/*! * Materialize v0.100.1 (http://materializecss.com) * Copyright 2014-2017 Materialize * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) */ var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } // Check for jQuery. if (typeof jQuery === 'undefined') { var jQuery; // Check if require is a defined function. if (typeof require === 'function') { jQuery = $ = require('jquery'); // Else use the dollar sign alias. } else { jQuery = $; } } ; /* * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/ * Open source under the BSD License. * Copyright © 2008 George McGinley Smith * All rights reserved. * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE */ (function (factory) { if (typeof define === "function" && define.amd) { define(['jquery'], function ($) { return factory($); }); } else if (typeof module === "object" && typeof module.exports === "object") { exports = factory(require('jquery')); } else { factory(jQuery); } })(function ($) { // Preserve the original jQuery "swing" easing as "jswing" $.easing['jswing'] = $.easing['swing']; var pow = Math.pow, sqrt = Math.sqrt, sin = Math.sin, cos = Math.cos, PI = Math.PI, c1 = 1.70158, c2 = c1 * 1.525, c3 = c1 + 1, c4 = 2 * PI / 3, c5 = 2 * PI / 4.5; // x is the fraction of animation progress, in the range 0..1 function bounceOut(x) { var n1 = 7.5625, d1 = 2.75; if (x < 1 / d1) { return n1 * x * x; } else if (x < 2 / d1) { return n1 * (x -= 1.5 / d1) * x + .75; } else if (x < 2.5 / d1) { return n1 * (x -= 2.25 / d1) * x + .9375; } else { return n1 * (x -= 2.625 / d1) * x + .984375; } } $.extend($.easing, { def: 'easeOutQuad', swing: function (x) { return $.easing[$.easing.def](x); }, easeInQuad: function (x) { return x * x; }, easeOutQuad: function (x) { return 1 - (1 - x) * (1 - x); }, easeInOutQuad: function (x) { return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2; }, easeInCubic: function (x) { return x * x * x; }, easeOutCubic: function (x) { return 1 - pow(1 - x, 3); }, easeInOutCubic: function (x) { return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2; }, easeInQuart: function (x) { return x * x * x * x; }, easeOutQuart: function (x) { return 1 - pow(1 - x, 4); }, easeInOutQuart: function (x) { return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2; }, easeInQuint: function (x) { return x * x * x * x * x; }, easeOutQuint: function (x) { return 1 - pow(1 - x, 5); }, easeInOutQuint: function (x) { return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2; }, easeInSine: function (x) { return 1 - cos(x * PI / 2); }, easeOutSine: function (x) { return sin(x * PI / 2); }, easeInOutSine: function (x) { return -(cos(PI * x) - 1) / 2; }, easeInExpo: function (x) { return x === 0 ? 0 : pow(2, 10 * x - 10); }, easeOutExpo: function (x) { return x === 1 ? 1 : 1 - pow(2, -10 * x); }, easeInOutExpo: function (x) { return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2; }, easeInCirc: function (x) { return 1 - sqrt(1 - pow(x, 2)); }, easeOutCirc: function (x) { return sqrt(1 - pow(x - 1, 2)); }, easeInOutCirc: function (x) { return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2; }, easeInElastic: function (x) { return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4); }, easeOutElastic: function (x) { return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1; }, easeInOutElastic: function (x) { return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1; }, easeInBack: function (x) { return c3 * x * x * x - c1 * x * x; }, easeOutBack: function (x) { return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2); }, easeInOutBack: function (x) { return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2; }, easeInBounce: function (x) { return 1 - bounceOut(1 - x); }, easeOutBounce: bounceOut, easeInOutBounce: function (x) { return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2; } }); });; // Custom Easing jQuery.extend(jQuery.easing, { easeInOutMaterial: function (x, t, b, c, d) { if ((t /= d / 2) < 1) return c / 2 * t * t + b; return c / 4 * ((t -= 2) * t * t + 2) + b; } });; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ /*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ /*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) { function t(e) { var t = e.length, a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e; }if (!e.jQuery) { var r = function (e, t) { return new r.fn.init(e, t); };r.isWindow = function (e) { return null != e && e == e.window; }, r.type = function (e) { return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e; }, r.isArray = Array.isArray || function (e) { return "array" === r.type(e); }, r.isPlainObject = function (e) { var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try { if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1; } catch (a) { return !1; }for (t in e) {}return void 0 === t || o.call(e, t); }, r.each = function (e, r, a) { var n, o = 0, i = e.length, s = t(e);if (a) { if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) { if (n = r.apply(e[o], a), n === !1) break; } } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) { if (n = r.call(e[o], o, e[o]), n === !1) break; }return e; }, r.data = function (e, t, n) { if (void 0 === n) { var o = e[r.expando], i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t]; } else if (void 0 !== t) { var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n; } }, r.removeData = function (e, t) { var n = e[r.expando], o = n && a[n];o && r.each(t, function (e, t) { delete o[t]; }); }, r.extend = function () { var e, t, a, n, o, i, s = arguments[0] || {}, l = 1, u = arguments.length, c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) { if (null != (o = arguments[l])) for (n in o) { e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a)); } }return s; }, r.queue = function (e, a, n) { function o(e, r) { var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) { for (var r = +t.length, a = 0, n = e.length; r > a;) { e[n++] = t[a++]; }if (r !== r) for (; void 0 !== t[a];) { e[n++] = t[a++]; }return e.length = n, e; }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a; }if (e) { a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || []; } }, r.dequeue = function (e, t) { r.each(e.nodeType ? [e] : e, function (e, a) { t = t || "fx";var n = r.queue(a, t), o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () { r.dequeue(a, t); })); }); }, r.fn = r.prototype = { init: function (e) { if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node."); }, offset: function () { var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) }; }, position: function () { function e() { for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) { e = e.offsetParent; }return e || document; }var t = this[0], e = e.apply(t), a = this.offset(), n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left }; } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) { n["[object " + s[l] + "]"] = s[l].toLowerCase(); }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r }; } }(window), function (e) { "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e(); }(function () { return function (e, t, r, a) { function n(e) { for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) { var n = e[t];n && a.push(n); }return a; }function o(e) { return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e; }function i(e) { var t = f.data(e, "velocity");return null === t ? a : t; }function s(e) { return function (t) { return Math.round(t * e) * (1 / e); }; }function l(e, r, a, n) { function o(e, t) { return 1 - 3 * t + 3 * e; }function i(e, t) { return 3 * t - 6 * e; }function s(e) { return 