $(this);
+ if (!rails.allowAction(button)) return rails.stopEverything(e);
+
+ rails.handleRemote(button);
+ return false;
+ });
+
+ $document.delegate(rails.inputChangeSelector, 'change.rails', function(e) {
+ var link = $(this);
+ if (!rails.allowAction(link)) return rails.stopEverything(e);
+
+ rails.handleRemote(link);
+ return false;
+ });
+
+ $document.delegate(rails.formSubmitSelector, 'submit.rails', function(e) {
+ var form = $(this),
+ remote = form.data('remote') !== undefined,
+ blankRequiredInputs = rails.blankInputs(form, rails.requiredInputSelector),
+ nonBlankFileInputs = rails.nonBlankInputs(form, rails.fileInputSelector);
+
+ if (!rails.allowAction(form)) return rails.stopEverything(e);
+
+ // skip other logic when required values are missing or file upload is present
+ if (blankRequiredInputs && form.attr("novalidate") == undefined && rails.fire(form, 'ajax:aborted:required', [blankRequiredInputs])) {
+ return rails.stopEverything(e);
+ }
+
+ if (remote) {
+ if (nonBlankFileInputs) {
+ // slight timeout so that the submit button gets properly serialized
+ // (make it easy for event handler to serialize form without disabled values)
+ setTimeout(function(){ rails.disableFormElements(form); }, 13);
+ var aborted = rails.fire(form, 'ajax:aborted:file', [nonBlankFileInputs]);
+
+ // re-enable form elements if event bindings return false (canceling normal form submission)
+ if (!aborted) { setTimeout(function(){ rails.enableFormElements(form); }, 13); }
+
+ return aborted;
+ }
+
+ rails.handleRemote(form);
+ return false;
+
+ } else {
+ // slight timeout so that the submit button gets properly serialized
+ setTimeout(function(){ rails.disableFormElements(form); }, 13);
+ }
+ });
+
+ $document.delegate(rails.formInputClickSelector, 'click.rails', function(event) {
+ var button = $(this);
+
+ if (!rails.allowAction(button)) return rails.stopEverything(event);
+
+ // register the pressed submit button
+ var name = button.attr('name'),
+ data = name ? {name:name, value:button.val()} : null;
+
+ button.closest('form').data('ujs:submit-button', data);
+ });
+
+ $document.delegate(rails.formSubmitSelector, 'ajax:beforeSend.rails', function(event) {
+ if (this == event.target) rails.disableFormElements($(this));
+ });
+
+ $document.delegate(rails.formSubmitSelector, 'ajax:complete.rails', function(event) {
+ if (this == event.target) rails.enableFormElements($(this));
+ });
+
+ $(function(){
+ rails.refreshCSRFTokens();
+ });
+ }
+
+})( jQuery );
+/*
+ * File: jquery.dataTables.min.js
+ * Version: 1.9.3
+ * Author: Allan Jardine (www.sprymedia.co.uk)
+ * Info: www.datatables.net
+ *
+ * Copyright 2008-2012 Allan Jardine, all rights reserved.
+ *
+ * This source file is free software, under either the GPL v2 license or a
+ * BSD style license, available at:
+ * http://datatables.net/license_gpl2
+ * http://datatables.net/license_bsd
+ *
+ * This source file is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY
+ * or FITNESS FOR A PARTICULAR PURPOSE. See the license files for details.
+ */
+
+(function(i,O,l,n){var j=function(e){function o(a,b){var c=j.defaults.columns,d=a.aoColumns.length,c=i.extend({},j.models.oColumn,c,{sSortingClass:a.oClasses.sSortable,sSortingClassJUI:a.oClasses.sSortJUI,nTh:b?b:l.createElement("th"),sTitle:c.sTitle?c.sTitle:b?b.innerHTML:"",aDataSort:c.aDataSort?c.aDataSort:[d],mData:c.mData?c.oDefaults:d});a.aoColumns.push(c);if(a.aoPreSearchCols[d]===n||null===a.aoPreSearchCols[d])a.aoPreSearchCols[d]=i.extend({},j.models.oSearch);else if(c=a.aoPreSearchCols[d],
+c.bRegex===n&&(c.bRegex=!0),c.bSmart===n&&(c.bSmart=!0),c.bCaseInsensitive===n)c.bCaseInsensitive=!0;r(a,d,null)}function r(a,b,c){var d=a.aoColumns[b];c!==n&&null!==c&&(c.mDataProp&&!c.mData&&(c.mData=c.mDataProp),c.sType!==n&&(d.sType=c.sType,d._bAutoType=!1),i.extend(d,c),p(d,c,"sWidth","sWidthOrig"),c.iDataSort!==n&&(d.aDataSort=[c.iDataSort]),p(d,c,"aDataSort"));var h=d.mRender?S(d.mRender):null,f=S(d.mData);d.fnGetData=function(a,b){var c=f(a,b);return d.mRender&&b&&""!==b?h(c,b,a):c};d.fnSetData=
+ta(d.mData);a.oFeatures.bSort||(d.bSortable=!1);!d.bSortable||-1==i.inArray("asc",d.asSorting)&&-1==i.inArray("desc",d.asSorting)?(d.sSortingClass=a.oClasses.sSortableNone,d.sSortingClassJUI=""):d.bSortable||-1==i.inArray("asc",d.asSorting)&&-1==i.inArray("desc",d.asSorting)?(d.sSortingClass=a.oClasses.sSortable,d.sSortingClassJUI=a.oClasses.sSortJUI):-1!=i.inArray("asc",d.asSorting)&&-1==i.inArray("desc",d.asSorting)?(d.sSortingClass=a.oClasses.sSortableAsc,d.sSortingClassJUI=a.oClasses.sSortJUIAscAllowed):
+-1==i.inArray("asc",d.asSorting)&&-1!=i.inArray("desc",d.asSorting)&&(d.sSortingClass=a.oClasses.sSortableDesc,d.sSortingClassJUI=a.oClasses.sSortJUIDescAllowed)}function k(a){if(!1===a.oFeatures.bAutoWidth)return!1;ca(a);for(var b=0,c=a.aoColumns.length;b<c;b++)a.aoColumns[b].nTh.style.width=a.aoColumns[b].sWidth}function G(a,b){var c=v(a,"bVisible");return"number"===typeof c[b]?c[b]:null}function t(a,b){var c=v(a,"bVisible"),c=i.inArray(b,c);return-1!==c?c:null}function w(a){return v(a,"bVisible").length}
+function v(a,b){var c=[];i.map(a.aoColumns,function(a,h){a[b]&&c.push(h)});return c}function D(a){for(var b=j.ext.aTypes,c=b.length,d=0;d<c;d++){var h=b[d](a);if(null!==h)return h}return"string"}function y(a,b){for(var c=b.split(","),d=[],h=0,f=a.aoColumns.length;h<f;h++)for(var g=0;g<f;g++)if(a.aoColumns[h].sName==c[g]){d.push(g);break}return d}function H(a){for(var b="",c=0,d=a.aoColumns.length;c<d;c++)b+=a.aoColumns[c].sName+",";return b.length==d?"":b.slice(0,-1)}function ua(a,b,c,d){var h,f,
+g,e,s;if(b)for(h=b.length-1;0<=h;h--){var m=b[h].aTargets;i.isArray(m)||E(a,1,"aTargets must be an array of targets, not a "+typeof m);f=0;for(g=m.length;f<g;f++)if("number"===typeof m[f]&&0<=m[f]){for(;a.aoColumns.length<=m[f];)o(a);d(m[f],b[h])}else if("number"===typeof m[f]&&0>m[f])d(a.aoColumns.length+m[f],b[h]);else if("string"===typeof m[f]){e=0;for(s=a.aoColumns.length;e<s;e++)("_all"==m[f]||i(a.aoColumns[e].nTh).hasClass(m[f]))&&d(e,b[h])}}if(c){h=0;for(a=c.length;h<a;h++)d(h,c[h])}}function J(a,
+b){var c;c=i.isArray(b)?b.slice():i.extend(!0,{},b);var d=a.aoData.length,h=i.extend(!0,{},j.models.oRow);h._aData=c;a.aoData.push(h);for(var f,h=0,g=a.aoColumns.length;h<g;h++)c=a.aoColumns[h],"function"===typeof c.fnRender&&c.bUseRendered&&null!==c.mData?I(a,d,h,T(a,d,h)):I(a,d,h,x(a,d,h)),c._bAutoType&&"string"!=c.sType&&(f=x(a,d,h,"type"),null!==f&&""!==f&&(f=D(f),null===c.sType?c.sType=f:c.sType!=f&&"html"!=c.sType&&(c.sType="string")));a.aiDisplayMaster.push(d);a.oFeatures.bDeferRender||da(a,
+d);return d}function va(a){var b,c,d,h,f,g,e,s,m;if(a.bDeferLoading||null===a.sAjaxSource){e=a.nTBody.childNodes;b=0;for(c=e.length;b<c;b++)if("TR"==e[b].nodeName.toUpperCase()){s=a.aoData.length;e[b]._DT_RowIndex=s;a.aoData.push(i.extend(!0,{},j.models.oRow,{nTr:e[b]}));a.aiDisplayMaster.push(s);g=e[b].childNodes;d=f=0;for(h=g.length;d<h;d++)if(m=g[d].nodeName.toUpperCase(),"TD"==m||"TH"==m)I(a,s,f,i.trim(g[d].innerHTML)),f++}}e=U(a);g=[];b=0;for(c=e.length;b<c;b++){d=0;for(h=e[b].childNodes.length;d<
+h;d++)f=e[b].childNodes[d],m=f.nodeName.toUpperCase(),("TD"==m||"TH"==m)&&g.push(f)}h=0;for(e=a.aoColumns.length;h<e;h++){m=a.aoColumns[h];null===m.sTitle&&(m.sTitle=m.nTh.innerHTML);f=m._bAutoType;s="function"===typeof m.fnRender;var o=null!==m.sClass,k=m.bVisible,r,n;if(f||s||o||!k){b=0;for(c=a.aoData.length;b<c;b++)d=a.aoData[b],r=g[b*e+h],f&&"string"!=m.sType&&(n=x(a,b,h,"type"),""!==n&&(n=D(n),null===m.sType?m.sType=n:m.sType!=n&&"html"!=m.sType&&(m.sType="string"))),"function"===typeof m.mData&&
+(r.innerHTML=x(a,b,h,"display")),s&&(n=T(a,b,h),r.innerHTML=n,m.bUseRendered&&I(a,b,h,n)),o&&(r.className+=" "+m.sClass),k?d._anHidden[h]=null:(d._anHidden[h]=r,r.parentNode.removeChild(r)),m.fnCreatedCell&&m.fnCreatedCell.call(a.oInstance,r,x(a,b,h,"display"),d._aData,b,h)}}if(0!==a.aoRowCreatedCallback.length){b=0;for(c=a.aoData.length;b<c;b++)d=a.aoData[b],C(a,"aoRowCreatedCallback",null,[d.nTr,d._aData,b])}}function K(a,b){return b._DT_RowIndex!==n?b._DT_RowIndex:null}function ea(a,b,c){for(var b=
+L(a,b),d=0,a=a.aoColumns.length;d<a;d++)if(b[d]===c)return d;return-1}function Y(a,b,c,d){for(var h=[],f=0,g=d.length;f<g;f++)h.push(x(a,b,d[f],c));return h}function x(a,b,c,d){var h=a.aoColumns[c];if((c=h.fnGetData(a.aoData[b]._aData,d))===n)return a.iDrawError!=a.iDraw&&null===h.sDefaultContent&&(E(a,0,"Requested unknown parameter "+("function"==typeof h.mData?"{mData function}":"'"+h.mData+"'")+" from the data source for row "+b),a.iDrawError=a.iDraw),h.sDefaultContent;if(null===c&&null!==h.sDefaultContent)c=
+h.sDefaultContent;else if("function"===typeof c)return c();return"display"==d&&null===c?"":c}function I(a,b,c,d){a.aoColumns[c].fnSetData(a.aoData[b]._aData,d)}function S(a){if(null===a)return function(){return null};if("function"===typeof a)return function(b,d,h){return a(b,d,h)};if("string"===typeof a&&(-1!==a.indexOf(".")||-1!==a.indexOf("["))){var b=function(a,d,h){var f=h.split("."),g;if(""!==h){var e=0;for(g=f.length;e<g;e++){if(h=f[e].match(V)){f[e]=f[e].replace(V,"");""!==f[e]&&(a=a[f[e]]);
+g=[];f.splice(0,e+1);for(var f=f.join("."),e=0,i=a.length;e<i;e++)g.push(b(a[e],d,f));a=h[0].substring(1,h[0].length-1);a=""===a?g:g.join(a);break}if(null===a||a[f[e]]===n)return n;a=a[f[e]]}}return a};return function(c,d){return b(c,d,a)}}return function(b){return b[a]}}function ta(a){if(null===a)return function(){};if("function"===typeof a)return function(b,d){a(b,"set",d)};if("string"===typeof a&&(-1!==a.indexOf(".")||-1!==a.indexOf("["))){var b=function(a,d,h){var h=h.split("."),f,g,e=0;for(g=
+h.length-1;e<g;e++){if(f=h[e].match(V)){h[e]=h[e].replace(V,"");a[h[e]]=[];f=h.slice();f.splice(0,e+1);g=f.join(".");for(var i=0,m=d.length;i<m;i++)f={},b(f,d[i],g),a[h[e]].push(f);return}if(null===a[h[e]]||a[h[e]]===n)a[h[e]]={};a=a[h[e]]}a[h[h.length-1].replace(V,"")]=d};return function(c,d){return b(c,d,a)}}return function(b,d){b[a]=d}}function Z(a){for(var b=[],c=a.aoData.length,d=0;d<c;d++)b.push(a.aoData[d]._aData);return b}function fa(a){a.aoData.splice(0,a.aoData.length);a.aiDisplayMaster.splice(0,
+a.aiDisplayMaster.length);a.aiDisplay.splice(0,a.aiDisplay.length);A(a)}function ga(a,b){for(var c=-1,d=0,h=a.length;d<h;d++)a[d]==b?c=d:a[d]>b&&a[d]--; -1!=c&&a.splice(c,1)}function T(a,b,c){var d=a.aoColumns[c];return d.fnRender({iDataRow:b,iDataColumn:c,oSettings:a,aData:a.aoData[b]._aData,mDataProp:d.mData},x(a,b,c,"display"))}function da(a,b){var c=a.aoData[b],d;if(null===c.nTr){c.nTr=l.createElement("tr");c.nTr._DT_RowIndex=b;c._aData.DT_RowId&&(c.nTr.id=c._aData.DT_RowId);c._aData.DT_RowClass&&
+i(c.nTr).addClass(c._aData.DT_RowClass);for(var h=0,f=a.aoColumns.length;h<f;h++){var g=a.aoColumns[h];d=l.createElement(g.sCellType);d.innerHTML="function"===typeof g.fnRender&&(!g.bUseRendered||null===g.mData)?T(a,b,h):x(a,b,h,"display");null!==g.sClass&&(d.className=g.sClass);g.bVisible?(c.nTr.appendChild(d),c._anHidden[h]=null):c._anHidden[h]=d;g.fnCreatedCell&&g.fnCreatedCell.call(a.oInstance,d,x(a,b,h,"display"),c._aData,b,h)}C(a,"aoRowCreatedCallback",null,[c.nTr,c._aData,b])}}function wa(a){var b,
+c,d;if(0!==a.nTHead.getElementsByTagName("th").length){b=0;for(d=a.aoColumns.length;b<d;b++)if(c=a.aoColumns[b].nTh,c.setAttribute("role","columnheader"),a.aoColumns[b].bSortable&&(c.setAttribute("tabindex",a.iTabIndex),c.setAttribute("aria-controls",a.sTableId)),null!==a.aoColumns[b].sClass&&i(c).addClass(a.aoColumns[b].sClass),a.aoColumns[b].sTitle!=c.innerHTML)c.innerHTML=a.aoColumns[b].sTitle}else{var h=l.createElement("tr");b=0;for(d=a.aoColumns.length;b<d;b++)c=a.aoColumns[b].nTh,c.innerHTML=
+a.aoColumns[b].sTitle,c.setAttribute("tabindex","0"),null!==a.aoColumns[b].sClass&&i(c).addClass(a.aoColumns[b].sClass),h.appendChild(c);i(a.nTHead).html("")[0].appendChild(h);W(a.aoHeader,a.nTHead)}i(a.nTHead).children("tr").attr("role","row");if(a.bJUI){b=0;for(d=a.aoColumns.length;b<d;b++){c=a.aoColumns[b].nTh;h=l.createElement("div");h.className=a.oClasses.sSortJUIWrapper;i(c).contents().appendTo(h);var f=l.createElement("span");f.className=a.oClasses.sSortIcon;h.appendChild(f);c.appendChild(h)}}if(a.oFeatures.bSort)for(b=
+0;b<a.aoColumns.length;b++)!1!==a.aoColumns[b].bSortable?ha(a,a.aoColumns[b].nTh,b):i(a.aoColumns[b].nTh).addClass(a.oClasses.sSortableNone);""!==a.oClasses.sFooterTH&&i(a.nTFoot).children("tr").children("th").addClass(a.oClasses.sFooterTH);if(null!==a.nTFoot){c=P(a,null,a.aoFooter);b=0;for(d=a.aoColumns.length;b<d;b++)c[b]&&(a.aoColumns[b].nTf=c[b],a.aoColumns[b].sClass&&i(c[b]).addClass(a.aoColumns[b].sClass))}}function X(a,b,c){var d,h,f,g=[],e=[],i=a.aoColumns.length,m;c===n&&(c=!1);d=0;for(h=
+b.length;d<h;d++){g[d]=b[d].slice();g[d].nTr=b[d].nTr;for(f=i-1;0<=f;f--)!a.aoColumns[f].bVisible&&!c&&g[d].splice(f,1);e.push([])}d=0;for(h=g.length;d<h;d++){if(a=g[d].nTr)for(;f=a.firstChild;)a.removeChild(f);f=0;for(b=g[d].length;f<b;f++)if(m=i=1,e[d][f]===n){a.appendChild(g[d][f].cell);for(e[d][f]=1;g[d+i]!==n&&g[d][f].cell==g[d+i][f].cell;)e[d+i][f]=1,i++;for(;g[d][f+m]!==n&&g[d][f].cell==g[d][f+m].cell;){for(c=0;c<i;c++)e[d+c][f+m]=1;m++}g[d][f].cell.rowSpan=i;g[d][f].cell.colSpan=m}}}function z(a){var b=
+C(a,"aoPreDrawCallback","preDraw",[a]);if(-1!==i.inArray(!1,b))F(a,!1);else{var c,d,b=[],h=0,f=a.asStripeClasses.length;c=a.aoOpenRows.length;a.bDrawing=!0;a.iInitDisplayStart!==n&&-1!=a.iInitDisplayStart&&(a._iDisplayStart=a.oFeatures.bServerSide?a.iInitDisplayStart:a.iInitDisplayStart>=a.fnRecordsDisplay()?0:a.iInitDisplayStart,a.iInitDisplayStart=-1,A(a));if(a.bDeferLoading)a.bDeferLoading=!1,a.iDraw++;else if(a.oFeatures.bServerSide){if(!a.bDestroying&&!xa(a))return}else a.iDraw++;if(0!==a.aiDisplay.length){var g=
+a._iDisplayStart;d=a._iDisplayEnd;a.oFeatures.bServerSide&&(g=0,d=a.aoData.length);for(;g<d;g++){var e=a.aoData[a.aiDisplay[g]];null===e.nTr&&da(a,a.aiDisplay[g]);var s=e.nTr;if(0!==f){var m=a.asStripeClasses[h%f];e._sRowStripe!=m&&(i(s).removeClass(e._sRowStripe).addClass(m),e._sRowStripe=m)}C(a,"aoRowCallback",null,[s,a.aoData[a.aiDisplay[g]]._aData,h,g]);b.push(s);h++;if(0!==c)for(e=0;e<c;e++)if(s==a.aoOpenRows[e].nParent){b.push(a.aoOpenRows[e].nTr);break}}}else b[0]=l.createElement("tr"),a.asStripeClasses[0]&&
+(b[0].className=a.asStripeClasses[0]),c=a.oLanguage,f=c.sZeroRecords,1==a.iDraw&&null!==a.sAjaxSource&&!a.oFeatures.bServerSide?f=c.sLoadingRecords:c.sEmptyTable&&0===a.fnRecordsTotal()&&(f=c.sEmptyTable),c=l.createElement("td"),c.setAttribute("valign","top"),c.colSpan=w(a),c.className=a.oClasses.sRowEmpty,c.innerHTML=ia(a,f),b[h].appendChild(c);C(a,"aoHeaderCallback","header",[i(a.nTHead).children("tr")[0],Z(a),a._iDisplayStart,a.fnDisplayEnd(),a.aiDisplay]);C(a,"aoFooterCallback","footer",[i(a.nTFoot).children("tr")[0],
+Z(a),a._iDisplayStart,a.fnDisplayEnd(),a.aiDisplay]);h=l.createDocumentFragment();c=l.createDocumentFragment();if(a.nTBody){f=a.nTBody.parentNode;c.appendChild(a.nTBody);if(!a.oScroll.bInfinite||!a._bInitComplete||a.bSorted||a.bFiltered)for(;c=a.nTBody.firstChild;)a.nTBody.removeChild(c);c=0;for(d=b.length;c<d;c++)h.appendChild(b[c]);a.nTBody.appendChild(h);null!==f&&f.appendChild(a.nTBody)}C(a,"aoDrawCallback","draw",[a]);a.bSorted=!1;a.bFiltered=!1;a.bDrawing=!1;a.oFeatures.bServerSide&&(F(a,!1),
+a._bInitComplete||$(a))}}function aa(a){a.oFeatures.bSort?Q(a,a.oPreviousSearch):a.oFeatures.bFilter?M(a,a.oPreviousSearch):(A(a),z(a))}function ya(a){var b=i("<div></div>")[0];a.nTable.parentNode.insertBefore(b,a.nTable);a.nTableWrapper=i('<div id="'+a.sTableId+'_wrapper" class="'+a.oClasses.sWrapper+'" role="grid"></div>')[0];a.nTableReinsertBefore=a.nTable.nextSibling;for(var c=a.nTableWrapper,d=a.sDom.split(""),h,f,g,e,s,m,o,k=0;k<d.length;k++){f=0;g=d[k];if("<"==g){e=i("<div></div>")[0];s=d[k+
+1];if("'"==s||'"'==s){m="";for(o=2;d[k+o]!=s;)m+=d[k+o],o++;"H"==m?m=a.oClasses.sJUIHeader:"F"==m&&(m=a.oClasses.sJUIFooter);-1!=m.indexOf(".")?(s=m.split("."),e.id=s[0].substr(1,s[0].length-1),e.className=s[1]):"#"==m.charAt(0)?e.id=m.substr(1,m.length-1):e.className=m;k+=o}c.appendChild(e);c=e}else if(">"==g)c=c.parentNode;else if("l"==g&&a.oFeatures.bPaginate&&a.oFeatures.bLengthChange)h=za(a),f=1;else if("f"==g&&a.oFeatures.bFilter)h=Aa(a),f=1;else if("r"==g&&a.oFeatures.bProcessing)h=Ba(a),f=
+1;else if("t"==g)h=Ca(a),f=1;else if("i"==g&&a.oFeatures.bInfo)h=Da(a),f=1;else if("p"==g&&a.oFeatures.bPaginate)h=Ea(a),f=1;else if(0!==j.ext.aoFeatures.length){e=j.ext.aoFeatures;o=0;for(s=e.length;o<s;o++)if(g==e[o].cFeature){(h=e[o].fnInit(a))&&(f=1);break}}1==f&&null!==h&&("object"!==typeof a.aanFeatures[g]&&(a.aanFeatures[g]=[]),a.aanFeatures[g].push(h),c.appendChild(h))}b.parentNode.replaceChild(a.nTableWrapper,b)}function W(a,b){var c=i(b).children("tr"),d,h,f,g,e,s,m,j;a.splice(0,a.length);
+h=0;for(s=c.length;h<s;h++)a.push([]);h=0;for(s=c.length;h<s;h++){f=0;for(m=c[h].childNodes.length;f<m;f++)if(d=c[h].childNodes[f],"TD"==d.nodeName.toUpperCase()||"TH"==d.nodeName.toUpperCase()){var o=1*d.getAttribute("colspan"),k=1*d.getAttribute("rowspan"),o=!o||0===o||1===o?1:o,k=!k||0===k||1===k?1:k;for(g=0;a[h][g];)g++;j=g;for(e=0;e<o;e++)for(g=0;g<k;g++)a[h+g][j+e]={cell:d,unique:1==o?!0:!1},a[h+g].nTr=c[h]}}}function P(a,b,c){var d=[];c||(c=a.aoHeader,b&&(c=[],W(c,b)));for(var b=0,h=c.length;b<
+h;b++)for(var f=0,g=c[b].length;f<g;f++)if(c[b][f].unique&&(!d[f]||!a.bSortCellsTop))d[f]=c[b][f].cell;return d}function xa(a){if(a.bAjaxDataGet){a.iDraw++;F(a,!0);var b=Fa(a);ja(a,b);a.fnServerData.call(a.oInstance,a.sAjaxSource,b,function(b){Ga(a,b)},a);return!1}return!0}function Fa(a){var b=a.aoColumns.length,c=[],d,h,f,g;c.push({name:"sEcho",value:a.iDraw});c.push({name:"iColumns",value:b});c.push({name:"sColumns",value:H(a)});c.push({name:"iDisplayStart",value:a._iDisplayStart});c.push({name:"iDisplayLength",
+value:!1!==a.oFeatures.bPaginate?a._iDisplayLength:-1});for(f=0;f<b;f++)d=a.aoColumns[f].mData,c.push({name:"mDataProp_"+f,value:"function"===typeof d?"function":d});if(!1!==a.oFeatures.bFilter){c.push({name:"sSearch",value:a.oPreviousSearch.sSearch});c.push({name:"bRegex",value:a.oPreviousSearch.bRegex});for(f=0;f<b;f++)c.push({name:"sSearch_"+f,value:a.aoPreSearchCols[f].sSearch}),c.push({name:"bRegex_"+f,value:a.aoPreSearchCols[f].bRegex}),c.push({name:"bSearchable_"+f,value:a.aoColumns[f].bSearchable})}if(!1!==
+a.oFeatures.bSort){var e=0;d=null!==a.aaSortingFixed?a.aaSortingFixed.concat(a.aaSorting):a.aaSorting.slice();for(f=0;f<d.length;f++){h=a.aoColumns[d[f][0]].aDataSort;for(g=0;g<h.length;g++)c.push({name:"iSortCol_"+e,value:h[g]}),c.push({name:"sSortDir_"+e,value:d[f][1]}),e++}c.push({name:"iSortingCols",value:e});for(f=0;f<b;f++)c.push({name:"bSortable_"+f,value:a.aoColumns[f].bSortable})}return c}function ja(a,b){C(a,"aoServerParams","serverParams",[b])}function Ga(a,b){if(b.sEcho!==n){if(1*b.sEcho<
+a.iDraw)return;a.iDraw=1*b.sEcho}(!a.oScroll.bInfinite||a.oScroll.bInfinite&&(a.bSorted||a.bFiltered))&&fa(a);a._iRecordsTotal=parseInt(b.iTotalRecords,10);a._iRecordsDisplay=parseInt(b.iTotalDisplayRecords,10);var c=H(a),c=b.sColumns!==n&&""!==c&&b.sColumns!=c,d;c&&(d=y(a,b.sColumns));for(var h=S(a.sAjaxDataProp)(b),f=0,g=h.length;f<g;f++)if(c){for(var e=[],i=0,m=a.aoColumns.length;i<m;i++)e.push(h[f][d[i]]);J(a,e)}else J(a,h[f]);a.aiDisplay=a.aiDisplayMaster.slice();a.bAjaxDataGet=!1;z(a);a.bAjaxDataGet=
+!0;F(a,!1)}function Aa(a){var b=a.oPreviousSearch,c=a.oLanguage.sSearch,c=-1!==c.indexOf("_INPUT_")?c.replace("_INPUT_",'<input type="text" />'):""===c?'<input type="text" />':c+' <input type="text" />',d=l.createElement("div");d.className=a.oClasses.sFilter;d.innerHTML="<label>"+c+"</label>";a.aanFeatures.f||(d.id=a.sTableId+"_filter");c=i('input[type="text"]',d);d._DT_Input=c[0];c.val(b.sSearch.replace('"',"""));c.bind("keyup.DT",function(){for(var c=a.aanFeatures.f,d=this.value===""?"":this.value,
+g=0,e=c.length;g<e;g++)c[g]!=i(this).parents("div.dataTables_filter")[0]&&i(c[g]._DT_Input).val(d);d!=b.sSearch&&M(a,{sSearch:d,bRegex:b.bRegex,bSmart:b.bSmart,bCaseInsensitive:b.bCaseInsensitive})});c.attr("aria-controls",a.sTableId).bind("keypress.DT",function(a){if(a.keyCode==13)return false});return d}function M(a,b,c){var d=a.oPreviousSearch,h=a.aoPreSearchCols,f=function(a){d.sSearch=a.sSearch;d.bRegex=a.bRegex;d.bSmart=a.bSmart;d.bCaseInsensitive=a.bCaseInsensitive};if(a.oFeatures.bServerSide)f(b);
+else{Ha(a,b.sSearch,c,b.bRegex,b.bSmart,b.bCaseInsensitive);f(b);for(b=0;b<a.aoPreSearchCols.length;b++)Ia(a,h[b].sSearch,b,h[b].bRegex,h[b].bSmart,h[b].bCaseInsensitive);Ja(a)}a.bFiltered=!0;i(a.oInstance).trigger("filter",a);a._iDisplayStart=0;A(a);z(a);ka(a,0)}function Ja(a){for(var b=j.ext.afnFiltering,c=v(a,"bSearchable"),d=0,h=b.length;d<h;d++)for(var f=0,g=0,e=a.aiDisplay.length;g<e;g++){var i=a.aiDisplay[g-f];b[d](a,Y(a,i,"filter",c),i)||(a.aiDisplay.splice(g-f,1),f++)}}function Ia(a,b,c,
+d,h,f){if(""!==b)for(var g=0,b=la(b,d,h,f),d=a.aiDisplay.length-1;0<=d;d--)h=Ka(x(a,a.aiDisplay[d],c,"filter"),a.aoColumns[c].sType),b.test(h)||(a.aiDisplay.splice(d,1),g++)}function Ha(a,b,c,d,h,f){d=la(b,d,h,f);h=a.oPreviousSearch;c||(c=0);0!==j.ext.afnFiltering.length&&(c=1);if(0>=b.length)a.aiDisplay.splice(0,a.aiDisplay.length),a.aiDisplay=a.aiDisplayMaster.slice();else if(a.aiDisplay.length==a.aiDisplayMaster.length||h.sSearch.length>b.length||1==c||0!==b.indexOf(h.sSearch)){a.aiDisplay.splice(0,
+a.aiDisplay.length);ka(a,1);for(b=0;b<a.aiDisplayMaster.length;b++)d.test(a.asDataSearch[b])&&a.aiDisplay.push(a.aiDisplayMaster[b])}else for(b=c=0;b<a.asDataSearch.length;b++)d.test(a.asDataSearch[b])||(a.aiDisplay.splice(b-c,1),c++)}function ka(a,b){if(!a.oFeatures.bServerSide){a.asDataSearch=[];for(var c=v(a,"bSearchable"),d=1===b?a.aiDisplayMaster:a.aiDisplay,h=0,f=d.length;h<f;h++)a.asDataSearch[h]=ma(a,Y(a,d[h],"filter",c))}}function ma(a,b){var c=b.join(" ");-1!==c.indexOf("&")&&(c=i("<div>").html(c).text());
+return c.replace(/[\n\r]/g," ")}function la(a,b,c,d){if(c)return a=b?a.split(" "):na(a).split(" "),a="^(?=.*?"+a.join(")(?=.*?")+").*$",RegExp(a,d?"i":"");a=b?a:na(a);return RegExp(a,d?"i":"")}function Ka(a,b){return"function"===typeof j.ext.ofnSearch[b]?j.ext.ofnSearch[b](a):null===a?"":"html"==b?a.replace(/[\r\n]/g," ").replace(/<.*?>/g,""):"string"===typeof a?a.replace(/[\r\n]/g," "):a}function na(a){return a.replace(RegExp("(\\/|\\.|\\*|\\+|\\?|\\||\\(|\\)|\\[|\\]|\\{|\\}|\\\\|\\$|\\^|\\-)","g"),
+"\\$1")}function Da(a){var b=l.createElement("div");b.className=a.oClasses.sInfo;a.aanFeatures.i||(a.aoDrawCallback.push({fn:La,sName:"information"}),b.id=a.sTableId+"_info");a.nTable.setAttribute("aria-describedby",a.sTableId+"_info");return b}function La(a){if(a.oFeatures.bInfo&&0!==a.aanFeatures.i.length){var b=a.oLanguage,c=a._iDisplayStart+1,d=a.fnDisplayEnd(),h=a.fnRecordsTotal(),f=a.fnRecordsDisplay(),g;g=0===f&&f==h?b.sInfoEmpty:0===f?b.sInfoEmpty+" "+b.sInfoFiltered:f==h?b.sInfo:b.sInfo+
+" "+b.sInfoFiltered;g+=b.sInfoPostFix;g=ia(a,g);null!==b.fnInfoCallback&&(g=b.fnInfoCallback.call(a.oInstance,a,c,d,h,f,g));a=a.aanFeatures.i;b=0;for(c=a.length;b<c;b++)i(a[b]).html(g)}}function ia(a,b){var c=a.fnFormatNumber(a._iDisplayStart+1),d=a.fnDisplayEnd(),d=a.fnFormatNumber(d),h=a.fnRecordsDisplay(),h=a.fnFormatNumber(h),f=a.fnRecordsTotal(),f=a.fnFormatNumber(f);a.oScroll.bInfinite&&(c=a.fnFormatNumber(1));return b.replace("_START_",c).replace("_END_",d).replace("_TOTAL_",h).replace("_MAX_",
+f)}function ba(a){var b,c,d=a.iInitDisplayStart;if(!1===a.bInitialised)setTimeout(function(){ba(a)},200);else{ya(a);wa(a);X(a,a.aoHeader);a.nTFoot&&X(a,a.aoFooter);F(a,!0);a.oFeatures.bAutoWidth&&ca(a);b=0;for(c=a.aoColumns.length;b<c;b++)null!==a.aoColumns[b].sWidth&&(a.aoColumns[b].nTh.style.width=q(a.aoColumns[b].sWidth));a.oFeatures.bSort?Q(a):a.oFeatures.bFilter?M(a,a.oPreviousSearch):(a.aiDisplay=a.aiDisplayMaster.slice(),A(a),z(a));null!==a.sAjaxSource&&!a.oFeatures.bServerSide?(c=[],ja(a,
+c),a.fnServerData.call(a.oInstance,a.sAjaxSource,c,function(c){var f=a.sAjaxDataProp!==""?S(a.sAjaxDataProp)(c):c;for(b=0;b<f.length;b++)J(a,f[b]);a.iInitDisplayStart=d;if(a.oFeatures.bSort)Q(a);else{a.aiDisplay=a.aiDisplayMaster.slice();A(a);z(a)}F(a,false);$(a,c)},a)):a.oFeatures.bServerSide||(F(a,!1),$(a))}}function $(a,b){a._bInitComplete=!0;C(a,"aoInitComplete","init",[a,b])}function oa(a){var b=j.defaults.oLanguage;!a.sEmptyTable&&(a.sZeroRecords&&"No data available in table"===b.sEmptyTable)&&
+p(a,a,"sZeroRecords","sEmptyTable");!a.sLoadingRecords&&(a.sZeroRecords&&"Loading..."===b.sLoadingRecords)&&p(a,a,"sZeroRecords","sLoadingRecords")}function za(a){if(a.oScroll.bInfinite)return null;var b='<select size="1" '+('name="'+a.sTableId+'_length"')+">",c,d,h=a.aLengthMenu;if(2==h.length&&"object"===typeof h[0]&&"object"===typeof h[1]){c=0;for(d=h[0].length;c<d;c++)b+='<option value="'+h[0][c]+'">'+h[1][c]+"</option>"}else{c=0;for(d=h.length;c<d;c++)b+='<option value="'+h[c]+'">'+h[c]+"</option>"}b+=
+"</select>";h=l.createElement("div");a.aanFeatures.l||(h.id=a.sTableId+"_length");h.className=a.oClasses.sLength;h.innerHTML="<label>"+a.oLanguage.sLengthMenu.replace("_MENU_",b)+"</label>";i('select option[value="'+a._iDisplayLength+'"]',h).attr("selected",!0);i("select",h).bind("change.DT",function(){var b=i(this).val(),h=a.aanFeatures.l;c=0;for(d=h.length;c<d;c++)h[c]!=this.parentNode&&i("select",h[c]).val(b);a._iDisplayLength=parseInt(b,10);A(a);if(a.fnDisplayEnd()==a.fnRecordsDisplay()){a._iDisplayStart=
+a.fnDisplayEnd()-a._iDisplayLength;if(a._iDisplayStart<0)a._iDisplayStart=0}if(a._iDisplayLength==-1)a._iDisplayStart=0;z(a)});i("select",h).attr("aria-controls",a.sTableId);return h}function A(a){a._iDisplayEnd=!1===a.oFeatures.bPaginate?a.aiDisplay.length:a._iDisplayStart+a._iDisplayLength>a.aiDisplay.length||-1==a._iDisplayLength?a.aiDisplay.length:a._iDisplayStart+a._iDisplayLength}function Ea(a){if(a.oScroll.bInfinite)return null;var b=l.createElement("div");b.className=a.oClasses.sPaging+a.sPaginationType;
+j.ext.oPagination[a.sPaginationType].fnInit(a,b,function(a){A(a);z(a)});a.aanFeatures.p||a.aoDrawCallback.push({fn:function(a){j.ext.oPagination[a.sPaginationType].fnUpdate(a,function(a){A(a);z(a)})},sName:"pagination"});return b}function pa(a,b){var c=a._iDisplayStart;if("number"===typeof b)a._iDisplayStart=b*a._iDisplayLength,a._iDisplayStart>a.fnRecordsDisplay()&&(a._iDisplayStart=0);else if("first"==b)a._iDisplayStart=0;else if("previous"==b)a._iDisplayStart=0<=a._iDisplayLength?a._iDisplayStart-
+a._iDisplayLength:0,0>a._iDisplayStart&&(a._iDisplayStart=0);else if("next"==b)0<=a._iDisplayLength?a._iDisplayStart+a._iDisplayLength<a.fnRecordsDisplay()&&(a._iDisplayStart+=a._iDisplayLength):a._iDisplayStart=0;else if("last"==b)if(0<=a._iDisplayLength){var d=parseInt((a.fnRecordsDisplay()-1)/a._iDisplayLength,10)+1;a._iDisplayStart=(d-1)*a._iDisplayLength}else a._iDisplayStart=0;else E(a,0,"Unknown paging action: "+b);i(a.oInstance).trigger("page",a);return c!=a._iDisplayStart}function Ba(a){var b=
+l.createElement("div");a.aanFeatures.r||(b.id=a.sTableId+"_processing");b.innerHTML=a.oLanguage.sProcessing;b.className=a.oClasses.sProcessing;a.nTable.parentNode.insertBefore(b,a.nTable);return b}function F(a,b){if(a.oFeatures.bProcessing)for(var c=a.aanFeatures.r,d=0,h=c.length;d<h;d++)c[d].style.visibility=b?"visible":"hidden";i(a.oInstance).trigger("processing",[a,b])}function Ca(a){if(""===a.oScroll.sX&&""===a.oScroll.sY)return a.nTable;var b=l.createElement("div"),c=l.createElement("div"),d=
+l.createElement("div"),h=l.createElement("div"),f=l.createElement("div"),g=l.createElement("div"),e=a.nTable.cloneNode(!1),j=a.nTable.cloneNode(!1),m=a.nTable.getElementsByTagName("thead")[0],o=0===a.nTable.getElementsByTagName("tfoot").length?null:a.nTable.getElementsByTagName("tfoot")[0],k=a.oClasses;c.appendChild(d);f.appendChild(g);h.appendChild(a.nTable);b.appendChild(c);b.appendChild(h);d.appendChild(e);e.appendChild(m);null!==o&&(b.appendChild(f),g.appendChild(j),j.appendChild(o));b.className=
+k.sScrollWrapper;c.className=k.sScrollHead;d.className=k.sScrollHeadInner;h.className=k.sScrollBody;f.className=k.sScrollFoot;g.className=k.sScrollFootInner;a.oScroll.bAutoCss&&(c.style.overflow="hidden",c.style.position="relative",f.style.overflow="hidden",h.style.overflow="auto");c.style.border="0";c.style.width="100%";f.style.border="0";d.style.width=""!==a.oScroll.sXInner?a.oScroll.sXInner:"100%";e.removeAttribute("id");e.style.marginLeft="0";a.nTable.style.marginLeft="0";null!==o&&(j.removeAttribute("id"),
+j.style.marginLeft="0");d=i(a.nTable).children("caption");0<d.length&&(d=d[0],"top"===d._captionSide?e.appendChild(d):"bottom"===d._captionSide&&o&&j.appendChild(d));""!==a.oScroll.sX&&(c.style.width=q(a.oScroll.sX),h.style.width=q(a.oScroll.sX),null!==o&&(f.style.width=q(a.oScroll.sX)),i(h).scroll(function(){c.scrollLeft=this.scrollLeft;if(o!==null)f.scrollLeft=this.scrollLeft}));""!==a.oScroll.sY&&(h.style.height=q(a.oScroll.sY));a.aoDrawCallback.push({fn:Ma,sName:"scrolling"});a.oScroll.bInfinite&&
+i(h).scroll(function(){if(!a.bDrawing&&i(this).scrollTop()!==0&&i(this).scrollTop()+i(this).height()>i(a.nTable).height()-a.oScroll.iLoadGap&&a.fnDisplayEnd()<a.fnRecordsDisplay()){pa(a,"next");A(a);z(a)}});a.nScrollHead=c;a.nScrollFoot=f;return b}function Ma(a){var b=a.nScrollHead.getElementsByTagName("div")[0],c=b.getElementsByTagName("table")[0],d=a.nTable.parentNode,h,f,g,e,j,m,o,k,r=[],n=null!==a.nTFoot?a.nScrollFoot.getElementsByTagName("div")[0]:null,p=null!==a.nTFoot?n.getElementsByTagName("table")[0]:
+null,l=a.oBrowser.bScrollOversize;i(a.nTable).children("thead, tfoot").remove();g=i(a.nTHead).clone()[0];a.nTable.insertBefore(g,a.nTable.childNodes[0]);null!==a.nTFoot&&(j=i(a.nTFoot).clone()[0],a.nTable.insertBefore(j,a.nTable.childNodes[1]));""===a.oScroll.sX&&(d.style.width="100%",b.parentNode.style.width="100%");var t=P(a,g);h=0;for(f=t.length;h<f;h++)o=G(a,h),t[h].style.width=a.aoColumns[o].sWidth;null!==a.nTFoot&&N(function(a){a.style.width=""},j.getElementsByTagName("tr"));a.oScroll.bCollapse&&
+""!==a.oScroll.sY&&(d.style.height=d.offsetHeight+a.nTHead.offsetHeight+"px");h=i(a.nTable).outerWidth();if(""===a.oScroll.sX){if(a.nTable.style.width="100%",l&&(i("tbody",d).height()>d.offsetHeight||"scroll"==i(d).css("overflow-y")))a.nTable.style.width=q(i(a.nTable).outerWidth()-a.oScroll.iBarWidth)}else""!==a.oScroll.sXInner?a.nTable.style.width=q(a.oScroll.sXInner):h==i(d).width()&&i(d).height()<i(a.nTable).height()?(a.nTable.style.width=q(h-a.oScroll.iBarWidth),i(a.nTable).outerWidth()>h-a.oScroll.iBarWidth&&
+(a.nTable.style.width=q(h))):a.nTable.style.width=q(h);h=i(a.nTable).outerWidth();f=a.nTHead.getElementsByTagName("tr");g=g.getElementsByTagName("tr");N(function(a,b){m=a.style;m.paddingTop="0";m.paddingBottom="0";m.borderTopWidth="0";m.borderBottomWidth="0";m.height=0;k=i(a).width();b.style.width=q(k);r.push(k)},g,f);i(g).height(0);null!==a.nTFoot&&(e=j.getElementsByTagName("tr"),j=a.nTFoot.getElementsByTagName("tr"),N(function(a,b){m=a.style;m.paddingTop="0";m.paddingBottom="0";m.borderTopWidth=
+"0";m.borderBottomWidth="0";m.height=0;k=i(a).width();b.style.width=q(k);r.push(k)},e,j),i(e).height(0));N(function(a){a.innerHTML="";a.style.width=q(r.shift())},g);null!==a.nTFoot&&N(function(a){a.innerHTML="";a.style.width=q(r.shift())},e);if(i(a.nTable).outerWidth()<h){e=d.scrollHeight>d.offsetHeight||"scroll"==i(d).css("overflow-y")?h+a.oScroll.iBarWidth:h;if(l&&(d.scrollHeight>d.offsetHeight||"scroll"==i(d).css("overflow-y")))a.nTable.style.width=q(e-a.oScroll.iBarWidth);d.style.width=q(e);b.parentNode.style.width=
+q(e);null!==a.nTFoot&&(n.parentNode.style.width=q(e));""===a.oScroll.sX?E(a,1,"The table cannot fit into the current element which will cause column misalignment. The table has been drawn at its minimum possible width."):""!==a.oScroll.sXInner&&E(a,1,"The table cannot fit into the current element which will cause column misalignment. Increase the sScrollXInner value or remove it to allow automatic calculation")}else d.style.width=q("100%"),b.parentNode.style.width=q("100%"),null!==a.nTFoot&&(n.parentNode.style.width=
+q("100%"));""===a.oScroll.sY&&l&&(d.style.height=q(a.nTable.offsetHeight+a.oScroll.iBarWidth));""!==a.oScroll.sY&&a.oScroll.bCollapse&&(d.style.height=q(a.oScroll.sY),l=""!==a.oScroll.sX&&a.nTable.offsetWidth>d.offsetWidth?a.oScroll.iBarWidth:0,a.nTable.offsetHeight<d.offsetHeight&&(d.style.height=q(a.nTable.offsetHeight+l)));l=i(a.nTable).outerWidth();c.style.width=q(l);b.style.width=q(l);c=i(a.nTable).height()>d.clientHeight||"scroll"==i(d).css("overflow-y");b.style.paddingRight=c?a.oScroll.iBarWidth+
+"px":"0px";null!==a.nTFoot&&(p.style.width=q(l),n.style.width=q(l),n.style.paddingRight=c?a.oScroll.iBarWidth+"px":"0px");i(d).scroll();if(a.bSorted||a.bFiltered)d.scrollTop=0}function N(a,b,c){for(var d=0,h=b.length;d<h;d++)for(var f=0,g=b[d].childNodes.length;f<g;f++)1==b[d].childNodes[f].nodeType&&(c?a(b[d].childNodes[f],c[d].childNodes[f]):a(b[d].childNodes[f]))}function Na(a,b){if(!a||null===a||""===a)return 0;b||(b=l.getElementsByTagName("body")[0]);var c,d=l.createElement("div");d.style.width=
+q(a);b.appendChild(d);c=d.offsetWidth;b.removeChild(d);return c}function ca(a){var b=0,c,d=0,h=a.aoColumns.length,f,g=i("th",a.nTHead),e=a.nTable.getAttribute("width");for(f=0;f<h;f++)a.aoColumns[f].bVisible&&(d++,null!==a.aoColumns[f].sWidth&&(c=Na(a.aoColumns[f].sWidthOrig,a.nTable.parentNode),null!==c&&(a.aoColumns[f].sWidth=q(c)),b++));if(h==g.length&&0===b&&d==h&&""===a.oScroll.sX&&""===a.oScroll.sY)for(f=0;f<a.aoColumns.length;f++)c=i(g[f]).width(),null!==c&&(a.aoColumns[f].sWidth=q(c));else{b=
+a.nTable.cloneNode(!1);f=a.nTHead.cloneNode(!0);d=l.createElement("tbody");c=l.createElement("tr");b.removeAttribute("id");b.appendChild(f);null!==a.nTFoot&&(b.appendChild(a.nTFoot.cloneNode(!0)),N(function(a){a.style.width=""},b.getElementsByTagName("tr")));b.appendChild(d);d.appendChild(c);d=i("thead th",b);0===d.length&&(d=i("tbody tr:eq(0)>td",b));g=P(a,f);for(f=d=0;f<h;f++){var j=a.aoColumns[f];j.bVisible&&null!==j.sWidthOrig&&""!==j.sWidthOrig?g[f-d].style.width=q(j.sWidthOrig):j.bVisible?g[f-
+d].style.width="":d++}for(f=0;f<h;f++)a.aoColumns[f].bVisible&&(d=Oa(a,f),null!==d&&(d=d.cloneNode(!0),""!==a.aoColumns[f].sContentPadding&&(d.innerHTML+=a.aoColumns[f].sContentPadding),c.appendChild(d)));h=a.nTable.parentNode;h.appendChild(b);""!==a.oScroll.sX&&""!==a.oScroll.sXInner?b.style.width=q(a.oScroll.sXInner):""!==a.oScroll.sX?(b.style.width="",i(b).width()<h.offsetWidth&&(b.style.width=q(h.offsetWidth))):""!==a.oScroll.sY?b.style.width=q(h.offsetWidth):e&&(b.style.width=q(e));b.style.visibility=
+"hidden";Pa(a,b);h=i("tbody tr:eq(0)",b).children();0===h.length&&(h=P(a,i("thead",b)[0]));if(""!==a.oScroll.sX){for(f=d=c=0;f<a.aoColumns.length;f++)a.aoColumns[f].bVisible&&(c=null===a.aoColumns[f].sWidthOrig?c+i(h[d]).outerWidth():c+(parseInt(a.aoColumns[f].sWidth.replace("px",""),10)+(i(h[d]).outerWidth()-i(h[d]).width())),d++);b.style.width=q(c);a.nTable.style.width=q(c)}for(f=d=0;f<a.aoColumns.length;f++)a.aoColumns[f].bVisible&&(c=i(h[d]).width(),null!==c&&0<c&&(a.aoColumns[f].sWidth=q(c)),
+d++);h=i(b).css("width");a.nTable.style.width=-1!==h.indexOf("%")?h:q(i(b).outerWidth());b.parentNode.removeChild(b)}e&&(a.nTable.style.width=q(e))}function Pa(a,b){""===a.oScroll.sX&&""!==a.oScroll.sY?(i(b).width(),b.style.width=q(i(b).outerWidth()-a.oScroll.iBarWidth)):""!==a.oScroll.sX&&(b.style.width=q(i(b).outerWidth()))}function Oa(a,b){var c=Qa(a,b);if(0>c)return null;if(null===a.aoData[c].nTr){var d=l.createElement("td");d.innerHTML=x(a,c,b,"");return d}return L(a,c)[b]}function Qa(a,b){for(var c=
+-1,d=-1,h=0;h<a.aoData.length;h++){var f=x(a,h,b,"display")+"",f=f.replace(/<.*?>/g,"");f.length>c&&(c=f.length,d=h)}return d}function q(a){if(null===a)return"0px";if("number"==typeof a)return 0>a?"0px":a+"px";var b=a.charCodeAt(a.length-1);return 48>b||57<b?a:a+"px"}function Ra(){var a=l.createElement("p"),b=a.style;b.width="100%";b.height="200px";b.padding="0px";var c=l.createElement("div"),b=c.style;b.position="absolute";b.top="0px";b.left="0px";b.visibility="hidden";b.width="200px";b.height="150px";
+b.padding="0px";b.overflow="hidden";c.appendChild(a);l.body.appendChild(c);b=a.offsetWidth;c.style.overflow="scroll";a=a.offsetWidth;b==a&&(a=c.clientWidth);l.body.removeChild(c);return b-a}function Q(a,b){var c,d,h,f,g,e,o=[],m=[],k=j.ext.oSort,r=a.aoData,l=a.aoColumns,p=a.oLanguage.oAria;if(!a.oFeatures.bServerSide&&(0!==a.aaSorting.length||null!==a.aaSortingFixed)){o=null!==a.aaSortingFixed?a.aaSortingFixed.concat(a.aaSorting):a.aaSorting.slice();for(c=0;c<o.length;c++)if(d=o[c][0],h=t(a,d),f=
+a.aoColumns[d].sSortDataType,j.ext.afnSortData[f])if(g=j.ext.afnSortData[f].call(a.oInstance,a,d,h),g.length===r.length){h=0;for(f=r.length;h<f;h++)I(a,h,d,g[h])}else E(a,0,"Returned data sort array (col "+d+") is the wrong length");c=0;for(d=a.aiDisplayMaster.length;c<d;c++)m[a.aiDisplayMaster[c]]=c;var q=o.length,G;c=0;for(d=r.length;c<d;c++)for(h=0;h<q;h++){G=l[o[h][0]].aDataSort;g=0;for(e=G.length;g<e;g++)f=l[G[g]].sType,f=k[(f?f:"string")+"-pre"],r[c]._aSortData[G[g]]=f?f(x(a,c,G[g],"sort")):
+x(a,c,G[g],"sort")}a.aiDisplayMaster.sort(function(a,b){var c,d,h,f,g;for(c=0;c<q;c++){g=l[o[c][0]].aDataSort;d=0;for(h=g.length;d<h;d++)if(f=l[g[d]].sType,f=k[(f?f:"string")+"-"+o[c][1]](r[a]._aSortData[g[d]],r[b]._aSortData[g[d]]),0!==f)return f}return k["numeric-asc"](m[a],m[b])})}(b===n||b)&&!a.oFeatures.bDeferRender&&R(a);c=0;for(d=a.aoColumns.length;c<d;c++)f=l[c].sTitle.replace(/<.*?>/g,""),h=l[c].nTh,h.removeAttribute("aria-sort"),h.removeAttribute("aria-label"),l[c].bSortable?0<o.length&&
+o[0][0]==c?(h.setAttribute("aria-sort","asc"==o[0][1]?"ascending":"descending"),h.setAttribute("aria-label",f+("asc"==(l[c].asSorting[o[0][2]+1]?l[c].asSorting[o[0][2]+1]:l[c].asSorting[0])?p.sSortAscending:p.sSortDescending))):h.setAttribute("aria-label",f+("asc"==l[c].asSorting[0]?p.sSortAscending:p.sSortDescending)):h.setAttribute("aria-label",f);a.bSorted=!0;i(a.oInstance).trigger("sort",a);a.oFeatures.bFilter?M(a,a.oPreviousSearch,1):(a.aiDisplay=a.aiDisplayMaster.slice(),a._iDisplayStart=0,
+A(a),z(a))}function ha(a,b,c,d){Sa(b,{},function(b){if(!1!==a.aoColumns[c].bSortable){var f=function(){var d,f;if(b.shiftKey){for(var e=!1,i=0;i<a.aaSorting.length;i++)if(a.aaSorting[i][0]==c){e=!0;d=a.aaSorting[i][0];f=a.aaSorting[i][2]+1;a.aoColumns[d].asSorting[f]?(a.aaSorting[i][1]=a.aoColumns[d].asSorting[f],a.aaSorting[i][2]=f):a.aaSorting.splice(i,1);break}!1===e&&a.aaSorting.push([c,a.aoColumns[c].asSorting[0],0])}else 1==a.aaSorting.length&&a.aaSorting[0][0]==c?(d=a.aaSorting[0][0],f=a.aaSorting[0][2]+
+1,a.aoColumns[d].asSorting[f]||(f=0),a.aaSorting[0][1]=a.aoColumns[d].asSorting[f],a.aaSorting[0][2]=f):(a.aaSorting.splice(0,a.aaSorting.length),a.aaSorting.push([c,a.aoColumns[c].asSorting[0],0]));Q(a)};a.oFeatures.bProcessing?(F(a,!0),setTimeout(function(){f();a.oFeatures.bServerSide||F(a,!1)},0)):f();"function"==typeof d&&d(a)}})}function R(a){var b,c,d,h,f,e=a.aoColumns.length,j=a.oClasses;for(b=0;b<e;b++)a.aoColumns[b].bSortable&&i(a.aoColumns[b].nTh).removeClass(j.sSortAsc+" "+j.sSortDesc+
+" "+a.aoColumns[b].sSortingClass);h=null!==a.aaSortingFixed?a.aaSortingFixed.concat(a.aaSorting):a.aaSorting.slice();for(b=0;b<a.aoColumns.length;b++)if(a.aoColumns[b].bSortable){f=a.aoColumns[b].sSortingClass;d=-1;for(c=0;c<h.length;c++)if(h[c][0]==b){f="asc"==h[c][1]?j.sSortAsc:j.sSortDesc;d=c;break}i(a.aoColumns[b].nTh).addClass(f);a.bJUI&&(c=i("span."+j.sSortIcon,a.aoColumns[b].nTh),c.removeClass(j.sSortJUIAsc+" "+j.sSortJUIDesc+" "+j.sSortJUI+" "+j.sSortJUIAscAllowed+" "+j.sSortJUIDescAllowed),
+c.addClass(-1==d?a.aoColumns[b].sSortingClassJUI:"asc"==h[d][1]?j.sSortJUIAsc:j.sSortJUIDesc))}else i(a.aoColumns[b].nTh).addClass(a.aoColumns[b].sSortingClass);f=j.sSortColumn;if(a.oFeatures.bSort&&a.oFeatures.bSortClasses){d=L(a);if(a.oFeatures.bDeferRender)i(d).removeClass(f+"1 "+f+"2 "+f+"3");else if(d.length>=e)for(b=0;b<e;b++)if(-1!=d[b].className.indexOf(f+"1")){c=0;for(a=d.length/e;c<a;c++)d[e*c+b].className=i.trim(d[e*c+b].className.replace(f+"1",""))}else if(-1!=d[b].className.indexOf(f+
+"2")){c=0;for(a=d.length/e;c<a;c++)d[e*c+b].className=i.trim(d[e*c+b].className.replace(f+"2",""))}else if(-1!=d[b].className.indexOf(f+"3")){c=0;for(a=d.length/e;c<a;c++)d[e*c+b].className=i.trim(d[e*c+b].className.replace(" "+f+"3",""))}var j=1,o;for(b=0;b<h.length;b++){o=parseInt(h[b][0],10);c=0;for(a=d.length/e;c<a;c++)d[e*c+o].className+=" "+f+j;3>j&&j++}}}function qa(a){if(a.oFeatures.bStateSave&&!a.bDestroying){var b,c;b=a.oScroll.bInfinite;var d={iCreate:(new Date).getTime(),iStart:b?0:a._iDisplayStart,
+iEnd:b?a._iDisplayLength:a._iDisplayEnd,iLength:a._iDisplayLength,aaSorting:i.extend(!0,[],a.aaSorting),oSearch:i.extend(!0,{},a.oPreviousSearch),aoSearchCols:i.extend(!0,[],a.aoPreSearchCols),abVisCols:[]};b=0;for(c=a.aoColumns.length;b<c;b++)d.abVisCols.push(a.aoColumns[b].bVisible);C(a,"aoStateSaveParams","stateSaveParams",[a,d]);a.fnStateSave.call(a.oInstance,a,d)}}function Ta(a,b){if(a.oFeatures.bStateSave){var c=a.fnStateLoad.call(a.oInstance,a);if(c){var d=C(a,"aoStateLoadParams","stateLoadParams",
+[a,c]);if(-1===i.inArray(!1,d)){a.oLoadedState=i.extend(!0,{},c);a._iDisplayStart=c.iStart;a.iInitDisplayStart=c.iStart;a._iDisplayEnd=c.iEnd;a._iDisplayLength=c.iLength;a.aaSorting=c.aaSorting.slice();a.saved_aaSorting=c.aaSorting.slice();i.extend(a.oPreviousSearch,c.oSearch);i.extend(!0,a.aoPreSearchCols,c.aoSearchCols);b.saved_aoColumns=[];for(d=0;d<c.abVisCols.length;d++)b.saved_aoColumns[d]={},b.saved_aoColumns[d].bVisible=c.abVisCols[d];C(a,"aoStateLoaded","stateLoaded",[a,c])}}}}function Ua(a){for(var b=
+O.location.pathname.split("/"),a=a+"_"+b[b.length-1].replace(/[\/:]/g,"").toLowerCase()+"=",b=l.cookie.split(";"),c=0;c<b.length;c++){for(var d=b[c];" "==d.charAt(0);)d=d.substring(1,d.length);if(0===d.indexOf(a))return decodeURIComponent(d.substring(a.length,d.length))}return null}function u(a){for(var b=0;b<j.settings.length;b++)if(j.settings[b].nTable===a)return j.settings[b];return null}function U(a){for(var b=[],a=a.aoData,c=0,d=a.length;c<d;c++)null!==a[c].nTr&&b.push(a[c].nTr);return b}function L(a,
+b){var c=[],d,h,f,e,i,j;h=0;var o=a.aoData.length;b!==n&&(h=b,o=b+1);for(f=h;f<o;f++)if(j=a.aoData[f],null!==j.nTr){h=[];e=0;for(i=j.nTr.childNodes.length;e<i;e++)d=j.nTr.childNodes[e].nodeName.toLowerCase(),("td"==d||"th"==d)&&h.push(j.nTr.childNodes[e]);e=d=0;for(i=a.aoColumns.length;e<i;e++)a.aoColumns[e].bVisible?c.push(h[e-d]):(c.push(j._anHidden[e]),d++)}return c}function E(a,b,c){a=null===a?"DataTables warning: "+c:"DataTables warning (table id = '"+a.sTableId+"'): "+c;if(0===b)if("alert"==
+j.ext.sErrMode)alert(a);else throw Error(a);else O.console&&console.log&&console.log(a)}function p(a,b,c,d){d===n&&(d=c);b[c]!==n&&(a[d]=b[c])}function Va(a,b){var c,d;for(d in b)b.hasOwnProperty(d)&&(c=b[d],"object"===typeof e[d]&&null!==c&&!1===i.isArray(c)?i.extend(!0,a[d],c):a[d]=c);return a}function Sa(a,b,c){i(a).bind("click.DT",b,function(b){a.blur();c(b)}).bind("keypress.DT",b,function(a){13===a.which&&c(a)}).bind("selectstart.DT",function(){return!1})}function B(a,b,c,d){c&&a[b].push({fn:c,
+sName:d})}function C(a,b,c,d){for(var b=a[b],h=[],e=b.length-1;0<=e;e--)h.push(b[e].fn.apply(a.oInstance,d));null!==c&&i(a.oInstance).trigger(c,d);return h}function Wa(a){var b=i('<div style="position:absolute; top:0; left:0; height:1px; width:1px; overflow:hidden"><div style="position:absolute; top:1px; left:1px; width:100px; height:50px; overflow:scroll;"><div id="DT_BrowserTest" style="width:100%; height:10px;"></div></div></div>')[0];l.body.appendChild(b);a.oBrowser.bScrollOversize=100===i("#DT_BrowserTest",
+b)[0].offsetWidth?!0:!1;l.body.removeChild(b)}function Xa(a){return function(){var b=[u(this[j.ext.iApiIndex])].concat(Array.prototype.slice.call(arguments));return j.ext.oApi[a].apply(this,b)}}var V=/\[.*?\]$/,Ya=O.JSON?JSON.stringify:function(a){var b=typeof a;if("object"!==b||null===a)return"string"===b&&(a='"'+a+'"'),a+"";var c,d,h=[],e=i.isArray(a);for(c in a)d=a[c],b=typeof d,"string"===b?d='"'+d+'"':"object"===b&&null!==d&&(d=Ya(d)),h.push((e?"":'"'+c+'":')+d);return(e?"[":"{")+h+(e?"]":"}")};
+this.$=function(a,b){var c,d,h=[],e;d=u(this[j.ext.iApiIndex]);var g=d.aoData,o=d.aiDisplay,k=d.aiDisplayMaster;b||(b={});b=i.extend({},{filter:"none",order:"current",page:"all"},b);if("current"==b.page){c=d._iDisplayStart;for(d=d.fnDisplayEnd();c<d;c++)(e=g[o[c]].nTr)&&h.push(e)}else if("current"==b.order&&"none"==b.filter){c=0;for(d=k.length;c<d;c++)(e=g[k[c]].nTr)&&h.push(e)}else if("current"==b.order&&"applied"==b.filter){c=0;for(d=o.length;c<d;c++)(e=g[o[c]].nTr)&&h.push(e)}else if("original"==
+b.order&&"none"==b.filter){c=0;for(d=g.length;c<d;c++)(e=g[c].nTr)&&h.push(e)}else if("original"==b.order&&"applied"==b.filter){c=0;for(d=g.length;c<d;c++)e=g[c].nTr,-1!==i.inArray(c,o)&&e&&h.push(e)}else E(d,1,"Unknown selection options");h=i(h);c=h.filter(a);h=h.find(a);return i([].concat(i.makeArray(c),i.makeArray(h)))};this._=function(a,b){var c=[],d,e,f=this.$(a,b);d=0;for(e=f.length;d<e;d++)c.push(this.fnGetData(f[d]));return c};this.fnAddData=function(a,b){if(0===a.length)return[];var c=[],
+d,e=u(this[j.ext.iApiIndex]);if("object"===typeof a[0]&&null!==a[0])for(var f=0;f<a.length;f++){d=J(e,a[f]);if(-1==d)return c;c.push(d)}else{d=J(e,a);if(-1==d)return c;c.push(d)}e.aiDisplay=e.aiDisplayMaster.slice();(b===n||b)&&aa(e);return c};this.fnAdjustColumnSizing=function(a){var b=u(this[j.ext.iApiIndex]);k(b);a===n||a?this.fnDraw(!1):(""!==b.oScroll.sX||""!==b.oScroll.sY)&&this.oApi._fnScrollDraw(b)};this.fnClearTable=function(a){var b=u(this[j.ext.iApiIndex]);fa(b);(a===n||a)&&z(b)};this.fnClose=
+function(a){for(var b=u(this[j.ext.iApiIndex]),c=0;c<b.aoOpenRows.length;c++)if(b.aoOpenRows[c].nParent==a)return(a=b.aoOpenRows[c].nTr.parentNode)&&a.removeChild(b.aoOpenRows[c].nTr),b.aoOpenRows.splice(c,1),0;return 1};this.fnDeleteRow=function(a,b,c){var d=u(this[j.ext.iApiIndex]),e,f,a="object"===typeof a?K(d,a):a,g=d.aoData.splice(a,1);e=0;for(f=d.aoData.length;e<f;e++)null!==d.aoData[e].nTr&&(d.aoData[e].nTr._DT_RowIndex=e);e=i.inArray(a,d.aiDisplay);d.asDataSearch.splice(e,1);ga(d.aiDisplayMaster,
+a);ga(d.aiDisplay,a);"function"===typeof b&&b.call(this,d,g);d._iDisplayStart>=d.fnRecordsDisplay()&&(d._iDisplayStart-=d._iDisplayLength,0>d._iDisplayStart&&(d._iDisplayStart=0));if(c===n||c)A(d),z(d);return g};this.fnDestroy=function(a){var b=u(this[j.ext.iApiIndex]),c=b.nTableWrapper.parentNode,d=b.nTBody,e,f,a=a===n?!1:!0;b.bDestroying=!0;C(b,"aoDestroyCallback","destroy",[b]);e=0;for(f=b.aoColumns.length;e<f;e++)!1===b.aoColumns[e].bVisible&&this.fnSetColumnVis(e,!0);i(b.nTableWrapper).find("*").andSelf().unbind(".DT");
+i("tbody>tr>td."+b.oClasses.sRowEmpty,b.nTable).parent().remove();b.nTable!=b.nTHead.parentNode&&(i(b.nTable).children("thead").remove(),b.nTable.appendChild(b.nTHead));b.nTFoot&&b.nTable!=b.nTFoot.parentNode&&(i(b.nTable).children("tfoot").remove(),b.nTable.appendChild(b.nTFoot));b.nTable.parentNode.removeChild(b.nTable);i(b.nTableWrapper).remove();b.aaSorting=[];b.aaSortingFixed=[];R(b);i(U(b)).removeClass(b.asStripeClasses.join(" "));i("th, td",b.nTHead).removeClass([b.oClasses.sSortable,b.oClasses.sSortableAsc,
+b.oClasses.sSortableDesc,b.oClasses.sSortableNone].join(" "));b.bJUI&&(i("th span."+b.oClasses.sSortIcon+", td span."+b.oClasses.sSortIcon,b.nTHead).remove(),i("th, td",b.nTHead).each(function(){var a=i("div."+b.oClasses.sSortJUIWrapper,this),c=a.contents();i(this).append(c);a.remove()}));!a&&b.nTableReinsertBefore?c.insertBefore(b.nTable,b.nTableReinsertBefore):a||c.appendChild(b.nTable);e=0;for(f=b.aoData.length;e<f;e++)null!==b.aoData[e].nTr&&d.appendChild(b.aoData[e].nTr);!0===b.oFeatures.bAutoWidth&&
+(b.nTable.style.width=q(b.sDestroyWidth));i(d).children("tr:even").addClass(b.asDestroyStripes[0]);i(d).children("tr:odd").addClass(b.asDestroyStripes[1]);e=0;for(f=j.settings.length;e<f;e++)j.settings[e]==b&&j.settings.splice(e,1);b=null};this.fnDraw=function(a){var b=u(this[j.ext.iApiIndex]);!1===a?(A(b),z(b)):aa(b)};this.fnFilter=function(a,b,c,d,e,f){var g=u(this[j.ext.iApiIndex]);if(g.oFeatures.bFilter){if(c===n||null===c)c=!1;if(d===n||null===d)d=!0;if(e===n||null===e)e=!0;if(f===n||null===
+f)f=!0;if(b===n||null===b){if(M(g,{sSearch:a+"",bRegex:c,bSmart:d,bCaseInsensitive:f},1),e&&g.aanFeatures.f){b=g.aanFeatures.f;c=0;for(d=b.length;c<d;c++)i(b[c]._DT_Input).val(a)}}else i.extend(g.aoPreSearchCols[b],{sSearch:a+"",bRegex:c,bSmart:d,bCaseInsensitive:f}),M(g,g.oPreviousSearch,1)}};this.fnGetData=function(a,b){var c=u(this[j.ext.iApiIndex]);if(a!==n){var d=a;if("object"===typeof a){var e=a.nodeName.toLowerCase();"tr"===e?d=K(c,a):"td"===e&&(d=K(c,a.parentNode),b=ea(c,d,a))}return b!==
+n?x(c,d,b,""):c.aoData[d]!==n?c.aoData[d]._aData:null}return Z(c)};this.fnGetNodes=function(a){var b=u(this[j.ext.iApiIndex]);return a!==n?b.aoData[a]!==n?b.aoData[a].nTr:null:U(b)};this.fnGetPosition=function(a){var b=u(this[j.ext.iApiIndex]),c=a.nodeName.toUpperCase();return"TR"==c?K(b,a):"TD"==c||"TH"==c?(c=K(b,a.parentNode),a=ea(b,c,a),[c,t(b,a),a]):null};this.fnIsOpen=function(a){for(var b=u(this[j.ext.iApiIndex]),c=0;c<b.aoOpenRows.length;c++)if(b.aoOpenRows[c].nParent==a)return!0;return!1};
+this.fnOpen=function(a,b,c){var d=u(this[j.ext.iApiIndex]),e=U(d);if(-1!==i.inArray(a,e)){this.fnClose(a);var e=l.createElement("tr"),f=l.createElement("td");e.appendChild(f);f.className=c;f.colSpan=w(d);"string"===typeof b?f.innerHTML=b:i(f).html(b);b=i("tr",d.nTBody);-1!=i.inArray(a,b)&&i(e).insertAfter(a);d.aoOpenRows.push({nTr:e,nParent:a});return e}};this.fnPageChange=function(a,b){var c=u(this[j.ext.iApiIndex]);pa(c,a);A(c);(b===n||b)&&z(c)};this.fnSetColumnVis=function(a,b,c){var d=u(this[j.ext.iApiIndex]),
+e,f,g=d.aoColumns,i=d.aoData,o,m;if(g[a].bVisible!=b){if(b){for(e=f=0;e<a;e++)g[e].bVisible&&f++;m=f>=w(d);if(!m)for(e=a;e<g.length;e++)if(g[e].bVisible){o=e;break}e=0;for(f=i.length;e<f;e++)null!==i[e].nTr&&(m?i[e].nTr.appendChild(i[e]._anHidden[a]):i[e].nTr.insertBefore(i[e]._anHidden[a],L(d,e)[o]))}else{e=0;for(f=i.length;e<f;e++)null!==i[e].nTr&&(o=L(d,e)[a],i[e]._anHidden[a]=o,o.parentNode.removeChild(o))}g[a].bVisible=b;X(d,d.aoHeader);d.nTFoot&&X(d,d.aoFooter);e=0;for(f=d.aoOpenRows.length;e<
+f;e++)d.aoOpenRows[e].nTr.colSpan=w(d);if(c===n||c)k(d),z(d);qa(d)}};this.fnSettings=function(){return u(this[j.ext.iApiIndex])};this.fnSort=function(a){var b=u(this[j.ext.iApiIndex]);b.aaSorting=a;Q(b)};this.fnSortListener=function(a,b,c){ha(u(this[j.ext.iApiIndex]),a,b,c)};this.fnUpdate=function(a,b,c,d,e){var f=u(this[j.ext.iApiIndex]),b="object"===typeof b?K(f,b):b;if(i.isArray(a)&&c===n){f.aoData[b]._aData=a.slice();for(c=0;c<f.aoColumns.length;c++)this.fnUpdate(x(f,b,c),b,c,!1,!1)}else if(i.isPlainObject(a)&&
+c===n){f.aoData[b]._aData=i.extend(!0,{},a);for(c=0;c<f.aoColumns.length;c++)this.fnUpdate(x(f,b,c),b,c,!1,!1)}else{I(f,b,c,a);var a=x(f,b,c,"display"),g=f.aoColumns[c];null!==g.fnRender&&(a=T(f,b,c),g.bUseRendered&&I(f,b,c,a));null!==f.aoData[b].nTr&&(L(f,b)[c].innerHTML=a)}c=i.inArray(b,f.aiDisplay);f.asDataSearch[c]=ma(f,Y(f,b,"filter",v(f,"bSearchable")));(e===n||e)&&k(f);(d===n||d)&&aa(f);return 0};this.fnVersionCheck=j.ext.fnVersionCheck;this.oApi={_fnExternApiFunc:Xa,_fnInitialise:ba,_fnInitComplete:$,
+_fnLanguageCompat:oa,_fnAddColumn:o,_fnColumnOptions:r,_fnAddData:J,_fnCreateTr:da,_fnGatherData:va,_fnBuildHead:wa,_fnDrawHead:X,_fnDraw:z,_fnReDraw:aa,_fnAjaxUpdate:xa,_fnAjaxParameters:Fa,_fnAjaxUpdateDraw:Ga,_fnServerParams:ja,_fnAddOptionsHtml:ya,_fnFeatureHtmlTable:Ca,_fnScrollDraw:Ma,_fnAdjustColumnSizing:k,_fnFeatureHtmlFilter:Aa,_fnFilterComplete:M,_fnFilterCustom:Ja,_fnFilterColumn:Ia,_fnFilter:Ha,_fnBuildSearchArray:ka,_fnBuildSearchRow:ma,_fnFilterCreateSearch:la,_fnDataToSearch:Ka,_fnSort:Q,
+_fnSortAttachListener:ha,_fnSortingClasses:R,_fnFeatureHtmlPaginate:Ea,_fnPageChange:pa,_fnFeatureHtmlInfo:Da,_fnUpdateInfo:La,_fnFeatureHtmlLength:za,_fnFeatureHtmlProcessing:Ba,_fnProcessingDisplay:F,_fnVisibleToColumnIndex:G,_fnColumnIndexToVisible:t,_fnNodeToDataIndex:K,_fnVisbleColumns:w,_fnCalculateEnd:A,_fnConvertToWidth:Na,_fnCalculateColumnWidths:ca,_fnScrollingWidthAdjust:Pa,_fnGetWidestNode:Oa,_fnGetMaxLenString:Qa,_fnStringToCss:q,_fnDetectType:D,_fnSettingsFromNode:u,_fnGetDataMaster:Z,
+_fnGetTrNodes:U,_fnGetTdNodes:L,_fnEscapeRegex:na,_fnDeleteIndex:ga,_fnReOrderIndex:y,_fnColumnOrdering:H,_fnLog:E,_fnClearTable:fa,_fnSaveState:qa,_fnLoadState:Ta,_fnCreateCookie:function(a,b,c,d,e){var f=new Date;f.setTime(f.getTime()+1E3*c);var c=O.location.pathname.split("/"),a=a+"_"+c.pop().replace(/[\/:]/g,"").toLowerCase(),g;null!==e?(g="function"===typeof i.parseJSON?i.parseJSON(b):eval("("+b+")"),b=e(a,g,f.toGMTString(),c.join("/")+"/")):b=a+"="+encodeURIComponent(b)+"; expires="+f.toGMTString()+
+"; path="+c.join("/")+"/";e="";f=9999999999999;if(4096<(null!==Ua(a)?l.cookie.length:b.length+l.cookie.length)+10){for(var a=l.cookie.split(";"),j=0,o=a.length;j<o;j++)if(-1!=a[j].indexOf(d)){var k=a[j].split("=");try{g=eval("("+decodeURIComponent(k[1])+")")}catch(r){continue}g.iCreate&&g.iCreate<f&&(e=k[0],f=g.iCreate)}""!==e&&(l.cookie=e+"=; expires=Thu, 01-Jan-1970 00:00:01 GMT; path="+c.join("/")+"/")}l.cookie=b},_fnReadCookie:Ua,_fnDetectHeader:W,_fnGetUniqueThs:P,_fnScrollBarWidth:Ra,_fnApplyToChildren:N,
+_fnMap:p,_fnGetRowData:Y,_fnGetCellData:x,_fnSetCellData:I,_fnGetObjectDataFn:S,_fnSetObjectDataFn:ta,_fnApplyColumnDefs:ua,_fnBindAction:Sa,_fnExtend:Va,_fnCallbackReg:B,_fnCallbackFire:C,_fnJsonString:Ya,_fnRender:T,_fnNodeToColumnIndex:ea,_fnInfoMacros:ia,_fnBrowserDetect:Wa,_fnGetColumns:v};i.extend(j.ext.oApi,this.oApi);for(var ra in j.ext.oApi)ra&&(this[ra]=Xa(ra));var sa=this;return this.each(function(){var a=0,b,c,d;c=this.getAttribute("id");var h=!1,f=!1;if("table"!=this.nodeName.toLowerCase())E(null,
+0,"Attempted to initialise DataTables on a node which is not a table: "+this.nodeName);else{a=0;for(b=j.settings.length;a<b;a++){if(j.settings[a].nTable==this){if(e===n||e.bRetrieve)return j.settings[a].oInstance;if(e.bDestroy){j.settings[a].oInstance.fnDestroy();break}else{E(j.settings[a],0,"Cannot reinitialise DataTable.\n\nTo retrieve the DataTables object for this table, pass no arguments or see the docs for bRetrieve and bDestroy");return}}if(j.settings[a].sTableId==this.id){j.settings.splice(a,
+1);break}}if(null===c||""===c)this.id=c="DataTables_Table_"+j.ext._oExternConfig.iNextUnique++;var g=i.extend(!0,{},j.models.oSettings,{nTable:this,oApi:sa.oApi,oInit:e,sDestroyWidth:i(this).width(),sInstance:c,sTableId:c});j.settings.push(g);g.oInstance=1===sa.length?sa:i(this).dataTable();e||(e={});e.oLanguage&&oa(e.oLanguage);e=Va(i.extend(!0,{},j.defaults),e);p(g.oFeatures,e,"bPaginate");p(g.oFeatures,e,"bLengthChange");p(g.oFeatures,e,"bFilter");p(g.oFeatures,e,"bSort");p(g.oFeatures,e,"bInfo");
+p(g.oFeatures,e,"bProcessing");p(g.oFeatures,e,"bAutoWidth");p(g.oFeatures,e,"bSortClasses");p(g.oFeatures,e,"bServerSide");p(g.oFeatures,e,"bDeferRender");p(g.oScroll,e,"sScrollX","sX");p(g.oScroll,e,"sScrollXInner","sXInner");p(g.oScroll,e,"sScrollY","sY");p(g.oScroll,e,"bScrollCollapse","bCollapse");p(g.oScroll,e,"bScrollInfinite","bInfinite");p(g.oScroll,e,"iScrollLoadGap","iLoadGap");p(g.oScroll,e,"bScrollAutoCss","bAutoCss");p(g,e,"asStripeClasses");p(g,e,"asStripClasses","asStripeClasses");
+p(g,e,"fnServerData");p(g,e,"fnFormatNumber");p(g,e,"sServerMethod");p(g,e,"aaSorting");p(g,e,"aaSortingFixed");p(g,e,"aLengthMenu");p(g,e,"sPaginationType");p(g,e,"sAjaxSource");p(g,e,"sAjaxDataProp");p(g,e,"iCookieDuration");p(g,e,"sCookiePrefix");p(g,e,"sDom");p(g,e,"bSortCellsTop");p(g,e,"iTabIndex");p(g,e,"oSearch","oPreviousSearch");p(g,e,"aoSearchCols","aoPreSearchCols");p(g,e,"iDisplayLength","_iDisplayLength");p(g,e,"bJQueryUI","bJUI");p(g,e,"fnCookieCallback");p(g,e,"fnStateLoad");p(g,e,
+"fnStateSave");p(g.oLanguage,e,"fnInfoCallback");B(g,"aoDrawCallback",e.fnDrawCallback,"user");B(g,"aoServerParams",e.fnServerParams,"user");B(g,"aoStateSaveParams",e.fnStateSaveParams,"user");B(g,"aoStateLoadParams",e.fnStateLoadParams,"user");B(g,"aoStateLoaded",e.fnStateLoaded,"user");B(g,"aoRowCallback",e.fnRowCallback,"user");B(g,"aoRowCreatedCallback",e.fnCreatedRow,"user");B(g,"aoHeaderCallback",e.fnHeaderCallback,"user");B(g,"aoFooterCallback",e.fnFooterCallback,"user");B(g,"aoInitComplete",
+e.fnInitComplete,"user");B(g,"aoPreDrawCallback",e.fnPreDrawCallback,"user");g.oFeatures.bServerSide&&g.oFeatures.bSort&&g.oFeatures.bSortClasses?B(g,"aoDrawCallback",R,"server_side_sort_classes"):g.oFeatures.bDeferRender&&B(g,"aoDrawCallback",R,"defer_sort_classes");e.bJQueryUI?(i.extend(g.oClasses,j.ext.oJUIClasses),e.sDom===j.defaults.sDom&&"lfrtip"===j.defaults.sDom&&(g.sDom='<"H"lfr>t<"F"ip>')):i.extend(g.oClasses,j.ext.oStdClasses);i(this).addClass(g.oClasses.sTable);if(""!==g.oScroll.sX||""!==
+g.oScroll.sY)g.oScroll.iBarWidth=Ra();g.iInitDisplayStart===n&&(g.iInitDisplayStart=e.iDisplayStart,g._iDisplayStart=e.iDisplayStart);e.bStateSave&&(g.oFeatures.bStateSave=!0,Ta(g,e),B(g,"aoDrawCallback",qa,"state_save"));null!==e.iDeferLoading&&(g.bDeferLoading=!0,a=i.isArray(e.iDeferLoading),g._iRecordsDisplay=a?e.iDeferLoading[0]:e.iDeferLoading,g._iRecordsTotal=a?e.iDeferLoading[1]:e.iDeferLoading);null!==e.aaData&&(f=!0);""!==e.oLanguage.sUrl?(g.oLanguage.sUrl=e.oLanguage.sUrl,i.getJSON(g.oLanguage.sUrl,
+null,function(a){oa(a);i.extend(true,g.oLanguage,e.oLanguage,a);ba(g)}),h=!0):i.extend(!0,g.oLanguage,e.oLanguage);null===e.asStripeClasses&&(g.asStripeClasses=[g.oClasses.sStripeOdd,g.oClasses.sStripeEven]);c=!1;d=i(this).children("tbody").children("tr");a=0;for(b=g.asStripeClasses.length;a<b;a++)if(d.filter(":lt(2)").hasClass(g.asStripeClasses[a])){c=!0;break}c&&(g.asDestroyStripes=["",""],i(d[0]).hasClass(g.oClasses.sStripeOdd)&&(g.asDestroyStripes[0]+=g.oClasses.sStripeOdd+" "),i(d[0]).hasClass(g.oClasses.sStripeEven)&&
+(g.asDestroyStripes[0]+=g.oClasses.sStripeEven),i(d[1]).hasClass(g.oClasses.sStripeOdd)&&(g.asDestroyStripes[1]+=g.oClasses.sStripeOdd+" "),i(d[1]).hasClass(g.oClasses.sStripeEven)&&(g.asDestroyStripes[1]+=g.oClasses.sStripeEven),d.removeClass(g.asStripeClasses.join(" ")));c=[];a=this.getElementsByTagName("thead");0!==a.length&&(W(g.aoHeader,a[0]),c=P(g));if(null===e.aoColumns){d=[];a=0;for(b=c.length;a<b;a++)d.push(null)}else d=e.aoColumns;a=0;for(b=d.length;a<b;a++)e.saved_aoColumns!==n&&e.saved_aoColumns.length==
+b&&(null===d[a]&&(d[a]={}),d[a].bVisible=e.saved_aoColumns[a].bVisible),o(g,c?c[a]:null);ua(g,e.aoColumnDefs,d,function(a,b){r(g,a,b)});a=0;for(b=g.aaSorting.length;a<b;a++){g.aaSorting[a][0]>=g.aoColumns.length&&(g.aaSorting[a][0]=0);var k=g.aoColumns[g.aaSorting[a][0]];g.aaSorting[a][2]===n&&(g.aaSorting[a][2]=0);e.aaSorting===n&&g.saved_aaSorting===n&&(g.aaSorting[a][1]=k.asSorting[0]);c=0;for(d=k.asSorting.length;c<d;c++)if(g.aaSorting[a][1]==k.asSorting[c]){g.aaSorting[a][2]=c;break}}R(g);Wa(g);
+a=i(this).children("caption").each(function(){this._captionSide=i(this).css("caption-side")});b=i(this).children("thead");0===b.length&&(b=[l.createElement("thead")],this.appendChild(b[0]));g.nTHead=b[0];b=i(this).children("tbody");0===b.length&&(b=[l.createElement("tbody")],this.appendChild(b[0]));g.nTBody=b[0];g.nTBody.setAttribute("role","alert");g.nTBody.setAttribute("aria-live","polite");g.nTBody.setAttribute("aria-relevant","all");b=i(this).children("tfoot");if(0===b.length&&0<a.length&&(""!==
+g.oScroll.sX||""!==g.oScroll.sY))b=[l.createElement("tfoot")],this.appendChild(b[0]);0<b.length&&(g.nTFoot=b[0],W(g.aoFooter,g.nTFoot));if(f)for(a=0;a<e.aaData.length;a++)J(g,e.aaData[a]);else va(g);g.aiDisplay=g.aiDisplayMaster.slice();g.bInitialised=!0;!1===h&&ba(g)}})};j.fnVersionCheck=function(e){for(var i=function(e,i){for(;e.length<i;)e+="0";return e},r=j.ext.sVersion.split("."),e=e.split("."),k="",l="",n=0,w=e.length;n<w;n++)k+=i(r[n],3),l+=i(e[n],3);return parseInt(k,10)>=parseInt(l,10)};
+j.fnIsDataTable=function(e){for(var i=j.settings,r=0;r<i.length;r++)if(i[r].nTable===e||i[r].nScrollHead===e||i[r].nScrollFoot===e)return!0;return!1};j.fnTables=function(e){var o=[];jQuery.each(j.settings,function(j,k){(!e||!0===e&&i(k.nTable).is(":visible"))&&o.push(k.nTable)});return o};j.version="1.9.3";j.settings=[];j.models={};j.models.ext={afnFiltering:[],afnSortData:[],aoFeatures:[],aTypes:[],fnVersionCheck:j.fnVersionCheck,iApiIndex:0,ofnSearch:{},oApi:{},oStdClasses:{},oJUIClasses:{},oPagination:{},
+oSort:{},sVersion:j.version,sErrMode:"alert",_oExternConfig:{iNextUnique:0}};j.models.oSearch={bCaseInsensitive:!0,sSearch:"",bRegex:!1,bSmart:!0};j.models.oRow={nTr:null,_aData:[],_aSortData:[],_anHidden:[],_sRowStripe:""};j.models.oColumn={aDataSort:null,asSorting:null,bSearchable:null,bSortable:null,bUseRendered:null,bVisible:null,_bAutoType:!0,fnCreatedCell:null,fnGetData:null,fnRender:null,fnSetData:null,mData:null,mRender:null,nTh:null,nTf:null,sClass:null,sContentPadding:null,sDefaultContent:null,
+sName:null,sSortDataType:"std",sSortingClass:null,sSortingClassJUI:null,sTitle:null,sType:null,sWidth:null,sWidthOrig:null};j.defaults={aaData:null,aaSorting:[[0,"asc"]],aaSortingFixed:null,aLengthMenu:[10,25,50,100],aoColumns:null,aoColumnDefs:null,aoSearchCols:[],asStripeClasses:null,bAutoWidth:!0,bDeferRender:!1,bDestroy:!1,bFilter:!0,bInfo:!0,bJQueryUI:!1,bLengthChange:!0,bPaginate:!0,bProcessing:!1,bRetrieve:!1,bScrollAutoCss:!0,bScrollCollapse:!1,bScrollInfinite:!1,bServerSide:!1,bSort:!0,bSortCellsTop:!1,
+bSortClasses:!0,bStateSave:!1,fnCookieCallback:null,fnCreatedRow:null,fnDrawCallback:null,fnFooterCallback:null,fnFormatNumber:function(e){if(1E3>e)return e;for(var i=e+"",e=i.split(""),j="",i=i.length,k=0;k<i;k++)0===k%3&&0!==k&&(j=this.oLanguage.sInfoThousands+j),j=e[i-k-1]+j;return j},fnHeaderCallback:null,fnInfoCallback:null,fnInitComplete:null,fnPreDrawCallback:null,fnRowCallback:null,fnServerData:function(e,j,n,k){k.jqXHR=i.ajax({url:e,data:j,success:function(e){e.sError&&k.oApi._fnLog(k,0,
+e.sError);i(k.oInstance).trigger("xhr",[k,e]);n(e)},dataType:"json",cache:!1,type:k.sServerMethod,error:function(e,i){"parsererror"==i&&k.oApi._fnLog(k,0,"DataTables warning: JSON data from server could not be parsed. This is caused by a JSON formatting error.")}})},fnServerParams:null,fnStateLoad:function(e){var e=this.oApi._fnReadCookie(e.sCookiePrefix+e.sInstance),j;try{j="function"===typeof i.parseJSON?i.parseJSON(e):eval("("+e+")")}catch(n){j=null}return j},fnStateLoadParams:null,fnStateLoaded:null,
+fnStateSave:function(e,i){this.oApi._fnCreateCookie(e.sCookiePrefix+e.sInstance,this.oApi._fnJsonString(i),e.iCookieDuration,e.sCookiePrefix,e.fnCookieCallback)},fnStateSaveParams:null,iCookieDuration:7200,iDeferLoading:null,iDisplayLength:10,iDisplayStart:0,iScrollLoadGap:100,iTabIndex:0,oLanguage:{oAria:{sSortAscending:": activate to sort column ascending",sSortDescending:": activate to sort column descending"},oPaginate:{sFirst:"First",sLast:"Last",sNext:"Next",sPrevious:"Previous"},sEmptyTable:"No data available in table",
+sInfo:"Showing _START_ to _END_ of _TOTAL_ entries",sInfoEmpty:"Showing 0 to 0 of 0 entries",sInfoFiltered:"(filtered from _MAX_ total entries)",sInfoPostFix:"",sInfoThousands:",",sLengthMenu:"Show _MENU_ entries",sLoadingRecords:"Loading...",sProcessing:"Processing...",sSearch:"Search:",sUrl:"",sZeroRecords:"No matching records found"},oSearch:i.extend({},j.models.oSearch),sAjaxDataProp:"aaData",sAjaxSource:null,sCookiePrefix:"SpryMedia_DataTables_",sDom:"lfrtip",sPaginationType:"two_button",sScrollX:"",
+sScrollXInner:"",sScrollY:"",sServerMethod:"GET"};j.defaults.columns={aDataSort:null,asSorting:["asc","desc"],bSearchable:!0,bSortable:!0,bUseRendered:!0,bVisible:!0,fnCreatedCell:null,fnRender:null,iDataSort:-1,mData:null,mRender:null,sCellType:"td",sClass:"",sContentPadding:"",sDefaultContent:null,sName:"",sSortDataType:"std",sTitle:null,sType:null,sWidth:null};j.models.oSettings={oFeatures:{bAutoWidth:null,bDeferRender:null,bFilter:null,bInfo:null,bLengthChange:null,bPaginate:null,bProcessing:null,
+bServerSide:null,bSort:null,bSortClasses:null,bStateSave:null},oScroll:{bAutoCss:null,bCollapse:null,bInfinite:null,iBarWidth:0,iLoadGap:null,sX:null,sXInner:null,sY:null},oLanguage:{fnInfoCallback:null},oBrowser:{bScrollOversize:!1},aanFeatures:[],aoData:[],aiDisplay:[],aiDisplayMaster:[],aoColumns:[],aoHeader:[],aoFooter:[],asDataSearch:[],oPreviousSearch:{},aoPreSearchCols:[],aaSorting:null,aaSortingFixed:null,asStripeClasses:null,asDestroyStripes:[],sDestroyWidth:0,aoRowCallback:[],aoHeaderCallback:[],
+aoFooterCallback:[],aoDrawCallback:[],aoRowCreatedCallback:[],aoPreDrawCallback:[],aoInitComplete:[],aoStateSaveParams:[],aoStateLoadParams:[],aoStateLoaded:[],sTableId:"",nTable:null,nTHead:null,nTFoot:null,nTBody:null,nTableWrapper:null,bDeferLoading:!1,bInitialised:!1,aoOpenRows:[],sDom:null,sPaginationType:"two_button",iCookieDuration:0,sCookiePrefix:"",fnCookieCallback:null,aoStateSave:[],aoStateLoad:[],oLoadedState:null,sAjaxSource:null,sAjaxDataProp:null,bAjaxDataGet:!0,jqXHR:null,fnServerData:null,
+aoServerParams:[],sServerMethod:null,fnFormatNumber:null,aLengthMenu:null,iDraw:0,bDrawing:!1,iDrawError:-1,_iDisplayLength:10,_iDisplayStart:0,_iDisplayEnd:10,_iRecordsTotal:0,_iRecordsDisplay:0,bJUI:null,oClasses:{},bFiltered:!1,bSorted:!1,bSortCellsTop:null,oInit:null,aoDestroyCallback:[],fnRecordsTotal:function(){return this.oFeatures.bServerSide?parseInt(this._iRecordsTotal,10):this.aiDisplayMaster.length},fnRecordsDisplay:function(){return this.oFeatures.bServerSide?parseInt(this._iRecordsDisplay,
+10):this.aiDisplay.length},fnDisplayEnd:function(){return this.oFeatures.bServerSide?!1===this.oFeatures.bPaginate||-1==this._iDisplayLength?this._iDisplayStart+this.aiDisplay.length:Math.min(this._iDisplayStart+this._iDisplayLength,this._iRecordsDisplay):this._iDisplayEnd},oInstance:null,sInstance:null,iTabIndex:0,nScrollHead:null,nScrollFoot:null};j.ext=i.extend(!0,{},j.models.ext);i.extend(j.ext.oStdClasses,{sTable:"dataTable",sPagePrevEnabled:"paginate_enabled_previous",sPagePrevDisabled:"paginate_disabled_previous",
+sPageNextEnabled:"paginate_enabled_next",sPageNextDisabled:"paginate_disabled_next",sPageJUINext:"",sPageJUIPrev:"",sPageButton:"paginate_button",sPageButtonActive:"paginate_active",sPageButtonStaticDisabled:"paginate_button paginate_button_disabled",sPageFirst:"first",sPagePrevious:"previous",sPageNext:"next",sPageLast:"last",sStripeOdd:"odd",sStripeEven:"even",sRowEmpty:"dataTables_empty",sWrapper:"dataTables_wrapper",sFilter:"dataTables_filter",sInfo:"dataTables_info",sPaging:"dataTables_paginate paging_",
+sLength:"dataTables_length",sProcessing:"dataTables_processing",sSortAsc:"sorting_asc",sSortDesc:"sorting_desc",sSortable:"sorting",sSortableAsc:"sorting_asc_disabled",sSortableDesc:"sorting_desc_disabled",sSortableNone:"sorting_disabled",sSortColumn:"sorting_",sSortJUIAsc:"",sSortJUIDesc:"",sSortJUI:"",sSortJUIAscAllowed:"",sSortJUIDescAllowed:"",sSortJUIWrapper:"",sSortIcon:"",sScrollWrapper:"dataTables_scroll",sScrollHead:"dataTables_scrollHead",sScrollHeadInner:"dataTables_scrollHeadInner",sScrollBody:"dataTables_scrollBody",
+sScrollFoot:"dataTables_scrollFoot",sScrollFootInner:"dataTables_scrollFootInner",sFooterTH:"",sJUIHeader:"",sJUIFooter:""});i.extend(j.ext.oJUIClasses,j.ext.oStdClasses,{sPagePrevEnabled:"fg-button ui-button ui-state-default ui-corner-left",sPagePrevDisabled:"fg-button ui-button ui-state-default ui-corner-left ui-state-disabled",sPageNextEnabled:"fg-button ui-button ui-state-default ui-corner-right",sPageNextDisabled:"fg-button ui-button ui-state-default ui-corner-right ui-state-disabled",sPageJUINext:"ui-icon ui-icon-circle-arrow-e",
+sPageJUIPrev:"ui-icon ui-icon-circle-arrow-w",sPageButton:"fg-button ui-button ui-state-default",sPageButtonActive:"fg-button ui-button ui-state-default ui-state-disabled",sPageButtonStaticDisabled:"fg-button ui-button ui-state-default ui-state-disabled",sPageFirst:"first ui-corner-tl ui-corner-bl",sPageLast:"last ui-corner-tr ui-corner-br",sPaging:"dataTables_paginate fg-buttonset ui-buttonset fg-buttonset-multi ui-buttonset-multi paging_",sSortAsc:"ui-state-default",sSortDesc:"ui-state-default",
+sSortable:"ui-state-default",sSortableAsc:"ui-state-default",sSortableDesc:"ui-state-default",sSortableNone:"ui-state-default",sSortJUIAsc:"css_right ui-icon ui-icon-triangle-1-n",sSortJUIDesc:"css_right ui-icon ui-icon-triangle-1-s",sSortJUI:"css_right ui-icon ui-icon-carat-2-n-s",sSortJUIAscAllowed:"css_right ui-icon ui-icon-carat-1-n",sSortJUIDescAllowed:"css_right ui-icon ui-icon-carat-1-s",sSortJUIWrapper:"DataTables_sort_wrapper",sSortIcon:"DataTables_sort_icon",sScrollHead:"dataTables_scrollHead ui-state-default",
+sScrollFoot:"dataTables_scrollFoot ui-state-default",sFooterTH:"ui-state-default",sJUIHeader:"fg-toolbar ui-toolbar ui-widget-header ui-corner-tl ui-corner-tr ui-helper-clearfix",sJUIFooter:"fg-toolbar ui-toolbar ui-widget-header ui-corner-bl ui-corner-br ui-helper-clearfix"});i.extend(j.ext.oPagination,{two_button:{fnInit:function(e,j,n){var k=e.oLanguage.oPaginate,l=function(i){e.oApi._fnPageChange(e,i.data.action)&&n(e)},k=!e.bJUI?'<a class="'+e.oClasses.sPagePrevDisabled+'" tabindex="'+e.iTabIndex+
+'" role="button">'+k.sPrevious+'</a><a class="'+e.oClasses.sPageNextDisabled+'" tabindex="'+e.iTabIndex+'" role="button">'+k.sNext+"</a>":'<a class="'+e.oClasses.sPagePrevDisabled+'" tabindex="'+e.iTabIndex+'" role="button"><span class="'+e.oClasses.sPageJUIPrev+'"></span></a><a class="'+e.oClasses.sPageNextDisabled+'" tabindex="'+e.iTabIndex+'" role="button"><span class="'+e.oClasses.sPageJUINext+'"></span></a>';i(j).append(k);var t=i("a",j),k=t[0],t=t[1];e.oApi._fnBindAction(k,{action:"previous"},
+l);e.oApi._fnBindAction(t,{action:"next"},l);e.aanFeatures.p||(j.id=e.sTableId+"_paginate",k.id=e.sTableId+"_previous",t.id=e.sTableId+"_next",k.setAttribute("aria-controls",e.sTableId),t.setAttribute("aria-controls",e.sTableId))},fnUpdate:function(e){if(e.aanFeatures.p)for(var i=e.oClasses,j=e.aanFeatures.p,k=0,n=j.length;k<n;k++)0!==j[k].childNodes.length&&(j[k].childNodes[0].className=0===e._iDisplayStart?i.sPagePrevDisabled:i.sPagePrevEnabled,j[k].childNodes[1].className=e.fnDisplayEnd()==e.fnRecordsDisplay()?
+i.sPageNextDisabled:i.sPageNextEnabled)}},iFullNumbersShowPages:5,full_numbers:{fnInit:function(e,j,n){var k=e.oLanguage.oPaginate,l=e.oClasses,t=function(i){e.oApi._fnPageChange(e,i.data.action)&&n(e)};i(j).append('<a tabindex="'+e.iTabIndex+'" class="'+l.sPageButton+" "+l.sPageFirst+'">'+k.sFirst+'</a><a tabindex="'+e.iTabIndex+'" class="'+l.sPageButton+" "+l.sPagePrevious+'">'+k.sPrevious+'</a><span></span><a tabindex="'+e.iTabIndex+'" class="'+l.sPageButton+" "+l.sPageNext+'">'+k.sNext+'</a><a tabindex="'+
+e.iTabIndex+'" class="'+l.sPageButton+" "+l.sPageLast+'">'+k.sLast+"</a>");var w=i("a",j),k=w[0],l=w[1],v=w[2],w=w[3];e.oApi._fnBindAction(k,{action:"first"},t);e.oApi._fnBindAction(l,{action:"previous"},t);e.oApi._fnBindAction(v,{action:"next"},t);e.oApi._fnBindAction(w,{action:"last"},t);e.aanFeatures.p||(j.id=e.sTableId+"_paginate",k.id=e.sTableId+"_first",l.id=e.sTableId+"_previous",v.id=e.sTableId+"_next",w.id=e.sTableId+"_last")},fnUpdate:function(e,o){if(e.aanFeatures.p){var l=j.ext.oPagination.iFullNumbersShowPages,
+k=Math.floor(l/2),n=Math.ceil(e.fnRecordsDisplay()/e._iDisplayLength),t=Math.ceil(e._iDisplayStart/e._iDisplayLength)+1,w="",v,D=e.oClasses,y,H=e.aanFeatures.p,O=function(i){e.oApi._fnBindAction(this,{page:i+v-1},function(i){e.oApi._fnPageChange(e,i.data.page);o(e);i.preventDefault()})};-1===e._iDisplayLength?t=k=v=1:n<l?(v=1,k=n):t<=k?(v=1,k=l):t>=n-k?(v=n-l+1,k=n):(v=t-Math.ceil(l/2)+1,k=v+l-1);for(l=v;l<=k;l++)w+=t!==l?'<a tabindex="'+e.iTabIndex+'" class="'+D.sPageButton+'">'+e.fnFormatNumber(l)+
+"</a>":'<a tabindex="'+e.iTabIndex+'" class="'+D.sPageButtonActive+'">'+e.fnFormatNumber(l)+"</a>";l=0;for(k=H.length;l<k;l++)0!==H[l].childNodes.length&&(i("span:eq(0)",H[l]).html(w).children("a").each(O),y=H[l].getElementsByTagName("a"),y=[y[0],y[1],y[y.length-2],y[y.length-1]],i(y).removeClass(D.sPageButton+" "+D.sPageButtonActive+" "+D.sPageButtonStaticDisabled),i([y[0],y[1]]).addClass(1==t?D.sPageButtonStaticDisabled:D.sPageButton),i([y[2],y[3]]).addClass(0===n||t===n||-1===e._iDisplayLength?
+D.sPageButtonStaticDisabled:D.sPageButton))}}}});i.extend(j.ext.oSort,{"string-pre":function(e){"string"!=typeof e&&(e=null!==e&&e.toString?e.toString():"");return e.toLowerCase()},"string-asc":function(e,i){return e<i?-1:e>i?1:0},"string-desc":function(e,i){return e<i?1:e>i?-1:0},"html-pre":function(e){return e.replace(/<.*?>/g,"").toLowerCase()},"html-asc":function(e,i){return e<i?-1:e>i?1:0},"html-desc":function(e,i){return e<i?1:e>i?-1:0},"date-pre":function(e){e=Date.parse(e);if(isNaN(e)||""===
+e)e=Date.parse("01/01/1970 00:00:00");return e},"date-asc":function(e,i){return e-i},"date-desc":function(e,i){return i-e},"numeric-pre":function(e){return"-"==e||""===e?0:1*e},"numeric-asc":function(e,i){return e-i},"numeric-desc":function(e,i){return i-e}});i.extend(j.ext.aTypes,[function(e){if("number"===typeof e)return"numeric";if("string"!==typeof e)return null;var i,j=!1;i=e.charAt(0);if(-1=="0123456789-".indexOf(i))return null;for(var k=1;k<e.length;k++){i=e.charAt(k);if(-1=="0123456789.".indexOf(i))return null;
+if("."==i){if(j)return null;j=!0}}return"numeric"},function(e){var i=Date.parse(e);return null!==i&&!isNaN(i)||"string"===typeof e&&0===e.length?"date":null},function(e){return"string"===typeof e&&-1!=e.indexOf("<")&&-1!=e.indexOf(">")?"html":null}]);i.fn.DataTable=j;i.fn.dataTable=j;i.fn.dataTableSettings=j.settings;i.fn.dataTableExt=j.ext})(jQuery,window,document,void 0);
+/**
+ * noty - jQuery Notification Plugin v2.2.2
+ * Contributors: https://github.com/needim/noty/graphs/contributors
+ *
+ * Examples and Documentation - http://needim.github.com/noty/
+ *
+ * Licensed under the MIT licenses:
+ * http://www.opensource.org/licenses/mit-license.php
+ *
+ **/
+
+
+if (typeof Object.create !== 'function') {
+ Object.create = function (o) {
+ function F() {
+ }
+
+ F.prototype = o;
+ return new F();
+ };
+}
+
+(function ($) {
+
+ var NotyObject = {
+
+ init:function (options) {
+
+ // Mix in the passed in options with the default options
+ this.options = $.extend({}, $.noty.defaults, options);
+
+ this.options.layout = (this.options.custom) ? $.noty.layouts['inline'] : $.noty.layouts[this.options.layout];
+
+ if ($.noty.themes[this.options.theme])
+ this.options.theme = $.noty.themes[this.options.theme];
+ else
+ options.themeClassName = this.options.theme;
+
+ delete options.layout;
+ delete options.theme;
+
+ this.options = $.extend({}, this.options, this.options.layout.options);
+ this.options.id = 'noty_' + (new Date().getTime() * Math.floor(Math.random() * 1000000));
+
+ this.options = $.extend({}, this.options, options);
+
+ // Build the noty dom initial structure
+ this._build();
+
+ // return this so we can chain/use the bridge with less code.
+ return this;
+ }, // end init
+
+ _build:function () {
+
+ // Generating noty bar
+ var $bar = $('<div class="noty_bar noty_type_' + this.options.type + '"></div>').attr('id', this.options.id);
+ $bar.append(this.options.template).find('.noty_text').html(this.options.text);
+
+ this.$bar = (this.options.layout.parent.object !== null) ? $(this.options.layout.parent.object).css(this.options.layout.parent.css).append($bar) : $bar;
+
+ if (this.options.themeClassName)
+ this.$bar.addClass(this.options.themeClassName).addClass('noty_container_type_' + this.options.type);
+
+ // Set buttons if available
+ if (this.options.buttons) {
+
+ // If we have button disable closeWith & timeout options
+ this.options.closeWith = [];
+ this.options.timeout = false;
+
+ var $buttons = $('<div/>').addClass('noty_buttons');
+
+ (this.options.layout.parent.object !== null) ? this.$bar.find('.noty_bar').append($buttons) : this.$bar.append($buttons);
+
+ var self = this;
+
+ $.each(this.options.buttons, function (i, button) {
+ var $button = $('<button/>').addClass((button.addClass) ? button.addClass : 'gray').html(button.text).attr('id', button.id ? button.id : 'button-' + i)
+ .appendTo(self.$bar.find('.noty_buttons'))
+ .on('click', function () {
+ if ($.isFunction(button.onClick)) {
+ button.onClick.call($button, self);
+ }
+ });
+ });
+ }
+
+ // For easy access
+ this.$message = this.$bar.find('.noty_message');
+ this.$closeButton = this.$bar.find('.noty_close');
+ this.$buttons = this.$bar.find('.noty_buttons');
+
+ $.noty.store[this.options.id] = this; // store noty for api
+
+ }, // end _build
+
+ show:function () {
+
+ var self = this;
+
+ (self.options.custom) ? self.options.custom.find(self.options.layout.container.selector).append(self.$bar) : $(self.options.layout.container.selector).append(self.$bar);
+
+ if (self.options.theme && self.options.theme.style)
+ self.options.theme.style.apply(self);
+
+ ($.type(self.options.layout.css) === 'function') ? this.options.layout.css.apply(self.$bar) : self.$bar.css(this.options.layout.css || {});
+
+ self.$bar.addClass(self.options.layout.addClass);
+
+ self.options.layout.container.style.apply($(self.options.layout.container.selector));
+
+ self.showing = true;
+
+ if (self.options.theme && self.options.theme.style)
+ self.options.theme.callback.onShow.apply(this);
+
+ if ($.inArray('click', self.options.closeWith) > -1)
+ self.$bar.css('cursor', 'pointer').one('click', function (evt) {
+ self.stopPropagation(evt);
+ if (self.options.callback.onCloseClick) {
+ self.options.callback.onCloseClick.apply(self);
+ }
+ self.close();
+ });
+
+ if ($.inArray('hover', self.options.closeWith) > -1)
+ self.$bar.one('mouseenter', function () {
+ self.close();
+ });
+
+ if ($.inArray('button', self.options.closeWith) > -1)
+ self.$closeButton.one('click', function (evt) {
+ self.stopPropagation(evt);
+ self.close();
+ });
+
+ if ($.inArray('button', self.options.closeWith) == -1)
+ self.$closeButton.remove();
+
+ if (self.options.callback.onShow)
+ self.options.callback.onShow.apply(self);
+
+ self.$bar.animate(
+ self.options.animation.open,
+ self.options.animation.speed,
+ self.options.animation.easing,
+ function () {
+ if (self.options.callback.afterShow) self.options.callback.afterShow.apply(self);
+ self.showing = false;
+ self.shown = true;
+ });
+
+ // If noty is have a timeout option
+ if (self.options.timeout)
+ self.$bar.delay(self.options.timeout).promise().done(function () {
+ self.close();
+ });
+
+ return this;
+
+ }, // end show
+
+ close:function () {
+
+ if (this.closed) return;
+ if (this.$bar && this.$bar.hasClass('i-am-closing-now')) return;
+
+ var self = this;
+
+ if (this.showing) {
+ self.$bar.queue(
+ function () {
+ self.close.apply(self);
+ }
+ )
+ return;
+ }
+
+ if (!this.shown && !this.showing) { // If we are still waiting in the queue just delete from queue
+ var queue = [];
+ $.each($.noty.queue, function (i, n) {
+ if (n.options.id != self.options.id) {
+ queue.push(n);
+ }
+ });
+ $.noty.queue = queue;
+ return;
+ }
+
+ self.$bar.addClass('i-am-closing-now');
+
+ if (self.options.callback.onClose) {
+ self.options.callback.onClose.apply(self);
+ }
+
+ self.$bar.clearQueue().stop().animate(
+ self.options.animation.close,
+ self.options.animation.speed,
+ self.options.animation.easing,
+ function () {
+ if (self.options.callback.afterClose) self.options.callback.afterClose.apply(self);
+ })
+ .promise().done(function () {
+
+ // Modal Cleaning
+ if (self.options.modal) {
+ $.notyRenderer.setModalCount(-1);
+ if ($.notyRenderer.getModalCount() == 0) $('.noty_modal').fadeOut('fast', function () {
+ $(this).remove();
+ });
+ }
+
+ // Layout Cleaning
+ $.notyRenderer.setLayoutCountFor(self, -1);
+ if ($.notyRenderer.getLayoutCountFor(self) == 0) $(self.options.layout.container.selector).remove();
+
+ // Make sure self.$bar has not been removed before attempting to remove it
+ if (typeof self.$bar !== 'undefined' && self.$bar !== null ) {
+ self.$bar.remove();
+ self.$bar = null;
+ self.closed = true;
+ }
+
+ delete $.noty.store[self.options.id]; // deleting noty from store
+
+ if(self.options.theme.callback && self.options.theme.callback.onClose) {
+ self.options.theme.callback.onClose.apply(self);
+ }
+
+ if (!self.options.dismissQueue) {
+ // Queue render
+ $.noty.ontap = true;
+
+ $.notyRenderer.render();
+ }
+
+ if (self.options.maxVisible > 0 && self.options.dismissQueue) {
+ $.notyRenderer.render();
+ }
+ })
+
+ }, // end close
+
+ setText:function (text) {
+ if (!this.closed) {
+ this.options.text = text;
+ this.$bar.find('.noty_text').html(text);
+ }
+ return this;
+ },
+
+ setType:function (type) {
+ if (!this.closed) {
+ this.options.type = type;
+ this.options.theme.style.apply(this);
+ this.options.theme.callback.onShow.apply(this);
+ }
+ return this;
+ },
+
+ setTimeout:function (time) {
+ if (!this.closed) {
+ var self = this;
+ this.options.timeout = time;
+ self.$bar.delay(self.options.timeout).promise().done(function () {
+ self.close();
+ });
+ }
+ return this;
+ },
+
+ stopPropagation:function (evt) {
+ evt = evt || window.event;
+ if (typeof evt.stopPropagation !== "undefined") {
+ evt.stopPropagation();
+ } else {
+ evt.cancelBubble = true;
+ }
+ },
+
+ closed:false,
+ showing:false,
+ shown:false
+
+ }; // end NotyObject
+
+ $.notyRenderer = {};
+
+ $.notyRenderer.init = function (options) {
+
+ // Renderer creates a new noty
+ var notification = Object.create(NotyObject).init(options);
+
+ if (notification.options.killer)
+ $.noty.closeAll();
+
+ (notification.options.force) ? $.noty.queue.unshift(notification) : $.noty.queue.push(notification);
+
+ $.notyRenderer.render();
+
+ return ($.noty.returns == 'object') ? notification : notification.options.id;
+ };
+
+ $.notyRenderer.render = function () {
+
+ var instance = $.noty.queue[0];
+
+ if ($.type(instance) === 'object') {
+ if (instance.options.dismissQueue) {
+ if (instance.options.maxVisible > 0) {
+ if ($(instance.options.layout.container.selector + ' li').length < instance.options.maxVisible) {
+ $.notyRenderer.show($.noty.queue.shift());
+ } else {
+
+ }
+ } else {
+ $.notyRenderer.show($.noty.queue.shift());
+ }
+ } else {
+ if ($.noty.ontap) {
+ $.notyRenderer.show($.noty.queue.shift());
+ $.noty.ontap = false;
+ }
+ }
+ } else {
+ $.noty.ontap = true; // Queue is over
+ }
+
+ };
+
+ $.notyRenderer.show = function (notification) {
+
+ if (notification.options.modal) {
+ $.notyRenderer.createModalFor(notification);
+ $.notyRenderer.setModalCount(+1);
+ }
+
+ // Where is the container?
+ if (notification.options.custom) {
+ if (notification.options.custom.find(notification.options.layout.container.selector).length == 0) {
+ notification.options.custom.append($(notification.options.layout.container.object).addClass('i-am-new'));
+ } else {
+ notification.options.custom.find(notification.options.layout.container.selector).removeClass('i-am-new');
+ }
+ } else {
+ if ($(notification.options.layout.container.selector).length == 0) {
+ $('body').append($(notification.options.layout.container.object).addClass('i-am-new'));
+ } else {
+ $(notification.options.layout.container.selector).removeClass('i-am-new');
+ }
+ }
+
+ $.notyRenderer.setLayoutCountFor(notification, +1);
+
+ notification.show();
+ };
+
+ $.notyRenderer.createModalFor = function (notification) {
+ if ($('.noty_modal').length == 0) {
+ var modal = $('<div/>').addClass('noty_modal').addClass(notification.options.theme).data('noty_modal_count', 0);
+
+ if (notification.options.theme.modal && notification.options.theme.modal.css)
+ modal.css(notification.options.theme.modal.css);
+
+ modal.prependTo($('body')).fadeIn('fast');
+ }
+ };
+
+ $.notyRenderer.getLayoutCountFor = function (notification) {
+ return $(notification.options.layout.container.selector).data('noty_layout_count') || 0;
+ };
+
+ $.notyRenderer.setLayoutCountFor = function (notification, arg) {
+ return $(notification.options.layout.container.selector).data('noty_layout_count', $.notyRenderer.getLayoutCountFor(notification) + arg);
+ };
+
+ $.notyRenderer.getModalCount = function () {
+ return $('.noty_modal').data('noty_modal_count') || 0;
+ };
+
+ $.notyRenderer.setModalCount = function (arg) {
+ return $('.noty_modal').data('noty_modal_count', $.notyRenderer.getModalCount() + arg);
+ };
+
+ // This is for custom container
+ $.fn.noty = function (options) {
+ options.custom = $(this);
+ return $.notyRenderer.init(options);
+ };
+
+ $.noty = {};
+ $.noty.queue = [];
+ $.noty.ontap = true;
+ $.noty.layouts = {};
+ $.noty.themes = {};
+ $.noty.returns = 'object';
+ $.noty.store = {};
+
+ $.noty.get = function (id) {
+ return $.noty.store.hasOwnProperty(id) ? $.noty.store[id] : false;
+ };
+
+ $.noty.close = function (id) {
+ return $.noty.get(id) ? $.noty.get(id).close() : false;
+ };
+
+ $.noty.setText = function (id, text) {
+ return $.noty.get(id) ? $.noty.get(id).setText(text) : false;
+ };
+
+ $.noty.setType = function (id, type) {
+ return $.noty.get(id) ? $.noty.get(id).setType(type) : false;
+ };
+
+ $.noty.clearQueue = function () {
+ $.noty.queue = [];
+ };
+
+ $.noty.closeAll = function () {
+ $.noty.clearQueue();
+ $.each($.noty.store, function (id, noty) {
+ noty.close();
+ });
+ };
+
+ var windowAlert = window.alert;
+
+ $.noty.consumeAlert = function (options) {
+ window.alert = function (text) {
+ if (options)
+ options.text = text;
+ else
+ options = {text:text};
+
+ $.notyRenderer.init(options);
+ };
+ };
+
+ $.noty.stopConsumeAlert = function () {
+ window.alert = windowAlert;
+ };
+
+ $.noty.defaults = {
+ layout:'top',
+ theme:'defaultTheme',
+ type:'alert',
+ text:'',
+ dismissQueue:true,
+ template:'<div class="noty_message"><span class="noty_text"></span><div class="noty_close"></div></div>',
+ animation:{
+ open:{height:'toggle'},
+ close:{height:'toggle'},
+ easing:'swing',
+ speed:500
+ },
+ timeout:false,
+ force:false,
+ modal:false,
+ maxVisible:5,
+ killer: false,
+ closeWith:['click'],
+ callback:{
+ onShow:function () {
+ },
+ afterShow:function () {
+ },
+ onClose:function () {
+ },
+ afterClose:function () {
+ },
+ onCloseClick:function () {
+ }
+ },
+ buttons:false
+ };
+
+ $(window).on('resize', function () {
+ $.each($.noty.layouts, function (index, layout) {
+ layout.container.style.apply($(layout.container.selector));
+ });
+ });
+
+})(jQuery);
+
+// Helpers
+window.noty = function noty(options) {
+ return jQuery.notyRenderer.init(options);
+};
+(function($) {
+
+ $.noty.layouts.bottom = {
+ name: 'bottom',
+ options: {},
+ container: {
+ object: '<ul id="noty_bottom_layout_container" />',
+ selector: 'ul#noty_bottom_layout_container',
+ style: function() {
+ $(this).css({
+ bottom: 0,
+ left: '5%',
+ position: 'fixed',
+ width: '90%',
+ height: 'auto',
+ margin: 0,
+ padding: 0,
+ listStyleType: 'none',
+ zIndex: 9999999
+ });
+ }
+ },
+ parent: {
+ object: '<li />',
+ selector: 'li',
+ css: {}
+ },
+ css: {
+ display: 'none'
+ },
+ addClass: ''
+ };
+
+})(jQuery);
+(function($) {
+
+ $.noty.themes.defaultTheme = {
+ name: 'defaultTheme',
+ helpers: {
+ borderFix: function() {
+ if (this.options.dismissQueue) {
+ var selector = this.options.layout.container.selector + ' ' + this.options.layout.parent.selector;
+ switch (this.options.layout.name) {
+ case 'top':
+ $(selector).css({borderRadius: '0px 0px 0px 0px'});
+ $(selector).last().css({borderRadius: '0px 0px 5px 5px'}); break;
+ case 'topCenter': case 'topLeft': case 'topRight':
+ case 'bottomCenter': case 'bottomLeft': case 'bottomRight':
+ case 'center': case 'centerLeft': case 'centerRight': case 'inline':
+ $(selector).css({borderRadius: '0px 0px 0px 0px'});
+ $(selector).first().css({'border-top-left-radius': '5px', 'border-top-right-radius': '5px'});
+ $(selector).last().css({'border-bottom-left-radius': '5px', 'border-bottom-right-radius': '5px'}); break;
+ case 'bottom':
+ $(selector).css({borderRadius: '0px 0px 0px 0px'});
+ $(selector).first().css({borderRadius: '5px 5px 0px 0px'}); break;
+ default: break;
+ }
+ }
+ }
+ },
+ modal: {
+ css: {
+ position: 'fixed',
+ width: '100%',
+ height: '100%',
+ backgroundColor: '#000',
+ zIndex: 10000,
+ opacity: 0.6,
+ display: 'none',
+ left: 0,
+ top: 0
+ }
+ },
+ style: function() {
+
+ this.$bar.css({
+ overflow: 'hidden',
+ background: "url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABsAAAAoCAYAAAAPOoFWAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAPZJREFUeNq81tsOgjAMANB2ov7/7ypaN7IlIwi9rGuT8QSc9EIDAsAznxvY4pXPKr05RUE5MEVB+TyWfCEl9LZApYopCmo9C4FKSMtYoI8Bwv79aQJU4l6hXXCZrQbokJEksxHo9KMOgc6w1atHXM8K9DVC7FQnJ0i8iK3QooGgbnyKgMDygBWyYFZoqx4qS27KqLZJjA1D0jK6QJcYEQEiWv9PGkTsbqxQ8oT+ZtZB6AkdsJnQDnMoHXHLGKOgDYuCWmYhEERCI5gaamW0bnHdA3k2ltlIN+2qKRyCND0bhqSYCyTB3CAOc4WusBEIpkeBuPgJMAAX8Hs1NfqHRgAAAABJRU5ErkJggg==') repeat-x scroll left top #fff"
+ });
+
+ this.$message.css({
+ fontSize: '13px',
+ lineHeight: '16px',
+ textAlign: 'center',
+ padding: '8px 10px 9px',
+ width: 'auto',
+ position: 'relative'
+ });
+
+ this.$closeButton.css({
+ position: 'absolute',
+ top: 4, right: 4,
+ width: 10, height: 10,
+ background: "url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAYAAACNMs+9AAAACXBIWXMAAAsTAAALEwEAmpwYAAAKT2lDQ1BQaG90b3Nob3AgSUNDIHByb2ZpbGUAAHjanVNnVFPpFj333vRCS4iAlEtvUhUIIFJCi4AUkSYqIQkQSoghodkVUcERRUUEG8igiAOOjoCMFVEsDIoK2AfkIaKOg6OIisr74Xuja9a89+bN/rXXPues852zzwfACAyWSDNRNYAMqUIeEeCDx8TG4eQuQIEKJHAAEAizZCFz/SMBAPh+PDwrIsAHvgABeNMLCADATZvAMByH/w/qQplcAYCEAcB0kThLCIAUAEB6jkKmAEBGAYCdmCZTAKAEAGDLY2LjAFAtAGAnf+bTAICd+Jl7AQBblCEVAaCRACATZYhEAGg7AKzPVopFAFgwABRmS8Q5ANgtADBJV2ZIALC3AMDOEAuyAAgMADBRiIUpAAR7AGDIIyN4AISZABRG8lc88SuuEOcqAAB4mbI8uSQ5RYFbCC1xB1dXLh4ozkkXKxQ2YQJhmkAuwnmZGTKBNA/g88wAAKCRFRHgg/P9eM4Ors7ONo62Dl8t6r8G/yJiYuP+5c+rcEAAAOF0ftH+LC+zGoA7BoBt/qIl7gRoXgugdfeLZrIPQLUAoOnaV/Nw+H48PEWhkLnZ2eXk5NhKxEJbYcpXff5nwl/AV/1s+X48/Pf14L7iJIEyXYFHBPjgwsz0TKUcz5IJhGLc5o9H/LcL//wd0yLESWK5WCoU41EScY5EmozzMqUiiUKSKcUl0v9k4t8s+wM+3zUAsGo+AXuRLahdYwP2SycQWHTA4vcAAPK7b8HUKAgDgGiD4c93/+8//UegJQCAZkmScQAAXkQkLlTKsz/HCAAARKCBKrBBG/TBGCzABhzBBdzBC/xgNoRCJMTCQhBCCmSAHHJgKayCQiiGzbAdKmAv1EAdNMBRaIaTcA4uwlW4Dj1wD/phCJ7BKLyBCQRByAgTYSHaiAFiilgjjggXmYX4IcFIBBKLJCDJiBRRIkuRNUgxUopUIFVIHfI9cgI5h1xGupE7yAAygvyGvEcxlIGyUT3UDLVDuag3GoRGogvQZHQxmo8WoJvQcrQaPYw2oefQq2gP2o8+Q8cwwOgYBzPEbDAuxsNCsTgsCZNjy7EirAyrxhqwVqwDu4n1Y8+xdwQSgUXACTYEd0IgYR5BSFhMWE7YSKggHCQ0EdoJNwkDhFHCJyKTqEu0JroR+cQYYjIxh1hILCPWEo8TLxB7iEPENyQSiUMyJ7mQAkmxpFTSEtJG0m5SI+ksqZs0SBojk8naZGuyBzmULCAryIXkneTD5DPkG+Qh8lsKnWJAcaT4U+IoUspqShnlEOU05QZlmDJBVaOaUt2ooVQRNY9aQq2htlKvUYeoEzR1mjnNgxZJS6WtopXTGmgXaPdpr+h0uhHdlR5Ol9BX0svpR+iX6AP0dwwNhhWDx4hnKBmbGAcYZxl3GK+YTKYZ04sZx1QwNzHrmOeZD5lvVVgqtip8FZHKCpVKlSaVGyovVKmqpqreqgtV81XLVI+pXlN9rkZVM1PjqQnUlqtVqp1Q61MbU2epO6iHqmeob1Q/pH5Z/YkGWcNMw09DpFGgsV/jvMYgC2MZs3gsIWsNq4Z1gTXEJrHN2Xx2KruY/R27iz2qqaE5QzNKM1ezUvOUZj8H45hx+Jx0TgnnKKeX836K3hTvKeIpG6Y0TLkxZVxrqpaXllirSKtRq0frvTau7aedpr1Fu1n7gQ5Bx0onXCdHZ4/OBZ3nU9lT3acKpxZNPTr1ri6qa6UbobtEd79up+6Ynr5egJ5Mb6feeb3n+hx9L/1U/W36p/VHDFgGswwkBtsMzhg8xTVxbzwdL8fb8VFDXcNAQ6VhlWGX4YSRudE8o9VGjUYPjGnGXOMk423GbcajJgYmISZLTepN7ppSTbmmKaY7TDtMx83MzaLN1pk1mz0x1zLnm+eb15vft2BaeFostqi2uGVJsuRaplnutrxuhVo5WaVYVVpds0atna0l1rutu6cRp7lOk06rntZnw7Dxtsm2qbcZsOXYBtuutm22fWFnYhdnt8Wuw+6TvZN9un2N/T0HDYfZDqsdWh1+c7RyFDpWOt6azpzuP33F9JbpL2dYzxDP2DPjthPLKcRpnVOb00dnF2e5c4PziIuJS4LLLpc+Lpsbxt3IveRKdPVxXeF60vWdm7Obwu2o26/uNu5p7ofcn8w0nymeWTNz0MPIQ+BR5dE/C5+VMGvfrH5PQ0+BZ7XnIy9jL5FXrdewt6V3qvdh7xc+9j5yn+M+4zw33jLeWV/MN8C3yLfLT8Nvnl+F30N/I/9k/3r/0QCngCUBZwOJgUGBWwL7+Hp8Ib+OPzrbZfay2e1BjKC5QRVBj4KtguXBrSFoyOyQrSH355jOkc5pDoVQfujW0Adh5mGLw34MJ4WHhVeGP45wiFga0TGXNXfR3ENz30T6RJZE3ptnMU85ry1KNSo+qi5qPNo3ujS6P8YuZlnM1VidWElsSxw5LiquNm5svt/87fOH4p3iC+N7F5gvyF1weaHOwvSFpxapLhIsOpZATIhOOJTwQRAqqBaMJfITdyWOCnnCHcJnIi/RNtGI2ENcKh5O8kgqTXqS7JG8NXkkxTOlLOW5hCepkLxMDUzdmzqeFpp2IG0yPTq9MYOSkZBxQqohTZO2Z+pn5mZ2y6xlhbL+xW6Lty8elQfJa7OQrAVZLQq2QqboVFoo1yoHsmdlV2a/zYnKOZarnivN7cyzytuQN5zvn//tEsIS4ZK2pYZLVy0dWOa9rGo5sjxxedsK4xUFK4ZWBqw8uIq2Km3VT6vtV5eufr0mek1rgV7ByoLBtQFr6wtVCuWFfevc1+1dT1gvWd+1YfqGnRs+FYmKrhTbF5cVf9go3HjlG4dvyr+Z3JS0qavEuWTPZtJm6ebeLZ5bDpaql+aXDm4N2dq0Dd9WtO319kXbL5fNKNu7g7ZDuaO/PLi8ZafJzs07P1SkVPRU+lQ27tLdtWHX+G7R7ht7vPY07NXbW7z3/T7JvttVAVVN1WbVZftJ+7P3P66Jqun4lvttXa1ObXHtxwPSA/0HIw6217nU1R3SPVRSj9Yr60cOxx++/p3vdy0NNg1VjZzG4iNwRHnk6fcJ3/ceDTradox7rOEH0x92HWcdL2pCmvKaRptTmvtbYlu6T8w+0dbq3nr8R9sfD5w0PFl5SvNUyWna6YLTk2fyz4ydlZ19fi753GDborZ752PO32oPb++6EHTh0kX/i+c7vDvOXPK4dPKy2+UTV7hXmq86X23qdOo8/pPTT8e7nLuarrlca7nuer21e2b36RueN87d9L158Rb/1tWeOT3dvfN6b/fF9/XfFt1+cif9zsu72Xcn7q28T7xf9EDtQdlD3YfVP1v+3Njv3H9qwHeg89HcR/cGhYPP/pH1jw9DBY+Zj8uGDYbrnjg+OTniP3L96fynQ89kzyaeF/6i/suuFxYvfvjV69fO0ZjRoZfyl5O/bXyl/erA6xmv28bCxh6+yXgzMV70VvvtwXfcdx3vo98PT+R8IH8o/2j5sfVT0Kf7kxmTk/8EA5jz/GMzLdsAAAAgY0hSTQAAeiUAAICDAAD5/wAAgOkAAHUwAADqYAAAOpgAABdvkl/FRgAAATpJREFUeNoszrFqVFEUheG19zlz7sQ7ijMQBAvfYBqbpJCoZSAQbOwEE1IHGytbLQUJ8SUktW8gCCFJMSGSNxCmFBJO7j5rpXD6n5/P5vM53H3b3T9LOiB5AQDuDjM7BnA7DMPHDGBH0nuSzwHsRcRVRNRSysuU0i6AOwA/02w2+9Fae00SEbEh6SGAR5K+k3zWWptKepCm0+kpyRoRGyRBcpPkDsn1iEBr7drdP2VJZyQXERGSPpiZAViTBACXKaV9kqd5uVzCzO5KKb/d/UZSDwD/eyxqree1VqSu6zKAF2Z2RPJJaw0rAkjOJT0m+SuT/AbgDcmnkmBmfwAsJL1dXQ8lWY6IGwB1ZbrOOb8zs8thGP4COFwx/mE8Ho9Go9ErMzvJOW/1fY/JZIJSypqZfXX3L13X9fcDAKJct1sx3OiuAAAAAElFTkSuQmCC)",
+ display: 'none',
+ cursor: 'pointer'
+ });
+
+ this.$buttons.css({
+ padding: 5,
+ textAlign: 'right',
+ borderTop: '1px solid #ccc',
+ backgroundColor: '#fff'
+ });
+
+ this.$buttons.find('button').css({
+ marginLeft: 5
+ });
+
+ this.$buttons.find('button:first').css({
+ marginLeft: 0
+ });
+
+ this.$bar.on({
+ mouseenter: function() { $(this).find('.noty_close').stop().fadeTo('normal',1); },
+ mouseleave: function() { $(this).find('.noty_close').stop().fadeTo('normal',0); }
+ });
+
+ switch (this.options.layout.name) {
+ case 'top':
+ this.$bar.css({
+ borderRadius: '0px 0px 5px 5px',
+ borderBottom: '2px solid #eee',
+ borderLeft: '2px solid #eee',
+ borderRight: '2px solid #eee',
+ boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)"
+ });
+ break;
+ case 'topCenter': case 'center': case 'bottomCenter': case 'inline':
+ this.$bar.css({
+ borderRadius: '5px',
+ border: '1px solid #eee',
+ boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)"
+ });
+ this.$message.css({fontSize: '13px', textAlign: 'center'});
+ break;
+ case 'topLeft': case 'topRight':
+ case 'bottomLeft': case 'bottomRight':
+ case 'centerLeft': case 'centerRight':
+ this.$bar.css({
+ borderRadius: '5px',
+ border: '1px solid #eee',
+ boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)"
+ });
+ this.$message.css({fontSize: '13px', textAlign: 'left'});
+ break;
+ case 'bottom':
+ this.$bar.css({
+ borderRadius: '5px 5px 0px 0px',
+ borderTop: '2px solid #eee',
+ borderLeft: '2px solid #eee',
+ borderRight: '2px solid #eee',
+ boxShadow: "0 -2px 4px rgba(0, 0, 0, 0.1)"
+ });
+ break;
+ default:
+ this.$bar.css({
+ border: '2px solid #eee',
+ boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)"
+ });
+ break;
+ }
+
+ switch (this.options.type) {
+ case 'alert': case 'notification':
+ this.$bar.css({backgroundColor: '#D3CD47', borderColor: '#A7A72E', color: '#444'}); break;
+ case 'warning':
+ this.$bar.css({backgroundColor: '#FFEAA8', borderColor: '#FFC237', color: '#826200'});
+ this.$buttons.css({borderTop: '1px solid #FFC237'}); break;
+ case 'error':
+ this.$bar.css({backgroundColor: 'red', borderColor: 'darkred', color: '#FFF'});
+ this.$message.css({fontWeight: 'bold'});
+ this.$buttons.css({borderTop: '1px solid darkred'}); break;
+ case 'information':
+ this.$bar.css({backgroundColor: '#57B7E2', borderColor: '#0B90C4', color: '#FFF'});
+ this.$buttons.css({borderTop: '1px solid #0B90C4'}); break;
+ case 'success':
+ this.$bar.css({backgroundColor: 'lightgreen', borderColor: '#50C24E', color: 'darkgreen'});
+ this.$buttons.css({borderTop: '1px solid #50C24E'});break;
+ default:
+ this.$bar.css({backgroundColor: '#FFF', borderColor: '#CCC', color: '#444'}); break;
+ }
+ },
+ callback: {
+ onShow: function() { $.noty.themes.defaultTheme.helpers.borderFix.apply(this); },
+ onClose: function() { $.noty.themes.defaultTheme.helpers.borderFix.apply(this); }
+ }
+ };
+
+})(jQuery);
+/*!