3 * e; }function l(e, t, r) { return ((o(t, r) * e + i(t, r)) * e + s(t)) * e; }function u(e, t, r) { return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t); }function c(t, r) { for (var n = 0; m > n; ++n) { var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o; }return r; }function p() { for (var t = 0; b > t; ++t) { w[t] = l(t * x, e, a); } }function f(t, r, n) { var o, i, s = 0;do { i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i; } while (Math.abs(o) > h && ++s < v);return i; }function d(t) { for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) { r += x; }--n;var i = (t - w[n]) / (w[n + 1] - w[n]), s = r + i * x, l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x); }function g() { V = !0, (e != r || a != n) && p(); }var m = 4, y = .001, h = 1e-7, v = 10, b = 11, x = 1 / (b - 1), S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) { if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1; }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b), V = !1, C = function (t) { return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n); };C.getControlPoints = function () { return [{ x: e, y: r }, { x: a, y: n }]; };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () { return T; }, C; }function u(e, t) { var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r; }function c(e) { if (e) { var t = new Date().getTime(), r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) { if (b.State.calls[o]) { var s = b.State.calls[o], l = s[0], u = s[2], d = s[3], g = !!d, y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) { var P = l[v], V = P.element;if (i(V)) { var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) { if ("flex" === u.display) { var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) { S.setPropertyValue(V, "display", t); }); }S.setPropertyValue(V, "display", u.display); }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) { if ("element" !== k) { var A, F = P[k], j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else { var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue; }if (F.currentValue = A, "tween" === k) y = A;else { if (S.Hooks.registered[k]) { var H = S.Hooks.getRoot(k), N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N); }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0); } } }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V); } }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o); } } }b.State.isTicking && w(c); }function p(e, t) { if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) { var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) { i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) { var r = /^scale/.test(t) ? 1 : 0, n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]); }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating"); }if (!t && o.complete && !o.loop && u === c - 1) try { o.complete.call(n, n); } catch (g) { setTimeout(function () { throw g; }, 1); }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) { /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100); }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue); }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) { if (b.State.calls[m] !== !1) { l = !0;break; } }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []); }var f, d = function () { if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) { var t = r.createElement("div");if (t.innerHTML = "", t.getElementsByTagName("span").length) return t = null, e; }return a; }(), g = function () { var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) { var r, a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () { t(a + r); }, r); }; }(), m = { isString: function (e) { return "string" == typeof e; }, isArray: Array.isArray || function (e) { return "[object Array]" === Object.prototype.toString.call(e); }, isFunction: function (e) { return "[object Function]" === Object.prototype.toString.call(e); }, isNode: function (e) { return e && e.nodeType; }, isNodeList: function (e) { return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0); }, isWrapped: function (e) { return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e)); }, isSVG: function (e) { return t.SVGElement && e instanceof t.SVGElement; }, isEmptyObject: function (e) { for (var t in e) { return !1; }return !0; } }, y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400, v = "swing", b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) { f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} }); }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () { function e(e) { return -e.tension * e.x - e.friction * e.v; }function t(t, r, a) { var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) }; }function r(r, a) { var n = { dx: r.v, dv: e(r) }, o = t(r, .5 * a, n), i = t(r, .5 * a, o), s = t(r, a, i), l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx), u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r; }return function a(e, t, n) { var o, i, s, l = { x: -1, v: 0, tension: null, friction: null }, u = [0], c = 0, p = 1e-4, f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) { return u[e * (u.length - 1) | 0]; } : c; }; }();b.Easings = { linear: function (e) { return e; }, swing: function (e) { return .5 - Math.cos(e * Math.PI) / 2; }, spring: function (e) { return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e); } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) { b.Easings[t[0]] = l.apply(null, t[1]); });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () { for (var e = 0; e < S.Lists.colors.length; e++) { var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t]; }var r, a, n;if (d) for (r in S.Hooks.templates) { a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]); }for (r in S.Hooks.templates) { a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) { var i = r + n[e], s = e;S.Hooks.registered[i] = [r, s]; } } }, getRoot: function (e) { var t = S.Hooks.registered[e];return t ? t[0] : e; }, cleanRootPropertyValue: function (e, t) { return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t; }, extractValue: function (e, t) { var r = S.Hooks.registered[e];if (r) { var a = r[0], n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n]; }return t; }, injectValue: function (e, t, r) { var a = S.Hooks.registered[e];if (a) { var n, o, i = a[0], s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" "); }return r; } }, Normalizations: { registered: { clip: function (e, t, r) { switch (e) {case "name": return "clip";case "extract": var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject": return "rect(" + r + ")";} }, blur: function (e, t, r) { switch (e) {case "name": return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract": var a = parseFloat(r);if (!a && 0 !== a) { var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0; }return a;case "inject": return parseFloat(r) ? "blur(" + r + ")" : "none";} }, opacity: function (e, t, r) { if (8 >= d) switch (e) {case "name": return "filter";case "extract": var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject": return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name": return "opacity";case "extract": return r;case "inject": return r;} } }, register: function () { 9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) { !function () { var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) { switch (e) {case "name": return "transform";case "extract": return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject": var o = !1;switch (t.substr(0, t.length - 1)) {case "translate": o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale": b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew": o = !