+ Colorbox v1.4.27 - 2013-07-16
+ jQuery lightbox and modal window plugin
+ (c) 2013 Jack Moore - http://www.jacklmoore.com/colorbox
+ license: http://www.opensource.org/licenses/mit-license.php
+*/
+
+(function(t,e,i){function o(i,o,n){var r=e.createElement(i);return o&&(r.id=te+o),n&&(r.style.cssText=n),t(r)}function n(){return i.innerHeight?i.innerHeight:t(i).height()}function r(t){var e=E.length,i=(j+t)%e;return 0>i?e+i:i}function l(t,e){return Math.round((/%/.test(t)?("x"===e?H.width():n())/100:1)*parseInt(t,10))}function h(t,e){return t.photo||t.photoRegex.test(e)}function s(t,e){return t.retinaUrl&&i.devicePixelRatio>1?e.replace(t.photoRegex,t.retinaSuffix):e}function a(t){"contains"in v[0]&&!v[0].contains(t.target)&&(t.stopPropagation(),v.focus())}function d(){var e,i=t.data(A,Z);null==i?(O=t.extend({},Y),console&&console.log&&console.log("Error: cboxElement missing settings object")):O=t.extend({},i);for(e in O)t.isFunction(O[e])&&"on"!==e.slice(0,2)&&(O[e]=O[e].call(A));O.rel=O.rel||A.rel||t(A).data("rel")||"nofollow",O.href=O.href||t(A).attr("href"),O.title=O.title||A.title,"string"==typeof O.href&&(O.href=t.trim(O.href))}function c(i,o){t(e).trigger(i),se.trigger(i),t.isFunction(o)&&o.call(A)}function u(){var t,e,i,o,n,r=te+"Slideshow_",l="click."+te;O.slideshow&&E[1]?(e=function(){clearTimeout(t)},i=function(){(O.loop||E[j+1])&&(t=setTimeout(J.next,O.slideshowSpeed))},o=function(){R.html(O.slideshowStop).unbind(l).one(l,n),se.bind(ne,i).bind(oe,e).bind(re,n),v.removeClass(r+"off").addClass(r+"on")},n=function(){e(),se.unbind(ne,i).unbind(oe,e).unbind(re,n),R.html(O.slideshowStart).unbind(l).one(l,function(){J.next(),o()}),v.removeClass(r+"on").addClass(r+"off")},O.slideshowAuto?o():n()):v.removeClass(r+"off "+r+"on")}function p(i){G||(A=i,d(),E=t(A),j=0,"nofollow"!==O.rel&&(E=t("."+ee).filter(function(){var e,i=t.data(this,Z);return i&&(e=t(this).data("rel")||i.rel||this.rel),e===O.rel}),j=E.index(A),-1===j&&(E=E.add(A),j=E.length-1)),g.css({opacity:parseFloat(O.opacity),cursor:O.overlayClose?"pointer":"auto",visibility:"visible"}).show(),V&&v.add(g).removeClass(V),O.className&&v.add(g).addClass(O.className),V=O.className,O.closeButton?P.html(O.close).appendTo(x):P.appendTo("<div/>"),$||($=q=!0,v.css({visibility:"hidden",display:"block"}),W=o(ae,"LoadedContent","width:0; height:0; overflow:hidden"),x.css({width:"",height:""}).append(W),_=b.height()+k.height()+x.outerHeight(!0)-x.height(),D=T.width()+C.width()+x.outerWidth(!0)-x.width(),N=W.outerHeight(!0),z=W.outerWidth(!0),O.w=l(O.initialWidth,"x"),O.h=l(O.initialHeight,"y"),J.position(),u(),c(ie,O.onOpen),B.add(S).hide(),v.focus(),O.trapFocus&&e.addEventListener&&(e.addEventListener("focus",a,!0),se.one(le,function(){e.removeEventListener("focus",a,!0)})),O.returnFocus&&se.one(le,function(){t(A).focus()})),w())}function f(){!v&&e.body&&(X=!1,H=t(i),v=o(ae).attr({id:Z,"class":t.support.opacity===!1?te+"IE":"",role:"dialog",tabindex:"-1"}).hide(),g=o(ae,"Overlay").hide(),L=t([o(ae,"LoadingOverlay")[0],o(ae,"LoadingGraphic")[0]]),y=o(ae,"Wrapper"),x=o(ae,"Content").append(S=o(ae,"Title"),M=o(ae,"Current"),K=t('<button type="button"/>').attr({id:te+"Previous"}),I=t('<button type="button"/>').attr({id:te+"Next"}),R=o("button","Slideshow"),L),P=t('<button type="button"/>').attr({id:te+"Close"}),y.append(o(ae).append(o(ae,"TopLeft"),b=o(ae,"TopCenter"),o(ae,"TopRight")),o(ae,!1,"clear:left").append(T=o(ae,"MiddleLeft"),x,C=o(ae,"MiddleRight")),o(ae,!1,"clear:left").append(o(ae,"BottomLeft"),k=o(ae,"BottomCenter"),o(ae,"BottomRight"))).find("div div").css({"float":"left"}),F=o(ae,!1,"position:absolute; width:9999px; visibility:hidden; display:none"),B=I.add(K).add(M).add(R),t(e.body).append(g,v.append(y,F)))}function m(){function i(t){t.which>1||t.shiftKey||t.altKey||t.metaKey||t.ctrlKey||(t.preventDefault(),p(this))}return v?(X||(X=!0,I.click(function(){J.next()}),K.click(function(){J.prev()}),P.click(function(){J.close()}),g.click(function(){O.overlayClose&&J.close()}),t(e).bind("keydown."+te,function(t){var e=t.keyCode;$&&O.escKey&&27===e&&(t.preventDefault(),J.close()),$&&O.arrowKey&&E[1]&&!t.altKey&&(37===e?(t.preventDefault(),K.click()):39===e&&(t.preventDefault(),I.click()))}),t.isFunction(t.fn.on)?t(e).on("click."+te,"."+ee,i):t("."+ee).live("click."+te,i)),!0):!1}function w(){var n,r,a,u=J.prep,p=++de;q=!0,U=!1,A=E[j],d(),c(he),c(oe,O.onLoad),O.h=O.height?l(O.height,"y")-N-_:O.innerHeight&&l(O.innerHeight,"y"),O.w=O.width?l(O.width,"x")-z-D:O.innerWidth&&l(O.innerWidth,"x"),O.mw=O.w,O.mh=O.h,O.maxWidth&&(O.mw=l(O.maxWidth,"x")-z-D,O.mw=O.w&&O.w<O.mw?O.w:O.mw),O.maxHeight&&(O.mh=l(O.maxHeight,"y")-N-_,O.mh=O.h&&O.h<O.mh?O.h:O.mh),n=O.href,Q=setTimeout(function(){L.show()},100),O.inline?(a=o(ae).hide().insertBefore(t(n)[0]),se.one(he,function(){a.replaceWith(W.children())}),u(t(n))):O.iframe?u(" "):O.html?u(O.html):h(O,n)?(n=s(O,n),U=e.createElement("img"),t(U).addClass(te+"Photo").bind("error",function(){O.title=!1,u(o(ae,"Error").html(O.imgError))}).one("load",function(){var e;p===de&&(U.alt=t(A).attr("alt")||t(A).attr("data-alt")||"",O.retinaImage&&i.devicePixelRatio>1&&(U.height=U.height/i.devicePixelRatio,U.width=U.width/i.devicePixelRatio),O.scalePhotos&&(r=function(){U.height-=U.height*e,U.width-=U.width*e},O.mw&&U.width>O.mw&&(e=(U.width-O.mw)/U.width,r()),O.mh&&U.height>O.mh&&(e=(U.height-O.mh)/U.height,r())),O.h&&(U.style.marginTop=Math.max(O.mh-U.height,0)/2+"px"),E[1]&&(O.loop||E[j+1])&&(U.style.cursor="pointer",U.onclick=function(){J.next()}),U.style.width=U.width+"px",U.style.height=U.height+"px",setTimeout(function(){u(U)},1))}),setTimeout(function(){U.src=n},1)):n&&F.load(n,O.data,function(e,i){p===de&&u("error"===i?o(ae,"Error").html(O.xhrError):t(this).contents())})}var g,v,y,x,b,T,C,k,E,H,W,F,L,S,M,R,I,K,P,B,O,_,D,N,z,A,j,U,$,q,G,Q,J,V,X,Y={transition:"elastic",speed:300,fadeOut:300,width:!1,initialWidth:"600",innerWidth:!1,maxWidth:!1,height:!1,initialHeight:"450",innerHeight:!1,maxHeight:!1,scalePhotos:!0,scrolling:!0,inline:!1,html:!1,iframe:!1,fastIframe:!0,photo:!1,href:!1,title:!1,rel:!1,opacity:.9,preloading:!0,className:!1,retinaImage:!1,retinaUrl:!1,retinaSuffix:"@2x.$1",current:"image {current} of {total}",previous:"previous",next:"next",close:"close",xhrError:"This content failed to load.",imgError:"This image failed to load.",open:!1,returnFocus:!0,trapFocus:!0,reposition:!0,loop:!0,slideshow:!1,slideshowAuto:!0,slideshowSpeed:2500,slideshowStart:"start slideshow",slideshowStop:"stop slideshow",photoRegex:/\.(gif|png|jp(e|g|eg)|bmp|ico|webp)((#|\?).*)?$/i,onOpen:!1,onLoad:!1,onComplete:!1,onCleanup:!1,onClosed:!1,overlayClose:!0,escKey:!0,arrowKey:!0,top:!1,bottom:!1,left:!1,right:!1,fixed:!1,data:void 0,closeButton:!0},Z="colorbox",te="cbox",ee=te+"Element",ie=te+"_open",oe=te+"_load",ne=te+"_complete",re=te+"_cleanup",le=te+"_closed",he=te+"_purge",se=t("<a/>"),ae="div",de=0,ce={};t.colorbox||(t(f),J=t.fn[Z]=t[Z]=function(e,i){var o=this;if(e=e||{},f(),m()){if(t.isFunction(o))o=t("<a/>"),e.open=!0;else if(!o[0])return o;i&&(e.onComplete=i),o.each(function(){t.data(this,Z,t.extend({},t.data(this,Z)||Y,e))}).addClass(ee),(t.isFunction(e.open)&&e.open.call(o)||e.open)&&p(o[0])}return o},J.position=function(e,i){function o(){b[0].style.width=k[0].style.width=x[0].style.width=parseInt(v[0].style.width,10)-D+"px",x[0].style.height=T[0].style.height=C[0].style.height=parseInt(v[0].style.height,10)-_+"px"}var r,h,s,a=0,d=0,c=v.offset();if(H.unbind("resize."+te),v.css({top:-9e4,left:-9e4}),h=H.scrollTop(),s=H.scrollLeft(),O.fixed?(c.top-=h,c.left-=s,v.css({position:"fixed"})):(a=h,d=s,v.css({position:"absolute"})),d+=O.right!==!1?Math.max(H.width()-O.w-z-D-l(O.right,"x"),0):O.left!==!1?l(O.left,"x"):Math.round(Math.max(H.width()-O.w-z-D,0)/2),a+=O.bottom!==!1?Math.max(n()-O.h-N-_-l(O.bottom,"y"),0):O.top!==!1?l(O.top,"y"):Math.round(Math.max(n()-O.h-N-_,0)/2),v.css({top:c.top,left:c.left,visibility:"visible"}),y[0].style.width=y[0].style.height="9999px",r={width:O.w+z+D,height:O.h+N+_,top:a,left:d},e){var u=0;t.each(r,function(t){return r[t]!==ce[t]?(u=e,void 0):void 0}),e=u}ce=r,e||v.css(r),v.dequeue().animate(r,{duration:e||0,complete:function(){o(),q=!1,y[0].style.width=O.w+z+D+"px",y[0].style.height=O.h+N+_+"px",O.reposition&&setTimeout(function(){H.bind("resize."+te,J.position)},1),i&&i()},step:o})},J.resize=function(t){var e;$&&(t=t||{},t.width&&(O.w=l(t.width,"x")-z-D),t.innerWidth&&(O.w=l(t.innerWidth,"x")),W.css({width:O.w}),t.height&&(O.h=l(t.height,"y")-N-_),t.innerHeight&&(O.h=l(t.innerHeight,"y")),t.innerHeight||t.height||(e=W.scrollTop(),W.css({height:"auto"}),O.h=W.height()),W.css({height:O.h}),e&&W.scrollTop(e),J.position("none"===O.transition?0:O.speed))},J.prep=function(i){function n(){return O.w=O.w||W.width(),O.w=O.mw&&O.mw<O.w?O.mw:O.w,O.w}function l(){return O.h=O.h||W.height(),O.h=O.mh&&O.mh<O.h?O.mh:O.h,O.h}if($){var a,d="none"===O.transition?0:O.speed;W.empty().remove(),W=o(ae,"LoadedContent").append(i),W.hide().appendTo(F.show()).css({width:n(),overflow:O.scrolling?"auto":"hidden"}).css({height:l()}).prependTo(x),F.hide(),t(U).css({"float":"none"}),a=function(){function i(){t.support.opacity===!1&&v[0].style.removeAttribute("filter")}var n,l,a=E.length,u="frameBorder",p="allowTransparency";$&&(l=function(){clearTimeout(Q),L.hide(),c(ne,O.onComplete)},S.html(O.title).add(W).show(),a>1?("string"==typeof O.current&&M.html(O.current.replace("{current}",j+1).replace("{total}",a)).show(),I[O.loop||a-1>j?"show":"hide"]().html(O.next),K[O.loop||j?"show":"hide"]().html(O.previous),O.slideshow&&R.show(),O.preloading&&t.each([r(-1),r(1)],function(){var i,o,n=E[this],r=t.data(n,Z);r&&r.href?(i=r.href,t.isFunction(i)&&(i=i.call(n))):i=t(n).attr("href"),i&&h(r,i)&&(i=s(r,i),o=e.createElement("img"),o.src=i)})):B.hide(),O.iframe?(n=o("iframe")[0],u in n&&(n[u]=0),p in n&&(n[p]="true"),O.scrolling||(n.scrolling="no"),t(n).attr({src:O.href,name:(new Date).getTime(),"class":te+"Iframe",allowFullScreen:!0,webkitAllowFullScreen:!0,mozallowfullscreen:!0}).one("load",l).appendTo(W),se.one(he,function(){n.src="//about:blank"}),O.fastIframe&&t(n).trigger("load")):l(),"fade"===O.transition?v.fadeTo(d,1,i):i())},"fade"===O.transition?v.fadeTo(d,0,function(){J.position(0,a)}):J.position(d,a)}},J.next=function(){!q&&E[1]&&(O.loop||E[j+1])&&(j=r(1),p(E[j]))},J.prev=function(){!q&&E[1]&&(O.loop||j)&&(j=r(-1),p(E[j]))},J.close=function(){$&&!G&&(G=!0,$=!1,c(re,O.onCleanup),H.unbind("."+te),g.fadeTo(O.fadeOut||0,0),v.stop().fadeTo(O.fadeOut||0,0,function(){v.add(g).css({opacity:1,cursor:"auto"}).hide(),c(he),W.empty().remove(),setTimeout(function(){G=!1,c(le,O.onClosed)},1)}))},J.remove=function(){v&&(v.stop(),t.colorbox.close(),v.stop().remove(),g.remove(),G=!1,v=null,t("."+ee).removeData(Z).removeClass(ee),t(e).unbind("click."+te))},J.element=function(){return t(A)},J.settings=Y)})(jQuery,document,window);
+/*! jQuery UI - v1.9.1 - 2012-10-31
+* http://jqueryui.com
+* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.position.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.menu.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.spinner.js, jquery.ui.tabs.js, jquery.ui.tooltip.js, jquery.ui.effect.js, jquery.ui.effect-blind.js, jquery.ui.effect-bounce.js, jquery.ui.effect-clip.js, jquery.ui.effect-drop.js, jquery.ui.effect-explode.js, jquery.ui.effect-fade.js, jquery.ui.effect-fold.js, jquery.ui.effect-highlight.js, jquery.ui.effect-pulsate.js, jquery.ui.effect-scale.js, jquery.ui.effect-shake.js, jquery.ui.effect-slide.js, jquery.ui.effect-transfer.js
+* Copyright (c) 2012 jQuery Foundation and other contributors Licensed MIT */
+
+
+(function(e,t){function i(t,n){var r,i,o,u=t.nodeName.toLowerCase();return"area"===u?(r=t.parentNode,i=r.name,!t.href||!i||r.nodeName.toLowerCase()!=="map"?!1:(o=e("img[usemap=#"+i+"]")[0],!!o&&s(o))):(/input|select|textarea|button|object/.test(u)?!t.disabled:"a"===u?t.href||n:n)&&s(t)}function s(t){return e.expr.filters.visible(t)&&!e(t).parents().andSelf().filter(function(){return e.css(this,"visibility")==="hidden"}).length}var n=0,r=/^ui-id-\d+$/;e.ui=e.ui||{};if(e.ui.version)return;e.extend(e.ui,{version:"1.9.1",keyCode:{BACKSPACE:8,COMMA:188,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SPACE:32,TAB:9,UP:38}}),e.fn.extend({_focus:e.fn.focus,focus:function(t,n){return typeof t=="number"?this.each(function(){var r=this;setTimeout(function(){e(r).focus(),n&&n.call(r)},t)}):this._focus.apply(this,arguments)},scrollParent:function(){var t;return e.ui.ie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?t=this.parents().filter(function(){return/(relative|absolute|fixed)/.test(e.css(this,"position"))&&/(auto|scroll)/.test(e.css(this,"overflow")+e.css(this,"overflow-y")+e.css(this,"overflow-x"))}).eq(0):t=this.parents().filter(function(){return/(auto|scroll)/.test(e.css(this,"overflow")+e.css(this,"overflow-y")+e.css(this,"overflow-x"))}).eq(0),/fixed/.test(this.css("position"))||!t.length?e(document):t},zIndex:function(n){if(n!==t)return this.css("zIndex",n);if(this.length){var r=e(this[0]),i,s;while(r.length&&r[0]!==document){i=r.css("position");if(i==="absolute"||i==="relative"||i==="fixed"){s=parseInt(r.css("zIndex"),10);if(!isNaN(s)&&s!==0)return s}r=r.parent()}}return 0},uniqueId:function(){return this.each(function(){this.id||(this.id="ui-id-"+ ++n)})},removeUniqueId:function(){return this.each(function(){r.test(this.id)&&e(this).removeAttr("id")})}}),e("<a>").outerWidth(1).jquery||e.each(["Width","Height"],function(n,r){function u(t,n,r,s){return e.each(i,function(){n-=parseFloat(e.css(t,"padding"+this))||0,r&&(n-=parseFloat(e.css(t,"border"+this+"Width"))||0),s&&(n-=parseFloat(e.css(t,"margin"+this))||0)}),n}var i=r==="Width"?["Left","Right"]:["Top","Bottom"],s=r.toLowerCase(),o={innerWidth:e.fn.innerWidth,innerHeight:e.fn.innerHeight,outerWidth:e.fn.outerWidth,outerHeight:e.fn.outerHeight};e.fn["inner"+r]=function(n){return n===t?o["inner"+r].call(this):this.each(function(){e(this).css(s,u(this,n)+"px")})},e.fn["outer"+r]=function(t,n){return typeof t!="number"?o["outer"+r].call(this,t):this.each(function(){e(this).css(s,u(this,t,!0,n)+"px")})}}),e.extend(e.expr[":"],{data:e.expr.createPseudo?e.expr.createPseudo(function(t){return function(n){return!!e.data(n,t)}}):function(t,n,r){return!!e.data(t,r[3])},focusable:function(t){return i(t,!isNaN(e.attr(t,"tabindex")))},tabbable:function(t){var n=e.attr(t,"tabindex"),r=isNaN(n);return(r||n>=0)&&i(t,!r)}}),e(function(){var t=document.body,n=t.appendChild(n=document.createElement("div"));n.offsetHeight,e.extend(n.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),e.support.minHeight=n.offsetHeight===100,e.support.selectstart="onselectstart"in n,t.removeChild(n).style.display="none"}),function(){var t=/msie ([\w.]+)/.exec(navigator.userAgent.toLowerCase())||[];e.ui.ie=t.length?!0:!1,e.ui.ie6=parseFloat(t[1],10)===6}(),e.fn.extend({disableSelection:function(){return this.bind((e.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),e.extend(e.ui,{plugin:{add:function(t,n,r){var i,s=e.ui[t].prototype;for(i in r)s.plugins[i]=s.plugins[i]||[],s.plugins[i].push([n,r[i]])},call:function(e,t,n){var r,i=e.plugins[t];if(!i||!e.element[0].parentNode||e.element[0].parentNode.nodeType===11)return;for(r=0;r<i.length;r++)e.options[i[r][0]]&&i[r][1].apply(e.element,n)}},contains:e.contains,hasScroll:function(t,n){if(e(t).css("overflow")==="hidden")return!1;var r=n&&n==="left"?"scrollLeft":"scrollTop",i=!1;return t[r]>0?!0:(t[r]=1,i=t[r]>0,t[r]=0,i)},isOverAxis:function(e,t,n){return e>t&&e<t+n},isOver:function(t,n,r,i,s,o){return e.ui.isOverAxis(t,r,s)&&e.ui.isOverAxis(n,i,o)}})})(jQuery);(function(e,t){var n=0,r=Array.prototype.slice,i=e.cleanData;e.cleanData=function(t){for(var n=0,r;(r=t[n])!=null;n++)try{e(r).triggerHandler("remove")}catch(s){}i(t)},e.widget=function(t,n,r){var i,s,o,u,a=t.split(".")[0];t=t.split(".")[1],i=a+"-"+t,r||(r=n,n=e.Widget),e.expr[":"][i.toLowerCase()]=function(t){return!!e.data(t,i)},e[a]=e[a]||{},s=e[a][t],o=e[a][t]=function(e,t){if(!this._createWidget)return new o(e,t);arguments.length&&this._createWidget(e,t)},e.extend(o,s,{version:r.version,_proto:e.extend({},r),_childConstructors:[]}),u=new n,u.options=e.widget.extend({},u.options),e.each(r,function(t,i){e.isFunction(i)&&(r[t]=function(){var e=function(){return n.prototype[t].apply(this,arguments)},r=function(e){return n.prototype[t].apply(this,e)};return function(){var t=this._super,n=this._superApply,s;return this._super=e,this._superApply=r,s=i.apply(this,arguments),this._super=t,this._superApply=n,s}}())}),o.prototype=e.widget.extend(u,{widgetEventPrefix:u.widgetEventPrefix||t},r,{constructor:o,namespace:a,widgetName:t,widgetBaseClass:i,widgetFullName:i}),s?(e.each(s._childConstructors,function(t,n){var r=n.prototype;e.widget(r.namespace+"."+r.widgetName,o,n._proto)}),delete s._childConstructors):n._childConstructors.push(o),e.widget.bridge(t,o)},e.widget.extend=function(n){var i=r.call(arguments,1),s=0,o=i.length,u,a;for(;s<o;s++)for(u in i[s])a=i[s][u],i[s].hasOwnProperty(u)&&a!==t&&(e.isPlainObject(a)?n[u]=e.isPlainObject(n[u])?e.widget.extend({},n[u],a):e.widget.extend({},a):n[u]=a);return n},e.widget.bridge=function(n,i){var s=i.prototype.widgetFullName;e.fn[n]=function(o){var u=typeof o=="string",a=r.call(arguments,1),f=this;return o=!u&&a.length?e.widget.extend.apply(null,[o].concat(a)):o,u?this.each(function(){var r,i=e.data(this,s);if(!i)return e.error("cannot call methods on "+n+" prior to initialization; "+"attempted to call method '"+o+"'");if(!e.isFunction(i[o])||o.charAt(0)==="_")return e.error("no such method '"+o+"' for "+n+" widget instance");r=i[o].apply(i,a);if(r!==i&&r!==t)return f=r&&r.jquery?f.pushStack(r.get()):r,!1}):this.each(function(){var t=e.data(this,s);t?t.option(o||{})._init():new i(o,this)}),f}},e.Widget=function(){},e.Widget._childConstructors=[],e.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",defaultElement:"<div>",options:{disabled:!1,create:null},_createWidget:function(t,r){r=e(r||this.defaultElement||this)[0],this.element=e(r),this.uuid=n++,this.eventNamespace="."+this.widgetName+this.uuid,this.options=e.widget.extend({},this.options,this._getCreateOptions(),t),this.bindings=e(),this.hoverable=e(),this.focusable=e(),r!==this&&(e.data(r,this.widgetName,this),e.data(r,this.widgetFullName,this),this._on(this.element,{remove:function(e){e.target===r&&this.destroy()}}),this.document=e(r.style?r.ownerDocument:r.document||r),this.window=e(this.document[0].defaultView||this.document[0].parentWindow)),this._create(),this._trigger("create",null,this._getCreateEventData()),this._init()},_getCreateOptions:e.noop,_getCreateEventData:e.noop,_create:e.noop,_init:e.noop,destroy:function(){this._destroy(),this.element.unbind(this.eventNamespace).removeData(this.widgetName).removeData(this.widgetFullName).removeData(e.camelCase(this.widgetFullName)),this.widget().unbind(this.eventNamespace).removeAttr("aria-disabled").removeClass(this.widgetFullName+"-disabled "+"ui-state-disabled"),this.bindings.unbind(this.eventNamespace),this.hoverable.removeClass("ui-state-hover"),this.focusable.removeClass("ui-state-focus")},_destroy:e.noop,widget:function(){return this.element},option:function(n,r){var i=n,s,o,u;if(arguments.length===0)return e.widget.extend({},this.options);if(typeof n=="string"){i={},s=n.split("."),n=s.shift();if(s.length){o=i[n]=e.widget.extend({},this.options[n]);for(u=0;u<s.length-1;u++)o[s[u]]=o[s[u]]||{},o=o[s[u]];n=s.pop();if(r===t)return o[n]===t?null:o[n];o[n]=r}else{if(r===t)return this.options[n]===t?null:this.options[n];i[n]=r}}return this._setOptions(i),this},_setOptions:function(e){var t;for(t in e)this._setOption(t,e[t]);return this},_setOption:function(e,t){return this.options[e]=t,e==="disabled"&&(this.widget().toggleClass(this.widgetFullName+"-disabled ui-state-disabled",!!t).attr("aria-disabled",t),this.hoverable.removeClass("ui-state-hover"),this.focusable.removeClass("ui-state-focus")),this},enable:function(){return this._setOption("disabled",!1)},disable:function(){return this._setOption("disabled",!0)},_on:function(t,n){var r,i=this;n?(t=r=e(t),this.bindings=this.bindings.add(t)):(n=t,t=this.element,r=this.widget()),e.each(n,function(n,s){function o(){if(i.options.disabled===!0||e(this).hasClass("ui-state-disabled"))return;return(typeof s=="string"?i[s]:s).apply(i,arguments)}typeof s!="string"&&(o.guid=s.guid=s.guid||o.guid||e.guid++);var u=n.match(/^(\w+)\s*(.*)$/),a=u[1]+i.eventNamespace,f=u[2];f?r.delegate(f,a,o):t.bind(a,o)})},_off:function(e,t){t=(t||"").split(" ").join(this.eventNamespace+" ")+this.eventNamespace,e.unbind(t).undelegate(t)},_delay:function(e,t){function n(){return(typeof e=="string"?r[e]:e).apply(r,arguments)}var r=this;return setTimeout(n,t||0)},_hoverable:function(t){this.hoverable=this.hoverable.add(t),this._on(t,{mouseenter:function(t){e(t.currentTarget).addClass("ui-state-hover")},mouseleave:function(t){e(t.currentTarget).removeClass("ui-state-hover")}})},_focusable:function(t){this.focusable=this.focusable.add(t),this._on(t,{focusin:function(t){e(t.currentTarget).addClass("ui-state-focus")},focusout:function(t){e(t.currentTarget).removeClass("ui-state-focus")}})},_trigger:function(t,n,r){var i,s,o=this.options[t];r=r||{},n=e.Event(n),n.type=(t===this.widgetEventPrefix?t:this.widgetEventPrefix+t).toLowerCase(),n.target=this.element[0],s=n.originalEvent;if(s)for(i in s)i in n||(n[i]=s[i]);return this.element.trigger(n,r),!(e.isFunction(o)&&o.apply(this.element[0],[n].concat(r))===!1||n.isDefaultPrevented())}},e.each({show:"fadeIn",hide:"fadeOut"},function(t,n){e.Widget.prototype["_"+t]=function(r,i,s){typeof i=="string"&&(i={effect:i});var o,u=i?i===!0||typeof i=="number"?n:i.effect||n:t;i=i||{},typeof i=="number"&&(i={duration:i}),o=!e.isEmptyObject(i),i.complete=s,i.delay&&r.delay(i.delay),o&&e.effects&&(e.effects.effect[u]||e.uiBackCompat!==!1&&e.effects[u])?r[t](i):u!==t&&r[u]?r[u](i.duration,i.easing,s):r.queue(function(n){e(this)[t](),s&&s.call(r[0]),n()})}}),e.uiBackCompat!==!1&&(e.Widget.prototype._getCreateOptions=function(){return e.metadata&&e.metadata.get(this.element[0])[this.widgetName]})})(jQuery);(function(e,t){var n=!1;e(document).mouseup(function(e){n=!1}),e.widget("ui.mouse",{version:"1.9.1",options:{cancel:"input,textarea,button,select,option",distance:1,delay:0},_mouseInit:function(){var t=this;this.element.bind("mousedown."+this.widgetName,function(e){return t._mouseDown(e)}).bind("click."+this.widgetName,function(n){if(!0===e.data(n.target,t.widgetName+".preventClickEvent"))return e.removeData(n.target,t.widgetName+".preventClickEvent"),n.stopImmediatePropagation(),!1}),this.started=!1},_mouseDestroy:function(){this.element.unbind("."+this.widgetName),this._mouseMoveDelegate&&e(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate)},_mouseDown:function(t){if(n)return;this._mouseStarted&&this._mouseUp(t),this._mouseDownEvent=t;var r=this,i=t.which===1,s=typeof this.options.cancel=="string"&&t.target.nodeName?e(t.target).closest(this.options.cancel).length:!1;if(!i||s||!this._mouseCapture(t))return!0;this.mouseDelayMet=!this.options.delay,this.mouseDelayMet||(this._mouseDelayTimer=setTimeout(function(){r.mouseDelayMet=!0},this.options.delay));if(this._mouseDistanceMet(t)&&this._mouseDelayMet(t)){this._mouseStarted=this._mouseStart(t)!==!1;if(!this._mouseStarted)return t.preventDefault(),!0}return!0===e.data(t.target,this.widgetName+".preventClickEvent")&&e.removeData(t.target,this.widgetName+".preventClickEvent"),this._mouseMoveDelegate=function(e){return r._mouseMove(e)},this._mouseUpDelegate=function(e){return r._mouseUp(e)},e(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate),t.preventDefault(),n=!0,!0},_mouseMove:function(t){return!e.ui.ie||document.documentMode>=9||!!t.button?this._mouseStarted?(this._mouseDrag(t),t.preventDefault()):(this._mouseDistanceMet(t)&&this._mouseDelayMet(t)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,t)!==!1,this._mouseStarted?this._mouseDrag(t):this._mouseUp(t)),!this._mouseStarted):this._mouseUp(t)},_mouseUp:function(t){return e(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,t.target===this._mouseDownEvent.target&&e.data(t.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(t)),!1},_mouseDistanceMet:function(e){return Math.max(Math.abs(this._mouseDownEvent.pageX-e.pageX),Math.abs(this._mouseDownEvent.pageY-e.pageY))>=this.options.distance},_mouseDelayMet:function(e){return this.mouseDelayMet},_mouseStart:function(e){},_mouseDrag:function(e){},_mouseStop:function(e){},_mouseCapture:function(e){return!0}})})(jQuery);(function(e,t){function h(e,t,n){return[parseInt(e[0],10)*(l.test(e[0])?t/100:1),parseInt(e[1],10)*(l.test(e[1])?n/100:1)]}function p(t,n){return parseInt(e.css(t,n),10)||0}e.ui=e.ui||{};var n,r=Math.max,i=Math.abs,s=Math.round,o=/left|center|right/,u=/top|center|bottom/,a=/[\+\-]\d+%?/,f=/^\w+/,l=/%$/,c=e.fn.position;e.position={scrollbarWidth:function(){if(n!==t)return n;var r,i,s=e("<div style='display:block;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>"),o=s.children()[0];return e("body").append(s),r=o.offsetWidth,s.css("overflow","scroll"),i=o.offsetWidth,r===i&&(i=s[0].clientWidth),s.remove(),n=r-i},getScrollInfo:function(t){var n=t.isWindow?"":t.element.css("overflow-x"),r=t.isWindow?"":t.element.css("overflow-y"),i=n==="scroll"||n==="auto"&&t.width<t.element[0].scrollWidth,s=r==="scroll"||r==="auto"&&t.height<t.element[0].scrollHeight;return{width:i?e.position.scrollbarWidth():0,height:s?e.position.scrollbarWidth():0}},getWithinInfo:function(t){var n=e(t||window),r=e.isWindow(n[0]);return{element:n,isWindow:r,offset:n.offset()||{left:0,top:0},scrollLeft:n.scrollLeft(),scrollTop:n.scrollTop(),width:r?n.width():n.outerWidth(),height:r?n.height():n.outerHeight()}}},e.fn.position=function(t){if(!t||!t.of)return c.apply(this,arguments);t=e.extend({},t);var n,l,d,v,m,g=e(t.of),y=e.position.getWithinInfo(t.within),b=e.position.getScrollInfo(y),w=g[0],E=(t.collision||"flip").split(" "),S={};return w.nodeType===9?(l=g.width(),d=g.height(),v={top:0,left:0}):e.isWindow(w)?(l=g.width(),d=g.height(),v={top:g.scrollTop(),left:g.scrollLeft()}):w.preventDefault?(t.at="left top",l=d=0,v={top:w.pageY,left:w.pageX}):(l=g.outerWidth(),d=g.outerHeight(),v=g.offset()),m=e.extend({},v),e.each(["my","at"],function(){var e=(t[this]||"").split(" "),n,r;e.length===1&&(e=o.test(e[0])?e.concat(["center"]):u.test(e[0])?["center"].concat(e):["center","center"]),e[0]=o.test(e[0])?e[0]:"center",e[1]=u.test(e[1])?e[1]:"center",n=a.exec(e[0]),r=a.exec(e[1]),S[this]=[n?n[0]:0,r?r[0]:0],t[this]=[f.exec(e[0])[0],f.exec(e[1])[0]]}),E.length===1&&(E[1]=E[0]),t.at[0]==="right"?m.left+=l:t.at[0]==="center"&&(m.left+=l/2),t.at[1]==="bottom"?m.top+=d:t.at[1]==="center"&&(m.top+=d/2),n=h(S.at,l,d),m.left+=n[0],m.top+=n[1],this.each(function(){var o,u,a=e(this),f=a.outerWidth(),c=a.outerHeight(),w=p(this,"marginLeft"),x=p(this,"marginTop"),T=f+w+p(this,"marginRight")+b.width,N=c+x+p(this,"marginBottom")+b.height,C=e.extend({},m),k=h(S.my,a.outerWidth(),a.outerHeight());t.my[0]==="right"?C.left-=f:t.my[0]==="center"&&(C.left-=f/2),t.my[1]==="bottom"?C.top-=c:t.my[1]==="center"&&(C.top-=c/2),C.left+=k[0],C.top+=k[1],e.support.offsetFractions||(C.left=s(C.left),C.top=s(C.top)),o={marginLeft:w,marginTop:x},e.each(["left","top"],function(r,i){e.ui.position[E[r]]&&e.ui.position[E[r]][i](C,{targetWidth:l,targetHeight:d,elemWidth:f,elemHeight:c,collisionPosition:o,collisionWidth:T,collisionHeight:N,offset:[n[0]+k[0],n[1]+k[1]],my:t.my,at:t.at,within:y,elem:a})}),e.fn.bgiframe&&a.bgiframe(),t.using&&(u=function(e){var n=v.left-C.left,s=n+l-f,o=v.top-C.top,u=o+d-c,h={target:{element:g,left:v.left,top:v.top,width:l,height:d},element:{element:a,left:C.left,top:C.top,width:f,height:c},horizontal:s<0?"left":n>0?"right":"center",vertical:u<0?"top":o>0?"bottom":"middle"};l<f&&i(n+s)<l&&(h.horizontal="center"),d<c&&i(o+u)<d&&(h.vertical="middle"),r(i(n),i(s))>r(i(o),i(u))?h.important="horizontal":h.important="vertical",t.using.call(this,e,h)}),a.offset(e.extend(C,{using:u}))})},e.ui.position={fit:{left:function(e,t){var n=t.within,i=n.isWindow?n.scrollLeft:n.offset.left,s=n.width,o=e.left-t.collisionPosition.marginLeft,u=i-o,a=o+t.collisionWidth-s-i,f;t.collisionWidth>s?u>0&&a<=0?(f=e.left+u+t.collisionWidth-s-i,e.left+=u-f):a>0&&u<=0?e.left=i:u>a?e.left=i+s-t.collisionWidth:e.left=i:u>0?e.left+=u:a>0?e.left-=a:e.left=r(e.left-o,e.left)},top:function(e,t){var n=t.within,i=n.isWindow?n.scrollTop:n.offset.top,s=t.within.height,o=e.top-t.collisionPosition.marginTop,u=i-o,a=o+t.collisionHeight-s-i,f;t.collisionHeight>s?u>0&&a<=0?(f=e.top+u+t.collisionHeight-s-i,e.top+=u-f):a>0&&u<=0?e.top=i:u>a?e.top=i+s-t.collisionHeight:e.top=i:u>0?e.top+=u:a>0?e.top-=a:e.top=r(e.top-o,e.top)}},flip:{left:function(e,t){var n=t.within,r=n.offset.left+n.scrollLeft,s=n.width,o=n.isWindow?n.scrollLeft:n.offset.left,u=e.left-t.collisionPosition.marginLeft,a=u-o,f=u+t.collisionWidth-s-o,l=t.my[0]==="left"?-t.elemWidth:t.my[0]==="right"?t.elemWidth:0,c=t.at[0]==="left"?t.targetWidth:t.at[0]==="right"?-t.targetWidth:0,h=-2*t.offset[0],p,d;if(a<0){p=e.left+l+c+h+t.collisionWidth-s-r;if(p<0||p<i(a))e.left+=l+c+h}else if(f>0){d=e.left-t.collisionPosition.marginLeft+l+c+h-o;if(d>0||i(d)<f)e.left+=l+c+h}},top:function(e,t){var n=t.within,r=n.offset.top+n.scrollTop,s=n.height,o=n.isWindow?n.scrollTop:n.offset.top,u=e.top-t.collisionPosition.marginTop,a=u-o,f=u+t.collisionHeight-s-o,l=t.my[1]==="top",c=l?-t.elemHeight:t.my[1]==="bottom"?t.elemHeight:0,h=t.at[1]==="top"?t.targetHeight:t.at[1]==="bottom"?-t.targetHeight:0,p=-2*t.offset[1],d,v;a<0?(v=e.top+c+h+p+t.collisionHeight-s-r,e.top+c+h+p>a&&(v<0||v<i(a))&&(e.top+=c+h+p)):f>0&&(d=e.top-t.collisionPosition.marginTop+c+h+p-o,e.top+c+h+p>f&&(d>0||i(d)<f)&&(e.top+=c+h+p))}},flipfit:{left:function(){e.ui.position.flip.left.apply(this,arguments),e.ui.position.fit.left.apply(this,arguments)},top:function(){e.ui.position.flip.top.apply(this,arguments),e.ui.position.fit.top.apply(this,arguments)}}},function(){var t,n,r,i,s,o=document.getElementsByTagName("body")[0],u=document.createElement("div");t=document.createElement(o?"div":"body"),r={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},o&&e.extend(r,{position:"absolute",left:"-1000px",top:"-1000px"});for(s in r)t.style[s]=r[s];t.appendChild(u),n=o||document.documentElement,n.insertBefore(t,n.firstChild),u.style.cssText="position: absolute; left: 10.7432222px;",i=e(u).offset().left,e.support.offsetFractions=i>10&&i<11,t.innerHTML="",n.removeChild(t)}(),e.uiBackCompat!==!1&&function(e){var n=e.fn.position;e.fn.position=function(r){if(!r||!r.offset)return n.call(this,r);var i=r.offset.split(" "),s=r.at.split(" ");return i.length===1&&(i[1]=i[0]),/^\d/.test(i[0])&&(i[0]="+"+i[0]),/^\d/.test(i[1])&&(i[1]="+"+i[1]),s.length===1&&(/left|center|right/.test(s[0])?s[1]="center":(s[1]=s[0],s[0]="center")),n.call(this,e.extend(r,{at:s[0]+i[0]+" "+s[1]+i[1],offset:t}))}}(jQuery)})(jQuery);(function(e,t){e.widget("ui.draggable",e.ui.mouse,{version:"1.9.1",widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){this.options.helper=="original"&&!/^(?:r|a|f)/.test(this.element.css("position"))&&(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},_destroy:function(){this.element.removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy()},_mouseCapture:function(t){var n=this.options;return this.helper||n.disabled||e(t.target).is(".ui-resizable-handle")?!1:(this.handle=this._getHandle(t),this.handle?(e(n.iframeFix===!0?"iframe":n.iframeFix).each(function(){e('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(e(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(t){var n=this.options;return this.helper=this._createHelper(t),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),e.ui.ddmanager&&(e.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},e.extend(this.offset,{click:{left:t.pageX-this.offset.left,top:t.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(t),this.originalPageX=t.pageX,this.originalPageY=t.pageY,n.cursorAt&&this._adjustOffsetFromHelper(n.cursorAt),n.containment&&this._setContainment(),this._trigger("start",t)===!1?(this._clear(),!1):(this._cacheHelperProportions(),e.ui.ddmanager&&!n.dropBehaviour&&e.ui.ddmanager.prepareOffsets(this,t),this._mouseDrag(t,!0),e.ui.ddmanager&&e.ui.ddmanager.dragStart(this,t),!0)},_mouseDrag:function(t,n){this.position=this._generatePosition(t),this.positionAbs=this._convertPositionTo("absolute");if(!n){var r=this._uiHash();if(this._trigger("drag",t,r)===!1)return this._mouseUp({}),!1;this.position=r.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return e.ui.ddmanager&&e.ui.ddmanager.drag(this,t),!1},_mouseStop:function(t){var n=!1;e.ui.ddmanager&&!this.options.dropBehaviour&&(n=e.ui.ddmanager.drop(this,t)),this.dropped&&(n=this.dropped,this.dropped=!1);var r=this.element[0],i=!1;while(r&&(r=r.parentNode))r==document&&(i=!0);if(!i&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!n||this.options.revert=="valid"&&n||this.options.revert===!0||e.isFunction(this.options.revert)&&this.options.revert.call(this.element,n)){var s=this;e(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){s._trigger("stop",t)!==!1&&s._clear()})}else this._trigger("stop",t)!==!1&&this._clear();return!1},_mouseUp:function(t){return e("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),e.ui.ddmanager&&e.ui.ddmanager.dragStop(this,t),e.ui.mouse.prototype._mouseUp.call(this,t)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(t){var n=!this.options.handle||!e(this.options.handle,this.element).length?!0:!1;return e(this.options.handle,this.element).find("*").andSelf().each(function(){this==t.target&&(n=!0)}),n},_createHelper:function(t){var n=this.options,r=e.isFunction(n.helper)?e(n.helper.apply(this.element[0],[t])):n.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return r.parents("body").length||r.appendTo(n.appendTo=="parent"?this.element[0].parentNode:n.appendTo),r[0]!=this.element[0]&&!/(fixed|absolute)/.test(r.css("position"))&&r.css("position","absolute"),r},_adjustOffsetFromHelper:function(t){typeof t=="string"&&(t=t.split(" ")),e.isArray(t)&&(t={left:+t[0],top:+t[1]||0}),"left"in t&&(this.offset.click.left=t.left+this.margins.left),"right"in t&&(this.offset.click.left=this.helperProportions.width-t.right+this.margins.left),"top"in t&&(this.offset.click.top=t.top+this.margins.top),"bottom"in t&&(this.offset.click.top=this.helperProportions.height-t.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var t=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&e.contains(this.scrollParent[0],this.offsetParent[0])&&(t.left+=this.scrollParent.scrollLeft(),t.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&e.ui.ie)t={top:0,left:0};return{top:t.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:t.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var e=this.element.position();return{top:e.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:e.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var t=this.options;t.containment=="parent"&&(t.containment=this.helper[0].parentNode);if(t.containment=="document"||t.containment=="window")this.containment=[t.containment=="document"?0:e(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,t.containment=="document"?0:e(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(t.containment=="document"?0:e(window).scrollLeft())+e(t.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(t.containment=="document"?0:e(window).scrollTop())+(e(t.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(t.containment)&&t.containment.constructor!=Array){var n=e(t.containment),r=n[0];if(!r)return;var i=n.offset(),s=e(r).css("overflow")!="hidden";this.containment=[(parseInt(e(r).css("borderLeftWidth"),10)||0)+(parseInt(e(r).css("paddingLeft"),10)||0),(parseInt(e(r).css("borderTopWidth"),10)||0)+(parseInt(e(r).css("paddingTop"),10)||0),(s?Math.max(r.scrollWidth,r.offsetWidth):r.offsetWidth)-(parseInt(e(r).css("borderLeftWidth"),10)||0)-(parseInt(e(r).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(s?Math.max(r.scrollHeight,r.offsetHeight):r.offsetHeight)-(parseInt(e(r).css("borderTopWidth"),10)||0)-(parseInt(e(r).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=n}else t.containment.constructor==Array&&(this.containment=t.containment)},_convertPositionTo:function(t,n){n||(n=this.position);var r=t=="absolute"?1:-1,i=this.options,s=this.cssPosition!="absolute"||this.scrollParent[0]!=document&&!!e.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,o=/(html|body)/i.test(s[0].tagName);return{top:n.top+this.offset.relative.top*r+this.offset.parent.top*r-(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():o?0:s.scrollTop())*r,left:n.left+this.offset.relative.left*r+this.offset.parent.left*r-(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():o?0:s.scrollLeft())*r}},_generatePosition:function(t){var n=this.options,r=this.cssPosition!="absolute"||this.scrollParent[0]!=document&&!!e.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,i=/(html|body)/i.test(r[0].tagName),s=t.pageX,o=t.pageY;if(this.originalPosition){var u;if(this.containment){if(this.relative_container){var a=this.relative_container.offset();u=[this.containment[0]+a.left,this.containment[1]+a.top,this.containment[2]+a.left,this.containment[3]+a.top]}else u=this.containment;t.pageX-this.offset.click.left<u[0]&&(s=u[0]+this.offset.click.left),t.pageY-this.offset.click.top<u[1]&&(o=u[1]+this.offset.click.top),t.pageX-this.offset.click.left>u[2]&&(s=u[2]+this.offset.click.left),t.pageY-this.offset.click.top>u[3]&&(o=u[3]+this.offset.click.top)}if(n.grid){var f=n.grid[1]?this.originalPageY+Math.round((o-this.originalPageY)/n.grid[1])*n.grid[1]:this.originalPageY;o=u?f-this.offset.click.top<u[1]||f-this.offset.click.top>u[3]?f-this.offset.click.top<u[1]?f+n.grid[1]:f-n.grid[1]:f:f;var l=n.grid[0]?this.originalPageX+Math.round((s-this.originalPageX)/n.grid[0])*n.grid[0]:this.originalPageX;s=u?l-this.offset.click.left<u[0]||l-this.offset.click.left>u[2]?l-this.offset.click.left<u[0]?l+n.grid[0]:l-n.grid[0]:l:l}}return{top:o-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():i?0:r.scrollTop()),left:s-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():i?0:r.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging"),this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove(),this.helper=null,this.cancelHelperRemoval=!1},_trigger:function(t,n,r){return r=r||this._uiHash(),e.ui.plugin.call(this,t,[n,r]),t=="drag"&&(this.positionAbs=this._convertPositionTo("absolute")),e.Widget.prototype._trigger.call(this,t,n,r)},plugins:{},_uiHash:function(e){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}}),e.ui.plugin.add("draggable","connectToSortable",{start:function(t,n){var r=e(this).data("draggable"),i=r.options,s=e.extend({},n,{item:r.element});r.sortables=[],e(i.connectToSortable).each(function(){var n=e.data(this,"sortable");n&&!n.options.disabled&&(r.sortables.push({instance:n,shouldRevert:n.options.revert}),n.refreshPositions(),n._trigger("activate",t,s))})},stop:function(t,n){var r=e(this).data("draggable"),i=e.extend({},n,{item:r.element});e.each(r.sortables,function(){this.instance.isOver?(this.instance.isOver=0,r.cancelHelperRemoval=!0,this.instance.cancelHelperRemoval=!1,this.shouldRevert&&(this.instance.options.revert=!0),this.instance._mouseStop(t),this.instance.options.helper=this.instance.options._helper,r.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})):(this.instance.cancelHelperRemoval=!1,this.instance._trigger("deactivate",t,i))})},drag:function(t,n){var r=e(this).data("draggable"),i=this,s=function(t){var n=this.offset.click.top,r=this.offset.click.left,i=this.positionAbs.top,s=this.positionAbs.left,o=t.height,u=t.width,a=t.top,f=t.left;return e.ui.isOver(i+n,s+r,a,f,o,u)};e.each(r.sortables,function(s){var o=!1,u=this;this.instance.positionAbs=r.positionAbs,this.instance.helperProportions=r.helperProportions,this.instance.offset.click=r.offset.click,this.instance._intersectsWith(this.instance.containerCache)&&(o=!0,e.each(r.sortables,function(){return this.instance.positionAbs=r.positionAbs,this.instance.helperProportions=r.helperProportions,this.instance.offset.click=r.offset.click,this!=u&&this.instance._intersectsWith(this.instance.containerCache)&&e.ui.contains(u.instance.element[0],this.instance.element[0])&&(o=!1),o})),o?(this.instance.isOver||(this.instance.isOver=1,this.instance.currentItem=e(i).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",!0),this.instance.options._helper=this.instance.options.helper,this.instance.options.helper=function(){return n.helper[0]},t.target=this.instance.currentItem[0],this.instance._mouseCapture(t,!0),this.instance._mouseStart(t,!0,!0),this.instance.offset.click.top=r.offset.click.top,this.instance.offset.click.left=r.offset.click.left,this.instance.offset.parent.left-=r.offset.parent.left-this.instance.offset.parent.left,this.instance.offset.parent.top-=r.offset.parent.top-this.instance.offset.parent.top,r._trigger("toSortable",t),r.dropped=this.instance.element,r.currentItem=r.element,this.instance.fromOutside=r),this.instance.currentItem&&this.instance._mouseDrag(t)):this.instance.isOver&&(this.instance.isOver=0,this.instance.cancelHelperRemoval=!0,this.instance.options.revert=!1,this.instance._trigger("out",t,this.instance._uiHash(this.instance)),this.instance._mouseStop(t,!0),this.instance.options.helper=this.instance.options._helper,this.instance.currentItem.remove(),this.instance.placeholder&&this.instance.placeholder.remove(),r._trigger("fromSortable",t),r.dropped=!1)})}}),e.ui.plugin.add("draggable","cursor",{start:function(t,n){var r=e("body"),i=e(this).data("draggable").options;r.css("cursor")&&(i._cursor=r.css("cursor")),r.css("cursor",i.cursor)},stop:function(t,n){var r=e(this).data("draggable").options;r._cursor&&e("body").css("cursor",r._cursor)}}),e.ui.plugin.add("draggable","opacity",{start:function(t,n){var r=e(n.helper),i=e(this).data("draggable").options;r.css("opacity")&&(i._opacity=r.css("opacity")),r.css("opacity",i.opacity)},stop:function(t,n){var r=e(this).data("draggable").options;r._opacity&&e(n.helper).css("opacity",r._opacity)}}),e.ui.plugin.add("draggable","scroll",{start:function(t,n){var r=e(this).data("draggable");r.scrollParent[0]!=document&&r.scrollParent[0].tagName!="HTML"&&(r.overflowOffset=r.scrollParent.offset())},drag:function(t,n){var r=e(this).data("draggable"),i=r.options,s=!1;if(r.scrollParent[0]!=document&&r.scrollParent[0].tagName!="HTML"){if(!i.axis||i.axis!="x")r.overflowOffset.top+r.scrollParent[0].offsetHeight-t.pageY<i.scrollSensitivity?r.scrollParent[0].scrollTop=s=r.scrollParent[0].scrollTop+i.scrollSpeed:t.pageY-r.overflowOffset.top<i.scrollSensitivity&&(r.scrollParent[0].scrollTop=s=r.scrollParent[0].scrollTop-i.scrollSpeed);if(!i.axis||i.axis!="y")r.overflowOffset.left+r.scrollParent[0].offsetWidth-t.pageX<i.scrollSensitivity?r.scrollParent[0].scrollLeft=s=r.scrollParent[0].scrollLeft+i.scrollSpeed:t.pageX-r.overflowOffset.left<i.scrollSensitivity&&(r.scrollParent[0].scrollLeft=s=r.scrollParent[0].scrollLeft-i.scrollSpeed)}else{if(!i.axis||i.axis!="x")t.pageY-e(document).scrollTop()<i.scrollSensitivity?s=e(document).scrollTop(e(document).scrollTop()-i.scrollSpeed):e(window).height()-(t.pageY-e(document).scrollTop())<i.scrollSensitivity&&(s=e(document).scrollTop(e(document).scrollTop()+i.scrollSpeed));if(!i.axis||i.axis!="y")t.pageX-e(document).scrollLeft()<i.scrollSensitivity?s=e(document).scrollLeft(e(document).scrollLeft()-i.scrollSpeed):e(window).width()-(t.pageX-e(document).scrollLeft())<i.scrollSensitivity&&(s=e(document).scrollLeft(e(document).scrollLeft()+i.scrollSpeed))}s!==!1&&e.ui.ddmanager&&!i.dropBehaviour&&e.ui.ddmanager.prepareOffsets(r,t)}}),e.ui.plugin.add("draggable","snap",{start:function(t,n){var r=e(this).data("draggable"),i=r.options;r.snapElements=[],e(i.snap.constructor!=String?i.snap.items||":data(draggable)":i.snap).each(function(){var t=e(this),n=t.offset();this!=r.element[0]&&r.snapElements.push({item:this,width:t.outerWidth(),height:t.outerHeight(),top:n.top,left:n.left})})},drag:function(t,n){var r=e(this).data("draggable"),i=r.options,s=i.snapTolerance,o=n.offset.left,u=o+r.helperProportions.width,a=n.offset.top,f=a+r.helperProportions.height;for(var l=r.snapElements.length-1;l>=0;l--){var c=r.snapElements[l].left,h=c+r.snapElements[l].width,p=r.snapElements[l].top,d=p+r.snapElements[l].height;if(!(c-s<o&&o<h+s&&p-s<a&&a<d+s||c-s<o&&o<h+s&&p-s<f&&f<d+s||c-s<u&&u<h+s&&p-s<a&&a<d+s||c-s<u&&u<h+s&&p-s<f&&f<d+s)){r.snapElements[l].snapping&&r.options.snap.release&&r.options.snap.release.call(r.element,t,e.extend(r._uiHash(),{snapItem:r.snapElements[l].item})),r.snapElements[l].snapping=!1;continue}if(i.snapMode!="inner"){var v=Math.abs(p-f)<=s,m=Math.abs(d-a)<=s,g=Math.abs(c-u)<=s,y=Math.abs(h-o)<=s;v&&(n.position.top=r._convertPositionTo("relative",{top:p-r.helperProportions.height,left:0}).top-r.margins.top),m&&(n.position.top=r._convertPositionTo("relative",{top:d,left:0}).top-r.margins.top),g&&(n.position.left=r._convertPositionTo("relative",{top:0,left:c-r.helperProportions.width}).left-r.margins.left),y&&(n.position.left=r._convertPositionTo("relative",{top:0,left:h}).left-r.margins.left)}var b=v||m||g||y;if(i.snapMode!="outer"){var v=Math.abs(p-a)<=s,m=Math.abs(d-f)<=s,g=Math.abs(c-o)<=s,y=Math.abs(h-u)<=s;v&&(n.position.top=r._convertPositionTo("relative",{top:p,left:0}).top-r.margins.top),m&&(n.position.top=r._convertPositionTo("relative",{top:d-r.helperProportions.height,left:0}).top-r.margins.top),g&&(n.position.left=r._convertPositionTo("relative",{top:0,left:c}).left-r.margins.left),y&&(n.position.left=r._convertPositionTo("relative",{top:0,left:h-r.helperProportions.width}).left-r.margins.left)}!r.snapElements[l].snapping&&(v||m||g||y||b)&&r.options.snap.snap&&r.options.snap.snap.call(r.element,t,e.extend(r._uiHash(),{snapItem:r.snapElements[l].item})),r.snapElements[l].snapping=v||m||g||y||b}}}),e.ui.plugin.add("draggable","stack",{start:function(t,n){var r=e(this).data("draggable").options,i=e.makeArray(e(r.stack)).sort(function(t,n){return(parseInt(e(t).css("zIndex"),10)||0)-(parseInt(e(n).css("zIndex"),10)||0)});if(!i.length)return;var s=parseInt(i[0].style.zIndex)||0;e(i).each(function(e){this.style.zIndex=s+e}),this[0].style.zIndex=s+i.length}}),e.ui.plugin.add("draggable","zIndex",{start:function(t,n){var r=e(n.helper),i=e(this).data("draggable").options;r.css("zIndex")&&(i._zIndex=r.css("zIndex")),r.css("zIndex",i.zIndex)},stop:function(t,n){var r=e(this).data("draggable").options;r._zIndex&&e(n.helper).css("zIndex",r._zIndex)}})})(jQuery);(function(e,t){e.widget("ui.droppable",{version:"1.9.1",widgetEventPrefix:"drop",options:{accept:"*",activeClass:!1,addClasses:!0,greedy:!1,hoverClass:!1,scope:"default",tolerance:"intersect"},_create:function(){var t=this.options,n=t.accept;this.isover=0,this.isout=1,this.accept=e.isFunction(n)?n:function(e){return e.is(n)},this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight},e.ui.ddmanager.droppables[t.scope]=e.ui.ddmanager.droppables[t.scope]||[],e.ui.ddmanager.droppables[t.scope].push(this),t.addClasses&&this.element.addClass("ui-droppable")},_destroy:function(){var t=e.ui.ddmanager.droppables[this.options.scope];for(var n=0;n<t.length;n++)t[n]==this&&t.splice(n,1);this.element.removeClass("ui-droppable ui-droppable-disabled")},_setOption:function(t,n){t=="accept"&&(this.accept=e.isFunction(n)?n:function(e){return e.is(n)}),e.Widget.prototype._setOption.apply(this,arguments)},_activate:function(t){var n=e.ui.ddmanager.current;this.options.activeClass&&this.element.addClass(this.options.activeClass),n&&this._trigger("activate",t,this.ui(n))},_deactivate:function(t){var n=e.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass),n&&this._trigger("deactivate",t,this.ui(n))},_over:function(t){var n=e.ui.ddmanager.current;if(!n||(n.currentItem||n.element)[0]==this.element[0])return;this.accept.call(this.element[0],n.currentItem||n.element)&&(this.options.hoverClass&&this.element.addClass(this.options.hoverClass),this._trigger("over",t,this.ui(n)))},_out:function(t){var n=e.ui.ddmanager.current;if(!n||(n.currentItem||n.element)[0]==this.element[0])return;this.accept.call(this.element[0],n.currentItem||n.element)&&(this.options.hoverClass&&this.element.removeClass(this.options.hoverClass),this._trigger("out",t,this.ui(n)))},_drop:function(t,n){var r=n||e.ui.ddmanager.current;if(!r||(r.currentItem||r.element)[0]==this.element[0])return!1;var i=!1;return this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var t=e.data(this,"droppable");if(t.options.greedy&&!t.options.disabled&&t.options.scope==r.options.scope&&t.accept.call(t.element[0],r.currentItem||r.element)&&e.ui.intersect(r,e.extend(t,{offset:t.element.offset()}),t.options.tolerance))return i=!0,!1}),i?!1:this.accept.call(this.element[0],r.currentItem||r.element)?(this.options.activeClass&&this.element.removeClass(this.options.activeClass),this.options.hoverClass&&this.element.removeClass(this.options.hoverClass),this._trigger("drop",t,this.ui(r)),this.element):!1},ui:function(e){return{draggable:e.currentItem||e.element,helper:e.helper,position:e.position,offset:e.positionAbs}}}),e.ui.intersect=function(t,n,r){if(!n.offset)return!1;var i=(t.positionAbs||t.position.absolute).left,s=i+t.helperProportions.width,o=(t.positionAbs||t.position.absolute).top,u=o+t.helperProportions.height,a=n.offset.left,f=a+n.proportions.width,l=n.offset.top,c=l+n.proportions.height;switch(r){case"fit":return a<=i&&s<=f&&l<=o&&u<=c;case"intersect":return a<i+t.helperProportions.width/2&&s-t.helperProportions.width/2<f&&l<o+t.helperProportions.height/2&&u-t.helperProportions.height/2<c;case"pointer":var h=(t.positionAbs||t.position.absolute).left+(t.clickOffset||t.offset.click).left,p=(t.positionAbs||t.position.absolute).top+(t.clickOffset||t.offset.click).top,d=e.ui.isOver(p,h,l,a,n.proportions.height,n.proportions.width);return d;case"touch":return(o>=l&&o<=c||u>=l&&u<=c||o<l&&u>c)&&(i>=a&&i<=f||s>=a&&s<=f||i<a&&s>f);default:return!1}},e.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(t,n){var r=e.ui.ddmanager.droppables[t.options.scope]||[],i=n?n.type:null,s=(t.currentItem||t.element).find(":data(droppable)").andSelf();e:for(var o=0;o<r.length;o++){if(r[o].options.disabled||t&&!r[o].accept.call(r[o].element[0],t.currentItem||t.element))continue;for(var u=0;u<s.length;u++)if(s[u]==r[o].element[0]){r[o].proportions.height=0;continue e}r[o].visible=r[o].element.css("display")!="none";if(!r[o].visible)continue;i=="mousedown"&&r[o]._activate.call(r[o],n),r[o].offset=r[o].element.offset(),r[o].proportions={width:r[o].element[0].offsetWidth,height:r[o].element[0].offsetHeight}}},drop:function(t,n){var r=!1;return e.each(e.ui.ddmanager.droppables[t.options.scope]||[],function(){if(!this.options)return;!this.options.disabled&&this.visible&&e.ui.intersect(t,this,this.options.tolerance)&&(r=this._drop.call(this,n)||r),!this.options.disabled&&this.visible&&this.accept.call(this.element[0],t.currentItem||t.element)&&(this.isout=1,this.isover=0,this._deactivate.call(this,n))}),r},dragStart:function(t,n){t.element.parentsUntil("body").bind("scroll.droppable",function(){t.options.refreshPositions||e.ui.ddmanager.prepareOffsets(t,n)})},drag:function(t,n){t.options.refreshPositions&&e.ui.ddmanager.prepareOffsets(t,n),e.each(e.ui.ddmanager.droppables[t.options.scope]||[],function(){if(this.options.disabled||this.greedyChild||!this.visible)return;var r=e.ui.intersect(t,this,this.options.tolerance),i=!r&&this.isover==1?"isout":r&&this.isover==0?"isover":null;if(!i)return;var s;if(this.options.greedy){var o=this.options.scope,u=this.element.parents(":data(droppable)").filter(function(){return e.data(this,"droppable").options.scope===o});u.length&&(s=e.data(u[0],"droppable"),s.greedyChild=i=="isover"?1:0)}s&&i=="isover"&&(s.isover=0,s.isout=1,s._out.call(s,n)),this[i]=1,this[i=="isout"?"isover":"isout"]=0,this[i=="isover"?"_over":"_out"].call(this,n),s&&i=="isout"&&(s.isout=0,s.isover=1,s._over.call(s,n))})},dragStop:function(t,n){t.element.parentsUntil("body").unbind("scroll.droppable"),t.options.refreshPositions||e.ui.ddmanager.prepareOffsets(t,n)}}})(jQuery);(function(e,t){e.widget("ui.resizable",e.ui.mouse,{version:"1.9.1",widgetEventPrefix:"resize",options:{alsoResize:!1,animate:!1,animateDuration:"slow",animateEasing:"swing",aspectRatio:!1,autoHide:!1,containment:!1,ghost:!1,grid:!1,handles:"e,s,se",helper:!1,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1e3},_create:function(){var t=this,n=this.options;this.element.addClass("ui-resizable"),e.extend(this,{_aspectRatio:!!n.aspectRatio,aspectRatio:n.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:n.helper||n.ghost||n.animate?n.helper||"ui-resizable-helper":null}),this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)&&(this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=n.handles||(e(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var r=this.handles.split(",");this.handles={};for(var i=0;i<r.length;i++){var s=e.trim(r[i]),o="ui-resizable-"+s,u=e('<div class="ui-resizable-handle '+o+'"></div>');u.css({zIndex:n.zIndex}),"se"==s&&u.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[s]=".ui-resizable-"+s,this.element.append(u)}}this._renderAxis=function(t){t=t||this.element;for(var n in this.handles){this.handles[n].constructor==String&&(this.handles[n]=e(this.handles[n],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var r=e(this.handles[n],this.element),i=0;i=/sw|ne|nw|se|n|s/.test(n)?r.outerHeight():r.outerWidth();var s=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");t.css(s,i),this._proportionallyResize()}if(!e(this.handles[n]).length)continue}},this._renderAxis(this.element),this._handles=e(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!t.resizing){if(this.className)var e=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);t.axis=e&&e[1]?e[1]:"se"}}),n.autoHide&&(this._handles.hide(),e(this.element).addClass("ui-resizable-autohide").mouseenter(function(){if(n.disabled)return;e(this).removeClass("ui-resizable-autohide"),t._handles.show()}).mouseleave(function(){if(n.disabled)return;t.resizing||(e(this).addClass("ui-resizable-autohide"),t._handles.hide())})),this._mouseInit()},_destroy:function(){this._mouseDestroy();var t=function(t){e(t).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){t(this.element);var n=this.element;this.originalElement.css({position:n.css("position"),width:n.outerWidth(),height:n.outerHeight(),top:n.css("top"),left:n.css("left")}).insertAfter(n),n.remove()}return this.originalElement.css("resize",this.originalResizeStyle),t(this.originalElement),this},_mouseCapture:function(t){var n=!1;for(var r in this.handles)e(this.handles[r])[0]==t.target&&(n=!0);return!this.options.disabled&&n},_mouseStart:function(t){var r=this.options,i=this.element.position(),s=this.element;this.resizing=!0,this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()},(s.is(".ui-draggable")||/absolute/.test(s.css("position")))&&s.css({position:"absolute",top:i.top,left:i.left}),this._renderProxy();var o=n(this.helper.css("left")),u=n(this.helper.css("top"));r.containment&&(o+=e(r.containment).scrollLeft()||0,u+=e(r.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:o,top:u},this.size=this._helper?{width:s.outerWidth(),height:s.outerHeight()}:{width:s.width(),height:s.height()},this.originalSize=this._helper?{width:s.outerWidth(),height:s.outerHeight()}:{width:s.width(),height:s.height()},this.originalPosition={left:o,top:u},this.sizeDiff={width:s.outerWidth()-s.width(),height:s.outerHeight()-s.height()},this.originalMousePosition={left:t.pageX,top:t.pageY},this.aspectRatio=typeof r.aspectRatio=="number"?r.aspectRatio:this.originalSize.width/this.originalSize.height||1;var a=e(".ui-resizable-"+this.axis).css("cursor");return e("body").css("cursor",a=="auto"?this.axis+"-resize":a),s.addClass("ui-resizable-resizing"),this._propagate("start",t),!0},_mouseDrag:function(e){var t=this.helper,n=this.options,r={},i=this,s=this.originalMousePosition,o=this.axis,u=e.pageX-s.left||0,a=e.pageY-s.top||0,f=this._change[o];if(!f)return!1;var l=f.apply(this,[e,u,a]);this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey)l=this._updateRatio(l,e);return l=this._respectSize(l,e),this._propagate("resize",e),t.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",e,this.ui()),!1},_mouseStop:function(t){this.resizing=!1;var n=this.options,r=this;if(this._helper){var i=this._proportionallyResizeElements,s=i.length&&/textarea/i.test(i[0].nodeName),o=s&&e.ui.hasScroll(i[0],"left")?0:r.sizeDiff.height,u=s?0:r.sizeDiff.width,a={width:r.helper.width()-u,height:r.helper.height()-o},f=parseInt(r.element.css("left"),10)+(r.position.left-r.originalPosition.left)||null,l=parseInt(r.element.css("top"),10)+(r.position.top-r.originalPosition.top)||null;n.animate||this.element.css(e.extend(a,{top:l,left:f})),r.helper.height(r.size.height),r.helper.width(r.size.width),this._helper&&!n.animate&&this._proportionallyResize()}return e("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",t),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(e){var t=this.options,n,i,s,o,u;u={minWidth:r(t.minWidth)?t.minWidth:0,maxWidth:r(t.maxWidth)?t.maxWidth:Infinity,minHeight:r(t.minHeight)?t.minHeight:0,maxHeight:r(t.maxHeight)?t.maxHeight:Infinity};if(this._aspectRatio||e)n=u.minHeight*this.aspectRatio,s=u.minWidth/this.aspectRatio,i=u.maxHeight*this.aspectRatio,o=u.maxWidth/this.aspectRatio,n>u.minWidth&&(u.minWidth=n),s>u.minHeight&&(u.minHeight=s),i<u.maxWidth&&(u.maxWidth=i),o<u.maxHeight&&(u.maxHeight=o);this._vBoundaries=u},_updateCache:function(e){var t=this.options;this.offset=this.helper.offset(),r(e.left)&&(this.position.left=e.left),r(e.top)&&(this.position.top=e.top),r(e.height)&&(this.size.height=e.height),r(e.width)&&(this.size.width=e.width)},_updateRatio:function(e,t){var n=this.options,i=this.position,s=this.size,o=this.axis;return r(e.height)?e.width=e.height*this.aspectRatio:r(e.width)&&(e.height=e.width/this.aspectRatio),o=="sw"&&(e.left=i.left+(s.width-e.width),e.top=null),o=="nw"&&(e.top=i.top+(s.height-e.height),e.left=i.left+(s.width-e.width)),e},_respectSize:function(e,t){var n=this.helper,i=this._vBoundaries,s=this._aspectRatio||t.shiftKey,o=this.axis,u=r(e.width)&&i.maxWidth&&i.maxWidth<e.width,a=r(e.height)&&i.maxHeight&&i.maxHeight<e.height,f=r(e.width)&&i.minWidth&&i.minWidth>e.width,l=r(e.height)&&i.minHeight&&i.minHeight>e.height;f&&(e.width=i.minWidth),l&&(e.height=i.minHeight),u&&(e.width=i.maxWidth),a&&(e.height=i.maxHeight);var c=this.originalPosition.left+this.originalSize.width,h=this.position.top+this.size.height,p=/sw|nw|w/.test(o),d=/nw|ne|n/.test(o);f&&p&&(e.left=c-i.minWidth),u&&p&&(e.left=c-i.maxWidth),l&&d&&(e.top=h-i.minHeight),a&&d&&(e.top=h-i.maxHeight);var v=!e.width&&!e.height;return v&&!e.left&&e.top?e.top=null:v&&!e.top&&e.left&&(e.left=null),e},_proportionallyResize:function(){var t=this.options;if(!this._proportionallyResizeElements.length)return;var n=this.helper||this.element;for(var r=0;r<this._proportionallyResizeElements.length;r++){var i=this._proportionallyResizeElements[r];if(!this.borderDif){var s=[i.css("borderTopWidth"),i.css("borderRightWidth"),i.css("borderBottomWidth"),i.css("borderLeftWidth")],o=[i.css("paddingTop"),i.css("paddingRight"),i.css("paddingBottom"),i.css("paddingLeft")];this.borderDif=e.map(s,function(e,t){var n=parseInt(e,10)||0,r=parseInt(o[t],10)||0;return n+r})}i.css({height:n.height()-this.borderDif[0]-this.borderDif[2]||0,width:n.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var t=this.element,n=this.options;this.elementOffset=t.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var r=e.ui.ie6?1:0,i=e.ui.ie6?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+i,height:this.element.outerHeight()+i,position:"absolute",left:this.elementOffset.left-r+"px",top:this.elementOffset.top-r+"px",zIndex:++n.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(e,t,n){return{width:this.originalSize.width+t}},w:function(e,t,n){var r=this.options,i=this.originalSize,s=this.originalPosition;return{left:s.left+t,width:i.width-t}},n:function(e,t,n){var r=this.options,i=this.originalSize,s=this.originalPosition;return{top:s.top+n,height:i.height-n}},s:function(e,t,n){return{height:this.originalSize.height+n}},se:function(t,n,r){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[t,n,r]))},sw:function(t,n,r){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[t,n,r]))},ne:function(t,n,r){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[t,n,r]))},nw:function(t,n,r){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[t,n,r]))}},_propagate:function(t,n){e.ui.plugin.call(this,t,[n,this.ui()]),t!="resize"&&this._trigger(t,n,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),e.ui.plugin.add("resizable","alsoResize",{start:function(t,n){var r=e(this).data("resizable"),i=r.options,s=function(t){e(t).each(function(){var t=e(this);t.data("resizable-alsoresize",{width:parseInt(t.width(),10),height:parseInt(t.height(),10),left:parseInt(t.css("left"),10),top:parseInt(t.css("top"),10)})})};typeof i.alsoResize=="object"&&!i.alsoResize.parentNode?i.alsoResize.length?(i.alsoResize=i.alsoResize[0],s(i.alsoResize)):e.each(i.alsoResize,function(e){s(e)}):s(i.alsoResize)},resize:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.originalSize,o=r.originalPosition,u={height:r.size.height-s.height||0,width:r.size.width-s.width||0,top:r.position.top-o.top||0,left:r.position.left-o.left||0},a=function(t,r){e(t).each(function(){var t=e(this),i=e(this).data("resizable-alsoresize"),s={},o=r&&r.length?r:t.parents(n.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(o,function(e,t){var n=(i[t]||0)+(u[t]||0);n&&n>=0&&(s[t]=n||null)}),t.css(s)})};typeof i.alsoResize=="object"&&!i.alsoResize.nodeType?e.each(i.alsoResize,function(e,t){a(e,t)}):a(i.alsoResize)},stop:function(t,n){e(this).removeData("resizable-alsoresize")}}),e.ui.plugin.add("resizable","animate",{stop:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r._proportionallyResizeElements,o=s.length&&/textarea/i.test(s[0].nodeName),u=o&&e.ui.hasScroll(s[0],"left")?0:r.sizeDiff.height,a=o?0:r.sizeDiff.width,f={width:r.size.width-a,height:r.size.height-u},l=parseInt(r.element.css("left"),10)+(r.position.left-r.originalPosition.left)||null,c=parseInt(r.element.css("top"),10)+(r.position.top-r.originalPosition.top)||null;r.element.animate(e.extend(f,c&&l?{top:c,left:l}:{}),{duration:i.animateDuration,easing:i.animateEasing,step:function(){var n={width:parseInt(r.element.css("width"),10),height:parseInt(r.element.css("height"),10),top:parseInt(r.element.css("top"),10),left:parseInt(r.element.css("left"),10)};s&&s.length&&e(s[0]).css({width:n.width,height:n.height}),r._updateCache(n),r._propagate("resize",t)}})}}),e.ui.plugin.add("resizable","containment",{start:function(t,r){var i=e(this).data("resizable"),s=i.options,o=i.element,u=s.containment,a=u instanceof e?u.get(0):/parent/.test(u)?o.parent().get(0):u;if(!a)return;i.containerElement=e(a);if(/document/.test(u)||u==document)i.containerOffset={left:0,top:0},i.containerPosition={left:0,top:0},i.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight};else{var f=e(a),l=[];e(["Top","Right","Left","Bottom"]).each(function(e,t){l[e]=n(f.css("padding"+t))}),i.containerOffset=f.offset(),i.containerPosition=f.position(),i.containerSize={height:f.innerHeight()-l[3],width:f.innerWidth()-l[1]};var c=i.containerOffset,h=i.containerSize.height,p=i.containerSize.width,d=e.ui.hasScroll(a,"left")?a.scrollWidth:p,v=e.ui.hasScroll(a)?a.scrollHeight:h;i.parentData={element:a,left:c.left,top:c.top,width:d,height:v}}},resize:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.containerSize,o=r.containerOffset,u=r.size,a=r.position,f=r._aspectRatio||t.shiftKey,l={top:0,left:0},c=r.containerElement;c[0]!=document&&/static/.test(c.css("position"))&&(l=o),a.left<(r._helper?o.left:0)&&(r.size.width=r.size.width+(r._helper?r.position.left-o.left:r.position.left-l.left),f&&(r.size.height=r.size.width/r.aspectRatio),r.position.left=i.helper?o.left:0),a.top<(r._helper?o.top:0)&&(r.size.height=r.size.height+(r._helper?r.position.top-o.top:r.position.top),f&&(r.size.width=r.size.height*r.aspectRatio),r.position.top=r._helper?o.top:0),r.offset.left=r.parentData.left+r.position.left,r.offset.top=r.parentData.top+r.position.top;var h=Math.abs((r._helper?r.offset.left-l.left:r.offset.left-l.left)+r.sizeDiff.width),p=Math.abs((r._helper?r.offset.top-l.top:r.offset.top-o.top)+r.sizeDiff.height),d=r.containerElement.get(0)==r.element.parent().get(0),v=/relative|absolute/.test(r.containerElement.css("position"));d&&v&&(h-=r.parentData.left),h+r.size.width>=r.parentData.width&&(r.size.width=r.parentData.width-h,f&&(r.size.height=r.size.width/r.aspectRatio)),p+r.size.height>=r.parentData.height&&(r.size.height=r.parentData.height-p,f&&(r.size.width=r.size.height*r.aspectRatio))},stop:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.position,o=r.containerOffset,u=r.containerPosition,a=r.containerElement,f=e(r.helper),l=f.offset(),c=f.outerWidth()-r.sizeDiff.width,h=f.outerHeight()-r.sizeDiff.height;r._helper&&!i.animate&&/relative/.test(a.css("position"))&&e(this).css({left:l.left-u.left-o.left,width:c,height:h}),r._helper&&!i.animate&&/static/.test(a.css("position"))&&e(this).css({left:l.left-u.left-o.left,width:c,height:h})}}),e.ui.plugin.add("resizable","ghost",{start:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.size;r.ghost=r.originalElement.clone(),r.ghost.css({opacity:.25,display:"block",position:"relative",height:s.height,width:s.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:""),r.ghost.appendTo(r.helper)},resize:function(t,n){var r=e(this).data("resizable"),i=r.options;r.ghost&&r.ghost.css({position:"relative",height:r.size.height,width:r.size.width})},stop:function(t,n){var r=e(this).data("resizable"),i=r.options;r.ghost&&r.helper&&r.helper.get(0).removeChild(r.ghost.get(0))}}),e.ui.plugin.add("resizable","grid",{resize:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.size,o=r.originalSize,u=r.originalPosition,a=r.axis,f=i._aspectRatio||t.shiftKey;i.grid=typeof i.grid=="number"?[i.grid,i.grid]:i.grid;var l=Math.round((s.width-o.width)/(i.grid[0]||1))*(i.grid[0]||1),c=Math.round((s.height-o.height)/(i.grid[1]||1))*(i.grid[1]||1);/^(se|s|e)$/.test(a)?(r.size.width=o.width+l,r.size.height=o.height+c):/^(ne)$/.test(a)?(r.size.width=o.width+l,r.size.height=o.height+c,r.position.top=u.top-c):/^(sw)$/.test(a)?(r.size.width=o.width+l,r.size.height=o.height+c,r.position.left=u.left-l):(r.size.width=o.width+l,r.size.height=o.height+c,r.position.top=u.top-c,r.position.left=u.left-l)}});var n=function(e){return parseInt(e,10)||0},r=function(e){return!isNaN(parseInt(e,10))}})(jQuery);(function(e,t){e.widget("ui.selectable",e.ui.mouse,{version:"1.9.1",options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var t=this;this.element.addClass("ui-selectable"),this.dragged=!1;var n;this.refresh=function(){n=e(t.options.filter,t.element[0]),n.addClass("ui-selectee"),n.each(function(){var t=e(this),n=t.offset();e.data(this,"selectable-item",{element:this,$element:t,left:n.left,top:n.top,right:n.left+t.outerWidth(),bottom:n.top+t.outerHeight(),startselected:!1,selected:t.hasClass("ui-selected"),selecting:t.hasClass("ui-selecting"),unselecting:t.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=n.addClass("ui-selectee"),this._mouseInit(),this.helper=e("<div class='ui-selectable-helper'></div>")},_destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled"),this._mouseDestroy()},_mouseStart:function(t){var n=this;this.opos=[t.pageX,t.pageY];if(this.options.disabled)return;var r=this.options;this.selectees=e(r.filter,this.element[0]),this._trigger("start",t),e(r.appendTo).append(this.helper),this.helper.css({left:t.clientX,top:t.clientY,width:0,height:0}),r.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var r=e.data(this,"selectable-item");r.startselected=!0,!t.metaKey&&!t.ctrlKey&&(r.$element.removeClass("ui-selected"),r.selected=!1,r.$element.addClass("ui-unselecting"),r.unselecting=!0,n._trigger("unselecting",t,{unselecting:r.element}))}),e(t.target).parents().andSelf().each(function(){var r=e.data(this,"selectable-item");if(r){var i=!t.metaKey&&!t.ctrlKey||!r.$element.hasClass("ui-selected");return r.$element.removeClass(i?"ui-unselecting":"ui-selected").addClass(i?"ui-selecting":"ui-unselecting"),r.unselecting=!i,r.selecting=i,r.selected=i,i?n._trigger("selecting",t,{selecting:r.element}):n._trigger("unselecting",t,{unselecting:r.element}),!1}})},_mouseDrag:function(t){var n=this;this.dragged=!0;if(this.options.disabled)return;var r=this.options,i=this.opos[0],s=this.opos[1],o=t.pageX,u=t.pageY;if(i>o){var a=o;o=i,i=a}if(s>u){var a=u;u=s,s=a}return this.helper.css({left:i,top:s,width:o-i,height:u-s}),this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!a||a.element==n.element[0])return;var f=!1;r.tolerance=="touch"?f=!(a.left>o||a.right<i||a.top>u||a.bottom<s):r.tolerance=="fit"&&(f=a.left>i&&a.right<o&&a.top>s&&a.bottom<u),f?(a.selected&&(a.$element.removeClass("ui-selected"),a.selected=!1),a.unselecting&&(a.$element.removeClass("ui-unselecting"),a.unselecting=!1),a.selecting||(a.$element.addClass("ui-selecting"),a.selecting=!0,n._trigger("selecting",t,{selecting:a.element}))):(a.selecting&&((t.metaKey||t.ctrlKey)&&a.startselected?(a.$element.removeClass("ui-selecting"),a.selecting=!1,a.$element.addClass("ui-selected"),a.selected=!0):(a.$element.removeClass("ui-selecting"),a.selecting=!1,a.startselected&&(a.$element.addClass("ui-unselecting"),a.unselecting=!0),n._trigger("unselecting",t,{unselecting:a.element}))),a.selected&&!t.metaKey&&!t.ctrlKey&&!a.startselected&&(a.$element.removeClass("ui-selected"),a.selected=!1,a.$element.addClass("ui-unselecting"),a.unselecting=!0,n._trigger("unselecting",t,{unselecting:a.element})))}),!1},_mouseStop:function(t){var n=this;this.dragged=!1;var r=this.options;return e(".ui-unselecting",this.element[0]).each(function(){var r=e.data(this,"selectable-item");r.$element.removeClass("ui-unselecting"),r.unselecting=!1,r.startselected=!1,n._trigger("unselected",t,{unselected:r.element})}),e(".ui-selecting",this.element[0]).each(function(){var r=e.data(this,"selectable-item");r.$element.removeClass("ui-selecting").addClass("ui-selected"),r.selecting=!1,r.selected=!0,r.startselected=!0,n._trigger("selected",t,{selected:r.element})}),this._trigger("stop",t),this.helper.remove(),!1}})})(jQuery);(function(e,t){e.widget("ui.sortable",e.ui.mouse,{version:"1.9.1",widgetEventPrefix:"sort",ready:!1,options:{appendTo:"parent",axis:!1,connectWith:!1,containment:!1,cursor:"auto",cursorAt:!1,dropOnEmpty:!0,forcePlaceholderSize:!1,forceHelperSize:!1,grid:!1,handle:!1,helper:"original",items:"> *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var e=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?e.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},_destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var e=this.items.length-1;e>=0;e--)this.items[e].item.removeData(this.widgetName+"-item");return this},_setOption:function(t,n){t==="disabled"?(this.options[t]=n,this.widget().toggleClass("ui-sortable-disabled",!!n)):e.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(t,n){var r=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(t);var i=null,s=e(t.target).parents().each(function(){if(e.data(this,r.widgetName+"-item")==r)return i=e(this),!1});e.data(t.target,r.widgetName+"-item")==r&&(i=e(t.target));if(!i)return!1;if(this.options.handle&&!n){var o=!1;e(this.options.handle,i).find("*").andSelf().each(function(){this==t.target&&(o=!0)});if(!o)return!1}return this.currentItem=i,this._removeCurrentsFromItems(),!0},_mouseStart:function(t,n,r){var i=this.options;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(t),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},e.extend(this.offset,{click:{left:t.pageX-this.offset.left,top:t.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(t),this.originalPageX=t.pageX,this.originalPageY=t.pageY,i.cursorAt&&this._adjustOffsetFromHelper(i.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),i.containment&&this._setContainment(),i.cursor&&(e("body").css("cursor")&&(this._storedCursor=e("body").css("cursor")),e("body").css("cursor",i.cursor)),i.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",i.opacity)),i.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",i.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",t,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!r)for(var s=this.containers.length-1;s>=0;s--)this.containers[s]._trigger("activate",t,this._uiHash(this));return e.ui.ddmanager&&(e.ui.ddmanager.current=this),e.ui.ddmanager&&!i.dropBehaviour&&e.ui.ddmanager.prepareOffsets(this,t),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(t),!0},_mouseDrag:function(t){this.position=this._generatePosition(t),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var n=this.options,r=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-t.pageY<n.scrollSensitivity?this.scrollParent[0].scrollTop=r=this.scrollParent[0].scrollTop+n.scrollSpeed:t.pageY-this.overflowOffset.top<n.scrollSensitivity&&(this.scrollParent[0].scrollTop=r=this.scrollParent[0].scrollTop-n.scrollSpeed),this.overflowOffset.left+this.scrollParent[0].offsetWidth-t.pageX<n.scrollSensitivity?this.scrollParent[0].scrollLeft=r=this.scrollParent[0].scrollLeft+n.scrollSpeed:t.pageX-this.overflowOffset.left<n.scrollSensitivity&&(this.scrollParent[0].scrollLeft=r=this.scrollParent[0].scrollLeft-n.scrollSpeed)):(t.pageY-e(document).scrollTop()<n.scrollSensitivity?r=e(document).scrollTop(e(document).scrollTop()-n.scrollSpeed):e(window).height()-(t.pageY-e(document).scrollTop())<n.scrollSensitivity&&(r=e(document).scrollTop(e(document).scrollTop()+n.scrollSpeed)),t.pageX-e(document).scrollLeft()<n.scrollSensitivity?r=e(document).scrollLeft(e(document).scrollLeft()-n.scrollSpeed):e(window).width()-(t.pageX-e(document).scrollLeft())<n.scrollSensitivity&&(r=e(document).scrollLeft(e(document).scrollLeft()+n.scrollSpeed))),r!==!1&&e.ui.ddmanager&&!n.dropBehaviour&&e.ui.ddmanager.prepareOffsets(this,t)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(var i=this.items.length-1;i>=0;i--){var s=this.items[i],o=s.item[0],u=this._intersectsWithPointer(s);if(!u)continue;if(s.instance!==this.currentContainer)continue;if(o!=this.currentItem[0]&&this.placeholder[u==1?"next":"prev"]()[0]!=o&&!e.contains(this.placeholder[0],o)&&(this.options.type=="semi-dynamic"?!e.contains(this.element[0],o):!0)){this.direction=u==1?"down":"up";if(this.options.tolerance!="pointer"&&!this._intersectsWithSides(s))break;this._rearrange(t,s),this._trigger("change",t,this._uiHash());break}}return this._contactContainers(t),e.ui.ddmanager&&e.ui.ddmanager.drag(this,t),this._trigger("sort",t,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(t,n){if(!t)return;e.ui.ddmanager&&!this.options.dropBehaviour&&e.ui.ddmanager.drop(this,t);if(this.options.revert){var r=this,i=this.placeholder.offset();this.reverting=!0,e(this.helper).animate({left:i.left-this.offset.parent.left-this.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:i.top-this.offset.parent.top-this.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){r._clear(t)})}else this._clear(t,n);return!1},cancel:function(){if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var t=this.containers.length-1;t>=0;t--)this.containers[t]._trigger("deactivate",null,this._uiHash(this)),this.containers[t].containerCache.over&&(this.containers[t]._trigger("out",null,this._uiHash(this)),this.containers[t].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),e.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?e(this.domPosition.prev).after(this.currentItem):e(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(t){var n=this._getItemsAsjQuery(t&&t.connected),r=[];return t=t||{},e(n).each(function(){var n=(e(t.item||this).attr(t.attribute||"id")||"").match(t.expression||/(.+)[-=_](.+)/);n&&r.push((t.key||n[1]+"[]")+"="+(t.key&&t.expression?n[1]:n[2]))}),!r.length&&t.key&&r.push(t.key+"="),r.join("&")},toArray:function(t){var n=this._getItemsAsjQuery(t&&t.connected),r=[];return t=t||{},n.each(function(){r.push(e(t.item||this).attr(t.attribute||"id")||"")}),r},_intersectsWith:function(e){var t=this.positionAbs.left,n=t+this.helperProportions.width,r=this.positionAbs.top,i=r+this.helperProportions.height,s=e.left,o=s+e.width,u=e.top,a=u+e.height,f=this.offset.click.top,l=this.offset.click.left,c=r+f>u&&r+f<a&&t+l>s&&t+l<o;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>e[this.floating?"width":"height"]?c:s<t+this.helperProportions.width/2&&n-this.helperProportions.width/2<o&&u<r+this.helperProportions.height/2&&i-this.helperProportions.height/2<a},_intersectsWithPointer:function(t){var n=this.options.axis==="x"||e.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,t.top,t.height),r=this.options.axis==="y"||e.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,t.left,t.width),i=n&&r,s=this._getDragVerticalDirection(),o=this._getDragHorizontalDirection();return i?this.floating?o&&o=="right"||s=="down"?2:1:s&&(s=="down"?2:1):!1},_intersectsWithSides:function(t){var n=e.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,t.top+t.height/2,t.height),r=e.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,t.left+t.width/2,t.width),i=this._getDragVerticalDirection(),s=this._getDragHorizontalDirection();return this.floating&&s?s=="right"&&r||s=="left"&&!r:i&&(i=="down"&&n||i=="up"&&!n)},_getDragVerticalDirection:function(){var e=this.positionAbs.top-this.lastPositionAbs.top;return e!=0&&(e>0?"down":"up")},_getDragHorizontalDirection:function(){var e=this.positionAbs.left-this.lastPositionAbs.left;return e!=0&&(e>0?"right":"left")},refresh:function(e){return this._refreshItems(e),this.refreshPositions(),this},_connectWith:function(){var e=this.options;return e.connectWith.constructor==String?[e.connectWith]:e.connectWith},_getItemsAsjQuery:function(t){var n=[],r=[],i=this._connectWith();if(i&&t)for(var s=i.length-1;s>=0;s--){var o=e(i[s]);for(var u=o.length-1;u>=0;u--){var a=e.data(o[u],this.widgetName);a&&a!=this&&!a.options.disabled&&r.push([e.isFunction(a.options.items)?a.options.items.call(a.element):e(a.options.items,a.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),a])}}r.push([e.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):e(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var s=r.length-1;s>=0;s--)r[s][0].each(function(){n.push(this)});return e(n)},_removeCurrentsFromItems:function(){var t=this.currentItem.find(":data("+this.widgetName+"-item)");this.items=e.grep(this.items,function(e){for(var n=0;n<t.length;n++)if(t[n]==e.item[0])return!1;return!0})},_refreshItems:function(t){this.items=[],this.containers=[this];var n=this.items,r=[[e.isFunction(this.options.items)?this.options.items.call(this.element[0],t,{item:this.currentItem}):e(this.options.items,this.element),this]],i=this._connectWith();if(i&&this.ready)for(var s=i.length-1;s>=0;s--){var o=e(i[s]);for(var u=o.length-1;u>=0;u--){var a=e.data(o[u],this.widgetName);a&&a!=this&&!a.options.disabled&&(r.push([e.isFunction(a.options.items)?a.options.items.call(a.element[0],t,{item:this.currentItem}):e(a.options.items,a.element),a]),this.containers.push(a))}}for(var s=r.length-1;s>=0;s--){var f=r[s][1],l=r[s][0];for(var u=0,c=l.length;u<c;u++){var h=e(l[u]);h.data(this.widgetName+"-item",f),n.push({item:h,instance:f,width:0,height:0,left:0,top:0})}}},refreshPositions:function(t){this.offsetParent&&this.helper&&(this.offset.parent=this._getParentOffset());for(var n=this.items.length-1;n>=0;n--){var r=this.items[n];if(r.instance!=this.currentContainer&&this.currentContainer&&r.item[0]!=this.currentItem[0])continue;var i=this.options.toleranceElement?e(this.options.toleranceElement,r.item):r.item;t||(r.width=i.outerWidth(),r.height=i.outerHeight());var s=i.offset();r.left=s.left,r.top=s.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var n=this.containers.length-1;n>=0;n--){var s=this.containers[n].element.offset();this.containers[n].containerCache.left=s.left,this.containers[n].containerCache.top=s.top,this.containers[n].containerCache.width=this.containers[n].element.outerWidth(),this.containers[n].containerCache.height=this.containers[n].element.outerHeight()}return this},_createPlaceholder:function(t){t=t||this;var n=t.options;if(!n.placeholder||n.placeholder.constructor==String){var r=n.placeholder;n.placeholder={element:function(){var n=e(document.createElement(t.currentItem[0].nodeName)).addClass(r||t.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return r||(n.style.visibility="hidden"),n},update:function(e,i){if(r&&!n.forcePlaceholderSize)return;i.height()||i.height(t.currentItem.innerHeight()-parseInt(t.currentItem.css("paddingTop")||0,10)-parseInt(t.currentItem.css("paddingBottom")||0,10)),i.width()||i.width(t.currentItem.innerWidth()-parseInt(t.currentItem.css("paddingLeft")||0,10)-parseInt(t.currentItem.css("paddingRight")||0,10))}}}t.placeholder=e(n.placeholder.element.call(t.element,t.currentItem)),t.currentItem.after(t.placeholder),n.placeholder.update(t,t.placeholder)},_contactContainers:function(t){var n=null,r=null;for(var i=this.containers.length-1;i>=0;i--){if(e.contains(this.currentItem[0],this.containers[i].element[0]))continue;if(this._intersectsWith(this.containers[i].containerCache)){if(n&&e.contains(this.containers[i].element[0],n.element[0]))continue;n=this.containers[i],r=i}else this.containers[i].containerCache.over&&(this.containers[i]._trigger("out",t,this._uiHash(this)),this.containers[i].containerCache.over=0)}if(!n)return;if(this.containers.length===1)this.containers[r]._trigger("over",t,this._uiHash(this)),this.containers[r].containerCache.over=1;else{var s=1e4,o=null,u=this.containers[r].floating?"left":"top",a=this.containers[r].floating?"width":"height",f=this.positionAbs[u]+this.offset.click[u];for(var l=this.items.length-1;l>=0;l--){if(!e.contains(this.containers[r].element[0],this.items[l].item[0]))continue;if(this.items[l].item[0]==this.currentItem[0])continue;var c=this.items[l].item.offset()[u],h=!1;Math.abs(c-f)>Math.abs(c+this.items[l][a]-f)&&(h=!0,c+=this.items[l][a]),Math.abs(c-f)<s&&(s=Math.abs(c-f),o=this.items[l],this.direction=h?"up":"down")}if(!o&&!this.options.dropOnEmpty)return;this.currentContainer=this.containers[r],o?this._rearrange(t,o,null,!0):this._rearrange(t,null,this.containers[r].element,!0),this._trigger("change",t,this._uiHash()),this.containers[r]._trigger("change",t,this._uiHash(this)),this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[r]._trigger("over",t,this._uiHash(this)),this.containers[r].containerCache.over=1}},_createHelper:function(t){var n=this.options,r=e.isFunction(n.helper)?e(n.helper.apply(this.element[0],[t,this.currentItem])):n.helper=="clone"?this.currentItem.clone():this.currentItem;return r.parents("body").length||e(n.appendTo!="parent"?n.appendTo:this.currentItem[0].parentNode)[0].appendChild(r[0]),r[0]==this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),(r[0].style.width==""||n.forceHelperSize)&&r.width(this.currentItem.width()),(r[0].style.height==""||n.forceHelperSize)&&r.height(this.currentItem.height()),r},_adjustOffsetFromHelper:function(t){typeof t=="string"&&(t=t.split(" ")),e.isArray(t)&&(t={left:+t[0],top:+t[1]||0}),"left"in t&&(this.offset.click.left=t.left+this.margins.left),"right"in t&&(this.offset.click.left=this.helperProportions.width-t.right+this.margins.left),"top"in t&&(this.offset.click.top=t.top+this.margins.top),"bottom"in t&&(this.offset.click.top=this.helperProportions.height-t.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var t=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&e.contains(this.scrollParent[0],this.offsetParent[0])&&(t.left+=this.scrollParent.scrollLeft(),t.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&e.ui.ie)t={top:0,left:0};return{top:t.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:t.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var e=this.currentItem.position();return{top:e.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:e.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var t=this.options;t.containment=="parent"&&(t.containment=this.helper[0].parentNode);if(t.containment=="document"||t.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,e(t.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(e(t.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(t.containment)){var n=e(t.containment)[0],r=e(t.containment).offset(),i=e(n).css("overflow")!="hidden";this.containment=[r.left+(parseInt(e(n).css("borderLeftWidth"),10)||0)+(parseInt(e(n).css("paddingLeft"),10)||0)-this.margins.left,r.top+(parseInt(e(n).css("borderTopWidth"),10)||0)+(parseInt(e(n).css("paddingTop"),10)||0)-this.margins.top,r.left+(i?Math.max(n.scrollWidth,n.offsetWidth):n.offsetWidth)-(parseInt(e(n).css("borderLeftWidth"),10)||0)-(parseInt(e(n).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,r.top+(i?Math.max(n.scrollHeight,n.offsetHeight):n.offsetHeight)-(parseInt(e(n).css("borderTopWidth"),10)||0)-(parseInt(e(n).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(t,n){n||(n=this.position);var r=t=="absolute"?1:-1,i=this.options,s=this.cssPosition!="absolute"||this.scrollParent[0]!=document&&!!e.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,o=/(html|body)/i.test(s[0].tagName);return{top:n.top+this.offset.relative.top*r+this.offset.parent.top*r-(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():o?0:s.scrollTop())*r,left:n.left+this.offset.relative.left*r+this.offset.parent.left*r-(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():o?0:s.scrollLeft())*r}},_generatePosition:function(t){var n=this.options,r=this.cssPosition!="absolute"||this.scrollParent[0]!=document&&!!e.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,i=/(html|body)/i.test(r[0].tagName);this.cssPosition=="relative"&&(this.scrollParent[0]==document||this.scrollParent[0]==this.offsetParent[0])&&(this.offset.relative=this._getRelativeOffset());var s=t.pageX,o=t.pageY;if(this.originalPosition){this.containment&&(t.pageX-this.offset.click.left<this.containment[0]&&(s=this.containment[0]+this.offset.click.left),t.pageY-this.offset.click.top<this.containment[1]&&(o=this.containment[1]+this.offset.click.top),t.pageX-this.offset.click.left>this.containment[2]&&(s=this.containment[2]+this.offset.click.left),t.pageY-this.offset.click.top>this.containment[3]&&(o=this.containment[3]+this.offset.click.top));if(n.grid){var u=this.originalPageY+Math.round((o-this.originalPageY)/n.grid[1])*n.grid[1];o=this.containment?u-this.offset.click.top<this.containment[1]||u-this.offset.click.top>this.containment[3]?u-this.offset.click.top<this.containment[1]?u+n.grid[1]:u-n.grid[1]:u:u;var a=this.originalPageX+Math.round((s-this.originalPageX)/n.grid[0])*n.grid[0];s=this.containment?a-this.offset.click.left<this.containment[0]||a-this.offset.click.left>this.containment[2]?a-this.offset.click.left<this.containment[0]?a+n.grid[0]:a-n.grid[0]:a:a}}return{top:o-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():i?0:r.scrollTop()),left:s-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():i?0:r.scrollLeft())}},_rearrange:function(e,t,n,r){n?n[0].appendChild(this.placeholder[0]):t.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?t.item[0]:t.item[0].nextSibling),this.counter=this.counter?++this.counter:1;var i=this.counter;this._delay(function(){i==this.counter&&this.refreshPositions(!r)})},_clear:function(t,n){this.reverting=!1;var r=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem),this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var i in this._storedCSS)if(this._storedCSS[i]=="auto"||this._storedCSS[i]=="static")this._storedCSS[i]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!n&&r.push(function(e){this._trigger("receive",e,this._uiHash(this.fromOutside))}),(this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!n&&r.push(function(e){this._trigger("update",e,this._uiHash())}),this!==this.currentContainer&&(n||(r.push(function(e){this._trigger("remove",e,this._uiHash())}),r.push(function(e){return function(t){e._trigger("receive",t,this._uiHash(this))}}.call(this,this.currentContainer)),r.push(function(e){return function(t){e._trigger("update",t,this._uiHash(this))}}.call(this,this.currentContainer))));for(var i=this.containers.length-1;i>=0;i--)n||r.push(function(e){return function(t){e._trigger("deactivate",t,this._uiHash(this))}}.call(this,this.containers[i])),this.containers[i].containerCache.over&&(r.push(function(e){return function(t){e._trigger("out",t,this._uiHash(this))}}.call(this,this.containers[i])),this.containers[i].containerCache.over=0);this._storedCursor&&e("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!n){this._trigger("beforeStop",t,this._uiHash());for(var i=0;i<r.length;i++)r[i].call(this,t);this._trigger("stop",t,this._uiHash())}return this.fromOutside=!1,!1}n||this._trigger("beforeStop",t,this._uiHash()),this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.helper[0]!=this.currentItem[0]&&this.helper.remove(),this.helper=null;if(!n){for(var i=0;i<r.length;i++)r[i].call(this,t);this._trigger("stop",t,this._uiHash())}return this.fromOutside=!1,!0},_trigger:function(){e.Widget.prototype._trigger.apply(this,arguments)===!1&&this.cancel()},_uiHash:function(t){var n=t||this;return{helper:n.helper,placeholder:n.placeholder||e([]),position:n.position,originalPosition:n.originalPosition,offset:n.positionAbs,item:n.currentItem,sender:t?t.element:null}}})})(jQuery);(function(e,t){var n=0,r={},i={};r.height=r.paddingTop=r.paddingBottom=r.borderTopWidth=r.borderBottomWidth="hide",i.height=i.paddingTop=i.paddingBottom=i.borderTopWidth=i.borderBottomWidth="show",e.widget("ui.accordion",{version:"1.9.1",options:{active:0,animate:{},collapsible:!1,event:"click",header:"> li > :first-child,> :not(li):even",heightStyle:"auto",icons:{activeHeader:"ui-icon-triangle-1-s",header:"ui-icon-triangle-1-e"},activate:null,beforeActivate:null},_create:function(){var t=this.accordionId="ui-accordion-"+(this.element.attr("id")||++n),r=this.options;this.prevShow=this.prevHide=e(),this.element.addClass("ui-accordion ui-widget ui-helper-reset"),this.headers=this.element.find(r.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all"),this._hoverable(this.headers),this._focusable(this.headers),this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom").hide(),!r.collapsible&&(r.active===!1||r.active==null)&&(r.active=0),r.active<0&&(r.active+=this.headers.length),this.active=this._findActive(r.active).addClass("ui-accordion-header-active ui-state-active").toggleClass("ui-corner-all ui-corner-top"),this.active.next().addClass("ui-accordion-content-active").show(),this._createIcons(),this.refresh(),this.element.attr("role","tablist"),this.headers.attr("role","tab").each(function(n){var r=e(this),i=r.attr("id"),s=r.next(),o=s.attr("id");i||(i=t+"-header-"+n,r.attr("id",i)),o||(o=t+"-panel-"+n,s.attr("id",o)),r.attr("aria-controls",o),s.attr("aria-labelledby",i)}).next().attr("role","tabpanel"),this.headers.not(this.active).attr({"aria-selected":"false",tabIndex:-1}).next().attr({"aria-expanded":"false","aria-hidden":"true"}).hide(),this.active.length?this.active.attr({"aria-selected":"true",tabIndex:0}).next().attr({"aria-expanded":"true","aria-hidden":"false"}):this.headers.eq(0).attr("tabIndex",0),this._on(this.headers,{keydown:"_keydown"}),this._on(this.headers.next(),{keydown:"_panelKeyDown"}),this._setupEvents(r.event)},_getCreateEventData:function(){return{header:this.active,content:this.active.length?this.active.next():e()}},_createIcons:function(){var t=this.options.icons;t&&(e("<span>").addClass("ui-accordion-header-icon ui-icon "+t.header).prependTo(this.headers),this.active.children(".ui-accordion-header-icon").removeClass(t.header).addClass(t.activeHeader),this.headers.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.removeClass("ui-accordion-icons").children(".ui-accordion-header-icon").remove()},_destroy:function(){var e;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.removeClass("ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-selected").removeAttr("aria-controls").removeAttr("tabIndex").each(function(){/^ui-accordion/.test(this.id)&&this.removeAttribute("id")}),this._destroyIcons(),e=this.headers.next().css("display","").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled").each(function(){/^ui-accordion/.test(this.id)&&this.removeAttribute("id")}),this.options.heightStyle!=="content"&&e.css("height","")},_setOption:function(e,t){if(e==="active"){this._activate(t);return}e==="event"&&(this.options.event&&this._off(this.headers,this.options.event),this._setupEvents(t)),this._super(e,t),e==="collapsible"&&!t&&this.options.active===!1&&this._activate(0),e==="icons"&&(this._destroyIcons(),t&&this._createIcons()),e==="disabled"&&this.headers.add(this.headers.next()).toggleClass("ui-state-disabled",!!t)},_keydown:function(t){if(t.altKey||t.ctrlKey)return;var n=e.ui.keyCode,r=this.headers.length,i=this.headers.index(t.target),s=!1;switch(t.keyCode){case n.RIGHT:case n.DOWN:s=this.headers[(i+1)%r];break;case n.LEFT:case n.UP:s=this.headers[(i-1+r)%r];break;case n.SPACE:case n.ENTER:this._eventHandler(t);break;case n.HOME:s=this.headers[0];break;case n.END:s=this.headers[r-1]}s&&(e(t.target).attr("tabIndex",-1),e(s).attr("tabIndex",0),s.focus(),t.preventDefault())},_panelKeyDown:function(t){t.keyCode===e.ui.keyCode.UP&&t.ctrlKey&&e(t.currentTarget).prev().focus()},refresh:function(){var t,n,r=this.options.heightStyle,i=this.element.parent();r==="fill"?(e.support.minHeight||(n=i.css("overflow"),i.css("overflow","hidden")),t=i.height(),this.element.siblings(":visible").each(function(){var n=e(this),r=n.css("position");if(r==="absolute"||r==="fixed")return;t-=n.outerHeight(!0)}),n&&i.css("overflow",n),this.headers.each(function(){t-=e(this).outerHeight(!0)}),this.headers.next().each(function(){e(this).height(Math.max(0,t-e(this).innerHeight()+e(this).height()))}).css("overflow","auto")):r==="auto"&&(t=0,this.headers.next().each(function(){t=Math.max(t,e(this).height("").height())}).height(t))},_activate:function(t){var n=this._findActive(t)[0];if(n===this.active[0])return;n=n||this.active[0],this._eventHandler({target:n,currentTarget:n,preventDefault:e.noop})},_findActive:function(t){return typeof t=="number"?this.headers.eq(t):e()},_setupEvents:function(t){var n={};if(!t)return;e.each(t.split(" "),function(e,t){n[t]="_eventHandler"}),this._on(this.headers,n)},_eventHandler:function(t){var n=this.options,r=this.active,i=e(t.currentTarget),s=i[0]===r[0],o=s&&n.collapsible,u=o?e():i.next(),a=r.next(),f={oldHeader:r,oldPanel:a,newHeader:o?e():i,newPanel:u};t.preventDefault();if(s&&!n.collapsible||this._trigger("beforeActivate",t,f)===!1)return;n.active=o?!1:this.headers.index(i),this.active=s?e():i,this._toggle(f),r.removeClass("ui-accordion-header-active ui-state-active"),n.icons&&r.children(".ui-accordion-header-icon").removeClass(n.icons.activeHeader).addClass(n.icons.header),s||(i.removeClass("ui-corner-all").addClass("ui-accordion-header-active ui-state-active ui-corner-top"),n.icons&&i.children(".ui-accordion-header-icon").removeClass(n.icons.header).addClass(n.icons.activeHeader),i.next().addClass("ui-accordion-content-active"))},_toggle:function(t){var n=t.newPanel,r=this.prevShow.length?this.prevShow:t.oldPanel;this.prevShow.add(this.prevHide).stop(!0,!0),this.prevShow=n,this.prevHide=r,this.options.animate?this._animate(n,r,t):(r.hide(),n.show(),this._toggleComplete(t)),r.attr({"aria-expanded":"false","aria-hidden":"true"}),r.prev().attr("aria-selected","false"),n.length&&r.length?r.prev().attr("tabIndex",-1):n.length&&this.headers.filter(function(){return e(this).attr("tabIndex")===0}).attr("tabIndex",-1),n.attr({"aria-expanded":"true","aria-hidden":"false"}).prev().attr({"aria-selected":"true",tabIndex:0})},_animate:function(e,t,n){var s,o,u,a=this,f=0,l=e.length&&(!t.length||e.index()<t.index()),c=this.options.animate||{},h=l&&c.down||c,p=function(){a._toggleComplete(n)};typeof h=="number"&&(u=h),typeof h=="string"&&(o=h),o=o||h.easing||c.easing,u=u||h.duration||c.duration;if(!t.length)return e.animate(i,u,o,p);if(!e.length)return t.animate(r,u,o,p);s=e.show().outerHeight(),t.animate(r,{duration:u,easing:o,step:function(e,t){t.now=Math.round(e)}}),e.hide().animate(i,{duration:u,easing:o,complete:p,step:function(e,n){n.now=Math.round(e),n.prop!=="height"?f+=n.now:a.options.heightStyle!=="content"&&(n.now=Math.round(s-t.outerHeight()-f),f=0)}})},_toggleComplete:function(e){var t=e.oldPanel;t.removeClass("ui-accordion-content-active").prev().removeClass("ui-corner-top").addClass("ui-corner-all"),t.length&&(t.parent()[0].className=t.parent()[0].className),this._trigger("activate",null,e)}}),e.uiBackCompat!==!1&&(function(e,t){e.extend(t.options,{navigation:!1,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}});var n=t._create;t._create=function(){if(this.options.navigation){var t=this,r=this.element.find(this.options.header),i=r.next(),s=r.add(i).find("a").filter(this.options.navigationFilter)[0];s&&r.add(i).each(function(n){if(e.contains(this,s))return t.options.active=Math.floor(n/2),!1})}n.call(this)}}(jQuery,jQuery.ui.accordion.prototype),function(e,t){e.extend(t.options,{heightStyle:null,autoHeight:!0,clearStyle:!1,fillSpace:!1});var n=t._create,r=t._setOption;e.extend(t,{_create:function(){this.options.heightStyle=this.options.heightStyle||this._mergeHeightStyle(),n.call(this)},_setOption:function(e){if(e==="autoHeight"||e==="clearStyle"||e==="fillSpace")this.options.heightStyle=this._mergeHeightStyle();r.apply(this,arguments)},_mergeHeightStyle:function(){var e=this.options;if(e.fillSpace)return"fill";if(e.clearStyle)return"content";if(e.autoHeight)return"auto"}})}(jQuery,jQuery.ui.accordion.prototype),function(e,t){e.extend(t.options.icons,{activeHeader:null,headerSelected:"ui-icon-triangle-1-s"});var n=t._createIcons;t._createIcons=function(){this.options.icons&&(this.options.icons.activeHeader=this.options.icons.activeHeader||this.options.icons.headerSelected),n.call(this)}}(jQuery,jQuery.ui.accordion.prototype),function(e,t){t.activate=t._activate;var n=t._findActive;t._findActive=function(e){return e===-1&&(e=!1),e&&typeof e!="number"&&(e=this.headers.index(this.headers.filter(e)),e===-1&&(e=!1)),n.call(this,e)}}(jQuery,jQuery.ui.accordion.prototype),jQuery.ui.accordion.prototype.resize=jQuery.ui.accordion.prototype.refresh,function(e,t){e.extend(t.options,{change:null,changestart:null});var n=t._trigger;t._trigger=function(e,t,r){var i=n.apply(this,arguments);return i?(e==="beforeActivate"?i=n.call(this,"changestart",t,{oldHeader:r.oldHeader,oldContent:r.oldPanel,newHeader:r.newHeader,newContent:r.newPanel}):e==="activate"&&(i=n.call(this,"change",t,{oldHeader:r.oldHeader,oldContent:r.oldPanel,newHeader:r.newHeader,newContent:r.newPanel})),i):!1}}(jQuery,jQuery.ui.accordion.prototype),function(e,t){e.extend(t.options,{animate:null,animated:"slide"});var n=t._create;t._create=function(){var e=this.options;e.animate===null&&(e.animated?e.animated==="slide"?e.animate=300:e.animated==="bounceslide"?e.animate={duration:200,down:{easing:"easeOutBounce",duration:1e3}}:e.animate=e.animated:e.animate=!1),n.call(this)}}(jQuery,jQuery.ui.accordion.prototype))})(jQuery);(function(e,t){var n=0;e.widget("ui.autocomplete",{version:"1.9.1",defaultElement:"<input>",options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null,change:null,close:null,focus:null,open:null,response:null,search:null,select:null},pending:0,_create:function(){var t,n,r;this.isMultiLine=this._isMultiLine(),this.valueMethod=this.element[this.element.is("input,textarea")?"val":"text"],this.isNewMenu=!0,this.element.addClass("ui-autocomplete-input").attr("autocomplete","off"),this._on(this.element,{keydown:function(i){if(this.element.prop("readOnly")){t=!0,r=!0,n=!0;return}t=!1,r=!1,n=!1;var s=e.ui.keyCode;switch(i.keyCode){case s.PAGE_UP:t=!0,this._move("previousPage",i);break;case s.PAGE_DOWN:t=!0,this._move("nextPage",i);break;case s.UP:t=!0,this._keyEvent("previous",i);break;case s.DOWN:t=!0,this._keyEvent("next",i);break;case s.ENTER:case s.NUMPAD_ENTER:this.menu.active&&(t=!0,i.preventDefault(),this.menu.select(i));break;case s.TAB:this.menu.active&&this.menu.select(i);break;case s.ESCAPE:this.menu.element.is(":visible")&&(this._value(this.term),this.close(i),i.preventDefault());break;default:n=!0,this._searchTimeout(i)}},keypress:function(r){if(t){t=!1,r.preventDefault();return}if(n)return;var i=e.ui.keyCode;switch(r.keyCode){case i.PAGE_UP:this._move("previousPage",r);break;case i.PAGE_DOWN:this._move("nextPage",r);break;case i.UP:this._keyEvent("previous",r);break;case i.DOWN:this._keyEvent("next",r)}},input:function(e){if(r){r=!1,e.preventDefault();return}this._searchTimeout(e)},focus:function(){this.selectedItem=null,this.previous=this._value()},blur:function(e){if(this.cancelBlur){delete this.cancelBlur;return}clearTimeout(this.searching),this.close(e),this._change(e)}}),this._initSource(),this.menu=e("<ul>").addClass("ui-autocomplete").appendTo(this.document.find(this.options.appendTo||"body")[0]).menu({input:e(),role:null}).zIndex(this.element.zIndex()+1).hide().data("menu"),this._on(this.menu.element,{mousedown:function(t){t.preventDefault(),this.cancelBlur=!0,this._delay(function(){delete this.cancelBlur});var n=this.menu.element[0];e(t.target).closest(".ui-menu-item").length||this._delay(function(){var t=this;this.document.one("mousedown",function(r){r.target!==t.element[0]&&r.target!==n&&!e.contains(n,r.target)&&t.close()})})},menufocus:function(t,n){if(this.isNewMenu){this.isNewMenu=!1;if(t.originalEvent&&/^mouse/.test(t.originalEvent.type)){this.menu.blur(),this.document.one("mousemove",function(){e(t.target).trigger(t.originalEvent)});return}}var r=n.item.data("ui-autocomplete-item")||n.item.data("item.autocomplete");!1!==this._trigger("focus",t,{item:r})?t.originalEvent&&/^key/.test(t.originalEvent.type)&&this._value(r.value):this.liveRegion.text(r.value)},menuselect:function(e,t){var n=t.item.data("ui-autocomplete-item")||t.item.data("item.autocomplete"),r=this.previous;this.element[0]!==this.document[0].activeElement&&(this.element.focus(),this.previous=r,this._delay(function(){this.previous=r,this.selectedItem=n})),!1!==this._trigger("select",e,{item:n})&&this._value(n.value),this.term=this._value(),this.close(e),this.selectedItem=n}}),this.liveRegion=e("<span>",{role:"status","aria-live":"polite"}).addClass("ui-helper-hidden-accessible").insertAfter(this.element),e.fn.bgiframe&&this.menu.element.bgiframe(),this._on(this.window,{beforeunload:function(){this.element.removeAttr("autocomplete")}})},_destroy:function(){clearTimeout(this.searching),this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete"),this.menu.element.remove(),this.liveRegion.remove()},_setOption:function(e,t){this._super(e,t),e==="source"&&this._initSource(),e==="appendTo"&&this.menu.element.appendTo(this.document.find(t||"body")[0]),e==="disabled"&&t&&this.xhr&&this.xhr.abort()},_isMultiLine:function(){return this.element.is("textarea")?!0:this.element.is("input")?!1:this.element.prop("isContentEditable")},_initSource:function(){var t,n,r=this;e.isArray(this.options.source)?(t=this.options.source,this.source=function(n,r){r(e.ui.autocomplete.filter(t,n.term))}):typeof this.options.source=="string"?(n=this.options.source,this.source=function(t,i){r.xhr&&r.xhr.abort(),r.xhr=e.ajax({url:n,data:t,dataType:"json",success:function(e){i(e)},error:function(){i([])}})}):this.source=this.options.source},_searchTimeout:function(e){clearTimeout(this.searching),this.searching=this._delay(function(){this.term!==this._value()&&(this.selectedItem=null,this.search(null,e))},this.options.delay)},search:function(e,t){e=e!=null?e:this._value(),this.term=this._value();if(e.length<this.options.minLength)return this.close(t);if(this._trigger("search",t)===!1)return;return this._search(e)},_search:function(e){this.pending++,this.element.addClass("ui-autocomplete-loading"),this.cancelSearch=!1,this.source({term:e},this._response())},_response:function(){var e=this,t=++n;return function(r){t===n&&e.__response(r),e.pending--,e.pending||e.element.removeClass("ui-autocomplete-loading")}},__response:function(e){e&&(e=this._normalize(e)),this._trigger("response",null,{content:e}),!this.options.disabled&&e&&e.length&&!this.cancelSearch?(this._suggest(e),this._trigger("open")):this._close()},close:function(e){this.cancelSearch=!0,this._close(e)},_close:function(e){this.menu.element.is(":visible")&&(this.menu.element.hide(),this.menu.blur(),this.isNewMenu=!0,this._trigger("close",e))},_change:function(e){this.previous!==this._value()&&this._trigger("change",e,{item:this.selectedItem})},_normalize:function(t){return t.length&&t[0].label&&t[0].value?t:e.map(t,function(t){return typeof t=="string"?{label:t,value:t}:e.extend({label:t.label||t.value,value:t.value||t.label},t)})},_suggest:function(t){var n=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(n,t),this.menu.refresh(),n.show(),this._resizeMenu(),n.position(e.extend({of:this.element},this.options.position)),this.options.autoFocus&&this.menu.next()},_resizeMenu:function(){var e=this.menu.element;e.outerWidth(Math.max(e.width("").outerWidth()+1,this.element.outerWidth()))},_renderMenu:function(t,n){var r=this;e.each(n,function(e,n){r._renderItemData(t,n)})},_renderItemData:function(e,t){return this._renderItem(e,t).data("ui-autocomplete-item",t)},_renderItem:function(t,n){return e("<li>").append(e("<a>").text(n.label)).appendTo(t)},_move:function(e,t){if(!this.menu.element.is(":visible")){this.search(null,t);return}if(this.menu.isFirstItem()&&/^previous/.test(e)||this.menu.isLastItem()&&/^next/.test(e)){this._value(this.term),this.menu.blur();return}this.menu[e](t)},widget:function(){return this.menu.element},_value:function(){return this.valueMethod.apply(this.element,arguments)},_keyEvent:function(e,t){if(!this.isMultiLine||this.menu.element.is(":visible"))this._move(e,t),t.preventDefault()}}),e.extend(e.ui.autocomplete,{escapeRegex:function(e){return e.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&")},filter:function(t,n){var r=new RegExp(e.ui.autocomplete.escapeRegex(n),"i");return e.grep(t,function(e){return r.test(e.label||e.value||e)})}}),e.widget("ui.autocomplete",e.ui.autocomplete,{options:{messages:{noResults:"No search results.",results:function(e){return e+(e>1?" results are":" result is")+" available, use up and down arrow keys to navigate."}}},__response:function(e){var t;this._superApply(arguments);if(this.options.disabled||this.cancelSearch)return;e&&e.length?t=this.options.messages.results(e.length):t=this.options.messages.noResults,this.liveRegion.text(t)}})})(jQuery);(function(e,t){var n,r,i,s,o="ui-button ui-widget ui-state-default ui-corner-all",u="ui-state-hover ui-state-active ",a="ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",f=function(){var t=e(this).find(":ui-button");setTimeout(function(){t.button("refresh")},1)},l=function(t){var n=t.name,r=t.form,i=e([]);return n&&(r?i=e(r).find("[name='"+n+"']"):i=e("[name='"+n+"']",t.ownerDocument).filter(function(){return!this.form})),i};e.widget("ui.button",{version:"1.9.1",defaultElement:"<button>",options:{disabled:null,text:!0,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset"+this.eventNamespace).bind("reset"+this.eventNamespace,f),typeof this.options.disabled!="boolean"?this.options.disabled=!!this.element.prop("disabled"):this.element.prop("disabled",this.options.disabled),this._determineButtonType(),this.hasTitle=!!this.buttonElement.attr("title");var t=this,u=this.options,a=this.type==="checkbox"||this.type==="radio",c="ui-state-hover"+(a?"":" ui-state-active"),h="ui-state-focus";u.label===null&&(u.label=this.type==="input"?this.buttonElement.val():this.buttonElement.html()),this.buttonElement.addClass(o).attr("role","button").bind("mouseenter"+this.eventNamespace,function(){if(u.disabled)return;e(this).addClass("ui-state-hover"),this===n&&e(this).addClass("ui-state-active")}).bind("mouseleave"+this.eventNamespace,function(){if(u.disabled)return;e(this).removeClass(c)}).bind("click"+this.eventNamespace,function(e){u.disabled&&(e.preventDefault(),e.stopImmediatePropagation())}),this.element.bind("focus"+this.eventNamespace,function(){t.buttonElement.addClass(h)}).bind("blur"+this.eventNamespace,function(){t.buttonElement.removeClass(h)}),a&&(this.element.bind("change"+this.eventNamespace,function(){if(s)return;t.refresh()}),this.buttonElement.bind("mousedown"+this.eventNamespace,function(e){if(u.disabled)return;s=!1,r=e.pageX,i=e.pageY}).bind("mouseup"+this.eventNamespace,function(e){if(u.disabled)return;if(r!==e.pageX||i!==e.pageY)s=!0})),this.type==="checkbox"?this.buttonElement.bind("click"+this.eventNamespace,function(){if(u.disabled||s)return!1;e(this).toggleClass("ui-state-active"),t.buttonElement.attr("aria-pressed",t.element[0].checked)}):this.type==="radio"?this.buttonElement.bind("click"+this.eventNamespace,function(){if(u.disabled||s)return!1;e(this).addClass("ui-state-active"),t.buttonElement.attr("aria-pressed","true");var n=t.element[0];l(n).not(n).map(function(){return e(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed","false")}):(this.buttonElement.bind("mousedown"+this.eventNamespace,function(){if(u.disabled)return!1;e(this).addClass("ui-state-active"),n=this,t.document.one("mouseup",function(){n=null})}).bind("mouseup"+this.eventNamespace,function(){if(u.disabled)return!1;e(this).removeClass("ui-state-active")}).bind("keydown"+this.eventNamespace,function(t){if(u.disabled)return!1;(t.keyCode===e.ui.keyCode.SPACE||t.keyCode===e.ui.keyCode.ENTER)&&e(this).addClass("ui-state-active")}).bind("keyup"+this.eventNamespace,function(){e(this).removeClass("ui-state-active")}),this.buttonElement.is("a")&&this.buttonElement.keyup(function(t){t.keyCode===e.ui.keyCode.SPACE&&e(this).click()})),this._setOption("disabled",u.disabled),this._resetButton()},_determineButtonType:function(){var e,t,n;this.element.is("[type=checkbox]")?this.type="checkbox":this.element.is("[type=radio]")?this.type="radio":this.element.is("input")?this.type="input":this.type="button",this.type==="checkbox"||this.type==="radio"?(e=this.element.parents().last(),t="label[for='"+this.element.attr("id")+"']",this.buttonElement=e.find(t),this.buttonElement.length||(e=e.length?e.siblings():this.element.siblings(),this.buttonElement=e.filter(t),this.buttonElement.length||(this.buttonElement=e.find(t))),this.element.addClass("ui-helper-hidden-accessible"),n=this.element.is(":checked"),n&&this.buttonElement.addClass("ui-state-active"),this.buttonElement.prop("aria-pressed",n)):this.buttonElement=this.element},widget:function(){return this.buttonElement},_destroy:function(){this.element.removeClass("ui-helper-hidden-accessible"),this.buttonElement.removeClass(o+" "+u+" "+a).removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html()),this.hasTitle||this.buttonElement.removeAttr("title")},_setOption:function(e,t){this._super(e,t);if(e==="disabled"){t?this.element.prop("disabled",!0):this.element.prop("disabled",!1);return}this._resetButton()},refresh:function(){var t=this.element.is(":disabled")||this.element.hasClass("ui-button-disabled");t!==this.options.disabled&&this._setOption("disabled",t),this.type==="radio"?l(this.element[0]).each(function(){e(this).is(":checked")?e(this).button("widget").addClass("ui-state-active").attr("aria-pressed","true"):e(this).button("widget").removeClass("ui-state-active").attr("aria-pressed","false")}):this.type==="checkbox"&&(this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed","true"):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed","false"))},_resetButton:function(){if(this.type==="input"){this.options.label&&this.element.val(this.options.label);return}var t=this.buttonElement.removeClass(a),n=e("<span></span>",this.document[0]).addClass("ui-button-text").html(this.options.label).appendTo(t.empty()).text(),r=this.options.icons,i=r.primary&&r.secondary,s=[];r.primary||r.secondary?(this.options.text&&s.push("ui-button-text-icon"+(i?"s":r.primary?"-primary":"-secondary")),r.primary&&t.prepend("<span class='ui-button-icon-primary ui-icon "+r.primary+"'></span>"),r.secondary&&t.append("<span class='ui-button-icon-secondary ui-icon "+r.secondary+"'></span>"),this.options.text||(s.push(i?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||t.attr("title",e.trim(n)))):s.push("ui-button-text-only"),t.addClass(s.join(" "))}}),e.widget("ui.buttonset",{version:"1.9.1",options:{items:"button, input[type=button], input[type=submit], input[type=reset], input[type=checkbox], input[type=radio], a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(e,t){e==="disabled"&&this.buttons.button("option",e,t),this._super(e,t)},refresh:function(){var t=this.element.css("direction")==="rtl";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return e(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(t?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(t?"ui-corner-left":"ui-corner-right").end().end()},_destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return e(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy")}})})(jQuery);(function($,undefined){function Datepicker(){this.debug=!1,this._curInst=null,this._keyEvent=!1,this._disabledInputs=[],this._datepickerShowing=!1,this._inDialog=!1,this._mainDivId="ui-datepicker-div",this._inlineClass="ui-datepicker-inline",this._appendClass="ui-datepicker-append",this._triggerClass="ui-datepicker-trigger",this._dialogClass="ui-datepicker-dialog",this._disableClass="ui-datepicker-disabled",this._unselectableClass="ui-datepicker-unselectable",this._currentClass="ui-datepicker-current-day",this._dayOverClass="ui-datepicker-days-cell-over",this.regional=[],this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:!1,showMonthAfterYear:!1,yearSuffix:""},this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:!1,hideIfNoPrevNext:!1,navigationAsDateFormat:!1,gotoCurrent:!1,changeMonth:!1,changeYear:!1,yearRange:"c-10:c+10",showOtherMonths:!1,selectOtherMonths:!1,showWeek:!1,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:!0,showButtonPanel:!1,autoSize:!1,disabled:!1},$.extend(this._defaults,this.regional[""]),this.dpDiv=bindHover($('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function bindHover(e){var t="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return e.delegate(t,"mouseout",function(){$(this).removeClass("ui-state-hover"),this.className.indexOf("ui-datepicker-prev")!=-1&&$(this).removeClass("ui-datepicker-prev-hover"),this.className.indexOf("ui-datepicker-next")!=-1&&$(this).removeClass("ui-datepicker-next-hover")}).delegate(t,"mouseover",function(){$.datepicker._isDisabledDatepicker(instActive.inline?e.parent()[0]:instActive.input[0])||($(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),$(this).addClass("ui-state-hover"),this.className.indexOf("ui-datepicker-prev")!=-1&&$(this).addClass("ui-datepicker-prev-hover"),this.className.indexOf("ui-datepicker-next")!