/(deg|\d)$/i.test(n);break;case "rotate": o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];} }; }(); }for (var e = 0; e < S.Lists.colors.length; e++) { !function () { var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) { switch (e) {case "name": return t;case "extract": var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else { var i, s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " "); }return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject": return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";} }; }(); } } }, Names: { camelCase: function (e) { return e.replace(/-(\w)/g, function (e, t) { return t.toUpperCase(); }); }, SVGAttribute: function (e) { var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e); }, prefixCheck: function (e) { if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) { var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) { return e.toUpperCase(); }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0]; }return [e, !1]; } }, Values: { hexToRgb: function (e) { var t, r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i, a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) { return t + t + r + r + a + a; }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0]; }, isCSSNullValue: function (e) { return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e); }, getUnitType: function (e) { return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px" ); }, getDisplayType: function (e) { var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block" ); }, addClass: function (e, t) { e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t; }, removeClass: function (e, t) { e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " "); } }, getPropertyValue: function (e, r, n, o) { function s(e, r) { function n() { u && S.setPropertyValue(e, "display", "none"); }var l = 0;if (8 >= d) l = f.css(e, r);else { var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) { if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c; }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p; } }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n(); }if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) { var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px"); }return l; }var l;if (S.Hooks.registered[r]) { var u = r, c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n); } else if (S.Normalizations.registered[r]) { var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g); }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) { if (/^(height|width)$/i.test(r)) try { l = e.getBBox()[r]; } catch (m) { l = 0; } else l = e.getAttribute(r); } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l; }, setPropertyValue: function (e, r, a, n, o) { var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else { if (S.Hooks.registered[r]) { var l = r, u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u; }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try { e.style[s] = a; } catch (c) { b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]"); } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a); }return [s, a]; }, flushTransformCache: function (e) { function t(t) { return parseFloat(S.getPropertyValue(e, t)); }var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) { var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) { /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]); }); } else { var n, o;f.each(i(e).transformCache, function (t) { return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " ")); }), o && (r = "perspective" + o + " " + r); }S.setPropertyValue(e, "transform", r); } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) { var n = a;return e = o(e), f.each(e, function (e, o) { if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else { var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s; } }), n; };var P = function () { function e() { return s ? k.promise || null : l; }function n() { function e(e) { function p(e, t) { var r = a, n = a, i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i]; }function d(e, t) { var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) { return r = e, ""; }), r || (r = S.Values.getUnitType(e)), [a, r]; }function h() { var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") }, a = e.position === L.lastPosition && e.myParent === L.lastParent, n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100, l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else { var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) { b.CSS.setPropertyValue(u, t, "hidden"); }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) { b.CSS.setPropertyValue(u, t, s + "%"); }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u); }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l; }if (s.begin && 0 === V) try { s.begin.call(g, g); } catch (x) { setTimeout(function () { throw x; }, 1); }if ("scroll" === A) { var P, C, T, F = /^x$/i.test(s.axis) ? "Left" : "Top", j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o); } else if ("reverse" === A) { if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) { if ("element" !== H) { var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o); } }l = E; } else if ("start" === A) { var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) { if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) { var r = p(t, !0), n = r[0], o = r[1], i = r[2];if (S.RegEx.isHex.test(n)) { for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) { var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f; }delete y[e]; } } });for (var z in y) { var O = p(y[z]), q = O[0], $ = O[1], M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z), B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) { (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W, G, Y, D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) { return D = t, ""; }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else { n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%": M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px": break;default: M *= n[Y + "ToPx"];}switch (G) {case "%": M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px": break;default: M *= 1 / n[G + "ToPx"];} }switch (D) {case "+": q = M + q;break;case "-": q = M - q;break;case "*": q = M * q;break;case "/": q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o); } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support."); }l.element = o; }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++); }var n, o = this, s = f.extend({}, b.defaults, v), l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) { b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e }; }), s.duration.toString().toLowerCase()) {case "fast": s.duration = 200;break;case "normal": s.duration = h;break;case "slow": s.duration = 600;break;default: s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) { return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t)); }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o); }var s, l, d, g, y, v, x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) { x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length, V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) { var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) { m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T]; } }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) { k.resolver = e, k.rejecter = t; }));var A;switch (y) {case "scroll": A = "scroll";break;case "reverse": A = "reverse";break;case "finish":case "stop": f.each(g, function (e, t) { i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer); });var F = [];return f.each(b.State.calls, function (e, t) { t && f.each(t[1], function (r, n) { var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) { a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) { m.isFunction(t) && t(null, !0); }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) { t.endValue = t.currentValue; }), F.push(e)) : "finish" === y && (t[2].duration = 1)); }) : !0; }); }), "stop" === y && (f.each(F, function (e, t) { p(t, !0); }), k.promise && k.resolver(g)), e();default: if (!f.isPlainObject(y) || m.isEmptyObject(y)) { if (m.isString(y) && b.Redirects[y]) { var j = f.extend({}, v), E = j.duration, H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) { parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a); }), e(); }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e(); }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null }, R = [];f.each(g, function (e, t) { m.isNode(t) && n.call(t); });var z, j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) { var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q); }return e(); } };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () { r.hidden ? (w = function (e) { return setTimeout(function () { e(!0); }, 16); }, c()) : w = t.requestAnimationFrame || g; }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) { b.Redirects["slide" + t] = function (e, r, n, o, i, s) { var l = f.extend({}, r), u = l.begin, c = l.complete, p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" }, d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () { u && u.call(i, i);for (var r in p) { d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a]; }d.overflow = e.style.overflow, e.style.overflow = "hidden"; }, l.complete = function () { for (var t in d) { e.style[t] = d[t]; }c && c.call(i, i), s && s.resolver(i); }, b(e, p, l); }; }), f.each(["In", "Out"], function (e, t) { b.Redirects["fade" + t] = function (e, r, n, o, i, s) { var l = f.extend({}, r), u = { opacity: "In" === t ? 1 : 0 }, c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () { c && c.call(i, i), s && s.resolver(i); }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l); }; }), b; }(window.jQuery || window.Zepto || window, window, document); })); ;!function (a, b, c, d) { "use strict"; function k(a, b, c) { return setTimeout(q(a, c), b); }function l(a, b, c) { return Array.isArray(a) ? (m(a, c[b], c), !0) : !1; }function m(a, b, c) { var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) { b.call(c, a[e], e, a), e++; } else for (e in a) { a.hasOwnProperty(e) && b.call(c, a[e], e, a); } }function n(a, b, c) { for (var e = Object.keys(b), f = 0; f < e.length;) { (!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++; }return a; }function o(a, b) { return n(a, b, !0); }function p(a, b, c) { var e, d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c); }function q(a, b) { return function () { return a.apply(b, arguments); }; }function r(a, b) { return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a; }function s(a, b) { return a === d ? b : a; }function t(a, b, c) { m(x(b), function (b) { a.addEventListener(b, c, !1); }); }function u(a, b, c) { m(x(b), function (b) { a.removeEventListener(b, c, !1); }); }function v(a, b) { for (; a;) { if (a == b) return !0;a = a.parentNode; }return !1; }function w(a, b) { return a.indexOf(b) > -1; }function x(a) { return a.trim().split(/\s+/g); }function y(a, b, c) { if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) { if (c && a[d][c] == b || !c && a[d] === b) return d;d++; }return -1; }function z(a) { return Array.prototype.slice.call(a, 0); }function A(a, b, c) { for (var d = [], e = [], f = 0; f < a.length;) { var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++; }return c && (d = b ? d.sort(function (a, c) { return a[b] > c[b]; }) : d.sort()), d; }function B(a, b) { for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) { if (c = e[h], f = c ? c + g : b, f in a) return f;h++; }return d; }function D() { return C++; }function E(a) { var b = a.ownerDocument;return b.defaultView || b.parentWindow; }function ab(a, b) { var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) { r(a.options.enable, [a]) && c.handler(b); }, this.init(); }function bb(a) { var b, c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb); }function cb(a, b, c) { var d = c.pointers.length, e = c.changedPointers.length, f = b & O && 0 === d - e, g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c; }function db(a, b) { var c = a.session, d = b.pointers, e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput, g = c.firstMultiple, h = g ? g.center : f.center, i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k; }function eb(a, b) { var c = b.center, d = a.offsetDelta || {}, e = a.prevDelta || {}, f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y); }function fb(a, b) { var f, g, h, j, c = a.lastInterval || b, e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) { var k = c.deltaX - b.deltaX, l = c.deltaY - b.deltaY, m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b; } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j; }function gb(a) { for (var b = [], c = 0; c < a.pointers.length;) { b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++; }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY }; }function hb(a) { var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) { c += a[e].clientX, d += a[e].clientY, e++; }return { x: h(c / b), y: h(d / b) }; }function ib(a, b, c) { return { x: b / a || 0, y: c / a || 0 }; }function jb(a, b) { return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W; }function kb(a, b, c) { c || (c = $);var d = b[c[0]] - a[c[0]], e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e); }function lb(a, b, c) { c || (c = $);var d = b[c[0]] - a[c[0]], e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI; }function mb(a, b) { return lb(b[1], b[0], _) - lb(a[1], a[0], _); }function nb(a, b) { return kb(b[0], b[1], _) / kb(a[0], a[1], _); }function rb() { this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments); }function wb() { this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = []; }function Ab() { this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments); }function Bb(a, b) { var c = z(a.touches), d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d]; }function Eb() { this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments); }function Fb(a, b) { var c = z(a.touches), d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e, f, g = z(a.changedTouches), h = [], i = this.target;if (f = c.filter(function (a) { return v(a.target, i); }), b === O) for (e = 0; e < f.length;) { d[f[e].identifier] = !0, e++; }for (e = 0; e < g.length;) { d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++; }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0; }function Gb() { ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a); }function Pb(a, b) { this.manager = a, this.set(b); }function Qb(a) { if (w(a, Mb)) return Mb;var b = w(a, Nb), c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb; }function Yb(a) { this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = []; }function Zb(a) { return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : ""; }function $b(a) { return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : ""; }function _b(a, b) { var c = b.manager;return c ? c.get(a) : a; }function ac() { Yb.apply(this, arguments); }function bc() { ac.apply(this, arguments), this.pX = null, this.pY = null; }function cc() { ac.apply(this, arguments); }function dc() { Yb.apply(this, arguments), this._timer = null, this._input = null; }function ec() { ac.apply(this, arguments); }function fc() { ac.apply(this, arguments); }function gc() { Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0; }function hc(a, b) { return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b); }function kc(a, b) { b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) { var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]); }, this); }function lc(a, b) { var c = a.element;m(a.options.cssProps, function (a, d) { c.style[B(c.style, d)] = b ? a : ""; }); }function mc(a, c) { var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d); }var e = ["", "webkit", "moz", "MS", "ms", "o"], f = b.createElement("div"), g = "function", h = Math.round, i = Math.abs, j = Date.now, C = 1, F = /mobile|tablet|ip(ad|hone|od)|android/i, G = "ontouchstart" in a, H = B(a, "PointerEvent") !== d, I = G && F.test(navigator.userAgent), J = "touch", K = "pen", L = "mouse", M = "kinect", N = 25, O = 1, P = 2, Q = 4, R = 8, S = 1, T = 2, U = 4, V = 8, W = 16, X = T | U, Y = V | W, Z = X | Y, $ = ["x", "y"], _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () { this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler); }, destroy: function () { this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler); } };var ob = { mousedown: O, mousemove: P, mouseup: Q }, pb = "mousedown", qb = "mousemove mouseup";p(rb, ab, { handler: function (a) { var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a })); } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R }, tb = { 2: J, 3: K, 4: L, 5: M }, ub = "pointerdown", vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) { var b = this.store, c = !1, d = a.type.toLowerCase().replace("ms", ""), e = sb[d], f = tb[a.pointerType] || a.pointerType, g = f == J, h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1)); } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, yb = "touchstart", zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) { var b = xb[a.type];if (b === O && (this.started = !0), this.started) { var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }); } } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) { var b = Cb[a.type], c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }); } }), p(Gb, ab, { handler: function (a, b, c) { var d = c.pointerType == J, e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c); }, destroy: function () { this.touch.destroy(), this.mouse.destroy(); } });var Hb = B(f.style, "touchAction"), Ib = Hb !== d, Jb = "compute", Kb = "auto", Lb = "manipulation", Mb = "none", Nb = "pan-x", Ob = "pan-y";Pb.prototype = { set: function (a) { a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim(); }, update: function () { this.set(this.manager.options.touchAction); }, compute: function () { var a = [];return m(this.manager.recognizers, function (b) { r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction())); }), Qb(a.join(" ")); }, preventDefaults: function (a) { if (!Ib) { var b = a.srcEvent, c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions, e = w(d, Mb), f = w(d, Ob), g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0; } }, preventSrc: function (a) { this.manager.session.prevented = !0, a.preventDefault(); } };var Rb = 1, Sb = 2, Tb = 4, Ub = 8, Vb = Ub, Wb = 16, Xb = 32;Yb.prototype = { defaults: {}, set: function (a) { return n(this.options, a), this.manager && this.manager.touchAction.update(), this; }, recognizeWith: function (a) { if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this; }, dropRecognizeWith: function (a) { return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this); }, requireFailure: function (a) { if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this; }, dropRequireFailure: function (a) { if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this; }, hasRequireFailures: function () { return this.requireFail.length > 0; }, canRecognizeWith: function (a) { return !!this.simultaneous[a.id]; }, emit: function (a) { function d(d) { b.manager.emit(b.options.event + (d ? Zb(c) : ""), a); }var b = this, c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0); }, tryEmit: function (a) { return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0); }, canEmit: function () { for (var a = 0; a < this.requireFail.length;) { if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++; }return !0; }, recognize: function (a) { var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0); }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) { var b = this.options.pointers;return 0 === b || a.pointers.length === b; }, process: function (a) { var b = this.state, c = a.eventType, d = b & (Sb | Tb), e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb; } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () { var a = this.options.direction, b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b; }, directionTest: function (a) { var b = this.options, c = !0, d = a.distance, e = a.direction, f = a.deltaX, g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction; }, attrTest: function (a) { return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a)); }, emit: function (a) { this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a); } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () { return [Mb]; }, attrTest: function (a) { return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb); }, emit: function (a) { if (this._super.emit.call(this, a), 1 !== a.scale) { var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a); } } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () { return [Kb]; }, process: function (a) { var b = this.options, c = a.pointers.length === b.pointers, d = a.distance < b.threshold, e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () { this.state = Vb, this.tryEmit(); }, b.time, this);else if (a.eventType & Q) return Vb;return Xb; }, reset: function () { clearTimeout(this._timer); }, emit: function (a) { this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input))); } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () { return [Mb]; }, attrTest: function (a) { return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb); } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () { return bc.prototype.getTouchAction.call(this); }, attrTest: function (a) { var c, b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q; }, emit: function (a) { var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a); } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () { return [Lb]; }, process: function (a) { var b = this.options, c = a.pointers.length === b.pointers, d = a.distance < b.threshold, e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) { if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0, g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () { this.state = Vb, this.tryEmit(); }, b.interval, this), Sb) : Vb; }return Xb; }, failTimeout: function () { return this._timer = k(function () { this.state = Xb; }, this.options.interval, this), Xb; }, reset: function () { clearTimeout(this._timer); }, emit: function () { this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input)); } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1, jc = 2;kc.prototype = { set: function (a) { return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this; }, stop: function (a) { this.session.stopped = a ? jc : ic; }, recognize: function (a) { var b = this.session;if (!b.stopped) { this.touchAction.preventDefaults(a);var c, d = this.recognizers, e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) { c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++; } } }, get: function (a) { if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) { if (b[c].options.event == a) return b[c]; }return null; }, add: function (a) { if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a; }, remove: function (a) { if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this; }, on: function (a, b) { var c = this.handlers;return m(x(a), function (a) { c[a] = c[a] || [], c[a].push(b); }), this; }, off: function (a, b) { var c = this.handlers;return m(x(a), function (a) { b ? c[a].splice(y(c[a], b), 1) : delete c[a]; }), this; }, emit: function (a, b) { this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) { b.type = a, b.preventDefault = function () { b.srcEvent.preventDefault(); };for (var d = 0; d < c.length;) { c[d](b), d++; } } }, destroy: function () { this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null; } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () { return hc; }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc; }(window, document, "Hammer");;(function (factory) { if (typeof define === 'function' && define.amd) { define(['jquery', 'hammerjs'], factory); } else if (typeof exports === 'object') { factory(require('jquery'), require('hammerjs')); } else { factory(jQuery, Hammer); } })(function ($, Hammer) { function hammerify(el, options) { var $el = $(el); if (!$el.data("hammer")) { $el.data("hammer", new Hammer($el[0], options)); } } $.fn.hammer = function (options) { return this.each(function () { hammerify(this, options); }); }; // extend the emit method to also trigger jQuery events Hammer.Manager.prototype.emit = function (originalEmit) { return function (type, data) { originalEmit.call(this, type, data); $(this.element).trigger({ type: type, gesture: data }); }; }(Hammer.Manager.prototype.emit); }); ; // Required for Meteor package, the use of window prevents export by Meteor (function (window) { if (window.Package) { Materialize = {}; } else { window.Materialize = {}; } })(window); /* * raf.js * https://github.com/ngryman/raf.js * * original requestAnimationFrame polyfill by Erik Möller * inspired from paul_irish gist and post * * Copyright (c) 2013 ngryman * Licensed under the MIT license. */ (function (window) { var lastTime = 0, vendors = ['webkit', 'moz'], requestAnimationFrame = window.requestAnimationFrame, cancelAnimationFrame = window.cancelAnimationFrame, i = vendors.length; // try to un-prefix existing raf while (--i >= 0 && !requestAnimationFrame) { requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame']; cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame']; } // polyfill with setTimeout fallback // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 if (!requestAnimationFrame || !cancelAnimationFrame) { requestAnimationFrame = function (callback) { var now = +Date.now(), nextTime = Math.max(lastTime + 16, now); return setTimeout(function () { callback(lastTime = nextTime); }, nextTime - now); }; cancelAnimationFrame = clearTimeout; } // export to window window.requestAnimationFrame = requestAnimationFrame; window.cancelAnimationFrame = cancelAnimationFrame; })(window); /** * Generate approximated selector string for a jQuery object * @param {jQuery} obj jQuery object to be parsed * @returns {string} */ Materialize.objectSelectorString = function (obj) { var tagStr = obj.prop('tagName') || ''; var idStr = obj.attr('id') || ''; var classStr = obj.attr('class') || ''; return (tagStr + idStr + classStr).replace(/\s/g, ''); }; // Unique Random ID Materialize.guid = function () { function s4() { return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1); } return function () { return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4(); }; }(); /** * Escapes hash from special characters * @param {string} hash String returned from this.hash * @returns {string} */ Materialize.escapeHash = function (hash) { return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1"); }; Materialize.elementOrParentIsFixed = function (element) { var $element = $(element); var $checkElements = $element.add($element.parents()); var isFixed = false; $checkElements.each(function () { if ($(this).css("position") === "fixed") { isFixed = true; return false; } }); return isFixed; }; /** * Get time in ms * @license https://raw.github.com/jashkenas/underscore/master/LICENSE * @type {function} * @return {number} */ var getTime = Date.now || function () { return new Date().getTime(); }; /** * Returns a function, that, when invoked, will only be triggered at most once * during a given window of time. Normally, the throttled function will run * as much as it can, without ever going more than once per `wait` duration; * but if you'd like to disable the execution on the leading edge, pass * `{leading: false}`. To disable execution on the trailing edge, ditto. * @license https://raw.github.com/jashkenas/underscore/master/LICENSE * @param {function} func * @param {number} wait * @param {Object=} options * @returns {Function} */ Materialize.throttle = function (func, wait, options) { var context, args, result; var timeout = null; var previous = 0; options || (options = {}); var later = function () { previous = options.leading === false ? 0 : getTime(); timeout = null; result = func.apply(context, args); context = args = null; }; return function () { var now = getTime(); if (!previous && options.leading === false) previous = now; var remaining = wait - (now - previous); context = this; args = arguments; if (remaining <= 0) { clearTimeout(timeout); timeout = null; previous = now; result = func.apply(context, args); context = args = null; } else if (!timeout && options.trailing !== false) { timeout = setTimeout(later, remaining); } return result; }; }; // Velocity has conflicts when loaded with jQuery, this will check for it // First, check if in noConflict mode var Vel; if (jQuery) { Vel = jQuery.Velocity; } else if ($) { Vel = $.Velocity; } else { Vel = Velocity; } ;(function ($) { $.fn.collapsible = function (options, methodParam) { var defaults = { accordion: undefined, onOpen: undefined, onClose: undefined }; var methodName = options; options = $.extend(defaults, options); return this.each(function () { var $this = $(this); var $panel_headers = $(this).find('> li > .collapsible-header'); var collapsible_type = $this.data("collapsible"); /**************** Helper Functions ****************/ // Accordion Open function accordionOpen(object) { $panel_headers = $this.find('> li > .collapsible-header'); if (object.hasClass('active')) { object.parent().addClass('active'); } else { object.parent().removeClass('active'); } if (object.parent().hasClass('active')) { object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ''); } }); } else { object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ''); } }); } $panel_headers.not(object).removeClass('active').parent().removeClass('active'); // Close previously open accordion elements. $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () { if ($(this).is(':visible')) { $(this).