=-1&&$(this).addClass("ui-datepicker-next-hover"))})}function extendRemove(e,t){$.extend(e,t);for(var n in t)if(t[n]==null||t[n]==undefined)e[n]=t[n];return e}$.extend($.ui,{datepicker:{version:"1.9.1"}});var PROP_NAME="datepicker",dpuuid=(new Date).getTime(),instActive;$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(e){return extendRemove(this._defaults,e||{}),this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase(),inline=nodeName=="div"||nodeName=="span";target.id||(this.uuid+=1,target.id="dp"+this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{}),nodeName=="input"?this._connectDatepicker(target,inst):inline&&this._inlineDatepicker(target,inst)},_newInst:function(e,t){var n=e[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1");return{id:n,input:e,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:t,dpDiv:t?bindHover($('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')):this.dpDiv}},_connectDatepicker:function(e,t){var n=$(e);t.append=$([]),t.trigger=$([]);if(n.hasClass(this.markerClassName))return;this._attachments(n,t),n.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,n,r){t.settings[n]=r}).bind("getData.datepicker",function(e,n){return this._get(t,n)}),this._autoSize(t),$.data(e,PROP_NAME,t),t.settings.disabled&&this._disableDatepicker(e)},_attachments:function(e,t){var n=this._get(t,"appendText"),r=this._get(t,"isRTL");t.append&&t.append.remove(),n&&(t.append=$('<span class="'+this._appendClass+'">'+n+"</span>"),e[r?"before":"after"](t.append)),e.unbind("focus",this._showDatepicker),t.trigger&&t.trigger.remove();var i=this._get(t,"showOn");(i=="focus"||i=="both")&&e.focus(this._showDatepicker);if(i=="button"||i=="both"){var s=this._get(t,"buttonText"),o=this._get(t,"buttonImage");t.trigger=$(this._get(t,"buttonImageOnly")?$("<img/>").addClass(this._triggerClass).attr({src:o,alt:s,title:s}):$('<button type="button"></button>').addClass(this._triggerClass).html(o==""?s:$("<img/>").attr({src:o,alt:s,title:s}))),e[r?"before":"after"](t.trigger),t.trigger.click(function(){return $.datepicker._datepickerShowing&&$.datepicker._lastInput==e[0]?$.datepicker._hideDatepicker():$.datepicker._datepickerShowing&&$.datepicker._lastInput!=e[0]?($.datepicker._hideDatepicker(),$.datepicker._showDatepicker(e[0])):$.datepicker._showDatepicker(e[0]),!1})}},_autoSize:function(e){if(this._get(e,"autoSize")&&!e.inline){var t=new Date(2009,11,20),n=this._get(e,"dateFormat");if(n.match(/[DM]/)){var r=function(e){var t=0,n=0;for(var r=0;r<e.length;r++)e[r].length>t&&(t=e[r].length,n=r);return n};t.setMonth(r(this._get(e,n.match(/MM/)?"monthNames":"monthNamesShort"))),t.setDate(r(this._get(e,n.match(/DD/)?"dayNames":"dayNamesShort"))+20-t.getDay())}e.input.attr("size",this._formatDate(e,t).length)}},_inlineDatepicker:function(e,t){var n=$(e);if(n.hasClass(this.markerClassName))return;n.addClass(this.markerClassName).append(t.dpDiv).bind("setData.datepicker",function(e,n,r){t.settings[n]=r}).bind("getData.datepicker",function(e,n){return this._get(t,n)}),$.data(e,PROP_NAME,t),this._setDate(t,this._getDefaultDate(t),!0),this._updateDatepicker(t),this._updateAlternate(t),t.settings.disabled&&this._disableDatepicker(e),t.dpDiv.css("display","block")},_dialogDatepicker:function(e,t,n,r,i){var s=this._dialogInst;if(!s){this.uuid+=1;var o="dp"+this.uuid;this._dialogInput=$('<input type="text" id="'+o+'" style="position: absolute; top: -100px; width: 0px;"/>'),this._dialogInput.keydown(this._doKeyDown),$("body").append(this._dialogInput),s=this._dialogInst=this._newInst(this._dialogInput,!1),s.settings={},$.data(this._dialogInput[0],PROP_NAME,s)}extendRemove(s.settings,r||{}),t=t&&t.constructor==Date?this._formatDate(s,t):t,this._dialogInput.val(t),this._pos=i?i.length?i:[i.pageX,i.pageY]:null;if(!this._pos){var u=document.documentElement.clientWidth,a=document.documentElement.clientHeight,f=document.documentElement.scrollLeft||document.body.scrollLeft,l=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[u/2-100+f,a/2-150+l]}return this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),s.settings.onSelect=n,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),$.blockUI&&$.blockUI(this.dpDiv),$.data(this._dialogInput[0],PROP_NAME,s),this},_destroyDatepicker:function(e){var t=$(e),n=$.data(e,PROP_NAME);if(!t.hasClass(this.markerClassName))return;var r=e.nodeName.toLowerCase();$.removeData(e,PROP_NAME),r=="input"?(n.append.remove(),n.trigger.remove(),t.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):(r=="div"||r=="span")&&t.removeClass(this.markerClassName).empty()},_enableDatepicker:function(e){var t=$(e),n=$.data(e,PROP_NAME);if(!t.hasClass(this.markerClassName))return;var r=e.nodeName.toLowerCase();if(r=="input")e.disabled=!1,n.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""});else if(r=="div"||r=="span"){var i=t.children("."+this._inlineClass);i.children().removeClass("ui-state-disabled"),i.find("select.ui-datepicker-month, select.ui-datepicker-year").prop("disabled",!1)}this._disabledInputs=$.map(this._disabledInputs,function(t){return t==e?null:t})},_disableDatepicker:function(e){var t=$(e),n=$.data(e,PROP_NAME);if(!t.hasClass(this.markerClassName))return;var r=e.nodeName.toLowerCase();if(r=="input")e.disabled=!0,n.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"});else if(r=="div"||r=="span"){var i=t.children("."+this._inlineClass);i.children().addClass("ui-state-disabled"),i.find("select.ui-datepicker-month, select.ui-datepicker-year").prop("disabled",!0)}this._disabledInputs=$.map(this._disabledInputs,function(t){return t==e?null:t}),this._disabledInputs[this._disabledInputs.length]=e},_isDisabledDatepicker:function(e){if(!e)return!1;for(var t=0;t<this._disabledInputs.length;t++)if(this._disabledInputs[t]==e)return!0;return!1},_getInst:function(e){try{return $.data(e,PROP_NAME)}catch(t){throw"Missing instance data for this datepicker"}},_optionDatepicker:function(e,t,n){var r=this._getInst(e);if(arguments.length==2&&typeof t=="string")return t=="defaults"?$.extend({},$.datepicker._defaults):r?t=="all"?$.extend({},r.settings):this._get(r,t):null;var i=t||{};typeof t=="string"&&(i={},i[t]=n);if(r){this._curInst==r&&this._hideDatepicker();var s=this._getDateDatepicker(e,!0),o=this._getMinMaxDate(r,"min"),u=this._getMinMaxDate(r,"max");extendRemove(r.settings,i),o!==null&&i.dateFormat!==undefined&&i.minDate===undefined&&(r.settings.minDate=this._formatDate(r,o)),u!==null&&i.dateFormat!==undefined&&i.maxDate===undefined&&(r.settings.maxDate=this._formatDate(r,u)),this._attachments($(e),r),this._autoSize(r),this._setDate(r,s),this._updateAlternate(r),this._updateDatepicker(r)}},_changeDatepicker:function(e,t,n){this._optionDatepicker(e,t,n)},_refreshDatepicker:function(e){var t=this._getInst(e);t&&this._updateDatepicker(t)},_setDateDatepicker:function(e,t){var n=this._getInst(e);n&&(this._setDate(n,t),this._updateDatepicker(n),this._updateAlternate(n))},_getDateDatepicker:function(e,t){var n=this._getInst(e);return n&&!n.inline&&this._setDateFromField(n,t),n?this._getDate(n):null},_doKeyDown:function(e){var t=$.datepicker._getInst(e.target),n=!0,r=t.dpDiv.is(".ui-datepicker-rtl");t._keyEvent=!0;if($.datepicker._datepickerShowing)switch(e.keyCode){case 9:$.datepicker._hideDatepicker(),n=!1;break;case 13:var i=$("td."+$.datepicker._dayOverClass+":not(."+$.datepicker._currentClass+")",t.dpDiv);i[0]&&$.datepicker._selectDay(e.target,t.selectedMonth,t.selectedYear,i[0]);var s=$.datepicker._get(t,"onSelect");if(s){var o=$.datepicker._formatDate(t);s.apply(t.input?t.input[0]:null,[o,t])}else $.datepicker._hideDatepicker();return!1;case 27:$.datepicker._hideDatepicker();break;case 33:$.datepicker._adjustDate(e.target,e.ctrlKey?-$.datepicker._get(t,"stepBigMonths"):-$.datepicker._get(t,"stepMonths"),"M");break;case 34:$.datepicker._adjustDate(e.target,e.ctrlKey?+$.datepicker._get(t,"stepBigMonths"):+$.datepicker._get(t,"stepMonths"),"M");break;case 35:(e.ctrlKey||e.metaKey)&&$.datepicker._clearDate(e.target),n=e.ctrlKey||e.metaKey;break;case 36:(e.ctrlKey||e.metaKey)&&$.datepicker._gotoToday(e.target),n=e.ctrlKey||e.metaKey;break;case 37:(e.ctrlKey||e.metaKey)&&$.datepicker._adjustDate(e.target,r?1:-1,"D"),n=e.ctrlKey||e.metaKey,e.originalEvent.altKey&&$.datepicker._adjustDate(e.target,e.ctrlKey?-$.datepicker._get(t,"stepBigMonths"):-$.datepicker._get(t,"stepMonths"),"M");break;case 38:(e.ctrlKey||e.metaKey)&&$.datepicker._adjustDate(e.target,-7,"D"),n=e.ctrlKey||e.metaKey;break;case 39:(e.ctrlKey||e.metaKey)&&$.datepicker._adjustDate(e.target,r?-1:1,"D"),n=e.ctrlKey||e.metaKey,e.originalEvent.altKey&&$.datepicker._adjustDate(e.target,e.ctrlKey?+$.datepicker._get(t,"stepBigMonths"):+$.datepicker._get(t,"stepMonths"),"M");break;case 40:(e.ctrlKey||e.metaKey)&&$.datepicker._adjustDate(e.target,7,"D"),n=e.ctrlKey||e.metaKey;break;default:n=!1}else e.keyCode==36&&e.ctrlKey?$.datepicker._showDatepicker(this):n=!1;n&&(e.preventDefault(),e.stopPropagation())},_doKeyPress:function(e){var t=$.datepicker._getInst(e.target);if($.datepicker._get(t,"constrainInput")){var n=$.datepicker._possibleChars($.datepicker._get(t,"dateFormat")),r=String.fromCharCode(e.charCode==undefined?e.keyCode:e.charCode);return e.ctrlKey||e.metaKey||r<" "||!n||n.indexOf(r)>-1}},_doKeyUp:function(e){var t=$.datepicker._getInst(e.target);if(t.input.val()!=t.lastVal)try{var n=$.datepicker.parseDate($.datepicker._get(t,"dateFormat"),t.input?t.input.val():null,$.datepicker._getFormatConfig(t));n&&($.datepicker._setDateFromField(t),$.datepicker._updateAlternate(t),$.datepicker._updateDatepicker(t))}catch(r){$.datepicker.log(r)}return!0},_showDatepicker:function(e){e=e.target||e,e.nodeName.toLowerCase()!="input"&&(e=$("input",e.parentNode)[0]);if($.datepicker._isDisabledDatepicker(e)||$.datepicker._lastInput==e)return;var t=$.datepicker._getInst(e);$.datepicker._curInst&&$.datepicker._curInst!=t&&($.datepicker._curInst.dpDiv.stop(!0,!0),t&&$.datepicker._datepickerShowing&&$.datepicker._hideDatepicker($.datepicker._curInst.input[0]));var n=$.datepicker._get(t,"beforeShow"),r=n?n.apply(e,[e,t]):{};if(r===!1)return;extendRemove(t.settings,r),t.lastVal=null,$.datepicker._lastInput=e,$.datepicker._setDateFromField(t),$.datepicker._inDialog&&(e.value=""),$.datepicker._pos||($.datepicker._pos=$.datepicker._findPos(e),$.datepicker._pos[1]+=e.offsetHeight);var i=!1;$(e).parents().each(function(){return i|=$(this).css("position")=="fixed",!i});var s={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null,t.dpDiv.empty(),t.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),$.datepicker._updateDatepicker(t),s=$.datepicker._checkOffset(t,s,i),t.dpDiv.css({position:$.datepicker._inDialog&&$.blockUI?"static":i?"fixed":"absolute",display:"none",left:s.left+"px",top:s.top+"px"});if(!t.inline){var o=$.datepicker._get(t,"showAnim"),u=$.datepicker._get(t,"duration"),a=function(){var e=t.dpDiv.find("iframe.ui-datepicker-cover");if(!!e.length){var n=$.datepicker._getBorders(t.dpDiv);e.css({left:-n[0],top:-n[1],width:t.dpDiv.outerWidth(),height:t.dpDiv.outerHeight()})}};t.dpDiv.zIndex($(e).zIndex()+1),$.datepicker._datepickerShowing=!0,$.effects&&($.effects.effect[o]||$.effects[o])?t.dpDiv.show(o,$.datepicker._get(t,"showOptions"),u,a):t.dpDiv[o||"show"](o?u:null,a),(!o||!u)&&a(),t.input.is(":visible")&&!t.input.is(":disabled")&&t.input.focus(),$.datepicker._curInst=t}},_updateDatepicker:function(e){this.maxRows=4;var t=$.datepicker._getBorders(e.dpDiv);instActive=e,e.dpDiv.empty().append(this._generateHTML(e)),this._attachHandlers(e);var n=e.dpDiv.find("iframe.ui-datepicker-cover");!n.length||n.css({left:-t[0],top:-t[1],width:e.dpDiv.outerWidth(),height:e.dpDiv.outerHeight()}),e.dpDiv.find("."+this._dayOverClass+" a").mouseover();var r=this._getNumberOfMonths(e),i=r[1],s=17;e.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),i>1&&e.dpDiv.addClass("ui-datepicker-multi-"+i).css("width",s*i+"em"),e.dpDiv[(r[0]!=1||r[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"),e.dpDiv[(this._get(e,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),e==$.datepicker._curInst&&$.datepicker._datepickerShowing&&e.input&&e.input.is(":visible")&&!e.input.is(":disabled")&&e.input[0]!=document.activeElement&&e.input.focus();if(e.yearshtml){var o=e.yearshtml;setTimeout(function(){o===e.yearshtml&&e.yearshtml&&e.dpDiv.find("select.ui-datepicker-year:first").replaceWith(e.yearshtml),o=e.yearshtml=null},0)}},_getBorders:function(e){var t=function(e){return{thin:1,medium:2,thick:3}[e]||e};return[parseFloat(t(e.css("border-left-width"))),parseFloat(t(e.css("border-top-width")))]},_checkOffset:function(e,t,n){var r=e.dpDiv.outerWidth(),i=e.dpDiv.outerHeight(),s=e.input?e.input.outerWidth():0,o=e.input?e.input.outerHeight():0,u=document.documentElement.clientWidth+(n?0:$(document).scrollLeft()),a=document.documentElement.clientHeight+(n?0:$(document).scrollTop());return t.left-=this._get(e,"isRTL")?r-s:0,t.left-=n&&t.left==e.input.offset().left?$(document).scrollLeft():0,t.top-=n&&t.top==e.input.offset().top+o?$(document).scrollTop():0,t.left-=Math.min(t.left,t.left+r>u&&u>r?Math.abs(t.left+r-u):0),t.top-=Math.min(t.top,t.top+i>a&&a>i?Math.abs(i+o):0),t},_findPos:function(e){var t=this._getInst(e),n=this._get(t,"isRTL");while(e&&(e.type=="hidden"||e.nodeType!=1||$.expr.filters.hidden(e)))e=e[n?"previousSibling":"nextSibling"];var r=$(e).offset();return[r.left,r.top]},_hideDatepicker:function(e){var t=this._curInst;if(!t||e&&t!=$.data(e,PROP_NAME))return;if(this._datepickerShowing){var n=this._get(t,"showAnim"),r=this._get(t,"duration"),i=function(){$.datepicker._tidyDialog(t)};$.effects&&($.effects.effect[n]||$.effects[n])?t.dpDiv.hide(n,$.datepicker._get(t,"showOptions"),r,i):t.dpDiv[n=="slideDown"?"slideUp":n=="fadeIn"?"fadeOut":"hide"](n?r:null,i),n||i(),this._datepickerShowing=!1;var s=this._get(t,"onClose");s&&s.apply(t.input?t.input[0]:null,[t.input?t.input.val():"",t]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),$.blockUI&&($.unblockUI(),$("body").append(this.dpDiv))),this._inDialog=!1}},_tidyDialog:function(e){e.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(e){if(!$.datepicker._curInst)return;var t=$(e.target),n=$.datepicker._getInst(t[0]);(t[0].id!=$.datepicker._mainDivId&&t.parents("#"+$.datepicker._mainDivId).length==0&&!t.hasClass($.datepicker.markerClassName)&&!t.closest("."+$.datepicker._triggerClass).length&&$.datepicker._datepickerShowing&&(!$.datepicker._inDialog||!$.blockUI)||t.hasClass($.datepicker.markerClassName)&&$.datepicker._curInst!=n)&&$.datepicker._hideDatepicker()},_adjustDate:function(e,t,n){var r=$(e),i=this._getInst(r[0]);if(this._isDisabledDatepicker(r[0]))return;this._adjustInstDate(i,t+(n=="M"?this._get(i,"showCurrentAtPos"):0),n),this._updateDatepicker(i)},_gotoToday:function(e){var t=$(e),n=this._getInst(t[0]);if(this._get(n,"gotoCurrent")&&n.currentDay)n.selectedDay=n.currentDay,n.drawMonth=n.selectedMonth=n.currentMonth,n.drawYear=n.selectedYear=n.currentYear;else{var r=new Date;n.selectedDay=r.getDate(),n.drawMonth=n.selectedMonth=r.getMonth(),n.drawYear=n.selectedYear=r.getFullYear()}this._notifyChange(n),this._adjustDate(t)},_selectMonthYear:function(e,t,n){var r=$(e),i=this._getInst(r[0]);i["selected"+(n=="M"?"Month":"Year")]=i["draw"+(n=="M"?"Month":"Year")]=parseInt(t.options[t.selectedIndex].value,10),this._notifyChange(i),this._adjustDate(r)},_selectDay:function(e,t,n,r){var i=$(e);if($(r).hasClass(this._unselectableClass)||this._isDisabledDatepicker(i[0]))return;var s=this._getInst(i[0]);s.selectedDay=s.currentDay=$("a",r).html(),s.selectedMonth=s.currentMonth=t,s.selectedYear=s.currentYear=n,this._selectDate(e,this._formatDate(s,s.currentDay,s.currentMonth,s.currentYear))},_clearDate:function(e){var t=$(e),n=this._getInst(t[0]);this._selectDate(t,"")},_selectDate:function(e,t){var n=$(e),r=this._getInst(n[0]);t=t!=null?t:this._formatDate(r),r.input&&r.input.val(t),this._updateAlternate(r);var i=this._get(r,"onSelect");i?i.apply(r.input?r.input[0]:null,[t,r]):r.input&&r.input.trigger("change"),r.inline?this._updateDatepicker(r):(this._hideDatepicker(),this._lastInput=r.input[0],typeof r.input[0]!="object"&&r.input.focus(),this._lastInput=null)},_updateAlternate:function(e){var t=this._get(e,"altField");if(t){var n=this._get(e,"altFormat")||this._get(e,"dateFormat"),r=this._getDate(e),i=this.formatDate(n,r,this._getFormatConfig(e));$(t).each(function(){$(this).val(i)})}},noWeekends:function(e){var t=e.getDay();return[t>0&&t<6,""]},iso8601Week:function(e){var t=new Date(e.getTime());t.setDate(t.getDate()+4-(t.getDay()||7));var n=t.getTime();return t.setMonth(0),t.setDate(1),Math.floor(Math.round((n-t)/864e5)/7)+1},parseDate:function(e,t,n){if(e==null||t==null)throw"Invalid arguments";t=typeof t=="object"?t.toString():t+"";if(t=="")return null;var r=(n?n.shortYearCutoff:null)||this._defaults.shortYearCutoff;r=typeof r!="string"?r:(new Date).getFullYear()%100+parseInt(r,10);var i=(n?n.dayNamesShort:null)||this._defaults.dayNamesShort,s=(n?n.dayNames:null)||this._defaults.dayNames,o=(n?n.monthNamesShort:null)||this._defaults.monthNamesShort,u=(n?n.monthNames:null)||this._defaults.monthNames,a=-1,f=-1,l=-1,c=-1,h=!1,p=function(t){var n=y+1<e.length&&e.charAt(y+1)==t;return n&&y++,n},d=function(e){var n=p(e),r=e=="@"?14:e=="!"?20:e=="y"&&n?4:e=="o"?3:2,i=new RegExp("^\\d{1,"+r+"}"),s=t.substring(g).match(i);if(!s)throw"Missing number at position "+g;return g+=s[0].length,parseInt(s[0],10)},v=function(e,n,r){var i=$.map(p(e)?r:n,function(e,t){return[[t,e]]}).sort(function(e,t){return-(e[1].length-t[1].length)}),s=-1;$.each(i,function(e,n){var r=n[1];if(t.substr(g,r.length).toLowerCase()==r.toLowerCase())return s=n[0],g+=r.length,!1});if(s!=-1)return s+1;throw"Unknown name at position "+g},m=function(){if(t.charAt(g)!=e.charAt(y))throw"Unexpected literal at position "+g;g++},g=0;for(var y=0;y<e.length;y++)if(h)e.charAt(y)=="'"&&!p("'")?h=!1:m();else switch(e.charAt(y)){case"d":l=d("d");break;case"D":v("D",i,s);break;case"o":c=d("o");break;case"m":f=d("m");break;case"M":f=v("M",o,u);break;case"y":a=d("y");break;case"@":var b=new Date(d("@"));a=b.getFullYear(),f=b.getMonth()+1,l=b.getDate();break;case"!":var b=new Date((d("!")-this._ticksTo1970)/1e4);a=b.getFullYear(),f=b.getMonth()+1,l=b.getDate();break;case"'":p("'")?m():h=!0;break;default:m()}if(g<t.length){var w=t.substr(g);if(!/^\s+/.test(w))throw"Extra/unparsed characters found in date: "+w}a==-1?a=(new Date).getFullYear():a<100&&(a+=(new Date).getFullYear()-(new Date).getFullYear()%100+(a<=r?0:-100));if(c>-1){f=1,l=c;do{var E=this._getDaysInMonth(a,f-1);if(l<=E)break;f++,l-=E}while(!0)}var b=this._daylightSavingAdjust(new Date(a,f-1,l));if(b.getFullYear()!=a||b.getMonth()+1!=f||b.getDate()!=l)throw"Invalid date";return b},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1e7,formatDate:function(e,t,n){if(!t)return"";var r=(n?n.dayNamesShort:null)||this._defaults.dayNamesShort,i=(n?n.dayNames:null)||this._defaults.dayNames,s=(n?n.monthNamesShort:null)||this._defaults.monthNamesShort,o=(n?n.monthNames:null)||this._defaults.monthNames,u=function(t){var n=h+1<e.length&&e.charAt(h+1)==t;return n&&h++,n},a=function(e,t,n){var r=""+t;if(u(e))while(r.length<n)r="0"+r;return r},f=function(e,t,n,r){return u(e)?r[t]:n[t]},l="",c=!1;if(t)for(var h=0;h<e.length;h++)if(c)e.charAt(h)=="'"&&!u("'")?c=!1:l+=e.charAt(h);else switch(e.charAt(h)){case"d":l+=a("d",t.getDate(),2);break;case"D":l+=f("D",t.getDay(),r,i);break;case"o":l+=a("o",Math.round(((new Date(t.getFullYear(),t.getMonth(),t.getDate())).getTime()-(new Date(t.getFullYear(),0,0)).getTime())/864e5),3);break;case"m":l+=a("m",t.getMonth()+1,2);break;case"M":l+=f("M",t.getMonth(),s,o);break;case"y":l+=u("y")?t.getFullYear():(t.getYear()%100<10?"0":"")+t.getYear()%100;break;case"@":l+=t.getTime();break;case"!":l+=t.getTime()*1e4+this._ticksTo1970;break;case"'":u("'")?l+="'":c=!0;break;default:l+=e.charAt(h)}return l},_possibleChars:function(e){var t="",n=!1,r=function(t){var n=i+1<e.length&&e.charAt(i+1)==t;return n&&i++,n};for(var i=0;i<e.length;i++)if(n)e.charAt(i)=="'"&&!r("'")?n=!1:t+=e.charAt(i);else switch(e.charAt(i)){case"d":case"m":case"y":case"@":t+="0123456789";break;case"D":case"M":return null;case"'":r("'")?t+="'":n=!0;break;default:t+=e.charAt(i)}return t},_get:function(e,t){return e.settings[t]!==undefined?e.settings[t]:this._defaults[t]},_setDateFromField:function(e,t){if(e.input.val()==e.lastVal)return;var n=this._get(e,"dateFormat"),r=e.lastVal=e.input?e.input.val():null,i,s;i=s=this._getDefaultDate(e);var o=this._getFormatConfig(e);try{i=this.parseDate(n,r,o)||s}catch(u){this.log(u),r=t?"":r}e.selectedDay=i.getDate(),e.drawMonth=e.selectedMonth=i.getMonth(),e.drawYear=e.selectedYear=i.getFullYear(),e.currentDay=r?i.getDate():0,e.currentMonth=r?i.getMonth():0,e.currentYear=r?i.getFullYear():0,this._adjustInstDate(e)},_getDefaultDate:function(e){return this._restrictMinMax(e,this._determineDate(e,this._get(e,"defaultDate"),new Date))},_determineDate:function(e,t,n){var r=function(e){var t=new Date;return t.setDate(t.getDate()+e),t},i=function(t){try{return $.datepicker.parseDate($.datepicker._get(e,"dateFormat"),t,$.datepicker._getFormatConfig(e))}catch(n){}var r=(t.toLowerCase().match(/^c/)?$.datepicker._getDate(e):null)||new Date,i=r.getFullYear(),s=r.getMonth(),o=r.getDate(),u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,a=u.exec(t);while(a){switch(a[2]||"d"){case"d":case"D":o+=parseInt(a[1],10);break;case"w":case"W":o+=parseInt(a[1],10)*7;break;case"m":case"M":s+=parseInt(a[1],10),o=Math.min(o,$.datepicker._getDaysInMonth(i,s));break;case"y":case"Y":i+=parseInt(a[1],10),o=Math.min(o,$.datepicker._getDaysInMonth(i,s))}a=u.exec(t)}return new Date(i,s,o)},s=t==null||t===""?n:typeof t=="string"?i(t):typeof t=="number"?isNaN(t)?n:r(t):new Date(t.getTime());return s=s&&s.toString()=="Invalid Date"?n:s,s&&(s.setHours(0),s.setMinutes(0),s.setSeconds(0),s.setMilliseconds(0)),this._daylightSavingAdjust(s)},_daylightSavingAdjust:function(e){return e?(e.setHours(e.getHours()>12?e.getHours()+2:0),e):null},_setDate:function(e,t,n){var r=!t,i=e.selectedMonth,s=e.selectedYear,o=this._restrictMinMax(e,this._determineDate(e,t,new Date));e.selectedDay=e.currentDay=o.getDate(),e.drawMonth=e.selectedMonth=e.currentMonth=o.getMonth(),e.drawYear=e.selectedYear=e.currentYear=o.getFullYear(),(i!=e.selectedMonth||s!=e.selectedYear)&&!n&&this._notifyChange(e),this._adjustInstDate(e),e.input&&e.input.val(r?"":this._formatDate(e))},_getDate:function(e){var t=!e.currentYear||e.input&&e.input.val()==""?null:this._daylightSavingAdjust(new Date(e.currentYear,e.currentMonth,e.currentDay));return t},_attachHandlers:function(e){var t=this._get(e,"stepMonths"),n="#"+e.id.replace(/\\\\/g,"\\");e.dpDiv.find("[data-handler]").map(function(){var e={prev:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(n,-t,"M")},next:function(){window["DP_jQuery_"+dpuuid].datepicker._adjustDate(n,+t,"M")},hide:function(){window["DP_jQuery_"+dpuuid].datepicker._hideDatepicker()},today:function(){window["DP_jQuery_"+dpuuid].datepicker._gotoToday(n)},selectDay:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectDay(n,+this.getAttribute("data-month"),+this.getAttribute("data-year"),this),!1},selectMonth:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(n,this,"M"),!1},selectYear:function(){return window["DP_jQuery_"+dpuuid].datepicker._selectMonthYear(n,this,"Y"),!1}};$(this).bind(this.getAttribute("data-event"),e[this.getAttribute("data-handler")])})},_generateHTML:function(e){var t=new Date;t=this._daylightSavingAdjust(new Date(t.getFullYear(),t.getMonth(),t.getDate()));var n=this._get(e,"isRTL"),r=this._get(e,"showButtonPanel"),i=this._get(e,"hideIfNoPrevNext"),s=this._get(e,"navigationAsDateFormat"),o=this._getNumberOfMonths(e),u=this._get(e,"showCurrentAtPos"),a=this._get(e,"stepMonths"),f=o[0]!=1||o[1]!=1,l=this._daylightSavingAdjust(e.currentDay?new Date(e.currentYear,e.currentMonth,e.currentDay):new Date(9999,9,9)),c=this._getMinMaxDate(e,"min"),h=this._getMinMaxDate(e,"max"),p=e.drawMonth-u,d=e.drawYear;p<0&&(p+=12,d--);if(h){var v=this._daylightSavingAdjust(new Date(h.getFullYear(),h.getMonth()-o[0]*o[1]+1,h.getDate()));v=c&&v<c?c:v;while(this._daylightSavingAdjust(new Date(d,p,1))>v)p--,p<0&&(p=11,d--)}e.drawMonth=p,e.drawYear=d;var m=this._get(e,"prevText");m=s?this.formatDate(m,this._daylightSavingAdjust(new Date(d,p-a,1)),this._getFormatConfig(e)):m;var g=this._canAdjustMonth(e,-1,d,p)?'<a class="ui-datepicker-prev ui-corner-all" data-handler="prev" data-event="click" title="'+m+'"><span class="ui-icon ui-icon-circle-triangle-'+(n?"e":"w")+'">'+m+"</span></a>":i?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+m+'"><span class="ui-icon ui-icon-circle-triangle-'+(n?"e":"w")+'">'+m+"</span></a>",y=this._get(e,"nextText");y=s?this.formatDate(y,this._daylightSavingAdjust(new Date(d,p+a,1)),this._getFormatConfig(e)):y;var b=this._canAdjustMonth(e,1,d,p)?'<a class="ui-datepicker-next ui-corner-all" data-handler="next" data-event="click" title="'+y+'"><span class="ui-icon ui-icon-circle-triangle-'+(n?"w":"e")+'">'+y+"</span></a>":i?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+y+'"><span class="ui-icon ui-icon-circle-triangle-'+(n?"w":"e")+'">'+y+"</span></a>",w=this._get(e,"currentText"),E=this._get(e,"gotoCurrent")&&e.currentDay?l:t;w=s?this.formatDate(w,E,this._getFormatConfig(e)):w;var S=e.inline?"":'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" data-handler="hide" data-event="click">'+this._get(e,"closeText")+"</button>",x=r?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(n?S:"")+(this._isInRange(e,E)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" data-handler="today" data-event="click">'+w+"</button>":"")+(n?"":S)+"</div>":"",T=parseInt(this._get(e,"firstDay"),10);T=isNaN(T)?0:T;var N=this._get(e,"showWeek"),C=this._get(e,"dayNames"),k=this._get(e,"dayNamesShort"),L=this._get(e,"dayNamesMin"),A=this._get(e,"monthNames"),O=this._get(e,"monthNamesShort"),M=this._get(e,"beforeShowDay"),_=this._get(e,"showOtherMonths"),D=this._get(e,"selectOtherMonths"),P=this._get(e,"calculateWeek")||this.iso8601Week,H=this._getDefaultDate(e),B="";for(var j=0;j<o[0];j++){var F="";this.maxRows=4;for(var I=0;I<o[1];I++){var q=this._daylightSavingAdjust(new Date(d,p,e.selectedDay)),R=" ui-corner-all",U="";if(f){U+='<div class="ui-datepicker-group';if(o[1]>1)switch(I){case 0:U+=" ui-datepicker-group-first",R=" ui-corner-"+(n?"right":"left");break;case o[1]-1:U+=" ui-datepicker-group-last",R=" ui-corner-"+(n?"left":"right");break;default:U+=" ui-datepicker-group-middle",R=""}U+='">'}U+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+R+'">'+(/all|left/.test(R)&&j==0?n?b:g:"")+(/all|right/.test(R)&&j==0?n?g:b:"")+this._generateMonthYearHeader(e,p,d,c,h,j>0||I>0,A,O)+'</div><table class="ui-datepicker-calendar"><thead>'+"<tr>";var z=N?'<th class="ui-datepicker-week-col">'+this._get(e,"weekHeader")+"</th>":"";for(var W=0;W<7;W++){var X=(W+T)%7;z+="<th"+((W+T+6)%7>=5?' class="ui-datepicker-week-end"':"")+">"+'<span title="'+C[X]+'">'+L[X]+"</span></th>"}U+=z+"</tr></thead><tbody>";var V=this._getDaysInMonth(d,p);d==e.selectedYear&&p==e.selectedMonth&&(e.selectedDay=Math.min(e.selectedDay,V));var J=(this._getFirstDayOfMonth(d,p)-T+7)%7,K=Math.ceil((J+V)/7),Q=f?this.maxRows>K?this.maxRows:K:K;this.maxRows=Q;var G=this._daylightSavingAdjust(new Date(d,p,1-J));for(var Y=0;Y<Q;Y++){U+="<tr>";var Z=N?'<td class="ui-datepicker-week-col">'+this._get(e,"calculateWeek")(G)+"</td>":"";for(var W=0;W<7;W++){var et=M?M.apply(e.input?e.input[0]:null,[G]):[!0,""],tt=G.getMonth()!=p,nt=tt&&!D||!et[0]||c&&G<c||h&&G>h;Z+='<td class="'+((W+T+6)%7>=5?" ui-datepicker-week-end":"")+(tt?" ui-datepicker-other-month":"")+(G.getTime()==q.getTime()&&p==e.selectedMonth&&e._keyEvent||H.getTime()==G.getTime()&&H.getTime()==q.getTime()?" "+this._dayOverClass:"")+(nt?" "+this._unselectableClass+" ui-state-disabled":"")+(tt&&!_?"":" "+et[1]+(G.getTime()==l.getTime()?" "+this._currentClass:"")+(G.getTime()==t.getTime()?" ui-datepicker-today":""))+'"'+((!tt||_)&&et[2]?' title="'+et[2]+'"':"")+(nt?"":' data-handler="selectDay" data-event="click" data-month="'+G.getMonth()+'" data-year="'+G.getFullYear()+'"')+">"+(tt&&!_?" ":nt?'<span class="ui-state-default">'+G.getDate()+"</span>":'<a class="ui-state-default'+(G.getTime()==t.getTime()?" ui-state-highlight":"")+(G.getTime()==l.getTime()?" ui-state-active":"")+(tt?" ui-priority-secondary":"")+'" href="#">'+G.getDate()+"</a>")+"</td>",G.setDate(G.getDate()+1),G=this._daylightSavingAdjust(G)}U+=Z+"</tr>"}p++,p>11&&(p=0,d++),U+="</tbody></table>"+(f?"</div>"+(o[0]>0&&I==o[1]-1?'<div class="ui-datepicker-row-break"></div>':""):""),F+=U}B+=F}return B+=x+($.ui.ie6&&!e.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':""),e._keyEvent=!1,B},_generateMonthYearHeader:function(e,t,n,r,i,s,o,u){var a=this._get(e,"changeMonth"),f=this._get(e,"changeYear"),l=this._get(e,"showMonthAfterYear"),c='<div class="ui-datepicker-title">',h="";if(s||!a)h+='<span class="ui-datepicker-month">'+o[t]+"</span>";else{var p=r&&r.getFullYear()==n,d=i&&i.getFullYear()==n;h+='<select class="ui-datepicker-month" data-handler="selectMonth" data-event="change">';for(var v=0;v<12;v++)(!p||v>=r.getMonth())&&(!d||v<=i.getMonth())&&(h+='<option value="'+v+'"'+(v==t?' selected="selected"':"")+">"+u[v]+"</option>");h+="</select>"}l||(c+=h+(s||!a||!f?" ":""));if(!e.yearshtml){e.yearshtml="";if(s||!f)c+='<span class="ui-datepicker-year">'+n+"</span>";else{var m=this._get(e,"yearRange").split(":"),g=(new Date).getFullYear(),y=function(e){var t=e.match(/c[+-].*/)?n+parseInt(e.substring(1),10):e.match(/[+-].*/)?g+parseInt(e,10):parseInt(e,10);return isNaN(t)?g:t},b=y(m[0]),w=Math.max(b,y(m[1]||""));b=r?Math.max(b,r.getFullYear()):b,w=i?Math.min(w,i.getFullYear()):w,e.yearshtml+='<select class="ui-datepicker-year" data-handler="selectYear" data-event="change">';for(;b<=w;b++)e.yearshtml+='<option value="'+b+'"'+(b==n?' selected="selected"':"")+">"+b+"</option>";e.yearshtml+="</select>",c+=e.yearshtml,e.yearshtml=null}}return c+=this._get(e,"yearSuffix"),l&&(c+=(s||!a||!f?" ":"")+h),c+="</div>",c},_adjustInstDate:function(e,t,n){var r=e.drawYear+(n=="Y"?t:0),i=e.drawMonth+(n=="M"?t:0),s=Math.min(e.selectedDay,this._getDaysInMonth(r,i))+(n=="D"?t:0),o=this._restrictMinMax(e,this._daylightSavingAdjust(new Date(r,i,s)));e.selectedDay=o.getDate(),e.drawMonth=e.selectedMonth=o.getMonth(),e.drawYear=e.selectedYear=o.getFullYear(),(n=="M"||n=="Y")&&this._notifyChange(e)},_restrictMinMax:function(e,t){var n=this._getMinMaxDate(e,"min"),r=this._getMinMaxDate(e,"max"),i=n&&t<n?n:t;return i=r&&i>r?r:i,i},_notifyChange:function(e){var t=this._get(e,"onChangeMonthYear");t&&t.apply(e.input?e.input[0]:null,[e.selectedYear,e.selectedMonth+1,e])},_getNumberOfMonths:function(e){var t=this._get(e,"numberOfMonths");return t==null?[1,1]:typeof t=="number"?[1,t]:t},_getMinMaxDate:function(e,t){return this._determineDate(e,this._get(e,t+"Date"),null)},_getDaysInMonth:function(e,t){return 32-this._daylightSavingAdjust(new Date(e,t,32)).getDate()},_getFirstDayOfMonth:function(e,t){return(new Date(e,t,1)).getDay()},_canAdjustMonth:function(e,t,n,r){var i=this._getNumberOfMonths(e),s=this._daylightSavingAdjust(new Date(n,r+(t<0?t:i[0]*i[1]),1));return t<0&&s.setDate(this._getDaysInMonth(s.getFullYear(),s.getMonth())),this._isInRange(e,s)},_isInRange:function(e,t){var n=this._getMinMaxDate(e,"min"),r=this._getMinMaxDate(e,"max");return(!n||t.getTime()>=n.getTime())&&(!r||t.getTime()<=r.getTime())},_getFormatConfig:function(e){var t=this._get(e,"shortYearCutoff");return t=typeof t!="string"?t:(new Date).getFullYear()%100+parseInt(t,10),{shortYearCutoff:t,dayNamesShort:this._get(e,"dayNamesShort"),dayNames:this._get(e,"dayNames"),monthNamesShort:this._get(e,"monthNamesShort"),monthNames:this._get(e,"monthNames")}},_formatDate:function(e,t,n,r){t||(e.currentDay=e.selectedDay,e.currentMonth=e.selectedMonth,e.currentYear=e.selectedYear);var i=t?typeof t=="object"?t:this._daylightSavingAdjust(new Date(r,n,t)):this._daylightSavingAdjust(new Date(e.currentYear,e.currentMonth,e.currentDay));return this.formatDate(this._get(e,"dateFormat"),i,this._getFormatConfig(e))}}),$.fn.datepicker=function(e){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find(document.body).append($.datepicker.dpDiv),$.datepicker.initialized=!0);var t=Array.prototype.slice.call(arguments,1);return typeof e!="string"||e!="isDisabled"&&e!="getDate"&&e!="widget"?e=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+e+"Datepicker"].apply($.datepicker,[this[0]].concat(t)):this.each(function(){typeof e=="string"?$.datepicker["_"+e+"Datepicker"].apply($.datepicker,[this].concat(t)):$.datepicker._attachDatepicker(this,e)}):$.datepicker["_"+e+"Datepicker"].apply($.datepicker,[this[0]].concat(t))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.9.1",window["DP_jQuery_"+dpuuid]=$})(jQuery);(function(e,t){var n="ui-dialog ui-widget ui-widget-content ui-corner-all ",r={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},i={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0};e.widget("ui.dialog",{version:"1.9.1",options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",of:window,collision:"fit",using:function(t){var n=e(this).css(t).offset().top;n<0&&e(this).css("top",t.top-n)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.oldPosition={parent:this.element.parent(),index:this.element.parent().children().index(this.element)},this.options.title=this.options.title||this.originalTitle;var t=this,r=this.options,i=r.title||" ",s,o,u,a,f;s=(this.uiDialog=e("<div>")).addClass(n+r.dialogClass).css({display:"none",outline:0,zIndex:r.zIndex}).attr("tabIndex",-1).keydown(function(n){r.closeOnEscape&&!n.isDefaultPrevented()&&n.keyCode&&n.keyCode===e.ui.keyCode.ESCAPE&&(t.close(n),n.preventDefault())}).mousedown(function(e){t.moveToTop(!1,e)}).appendTo("body"),this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(s),o=(this.uiDialogTitlebar=e("<div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").bind("mousedown",function(){s.focus()}).prependTo(s),u=e("<a href='#'></a>").addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").click(function(e){e.preventDefault(),t.close(e)}).appendTo(o),(this.uiDialogTitlebarCloseText=e("<span>")).addClass("ui-icon ui-icon-closethick").text(r.closeText).appendTo(u),a=e("<span>").uniqueId().addClass("ui-dialog-title").html(i).prependTo(o),f=(this.uiDialogButtonPane=e("<div>")).addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),(this.uiButtonSet=e("<div>")).addClass("ui-dialog-buttonset").appendTo(f),s.attr({role:"dialog","aria-labelledby":a.attr("id")}),o.find("*").add(o).disableSelection(),this._hoverable(u),this._focusable(u),r.draggable&&e.fn.draggable&&this._makeDraggable(),r.resizable&&e.fn.resizable&&this._makeResizable(),this._createButtons(r.buttons),this._isOpen=!1,e.fn.bgiframe&&s.bgiframe(),this._on(s,{keydown:function(t){if(!r.modal||t.keyCode!==e.ui.keyCode.TAB)return;var n=e(":tabbable",s),i=n.filter(":first"),o=n.filter(":last");if(t.target===o[0]&&!t.shiftKey)return i.focus(1),!1;if(t.target===i[0]&&t.shiftKey)return o.focus(1),!1}})},_init:function(){this.options.autoOpen&&this.open()},_destroy:function(){var e,t=this.oldPosition;this.overlay&&this.overlay.destroy(),this.uiDialog.hide(),this.element.removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),this.uiDialog.remove(),this.originalTitle&&this.element.attr("title",this.originalTitle),e=t.parent.children().eq(t.index),e.length&&e[0]!==this.element[0]?e.before(this.element):t.parent.append(this.element)},widget:function(){return this.uiDialog},close:function(t){var n=this,r,i;if(!this._isOpen)return;if(!1===this._trigger("beforeClose",t))return;return this._isOpen=!1,this.overlay&&this.overlay.destroy(),this.options.hide?this._hide(this.uiDialog,this.options.hide,function(){n._trigger("close",t)}):(this.uiDialog.hide(),this._trigger("close",t)),e.ui.dialog.overlay.resize(),this.options.modal&&(r=0,e(".ui-dialog").each(function(){this!==n.uiDialog[0]&&(i=e(this).css("z-index"),isNaN(i)||(r=Math.max(r,i)))}),e.ui.dialog.maxZ=r),this},isOpen:function(){return this._isOpen},moveToTop:function(t,n){var r=this.options,i;return r.modal&&!t||!r.stack&&!r.modal?this._trigger("focus",n):(r.zIndex>e.ui.dialog.maxZ&&(e.ui.dialog.maxZ=r.zIndex),this.overlay&&(e.ui.dialog.maxZ+=1,e.ui.dialog.overlay.maxZ=e.ui.dialog.maxZ,this.overlay.$el.css("z-index",e.ui.dialog.overlay.maxZ)),i={scrollTop:this.element.scrollTop(),scrollLeft:this.element.scrollLeft()},e.ui.dialog.maxZ+=1,this.uiDialog.css("z-index",e.ui.dialog.maxZ),this.element.attr(i),this._trigger("focus",n),this)},open:function(){if(this._isOpen)return;var t,n=this.options,r=this.uiDialog;return this._size(),this._position(n.position),r.show(n.show),this.overlay=n.modal?new e.ui.dialog.overlay(this):null,this.moveToTop(!0),t=this.element.find(":tabbable"),t.length||(t=this.uiDialogButtonPane.find(":tabbable"),t.length||(t=r)),t.eq(0).focus(),this._isOpen=!0,this._trigger("open"),this},_createButtons:function(t){var n=this,r=!1;this.uiDialogButtonPane.remove(),this.uiButtonSet.empty(),typeof t=="object"&&t!==null&&e.each(t,function(){return!(r=!0)}),r?(e.each(t,function(t,r){r=e.isFunction(r)?{click:r,text:t}:r;var i=e("<button type='button'></button>").attr(r,!0).unbind("click").click(function(){r.click.apply(n.element[0],arguments)}).appendTo(n.uiButtonSet);e.fn.button&&i.button()}),this.uiDialog.addClass("ui-dialog-buttons"),this.uiDialogButtonPane.appendTo(this.uiDialog)):this.uiDialog.removeClass("ui-dialog-buttons")},_makeDraggable:function(){function r(e){return{position:e.position,offset:e.offset}}var t=this,n=this.options;this.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(n,i){e(this).addClass("ui-dialog-dragging"),t._trigger("dragStart",n,r(i))},drag:function(e,n){t._trigger("drag",e,r(n))},stop:function(i,s){n.position=[s.position.left-t.document.scrollLeft(),s.position.top-t.document.scrollTop()],e(this).removeClass("ui-dialog-dragging"),t._trigger("dragStop",i,r(s)),e.ui.dialog.overlay.resize()}})},_makeResizable:function(n){function u(e){return{originalPosition:e.originalPosition,originalSize:e.originalSize,position:e.position,size:e.size}}n=n===t?this.options.resizable:n;var r=this,i=this.options,s=this.uiDialog.css("position"),o=typeof n=="string"?n:"n,e,s,w,se,sw,ne,nw";this.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:this.element,maxWidth:i.maxWidth,maxHeight:i.maxHeight,minWidth:i.minWidth,minHeight:this._minHeight(),handles:o,start:function(t,n){e(this).addClass("ui-dialog-resizing"),r._trigger("resizeStart",t,u(n))},resize:function(e,t){r._trigger("resize",e,u(t))},stop:function(t,n){e(this).removeClass("ui-dialog-resizing"),i.height=e(this).height(),i.width=e(this).width(),r._trigger("resizeStop",t,u(n)),e.ui.dialog.overlay.resize()}}).css("position",s).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var e=this.options;return e.height==="auto"?e.minHeight:Math.min(e.minHeight,e.height)},_position:function(t){var n=[],r=[0,0],i;if(t){if(typeof t=="string"||typeof t=="object"&&"0"in t)n=t.split?t.split(" "):[t[0],t[1]],n.length===1&&(n[1]=n[0]),e.each(["left","top"],function(e,t){+n[e]===n[e]&&(r[e]=n[e],n[e]=t)}),t={my:n[0]+(r[0]<0?r[0]:"+"+r[0])+" "+n[1]+(r[1]<0?r[1]:"+"+r[1]),at:n.join(" ")};t=e.extend({},e.ui.dialog.prototype.options.position,t)}else t=e.ui.dialog.prototype.options.position;i=this.uiDialog.is(":visible"),i||this.uiDialog.show(),this.uiDialog.position(t),i||this.uiDialog.hide()},_setOptions:function(t){var n=this,s={},o=!1;e.each(t,function(e,t){n._setOption(e,t),e in r&&(o=!0),e in i&&(s[e]=t)}),o&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",s)},_setOption:function(t,r){var i,s,o=this.uiDialog;switch(t){case"buttons":this._createButtons(r);break;case"closeText":this.uiDialogTitlebarCloseText.text(""+r);break;case"dialogClass":o.removeClass(this.options.dialogClass).addClass(n+r);break;case"disabled":r?o.addClass("ui-dialog-disabled"):o.removeClass("ui-dialog-disabled");break;case"draggable":i=o.is(":data(draggable)"),i&&!r&&o.draggable("destroy"),!i&&r&&this._makeDraggable();break;case"position":this._position(r);break;case"resizable":s=o.is(":data(resizable)"),s&&!r&&o.resizable("destroy"),s&&typeof r=="string"&&o.resizable("option","handles",r),!s&&r!==!1&&this._makeResizable(r);break;case"title":e(".ui-dialog-title",this.uiDialogTitlebar).html(""+(r||" "))}this._super(t,r)},_size:function(){var t,n,r,i=this.options,s=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),i.minWidth>i.width&&(i.width=i.minWidth),t=this.uiDialog.css({height:"auto",width:i.width}).outerHeight(),n=Math.max(0,i.minHeight-t),i.height==="auto"?e.support.minHeight?this.element.css({minHeight:n,height:"auto"}):(this.uiDialog.show(),r=this.element.css("height","auto").height(),s||this.uiDialog.hide(),this.element.height(Math.max(r,n))):this.element.height(Math.max(i.height-t,0)),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),e.extend(e.ui.dialog,{uuid:0,maxZ:0,getTitleId:function(e){var t=e.attr("id");return t||(this.uuid+=1,t=this.uuid),"ui-dialog-title-"+t},overlay:function(t){this.$el=e.ui.dialog.overlay.create(t)}}),e.extend(e.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:e.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(e){return e+".dialog-overlay"}).join(" "),create:function(t){this.instances.length===0&&(setTimeout(function(){e.ui.dialog.overlay.instances.length&&e(document).bind(e.ui.dialog.overlay.events,function(t){if(e(t.target).zIndex()<e.ui.dialog.overlay.maxZ)return!1})},1),e(window).bind("resize.dialog-overlay",e.ui.dialog.overlay.resize));var n=this.oldInstances.pop()||e("<div>").addClass("ui-widget-overlay");return e(document).bind("keydown.dialog-overlay",function(r){var i=e.ui.dialog.overlay.instances;i.length!==0&&i[i.length-1]===n&&t.options.closeOnEscape&&!r.isDefaultPrevented()&&r.keyCode&&r.keyCode===e.ui.keyCode.ESCAPE&&(t.close(r),r.preventDefault())}),n.appendTo(document.body).css({width:this.width(),height:this.height()}),e.fn.bgiframe&&n.bgiframe(),this.instances.push(n),n},destroy:function(t){var n=e.inArray(t,this.instances),r=0;n!==-1&&this.oldInstances.push(this.instances.splice(n,1)[0]),this.instances.length===0&&e([document,window]).unbind(".dialog-overlay"),t.height(0).width(0).remove(),e.each(this.instances,function(){r=Math.max(r,this.css("z-index"))}),this.maxZ=r},height:function(){var t,n;return e.ui.ie?(t=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),n=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),t<n?e(window).height()+"px":t+"px"):e(document).height()+"px"},width:function(){var t,n;return e.ui.ie?(t=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth),n=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth),t<n?e(window).width()+"px":t+"px"):e(document).width()+"px"},resize:function(){var t=e([]);e.each(e.ui.dialog.overlay.instances,function(){t=t.add(this)}),t.css({width:0,height:0}).css({width:e.ui.dialog.overlay.width(),height:e.ui.dialog.overlay.height()})}}),e.extend(e.ui.dialog.overlay.prototype,{destroy:function(){e.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);(function(e,t){var n=!1;e.widget("ui.menu",{version:"1.9.1",defaultElement:"<ul>",delay:300,options:{icons:{submenu:"ui-icon-carat-1-e"},menus:"ul",position:{my:"left top",at:"right top"},role:"menu",blur:null,focus:null,select:null},_create:function(){this.activeMenu=this.element,this.element.uniqueId().addClass("ui-menu ui-widget ui-widget-content ui-corner-all").toggleClass("ui-menu-icons",!!this.element.find(".ui-icon").length).attr({role:this.options.role,tabIndex:0}).bind("click"+this.eventNamespace,e.proxy(function(e){this.options.disabled&&e.preventDefault()},this)),this.options.disabled&&this.element.addClass("ui-state-disabled").attr("aria-disabled","true"),this._on({"mousedown .ui-menu-item > a":function(e){e.preventDefault()},"click .ui-state-disabled > a":function(e){e.preventDefault()},"click .ui-menu-item:has(a)":function(t){var r=e(t.target).closest(".ui-menu-item");!n&&r.not(".ui-state-disabled").length&&(n=!0,this.select(t),r.has(".ui-menu").length?this.expand(t):this.element.is(":focus")||(this.element.trigger("focus",[!0]),this.active&&this.active.parents(".ui-menu").length===1&&clearTimeout(this.timer)))},"mouseenter .ui-menu-item":function(t){var n=e(t.currentTarget);n.siblings().children(".ui-state-active").removeClass("ui-state-active"),this.focus(t,n)},mouseleave:"collapseAll","mouseleave .ui-menu":"collapseAll",focus:function(e,t){var n=this.active||this.element.children(".ui-menu-item").eq(0);t||this.focus(e,n)},blur:function(t){this._delay(function(){e.contains(this.element[0],this.document[0].activeElement)||this.collapseAll(t)})},keydown:"_keydown"}),this.refresh(),this._on(this.document,{click:function(t){e(t.target).closest(".ui-menu").length||this.collapseAll(t),n=!1}})},_destroy:function(){this.element.removeAttr("aria-activedescendant").find(".ui-menu").andSelf().removeClass("ui-menu ui-widget ui-widget-content ui-corner-all ui-menu-icons").removeAttr("role").removeAttr("tabIndex").removeAttr("aria-labelledby").removeAttr("aria-expanded").removeAttr("aria-hidden").removeAttr("aria-disabled").removeUniqueId().show(),this.element.find(".ui-menu-item").removeClass("ui-menu-item").removeAttr("role").removeAttr("aria-disabled").children("a").removeUniqueId().removeClass("ui-corner-all ui-state-hover").removeAttr("tabIndex").removeAttr("role").removeAttr("aria-haspopup").children().each(function(){var t=e(this);t.data("ui-menu-submenu-carat")&&t.remove()}),this.element.find(".ui-menu-divider").removeClass("ui-menu-divider ui-widget-content")},_keydown:function(t){function a(e){return e.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&")}var n,r,i,s,o,u=!0;switch(t.keyCode){case e.ui.keyCode.PAGE_UP:this.previousPage(t);break;case e.ui.keyCode.PAGE_DOWN:this.nextPage(t);break;case e.ui.keyCode.HOME:this._move("first","first",t);break;case e.ui.keyCode.END:this._move("last","last",t);break;case e.ui.keyCode.UP:this.previous(t);break;case e.ui.keyCode.DOWN:this.next(t);break;case e.ui.keyCode.LEFT:this.collapse(t);break;case e.ui.keyCode.RIGHT:this.active&&!this.active.is(".ui-state-disabled")&&this.expand(t);break;case e.ui.keyCode.ENTER:case e.ui.keyCode.SPACE:this._activate(t);break;case e.ui.keyCode.ESCAPE:this.collapse(t);break;default:u=!1,r=this.previousFilter||"",i=String.fromCharCode(t.keyCode),s=!1,clearTimeout(this.filterTimer),i===r?s=!0:i=r+i,o=new RegExp("^"+a(i),"i"),n=this.activeMenu.children(".ui-menu-item").filter(function(){return o.test(e(this).children("a").text())}),n=s&&n.index(this.active.next())!==-1?this.active.nextAll(".ui-menu-item"):n,n.length||(i=String.fromCharCode(t.keyCode),o=new RegExp("^"+a(i),"i"),n=this.activeMenu.children(".ui-menu-item").filter(function(){return o.test(e(this).children("a").text())})),n.length?(this.focus(t,n),n.length>1?(this.previousFilter=i,this.filterTimer=this._delay(function(){delete this.previousFilter},1e3)):delete this.previousFilter):delete this.previousFilter}u&&t.preventDefault()},_activate:function(e){this.active.is(".ui-state-disabled")||(this.active.children("a[aria-haspopup='true']").length?this.expand(e):this.select(e))},refresh:function(){var t,n=this.options.icons.submenu,r=this.element.find(this.options.menus+":not(.ui-menu)").addClass("ui-menu ui-widget ui-widget-content ui-corner-all").hide().attr({role:this.options.role,"aria-hidden":"true","aria-expanded":"false"});t=r.add(this.element),t.children(":not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","presentation").children("a").uniqueId().addClass("ui-corner-all").attr({tabIndex:-1,role:this._itemRole()}),t.children(":not(.ui-menu-item)").each(function(){var t=e(this);/[^\-—–\s]/.test(t.text())||t.addClass("ui-widget-content ui-menu-divider")}),t.children(".ui-state-disabled").attr("aria-disabled","true"),r.each(function(){var t=e(this),r=t.prev("a"),i=e("<span>").addClass("ui-menu-icon ui-icon "+n).data("ui-menu-submenu-carat",!0);r.attr("aria-haspopup","true").prepend(i),t.attr("aria-labelledby",r.attr("id"))}),this.active&&!e.contains(this.element[0],this.active[0])&&this.blur()},_itemRole:function(){return{menu:"menuitem",listbox:"option"}[this.options.role]},focus:function(e,t){var n,r;this.blur(e,e&&e.type==="focus"),this._scrollIntoView(t),this.active=t.first(),r=this.active.children("a").addClass("ui-state-focus"),this.options.role&&this.element.attr("aria-activedescendant",r.attr("id")),this.active.parent().closest(".ui-menu-item").children("a:first").addClass("ui-state-active"),e&&e.type==="keydown"?this._close():this.timer=this._delay(function(){this._close()},this.delay),n=t.children(".ui-menu"),n.length&&/^mouse/.test(e.type)&&this._startOpening(n),this.activeMenu=t.parent(),this._trigger("focus",e,{item:t})},_scrollIntoView:function(t){var n,r,i,s,o,u;this._hasScroll()&&(n=parseFloat(e.css(this.activeMenu[0],"borderTopWidth"))||0,r=parseFloat(e.css(this.activeMenu[0],"paddingTop"))||0,i=t.offset().top-this.activeMenu.offset().top-n-r,s=this.activeMenu.scrollTop(),o=this.activeMenu.height(),u=t.height(),i<0?this.activeMenu.scrollTop(s+i):i+u>o&&this.activeMenu.scrollTop(s+i-o+u))},blur:function(e,t){t||clearTimeout(this.timer);if(!this.active)return;this.active.children("a").removeClass("ui-state-focus"),this.active=null,this._trigger("blur",e,{item:this.active})},_startOpening:function(e){clearTimeout(this.timer);if(e.attr("aria-hidden")!=="true")return;this.timer=this._delay(function(){this._close(),this._open(e)},this.delay)},_open:function(t){var n=e.extend({of:this.active},this.options.position);clearTimeout(this.timer),this.element.find(".ui-menu").not(t.parents(".ui-menu")).hide().attr("aria-hidden","true"),t.show().removeAttr("aria-hidden").attr("aria-expanded","true").position(n)},collapseAll:function(t,n){clearTimeout(this.timer),this.timer=this._delay(function(){var r=n?this.element:e(t&&t.target).closest(this.element.find(".ui-menu"));r.length||(r=this.element),this._close(r),this.blur(t),this.activeMenu=r},this.delay)},_close:function(e){e||(e=this.active?this.active.parent():this.element),e.find(".ui-menu").hide().attr("aria-hidden","true").attr("aria-expanded","false").end().find("a.ui-state-active").removeClass("ui-state-active")},collapse:function(e){var t=this.active&&this.active.parent().closest(".ui-menu-item",this.element);t&&t.length&&(this._close(),this.focus(e,t))},expand:function(e){var t=this.active&&this.active.children(".ui-menu ").children(".ui-menu-item").first();t&&t.length&&(this._open(t.parent()),this._delay(function(){this.focus(e,t)}))},next:function(e){this._move("next","first",e)},previous:function(e){this._move("prev","last",e)},isFirstItem:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},isLastItem:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},_move:function(e,t,n){var r;this.active&&(e==="first"||e==="last"?r=this.active[e==="first"?"prevAll":"nextAll"](".ui-menu-item").eq(-1):r=this.active[e+"All"](".ui-menu-item").eq(0));if(!r||!r.length||!this.active)r=this.activeMenu.children(".ui-menu-item")[t]();this.focus(n,r)},nextPage:function(t){var n,r,i;if(!this.active){this.next(t);return}if(this.isLastItem())return;this._hasScroll()?(r=this.active.offset().top,i=this.element.height(),this.active.nextAll(".ui-menu-item").each(function(){return n=e(this),n.offset().top-r-i<0}),this.focus(t,n)):this.focus(t,this.activeMenu.children(".ui-menu-item")[this.active?"last":"first"]())},previousPage:function(t){var n,r,i;if(!this.active){this.next(t);return}if(this.isFirstItem())return;this._hasScroll()?(r=this.active.offset().top,i=this.element.height(),this.active.prevAll(".ui-menu-item").each(function(){return n=e(this),n.offset().top-r+i>0}),this.focus(t,n)):this.focus(t,this.activeMenu.children(".ui-menu-item").first())},_hasScroll:function(){return this.element.outerHeight()<this.element.prop("scrollHeight")},select:function(t){this.active=this.active||e(t.target).closest(".ui-menu-item");var n={item:this.active};this.active.has(".ui-menu").length||this.collapseAll(t,!0),this._trigger("select",t,n)}})})(jQuery);(function(e,t){e.widget("ui.progressbar",{version:"1.9.1",options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()}),this.valueDiv=e("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},_destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove()},value:function(e){return e===t?this._value():(this._setOption("value",e),this)},_setOption:function(e,t){e==="value"&&(this.options.value=t,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),this._super(e,t)},_value:function(){var e=this.options.value;return typeof e!="number"&&(e=0),Math.min(this.options.max,Math.max(this.min,e))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var e=this.value(),t=this._percentage();this.oldValue!==e&&(this.oldValue=e,this._trigger("change")),this.valueDiv.toggle(e>this.min).toggleClass("ui-corner-right",e===this.options.max).width(t.toFixed(0)+"%"),this.element.attr("aria-valuenow",e)}})})(jQuery);(function(e,t){var n=5;e.widget("ui.slider",e.ui.mouse,{version:"1.9.1",widgetEventPrefix:"slide",options:{animate:!1,distance:0,max:100,min:0,orientation:"horizontal",range:!1,step:1,value:0,values:null},_create:function(){var t,r,i=this.options,s=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),o="<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",u=[];this._keySliding=!1,this._mouseSliding=!1,this._animateOff=!0,this._handleIndex=null,this._detectOrientation(),this._mouseInit(),this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget"+" ui-widget-content"+" ui-corner-all"+(i.disabled?" ui-slider-disabled ui-disabled":"")),this.range=e([]),i.range&&(i.range===!0&&(i.values||(i.values=[this._valueMin(),this._valueMin()]),i.values.length&&i.values.length!==2&&(i.values=[i.values[0],i.values[0]])),this.range=e("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(i.range==="min"||i.range==="max"?" ui-slider-range-"+i.range:""))),r=i.values&&i.values.length||1;for(t=s.length;t<r;t++)u.push(o);this.handles=s.add(e(u.join("")).appendTo(this.element)),this.handle=this.handles.eq(0),this.handles.add(this.range).filter("a").click(function(e){e.preventDefault()}).mouseenter(function(){i.disabled||e(this).addClass("ui-state-hover")}).mouseleave(function(){e(this).removeClass("ui-state-hover")}).focus(function(){i.disabled?e(this).blur():(e(".ui-slider .ui-state-focus").removeClass("ui-state-focus"),e(this).addClass("ui-state-focus"))}).blur(function(){e(this).removeClass("ui-state-focus")}),this.handles.each(function(t){e(this).data("ui-slider-handle-index",t)}),this._on(this.handles,{keydown:function(t){var r,i,s,o,u=e(t.target).data("ui-slider-handle-index");switch(t.keyCode){case e.ui.keyCode.HOME:case e.ui.keyCode.END:case e.ui.keyCode.PAGE_UP:case e.ui.keyCode.PAGE_DOWN:case e.ui.keyCode.UP:case e.ui.keyCode.RIGHT:case e.ui.keyCode.DOWN:case e.ui.keyCode.LEFT:t.preventDefault();if(!this._keySliding){this._keySliding=!0,e(t.target).addClass("ui-state-active"),r=this._start(t,u);if(r===!1)return}}o=this.options.step,this.options.values&&this.options.values.length?i=s=this.values(u):i=s=this.value();switch(t.keyCode){case e.ui.keyCode.HOME:s=this._valueMin();break;case e.ui.keyCode.END:s=this._valueMax();break;case e.ui.keyCode.PAGE_UP:s=this._trimAlignValue(i+(this._valueMax()-this._valueMin())/n);break;case e.ui.keyCode.PAGE_DOWN:s=this._trimAlignValue(i-(this._valueMax()-this._valueMin())/n);break;case e.ui.keyCode.UP:case e.ui.keyCode.RIGHT:if(i===this._valueMax())return;s=this._trimAlignValue(i+o);break;case e.ui.keyCode.DOWN:case e.ui.keyCode.LEFT:if(i===this._valueMin())return;s=this._trimAlignValue(i-o)}this._slide(t,u,s)},keyup:function(t){var n=e(t.target).data("ui-slider-handle-index");this._keySliding&&(this._keySliding=!1,this._stop(t,n),this._change(t,n),e(t.target).removeClass("ui-state-active"))}}),this._refreshValue(),this._animateOff=!1},_destroy:function(){this.handles.remove(),this.range.remove(),this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all"),this._mouseDestroy()},_mouseCapture:function(t){var n,r,i,s,o,u,a,f,l=this,c=this.options;return c.disabled?!1:(this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()},this.elementOffset=this.element.offset(),n={x:t.pageX,y:t.pageY},r=this._normValueFromMouse(n),i=this._valueMax()-this._valueMin()+1,this.handles.each(function(t){var n=Math.abs(r-l.values(t));i>n&&(i=n,s=e(this),o=t)}),c.range===!0&&this.values(1)===c.min&&(o+=1,s=e(this.handles[o])),u=this._start(t,o),u===!1?!1:(this._mouseSliding=!0,this._handleIndex=o,s.addClass("ui-state-active").focus(),a=s.offset(),f=!e(t.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=f?{left:0,top:0}:{left:t.pageX-a.left-s.width()/2,top:t.pageY-a.top-s.height()/2-(parseInt(s.css("borderTopWidth"),10)||0)-(parseInt(s.css("borderBottomWidth"),10)||0)+(parseInt(s.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(t,o,r),this._animateOff=!0,!0))},_mouseStart:function(){return!0},_mouseDrag:function(e){var t={x:e.pageX,y:e.pageY},n=this._normValueFromMouse(t);return this._slide(e,this._handleIndex,n),!1},_mouseStop:function(e){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(e,this._handleIndex),this._change(e,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(e){var t,n,r,i,s;return this.orientation==="horizontal"?(t=this.elementSize.width,n=e.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(t=this.elementSize.height,n=e.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),r=n/t,r>1&&(r=1),r<0&&(r=0),this.orientation==="vertical"&&(r=1-r),i=this._valueMax()-this._valueMin(),s=this._valueMin()+r*i,this._trimAlignValue(s)},_start:function(e,t){var n={handle:this.handles[t],value:this.value()};return this.options.values&&this.options.values.length&&(n.value=this.values(t),n.values=this.values()),this._trigger("start",e,n)},_slide:function(e,t,n){var r,i,s;this.options.values&&this.options.values.length?