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ''); execCallbacks($(this).siblings('.collapsible-header')); } }); } }); } // Expandable Open function expandableOpen(object) { if (object.hasClass('active')) { object.parent().addClass('active'); } else { object.parent().removeClass('active'); } if (object.parent().hasClass('active')) { object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ''); } }); } else { object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { $(this).css('height', ''); } }); } } // Open collapsible. object: .collapsible-header function collapsibleOpen(object, noToggle) { if (!noToggle) { object.toggleClass('active'); } if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion accordionOpen(object); } else { // Handle Expandables expandableOpen(object); } execCallbacks(object); } // Handle callbacks function execCallbacks(object) { if (object.hasClass('active')) { if (typeof options.onOpen === "function") { options.onOpen.call(this, object.parent()); } } else { if (typeof options.onClose === "function") { options.onClose.call(this, object.parent()); } } } /** * Check if object is children of panel header * @param {Object} object Jquery object * @return {Boolean} true if it is children */ function isChildrenOfPanelHeader(object) { var panelHeader = getPanelHeader(object); return panelHeader.length > 0; } /** * Get panel header from a children element * @param {Object} object Jquery object * @return {Object} panel header object */ function getPanelHeader(object) { return object.closest('li > .collapsible-header'); } // Turn off any existing event handlers function removeEventHandlers() { $this.off('click.collapse', '> li > .collapsible-header'); } /***** End Helper Functions *****/ // Methods if (methodName === 'destroy') { removeEventHandlers(); return; } else if (methodParam >= 0 && methodParam < $panel_headers.length) { var $curr_header = $panel_headers.eq(methodParam); if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) { collapsibleOpen($curr_header); } return; } removeEventHandlers(); // Add click handler to only direct collapsible header children $this.on('click.collapse', '> li > .collapsible-header', function (e) { var element = $(e.target); if (isChildrenOfPanelHeader(element)) { element = getPanelHeader(element); } collapsibleOpen(element); }); // Open first active if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion collapsibleOpen($panel_headers.filter('.active').first(), true); } else { // Handle Expandables $panel_headers.filter('.active').each(function () { collapsibleOpen($(this), true); }); } }); }; $(document).ready(function () { $('.collapsible').collapsible(); }); })(jQuery);;(function ($) { // Add posibility to scroll to selected option // usefull for select for example $.fn.scrollTo = function (elem) { $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top); return this; }; $.fn.dropdown = function (options) { var defaults = { inDuration: 300, outDuration: 225, constrainWidth: true, // Constrains width of dropdown to the activator hover: false, gutter: 0, // Spacing from edge belowOrigin: false, alignment: 'left', stopPropagation: false }; // Open dropdown. if (options === "open") { this.each(function () { $(this).trigger('open'); }); return false; } // Close dropdown. if (options === "close") { this.each(function () { $(this).trigger('close'); }); return false; } this.each(function () { var origin = $(this); var curr_options = $.extend({}, defaults, options); var isFocused = false; // Dropdown menu var activates = $("#" + origin.attr('data-activates')); function updateOptions() { if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration'); if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration'); if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth'); if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover'); if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter'); if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin'); if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment'); if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation'); } updateOptions(); // Attach dropdown to its activator origin.after(activates); /* Helper function to position and resize dropdown. Used in hover and click handler. */ function placeDropdown(eventType) { // Check for simultaneous focus and click events. if (eventType === 'focus') { isFocused = true; } // Check html data attributes updateOptions(); // Set Dropdown state activates.addClass('active'); origin.addClass('active'); var originWidth = origin[0].getBoundingClientRect().width; // Constrain width if (curr_options.constrainWidth === true) { activates.css('width', originWidth); } else { activates.css('white-space', 'nowrap'); } // Offscreen detection var windowHeight = window.innerHeight; var originHeight = origin.innerHeight(); var offsetLeft = origin.offset().left; var offsetTop = origin.offset().top - $(window).scrollTop(); var currAlignment = curr_options.alignment; var gutterSpacing = 0; var leftPosition = 0; // Below Origin var verticalOffset = 0; if (curr_options.belowOrigin === true) { verticalOffset = originHeight; } // Check for scrolling positioned container. var scrollYOffset = 0; var scrollXOffset = 0; var wrapper = origin.parent(); if (!wrapper.is('body')) { if (wrapper[0].scrollHeight > wrapper[0].clientHeight) { scrollYOffset = wrapper[0].scrollTop; } if (wrapper[0].scrollWidth > wrapper[0].clientWidth) { scrollXOffset = wrapper[0].scrollLeft; } } if (offsetLeft + activates.innerWidth() > $(window).width()) { // Dropdown goes past screen on right, force right alignment currAlignment = 'right'; } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) { // Dropdown goes past screen on left, force left alignment currAlignment = 'left'; } // Vertical bottom offscreen detection if (offsetTop + activates.innerHeight() > windowHeight) { // If going upwards still goes offscreen, just crop height of dropdown. if (offsetTop + originHeight - activates.innerHeight() < 0) { var adjustedHeight = windowHeight - offsetTop - verticalOffset; activates.css('max-height', adjustedHeight); } else { // Flow upwards. if (!verticalOffset) { verticalOffset += originHeight; } verticalOffset -= activates.innerHeight(); } } // Handle edge alignment if (currAlignment === 'left') { gutterSpacing = curr_options.gutter; leftPosition = origin.position().left + gutterSpacing; } else if (currAlignment === 'right') { // Material icons fix activates.stop(true, true).css({ opacity: 0, left: 0 }); var offsetRight = origin.position().left + originWidth - activates.width(); gutterSpacing = -curr_options.gutter; leftPosition = offsetRight + gutterSpacing; } // Position dropdown activates.css({ position: 'absolute', top: origin.position().top + verticalOffset + scrollYOffset, left: leftPosition + scrollXOffset }); // Show dropdown activates.slideDown({ queue: false, duration: curr_options.inDuration, easing: 'easeOutCubic', complete: function () { $(this).css('height', ''); } }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' }); // Add click close handler to document setTimeout(function () { $(document).on('click.' + activates.attr('id'), function (e) { hideDropdown(); $(document).off('click.' + activates.attr('id')); }); }, 0); } function hideDropdown() { // Check for simultaneous focus and click events. isFocused = false; activates.fadeOut(curr_options.outDuration); activates.removeClass('active'); origin.removeClass('active'); $(document).off('click.' + activates.attr('id')); setTimeout(function () { activates.css('max-height', ''); }, curr_options.outDuration); } // Hover if (curr_options.hover) { var open = false; origin.off('click.' + origin.attr('id')); // Hover handler to show dropdown origin.on('mouseenter', function (e) { // Mouse over if (open === false) { placeDropdown(); open = true; } }); origin.on('mouseleave', function (e) { // If hover on origin then to something other than dropdown content, then close var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element if (!