(r=this.values(t?0:1),this.options.values.length===2&&this.options.range===!0&&(t===0&&n>r||t===1&&n<r)&&(n=r),n!==this.values(t)&&(i=this.values(),i[t]=n,s=this._trigger("slide",e,{handle:this.handles[t],value:n,values:i}),r=this.values(t?0:1),s!==!1&&this.values(t,n,!0))):n!==this.value()&&(s=this._trigger("slide",e,{handle:this.handles[t],value:n}),s!==!1&&this.value(n))},_stop:function(e,t){var n={handle:this.handles[t],value:this.value()};this.options.values&&this.options.values.length&&(n.value=this.values(t),n.values=this.values()),this._trigger("stop",e,n)},_change:function(e,t){if(!this._keySliding&&!this._mouseSliding){var n={handle:this.handles[t],value:this.value()};this.options.values&&this.options.values.length&&(n.value=this.values(t),n.values=this.values()),this._trigger("change",e,n)}},value:function(e){if(arguments.length){this.options.value=this._trimAlignValue(e),this._refreshValue(),this._change(null,0);return}return this._value()},values:function(t,n){var r,i,s;if(arguments.length>1){this.options.values[t]=this._trimAlignValue(n),this._refreshValue(),this._change(null,t);return}if(!arguments.length)return this._values();if(!e.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(t):this.value();r=this.options.values,i=arguments[0];for(s=0;s<r.length;s+=1)r[s]=this._trimAlignValue(i[s]),this._change(null,s);this._refreshValue()},_setOption:function(t,n){var r,i=0;e.isArray(this.options.values)&&(i=this.options.values.length),e.Widget.prototype._setOption.apply(this,arguments);switch(t){case"disabled":n?(this.handles.filter(".ui-state-focus").blur(),this.handles.removeClass("ui-state-hover"),this.handles.prop("disabled",!0),this.element.addClass("ui-disabled")):(this.handles.prop("disabled",!1),this.element.removeClass("ui-disabled"));break;case"orientation":this._detectOrientation(),this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation),this._refreshValue();break;case"value":this._animateOff=!0,this._refreshValue(),this._change(null,0),this._animateOff=!1;break;case"values":this._animateOff=!0,this._refreshValue();for(r=0;r<i;r+=1)this._change(null,r);this._animateOff=!1;break;case"min":case"max":this._animateOff=!0,this._refreshValue(),this._animateOff=!1}},_value:function(){var e=this.options.value;return e=this._trimAlignValue(e),e},_values:function(e){var t,n,r;if(arguments.length)return t=this.options.values[e],t=this._trimAlignValue(t),t;n=this.options.values.slice();for(r=0;r<n.length;r+=1)n[r]=this._trimAlignValue(n[r]);return n},_trimAlignValue:function(e){if(e<=this._valueMin())return this._valueMin();if(e>=this._valueMax())return this._valueMax();var t=this.options.step>0?this.options.step:1,n=(e-this._valueMin())%t,r=e-n;return Math.abs(n)*2>=t&&(r+=n>0?t:-t),parseFloat(r.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var t,n,r,i,s,o=this.options.range,u=this.options,a=this,f=this._animateOff?!1:u.animate,l={};this.options.values&&this.options.values.length?this.handles.each(function(r){n=(a.values(r)-a._valueMin())/(a._valueMax()-a._valueMin())*100,l[a.orientation==="horizontal"?"left":"bottom"]=n+"%",e(this).stop(1,1)[f?"animate":"css"](l,u.animate),a.options.range===!0&&(a.orientation==="horizontal"?(r===0&&a.range.stop(1,1)[f?"animate":"css"]({left:n+"%"},u.animate),r===1&&a.range[f?"animate":"css"]({width:n-t+"%"},{queue:!1,duration:u.animate})):(r===0&&a.range.stop(1,1)[f?"animate":"css"]({bottom:n+"%"},u.animate),r===1&&a.range[f?"animate":"css"]({height:n-t+"%"},{queue:!1,duration:u.animate}))),t=n}):(r=this.value(),i=this._valueMin(),s=this._valueMax(),n=s!==i?(r-i)/(s-i)*100:0,l[this.orientation==="horizontal"?"left":"bottom"]=n+"%",this.handle.stop(1,1)[f?"animate":"css"](l,u.animate),o==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[f?"animate":"css"]({width:n+"%"},u.animate),o==="max"&&this.orientation==="horizontal"&&this.range[f?"animate":"css"]({width:100-n+"%"},{queue:!1,duration:u.animate}),o==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[f?"animate":"css"]({height:n+"%"},u.animate),o==="max"&&this.orientation==="vertical"&&this.range[f?"animate":"css"]({height:100-n+"%"},{queue:!1,duration:u.animate}))}})})(jQuery);(function(e){function t(e){return function(){var t=this.element.val();e.apply(this,arguments),this._refresh(),t!==this.element.val()&&this._trigger("change")}}e.widget("ui.spinner",{version:"1.9.1",defaultElement:"<input>",widgetEventPrefix:"spin",options:{culture:null,icons:{down:"ui-icon-triangle-1-s",up:"ui-icon-triangle-1-n"},incremental:!0,max:null,min:null,numberFormat:null,page:10,step:1,change:null,spin:null,start:null,stop:null},_create:function(){this._setOption("max",this.options.max),this._setOption("min",this.options.min),this._setOption("step",this.options.step),this._value(this.element.val(),!0),this._draw(),this._on(this._events),this._refresh(),this._on(this.window,{beforeunload:function(){this.element.removeAttr("autocomplete")}})},_getCreateOptions:function(){var t={},n=this.element;return e.each(["min","max","step"],function(e,r){var i=n.attr(r);i!==undefined&&i.length&&(t[r]=i)}),t},_events:{keydown:function(e){this._start(e)&&this._keydown(e)&&e.preventDefault()},keyup:"_stop",focus:function(){this.previous=this.element.val()},blur:function(e){if(this.cancelBlur){delete this.cancelBlur;return}this._refresh(),this.previous!==this.element.val()&&this._trigger("change",e)},mousewheel:function(e,t){if(!t)return;if(!this.spinning&&!this._start(e))return!1;this._spin((t>0?1:-1)*this.options.step,e),clearTimeout(this.mousewheelTimer),this.mousewheelTimer=this._delay(function(){this.spinning&&this._stop(e)},100),e.preventDefault()},"mousedown .ui-spinner-button":function(t){function r(){var e=this.element[0]===this.document[0].activeElement;e||(this.element.focus(),this.previous=n,this._delay(function(){this.previous=n}))}var n;n=this.element[0]===this.document[0].activeElement?this.previous:this.element.val(),t.preventDefault(),r.call(this),this.cancelBlur=!0,this._delay(function(){delete this.cancelBlur,r.call(this)});if(this._start(t)===!1)return;this._repeat(null,e(t.currentTarget).hasClass("ui-spinner-up")?1:-1,t)},"mouseup .ui-spinner-button":"_stop","mouseenter .ui-spinner-button":function(t){if(!e(t.currentTarget).hasClass("ui-state-active"))return;if(this._start(t)===!1)return!1;this._repeat(null,e(t.currentTarget).hasClass("ui-spinner-up")?1:-1,t)},"mouseleave .ui-spinner-button":"_stop"},_draw:function(){var e=this.uiSpinner=this.element.addClass("ui-spinner-input").attr("autocomplete","off").wrap(this._uiSpinnerHtml()).parent().append(this._buttonHtml());this.element.attr("role","spinbutton"),this.buttons=e.find(".ui-spinner-button").attr("tabIndex",-1).button().removeClass("ui-corner-all"),this.buttons.height()>Math.ceil(e.height()*.5)&&e.height()>0&&e.height(e.height()),this.options.disabled&&this.disable()},_keydown:function(t){var n=this.options,r=e.ui.keyCode;switch(t.keyCode){case r.UP:return this._repeat(null,1,t),!0;case r.DOWN:return this._repeat(null,-1,t),!0;case r.PAGE_UP:return this._repeat(null,n.page,t),!0;case r.PAGE_DOWN:return this._repeat(null,-n.page,t),!0}return!1},_uiSpinnerHtml:function(){return"<span class='ui-spinner ui-widget ui-widget-content ui-corner-all'></span>"},_buttonHtml:function(){return"<a class='ui-spinner-button ui-spinner-up ui-corner-tr'><span class='ui-icon "+this.options.icons.up+"'>▲</span>"+"</a>"+"<a class='ui-spinner-button ui-spinner-down ui-corner-br'>"+"<span class='ui-icon "+this.options.icons.down+"'>▼</span>"+"</a>"},_start:function(e){return!this.spinning&&this._trigger("start",e)===!1?!1:(this.counter||(this.counter=1),this.spinning=!0,!0)},_repeat:function(e,t,n){e=e||500,clearTimeout(this.timer),this.timer=this._delay(function(){this._repeat(40,t,n)},e),this._spin(t*this.options.step,n)},_spin:function(e,t){var n=this.value()||0;this.counter||(this.counter=1),n=this._adjustValue(n+e*this._increment(this.counter));if(!this.spinning||this._trigger("spin",t,{value:n})!==!1)this._value(n),this.counter++},_increment:function(t){var n=this.options.incremental;return n?e.isFunction(n)?n(t):Math.floor(t*t*t/5e4-t*t/500+17*t/200+1):1},_precision:function(){var e=this._precisionOf(this.options.step);return this.options.min!==null&&(e=Math.max(e,this._precisionOf(this.options.min))),e},_precisionOf:function(e){var t=e.toString(),n=t.indexOf(".");return n===-1?0:t.length-n-1},_adjustValue:function(e){var t,n,r=this.options;return t=r.min!==null?r.min:0,n=e-t,n=Math.round(n/r.step)*r.step,e=t+n,e=parseFloat(e.toFixed(this._precision())),r.max!==null&&e>r.max?r.max:r.min!==null&&e<r.min?r.min:e},_stop:function(e){if(!this.spinning)return;clearTimeout(this.timer),clearTimeout(this.mousewheelTimer),this.counter=0,this.spinning=!1,this._trigger("stop",e)},_setOption:function(e,t){if(e==="culture"||e==="numberFormat"){var n=this._parse(this.element.val());this.options[e]=t,this.element.val(this._format(n));return}(e==="max"||e==="min"||e==="step")&&typeof t=="string"&&(t=this._parse(t)),this._super(e,t),e==="disabled"&&(t?(this.element.prop("disabled",!0),this.buttons.button("disable")):(this.element.prop("disabled",!1),this.buttons.button("enable")))},_setOptions:t(function(e){this._super(e),this._value(this.element.val())}),_parse:function(e){return typeof e=="string"&&e!==""&&(e=window.Globalize&&this.options.numberFormat?Globalize.parseFloat(e,10,this.options.culture):+e),e===""||isNaN(e)?null:e},_format:function(e){return e===""?"":window.Globalize&&this.options.numberFormat?Globalize.format(e,this.options.numberFormat,this.options.culture):e},_refresh:function(){this.element.attr({"aria-valuemin":this.options.min,"aria-valuemax":this.options.max,"aria-valuenow":this._parse(this.element.val())})},_value:function(e,t){var n;e!==""&&(n=this._parse(e),n!==null&&(t||(n=this._adjustValue(n)),e=this._format(n))),this.element.val(e),this._refresh()},_destroy:function(){this.element.removeClass("ui-spinner-input").prop("disabled",!1).removeAttr("autocomplete").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.uiSpinner.replaceWith(this.element)},stepUp:t(function(e){this._stepUp(e)}),_stepUp:function(e){this._spin((e||1)*this.options.step)},stepDown:t(function(e){this._stepDown(e)}),_stepDown:function(e){this._spin((e||1)*-this.options.step)},pageUp:t(function(e){this._stepUp((e||1)*this.options.page)}),pageDown:t(function(e){this._stepDown((e||1)*this.options.page)}),value:function(e){if(!arguments.length)return this._parse(this.element.val());t(this._value).call(this,e)},widget:function(){return this.uiSpinner}})})(jQuery);(function(e,t){function i(){return++n}function s(e){return e.hash.length>1&&e.href.replace(r,"")===location.href.replace(r,"")}var n=0,r=/#.*$/;e.widget("ui.tabs",{version:"1.9.1",delay:300,options:{active:null,collapsible:!1,event:"click",heightStyle:"content",hide:null,show:null,activate:null,beforeActivate:null,beforeLoad:null,load:null},_create:function(){var t=this,n=this.options,r=n.active,i=location.hash.substring(1);this.running=!1,this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all").toggleClass("ui-tabs-collapsible",n.collapsible).delegate(".ui-tabs-nav > li","mousedown"+this.eventNamespace,function(t){e(this).is(".ui-state-disabled")&&t.preventDefault()}).delegate(".ui-tabs-anchor","focus"+this.eventNamespace,function(){e(this).closest("li").is(".ui-state-disabled")&&this.blur()}),this._processTabs();if(r===null){i&&this.tabs.each(function(t,n){if(e(n).attr("aria-controls")===i)return r=t,!1}),r===null&&(r=this.tabs.index(this.tabs.filter(".ui-tabs-active")));if(r===null||r===-1)r=this.tabs.length?0:!1}r!==!1&&(r=this.tabs.index(this.tabs.eq(r)),r===-1&&(r=n.collapsible?!1:0)),n.active=r,!n.collapsible&&n.active===!1&&this.anchors.length&&(n.active=0),e.isArray(n.disabled)&&(n.disabled=e.unique(n.disabled.concat(e.map(this.tabs.filter(".ui-state-disabled"),function(e){return t.tabs.index(e)}))).sort()),this.options.active!==!1&&this.anchors.length?this.active=this._findActive(this.options.active):this.active=e(),this._refresh(),this.active.length&&this.load(n.active)},_getCreateEventData:function(){return{tab:this.active,panel:this.active.length?this._getPanelForTab(this.active):e()}},_tabKeydown:function(t){var n=e(this.document[0].activeElement).closest("li"),r=this.tabs.index(n),i=!0;if(this._handlePageNav(t))return;switch(t.keyCode){case e.ui.keyCode.RIGHT:case e.ui.keyCode.DOWN:r++;break;case e.ui.keyCode.UP:case e.ui.keyCode.LEFT:i=!1,r--;break;case e.ui.keyCode.END:r=this.anchors.length-1;break;case e.ui.keyCode.HOME:r=0;break;case e.ui.keyCode.SPACE:t.preventDefault(),clearTimeout(this.activating),this._activate(r);return;case e.ui.keyCode.ENTER:t.preventDefault(),clearTimeout(this.activating),this._activate(r===this.options.active?!1:r);return;default:return}t.preventDefault(),clearTimeout(this.activating),r=this._focusNextTab(r,i),t.ctrlKey||(n.attr("aria-selected","false"),this.tabs.eq(r).attr("aria-selected","true"),this.activating=this._delay(function(){this.option("active",r)},this.delay))},_panelKeydown:function(t){if(this._handlePageNav(t))return;t.ctrlKey&&t.keyCode===e.ui.keyCode.UP&&(t.preventDefault(),this.active.focus())},_handlePageNav:function(t){if(t.altKey&&t.keyCode===e.ui.keyCode.PAGE_UP)return this._activate(this._focusNextTab(this.options.active-1,!1)),!0;if(t.altKey&&t.keyCode===e.ui.keyCode.PAGE_DOWN)return this._activate(this._focusNextTab(this.options.active+1,!0)),!0},_findNextTab:function(t,n){function i(){return t>r&&(t=0),t<0&&(t=r),t}var r=this.tabs.length-1;while(e.inArray(i(),this.options.disabled)!==-1)t=n?t+1:t-1;return t},_focusNextTab:function(e,t){return e=this._findNextTab(e,t),this.tabs.eq(e).focus(),e},_setOption:function(e,t){if(e==="active"){this._activate(t);return}if(e==="disabled"){this._setupDisabled(t);return}this._super(e,t),e==="collapsible"&&(this.element.toggleClass("ui-tabs-collapsible",t),!t&&this.options.active===!1&&this._activate(0)),e==="event"&&this._setupEvents(t),e==="heightStyle"&&this._setupHeightStyle(t)},_tabId:function(e){return e.attr("aria-controls")||"ui-tabs-"+i()},_sanitizeSelector:function(e){return e?e.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g,"\\$&"):""},refresh:function(){var t=this.options,n=this.tablist.children(":has(a[href])");t.disabled=e.map(n.filter(".ui-state-disabled"),function(e){return n.index(e)}),this._processTabs(),t.active===!1||!this.anchors.length?(t.active=!1,this.active=e()):this.active.length&&!e.contains(this.tablist[0],this.active[0])?this.tabs.length===t.disabled.length?(t.active=!1,this.active=e()):this._activate(this._findNextTab(Math.max(0,t.active-1),!1)):t.active=this.tabs.index(this.active),this._refresh()},_refresh:function(){this._setupDisabled(this.options.disabled),this._setupEvents(this.options.event),this._setupHeightStyle(this.options.heightStyle),this.tabs.not(this.active).attr({"aria-selected":"false",tabIndex:-1}),this.panels.not(this._getPanelForTab(this.active)).hide().attr({"aria-expanded":"false","aria-hidden":"true"}),this.active.length?(this.active.addClass("ui-tabs-active ui-state-active").attr({"aria-selected":"true",tabIndex:0}),this._getPanelForTab(this.active).show().attr({"aria-expanded":"true","aria-hidden":"false"})):this.tabs.eq(0).attr("tabIndex",0)},_processTabs:function(){var t=this;this.tablist=this._getList().addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all").attr("role","tablist"),this.tabs=this.tablist.find("> li:has(a[href])").addClass("ui-state-default ui-corner-top").attr({role:"tab",tabIndex:-1}),this.anchors=this.tabs.map(function(){return e("a",this)[0]}).addClass("ui-tabs-anchor").attr({role:"presentation",tabIndex:-1}),this.panels=e(),this.anchors.each(function(n,r){var i,o,u,a=e(r).uniqueId().attr("id"),f=e(r).closest("li"),l=f.attr("aria-controls");s(r)?(i=r.hash,o=t.element.find(t._sanitizeSelector(i))):(u=t._tabId(f),i="#"+u,o=t.element.find(i),o.length||(o=t._createPanel(u),o.insertAfter(t.panels[n-1]||t.tablist)),o.attr("aria-live","polite")),o.length&&(t.panels=t.panels.add(o)),l&&f.data("ui-tabs-aria-controls",l),f.attr({"aria-controls":i.substring(1),"aria-labelledby":a}),o.attr("aria-labelledby",a)}),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").attr("role","tabpanel")},_getList:function(){return this.element.find("ol,ul").eq(0)},_createPanel:function(t){return e("<div>").attr("id",t).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").data("ui-tabs-destroy",!0)},_setupDisabled:function(t){e.isArray(t)&&(t.length?t.length===this.anchors.length&&(t=!0):t=!1);for(var n=0,r;r=this.tabs[n];n++)t===!0||e.inArray(n,t)!==-1?e(r).addClass("ui-state-disabled").attr("aria-disabled","true"):e(r).removeClass("ui-state-disabled").removeAttr("aria-disabled");this.options.disabled=t},_setupEvents:function(t){var n={click:function(e){e.preventDefault()}};t&&e.each(t.split(" "),function(e,t){n[t]="_eventHandler"}),this._off(this.anchors.add(this.tabs).add(this.panels)),this._on(this.anchors,n),this._on(this.tabs,{keydown:"_tabKeydown"}),this._on(this.panels,{keydown:"_panelKeydown"}),this._focusable(this.tabs),this._hoverable(this.tabs)},_setupHeightStyle:function(t){var n,r,i=this.element.parent();t==="fill"?(e.support.minHeight||(r=i.css("overflow"),i.css("overflow","hidden")),n=i.height(),this.element.siblings(":visible").each(function(){var t=e(this),r=t.css("position");if(r==="absolute"||r==="fixed")return;n-=t.outerHeight(!0)}),r&&i.css("overflow",r),this.element.children().not(this.panels).each(function(){n-=e(this).outerHeight(!0)}),this.panels.each(function(){e(this).height(Math.max(0,n-e(this).innerHeight()+e(this).height()))}).css("overflow","auto")):t==="auto"&&(n=0,this.panels.each(function(){n=Math.max(n,e(this).height("").height())}).height(n))},_eventHandler:function(t){var n=this.options,r=this.active,i=e(t.currentTarget),s=i.closest("li"),o=s[0]===r[0],u=o&&n.collapsible,a=u?e():this._getPanelForTab(s),f=r.length?this._getPanelForTab(r):e(),l={oldTab:r,oldPanel:f,newTab:u?e():s,newPanel:a};t.preventDefault();if(s.hasClass("ui-state-disabled")||s.hasClass("ui-tabs-loading")||this.running||o&&!n.collapsible||this._trigger("beforeActivate",t,l)===!1)return;n.active=u?!1:this.tabs.index(s),this.active=o?e():s,this.xhr&&this.xhr.abort(),!f.length&&!a.length&&e.error("jQuery UI Tabs: Mismatching fragment identifier."),a.length&&this.load(this.tabs.index(s),t),this._toggle(t,l)},_toggle:function(t,n){function o(){r.running=!1,r._trigger("activate",t,n)}function u(){n.newTab.closest("li").addClass("ui-tabs-active ui-state-active"),i.length&&r.options.show?r._show(i,r.options.show,o):(i.show(),o())}var r=this,i=n.newPanel,s=n.oldPanel;this.running=!0,s.length&&this.options.hide?this._hide(s,this.options.hide,function(){n.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),u()}):(n.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),s.hide(),u()),s.attr({"aria-expanded":"false","aria-hidden":"true"}),n.oldTab.attr("aria-selected","false"),i.length&&s.length?n.oldTab.attr("tabIndex",-1):i.length&&this.tabs.filter(function(){return e(this).attr("tabIndex")===0}).attr("tabIndex",-1),i.attr({"aria-expanded":"true","aria-hidden":"false"}),n.newTab.attr({"aria-selected":"true",tabIndex:0})},_activate:function(t){var n,r=this._findActive(t);if(r[0]===this.active[0])return;r.length||(r=this.active),n=r.find(".ui-tabs-anchor")[0],this._eventHandler({target:n,currentTarget:n,preventDefault:e.noop})},_findActive:function(t){return t===!1?e():this.tabs.eq(t)},_getIndex:function(e){return typeof e=="string"&&(e=this.anchors.index(this.anchors.filter("[href$='"+e+"']"))),e},_destroy:function(){this.xhr&&this.xhr.abort(),this.element.removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible"),this.tablist.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all").removeAttr("role"),this.anchors.removeClass("ui-tabs-anchor").removeAttr("role").removeAttr("tabIndex").removeData("href.tabs").removeData("load.tabs").removeUniqueId(),this.tabs.add(this.panels).each(function(){e.data(this,"ui-tabs-destroy")?e(this).remove():e(this).removeClass("ui-state-default ui-state-active ui-state-disabled ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel").removeAttr("tabIndex").removeAttr("aria-live").removeAttr("aria-busy").removeAttr("aria-selected").removeAttr("aria-labelledby").removeAttr("aria-hidden").removeAttr("aria-expanded").removeAttr("role")}),this.tabs.each(function(){var t=e(this),n=t.data("ui-tabs-aria-controls");n?t.attr("aria-controls",n):t.removeAttr("aria-controls")}),this.options.heightStyle!=="content"&&this.panels.css("height","")},enable:function(n){var r=this.options.disabled;if(r===!1)return;n===t?r=!1:(n=this._getIndex(n),e.isArray(r)?r=e.map(r,function(e){return e!==n?e:null}):r=e.map(this.tabs,function(e,t){return t!==n?t:null})),this._setupDisabled(r)},disable:function(n){var r=this.options.disabled;if(r===!0)return;if(n===t)r=!0;else{n=this._getIndex(n);if(e.inArray(n,r)!==-1)return;e.isArray(r)?r=e.merge([n],r).sort():r=[n]}this._setupDisabled(r)},load:function(t,n){t=this._getIndex(t);var r=this,i=this.tabs.eq(t),o=i.find(".ui-tabs-anchor"),u=this._getPanelForTab(i),a={tab:i,panel:u};if(s(o[0]))return;this.xhr=e.ajax(this._ajaxSettings(o,n,a)),this.xhr&&this.xhr.statusText!=="canceled"&&(i.addClass("ui-tabs-loading"),u.attr("aria-busy","true"),this.xhr.success(function(e){setTimeout(function(){u.html(e),r._trigger("load",n,a)},1)}).complete(function(e,t){setTimeout(function(){t==="abort"&&r.panels.stop(!1,!0),i.removeClass("ui-tabs-loading"),u.removeAttr("aria-busy"),e===r.xhr&&delete r.xhr},1)}))},_ajaxSettings:function(t,n,r){var i=this;return{url:t.attr("href"),beforeSend:function(t,s){return i._trigger("beforeLoad",n,e.extend({jqXHR:t,ajaxSettings:s},r))}}},_getPanelForTab:function(t){var n=e(t).attr("aria-controls");return this.element.find(this._sanitizeSelector("#"+n))}}),e.uiBackCompat!==!1&&(e.ui.tabs.prototype._ui=function(e,t){return{tab:e,panel:t,index:this.anchors.index(e)}},e.widget("ui.tabs",e.ui.tabs,{url:function(e,t){this.anchors.eq(e).attr("href",t)}}),e.widget("ui.tabs",e.ui.tabs,{options:{ajaxOptions:null,cache:!1},_create:function(){this._super();var t=this;this._on({tabsbeforeload:function(n,r){if(e.data(r.tab[0],"cache.tabs")){n.preventDefault();return}r.jqXHR.success(function(){t.options.cache&&e.data(r.tab[0],"cache.tabs",!0)})}})},_ajaxSettings:function(t,n,r){var i=this.options.ajaxOptions;return e.extend({},i,{error:function(e,t){try{i.error(e,t,r.tab.closest("li").index(),r.tab[0])}catch(n){}}},this._superApply(arguments))},_setOption:function(e,t){e==="cache"&&t===!1&&this.anchors.removeData("cache.tabs"),this._super(e,t)},_destroy:function(){this.anchors.removeData("cache.tabs"),this._super()},url:function(e){this.anchors.eq(e).removeData("cache.tabs"),this._superApply(arguments)}}),e.widget("ui.tabs",e.ui.tabs,{abort:function(){this.xhr&&this.xhr.abort()}}),e.widget("ui.tabs",e.ui.tabs,{options:{spinner:"<em>Loading…</em>"},_create:function(){this._super(),this._on({tabsbeforeload:function(e,t){if(e.target!==this.element[0]||!this.options.spinner)return;var n=t.tab.find("span"),r=n.html();n.html(this.options.spinner),t.jqXHR.complete(function(){n.html(r)})}})}}),e.widget("ui.tabs",e.ui.tabs,{options:{enable:null,disable:null},enable:function(t){var n=this.options,r;if(t&&n.disabled===!0||e.isArray(n.disabled)&&e.inArray(t,n.disabled)!==-1)r=!0;this._superApply(arguments),r&&this._trigger("enable",null,this._ui(this.anchors[t],this.panels[t]))},disable:function(t){var n=this.options,r;if(t&&n.disabled===!1||e.isArray(n.disabled)&&e.inArray(t,n.disabled)===-1)r=!0;this._superApply(arguments),r&&this._trigger("disable",null,this._ui(this.anchors[t],this.panels[t]))}}),e.widget("ui.tabs",e.ui.tabs,{options:{add:null,remove:null,tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},add:function(n,r,i){i===t&&(i=this.anchors.length);var s,o,u=this.options,a=e(u.tabTemplate.replace(/#\{href\}/g,n).replace(/#\{label\}/g,r)),f=n.indexOf("#")?this._tabId(a):n.replace("#","");return a.addClass("ui-state-default ui-corner-top").data("ui-tabs-destroy",!0),a.attr("aria-controls",f),s=i>=this.tabs.length,o=this.element.find("#"+f),o.length||(o=this._createPanel(f),s?i>0?o.insertAfter(this.panels.eq(-1)):o.appendTo(this.element):o.insertBefore(this.panels[i])),o.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").hide(),s?a.appendTo(this.tablist):a.insertBefore(this.tabs[i]),u.disabled=e.map(u.disabled,function(e){return e>=i?++e:e}),this.refresh(),this.tabs.length===1&&u.active===!1&&this.option("active",0),this._trigger("add",null,this._ui(this.anchors[i],this.panels[i])),this},remove:function(t){t=this._getIndex(t);var n=this.options,r=this.tabs.eq(t).remove(),i=this._getPanelForTab(r).remove();return r.hasClass("ui-tabs-active")&&this.anchors.length>2&&this._activate(t+(t+1<this.anchors.length?1:-1)),n.disabled=e.map(e.grep(n.disabled,function(e){return e!==t}),function(e){return e>=t?--e:e}),this.refresh(),this._trigger("remove",null,this._ui(r.find("a")[0],i[0])),this}}),e.widget("ui.tabs",e.ui.tabs,{length:function(){return this.anchors.length}}),e.widget("ui.tabs",e.ui.tabs,{options:{idPrefix:"ui-tabs-"},_tabId:function(t){var n=t.is("li")?t.find("a[href]"):t;return n=n[0],e(n).closest("li").attr("aria-controls")||n.title&&n.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF\-]/g,"")||this.options.idPrefix+i()}}),e.widget("ui.tabs",e.ui.tabs,{options:{panelTemplate:"<div></div>"},_createPanel:function(t){return e(this.options.panelTemplate).attr("id",t).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").data("ui-tabs-destroy",!0)}}),e.widget("ui.tabs",e.ui.tabs,{_create:function(){var e=this.options;e.active===null&&e.selected!==t&&(e.active=e.selected===-1?!1:e.selected),this._super(),e.selected=e.active,e.selected===!1&&(e.selected=-1)},_setOption:function(e,t){if(e!=="selected")return this._super(e,t);var n=this.options;this._super("active",t===-1?!1:t),n.selected=n.active,n.selected===!1&&(n.selected=-1)},_eventHandler:function(){this._superApply(arguments),this.options.selected=this.options.active,this.options.selected===!1&&(this.options.selected=-1)}}),e.widget("ui.tabs",e.ui.tabs,{options:{show:null,select:null},_create:function(){this._super(),this.options.active!==!1&&this._trigger("show",null,this._ui(this.active.find(".ui-tabs-anchor")[0],this._getPanelForTab(this.active)[0]))},_trigger:function(e,t,n){var r=this._superApply(arguments);return r?(e==="beforeActivate"&&n.newTab.length?r=this._super("select",t,{tab:n.newTab.find(".ui-tabs-anchor")[0],panel:n.newPanel[0],index:n.newTab.closest("li").index()}):e==="activate"&&n.newTab.length&&(r=this._super("show",t,{tab:n.newTab.find(".ui-tabs-anchor")[0],panel:n.newPanel[0],index:n.newTab.closest("li").index()})),r):!1}}),e.widget("ui.tabs",e.ui.tabs,{select:function(e){e=this._getIndex(e);if(e===-1){if(!this.options.collapsible||this.options.selected===-1)return;e=this.options.selected}this.anchors.eq(e).trigger(this.options.event+this.eventNamespace)}}),function(){var t=0;e.widget("ui.tabs",e.ui.tabs,{options:{cookie:null},_create:function(){var e=this.options,t;e.active==null&&e.cookie&&(t=parseInt(this._cookie(),10),t===-1&&(t=!1),e.active=t),this._super()},_cookie:function(n){var r=[this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+ ++t)];return arguments.length&&(r.push(n===!1?-1:n),r.push(this.options.cookie)),e.cookie.apply(null,r)},_refresh:function(){this._super(),this.options.cookie&&this._cookie(this.options.active,this.options.cookie)},_eventHandler:function(){this._superApply(arguments),this.options.cookie&&this._cookie(this.options.active,this.options.cookie)},_destroy:function(){this._super(),this.options.cookie&&this._cookie(null,this.options.cookie)}})}(),e.widget("ui.tabs",e.ui.tabs,{_trigger:function(t,n,r){var i=e.extend({},r);return t==="load"&&(i.panel=i.panel[0],i.tab=i.tab.find(".ui-tabs-anchor")[0]),this._super(t,n,i)}}),e.widget("ui.tabs",e.ui.tabs,{options:{fx:null},_getFx:function(){var t,n,r=this.options.fx;return r&&(e.isArray(r)?(t=r[0],n=r[1]):t=n=r),r?{show:n,hide:t}:null},_toggle:function(e,t){function o(){n.running=!1,n._trigger("activate",e,t)}function u(){t.newTab.closest("li").addClass("ui-tabs-active ui-state-active"),r.length&&s.show?r.animate(s.show,s.show.duration,function(){o()}):(r.show(),o())}var n=this,r=t.newPanel,i=t.oldPanel,s=this._getFx();if(!s)return this._super(e,t);n.running=!0,i.length&&s.hide?i.animate(s.hide,s.hide.duration,function(){t.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),u()}):(t.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),i.hide(),u())}}))})(jQuery);(function(e){function n(t,n){var r=(t.attr("aria-describedby")||"").split(/\s+/);r.push(n),t.data("ui-tooltip-id",n).attr("aria-describedby",e.trim(r.join(" ")))}function r(t){var n=t.data("ui-tooltip-id"),r=(t.attr("aria-describedby")||"").split(/\s+/),i=e.inArray(n,r);i!==-1&&r.splice(i,1),t.removeData("ui-tooltip-id"),r=e.trim(r.join(" ")),r?t.attr("aria-describedby",r):t.removeAttr("aria-describedby")}var t=0;e.widget("ui.tooltip",{version:"1.9.1",options:{content:function(){return e(this).attr("title")},hide:!0,items:"[title]:not([disabled])",position:{my:"left top+15",at:"left bottom",collision:"flipfit flipfit"},show:!0,tooltipClass:null,track:!1,close:null,open:null},_create:function(){this._on({mouseover:"open",focusin:"open"}),this.tooltips={},this.parents={},this.options.disabled&&this._disable()},_setOption:function(t,n){var r=this;if(t==="disabled"){this[n?"_disable":"_enable"](),this.options[t]=n;return}this._super(t,n),t==="content"&&e.each(this.tooltips,function(e,t){r._updateContent(t)})},_disable:function(){var t=this;e.each(this.tooltips,function(n,r){var i=e.Event("blur");i.target=i.currentTarget=r[0],t.close(i,!0)}),this.element.find(this.options.items).andSelf().each(function(){var t=e(this);t.is("[title]")&&t.data("ui-tooltip-title",t.attr("title")).attr("title","")})},_enable:function(){this.element.find(this.options.items).andSelf().each(function(){var t=e(this);t.data("ui-tooltip-title")&&t.attr("title",t.data("ui-tooltip-title"))})},open:function(t){var n=this,r=e(t?t.target:this.element).closest(this.options.items);if(!r.length)return;if(this.options.track&&r.data("ui-tooltip-id")){this._find(r).position(e.extend({of:r},this.options.position)),this._off(this.document,"mousemove");return}r.attr("title")&&r.data("ui-tooltip-title",r.attr("title")),r.data("tooltip-open",!0),t&&t.type==="mouseover"&&r.parents().each(function(){var t;e(this).data("tooltip-open")&&(t=e.Event("blur"),t.target=t.currentTarget=this,n.close(t,!0)),this.title&&(e(this).uniqueId(),n.parents[this.id]={element:this,title:this.title},this.title="")}),this._updateContent(r,t)},_updateContent:function(e,t){var n,r=this.options.content,i=this;if(typeof r=="string")return this._open(t,e,r);n=r.call(e[0],function(n){if(!e.data("tooltip-open"))return;i._delay(function(){this._open(t,e,n)})}),n&&this._open(t,e,n)},_open:function(t,r,i){function f(e){a.of=e;if(s.is(":hidden"))return;s.position(a)}var s,o,u,a=e.extend({},this.options.position);if(!i)return;s=this._find(r);if(s.length){s.find(".ui-tooltip-content").html(i);return}r.is("[title]")&&(t&&t.type==="mouseover"?r.attr("title",""):r.removeAttr("title")),s=this._tooltip(r),n(r,s.attr("id")),s.find(".ui-tooltip-content").html(i),this.options.track&&t&&/^mouse/.test(t.originalEvent.type)?(this._on(this.document,{mousemove:f}),f(t)):s.position(e.extend({of:r},this.options.position)),s.hide(),this._show(s,this.options.show),this.options.show&&this.options.show.delay&&(u=setInterval(function(){s.is(":visible")&&(f(a.of),clearInterval(u))},e.fx.interval)),this._trigger("open",t,{tooltip:s}),o={keyup:function(t){if(t.keyCode===e.ui.keyCode.ESCAPE){var n=e.Event(t);n.currentTarget=r[0],this.close(n,!0)}},remove:function(){this._removeTooltip(s)}};if(!t||t.type==="mouseover")o.mouseleave="close";if(!t||t.type==="focusin")o.focusout="close";this._on(r,o)},close:function(t){var n=this,i=e(t?t.currentTarget:this.element),s=this._find(i);if(this.closing)return;i.data("ui-tooltip-title")&&i.attr("title",i.data("ui-tooltip-title")),r(i),s.stop(!0),this._hide(s,this.options.hide,function(){n._removeTooltip(e(this))}),i.removeData("tooltip-open"),this._off(i,"mouseleave focusout keyup"),i[0]!==this.element[0]&&this._off(i,"remove"),this._off(this.document,"mousemove"),t&&t.type==="mouseleave"&&e.each(this.parents,function(e,t){t.element.title=t.title,delete n.parents[e]}),this.closing=!0,this._trigger("close",t,{tooltip:s}),this.closing=!1},_tooltip:function(n){var r="ui-tooltip-"+t++,i=e("<div>").attr({id:r,role:"tooltip"}).addClass("ui-tooltip ui-widget ui-corner-all ui-widget-content "+(this.options.tooltipClass||""));return e("<div>").addClass("ui-tooltip-content").appendTo(i),i.appendTo(this.document[0].body),e.fn.bgiframe&&i.bgiframe(),this.tooltips[r]=n,i},_find:function(t){var n=t.data("ui-tooltip-id");return n?e("#"+n):e()},_removeTooltip:function(e){e.remove(),delete this.tooltips[e.attr("id")]},_destroy:function(){var t=this;e.each(this.tooltips,function(n,r){var i=e.Event("blur");i.target=i.currentTarget=r[0],t.close(i,!0),e("#"+n).remove(),r.data("ui-tooltip-title")&&(r.attr("title",r.data("ui-tooltip-title")),r.removeData("ui-tooltip-title"))})}})})(jQuery);jQuery.effects||function(e,t){var n=e.uiBackCompat!==!1,r="ui-effects-";e.effects={effect:{}},function(t,n){function p(e,t,n){var r=a[t.type]||{};return e==null?n||!t.def?null:t.def:(e=r.floor?~~e:parseFloat(e),isNaN(e)?t.def:r.mod?(e+r.mod)%r.mod:0>e?0:r.max<e?r.max:e)}function d(e){var n=o(),r=n._rgba=[];return e=e.toLowerCase(),h(s,function(t,i){var s,o=i.re.exec(e),a=o&&i.parse(o),f=i.space||"rgba";if(a)return s=n[f](a),n[u[f].cache]=s[u[f].cache],r=n._rgba=s._rgba,!1}),r.length?(r.join()==="0,0,0,0"&&t.extend(r,c.transparent),n):c[e]}function v(e,t,n){return n=(n+1)%1,n*6<1?e+(t-e)*n*6:n*2<1?t:n*3<2?e+(t-e)*(2/3-n)*6:e}var r="backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor".split(" "),i=/^([\-+])=\s*(\d+\.?\d*)/,s=[{re:/rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)/,parse:function(e){return[e[1],e[2],e[3],e[4]]}},{re:/rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)/,parse:function(e){return[e[1]*2.55,e[2]*2.55,e[3]*2.55,e[4]]}},{re:/#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,parse:function(e){return[parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16)]}},{re:/#([a-f0-9])([a-f0-9])([a-f0-9])/,parse:function(e){return[parseInt(e[1]+e[1],16),parseInt(e[2]+e[2],16),parseInt(e[3]+e[3],16)]}},{re:/hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)/,space:"hsla",parse:function(e){return[e[1],e[2]/100,e[3]/100,e[4]]}}],o=t.Color=function(e,n,r,i){return new t.Color.fn.parse(e,n,r,i)},u={rgba:{props:{red:{idx:0,type:"byte"},green:{idx:1,type:"byte"},blue:{idx:2,type:"byte"}}},hsla:{props:{hue:{idx:0,type:"degrees"},saturation:{idx:1,type:"percent"},lightness:{idx:2,type:"percent"}}}},a={"byte":{floor:!0,max:255},percent:{max:1},degrees:{mod:360,floor:!0}},f=o.support={},l=t("<p>")[0],c,h=t.each;l.style.cssText="background-color:rgba(1,1,1,.5)",f.rgba=l.style.backgroundColor.indexOf("rgba")>-1,h(u,function(e,t){t.cache="_"+e,t.props.alpha={idx:3,type:"percent",def:1}}),o.fn=t.extend(o.prototype,{parse:function(r,i,s,a){if(r===n)return this._rgba=[null,null,null,null],this;if(r.jquery||r.nodeType)r=t(r).css(i),i=n;var f=this,l=t.type(r),v=this._rgba=[];i!==n&&(r=[r,i,s,a],l="array");if(l==="string")return this.parse(d(r)||c._default);if(l==="array")return h(u.rgba.props,function(e,t){v[t.idx]=p(r[t.idx],t)}),this;if(l==="object")return r instanceof o?h(u,function(e,t){r[t.cache]&&(f[t.cache]=r[t.cache].slice())}):h(u,function(t,n){var i=n.cache;h(n.props,function(e,t){if(!f[i]&&n.to){if(e==="alpha"||r[e]==null)return;f[i]=n.to(f._rgba)}f[i][t.idx]=p(r[e],t,!0)}),f[i]&&e.inArray(null,f[i].slice(0,3))<0&&(f[i][3]=1,n.from&&(f._rgba=n.from(f[i])))}),this},is:function(e){var t=o(e),n=!0,r=this;return h(u,function(e,i){var s,o=t[i.cache];return o&&(s=r[i.cache]||i.to&&i.to(r._rgba)||[],h(i.props,function(e,t){if(o[t.idx]!=null)return n=o[t.idx]===s[t.idx],n})),n}),n},_space:function(){var e=[],t=this;return h(u,function(n,r){t[r.cache]&&e.push(n)}),e.pop()},transition:function(e,t){var n=o(e),r=n._space(),i=u[r],s=this.alpha()===0?o("transparent"):this,f=s[i.cache]||i.to(s._rgba),l=f.slice();return n=n[i.cache],h(i.props,function(e,r){var i=r.idx,s=f[i],o=n[i],u=a[r.type]||{};if(o===null)return;s===null?l[i]=o:(u.mod&&(o-s>u.mod/2?s+=u.mod:s-o>u.mod/2&&(s-=u.mod)),l[i]=p((o-s)*t+s,r))}),this[r](l)},blend:function(e){if(this._rgba[3]===1)return this;var n=this._rgba.slice(),r=n.pop(),i=o(e)._rgba;return o(t.map(n,function(e,t){return(1-r)*i[t]+r*e}))},toRgbaString:function(){var e="rgba(",n=t.map(this._rgba,function(e,t){return e==null?t>2?1:0:e});return n[3]===1&&(n.pop(),e="rgb("),e+n.join()+")"},toHslaString:function(){var e="hsla(",n=t.map(this.hsla(),function(e,t){return e==null&&(e=t>2?1:0),t&&t<3&&(e=Math.round(e*100)+"%"),e});return n[3]===1&&(n.pop(),e="hsl("),e+n.join()+")"},toHexString:function(e){var n=this._rgba.slice(),r=n.pop();return e&&n.push(~~(r*255)),"#"+t.map(n,function(e){return e=(e||0).toString(16),e.length===1?"0"+e:e}).join("")},toString:function(){return this._rgba[3]===0?"transparent":this.toRgbaString()}}),o.fn.parse.prototype=o.fn,u.hsla.to=function(e){if(e[0]==null||e[1]==null||e[2]==null)return[null,null,null,e[3]];var t=e[0]/255,n=e[1]/255,r=e[2]/255,i=e[3],s=Math.max(t,n,r),o=Math.min(t,n,r),u=s-o,a=s+o,f=a*.5,l,c;return o===s?l=0:t===s?l=60*(n-r)/u+360:n===s?l=60*(r-t)/u+120:l=60*(t-n)/u+240,f===0||f===1?c=f:f<=.5?c=u/a:c=u/(2-a),[Math.round(l)%360,c,f,i==null?1:i]},u.hsla.from=function(e){if(e[0]==null||e[1]==null||e[2]==null)return[null,null,null,e[3]];var t=e[0]/360,n=e[1],r=e[2],i=e[3],s=r<=.5?r*(1+n):r+n-r*n,o=2*r-s;return[Math.round(v(o,s,t+1/3)*255),Math.round(v(o,s,t)*255),Math.round(v(o,s,t-1/3)*255),i]},h(u,function(e,r){var s=r.props,u=r.cache,a=r.to,f=r.from;o.fn[e]=function(e){a&&!this[u]&&(this[u]=a(this._rgba));if(e===n)return this[u].slice();var r,i=t.type(e),l=i==="array"||i==="object"?e:arguments,c=this[u].slice();return h(s,function(e,t){var n=l[i==="object"?e:t.idx];n==null&&(n=c[t.idx]),c[t.idx]=p(n,t)}),f?(r=o(f(c)),r[u]=c,r):o(c)},h(s,function(n,r){if(o.fn[n])return;o.fn[n]=function(s){var o=t.type(s),u=n==="alpha"?this._hsla?"hsla":"rgba":e,a=this[u](),f=a[r.idx],l;return o==="undefined"?f:(o==="function"&&(s=s.call(this,f),o=t.type(s)),s==null&&r.empty?this:(o==="string"&&(l=i.exec(s),l&&(s=f+parseFloat(l[2])*(l[1]==="+"?1:-1))),a[r.idx]=s,this[u](a)))}})}),h(r,function(e,n){t.cssHooks[n]={set:function(e,r){var i,s,u="";if(t.type(r)!=="string"||(i=d(r))){r=o(i||r);if(!f.rgba&&r._rgba[3]!==1){s=n==="backgroundColor"?e.parentNode:e;while((u===""||u==="transparent")&&s&&s.style)try{u=t.css(s,"backgroundColor"),s=s.parentNode}catch(a){}r=r.blend(u&&u!=="transparent"?u:"_default")}r=r.toRgbaString()}try{e.style[n]=r}catch(l){}}},t.fx.step[n]=function(e){e.colorInit||(e.start=o(e.elem,n),e.end=o(e.end),e.colorInit=!0),t.cssHooks[n].set(e.elem,e.start.transition(e.end,e.pos))}}),t.cssHooks.borderColor={expand:function(e){var t={};return h(["Top","Right","Bottom","Left"],function(n,r){t["border"+r+"Color"]=e}),t}},c=t.Color.names={aqua:"#00ffff",black:"#000000",blue:"#0000ff",fuchsia:"#ff00ff",gray:"#808080",green:"#008000",lime:"#00ff00",maroon:"#800000",navy:"#000080",olive:"#808000",purple:"#800080",red:"#ff0000",silver:"#c0c0c0",teal:"#008080",white:"#ffffff",yellow:"#ffff00",transparent:[null,null,null,0],_default:"#ffffff"}}(jQuery),function(){function i(){var t=this.ownerDocument.defaultView?this.ownerDocument.defaultView.getComputedStyle(this,null):this.currentStyle,n={},r,i;if(t&&t.length&&t[0]&&t[t[0]]){i=t.length;while(i--)r=t[i],typeof t[r]=="string"&&(n[e.camelCase(r)]=t[r])}else for(r in t)typeof t[r]=="string"&&(n[r]=t[r]);return n}function s(t,n){var i={},s,o;for(s in n)o=n[s],t[s]!==o&&!r[s]&&(e.fx.step[s]||!isNaN(parseFloat(o)))&&(i[s]=o);return i}var n=["add","remove","toggle"],r={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};e.each(["borderLeftStyle","borderRightStyle","borderBottomStyle","borderTopStyle"],function(t,n){e.fx.step[n]=function(e){if(e.end!=="none"&&!e.setAttr||e.pos===1&&!e.setAttr)jQuery.style(e.elem,n,e.end),e.setAttr=!0}}),e.effects.animateClass=function(t,r,o,u){var a=e.speed(r,o,u);return this.queue(function(){var r=e(this),o=r.attr("class")||"",u,f=a.children?r.find("*").andSelf():r;f=f.map(function(){var t=e(this);return{el:t,start:i.call(this)}}),u=function(){e.each(n,function(e,n){t[n]&&r[n+"Class"](t[n])})},u(),f=f.map(function(){return this.end=i.call(this.el[0]),this.diff=s(this.start,this.end),this}),r.attr("class",o),f=f.map(function(){var t=this,n=e.Deferred(),r=jQuery.extend({},a,{queue:!1,complete:function(){n.resolve(t)}});return this.el.animate(this.diff,r),n.promise()}),e.when.apply(e,f.get()).done(function(){u(),e.each(arguments,function(){var t=this.el;e.each(this.diff,function(e){t.css(e,"")})}),a.complete.call(r[0])})})},e.fn.extend({_addClass:e.fn.addClass,addClass:function(t,n,r,i){return n?e.effects.animateClass.call(this,{add:t},n,r,i):this._addClass(t)},_removeClass:e.fn.removeClass,removeClass:function(t,n,r,i){return n?e.effects.animateClass.call(this,{remove:t},n,r,i):this._removeClass(t)},_toggleClass:e.fn.toggleClass,toggleClass:function(n,r,i,s,o){return typeof r=="boolean"||r===t?i?e.effects.animateClass.call(this,r?{add:n}:{remove:n},i,s,o):this._toggleClass(n,r):e.effects.animateClass.call(this,{toggle:n},r,i,s)},switchClass:function(t,n,r,i,s){return e.effects.animateClass.call(this,{add:n,remove:t},r,i,s)}})}(),function(){function i(t,n,r,i){e.isPlainObject(t)&&(n=t,t=t.effect),t={effect:t},n==null&&(n={}),e.isFunction(n)&&(i=n,r=null,n={});if(typeof n=="number"||e.fx.speeds[n])i=r,r=n,n={};return e.isFunction(r)&&(i=r,r=null),n&&e.extend(t,n),r=r||n.duration,t.duration=e.fx.off?0:typeof r=="number"?r:r in e.fx.speeds?e.fx.speeds[r]:e.fx.speeds._default,t.complete=i||n.complete,t}function s(t){return!t||typeof t=="number"||e.fx.speeds[t]?!0:typeof t=="string"&&!e.effects.effect[t]?n&&e.effects[t]?!1:!0:!1}e.extend(e.effects,{version:"1.9.1",save:function(e,t){for(var n=0;n<t.length;n++)t[n]!==null&&e.data(r+t[n],e[0].style[t[n]])},restore:function(e,n){var i,s;for(s=0;s<n.length;s++)n[s]!==null&&(i=e.data(r+n[s]),i===t&&(i=""),e.css(n[s],i))},setMode:function(e,t){return t==="toggle"&&(t=e.is(":hidden")?"show":"hide"),t},getBaseline:function(e,t){var n,r;switch(e[0]){case"top":n=0;break;case"middle":n=.5;break;case"bottom":n=1;break;default:n=e[0]/t.height}switch(e[1]){case"left":r=0;break;case"center":r=.5;break;case"right":r=1;break;default:r=e[1]/t.width}return{x:r,y:n}},createWrapper:function(t){if(t.parent().is(".ui-effects-wrapper"))return t.parent();var n={width:t.outerWidth(!0),height:t.outerHeight(!0),"float":t.css("float")},r=e("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),i={width:t.width(),height:t.height()},s=document.activeElement;try{s.id}catch(o){s=document.body}return t.wrap(r),(t[0]===s||e.contains(t[0],s))&&e(s).focus(),r=t.parent(),t.css("position")==="static"?(r.css({position:"relative"}),t.css({position:"relative"})):(e.extend(n,{position:t.css("position"),zIndex:t.css("z-index")}),e.each(["top","left","bottom","right"],function(e,r){n[r]=t.css(r),isNaN(parseInt(n[r],10))&&(n[r]="auto")}),t.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),t.css(i),r.css(n).show()},removeWrapper:function(t){var n=document.activeElement;return t.parent().is(".ui-effects-wrapper")&&(t.parent().replaceWith(t),(t[0]===n||e.contains(t[0],n))&&e(n).focus()),t},setTransition:function(t,n,r,i){return i=i||{},e.each(n,function(e,n){var s=t.cssUnit(n);s[0]>0&&(i[n]=s[0]*r+s[1])}),i}}),e.fn.extend({effect:function(){function a(n){function u(){e.isFunction(i)&&i.call(r[0]),e.isFunction(n)&&n()}var r=e(this),i=t.complete,s=t.mode;(r.is(":hidden")?s==="hide":s==="show")?u():o.call(r[0],t,u)}var t=i.apply(this,arguments),r=t.mode,s=t.queue,o=e.effects.effect[t.effect],u=!o&&n&&e.effects[t.effect];return e.fx.off||!o&&!u?r?this[r](t.duration,t.complete):this.each(function(){t.complete&&t.complete.call(this)}):o?s===!1?this.each(a):this.queue(s||"fx",a):u.call(this,{options:t,duration:t.duration,callback:t.complete,mode:t.mode})},_show:e.fn.show,show:function(e){if(s(e))return this._show.apply(this,arguments);var t=i.apply(this,arguments);return t.mode="show",this.effect.call(this,t)},_hide:e.fn.hide,hide:function(e){if(s(e))return this._hide.apply(this,arguments);var t=i.apply(this,arguments);return t.mode="hide",this.effect.call(this,t)},__toggle:e.fn.toggle,toggle:function(t){if(s(t)||typeof t=="boolean"||e.isFunction(t))return this.__toggle.apply(this,arguments);var n=i.apply(this,arguments);return n.mode="toggle",this.effect.call(this,n)},cssUnit:function(t){var n=this.css(t),r=[];return e.each(["em","px","%","pt"],function(e,t){n.indexOf(t)>0&&(r=[parseFloat(n),t])}),r}})}(),function(){var t={};e.each(["Quad","Cubic","Quart","Quint","Expo"],function(e,n){t[n]=function(t){return Math.pow(t,e+2)}}),e.extend(t,{Sine:function(e){return 1-Math.cos(e*Math.PI/2)},Circ:function(e){return 1-Math.sqrt(1-e*e)},Elastic:function(e){return e===0||e===1?e:-Math.pow(2,8*(e-1))*Math.sin(((e-1)*80-7.5)*Math.PI/15)},Back:function(e){return e*e*(3*e-2)},Bounce:function(e){var t,n=4;while(e<((t=Math.pow(2,--n))-1)/11);return 1/Math.pow(4,3-n)-7.5625*Math.pow((t*3-2)/22-e,2)}}),e.each(t,function(t,n){e.easing["easeIn"+t]=n,e.easing["easeOut"+t]=function(e){return 1-n(1-e)},e.easing["easeInOut"+t]=function(e){return e<.5?n(e*2)/2:1-n(e*-2+2)/2}})}()}(jQuery);(function(e,t){var n=/up|down|vertical/,r=/up|left|vertical|horizontal/;e.effects.effect.blind=function(t,i){var s=e(this),o=["position","top","bottom","left","right","height","width"],u=e.effects.setMode(s,t.mode||"hide"),a=t.direction||"up",f=n.test(a),l=f?"height":"width",c=f?"top":"left",h=r.test(a),p={},d=u==="show",v,m,g;s.parent().is(".ui-effects-wrapper")?e.effects.save(s.parent(),o):e.effects.save(s,o),s.show(),v=e.effects.createWrapper(s).css({overflow:"hidden"}),m=v[l](),g=parseFloat(v.css(c))||0,p[l]=d?m:0,h||(s.css(f?"bottom":"right",0).css(f?"top":"left","auto").css({position:"absolute"}),p[c]=d?g:m+g),d&&(v.css(l,0),h||v.css(c,g+m)),v.animate(p,{duration:t.duration,easing:t.easing,queue:!1,complete:function(){u==="hide"&&s.hide(),e.effects.restore(s,o),e.effects.removeWrapper(s),i()}})}})(jQuery);(function(e,t){e.effects.effect.bounce=function(t,n){var r=e(this),i=["position","top","bottom","left","right","height","width"],s=e.effects.setMode(r,t.mode||"effect"),o=s==="hide",u=s==="show",a=t.direction||"up",f=t.distance,l=t.times||5,c=l*2+(u||o?1:0),h=t.duration/c,p=t.easing,d=a==="up"||a==="down"?"top":"left",v=a==="up"||a==="left",m,g,y,b=r.queue(),w=b.length;(u||o)&&i.push("opacity"),e.effects.save(r,i),r.show(),e.effects.createWrapper(r),f||(f=r[d==="top"?"outerHeight":"outerWidth"]()/3),u&&(y={opacity:1},y[d]=0,r.css("opacity",0).css(d,v?-f*2:f*2).animate(y,h,p)),o&&(f/=Math.pow(2,l-1)),y={},y[d]=0;for(m=0;m<l;m++)g={},g[d]=(v?"-=":"+=")+f,r.animate(g,h,p).animate(y,h,p),f=o?f*2:f/2;o&&(g={opacity:0},g[d]=(v?"-=":"+=")+f,r.animate(g,h,p)),r.queue(function(){o&&r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()}),w>1&&b.splice.apply(b,[1,0].concat(b.splice(w,c+1))),r.dequeue()}})(jQuery);(function(e,t){e.effects.effect.clip=function(t,n){var r=e(this),i=["position","top","bottom","left","right","height","width"],s=e.effects.setMode(r,t.mode||"hide"),o=s==="show",u=t.direction||"vertical",a=u==="vertical",f=a?"height":"width",l=a?"top":"left",c={},h,p,d;e.effects.save(r,i),r.show(),h=e.effects.createWrapper(r).css({overflow:"hidden"}),p=r[0].tagName==="IMG"?h:r,d=p[f](),o&&(p.css(f,0),p.css(l,d/2)),c[f]=o?d:0,c[l]=o?0:d/2,p.animate(c,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){o||r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()}})}})(jQuery);(function(e,t){e.effects.effect.drop=function(t,n){var r=e(this),i=["position","top","bottom","left","right","opacity","height","width"],s=e.effects.setMode(r,t.mode||"hide"),o=s==="show",u=t.direction||"left",a=u==="up"||u==="down"?"top":"left",f=u==="up"||u==="left"?"pos":"neg",l={opacity:o?1:0},c;e.effects.save(r,i),r.show(),e.effects.createWrapper(r),c=t.distance||r[a==="top"?"outerHeight":"outerWidth"](!0)/2,o&&r.css("opacity",0).css(a,f==="pos"?-c:c),l[a]=(o?f==="pos"?"+=":"-=":f==="pos"?"-=":"+=")+c,r.animate(l,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){s==="hide"&&r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()}})}})(jQuery);(function(e,t){e.effects.effect.explode=function(t,n){function y(){c.push(this),c.length===r*i&&b()}function b(){s.css({visibility:"visible"}),e(c).remove(),u||s.hide(),n()}var r=t.pieces?Math.round(Math.sqrt(t.pieces)):3,i=r,s=e(this),o=e.effects.setMode(s,t.mode||"hide"),u=o==="show",a=s.show().css("visibility","hidden").offset(),f=Math.ceil(s.outerWidth()/i),l=Math.ceil(s.outerHeight()/r),c=[],h,p,d,v,m,g;for(h=0;h<r;h++){v=a.top+h*l,g=h-(r-1)/2;for(p=0;p<i;p++)d=a.left+p*f,m=p-(i-1)/2,s.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-p*f,top:-h*l}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:f,height:l,left:d+(u?m*f:0),top:v+(u?g*l:0),opacity:u?0:1}).animate({left:d+(u?0:m*f),top:v+(u?0:g*l),opacity:u?1:0},t.duration||500,t.easing,y)}}})(jQuery);(function(e,t){e.effects.effect.fade=function(t,n){var r=e(this),i=e.effects.setMode(r,t.mode||"toggle");r.animate({opacity:i},{queue:!1,duration:t.duration,easing:t.easing,complete:n})}})(jQuery);(function(e,t){e.effects.effect.fold=function(t,n){var r=e(this),i=["position","top","bottom","left","right","height","width"],s=e.effects.setMode(r,t.mode||"hide"),o=s==="show",u=s==="hide",a=t.size||15,f=/([0-9]+)%/.exec(a),l=!!t.horizFirst,c=o!==l,h=c?["width","height"]:["height","width"],p=t.duration/2,d,v,m={},g={};e.effects.save(r,i),r.show(),d=e.effects.createWrapper(r).css({overflow:"hidden"}),v=c?[d.width(),d.height()]:[d.height(),d.width()],f&&(a=parseInt(f[1],10)/100*v[u?0:1]),o&&d.css(l?{height:0,width:a}:{height:a,width:0}),m[h[0]]=o?v[0]:a,g[h[1]]=o?v[1]:0,d.animate(m,p,t.easing).animate(g,p,t.easing,function(){u&&r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()})}})(jQuery);(function(e,t){e.effects.effect.highlight=function(t,n){var r=e(this),i=["backgroundImage","backgroundColor","opacity"],s=e.effects.setMode(r,t.mode||"show"),o={backgroundColor:r.css("backgroundColor")};s==="hide"&&(o.opacity=0),e.effects.save(r,i),r.show().css({backgroundImage:"none",backgroundColor:t.color||"#ffff99"}).animate(o,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){s==="hide"&&r.hide(),e.effects.restore(r,i),n()}})}})(jQuery);(function(e,t){e.effects.effect.pulsate=function(t,n){var r=e(this),i=e.effects.setMode(r,t.mode||"show"),s=i==="show",o=i==="hide",u=s||i==="hide",a=(t.times||5)*2+(u?1:0),f=t.duration/a,l=0,c=r.queue(),h=c.length,p;if(s||!r.is(":visible"))r.css("opacity",0).show(),l=1;for(p=1;p<a;p++)r.animate({opacity:l},f,t.easing),l=1-l;r.animate({opacity:l},f,t.easing),r.queue(function(){o&&r.hide(),n()}),h>1&&c.splice.apply(c,[1,0].concat(c.splice(h,a+1))),r.dequeue()}})(jQuery);(function(e,t){e.effects.effect.puff=function(t,n){var r=e(this),i=e.effects.setMode(r,t.mode||"hide"),s=i==="hide",o=parseInt(t.percent,10)||150,u=o/100,a={height:r.height(),width:r.width()};e.extend(t,{effect:"scale",queue:!1,fade:!0,mode:i,complete:n,percent:s?o:100,from:s?a:{height:a.height*u,width:a.width*u}}),r.effect(t)},e.effects.effect.scale=function(t,n){var r=e(this),i=e.extend(!0,{},t),s=e.effects.setMode(r,t.mode||"effect"),o=parseInt(t.percent,10)||(parseInt(t.percent,10)===0?0:s==="hide"?0:100),u=t.direction||"both",a=t.origin,f={height:r.height(),width:r.width(),outerHeight:r.outerHeight(),outerWidth:r.outerWidth()},l={y:u!=="horizontal"?o/100:1,x:u!=="vertical"?o/100:1};i.effect="size",i.queue=!1,i.complete=n,s!=="effect"&&(i.origin=a||["middle","center"],i.restore=!0),i.from=t.from||(s==="show"?{height:0,width:0}:f),i.to={height:f.height*l.y,width:f.width*l.x,outerHeight:f.outerHeight*l.y,outerWidth:f.outerWidth*l.x},i.fade&&(s==="show"&&(i.from.opacity=0,i.to.opacity=1),s==="hide"&&(i.from.opacity=1,i.to.opacity=0)),r.effect(i)},e.effects.effect.size=function(t,n){var r,i,s,o=e(this),u=["position","top","bottom","left","right","width","height","overflow","opacity"],a=["position","top","bottom","left","right","overflow","opacity"],f=["width","height","overflow"],l=["fontSize"],c=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],h=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],p=e.effects.setMode(o,t.mode||"effect"),d=t.restore||p!=="effect",v=t.scale||"both",m=t.origin||["middle","center"],g=o.css("position"),y=d?u:a,b={height:0,width:0};p==="show"&&o.show(),r={height:o.height(),width:o.width(),outerHeight:o.outerHeight(),outerWidth:o.outerWidth()},t.mode==="toggle"&&p==="show"?(o.from=t.to||b,o.to=t.from||r):(o.from=t.from||(p==="show"?b:r),o.to=t.to||(p==="hide"?b:r)),s={from:{y:o.from.height/r.height,x:o.from.width/r.width},to:{y:o.to.height/r.height,x:o.to.width/r.width}};if(v==="box"||v==="both")s.from.y!==s.to.y&&(y=y.concat(c),o.from=e.effects.setTransition(o,c,s.from.y,o.from),o.to=e.effects.setTransition(o,c,s.to.y,o.to)),s.from.x!==s.to.x&&(y=y.concat(h),o.from=e.effects.setTransition(o,h,s.from.x,o.from),o.to=e.effects.setTransition(o,h,s.to.x,o.to));(v==="content"||v==="both")&&s.from.y!==s.to.y&&(y=y.concat(l).concat(f),o.from=e.effects.setTransition(o,l,s.from.y,o.from),o.to=e.effects.setTransition(o,l,s.to.y,o.to)),e.effects.save(o,y),o.show(),e.effects.createWrapper(o),o.css("overflow","hidden").css(o.from),m&&(i=e.effects.getBaseline(m,r),o.from.top=(r.outerHeight-o.outerHeight())*i.y,o.from.left=(r.outerWidth-o.outerWidth())*i.x,o.to.top=(r.outerHeight-o.to.outerHeight)*i.y,o.to.left=(r.outerWidth-o.to.outerWidth)*i.x),o.css(o.from);if(v==="content"||v==="both")c=c.concat(["marginTop","marginBottom"]).concat(l),h=h.concat(["marginLeft","marginRight"]),f=u.concat(c).concat(h),o.find("*[width]").each(function(){var n=e(this),r={height:n.height(),width:n.width()};d&&e.effects.save(n,f),n.from={height:r.height*s.from.y,width:r.width*s.from.x},n.to={height:r.height*s.to.y,width:r.width*s.to.x},s.from.y!==s.to.y&&(n.from=e.effects.setTransition(n,c,s.from.y,n.from),n.to=e.effects.setTransition(n,c,s.to.y,n.to)),s.from.x!==s.to.x&&(n.from=e.effects.setTransition(n,h,s.from.x,n.from),n.to=e.effects.setTransition(n,h,s.to.x,n.to)),n.css(n.from),n.animate(n.to,t.duration,t.easing,function(){d&&e.effects.restore(n,f)})});o.animate(o.to,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){o.to.opacity===0&&o.css("opacity",o.from.opacity),p==="hide"&&o.hide(),e.effects.restore(o,y),d||(g==="static"?o.css({position:"relative",top:o.to.top,left:o.to.left}):e.each(["top","left"],function(e,t){o.css(t,function(t,n){var r=parseInt(n,10),i=e?o.to.left:o.to.top;return n==="auto"?i+"px":r+i+"px"})})),e.effects.removeWrapper(o),n()}})}})(jQuery);(function(e,t){e.effects.effect.shake=function(t,n){var r=e(this),i=["position","top","bottom","left","right","height","width"],s=e.effects.setMode(r,t.mode||"effect"),o=t.direction||"left",u=t.distance||20,a=t.times||3,f=a*2+1,l=Math.round(t.duration/f),c=o==="up"||o==="down"?"top":"left",h=o==="up"||o==="left",p={},d={},v={},m,g=r.queue(),y=g.length;e.effects.save(r,i),r.show(),e.effects.createWrapper(r),p[c]=(h?"-=":"+=")+u,d[c]=(h?"+=":"-=")+u*2,v[c]=(h?"-=":"+=")+u*2,r.animate(p,l,t.easing);for(m=1;m<a;m++)r.animate(d,l,t.easing).animate(v,l,t.easing);r.animate(d,l,t.easing).animate(p,l/2,t.easing).queue(function(){s==="hide"&&r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()}),y>1&&g.splice.apply(g,[1,0].concat(g.splice(y,f+1))),r.dequeue()}})(jQuery);(function(e,t){e.effects.effect.slide=function(t,n){var r=e(this),i=["position","top","bottom","left","right","width","height"],s=e.effects.setMode(r,t.mode||"show"),o=s==="show",u=t.direction||"left",a=u==="up"||u==="down"?"top":"left",f=u==="up"||u==="left",l,c={};e.effects.save(r,i),r.show(),l=t.distance||r[a==="top"?"outerHeight":"outerWidth"](!0),e.effects.createWrapper(r).css({overflow:"hidden"}),o&&r.css(a,f?isNaN(l)?"-"+l:-l:l),c[a]=(o?f?"+=":"-=":f?"-=":"+=")+l,r.animate(c,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){s==="hide"&&r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()}})}})(jQuery);(function(e,t){e.effects.effect.transfer=function(t,n){var r=e(this),i=e(t.to),s=i.css("position")==="fixed",o=e("body"),u=s?o.scrollTop():0,a=s?o.scrollLeft():0,f=i.offset(),l={top:f.top-u,left:f.left-a,height:i.innerHeight(),width:i.innerWidth()},c=r.offset(),h=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(t.className).css({top:c.top-u,left:c.left-a,height:r.innerHeight(),width:r.innerWidth(),position:s?"fixed":"absolute"}).animate(l,t.duration,t.easing,function(){h.remove(),n()})}})(jQuery);
+// Chosen, a Select Box Enhancer for jQuery and Prototype
+// by Patrick Filler for Harvest, http://getharvest.com
+//
+// Version 1.0.0
+// Full source at https://github.com/harvesthq/chosen
+// Copyright (c) 2011 Harvest http://getharvest.com
+
+// MIT License, https://github.com/harvesthq/chosen/blob/master/LICENSE.md
+// This file is generated by `grunt build`, do not edit it by hand.
+(function() {
+ var $, AbstractChosen, Chosen, SelectParser, _ref,
+ __hasProp = {}.hasOwnProperty,
+ __extends = function(child, parent) { for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } function ctor() { this.constructor = child; } ctor.prototype = parent.prototype; child.prototype = new ctor(); child.__super__ = parent.prototype; return child; };
+
+ SelectParser = (function() {
+ function SelectParser() {
+ this.options_index = 0;
+ this.parsed = [];
+ }
+
+ SelectParser.prototype.add_node = function(child) {
+ if (child.nodeName.toUpperCase() === "OPTGROUP") {
+ return this.add_group(child);
+ } else {
+ return this.add_option(child);
+ }
+ };
+
+ SelectParser.prototype.add_group = function(group) {
+ var group_position, option, _i, _len, _ref, _results;
+ group_position = this.parsed.length;
+ this.parsed.push({
+ array_index: group_position,
+ group: true,
+ label: this.escapeExpression(group.label),
+ children: 0,
+ disabled: group.disabled
+ });
+ _ref = group.childNodes;
+ _results = [];
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ option = _ref[_i];
+ _results.push(this.add_option(option, group_position, group.disabled));
+ }
+ return _results;
+ };
+
+ SelectParser.prototype.add_option = function(option, group_position, group_disabled) {
+ if (option.nodeName.toUpperCase() === "OPTION") {
+ if (option.text !== "") {
+ if (group_position != null) {
+ this.parsed[group_position].children += 1;
+ }
+ this.parsed.push({
+ array_index: this.parsed.length,
+ options_index: this.options_index,
+ value: option.value,
+ text: option.text,
+ html: option.innerHTML,
+ selected: option.selected,
+ disabled: group_disabled === true ? group_disabled : option.disabled,
+ group_array_index: group_position,
+ classes: option.className,
+ style: option.style.cssText
+ });
+ } else {
+ this.parsed.push({
+ array_index: this.parsed.length,
+ options_index: this.options_index,
+ empty: true
+ });
+ }
+ return this.options_index += 1;
+ }
+ };
+
+ SelectParser.prototype.escapeExpression = function(text) {
+ var map, unsafe_chars;
+ if ((text == null) || text === false) {
+ return "";
+ }
+ if (!/[\&\<\>\"\'\`]/.test(text)) {
+ return text;
+ }
+ map = {
+ "<": "<",
+ ">": ">",
+ '"': """,
+ "'": "'",
+ "`": "`"
+ };
+ unsafe_chars = /&(?!\w+;)|[\<\>\"\'\`]/g;
+ return text.replace(unsafe_chars, function(chr) {
+ return map[chr] || "&";
+ });
+ };
+
+ return SelectParser;
+
+ })();
+
+ SelectParser.select_to_array = function(select) {
+ var child, parser, _i, _len, _ref;
+ parser = new SelectParser();
+ _ref = select.childNodes;
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ child = _ref[_i];
+ parser.add_node(child);
+ }
+ return parser.parsed;
+ };
+
+ AbstractChosen = (function() {
+ function AbstractChosen(form_field, options) {
+ this.form_field = form_field;
+ this.options = options != null ? options : {};
+ if (!AbstractChosen.browser_is_supported()) {
+ return;
+ }
+ this.is_multiple = this.form_field.multiple;
+ this.set_default_text();
+ this.set_default_values();
+ this.setup();
+ this.set_up_html();
+ this.register_observers();
+ }
+
+ AbstractChosen.prototype.set_default_values = function() {
+ var _this = this;
+ this.click_test_action = function(evt) {
+ return _this.test_active_click(evt);
+ };
+ this.activate_action = function(evt) {
+ return _this.activate_field(evt);
+ };
+ this.active_field = false;
+ this.mouse_on_container = false;
+ this.results_showing = false;
+ this.result_highlighted = null;
+ this.allow_single_deselect = (this.options.allow_single_deselect != null) && (this.form_field.options[0] != null) && this.form_field.options[0].text === "" ? this.options.allow_single_deselect : false;
+ this.disable_search_threshold = this.options.disable_search_threshold || 0;
+ this.disable_search = this.options.disable_search || false;
+ this.enable_split_word_search = this.options.enable_split_word_search != null ? this.options.enable_split_word_search : true;
+ this.group_search = this.options.group_search != null ? this.options.group_search : true;
+ this.search_contains = this.options.search_contains || false;
+ this.single_backstroke_delete = this.options.single_backstroke_delete != null ? this.options.single_backstroke_delete : true;
+ this.max_selected_options = this.options.max_selected_options || Infinity;
+ this.inherit_select_classes = this.options.inherit_select_classes || false;
+ this.display_selected_options = this.options.display_selected_options != null ? this.options.display_selected_options : true;
+ this.display_disabled_options = this.options.display_disabled_options != null ? this.options.display_disabled_options : true;
+ this.create_option = this.options.create_option || false;
+ this.persistent_create_option = this.options.persistent_create_option || false;
+ return this.skip_no_results = this.options.skip_no_results || false;
+ };
+
+ AbstractChosen.prototype.set_default_text = function() {
+ if (this.form_field.getAttribute("data-placeholder")) {
+ this.default_text = this.form_field.getAttribute("data-placeholder");
+ } else if (this.is_multiple) {
+ this.default_text = this.options.placeholder_text_multiple || this.options.placeholder_text || AbstractChosen.default_multiple_text;
+ } else {
+ this.default_text = this.options.placeholder_text_single || this.options.placeholder_text || AbstractChosen.default_single_text;
+ }
+ this.results_none_found = this.form_field.getAttribute("data-no_results_text") || this.options.no_results_text || AbstractChosen.default_no_result_text;
+ return this.create_option_text = this.form_field.getAttribute("data-create_option_text") || this.options.create_option_text || AbstractChosen.default_create_option_text;
+ };
+
+ AbstractChosen.prototype.mouse_enter = function() {
+ return this.mouse_on_container = true;
+ };
+
+ AbstractChosen.prototype.mouse_leave = function() {
+ return this.mouse_on_container = false;
+ };
+
+ AbstractChosen.prototype.input_focus = function(evt) {
+ var _this = this;
+ if (this.is_multiple) {
+ if (!this.active_field) {
+ return setTimeout((function() {
+ return _this.container_mousedown();
+ }), 50);
+ }
+ } else {
+ if (!this.active_field) {
+ return this.activate_field();
+ }
+ }
+ };
+
+ AbstractChosen.prototype.input_blur = function(evt) {
+ var _this = this;
+ if (!this.mouse_on_container) {
+ this.active_field = false;
+ return setTimeout((function() {
+ return _this.blur_test();
+ }), 100);
+ }
+ };
+
+ AbstractChosen.prototype.results_option_build = function(options) {
+ var content, data, _i, _len, _ref;
+ content = '';
+ _ref = this.results_data;
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ data = _ref[_i];
+ if (data.group) {
+ content += this.result_add_group(data);
+ } else {
+ content += this.result_add_option(data);
+ }
+ if (options != null ? options.first : void 0) {
+ if (data.selected && this.is_multiple) {
+ this.choice_build(data);
+ } else if (data.selected && !this.is_multiple) {
+ this.single_set_selected_text(data.text);
+ }
+ }
+ }
+ return content;
+ };
+
+ AbstractChosen.prototype.result_add_option = function(option) {
+ var classes, option_el;
+ if (!option.search_match) {
+ return '';
+ }
+ if (!this.include_option_in_results(option)) {
+ return '';
+ }
+ classes = [];
+ if (!option.disabled && !(option.selected && this.is_multiple)) {
+ classes.push("active-result");
+ }
+ if (option.disabled && !(option.selected && this.is_multiple)) {
+ classes.push("disabled-result");
+ }
+ if (option.selected) {
+ classes.push("result-selected");
+ }
+ if (option.group_array_index != null) {
+ classes.push("group-option");
+ }
+ if (option.classes !== "") {
+ classes.push(option.classes);
+ }
+ option_el = document.createElement("li");
+ option_el.className = classes.join(" ");
+ option_el.style.cssText = option.style;
+ option_el.setAttribute("data-option-array-index", option.array_index);
+ option_el.innerHTML = option.search_text;
+ return this.outerHTML(option_el);
+ };
+
+ AbstractChosen.prototype.result_add_group = function(group) {
+ var group_el;
+ if (!(group.search_match || group.group_match)) {
+ return '';
+ }
+ if (!(group.active_options > 0)) {
+ return '';
+ }
+ group_el = document.createElement("li");
+ group_el.className = "group-result";
+ group_el.innerHTML = group.search_text;
+ return this.outerHTML(group_el);
+ };
+
+ AbstractChosen.prototype.append_option = function(option) {
+ return this.select_append_option(option);
+ };
+
+ AbstractChosen.prototype.results_update_field = function() {
+ this.set_default_text();
+ if (!this.is_multiple) {
+ this.results_reset_cleanup();
+ }
+ this.result_clear_highlight();
+ this.results_build();
+ if (this.results_showing) {
+ return this.winnow_results();
+ }
+ };
+
+ AbstractChosen.prototype.reset_single_select_options = function() {
+ var result, _i, _len, _ref, _results;
+ _ref = this.results_data;
+ _results = [];
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ result = _ref[_i];
+ if (result.selected) {
+ _results.push(result.selected = false);
+ } else {
+ _results.push(void 0);
+ }
+ }
+ return _results;
+ };
+
+ AbstractChosen.prototype.results_toggle = function() {
+ if (this.results_showing) {
+ return this.results_hide();
+ } else {
+ return this.results_show();
+ }
+ };
+
+ AbstractChosen.prototype.results_search = function(evt) {
+ if (this.results_showing) {
+ return this.winnow_results();
+ } else {
+ return this.results_show();
+ }
+ };
+
+ AbstractChosen.prototype.winnow_results = function() {
+ var eregex, escapedSearchText, exact_result, option, regex, regexAnchor, results, results_group, searchText, startpos, text, zregex, _i, _len, _ref;
+ this.no_results_clear();
+ results = 0;
+ exact_result = false;
+ searchText = this.get_search_text();
+ escapedSearchText = searchText.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+ regexAnchor = this.search_contains ? "" : "^";
+ regex = new RegExp(regexAnchor + escapedSearchText, 'i');
+ zregex = new RegExp(escapedSearchText, 'i');
+ eregex = new RegExp('^' + escapedSearchText + '$', 'i');
+ _ref = this.results_data;
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ option = _ref[_i];
+ option.search_match = false;
+ results_group = null;
+ if (this.include_option_in_results(option)) {
+ if (option.group) {
+ option.group_match = false;
+ option.active_options = 0;
+ }
+ if ((option.group_array_index != null) && this.results_data[option.group_array_index]) {
+ results_group = this.results_data[option.group_array_index];
+ if (results_group.active_options === 0 && results_group.search_match) {
+ results += 1;
+ }
+ results_group.active_options += 1;
+ }
+ if (!(option.group && !this.group_search)) {
+ option.search_text = option.group ? option.label : option.html;
+ option.search_match = this.search_string_match(option.search_text, regex);
+ if (option.search_match && !option.group) {
+ results += 1;
+ }
+ exact_result = eregex.test(option.html);
+ if (option.search_match) {
+ if (searchText.length) {
+ startpos = option.search_text.search(zregex);
+ text = option.search_text.substr(0, startpos + searchText.length) + '</em>' + option.search_text.substr(startpos + searchText.length);
+ option.search_text = text.substr(0, startpos) + '<em>' + text.substr(startpos);
+ }
+ if (results_group != null) {
+ results_group.group_match = true;
+ }
+ } else if ((option.group_array_index != null) && this.results_data[option.group_array_index].search_match) {
+ option.search_match = true;
+ }
+ }
+ }
+ }
+ this.result_clear_highlight();
+ if (results < 1 && searchText.length) {
+ this.update_results_content("");
+ if (!(this.create_option && this.skip_no_results)) {
+ this.no_results(searchText);
+ }
+ } else {
+ this.update_results_content(this.results_option_build());
+ this.winnow_results_set_highlight();
+ }
+ if (this.create_option && (results < 1 || (!exact_result && this.persistent_create_option)) && searchText.length) {
+ return this.show_create_option(searchText);
+ }
+ };
+
+ AbstractChosen.prototype.search_string_match = function(search_string, regex) {
+ var part, parts, _i, _len;
+ if (regex.test(search_string)) {
+ return true;
+ } else if (this.enable_split_word_search && (search_string.indexOf(" ") >= 0 || search_string.indexOf("[") === 0)) {
+ parts = search_string.replace(/\[|\]/g, "").split(" ");
+ if (parts.length) {
+ for (_i = 0, _len = parts.length; _i < _len; _i++) {
+ part = parts[_i];
+ if (regex.test(part)) {
+ return true;
+ }
+ }
+ }
+ }
+ };
+
+ AbstractChosen.prototype.choices_count = function() {
+ var option, _i, _len, _ref;
+ if (this.selected_option_count != null) {
+ return this.selected_option_count;
+ }
+ this.selected_option_count = 0;
+ _ref = this.form_field.options;
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ option = _ref[_i];
+ if (option.selected) {
+ this.selected_option_count += 1;
+ }
+ }
+ return this.selected_option_count;
+ };
+
+ AbstractChosen.prototype.choices_click = function(evt) {
+ evt.preventDefault();
+ if (!(this.results_showing || this.is_disabled)) {
+ return this.results_show();
+ }
+ };
+
+ AbstractChosen.prototype.keyup_checker = function(evt) {
+ var stroke, _ref;
+ stroke = (_ref = evt.which) != null ? _ref : evt.keyCode;
+ this.search_field_scale();
+ switch (stroke) {
+ case 8:
+ if (this.is_multiple && this.backstroke_length < 1 && this.choices_count() > 0) {
+ return this.keydown_backstroke();
+ } else if (!this.pending_backstroke) {
+ this.result_clear_highlight();
+ return this.results_search();
+ }
+ break;
+ case 13:
+ evt.preventDefault();
+ if (this.results_showing) {
+ return this.result_select(evt);
+ }
+ break;
+ case 27:
+ if (this.results_showing) {
+ this.results_hide();
+ }
+ return true;
+ case 9:
+ case 38:
+ case 40:
+ case 16:
+ case 91:
+ case 17:
+ break;
+ default:
+ return this.results_search();
+ }
+ };
+
+ AbstractChosen.prototype.container_width = function() {
+ if (this.options.width != null) {
+ return this.options.width;
+ } else {
+ return "" + this.form_field.offsetWidth + "px";
+ }
+ };
+
+ AbstractChosen.prototype.include_option_in_results = function(option) {
+ if (this.is_multiple && (!this.display_selected_options && option.selected)) {
+ return false;
+ }
+ if (!this.display_disabled_options && option.disabled) {
+ return false;
+ }
+ if (option.empty) {
+ return false;
+ }
+ return true;
+ };
+
+ AbstractChosen.prototype.search_results_touchstart = function(evt) {
+ this.touch_started = true;
+ return this.search_results_mouseover(evt);
+ };
+
+ AbstractChosen.prototype.search_results_touchmove = function(evt) {
+ this.touch_started = false;
+ return this.search_results_mouseout(evt);
+ };
+
+ AbstractChosen.prototype.search_results_touchend = function(evt) {
+ if (this.touch_started) {
+ return this.search_results_mouseup(evt);
+ }
+ };
+
+ AbstractChosen.prototype.outerHTML = function(element) {
+ var tmp;
+ if (element.outerHTML) {
+ return element.outerHTML;
+ }
+ tmp = document.createElement("div");
+ tmp.appendChild(element);
+ return tmp.innerHTML;
+ };
+
+ AbstractChosen.browser_is_supported = function() {
+ if (window.navigator.appName === "Microsoft Internet Explorer") {
+ return document.documentMode >= 8;
+ }
+ if (/iP(od|hone)/i.test(window.navigator.userAgent)) {
+ return false;
+ }
+ if (/Android/i.test(window.navigator.userAgent)) {
+ if (/Mobile/i.test(window.navigator.userAgent)) {
+ return false;
+ }
+ }
+ return true;
+ };
+
+ AbstractChosen.default_multiple_text = "Select Some Options";
+
+ AbstractChosen.default_single_text = "Select an Option";
+
+ AbstractChosen.default_no_result_text = "No results match";
+
+ AbstractChosen.default_create_option_text = "Add Option";
+
+ return AbstractChosen;
+
+ })();
+
+ $ = jQuery;
+
+ $.fn.extend({
+ chosen: function(options) {
+ if (!AbstractChosen.browser_is_supported()) {
+ return this;
+ }
+ return this.each(function(input_field) {
+ var $this, chosen;
+ $this = $(this);
+ chosen = $this.data('chosen');
+ if (options === 'destroy' && chosen) {
+ chosen.destroy();
+ } else if (!chosen) {
+ $this.data('chosen', new Chosen(this, options));
+ }
+ });
+ }
+ });
+
+ Chosen = (function(_super) {
+ __extends(Chosen, _super);
+
+ function Chosen() {
+ _ref = Chosen.__super__.constructor.apply(this, arguments);
+ return _ref;
+ }
+
+ Chosen.prototype.setup = function() {
+ this.form_field_jq = $(this.form_field);
+ this.current_selectedIndex = this.form_field.selectedIndex;
+ return this.is_rtl = this.form_field_jq.hasClass("chosen-rtl");
+ };
+
+ Chosen.prototype.set_up_html = function() {
+ var container_classes, container_props;
+ container_classes = ["chosen-container"];
+ container_classes.push("chosen-container-" + (this.is_multiple ? "multi" : "single"));
+ if (this.inherit_select_classes && this.form_field.className) {
+ container_classes.push(this.form_field.className);
+ }
+ if (this.is_rtl) {
+ container_classes.push("chosen-rtl");
+ }
+ container_props = {
+ 'class': container_classes.join(' '),
+ 'style': "width: " + (this.container_width()) + ";",
+ 'title': this.form_field.title
+ };
+ if (this.form_field.id.length) {
+ container_props.id = this.form_field.id.replace(/[^\w]/g, '_') + "_chosen";
+ }
+ this.container = $("<div />", container_props);
+ if (this.is_multiple) {
+ this.container.html('<ul class="chosen-choices"><li class="search-field"><input type="text" value="' + this.default_text + '" class="default" autocomplete="off" style="width:25px;" /></li></ul><div class="chosen-drop"><ul class="chosen-results"></ul></div>');
+ } else {
+ this.container.html('<a class="chosen-single chosen-default" tabindex="-1"><span>' + this.default_text + '</span><div><b></b></div></a><div class="chosen-drop"><div class="chosen-search"><input type="text" autocomplete="off" /></div><ul class="chosen-results"></ul></div>');
+ }
+ this.form_field_jq.hide().after(this.container);
+ this.dropdown = this.container.find('div.chosen-drop').first();
+ this.search_field = this.container.find('input').first();
+ this.search_results = this.container.find('ul.chosen-results').first();
+ this.search_field_scale();
+ this.search_no_results = this.container.find('li.no-results').first();
+ if (this.is_multiple) {
+ this.search_choices = this.container.find('ul.chosen-choices').first();
+ this.search_container = this.container.find('li.search-field').first();
+ } else {
+ this.search_container = this.container.find('div.chosen-search').first();
+ this.selected_item = this.container.find('.chosen-single').first();
+ }
+ this.results_build();
+ this.set_tab_index();
+ this.set_label_behavior();
+ return this.form_field_jq.trigger("chosen:ready", {
+ chosen: this
+ });
+ };
+
+ Chosen.prototype.register_observers = function() {
+ var _this = this;
+ this.container.bind('mousedown.chosen', function(evt) {
+ _this.container_mousedown(evt);
+ });
+ this.container.bind('mouseup.chosen', function(evt) {
+ _this.container_mouseup(evt);
+ });
+ this.container.bind('mouseenter.chosen', function(evt) {
+ _this.mouse_enter(evt);
+ });
+ this.container.bind('mouseleave.chosen', function(evt) {
+ _this.mouse_leave(evt);
+ });
+ this.search_results.bind('mouseup.chosen', function(evt) {
+ _this.search_results_mouseup(evt);
+ });
+ this.search_results.bind('mouseover.chosen', function(evt) {
+ _this.search_results_mouseover(evt);
+ });
+ this.search_results.bind('mouseout.chosen', function(evt) {
+ _this.search_results_mouseout(evt);
+ });
+ this.search_results.bind('mousewheel.chosen DOMMouseScroll.chosen', function(evt) {
+ _this.search_results_mousewheel(evt);
+ });
+ this.search_results.bind('touchstart.chosen', function(evt) {
+ _this.search_results_touchstart(evt);
+ });
+ this.search_results.bind('touchmove.chosen', function(evt) {
+ _this.search_results_touchmove(evt);
+ });
+ this.search_results.bind('touchend.chosen', function(evt) {
+ _this.search_results_touchend(evt);
+ });
+ this.form_field_jq.bind("chosen:updated.chosen", function(evt) {
+ _this.results_update_field(evt);
+ });
+ this.form_field_jq.bind("chosen:activate.chosen", function(evt) {
+ _this.activate_field(evt);
+ });
+ this.form_field_jq.bind("chosen:open.chosen", function(evt) {
+ _this.container_mousedown(evt);
+ });
+ this.search_field.bind('blur.chosen', function(evt) {
+ _this.input_blur(evt);
+ });
+ this.search_field.bind('keyup.chosen', function(evt) {
+ _this.keyup_checker(evt);
+ });
+ this.search_field.bind('keydown.chosen', function(evt) {
+ _this.keydown_checker(evt);
+ });
+ this.search_field.bind('focus.chosen', function(evt) {
+ _this.input_focus(evt);
+ });
+ if (this.is_multiple) {
+ return this.search_choices.bind('click.chosen', function(evt) {
+ _this.choices_click(evt);
+ });
+ } else {
+ return this.container.bind('click.chosen', function(evt) {
+ evt.preventDefault();
+ });
+ }
+ };
+
+ Chosen.prototype.destroy = function() {
+ $(document).unbind("click.chosen", this.click_test_action);
+ if (this.search_field[0].tabIndex) {
+ this.form_field_jq[0].tabIndex = this.search_field[0].tabIndex;
+ }
+ this.container.remove();
+ this.form_field_jq.removeData('chosen');
+ return this.form_field_jq.show();
+ };
+
+ Chosen.prototype.search_field_disabled = function() {
+ this.is_disabled = this.form_field_jq[0].disabled;
+ if (this.is_disabled) {
+ this.container.addClass('chosen-disabled');
+ this.search_field[0].disabled = true;
+ if (!this.is_multiple) {
+ this.selected_item.unbind("focus.chosen", this.activate_action);
+ }
+ return this.close_field();
+ } else {
+ this.container.removeClass('chosen-disabled');
+ this.search_field[0].disabled = false;
+ if (!this.is_multiple) {
+ return this.selected_item.bind("focus.chosen", this.activate_action);
+ }
+ }
+ };
+
+ Chosen.prototype.container_mousedown = function(evt) {
+ if (!this.is_disabled) {
+ if (evt && evt.type === "mousedown" && !this.results_showing) {
+ evt.preventDefault();
+ }
+ if (!((evt != null) && ($(evt.target)).hasClass("search-choice-close"))) {
+ if (!this.active_field) {
+ if (this.is_multiple) {
+ this.search_field.val("");
+ }
+ $(document).bind('click.chosen', this.click_test_action);
+ this.results_show();
+ } else if (!this.is_multiple && evt && (($(evt.target)[0] === this.selected_item[0]) || $(evt.target).parents("a.chosen-single").length)) {
+ evt.preventDefault();
+ this.results_toggle();
+ }
+ return this.activate_field();
+ }
+ }
+ };
+
+ Chosen.prototype.container_mouseup = function(evt) {
+ if (evt.target.nodeName === "ABBR" && !this.is_disabled) {
+ return this.results_reset(evt);
+ }
+ };
+
+ Chosen.prototype.search_results_mousewheel = function(evt) {
+ var delta, _ref1, _ref2;
+ delta = -((_ref1 = evt.originalEvent) != null ? _ref1.wheelDelta : void 0) || ((_ref2 = evt.originialEvent) != null ? _ref2.detail : void 0);
+ if (delta != null) {
+ evt.preventDefault();
+ if (evt.type === 'DOMMouseScroll') {
+ delta = delta * 40;
+ }
+ return this.search_results.scrollTop(delta + this.search_results.scrollTop());
+ }
+ };
+
+ Chosen.prototype.blur_test = function(evt) {
+ if (!this.active_field && this.container.hasClass("chosen-container-active")) {
+ return this.close_field();
+ }
+ };
+
+ Chosen.prototype.close_field = function() {
+ $(document).unbind("click.chosen", this.click_test_action);
+ this.active_field = false;
+ this.results_hide();
+ this.container.removeClass("chosen-container-active");
+ this.clear_backstroke();
+ this.show_search_field_default();
+ return this.search_field_scale();
+ };
+
+ Chosen.prototype.activate_field = function() {
+ this.container.addClass("chosen-container-active");
+ this.active_field = true;
+ this.search_field.val(this.search_field.val());
+ return this.search_field.focus();
+ };
+
+ Chosen.prototype.test_active_click = function(evt) {
+ if (this.container.is($(evt.target).closest('.chosen-container'))) {
+ return this.active_field = true;
+ } else {
+ return this.close_field();
+ }
+ };
+
+ Chosen.prototype.results_build = function() {
+ this.parsing = true;
+ this.selected_option_count = null;
+ this.results_data = SelectParser.select_to_array(this.form_field);
+ if (this.is_multiple) {
+ this.search_choices.find("li.search-choice").remove();
+ } else if (!this.is_multiple) {
+ this.single_set_selected_text();
+ if (this.disable_search || this.form_field.options.length <= this.disable_search_threshold && !this.create_option) {
+ this.search_field[0].readOnly = true;
+ this.container.addClass("chosen-container-single-nosearch");
+ } else {
+ this.search_field[0].readOnly = false;
+ this.container.removeClass("chosen-container-single-nosearch");
+ }
+ }
+ this.update_results_content(this.results_option_build({
+ first: true
+ }));
+ this.search_field_disabled();
+ this.show_search_field_default();
+ this.search_field_scale();
+ return this.parsing = false;
+ };
+
+ Chosen.prototype.result_do_highlight = function(el) {
+ var high_bottom, high_top, maxHeight, visible_bottom, visible_top;
+ if (el.length) {
+ this.result_clear_highlight();
+ this.result_highlight = el;
+ this.result_highlight.addClass("highlighted");
+ maxHeight = parseInt(this.search_results.css("maxHeight"), 10);
+ visible_top = this.search_results.scrollTop();
+ visible_bottom = maxHeight + visible_top;
+ high_top = this.result_highlight.position().top + this.search_results.scrollTop();
+ high_bottom = high_top + this.result_highlight.outerHeight();
+ if (high_bottom >= visible_bottom) {
+ return this.search_results.scrollTop((high_bottom - maxHeight) > 0 ? high_bottom - maxHeight : 0);
+ } else if (high_top < visible_top) {
+ return this.search_results.scrollTop(high_top);
+ }
+ }
+ };
+
+ Chosen.prototype.result_clear_highlight = function() {
+ if (this.result_highlight) {
+ this.result_highlight.removeClass("highlighted");
+ }
+ return this.result_highlight = null;
+ };
+
+ Chosen.prototype.results_show = function() {
+ if (this.is_multiple && this.max_selected_options <= this.choices_count()) {
+ this.form_field_jq.trigger("chosen:maxselected", {
+ chosen: this
+ });
+ return false;
+ }
+ this.container.addClass("chosen-with-drop");
+ this.form_field_jq.trigger("chosen:showing_dropdown", {
+ chosen: this
+ });
+ this.results_showing = true;
+ this.search_field.focus();
+ this.search_field.val(this.search_field.val());
+ return this.winnow_results();
+ };
+
+ Chosen.prototype.update_results_content = function(content) {
+ return this.search_results.html(content);
+ };
+
+ Chosen.prototype.results_hide = function() {
+ if (this.results_showing) {
+ this.result_clear_highlight();
+ this.container.removeClass("chosen-with-drop");
+ this.form_field_jq.trigger("chosen:hiding_dropdown", {
+ chosen: this
+ });
+ }
+ return this.results_showing = false;
+ };
+
+ Chosen.prototype.set_tab_index = function(el) {
+ var ti;
+ if (this.form_field.tabIndex) {
+ ti = this.form_field.tabIndex;
+ this.form_field.tabIndex = -1;
+ return this.search_field[0].tabIndex = ti;
+ }
+ };
+
+ Chosen.prototype.set_label_behavior = function() {
+ var _this = this;
+ this.form_field_label = this.form_field_jq.parents("label");
+ if (!this.form_field_label.length && this.form_field.id.length) {
+ this.form_field_label = $("label[for='" + this.form_field.id + "']");
+ }
+ if (this.form_field_label.length > 0) {
+ return this.form_field_label.bind('click.chosen', function(evt) {
+ if (_this.is_multiple) {
+ return _this.container_mousedown(evt);
+ } else {
+ return _this.activate_field();
+ }
+ });
+ }
+ };
+
+ Chosen.prototype.show_search_field_default = function() {
+ if (this.is_multiple && this.choices_count() < 1 && !this.active_field) {
+ this.search_field.val(this.default_text);
+ return this.search_field.addClass("default");
+ } else {
+ this.search_field.val("");
+ return this.search_field.removeClass("default");
+ }
+ };
+
+ Chosen.prototype.search_results_mouseup = function(evt) {
+ var target;
+ target = $(evt.target).hasClass("active-result") ? $(evt.target) : $(evt.target).parents(".active-result").first();
+ if (target.length) {
+ this.result_highlight = target;
+ this.result_select(evt);
+ return this.search_field.focus();
+ }
+ };
+
+ Chosen.prototype.search_results_mouseover = function(evt) {
+ var target;
+ target = $(evt.target).hasClass("active-result") ? $(evt.target) : $(evt.target).parents(".active-result").first();
+ if (target) {
+ return this.result_do_highlight(target);
+ }
+ };
+
+ Chosen.prototype.search_results_mouseout = function(evt) {
+ if ($(evt.target).hasClass("active-result" || $(evt.target).parents('.active-result').first())) {
+ return this.result_clear_highlight();
+ }
+ };
+
+ Chosen.prototype.choice_build = function(item) {
+ var choice, close_link,
+ _this = this;
+ choice = $('<li />', {
+ "class": "search-choice"
+ }).html("<span>" + item.html + "</span>");
+ if (item.disabled) {
+ choice.addClass('search-choice-disabled');
+ } else {
+ close_link = $('<a />', {
+ "class": 'search-choice-close',
+ 'data-option-array-index': item.array_index
+ });
+ close_link.bind('click.chosen', function(evt) {
+ return _this.choice_destroy_link_click(evt);
+ });
+ choice.append(close_link);
+ }
+ return this.search_container.before(choice);
+ };
+
+ Chosen.prototype.choice_destroy_link_click = function(evt) {
+ evt.preventDefault();
+ evt.stopPropagation();
+ if (!this.is_disabled) {
+ return this.choice_destroy($(evt.target));
+ }
+ };
+
+ Chosen.prototype.choice_destroy = function(link) {
+ if (this.result_deselect(link[0].getAttribute("data-option-array-index"))) {
+ this.show_search_field_default();
+ if (this.is_multiple && this.choices_count() > 0 && this.search_field.val().length < 1) {
+ this.results_hide();
+ }
+ link.parents('li').first().remove();
+ return this.search_field_scale();
+ }
+ };
+
+ Chosen.prototype.results_reset = function() {
+ this.reset_single_select_options();
+ this.form_field.options[0].selected = true;
+ this.single_set_selected_text();
+ this.show_search_field_default();
+ this.results_reset_cleanup();
+ this.form_field_jq.trigger("change");
+ if (this.active_field) {
+ return this.results_hide();
+ }
+ };
+
+ Chosen.prototype.results_reset_cleanup = function() {
+ this.current_selectedIndex = this.form_field.selectedIndex;
+ return this.selected_item.find("abbr").remove();
+ };
+
+ Chosen.prototype.result_select = function(evt) {
+ var high, item;
+ if (this.result_highlight) {
+ high = this.result_highlight;
+ if (high.hasClass("create-option")) {
+ this.select_create_option(this.search_field.val());
+ return this.results_hide();
+ }
+ this.result_clear_highlight();
+ if (this.is_multiple && this.max_selected_options <= this.choices_count()) {
+ this.form_field_jq.trigger("chosen:maxselected", {
+ chosen: this
+ });
+ return false;
+ }
+ if (this.is_multiple) {
+ high.removeClass("active-result");
+ } else {
+ this.reset_single_select_options();
+ }
+ item = this.results_data[high[0].getAttribute("data-option-array-index")];
+ item.selected = true;
+ this.form_field.options[item.options_index].selected = true;
+ this.selected_option_count = null;
+ if (this.is_multiple) {
+ this.choice_build(item);
+ } else {
+ this.single_set_selected_text(item.text);
+ }
+ if (!((evt.metaKey || evt.ctrlKey) && this.is_multiple)) {
+ this.results_hide();
+ }
+ this.search_field.val("");
+ if (this.is_multiple || this.form_field.selectedIndex !== this.current_selectedIndex) {
+ this.form_field_jq.trigger("change", {
+ 'selected': this.form_field.options[item.options_index].value
+ });
+ }
+ this.current_selectedIndex = this.form_field.selectedIndex;
+ return this.search_field_scale();
+ }
+ };
+
+ Chosen.prototype.single_set_selected_text = function(text) {
+ if (text == null) {
+ text = this.default_text;
+ }
+ if (text === this.default_text) {
+ this.selected_item.addClass("chosen-default");
+ } else {
+ this.single_deselect_control_build();
+ this.selected_item.removeClass("chosen-default");
+ }
+ return this.selected_item.find("span").text(text);
+ };
+
+ Chosen.prototype.result_deselect = function(pos) {
+ var result_data;
+ result_data = this.results_data[pos];
+ if (!this.form_field.options[result_data.options_index].disabled) {
+ result_data.selected = false;
+ this.form_field.options[result_data.options_index].selected = false;
+ this.selected_option_count = null;
+ this.result_clear_highlight();
+ if (this.results_showing) {
+ this.winnow_results();
+ }
+ this.form_field_jq.trigger("change", {
+ deselected: this.form_field.options[result_data.options_index].value
+ });
+ this.search_field_scale();
+ return true;
+ } else {
+ return false;
+ }
+ };
+
+ Chosen.prototype.single_deselect_control_build = function() {
+ if (!this.allow_single_deselect) {
+ return;
+ }
+ if (!this.selected_item.find("abbr").length) {
+ this.selected_item.find("span").first().after("<abbr class=\"search-choice-close\"></abbr>");
+ }
+ return this.selected_item.addClass("chosen-single-with-deselect");
+ };
+
+ Chosen.prototype.get_search_text = function() {
+ if (this.search_field.val() === this.default_text) {
+ return "";
+ } else {
+ return $('<div/>').text($.trim(this.search_field.val())).html();
+ }
+ };
+
+ Chosen.prototype.winnow_results_set_highlight = function() {
+ var do_high, selected_results;
+ selected_results = !this.is_multiple ? this.search_results.find(".result-selected.active-result") : [];
+ do_high = selected_results.length ? selected_results.first() : this.search_results.find(".active-result").first();
+ if (do_high != null) {
+ return this.result_do_highlight(do_high);
+ }
+ };
+
+ Chosen.prototype.no_results = function(terms) {
+ var no_results_html;
+ no_results_html = $('<li class="no-results">' + this.results_none_found + ' "<span></span>"</li>');
+ no_results_html.find("span").first().html(terms);
+ return this.search_results.append(no_results_html);
+ };
+
+ Chosen.prototype.show_create_option = function(terms) {
+ var create_option_html;
+ create_option_html = $('<li class="create-option active-result"><a href="javascript:void(0);">' + this.create_option_text + '</a>: "' + terms + '"</li>');
+ return this.search_results.append(create_option_html);
+ };
+
+ Chosen.prototype.create_option_clear = function() {
+ return this.search_results.find(".create-option").remove();
+ };
+
+ Chosen.prototype.select_create_option = function(terms) {
+ if ($.isFunction(this.create_option)) {
+ return this.create_option.call(this, terms);
+ } else {
+ return this.select_append_option({
+ value: terms,
+ text: terms
+ });
+ }
+ };
+
+ Chosen.prototype.select_append_option = function(options) {
+ var option;
+ option = $('<option />', options).attr('selected', 'selected');
+ this.form_field_jq.append(option);
+ this.form_field_jq.trigger("chosen:updated");
+ this.form_field_jq.trigger("change");
+ return this.search_field.trigger("focus");
+ };
+
+ Chosen.prototype.no_results_clear = function() {
+ return this.search_results.find(".no-results").remove();
+ };
+
+ Chosen.prototype.keydown_arrow = function() {
+ var next_sib;
+ if (this.results_showing && this.result_highlight) {
+ next_sib = this.result_highlight.nextAll("li.active-result").first();
+ if (next_sib) {
+ return this.result_do_highlight(next_sib);
+ }
+ } else if (this.results_showing && this.create_option) {
+ return this.result_do_highlight(this.search_results.find('.create-option'));
+ } else {
+ return this.results_show();
+ }
+ };
+
+ Chosen.prototype.keyup_arrow = function() {
+ var prev_sibs;
+ if (!this.results_showing && !this.is_multiple) {
+ return this.results_show();
+ } else if (this.result_highlight) {
+ prev_sibs = this.result_highlight.prevAll("li.active-result");
+ if (prev_sibs.length) {
+ return this.result_do_highlight(prev_sibs.first());
+ } else {
+ if (this.choices_count() > 0) {
+ this.results_hide();
+ }
+ return this.result_clear_highlight();
+ }
+ }
+ };
+
+ Chosen.prototype.keydown_backstroke = function() {
+ var next_available_destroy;
+ if (this.pending_backstroke) {
+ this.choice_destroy(this.pending_backstroke.find("a").first());
+ return this.clear_backstroke();
+ } else {
+ next_available_destroy = this.search_container.siblings("li.search-choice").last();
+ if (next_available_destroy.length && !next_available_destroy.hasClass("search-choice-disabled")) {
+ this.pending_backstroke = next_available_destroy;
+ if (this.single_backstroke_delete) {
+ return this.keydown_backstroke();
+ } else {
+ return this.pending_backstroke.addClass("search-choice-focus");
+ }
+ }
+ }
+ };
+
+ Chosen.prototype.clear_backstroke = function() {
+ if (this.pending_backstroke) {
+ this.pending_backstroke.removeClass("search-choice-focus");
+ }
+ return this.pending_backstroke = null;
+ };
+
+ Chosen.prototype.keydown_checker = function(evt) {
+ var stroke, _ref1;
+ stroke = (_ref1 = evt.which) != null ? _ref1 : evt.keyCode;
+ this.search_field_scale();
+ if (stroke !== 8 && this.pending_backstroke) {
+ this.clear_backstroke();
+ }
+ switch (stroke) {
+ case 8:
+ this.backstroke_length = this.search_field.val().length;
+ break;
+ case 9:
+ if (this.results_showing && !this.is_multiple) {
+ this.result_select(evt);
+ }
+ this.mouse_on_container = false;
+ break;
+ case 13:
+ evt.preventDefault();
+ break;
+ case 38:
+ evt.preventDefault();
+ this.keyup_arrow();
+ break;
+ case 40:
+ evt.preventDefault();
+ this.keydown_arrow();
+ break;
+ }
+ };
+
+ Chosen.prototype.search_field_scale = function() {
+ var div, f_width, h, style, style_block, styles, w, _i, _len;
+ if (this.is_multiple) {
+ h = 0;
+ w = 0;
+ style_block = "position:absolute; left: -1000px; top: -1000px; display:none;";
+ styles = ['font-size', 'font-style', 'font-weight', 'font-family', 'line-height', 'text-transform', 'letter-spacing'];
+ for (_i = 0, _len = styles.length; _i < _len; _i++) {
+ style = styles[_i];
+ style_block += style + ":" + this.search_field.css(style) + ";";
+ }
+ div = $('<div />', {
+ 'style': style_block
+ });
+ div.text(this.search_field.val());
+ $('body').append(div);
+ w = div.width() + 25;
+ div.remove();
+ f_width = this.container.outerWidth();
+ if (w > f_width - 10) {
+ w = f_width - 10;
+ }
+ return this.search_field.css({
+ 'width': w + 'px'
+ });
+ }
+ };
+
+ return Chosen;
+
+ })(AbstractChosen);
+
+}).call(this);
+/*! perfect-scrollbar - v0.4.6
+* http://noraesae.github.com/perfect-scrollbar/
+* Copyright (c) 2013 HyeonJe Jun; Licensed MIT */
+
+"use strict";(function(e){"function"==typeof define&&define.amd?define(["jquery"],e):e(jQuery)})(function(e){var r={wheelSpeed:10,wheelPropagation:!1,minScrollbarLength:null,useBothWheelAxes:!1,useKeyboard:!0,suppressScrollX:!1,suppressScrollY:!1,scrollXMarginOffset:0,scrollYMarginOffset:0};e.fn.perfectScrollbar=function(o,l){return this.each(function(){var t=e.extend(!0,{},r),s=e(this);if("object"==typeof o?e.extend(!0,t,o):l=o,"update"===l)return s.data("perfect-scrollbar-update")&&s.data("perfect-scrollbar-update")(),s;if("destroy"===l)return s.data("perfect-scrollbar-destroy")&&s.data("perfect-scrollbar-destroy")(),s;if(s.data("perfect-scrollbar"))return s.data("perfect-scrollbar");s.addClass("ps-container");var n,c,a,i,p,f,u,d,b,h,v=e("<div class='ps-scrollbar-x-rail'></div>").appendTo(s),g=e("<div class='ps-scrollbar-y-rail'></div>").appendTo(s),m=e("<div class='ps-scrollbar-x'></div>").appendTo(v),w=e("<div class='ps-scrollbar-y'></div>").appendTo(g),T=parseInt(v.css("bottom"),10),L=parseInt(g.css("right"),10),y=function(){var e=parseInt(h*(f-i)/(i-b),10);s.scrollTop(e),v.css({bottom:T-e})},S=function(){var e=parseInt(d*(p-a)/(a-u),10);s.scrollLeft(e),g.css({right:L-e})},I=function(e){return t.minScrollbarLength&&(e=Math.max(e,t.minScrollbarLength)),e},C=function(){v.css({left:s.scrollLeft(),bottom:T-s.scrollTop(),width:a,display:t.suppressScrollX?"none":"inherit"}),g.css({top:s.scrollTop(),right:L-s.scrollLeft(),height:i,display:t.suppressScrollY?"none":"inherit"}),m.css({left:d,width:u}),w.css({top:h,height:b})},X=function(){a=s.width(),i=s.height(),p=s.prop("scrollWidth"),f=s.prop("scrollHeight"),!t.suppressScrollX&&p>a+t.scrollXMarginOffset?(n=!0,u=I(parseInt(a*a/p,10)),d=parseInt(s.scrollLeft()*(a-u)/(p-a),10)):(n=!1,u=0,d=0,s.scrollLeft(0)),!t.suppressScrollY&&f>i+t.scrollYMarginOffset?(c=!0,b=I(parseInt(i*i/f,10)),h=parseInt(s.scrollTop()*(i-b)/(f-i),10)):(c=!1,b=0,h=0,s.scrollTop(0)),h>=i-b&&(h=i-b),d>=a-u&&(d=a-u),C()},Y=function(e,r){var o=e+r,l=a-u;d=0>o?0:o>l?l:o,v.css({left:s.scrollLeft()}),m.css({left:d})},x=function(e,r){var o=e+r,l=i-b;h=0>o?0:o>l?l:o,g.css({top:s.scrollTop()}),w.css({top:h})},D=function(){var r,o;m.bind("mousedown.perfect-scrollbar",function(e){o=e.pageX,r=m.position().left,v.addClass("in-scrolling"),e.stopPropagation(),e.preventDefault()}),e(document).bind("mousemove.perfect-scrollbar",function(e){v.hasClass("in-scrolling")&&(S(),Y(r,e.pageX-o),e.stopPropagation(),e.preventDefault())}),e(document).bind("mouseup.perfect-scrollbar",function(){v.hasClass("in-scrolling")&&v.removeClass("in-scrolling")}),r=o=null},P=function(){var r,o;w.bind("mousedown.perfect-scrollbar",function(e){o=e.pageY,r=w.position().top,g.addClass("in-scrolling"),e.stopPropagation(),e.preventDefault()}),e(document).bind("mousemove.perfect-scrollbar",function(e){g.hasClass("in-scrolling")&&(y(),x(r,e.pageY-o),e.stopPropagation(),e.preventDefault())}),e(document).bind("mouseup.perfect-scrollbar",function(){g.hasClass("in-scrolling")&&g.removeClass("in-scrolling")}),r=o=null},k=function(){var e=function(e,r){var o=s.scrollTop();if(0===o&&r>0&&0===e)return!t.wheelPropagation;if(o>=f-i&&0>r&&0===e)return!t.wheelPropagation;var l=s.scrollLeft();return 0===l&&0>e&&0===r?!t.wheelPropagation:l>=p-a&&e>0&&0===r?!t.wheelPropagation:!0},r=!1;s.bind("mousewheel.perfect-scrollbar",function(o,l,a,i){t.useBothWheelAxes?c&&!n?i?s.scrollTop(s.scrollTop()-i*t.wheelSpeed):s.scrollTop(s.scrollTop()+a*t.wheelSpeed):n&&!c&&(a?s.scrollLeft(s.scrollLeft()+a*t.wheelSpeed):s.scrollLeft(s.scrollLeft()-i*t.wheelSpeed)):(s.scrollTop(s.scrollTop()-i*t.wheelSpeed),s.scrollLeft(s.scrollLeft()+a*t.wheelSpeed)),X(),r=e(a,i),r&&o.preventDefault()}),s.bind("MozMousePixelScroll.perfect-scrollbar",function(e){r&&e.preventDefault()})},M=function(){var r=function(e,r){var o=s.scrollTop();if(0===o&&r>0&&0===e)return!1;if(o>=f-i&&0>r&&0===e)return!1;var l=s.scrollLeft();return 0===l&&0>e&&0===r?!1:l>=p-a&&e>0&&0===r?!1:!0},o=!1;s.bind("mouseenter.perfect-scrollbar",function(){o=!0}),s.bind("mouseleave.perfect-scrollbar",function(){o=!1});var l=!1;e(document).bind("keydown.perfect-scrollbar",function(e){if(o){var n=0,c=0;switch(e.which){case 37:n=-3;break;case 38:c=3;break;case 39:n=3;break;case 40:c=-3;break;default:return}s.scrollTop(s.scrollTop()-c*t.wheelSpeed),s.scrollLeft(s.scrollLeft()+n*t.wheelSpeed),X(),l=r(n,c),l&&e.preventDefault()}})},O=function(){var e=function(e){e.stopPropagation()};w.bind("click.perfect-scrollbar",e),g.bind("click.perfect-scrollbar",function(e){var r=parseInt(b/2,10),o=e.pageY-g.offset().top-r,l=i-b,t=o/l;0>t?t=0:t>1&&(t=1),s.scrollTop((f-i)*t),X()}),m.bind("click.perfect-scrollbar",e),v.bind("click.perfect-scrollbar",function(e){var r=parseInt(u/2,10),o=e.pageX-v.offset().left-r,l=a-u,t=o/l;0>t?t=0:t>1&&(t=1),s.scrollLeft((p-a)*t),X()})},j=function(){var r=function(e,r){s.scrollTop(s.scrollTop()-r),s.scrollLeft(s.scrollLeft()-e),X()},o={},l=0,t={},n=null,c=!1;e(window).bind("touchstart.perfect-scrollbar",function(){c=!0}),e(window).bind("touchend.perfect-scrollbar",function(){c=!1}),s.bind("touchstart.perfect-scrollbar",function(e){var r=e.originalEvent.targetTouches[0];o.pageX=r.pageX,o.pageY=r.pageY,l=(new Date).getTime(),null!==n&&clearInterval(n),e.stopPropagation()}),s.bind("touchmove.perfect-scrollbar",function(e){if(!c&&1===e.originalEvent.targetTouches.length){var s=e.originalEvent.targetTouches[0],n={};n.pageX=s.pageX,n.pageY=s.pageY;var a=n.pageX-o.pageX,i=n.pageY-o.pageY;r(a,i),o=n;var p=(new Date).getTime();t.x=a/(p-l),t.y=i/(p-l),l=p,e.preventDefault()}}),s.bind("touchend.perfect-scrollbar",function(){clearInterval(n),n=setInterval(function(){return.01>Math.abs(t.x)&&.01>Math.abs(t.y)?(clearInterval(n),void 0):(r(30*t.x,30*t.y),t.x*=.8,t.y*=.8,void 0)},10)})},A=function(){s.unbind(".perfect-scrollbar"),e(window).unbind(".perfect-scrollbar"),e(document).unbind(".perfect-scrollbar"),s.data("perfect-scrollbar",null),s.data("perfect-scrollbar-update",null),s.data("perfect-scrollbar-destroy",null),m.remove(),w.remove(),v.remove(),g.remove(),m=w=a=i=p=f=u=d=T=b=h=L=null},E=function(r){s.addClass("ie").addClass("ie"+r);var o=function(){var r=function(){e(this).addClass("hover")},o=function(){e(this).removeClass("hover")};s.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o),v.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o),g.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o),m.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o),w.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o)},l=function(){C=function(){m.css({left:d+s.scrollLeft(),bottom:T,width:u}),w.css({top:h+s.scrollTop(),right:L,height:b}),m.hide().show(),w.hide().show()},y=function(){var e=parseInt(h*f/i,10);s.scrollTop(e),m.css({bottom:T}),m.hide().show()},S=function(){var e=parseInt(d*p/a,10);s.scrollLeft(e),w.hide().show()}};6===r&&(o(),l())},W="ontouchstart"in window||window.DocumentTouch&&document instanceof window.DocumentTouch,B=function(){var e=navigator.userAgent.toLowerCase().match(/(msie) ([\w.]+)/);e&&"msie"===e[1]&&E(parseInt(e[2],10)),X(),D(),P(),O(),W&&j(),s.mousewheel&&k(),t.useKeyboard&&M(),s.data("perfect-scrollbar",s),s.data("perfect-scrollbar-update",X),s.data("perfect-scrollbar-destroy",A)};return B(),s})}});
+/*! perfect-scrollbar - v0.4.6
+* http://noraesae.github.com/perfect-scrollbar/
+* Copyright (c) 2013 HyeonJe Jun; Licensed MIT */
+
+"use strict";(function(e){"function"==typeof define&&define.amd?define(["jquery"],e):e(jQuery)})(function(e){var r={wheelSpeed:10,wheelPropagation:!1,minScrollbarLength:null,useBothWheelAxes:!1,useKeyboard:!0,suppressScrollX:!1,suppressScrollY:!1,scrollXMarginOffset:0,scrollYMarginOffset:0};e.fn.perfectScrollbar=function(o,t){return this.each(function(){var l=e.extend(!0,{},r),n=e(this);if("object"==typeof o?e.extend(!0,l,o):t=o,"update"===t)return n.data("perfect-scrollbar-update")&&n.data("perfect-scrollbar-update")(),n;if("destroy"===t)return n.data("perfect-scrollbar-destroy")&&n.data("perfect-scrollbar-destroy")(),n;if(n.data("perfect-scrollbar"))return n.data("perfect-scrollbar");n.addClass("ps-container");var s,c,a,i,p,f,u,d,b,h,v=e("<div class='ps-scrollbar-x-rail'></div>").appendTo(n),g=e("<div class='ps-scrollbar-y-rail'></div>").appendTo(n),m=e("<div class='ps-scrollbar-x'></div>").appendTo(v),w=e("<div class='ps-scrollbar-y'></div>").appendTo(g),T=parseInt(v.css("bottom"),10),L=parseInt(g.css("right"),10),y=function(){var e=parseInt(h*(f-i)/(i-b),10);n.scrollTop(e),v.css({bottom:T-e})},S=function(){var e=parseInt(d*(p-a)/(a-u),10);n.scrollLeft(e),g.css({right:L-e})},I=function(e){return l.minScrollbarLength&&(e=Math.max(e,l.minScrollbarLength)),e},X=function(){v.css({left:n.scrollLeft(),bottom:T-n.scrollTop(),width:a,display:l.suppressScrollX?"none":"inherit"}),g.css({top:n.scrollTop(),right:L-n.scrollLeft(),height:i,display:l.suppressScrollY?"none":"inherit"}),m.css({left:d,width:u}),w.css({top:h,height:b})},D=function(){a=n.width(),i=n.height(),p=n.prop("scrollWidth"),f=n.prop("scrollHeight"),!l.suppressScrollX&&p>a+l.scrollXMarginOffset?(s=!0,u=I(parseInt(a*a/p,10)),d=parseInt(n.scrollLeft()*(a-u)/(p-a),10)):(s=!1,u=0,d=0,n.scrollLeft(0)),!l.suppressScrollY&&f>i+l.scrollYMarginOffset?(c=!0,b=I(parseInt(i*i/f,10)),h=parseInt(n.scrollTop()*(i-b)/(f-i),10)):(c=!1,b=0,h=0,n.scrollTop(0)),h>=i-b&&(h=i-b),d>=a-u&&(d=a-u),X()},Y=function(e,r){var o=e+r,t=a-u;d=0>o?0:o>t?t:o,v.css({left:n.scrollLeft()}),m.css({left:d})},x=function(e,r){var o=e+r,t=i-b;h=0>o?0:o>t?t:o,g.css({top:n.scrollTop()}),w.css({top:h})},C=function(){var r,o;m.bind("mousedown.perfect-scrollbar",function(e){o=e.pageX,r=m.position().left,v.addClass("in-scrolling"),e.stopPropagation(),e.preventDefault()}),e(document).bind("mousemove.perfect-scrollbar",function(e){v.hasClass("in-scrolling")&&(S(),Y(r,e.pageX-o),e.stopPropagation(),e.preventDefault())}),e(document).bind("mouseup.perfect-scrollbar",function(){v.hasClass("in-scrolling")&&v.removeClass("in-scrolling")}),r=o=null},P=function(){var r,o;w.bind("mousedown.perfect-scrollbar",function(e){o=e.pageY,r=w.position().top,g.addClass("in-scrolling"),e.stopPropagation(),e.preventDefault()}),e(document).bind("mousemove.perfect-scrollbar",function(e){g.hasClass("in-scrolling")&&(y(),x(r,e.pageY-o),e.stopPropagation(),e.preventDefault())}),e(document).bind("mouseup.perfect-scrollbar",function(){g.hasClass("in-scrolling")&&g.removeClass("in-scrolling")}),r=o=null},k=function(){var e=function(e,r){var o=n.scrollTop();if(0===o&&r>0&&0===e)return!l.wheelPropagation;if(o>=f-i&&0>r&&0===e)return!l.wheelPropagation;var t=n.scrollLeft();return 0===t&&0>e&&0===r?!l.wheelPropagation:t>=p-a&&e>0&&0===r?!l.wheelPropagation:!0},r=!1;n.bind("mousewheel.perfect-scrollbar",function(o,t,a,i){l.useBothWheelAxes?c&&!s?i?n.scrollTop(n.scrollTop()-i*l.wheelSpeed):n.scrollTop(n.scrollTop()+a*l.wheelSpeed):s&&!c&&(a?n.scrollLeft(n.scrollLeft()+a*l.wheelSpeed):n.scrollLeft(n.scrollLeft()-i*l.wheelSpeed)):(n.scrollTop(n.scrollTop()-i*l.wheelSpeed),n.scrollLeft(n.scrollLeft()+a*l.wheelSpeed)),D(),r=e(a,i),r&&o.preventDefault()}),n.bind("MozMousePixelScroll.perfect-scrollbar",function(e){r&&e.preventDefault()})},M=function(){var r=function(e,r){var o=n.scrollTop();if(0===o&&r>0&&0===e)return!1;if(o>=f-i&&0>r&&0===e)return!1;var t=n.scrollLeft();return 0===t&&0>e&&0===r?!1:t>=p-a&&e>0&&0===r?!1:!0},o=!1;n.bind("mouseenter.perfect-scrollbar",function(){o=!0}),n.bind("mouseleave.perfect-scrollbar",function(){o=!1});var t=!1;e(document).bind("keydown.perfect-scrollbar",function(e){if(o){var s=0,c=0;switch(e.which){case 37:s=-3;break;case 38:c=3;break;case 39:s=3;break;case 40:c=-3;break;default:return}n.scrollTop(n.scrollTop()-c*l.wheelSpeed),n.scrollLeft(n.scrollLeft()+s*l.wheelSpeed),D(),t=r(s,c),t&&e.preventDefault()}})},O=function(){var e=function(e){e.stopPropagation()};w.bind("click.perfect-scrollbar",e),g.bind("click.perfect-scrollbar",function(e){var r=parseInt(b/2,10),o=e.pageY-g.offset().top-r,t=i-b,l=o/t;0>l?l=0:l>1&&(l=1),n.scrollTop((f-i)*l),D()}),m.bind("click.perfect-scrollbar",e),v.bind("click.perfect-scrollbar",function(e){var r=parseInt(u/2,10),o=e.pageX-v.offset().left-r,t=a-u,l=o/t;0>l?l=0:l>1&&(l=1),n.scrollLeft((p-a)*l),D()})},E=function(){var r=function(e,r){n.scrollTop(n.scrollTop()-r),n.scrollLeft(n.scrollLeft()-e),D()},o={},t=0,l={},s=null,c=!1;e(window).bind("touchstart.perfect-scrollbar",function(){c=!0}),e(window).bind("touchend.perfect-scrollbar",function(){c=!1}),n.bind("touchstart.perfect-scrollbar",function(e){var r=e.originalEvent.targetTouches[0];o.pageX=r.pageX,o.pageY=r.pageY,t=(new Date).getTime(),null!==s&&clearInterval(s),e.stopPropagation()}),n.bind("touchmove.perfect-scrollbar",function(e){if(!c&&1===e.originalEvent.targetTouches.length){var n=e.originalEvent.targetTouches[0],s={};s.pageX=n.pageX,s.pageY=n.pageY;var a=s.pageX-o.pageX,i=s.pageY-o.pageY;r(a,i),o=s;var p=(new Date).getTime();l.x=a/(p-t),l.y=i/(p-t),t=p,e.preventDefault()}}),n.bind("touchend.perfect-scrollbar",function(){clearInterval(s),s=setInterval(function(){return.01>Math.abs(l.x)&&.01>Math.abs(l.y)?(clearInterval(s),void 0):(r(30*l.x,30*l.y),l.x*=.8,l.y*=.8,void 0)},10)})},A=function(){n.unbind(".perfect-scrollbar"),e(window).unbind(".perfect-scrollbar"),e(document).unbind(".perfect-scrollbar"),n.data("perfect-scrollbar",null),n.data("perfect-scrollbar-update",null),n.data("perfect-scrollbar-destroy",null),m.remove(),w.remove(),v.remove(),g.remove(),m=w=a=i=p=f=u=d=T=b=h=L=null},j=function(r){n.addClass("ie").addClass("ie"+r);var o=function(){var r=function(){e(this).addClass("hover")},o=function(){e(this).removeClass("hover")};n.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o),v.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o),g.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o),m.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o),w.bind("mouseenter.perfect-scrollbar",r).bind("mouseleave.perfect-scrollbar",o)},t=function(){X=function(){m.css({left:d+n.scrollLeft(),bottom:T,width:u}),w.css({top:h+n.scrollTop(),right:L,height:b}),m.hide().show(),w.hide().show()},y=function(){var e=parseInt(h*f/i,10);n.scrollTop(e),m.css({bottom:T}),m.hide().show()},S=function(){var e=parseInt(d*p/a,10);n.scrollLeft(e),w.hide().show()}};6===r&&(o(),t())},W="ontouchstart"in window||window.DocumentTouch&&document instanceof window.DocumentTouch,H=function(){var e=navigator.userAgent.toLowerCase().match(/(msie) ([\w.]+)/);e&&"msie"===e[1]&&j(parseInt(e[2],10)),D(),C(),P(),O(),W&&E(),n.mousewheel&&k(),l.useKeyboard&&M(),n.data("perfect-scrollbar",n),n.data("perfect-scrollbar-update",D),n.data("perfect-scrollbar-destroy",A)};return H(),n})}}),function(e){function r(r){var o=r||window.event,t=[].slice.call(arguments,1),l=0,n=0,s=0;return r=e.event.fix(o),r.type="mousewheel",o.wheelDelta&&(l=o.wheelDelta/120),o.detail&&(l=-o.detail/3),s=l,void 0!==o.axis&&o.axis===o.HORIZONTAL_AXIS&&(s=0,n=-1*l),void 0!==o.wheelDeltaY&&(s=o.wheelDeltaY/120),void 0!==o.wheelDeltaX&&(n=-1*o.wheelDeltaX/120),t.unshift(r,l,n,s),(e.event.dispatch||e.event.handle).apply(this,t)}var o=["DOMMouseScroll","mousewheel"];if(e.event.fixHooks)for(var t=o.length;t;)e.event.fixHooks[o[--t]]=e.event.mouseHooks;e.event.special.mousewheel={setup:function(){if(this.addEventListener)for(var e=o.length;e;)this.addEventListener(o[--e],r,!1);else this.onmousewheel=r},teardown:function(){if(this.removeEventListener)for(var e=o.length;e;)this.removeEventListener(o[--e],r,!1);else this.onmousewheel=null}},e.fn.extend({mousewheel:function(e){return e?this.bind("mousewheel",e):this.trigger("mousewheel")},unmousewheel:function(e){return this.unbind("mousewheel",e)}})}(jQuery);
+/*!
+ * fancyBox - jQuery Plugin
+ * version: 2.1.5 (Fri, 14 Jun 2013)
+ * @requires jQuery v1.6 or later
+ *
+ * Examples at http://fancyapps.com/fancybox/
+ * License: www.fancyapps.com/fancybox/#license
+ *
+ * Copyright 2012 Janis Skarnelis - janis@fancyapps.com
+ *
+ */
+
+
+(function (window, document, $, undefined) {
+ "use strict";
+
+ var H = $("html"),
+ W = $(window),
+ D = $(document),
+ F = $.fancybox = function () {
+ F.open.apply( this, arguments );
+ },
+ IE = navigator.userAgent.match(/msie/i),
+ didUpdate = null,
+ isTouch = document.createTouch !== undefined,
+
+ isQuery = function(obj) {
+ return obj && obj.hasOwnProperty && obj instanceof $;
+ },
+ isString = function(str) {
+ return str && $.type(str) === "string";
+ },
+ isPercentage = function(str) {
+ return isString(str) && str.indexOf('%') > 0;
+ },
+ isScrollable = function(el) {
+ return (el && !(el.style.overflow && el.style.overflow === 'hidden') && ((el.clientWidth && el.scrollWidth > el.clientWidth) || (el.clientHeight && el.scrollHeight > el.clientHeight)));
+ },
+ getScalar = function(orig, dim) {
+ var value = parseInt(orig, 10) || 0;
+
+ if (dim && isPercentage(orig)) {
+ value = F.getViewport()[ dim ] / 100 * value;
+ }
+
+ return Math.ceil(value);
+ },
+ getValue = function(value, dim) {
+ return getScalar(value, dim) + 'px';
+ };
+
+ $.extend(F, {
+ // The current version of fancyBox
+ version: '2.1.5',
+
+ defaults: {
+ padding : 15,
+ margin : 20,
+
+ width : 800,
+ height : 600,
+ minWidth : 100,
+ minHeight : 100,
+ maxWidth : 9999,
+ maxHeight : 9999,
+ pixelRatio: 1, // Set to 2 for retina display support
+
+ autoSize : true,
+ autoHeight : false,
+ autoWidth : false,
+
+ autoResize : true,
+ autoCenter : !isTouch,
+ fitToView : true,
+ aspectRatio : false,
+ topRatio : 0.5,
+ leftRatio : 0.5,
+
+ scrolling : 'auto', // 'auto', 'yes' or 'no'
+ wrapCSS : '',
+
+ arrows : true,
+ closeBtn : true,
+ closeClick : false,
+ nextClick : false,
+ mouseWheel : true,
+ autoPlay : false,
+ playSpeed : 3000,
+ preload : 3,
+ modal : false,
+ loop : true,
+
+ ajax : {
+ dataType : 'html',
+ headers : { 'X-fancyBox': true }
+ },
+ iframe : {
+ scrolling : 'auto',
+ preload : true
+ },
+ swf : {
+ wmode: 'transparent',
+ allowfullscreen : 'true',
+ allowscriptaccess : 'always'
+ },
+
+ keys : {
+ next : {
+ 13 : 'left', // enter
+ 34 : 'up', // page down
+ 39 : 'left', // right arrow
+ 40 : 'up' // down arrow
+ },
+ prev : {
+ 8 : 'right', // backspace
+ 33 : 'down', // page up
+ 37 : 'right', // left arrow
+ 38 : 'down' // up arrow
+ },
+ close : [27], // escape key
+ play : [32], // space - start/stop slideshow
+ toggle : [70] // letter "f" - toggle fullscreen
+ },
+
+ direction : {
+ next : 'left',
+ prev : 'right'
+ },
+
+ scrollOutside : true,
+
+ // Override some properties
+ index : 0,
+ type : null,
+ href : null,
+ content : null,
+ title : null,
+
+ // HTML templates
+ tpl: {
+ wrap : '<div class="fancybox-wrap" tabIndex="-1"><div class="fancybox-skin"><div class="fancybox-outer"><div class="fancybox-inner"></div></div></div></div>',
+ image : '<img class="fancybox-image" src="{href}" alt="" />',
+ iframe : '<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" frameborder="0" vspace="0" hspace="0" webkitAllowFullScreen mozallowfullscreen allowFullScreen' + (IE ? ' allowtransparency="true"' : '') + '></iframe>',
+ error : '<p class="fancybox-error">The requested content cannot be loaded.<br/>Please try again later.</p>',
+ closeBtn : '<a title="Close" class="fancybox-item fancybox-close" href="javascript:;"></a>',
+ next : '<a title="Next" class="fancybox-nav fancybox-next" href="javascript:;"><span></span></a>',
+ prev : '<a title="Previous" class="fancybox-nav fancybox-prev" href="javascript:;"><span></span></a>'
+ },
+
+ // Properties for each animation type
+ // Opening fancyBox
+ openEffect : 'fade', // 'elastic', 'fade' or 'none'
+ openSpeed : 250,
+ openEasing : 'swing',
+ openOpacity : true,
+ openMethod : 'zoomIn',
+
+ // Closing fancyBox
+ closeEffect : 'fade', // 'elastic', 'fade' or 'none'
+ closeSpeed : 250,
+ closeEasing : 'swing',
+ closeOpacity : true,
+ closeMethod : 'zoomOut',
+
+ // Changing next gallery item
+ nextEffect : 'elastic', // 'elastic', 'fade' or 'none'
+ nextSpeed : 250,
+ nextEasing : 'swing',
+ nextMethod : 'changeIn',
+
+ // Changing previous gallery item
+ prevEffect : 'elastic', // 'elastic', 'fade' or 'none'
+ prevSpeed : 250,
+ prevEasing : 'swing',
+ prevMethod : 'changeOut',
+
+ // Enable default helpers
+ helpers : {
+ overlay : true,
+ title : true
+ },
+
+ // Callbacks
+ onCancel : $.noop, // If canceling
+ beforeLoad : $.noop, // Before loading
+ afterLoad : $.noop, // After loading
+ beforeShow : $.noop, // Before changing in current item
+ afterShow : $.noop, // After opening
+ beforeChange : $.noop, // Before changing gallery item
+ beforeClose : $.noop, // Before closing
+ afterClose : $.noop // After closing
+ },
+
+ //Current state
+ group : {}, // Selected group
+ opts : {}, // Group options
+ previous : null, // Previous element
+ coming : null, // Element being loaded
+ current : null, // Currently loaded element
+ isActive : false, // Is activated
+ isOpen : false, // Is currently open
+ isOpened : false, // Have been fully opened at least once
+
+ wrap : null,
+ skin : null,
+ outer : null,
+ inner : null,
+
+ player : {
+ timer : null,
+ isActive : false
+ },
+
+ // Loaders
+ ajaxLoad : null,
+ imgPreload : null,
+
+ // Some collections
+ transitions : {},
+ helpers : {},
+
+ /*
+ * Static methods
+ */
+
+ open: function (group, opts) {
+ if (!group) {
+ return;
+ }
+
+ if (!$.isPlainObject(opts)) {
+ opts = {};
+ }
+
+ // Close if already active
+ if (false === F.close(true)) {
+ return;
+ }
+
+ // Normalize group
+ if (!$.isArray(group)) {
+ group = isQuery(group) ? $(group).get() : [group];
+ }
+
+ // Recheck if the type of each element is `object` and set content type (image, ajax, etc)
+ $.each(group, function(i, element) {
+ var obj = {},
+ href,
+ title,
+ content,
+ type,
+ rez,
+ hrefParts,
+ selector;
+
+ if ($.type(element) === "object") {
+ // Check if is DOM element
+ if (element.nodeType) {
+ element = $(element);
+ }
+
+ if (isQuery(element)) {
+ obj = {
+ href : element.data('fancybox-href') || element.attr('href'),
+ title : element.data('fancybox-title') || element.attr('title'),
+ isDom : true,
+ element : element
+ };
+
+ if ($.metadata) {
+ $.extend(true, obj, element.metadata());
+ }
+
+ } else {
+ obj = element;
+ }
+ }
+
+ href = opts.href || obj.href || (isString(element) ? element : null);
+ title = opts.title !== undefined ? opts.title : obj.title || '';
+
+ content = opts.content || obj.content;
+ type = content ? 'html' : (opts.type || obj.type);
+
+ if (!type && obj.isDom) {
+ type = element.data('fancybox-type');
+
+ if (!type) {
+ rez = element.prop('class').match(/fancybox\.(\w+)/);
+ type = rez ? rez[1] : null;
+ }
+ }
+
+ if (isString(href)) {
+ // Try to guess the content type
+ if (!type) {
+ if (F.isImage(href)) {
+ type = 'image';
+
+ } else if (F.isSWF(href)) {
+ type = 'swf';
+
+ } else if (href.charAt(0) === '#') {
+ type = 'inline';
+
+ } else if (isString(element)) {
+ type = 'html';
+ content = element;
+ }
+ }
+
+ // Split url into two pieces with source url and content selector, e.g,
+ // "/mypage.html #my_id" will load "/mypage.html" and display element having id "my_id"
+ if (type === 'ajax') {
+ hrefParts = href.split(/\s+/, 2);
+ href = hrefParts.shift();
+ selector = hrefParts.shift();
+ }
+ }
+
+ if (!content) {
+ if (type === 'inline') {
+ if (href) {
+ content = $( isString(href) ? href.replace(/.*(?=#[^\s]+$)/, '') : href ); //strip for ie7
+
+ } else if (obj.isDom) {
+ content = element;
+ }
+
+ } else if (type === 'html') {
+ content = href;
+
+ } else if (!type && !href && obj.isDom) {
+ type = 'inline';
+ content = element;
+ }
+ }
+
+ $.extend(obj, {
+ href : href,
+ type : type,
+ content : content,
+ title : title,
+ selector : selector
+ });
+
+ group[ i ] = obj;
+ });
+
+ // Extend the defaults
+ F.opts = $.extend(true, {}, F.defaults, opts);
+
+ // All options are merged recursive except keys
+ if (opts.keys !== undefined) {
+ F.opts.keys = opts.keys ? $.extend({}, F.defaults.keys, opts.keys) : false;
+ }
+
+ F.group = group;
+
+ return F._start(F.opts.index);
+ },
+
+ // Cancel image loading or abort ajax request
+ cancel: function () {
+ var coming = F.coming;
+
+ if (!coming || false === F.trigger('onCancel')) {
+ return;
+ }
+
+ F.hideLoading();
+
+ if (F.ajaxLoad) {
+ F.ajaxLoad.abort();
+ }
+
+ F.ajaxLoad = null;
+
+ if (F.imgPreload) {
+ F.imgPreload.onload = F.imgPreload.onerror = null;
+ }
+
+ if (coming.wrap) {
+ coming.wrap.stop(true, true).trigger('onReset').remove();
+ }
+
+ F.coming = null;
+
+ // If the first item has been canceled, then clear everything
+ if (!F.current) {
+ F._afterZoomOut( coming );
+ }
+ },
+
+ // Start closing animation if is open; remove immediately if opening/closing
+ close: function (event) {
+ F.cancel();
+
+ if (false === F.trigger('beforeClose')) {
+ return;
+ }
+
+ F.unbindEvents();
+
+ if (!F.isActive) {
+ return;
+ }
+
+ if (!F.isOpen || event === true) {
+ $('.fancybox-wrap').stop(true).trigger('onReset').remove();
+
+ F._afterZoomOut();
+
+ } else {
+ F.isOpen = F.isOpened = false;
+ F.isClosing = true;
+
+ $('.fancybox-item, .fancybox-nav').remove();
+
+ F.wrap.stop(true, true).removeClass('fancybox-opened');
+
+ F.transitions[ F.current.closeMethod ]();
+ }
+ },
+
+ // Manage slideshow:
+ // $.fancybox.play(); - toggle slideshow
+ // $.fancybox.play( true ); - start
+ // $.fancybox.play( false ); - stop
+ play: function ( action ) {
+ var clear = function () {
+ clearTimeout(F.player.timer);
+ },
+ set = function () {
+ clear();
+
+ if (F.current && F.player.isActive) {
+ F.player.timer = setTimeout(F.next, F.current.playSpeed);
+ }
+ },
+ stop = function () {
+ clear();
+
+ D.unbind('.player');
+
+ F.player.isActive = false;
+
+ F.trigger('onPlayEnd');
+ },
+ start = function () {
+ if (F.current && (F.current.loop || F.current.index < F.group.length - 1)) {
+ F.player.isActive = true;
+
+ D.bind({
+ 'onCancel.player beforeClose.player' : stop,
+ 'onUpdate.player' : set,
+ 'beforeLoad.player' : clear
+ });
+
+ set();
+
+ F.trigger('onPlayStart');
+ }
+ };
+
+ if (action === true || (!F.player.isActive && action !== false)) {
+ start();
+ } else {
+ stop();
+ }
+ },
+
+ // Navigate to next gallery item
+ next: function ( direction ) {
+ var current = F.current;
+
+ if (current) {
+ if (!isString(direction)) {
+ direction = current.direction.next;
+ }
+
+ F.jumpto(current.index + 1, direction, 'next');
+ }
+ },
+
+ // Navigate to previous gallery item
+ prev: function ( direction ) {
+ var current = F.current;
+
+ if (current) {
+ if (!isString(direction)) {
+ direction = current.direction.prev;
+ }
+
+ F.jumpto(current.index - 1, direction, 'prev');
+ }
+ },
+
+ // Navigate to gallery item by index
+ jumpto: function ( index, direction, router ) {
+ var current = F.current;
+
+ if (!current) {
+ return;
+ }
+
+ index = getScalar(index);
+
+ F.direction = direction || current.direction[ (index >= current.index ? 'next' : 'prev') ];
+ F.router = router || 'jumpto';
+
+ if (current.loop) {
+ if (index < 0) {
+ index = current.group.length + (index % current.group.length);
+ }
+
+ index = index % current.group.length;
+ }
+
+ if (current.group[ index ] !== undefined) {
+ F.cancel();
+
+ F._start(index);
+ }
+ },
+
+ // Center inside viewport and toggle position type to fixed or absolute if needed
+ reposition: function (e, onlyAbsolute) {
+ var current = F.current,
+ wrap = current ? current.wrap : null,
+ pos;
+
+ if (wrap) {
+ pos = F._getPosition(onlyAbsolute);
+
+ if (e && e.type === 'scroll') {
+ delete pos.position;
+
+ wrap.stop(true, true).animate(pos, 200);
+
+ } else {
+ wrap.css(pos);
+
+ current.pos = $.extend({}, current.dim, pos);
+ }
+ }
+ },
+
+ update: function (e) {
+ var type = (e && e.type),
+ anyway = !type || type === 'orientationchange';
+
+ if (anyway) {
+ clearTimeout(didUpdate);
+
+ didUpdate = null;
+ }
+
+ if (!F.isOpen || didUpdate) {
+ return;
+ }
+
+ didUpdate = setTimeout(function() {
+ var current = F.current;
+
+ if (!current || F.isClosing) {
+ return;
+ }
+
+ F.wrap.removeClass('fancybox-tmp');
+
+ if (anyway || type === 'load' || (type === 'resize' && current.autoResize)) {
+ F._setDimension();
+ }
+
+ if (!(type === 'scroll' && current.canShrink)) {
+ F.reposition(e);
+ }
+
+ F.trigger('onUpdate');
+
+ didUpdate = null;
+
+ }, (anyway && !isTouch ? 0 : 300));
+ },
+
+ // Shrink content to fit inside viewport or restore if resized
+ toggle: function ( action ) {
+ if (F.isOpen) {
+ F.current.fitToView = $.type(action) === "boolean" ? action : !F.current.fitToView;
+
+ // Help browser to restore document dimensions
+ if (isTouch) {
+ F.wrap.removeAttr('style').addClass('fancybox-tmp');
+
+ F.trigger('onUpdate');
+ }
+
+ F.update();
+ }
+ },
+
+ hideLoading: function () {
+ D.unbind('.loading');
+
+ $('#fancybox-loading').remove();
+ },
+
+ showLoading: function () {
+ var el, viewport;
+
+ F.hideLoading();
+
+ el = $('<div id="fancybox-loading"><div></div></div>').click(F.cancel).appendTo('body');
+
+ // If user will press the escape-button, the request will be canceled
+ D.bind('keydown.loading', function(e) {
+ if ((e.which || e.keyCode) === 27) {
+ e.preventDefault();
+
+ F.cancel();
+ }
+ });
+
+ if (!F.defaults.fixed) {
+ viewport = F.getViewport();
+
+ el.css({
+ position : 'absolute',
+ top : (viewport.h * 0.5) + viewport.y,
+ left : (viewport.w * 0.5) + viewport.x
+ });
+ }
+ },
+
+ getViewport: function () {
+ var locked = (F.current && F.current.locked) || false,
+ rez = {
+ x: W.scrollLeft(),
+ y: W.scrollTop()
+ };
+
+ if (locked) {
+ rez.w = locked[0].clientWidth;
+ rez.h = locked[0].clientHeight;
+
+ } else {
+ // See http://bugs.jquery.com/ticket/6724
+ rez.w = isTouch && window.innerWidth ? window.innerWidth : W.width();
+ rez.h = isTouch && window.innerHeight ? window.innerHeight : W.height();
+ }
+
+ return rez;
+ },
+
+ // Unbind the keyboard / clicking actions
+ unbindEvents: function () {
+ if (F.wrap && isQuery(F.wrap)) {
+ F.wrap.unbind('.fb');
+ }
+
+ D.unbind('.fb');
+ W.unbind('.fb');
+ },
+
+ bindEvents: function () {
+ var current = F.current,
+ keys;
+
+ if (!current) {
+ return;
+ }
+
+ // Changing document height on iOS devices triggers a 'resize' event,
+ // that can change document height... repeating infinitely
+ W.bind('orientationchange.fb' + (isTouch ? '' : ' resize.fb') + (current.autoCenter && !current.locked ? ' scroll.fb' : ''), F.update);
+
+ keys = current.keys;
+
+ if (keys) {
+ D.bind('keydown.fb', function (e) {
+ var code = e.which || e.keyCode,
+ target = e.target || e.srcElement;
+
+ // Skip esc key if loading, because showLoading will cancel preloading
+ if (code === 27 && F.coming) {
+ return false;
+ }
+
+ // Ignore key combinations and key events within form elements
+ if (!e.ctrlKey && !e.altKey && !e.shiftKey && !e.metaKey && !(target && (target.type || $(target).is('[contenteditable]')))) {
+ $.each(keys, function(i, val) {
+ if (current.group.length > 1 && val[ code ] !== undefined) {
+ F[ i ]( val[ code ] );
+
+ e.preventDefault();
+ return false;
+ }
+
+ if ($.inArray(code, val) > -1) {
+ F[ i ] ();
+
+ e.preventDefault();
+ return false;
+ }
+ });
+ }
+ });
+ }
+
+ if ($.fn.mousewheel && current.mouseWheel) {
+ F.wrap.bind('mousewheel.fb', function (e, delta, deltaX, deltaY) {
+ var target = e.target || null,
+ parent = $(target),
+ canScroll = false;
+
+ while (parent.length) {
+ if (canScroll || parent.is('.fancybox-skin') || parent.is('.fancybox-wrap')) {
+ break;
+ }
+
+ canScroll = isScrollable( parent[0] );
+ parent = $(parent).parent();
+ }
+
+ if (delta !== 0 && !canScroll) {
+ if (F.group.length > 1 && !current.canShrink) {
+ if (deltaY > 0 || deltaX > 0) {
+ F.prev( deltaY > 0 ? 'down' : 'left' );
+
+ } else if (deltaY < 0 || deltaX < 0) {
+ F.next( deltaY < 0 ? 'up' : 'right' );
+ }
+
+ e.preventDefault();
+ }
+ }
+ });
+ }
+ },
+
+ trigger: function (event, o) {
+ var ret, obj = o || F.coming || F.current;
+
+ if (!obj) {
+ return;
+ }
+
+ if ($.isFunction( obj[event] )) {
+ ret = obj[event].apply(obj, Array.prototype.slice.call(arguments, 1));
+ }
+
+ if (ret === false) {
+ return false;
+ }
+
+ if (obj.helpers) {
+ $.each(obj.helpers, function (helper, opts) {
+ if (opts && F.helpers[helper] && $.isFunction(F.helpers[helper][event])) {
+ F.helpers[helper][event]($.extend(true, {}, F.helpers[helper].defaults, opts), obj);
+ }
+ });
+ }
+
+ D.trigger(event);
+ },
+
+ isImage: function (str) {
+ return isString(str) && str.match(/(^data:image\/.*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg)((\?|#).*)?$)/i);
+ },
+
+ isSWF: function (str) {
+ return isString(str) && str.match(/\.(swf)((\?|#).*)?$/i);
+ },
+
+ _start: function (index) {
+ var coming = {},
+ obj,
+ href,
+ type,
+ margin,
+ padding;
+
+ index = getScalar( index );
+ obj = F.group[ index ] || null;
+
+ if (!obj) {
+ return false;
+ }
+
+ coming = $.extend(true, {}, F.opts, obj);
+
+ // Convert margin and padding properties to array - top, right, bottom, left
+ margin = coming.margin;
+ padding = coming.padding;
+
+ if ($.type(margin) === 'number') {
+ coming.margin = [margin, margin, margin, margin];
+ }
+
+ if ($.type(padding) === 'number') {
+ coming.padding = [padding, padding, padding, padding];
+ }
+
+ // 'modal' propery is just a shortcut
+ if (coming.modal) {
+ $.extend(true, coming, {
+ closeBtn : false,
+ closeClick : false,
+ nextClick : false,
+ arrows : false,
+ mouseWheel : false,
+ keys : null,
+ helpers: {
+ overlay : {
+ closeClick : false
+ }
+ }
+ });
+ }
+
+ // 'autoSize' property is a shortcut, too
+ if (coming.autoSize) {
+ coming.autoWidth = coming.autoHeight = true;
+ }
+
+ if (coming.width === 'auto') {
+ coming.autoWidth = true;
+ }
+
+ if (coming.height === 'auto') {
+ coming.autoHeight = true;
+ }
+
+ /*
+ * Add reference to the group, so it`s possible to access from callbacks, example:
+ * afterLoad : function() {
+ * this.title = 'Image ' + (this.index + 1) + ' of ' + this.group.length + (this.title ? ' - ' + this.title : '');
+ * }
+ */
+
+ coming.group = F.group;
+ coming.index = index;
+
+ // Give a chance for callback or helpers to update coming item (type, title, etc)
+ F.coming = coming;
+
+ if (false === F.trigger('beforeLoad')) {
+ F.coming = null;
+
+ return;
+ }
+
+ type = coming.type;
+ href = coming.href;
+
+ if (!type) {
+ F.coming = null;
+
+ //If we can not determine content type then drop silently or display next/prev item if looping through gallery
+ if (F.current && F.router && F.router !== 'jumpto') {
+ F.current.index = index;
+
+ return F[ F.router ]( F.direction );
+ }
+
+ return false;
+ }
+
+ F.isActive = true;
+
+ if (type === 'image' || type === 'swf') {
+ coming.autoHeight = coming.autoWidth = false;
+ coming.scrolling = 'visible';
+ }
+
+ if (type === 'image') {
+ coming.aspectRatio = true;
+ }
+
+ if (type === 'iframe' && isTouch) {
+ coming.scrolling = 'scroll';
+ }
+
+ // Build the neccessary markup
+ coming.wrap = $(coming.tpl.wrap).addClass('fancybox-' + (isTouch ? 'mobile' : 'desktop') + ' fancybox-type-' + type + ' fancybox-tmp ' + coming.wrapCSS).appendTo( coming.parent || 'body' );
+
+ $.extend(coming, {
+ skin : $('.fancybox-skin', coming.wrap),
+ outer : $('.fancybox-outer', coming.wrap),
+ inner : $('.fancybox-inner', coming.wrap)
+ });
+
+ $.each(["Top", "Right", "Bottom", "Left"], function(i, v) {
+ coming.skin.css('padding' + v, getValue(coming.padding[ i ]));
+ });
+
+ F.trigger('onReady');
+
+ // Check before try to load; 'inline' and 'html' types need content, others - href
+ if (type === 'inline' || type === 'html') {
+ if (!coming.content || !coming.content.length) {
+ return F._error( 'content' );
+ }
+
+ } else if (!href) {
+ return F._error( 'href' );
+ }
+
+ if (type === 'image') {
+ F._loadImage();
+
+ } else if (type === 'ajax') {
+ F._loadAjax();
+
+ } else if (type === 'iframe') {
+ F._loadIframe();
+
+ } else {
+ F._afterLoad();
+ }
+ },
+
+ _error: function ( type ) {
+ $.extend(F.coming, {
+ type : 'html',
+ autoWidth : true,
+ autoHeight : true,
+ minWidth : 0,
+ minHeight : 0,
+ scrolling : 'no',
+ hasError : type,
+ content : F.coming.tpl.error
+ });
+
+ F._afterLoad();
+ },
+
+ _loadImage: function () {
+ // Reset preload image so it is later possible to check "complete" property
+ var img = F.imgPreload = new Image();
+
+ img.onload = function () {
+ this.onload = this.onerror = null;
+
+ F.coming.width = this.width / F.opts.pixelRatio;
+ F.coming.height = this.height / F.opts.pixelRatio;
+
+ F._afterLoad();
+ };
+
+ img.onerror = function () {
+ this.onload = this.onerror = null;
+
+ F._error( 'image' );
+ };
+
+ img.src = F.coming.href;
+
+ if (img.complete !== true) {
+ F.showLoading();
+ }
+ },
+
+ _loadAjax: function () {
+ var coming = F.coming;
+
+ F.showLoading();
+
+ F.ajaxLoad = $.ajax($.extend({}, coming.ajax, {
+ url: coming.href,
+ error: function (jqXHR, textStatus) {
+ if (F.coming && textStatus !== 'abort') {
+ F._error( 'ajax', jqXHR );
+
+ } else {
+ F.hideLoading();
+ }
+ },
+ success: function (data, textStatus) {
+ if (textStatus === 'success') {
+ coming.content = data;
+
+ F._afterLoad();
+ }
+ }
+ }));
+ },
+
+ _loadIframe: function() {
+ var coming = F.coming,
+ iframe = $(coming.tpl.iframe.replace(/\{rnd\}/g, new Date().getTime()))
+ .attr('scrolling', isTouch ? 'auto' : coming.iframe.scrolling)
+ .attr('src', coming.href);
+
+ // This helps IE
+ $(coming.wrap).bind('onReset', function () {
+ try {
+ $(this).find('iframe').hide().attr('src', '//about:blank').end().empty();
+ } catch (e) {}
+ });
+
+ if (coming.iframe.preload) {
+ F.showLoading();
+
+ iframe.one('load', function() {
+ $(this).data('ready', 1);
+
+ // iOS will lose scrolling if we resize
+ if (!isTouch) {
+ $(this).bind('load.fb', F.update);
+ }
+
+ // Without this trick:
+ // - iframe won't scroll on iOS devices
+ // - IE7 sometimes displays empty iframe
+ $(this).parents('.fancybox-wrap').width('100%').removeClass('fancybox-tmp').show();
+
+ F._afterLoad();
+ });
+ }
+
+ coming.content = iframe.appendTo( coming.inner );
+
+ if (!coming.iframe.preload) {
+ F._afterLoad();
+ }
+ },
+
+ _preloadImages: function() {
+ var group = F.group,
+ current = F.current,
+ len = group.length,
+ cnt = current.preload ? Math.min(current.preload, len - 1) : 0,
+ item,
+ i;
+
+ for (i = 1; i <= cnt; i += 1) {
+ item = group[ (current.index + i ) % len ];
+
+ if (item.type === 'image' && item.href) {
+ new Image().src = item.href;
+ }
+ }
+ },
+
+ _afterLoad: function () {
+ var coming = F.coming,
+ previous = F.current,
+ placeholder = 'fancybox-placeholder',
+ current,
+ content,
+ type,
+ scrolling,
+ href,
+ embed;
+
+ F.hideLoading();
+
+ if (!coming || F.isActive === false) {
+ return;
+ }
+
+ if (false === F.trigger('afterLoad', coming, previous)) {
+ coming.wrap.stop(true).trigger('onReset').remove();
+
+ F.coming = null;
+
+ return;
+ }
+
+ if (previous) {
+ F.trigger('beforeChange', previous);
+
+ previous.wrap.stop(true).removeClass('fancybox-opened')
+ .find('.fancybox-item, .fancybox-nav')
+ .remove();
+ }
+
+ F.unbindEvents();
+
+ current = coming;
+ content = coming.content;
+ type = coming.type;
+ scrolling = coming.scrolling;
+
+ $.extend(F, {
+ wrap : current.wrap,
+ skin : current.skin,
+ outer : current.outer,
+ inner : current.inner,
+ current : current,
+ previous : previous
+ });
+
+ href = current.href;
+
+ switch (type) {
+ case 'inline':
+ case 'ajax':
+ case 'html':
+ if (current.selector) {
+ content = $('<div>').html(content).find(current.selector);
+
+ } else if (isQuery(content)) {
+ if (!content.data(placeholder)) {
+ content.data(placeholder, $('<div class="' + placeholder + '"></div>').insertAfter( content ).hide() );
+ }
+
+ content = content.show().detach();
+
+ current.wrap.bind('onReset', function () {
+ if ($(this).find(content).length) {
+ content.hide().replaceAll( content.data(placeholder) ).data(placeholder, false);
+ }
+ });
+ }
+ break;
+
+ case 'image':
+ content = current.tpl.image.replace('{href}', href);
+ break;
+
+ case 'swf':
+ content = '<object id="fancybox-swf" classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000" width="100%" height="100%"><param name="movie" value="' + href + '"></param>';
+ embed = '';
+
+ $.each(current.swf, function(name, val) {
+ content += '<param name="' + name + '" value="' + val + '"></param>';
+ embed += ' ' + name + '="' + val + '"';
+ });
+
+ content += '<embed src="' + href + '" type="application/x-shockwave-flash" width="100%" height="100%"' + embed + '></embed></object>';
+ break;
+ }
+
+ if (!(isQuery(content) && content.parent().is(current.inner))) {
+ current.inner.append( content );
+ }
+
+ // Give a chance for helpers or callbacks to update elements
+ F.trigger('beforeShow');
+
+ // Set scrolling before calculating dimensions
+ current.inner.css('overflow', scrolling === 'yes' ? 'scroll' : (scrolling === 'no' ? 'hidden' : scrolling));
+
+ // Set initial dimensions and start position
+ F._setDimension();
+
+ F.reposition();
+
+ F.isOpen = false;
+ F.coming = null;
+
+ F.bindEvents();
+
+ if (!F.isOpened) {
+ $('.fancybox-wrap').not( current.wrap ).stop(true).trigger('onReset').remove();
+
+ } else if (previous.prevMethod) {
+ F.transitions[ previous.prevMethod ]();
+ }
+
+ F.transitions[ F.isOpened ? current.nextMethod : current.openMethod ]();
+
+ F._preloadImages();
+ },
+
+ _setDimension: function () {
+ var viewport = F.getViewport(),
+ steps = 0,
+ canShrink = false,
+ canExpand = false,
+ wrap = F.wrap,
+ skin = F.skin,
+ inner = F.inner,
+ current = F.current,
+ width = current.width,
+ height = current.height,
+ minWidth = current.minWidth,
+ minHeight = current.minHeight,
+ maxWidth = current.maxWidth,
+ maxHeight = current.maxHeight,
+ scrolling = current.scrolling,
+ scrollOut = current.scrollOutside ? current.scrollbarWidth : 0,
+ margin = current.margin,
+ wMargin = getScalar(margin[1] + margin[3]),
+ hMargin = getScalar(margin[0] + margin[2]),
+ wPadding,
+ hPadding,
+ wSpace,
+ hSpace,
+ origWidth,
+ origHeight,
+ origMaxWidth,
+ origMaxHeight,
+ ratio,
+ width_,
+ height_,
+ maxWidth_,
+ maxHeight_,
+ iframe,
+ body;
+
+ // Reset dimensions so we could re-check actual size
+ wrap.add(skin).add(inner).width('auto').height('auto').removeClass('fancybox-tmp');
+
+ wPadding = getScalar(skin.outerWidth(true) - skin.width());
+ hPadding = getScalar(skin.outerHeight(true) - skin.height());
+
+ // Any space between content and viewport (margin, padding, border, title)
+ wSpace = wMargin + wPadding;
+ hSpace = hMargin + hPadding;
+
+ origWidth = isPercentage(width) ? (viewport.w - wSpace) * getScalar(width) / 100 : width;
+ origHeight = isPercentage(height) ? (viewport.h - hSpace) * getScalar(height) / 100 : height;
+
+ if (current.type === 'iframe') {
+ iframe = current.content;
+
+ if (current.autoHeight && iframe.data('ready') === 1) {
+ try {
+ if (iframe[0].contentWindow.document.location) {
+ inner.width( origWidth ).height(9999);
+
+ body = iframe.contents().find('body');
+
+ if (scrollOut) {
+ body.css('overflow-x', 'hidden');
+ }
+
+ origHeight = body.outerHeight(true);
+ }
+
+ } catch (e) {}
+ }
+
+ } else if (current.autoWidth || current.autoHeight) {
+ inner.addClass( 'fancybox-tmp' );
+
+ // Set width or height in case we need to calculate only one dimension
+ if (!current.autoWidth) {
+ inner.width( origWidth );
+ }
+
+ if (!current.autoHeight) {
+ inner.height( origHeight );
+ }
+
+ if (current.autoWidth) {
+ origWidth = inner.width();
+ }
+
+ if (current.autoHeight) {
+ origHeight = inner.height();
+ }
+
+ inner.removeClass( 'fancybox-tmp' );
+ }
+
+ width = getScalar( origWidth );
+ height = getScalar( origHeight );
+
+ ratio = origWidth / origHeight;
+
+ // Calculations for the content
+ minWidth = getScalar(isPercentage(minWidth) ? getScalar(minWidth, 'w') - wSpace : minWidth);
+ maxWidth = getScalar(isPercentage(maxWidth) ? getScalar(maxWidth, 'w') - wSpace : maxWidth);
+
+ minHeight = getScalar(isPercentage(minHeight) ? getScalar(minHeight, 'h') - hSpace : minHeight);
+ maxHeight = getScalar(isPercentage(maxHeight) ? getScalar(maxHeight, 'h') - hSpace : maxHeight);
+
+ // These will be used to determine if wrap can fit in the viewport
+ origMaxWidth = maxWidth;
+ origMaxHeight = maxHeight;
+
+ if (current.fitToView) {
+ maxWidth = Math.min(viewport.w - wSpace, maxWidth);
+ maxHeight = Math.min(viewport.h - hSpace, maxHeight);
+ }
+
+ maxWidth_ = viewport.w - wMargin;
+ maxHeight_ = viewport.h - hMargin;
+
+ if (current.aspectRatio) {
+ if (width > maxWidth) {
+ width = maxWidth;
+ height = getScalar(width / ratio);
+ }
+
+ if (height > maxHeight) {
+ height = maxHeight;
+ width = getScalar(height * ratio);
+ }
+
+ if (width < minWidth) {
+ width = minWidth;
+ height = getScalar(width / ratio);
+ }
+
+ if (height < minHeight) {
+ height = minHeight;
+ width = getScalar(height * ratio);
+ }
+
+ } else {
+ width = Math.max(minWidth, Math.min(width, maxWidth));
+
+ if (current.autoHeight && current.type !== 'iframe') {
+ inner.width( width );
+
+ height = inner.height();
+ }
+
+ height = Math.max(minHeight, Math.min(height, maxHeight));
+ }
+
+ // Try to fit inside viewport (including the title)
+ if (current.fitToView) {
+ inner.width( width ).height( height );
+
+ wrap.width( width + wPadding );
+
+ // Real wrap dimensions
+ width_ = wrap.width();
+ height_ = wrap.height();
+
+ if (current.aspectRatio) {
+ while ((width_ > maxWidth_ || height_ > maxHeight_) && width > minWidth && height > minHeight) {
+ if (steps++ > 19) {
+ break;
+ }
+
+ height = Math.max(minHeight, Math.min(maxHeight, height - 10));
+ width = getScalar(height * ratio);
+
+ if (width < minWidth) {
+ width = minWidth;
+ height = getScalar(width / ratio);
+ }
+
+ if (width > maxWidth) {
+ width = maxWidth;
+ height = getScalar(width / ratio);
+ }
+
+ inner.width( width ).height( height );
+
+ wrap.width( width + wPadding );
+
+ width_ = wrap.width();
+ height_ = wrap.height();
+ }
+
+ } else {
+ width = Math.max(minWidth, Math.min(width, width - (width_ - maxWidth_)));
+ height = Math.max(minHeight, Math.min(height, height - (height_ - maxHeight_)));
+ }
+ }
+
+ if (scrollOut && scrolling === 'auto' && height < origHeight && (width + wPadding + scrollOut) < maxWidth_) {
+ width += scrollOut;
+ }
+
+ inner.width( width ).height( height );
+
+ wrap.width( width + wPadding );
+
+ width_ = wrap.width();
+ height_ = wrap.height();
+
+ canShrink = (width_ > maxWidth_ || height_ > maxHeight_) && width > minWidth && height > minHeight;
+ canExpand = current.aspectRatio ? (width < origMaxWidth && height < origMaxHeight && width < origWidth && height < origHeight) : ((width < origMaxWidth || height < origMaxHeight) && (width < origWidth || height < origHeight));
+
+ $.extend(current, {
+ dim : {
+ width : getValue( width_ ),
+ height : getValue( height_ )
+ },
+ origWidth : origWidth,
+ origHeight : origHeight,
+ canShrink : canShrink,
+ canExpand : canExpand,
+ wPadding : wPadding,
+ hPadding : hPadding,
+ wrapSpace : height_ - skin.outerHeight(true),
+ skinSpace : skin.height() - height
+ });
+
+ if (!iframe && current.autoHeight && height > minHeight && height < maxHeight && !canExpand) {
+ inner.height('auto');
+ }
+ },
+
+ _getPosition: function (onlyAbsolute) {
+ var current = F.current,
+ viewport = F.getViewport(),
+ margin = current.margin,
+ width = F.wrap.width() + margin[1] + margin[3],
+ height = F.wrap.height() + margin[0] + margin[2],
+ rez = {
+ position: 'absolute',
+ top : margin[0],
+ left : margin[3]
+ };
+
+ if (current.autoCenter && current.fixed && !onlyAbsolute && height <= viewport.h && width <= viewport.w) {
+ rez.position = 'fixed';
+
+ } else if (!current.locked) {
+ rez.top += viewport.y;
+ rez.left += viewport.x;
+ }
+
+ rez.top = getValue(Math.max(rez.top, rez.top + ((viewport.h - height) * current.topRatio)));
+ rez.left = getValue(Math.max(rez.left, rez.left + ((viewport.w - width) * current.leftRatio)));
+
+ return rez;
+ },
+
+ _afterZoomIn: function () {
+ var current = F.current;
+
+ if (!current) {
+ return;
+ }
+
+ F.isOpen = F.isOpened = true;
+
+ F.wrap.css('overflow', 'visible').addClass('fancybox-opened');
+
+ F.update();
+
+ // Assign a click event
+ if ( current.closeClick || (current.nextClick && F.group.length > 1) ) {
+ F.inner.css('cursor', 'pointer').bind('click.fb', function(e) {
+ if (!$(e.target).is('a') && !$(e.target).parent().is('a')) {
+ e.preventDefault();
+
+ F[ current.closeClick ? 'close' : 'next' ]();
+ }
+ });
+ }
+
+ // Create a close button
+ if (current.closeBtn) {
+ $(current.tpl.closeBtn).appendTo(F.skin).bind('click.fb', function(e) {
+ e.preventDefault();
+
+ F.close();
+ });
+ }
+
+ // Create navigation arrows
+ if (current.arrows && F.group.length > 1) {
+ if (current.loop || current.index > 0) {
+ $(current.tpl.prev).appendTo(F.outer).bind('click.fb', F.prev);
+ }
+
+ if (current.loop || current.index < F.group.length - 1) {
+ $(current.tpl.next).appendTo(F.outer).bind('click.fb', F.next);
+ }
+ }
+
+ F.trigger('afterShow');
+
+ // Stop the slideshow if this is the last item
+ if (!current.loop && current.index === current.group.length - 1) {
+ F.play( false );
+
+ } else if (F.opts.autoPlay && !F.player.isActive) {
+ F.opts.autoPlay = false;
+
+ F.play();
+ }
+ },
+
+ _afterZoomOut: function ( obj ) {
+ obj = obj || F.current;
+
+ $('.fancybox-wrap').trigger('onReset').remove();
+
+ $.extend(F, {
+ group : {},
+ opts : {},
+ router : false,
+ current : null,
+ isActive : false,
+ isOpened : false,
+ isOpen : false,
+ isClosing : false,
+ wrap : null,
+ skin : null,
+ outer : null,
+ inner : null
+ });
+
+ F.trigger('afterClose', obj);
+ }
+ });
+
+ /*
+ * Default transitions
+ */
+
+ F.transitions = {
+ getOrigPosition: function () {
+ var current = F.current,
+ element = current.element,
+ orig = current.orig,
+ pos = {},
+ width = 50,
+ height = 50,
+ hPadding = current.hPadding,
+ wPadding = current.wPadding,
+ viewport = F.getViewport();
+
+ if (!orig && current.isDom && element.is(':visible')) {
+ orig = element.find('img:first');
+
+ if (!orig.length) {
+ orig = element;
+ }
+ }
+
+ if (isQuery(orig)) {
+ pos = orig.offset();
+
+ if (orig.is('img')) {
+ width = orig.outerWidth();
+ height = orig.outerHeight();
+ }
+
+ } else {
+ pos.top = viewport.y + (viewport.h - height) * current.topRatio;
+ pos.left = viewport.x + (viewport.w - width) * current.leftRatio;
+ }
+
+ if (F.wrap.css('position') === 'fixed' || current.locked) {
+ pos.top -= viewport.y;
+ pos.left -= viewport.x;
+ }
+
+ pos = {
+ top : getValue(pos.top - hPadding * current.topRatio),
+ left : getValue(pos.left - wPadding * current.leftRatio),
+ width : getValue(width + wPadding),
+ height : getValue(height + hPadding)
+ };
+
+ return pos;
+ },
+
+ step: function (now, fx) {
+ var ratio,
+ padding,
+ value,
+ prop = fx.prop,
+ current = F.current,
+ wrapSpace = current.wrapSpace,
+ skinSpace = current.skinSpace;
+
+ if (prop === 'width' || prop === 'height') {
+ ratio = fx.end === fx.start ? 1 : (now - fx.start) / (fx.end - fx.start);
+
+ if (F.isClosing) {
+ ratio = 1 - ratio;
+ }
+
+ padding = prop === 'width' ? current.wPadding : current.hPadding;
+ value = now - padding;
+
+ F.skin[ prop ]( getScalar( prop === 'width' ? value : value - (wrapSpace * ratio) ) );
+ F.inner[ prop ]( getScalar( prop === 'width' ? value : value - (wrapSpace * ratio) - (skinSpace * ratio) ) );
+ }
+ },
+
+ zoomIn: function () {
+ var current = F.current,
+ startPos = current.pos,
+ effect = current.openEffect,
+ elastic = effect === 'elastic',
+ endPos = $.extend({opacity : 1}, startPos);
+
+ // Remove "position" property that breaks older IE
+ delete endPos.position;
+
+ if (elastic) {
+ startPos = this.getOrigPosition();
+
+ if (current.openOpacity) {
+ startPos.opacity = 0.1;
+ }
+
+ } else if (effect === 'fade') {
+ startPos.opacity = 0.1;
+ }
+
+ F.wrap.css(startPos).animate(endPos, {
+ duration : effect === 'none' ? 0 : current.openSpeed,
+ easing : current.openEasing,
+ step : elastic ? this.step : null,
+ complete : F._afterZoomIn
+ });
+ },
+
+ zoomOut: function () {
+ var current = F.current,
+ effect = current.closeEffect,
+ elastic = effect === 'elastic',
+ endPos = {opacity : 0.1};
+
+ if (elastic) {
+ endPos = this.getOrigPosition();
+
+ if (current.closeOpacity) {
+ endPos.opacity = 0.1;
+ }
+ }
+
+ F.wrap.animate(endPos, {
+ duration : effect === 'none' ? 0 : current.closeSpeed,
+ easing : current.closeEasing,
+ step : elastic ? this.step : null,
+ complete : F._afterZoomOut
+ });
+ },
+
+ changeIn: function () {
+ var current = F.current,
+ effect = current.nextEffect,
+ startPos = current.pos,
+ endPos = { opacity : 1 },
+ direction = F.direction,
+ distance = 200,
+ field;
+
+ startPos.opacity = 0.1;
+
+ if (effect === 'elastic') {
+ field = direction === 'down' || direction === 'up' ? 'top' : 'left';
+
+ if (direction === 'down' || direction === 'right') {
+ startPos[ field ] = getValue(getScalar(startPos[ field ]) - distance);
+ endPos[ field ] = '+=' + distance + 'px';
+
+ } else {
+ startPos[ field ] = getValue(getScalar(startPos[ field ]) + distance);
+ endPos[ field ] = '-=' + distance + 'px';
+ }
+ }
+
+ // Workaround for http://bugs.jquery.com/ticket/12273
+ if (effect === 'none') {
+ F._afterZoomIn();
+
+ } else {
+ F.wrap.css(startPos).animate(endPos, {
+ duration : current.nextSpeed,
+ easing : current.nextEasing,
+ complete : F._afterZoomIn
+ });
+ }
+ },
+
+ changeOut: function () {
+ var previous = F.previous,
+ effect = previous.prevEffect,
+ endPos = { opacity : 0.1 },
+ direction = F.direction,
+ distance = 200;
+
+ if (effect === 'elastic') {
+ endPos[ direction === 'down' || direction === 'up' ? 'top' : 'left' ] = ( direction === 'up' || direction === 'left' ? '-' : '+' ) + '=' + distance + 'px';
+ }
+
+ previous.wrap.animate(endPos, {
+ duration : effect === 'none' ? 0 : previous.prevSpeed,
+ easing : previous.prevEasing,
+ complete : function () {
+ $(this).trigger('onReset').remove();
+ }
+ });
+ }
+ };
+
+ /*
+ * Overlay helper
+ */
+
+ F.helpers.overlay = {
+ defaults : {
+ closeClick : true, // if true, fancyBox will be closed when user clicks on the overlay
+ speedOut : 200, // duration of fadeOut animation
+ showEarly : true, // indicates if should be opened immediately or wait until the content is ready
+ css : {}, // custom CSS properties
+ locked : !isTouch, // if true, the content will be locked into overlay
+ fixed : true // if false, the overlay CSS position property will not be set to "fixed"
+ },
+
+ overlay : null, // current handle
+ fixed : false, // indicates if the overlay has position "fixed"
+ el : $('html'), // element that contains "the lock"
+
+ // Public methods
+ create : function(opts) {
+ opts = $.extend({}, this.defaults, opts);
+
+ if (this.overlay) {
+ this.close();
+ }
+
+ this.overlay = $('<div class="fancybox-overlay"></div>').appendTo( F.coming ? F.coming.parent : opts.parent );
+ this.fixed = false;
+
+ if (opts.fixed && F.defaults.fixed) {
+ this.overlay.addClass('fancybox-overlay-fixed');
+
+ this.fixed = true;
+ }
+ },
+
+ open : function(opts) {
+ var that = this;
+
+ opts = $.extend({}, this.defaults, opts);
+
+ if (this.overlay) {
+ this.overlay.unbind('.overlay').width('auto').height('auto');
+
+ } else {
+ this.create(opts);
+ }
+
+ if (!this.fixed) {
+ W.bind('resize.overlay', $.proxy( this.update, this) );
+
+ this.update();
+ }
+
+ if (opts.closeClick) {
+ this.overlay.bind('click.overlay', function(e) {
+ if ($(e.target).hasClass('fancybox-overlay')) {
+ if (F.isActive) {
+ F.close();
+ } else {
+ that.close();
+ }
+
+ return false;
+ }
+ });
+ }
+
+ this.overlay.css( opts.css ).show();
+ },
+
+ close : function() {
+ var scrollV, scrollH;
+
+ W.unbind('resize.overlay');
+
+ if (this.el.hasClass('fancybox-lock')) {
+ $('.fancybox-margin').removeClass('fancybox-margin');
+
+ scrollV = W.scrollTop();
+ scrollH = W.scrollLeft();
+
+ this.el.removeClass('fancybox-lock');
+
+ W.scrollTop( scrollV ).scrollLeft( scrollH );
+ }
+
+ $('.fancybox-overlay').remove().hide();
+
+ $.extend(this, {
+ overlay : null,
+ fixed : false
+ });
+ },
+
+ // Private, callbacks
+
+ update : function () {
+ var width = '100%', offsetWidth;
+
+ // Reset width/height so it will not mess
+ this.overlay.width(width).height('100%');
+
+ // jQuery does not return reliable result for IE
+ if (IE) {
+ offsetWidth = Math.max(document.documentElement.offsetWidth, document.body.offsetWidth);
+
+ if (D.width() > offsetWidth) {
+ width = D.width();
+ }
+
+ } else if (D.width() > W.width()) {
+ width = D.width();
+ }
+
+ this.overlay.width(width).height(D.height());
+ },
+
+ // This is where we can manipulate DOM, because later it would cause iframes to reload
+ onReady : function (opts, obj) {
+ var overlay = this.overlay;
+
+ $('.fancybox-overlay').stop(true, true);
+
+ if (!overlay) {
+ this.create(opts);
+ }
+
+ if (opts.locked && this.fixed && obj.fixed) {
+ if (!overlay) {
+ this.margin = D.height() > W.height() ? $('html').css('margin-right').replace("px", "") : false;
+ }
+
+ obj.locked = this.overlay.append( obj.wrap );
+ obj.fixed = false;
+ }
+
+ if (opts.showEarly === true) {
+ this.beforeShow.apply(this, arguments);
+ }
+ },
+
+ beforeShow : function(opts, obj) {
+ var scrollV, scrollH;
+
+ if (obj.locked) {
+ if (this.margin !== false) {
+ $('*').filter(function(){
+ return ($(this).css('position') === 'fixed' && !$(this).hasClass("fancybox-overlay") && !$(this).hasClass("fancybox-wrap") );
+ }).addClass('fancybox-margin');
+
+ this.el.addClass('fancybox-margin');
+ }
+
+ scrollV = W.scrollTop();
+ scrollH = W.scrollLeft();
+
+ this.el.addClass('fancybox-lock');
+
+ W.scrollTop( scrollV ).scrollLeft( scrollH );
+ }
+
+ this.open(opts);
+ },
+
+ onUpdate : function() {
+ if (!this.fixed) {
+ this.update();
+ }
+ },
+
+ afterClose: function (opts) {
+ // Remove overlay if exists and fancyBox is not opening
+ // (e.g., it is not being open using afterClose callback)
+ //if (this.overlay && !F.isActive) {
+ if (this.overlay && !F.coming) {
+ this.overlay.fadeOut(opts.speedOut, $.proxy( this.close, this ));
+ }
+ }
+ };
+
+ /*
+ * Title helper
+ */
+
+ F.helpers.title = {
+ defaults : {
+ type : 'float', // 'float', 'inside', 'outside' or 'over',
+ position : 'bottom' // 'top' or 'bottom'
+ },
+
+ beforeShow: function (opts) {
+ var current = F.current,
+ text = current.title,
+ type = opts.type,
+ title,
+ target;
+
+ if ($.isFunction(text)) {
+ text = text.call(current.element, current);
+ }
+
+ if (!isString(text) || $.trim(text) === '') {
+ return;
+ }
+
+ title = $('<div class="fancybox-title fancybox-title-' + type + '-wrap">' + text + '</div>');
+
+ switch (type) {
+ case 'inside':
+ target = F.skin;
+ break;
+
+ case 'outside':
+ target = F.wrap;
+ break;
+
+ case 'over':
+ target = F.inner;
+ break;
+
+ default: // 'float'
+ target = F.skin;
+
+ title.appendTo('body');
+
+ if (IE) {
+ title.width( title.width() );
+ }
+
+ title.wrapInner('<span class="child"></span>');
+
+ //Increase bottom margin so this title will also fit into viewport
+ F.current.margin[2] += Math.abs( getScalar(title.css('margin-bottom')) );
+ break;
+ }
+
+ title[ (opts.position === 'top' ? 'prependTo' : 'appendTo') ](target);
+ }
+ };
+
+ // jQuery plugin initialization
+ $.fn.fancybox = function (options) {
+ var index,
+ that = $(this),
+ selector = this.selector || '',
+ run = function(e) {
+ var what = $(this).blur(), idx = index, relType, relVal;
+
+ if (!(e.ctrlKey || e.altKey || e.shiftKey || e.metaKey) && !what.is('.fancybox-wrap')) {
+ relType = options.groupAttr || 'data-fancybox-group';
+ relVal = what.attr(relType);
+
+ if (!relVal) {
+ relType = 'rel';
+ relVal = what.get(0)[ relType ];
+ }
+
+ if (relVal && relVal !== '' && relVal !== 'nofollow') {
+ what = selector.length ? $(selector) : that;
+ what = what.filter('[' + relType + '="' + relVal + '"]');
+ idx = what.index(this);
+ }
+
+ options.index = idx;
+
+ // Stop an event from bubbling if everything is fine
+ if (F.open(what, options) !== false) {
+ e.preventDefault();
+ }
+ }
+ };
+
+ options = options || {};
+ index = options.index || 0;
+
+ if (!selector || options.live === false) {
+ that.unbind('click.fb-start').bind('click.fb-start', run);
+
+ } else {
+ D.undelegate(selector, 'click.fb-start').delegate(selector + ":not('.fancybox-item, .fancybox-nav')", 'click.fb-start', run);
+ }
+
+ this.filter('[data-fancybox-start=1]').trigger('click');
+
+ return this;
+ };
+
+ // Tests that need a body at doc ready
+ D.ready(function() {
+ var w1, w2;
+
+ if ( $.scrollbarWidth === undefined ) {
+ // http://benalman.com/projects/jquery-misc-plugins/#scrollbarwidth
+ $.scrollbarWidth = function() {
+ var parent = $('<div style="width:50px;height:50px;overflow:auto"><div/></div>').appendTo('body'),
+ child = parent.children(),
+ width = child.innerWidth() - child.height( 99 ).innerWidth();
+
+ parent.remove();
+
+ return width;
+ };
+ }
+
+ if ( $.support.fixedPosition === undefined ) {
+ $.support.fixedPosition = (function() {
+ var elem = $('<div style="position:fixed;top:20px;"></div>').appendTo('body'),
+ fixed = ( elem[0].offsetTop === 20 || elem[0].offsetTop === 15 );
+
+ elem.remove();
+
+ return fixed;
+ }());
+ }
+
+ $.extend(F.defaults, {
+ scrollbarWidth : $.scrollbarWidth(),
+ fixed : $.support.fixedPosition,
+ parent : $('body')
+ });
+
+ //Get real width of page scroll-bar
+ w1 = $(window).width();
+
+ H.addClass('fancybox-lock-test');
+
+ w2 = $(window).width();
+
+ H.removeClass('fancybox-lock-test');
+
+ $("<style type='text/css'>.fancybox-margin{margin-right:" + (w2 - w1) + "px;}</style>").appendTo("head");
+ });
+
+}(window, document, jQuery));
+// add/remove dynamic fields
+String.prototype.unescapeHtml = function () {
+ var temp = document.createElement("div");
+ temp.innerHTML = this;
+ var result = temp.childNodes[0].nodeValue;
+ temp.removeChild(temp.firstChild);
+ return result;
+}
+
+function removeFields(link) {
+ $(link).prev("input[type=hidden]").val("1");
+ $(link).closest(".fields").slideToggle("show");
+}
+
+function addFields(link, association, content) {
+ var numItems = $('.fields').length
+ var new_id = numItems
+ var regexp = new RegExp("new_" + association, "g")
+ $(link).parent().before(content.unescapeHtml().replace(regexp, new_id));
+ formLoad();
+ return false;
+}
+
+function openPopUp(url){
+ $.colorbox({href:url, opacity:0.5, width:"90%"});
+}
+
+function markActive(){
+ $('.dropdown_main_menu_sublevel a.actived').closest('.dropdown_main_menu_sublevel').show();
+}
+
+// page load functions
+
+var pageLoad = function(){
+ $('ul.menu').clone().appendTo('div.menu.short');
+
+
+ $('.dropdown_main_menu_sublevel').hide(0);
+
+ $('.menu.full .sublevel').click(function(){
+ $(this).next().slideToggle(200)
+ return false
+ })
+
+ $('.menu.short .sublevel').parent().mouseover(function(){
+ $(this).children().next().fadeIn(0)
+ return false
+ })
+
+ $('.menu.short .sublevel').parent().mouseleave(function(){
+ $(this).children().next().fadeOut(0)
+ return false
+ })
+
+ $('.dataTables_info').insertAfter('.dataTables_paginate');
+ $(".chosen").chosen({no_results_text: "Nenhum resultado encontrado", disable_search_threshold: 5});
+ $(".popup").click(function(e){
+ e.preventDefault()
+ var url = $(this).attr('href')
+ abrirPopUp(url)
+ })
+
+ markActive()
+
+ $('div.menu.short').show(0);
+ $('div.menu.short .dropdown_main_menu_sublevel').hide();
+ $('#content').toggleClass('menu-opened');
+ $('.short ul.dropdown_main_menu li ul li a.actived').parent().parent().parent().addClass('active');
+ $('.full ul.dropdown_main_menu li ul li a.actived').parent().parent().parent().addClass('active');
+
+ if($('ul.menu li.active a').html())
+ $('#header').append("<h1>"+$('ul.menu li.active a').html()+" » "+$('ul.menu a.actived').html()+"</h1>")
+
+ $('.full ul.dropdown_main_menu li:has(ul)').each(function( index ) {
+ $('.short ul.dropdown_main_menu li:has(ul) > ul').eq(index).prepend('<h1>'+$('.full ul.dropdown_main_menu li:has(ul) > a').eq(index).html()+'</h1>')
+ });
+
+ var $lefty = $('div.menu.full');
+ $lefty.animate({
+ marginLeft: '-20%'
+ }, 100);
+
+ $('.minify').on("click", function(){
+ var $lefty = $('div.menu.full');
+ $lefty.animate({
+ marginLeft: parseInt($lefty.css('margin-left'),10) == 0 ?
+ -$lefty.outerWidth()-2:
+ 0
+ }, 100);
+ setTimeout("$('div.menu.short').fadeToggle(100)", 0)
+ setTimeout("$('#content').toggleClass('menu-opened')", 0)
+ })
+};
+
+// form load functions
+
+var formLoad = function(){
+ $(".datepicker").datepicker({
+ dateFormat: 'yy-mm-dd'
+ });
+ $('select').chosen();
+ $(".chosen-container").css({width:$(".chosen-container").parent().css("width")})
+}
+
+$(document).ready(function(){
+ pageLoad();
+ formLoad();
+});
+
+
+
+
+
+
+
+
+
+
+
+
+
+; TI"required_assets_digest; TI"%dda3eaec4f29b800f9b187800695210c; FI"
_version; TI"%9bd74cab6f8cd17bb7b52df6002861bd; F
\ No newline at end of file