$(toEl).closest('.dropdown-content').is(activates)) { activates.stop(true, true); hideDropdown(); open = false; } }); activates.on('mouseleave', function (e) { // Mouse out var toEl = e.toElement || e.relatedTarget; if (!$(toEl).closest('.dropdown-button').is(origin)) { activates.stop(true, true); hideDropdown(); open = false; } }); // Click } else { // Click handler to show dropdown origin.off('click.' + origin.attr('id')); origin.on('click.' + origin.attr('id'), function (e) { if (!isFocused) { if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) { e.preventDefault(); // Prevents button click from moving window if (curr_options.stopPropagation) { e.stopPropagation(); } placeDropdown('click'); } // If origin is clicked and menu is open, close menu else if (origin.hasClass('active')) { hideDropdown(); $(document).off('click.' + activates.attr('id')); } } }); } // End else // Listen to open and close event - useful for select component origin.on('open', function (e, eventType) { placeDropdown(eventType); }); origin.on('close', hideDropdown); }); }; // End dropdown plugin $(document).ready(function () { $('.dropdown-button').dropdown(); }); })(jQuery); ;(function ($) { 'use strict'; var _defaults = { opacity: 0.5, inDuration: 250, outDuration: 250, ready: undefined, complete: undefined, dismissible: true, startingTop: '4%', endingTop: '10%' }; /** * @class * */ var Modal = function () { /** * Construct Modal instance and set up overlay * @constructor * @param {jQuery} $el * @param {Object} options */ function Modal($el, options) { _classCallCheck(this, Modal); // If exists, destroy and reinitialize if (!!$el[0].M_Modal) { $el[0].M_Modal.destroy(); } /** * The jQuery element * @type {jQuery} */ this.$el = $el; /** * Options for the modal * @member Modal#options * @prop {Number} [opacity=0.5] - Opacity of the modal overlay * @prop {Number} [inDuration=250] - Length in ms of enter transition * @prop {Number} [outDuration=250] - Length in ms of exit transition * @prop {Function} ready - Callback function called when modal is finished entering * @prop {Function} complete - Callback function called when modal is finished exiting * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click * @prop {String} [startingTop='4%'] - startingTop * @prop {String} [endingTop='10%'] - endingTop */ this.options = $.extend({}, Modal.defaults, options); /** * Describes open/close state of modal * @type {Boolean} */ this.isOpen = false; this.$el[0].M_Modal = this; this.id = $el.attr('id'); this.openingTrigger = undefined; this.$overlay = $(''); Modal._increment++; Modal._count++; this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2; this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1; this.setupEventHandlers(); } _createClass(Modal, [{ key: 'getInstance', /** * Get Instance */ value: function getInstance() { return this; } /** * Teardown component */ }, { key: 'destroy', value: function destroy() { this.removeEventHandlers(); this.$el[0].removeAttribute('style'); if (!!this.$overlay[0].parentNode) { this.$overlay[0].parentNode.removeChild(this.$overlay[0]); } this.$el[0].M_Modal = undefined; Modal._count--; } /** * Setup Event Handlers */ }, { key: 'setupEventHandlers', value: function setupEventHandlers() { this.handleOverlayClickBound = this.handleOverlayClick.bind(this); this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this); if (Modal._count === 1) { document.addEventListener('click', this.handleTriggerClick); } this.$overlay[0].addEventListener('click', this.handleOverlayClickBound); this.$el[0].addEventListener('click', this.handleModalCloseClickBound); } /** * Remove Event Handlers */ }, { key: 'removeEventHandlers', value: function removeEventHandlers() { if (Modal._count === 0) { document.removeEventListener('click', this.handleTriggerClick); } this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound); this.$el[0].removeEventListener('click', this.handleModalCloseClickBound); } /** * Handle Trigger Click * @param {Event} e */ }, { key: 'handleTriggerClick', value: function handleTriggerClick(e) { var $trigger = $(e.target).closest('.modal-trigger'); if (e.target && $trigger.length) { var modalId = $trigger[0].getAttribute('href'); if (modalId) { modalId = modalId.slice(1); } else { modalId = $trigger[0].getAttribute('data-target'); } var modalInstance = document.getElementById(modalId).M_Modal; if (modalInstance) { modalInstance.open($trigger); } e.preventDefault(); } } /** * Handle Overlay Click */ }, { key: 'handleOverlayClick', value: function handleOverlayClick() { if (this.options.dismissible) { this.close(); } } /** * Handle Modal Close Click * @param {Event} e */ }, { key: 'handleModalCloseClick', value: function handleModalCloseClick(e) { var $closeTrigger = $(e.target).closest('.modal-close'); if (e.target && $closeTrigger.length) { this.close(); } } /** * Handle Keydown * @param {Event} e */ }, { key: 'handleKeydown', value: function handleKeydown(e) { // ESC key if (e.keyCode === 27 && this.options.dismissible) { this.close(); } } /** * Animate in modal */ }, { key: 'animateIn', value: function animateIn() { var _this = this; // Set initial styles $.extend(this.$el[0].style, { display: 'block', opacity: 0 }); $.extend(this.$overlay[0].style, { display: 'block', opacity: 0 }); // Animate overlay Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' }); // Define modal animation options var enterVelocityOptions = { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic', // Handle modal ready callback complete: function () { if (typeof _this.options.ready === 'function') { _this.options.ready.call(_this, _this.$el, _this.openingTrigger); } } }; // Bottom sheet animation if (this.$el[0].classList.contains('bottom-sheet')) { Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions); // Normal modal animation } else { Vel.hook(this.$el[0], 'scaleX', 0.7); this.$el[0].style.top = this.options.startingTop; Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions); } } /** * Animate out modal */ }, { key: 'animateOut', value: function animateOut() { var _this2 = this; // Animate overlay Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' }); // Define modal animation options var exitVelocityOptions = { duration: this.options.outDuration, queue: false, ease: 'easeOutCubic', // Handle modal ready callback complete: function () { _this2.$el[0].style.display = 'none'; // Call complete callback if (typeof _this2.options.complete === 'function') { _this2.options.complete.call(_this2, _this2.$el); } _this2.$overlay[0].remove(); } }; // Bottom sheet animation if (this.$el[0].classList.contains('bottom-sheet')) { Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions); // Normal modal animation } else { Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions); } } /** * Open Modal * @param {jQuery} [$trigger] */ }, { key: 'open', value: function open($trigger) { if (this.isOpen) { return; } this.isOpen = true; var body = document.body; body.style.overflow = 'hidden'; this.$el[0].classList.add('open'); body.appendChild(this.$overlay[0]); // Set opening trigger, undefined indicates modal was opened by javascript this.openingTrigger = !!$trigger ? $trigger : undefined; if (this.options.dismissible) { this.handleKeydownBound = this.handleKeydown.bind(this); document.addEventListener('keydown', this.handleKeydownBound); } this.animateIn(); return this; } /** * Close Modal */ }, { key: 'close', value: function close() { if (!this.isOpen) { return; } this.isOpen = false; this.$el[0].classList.remove('open'); document.body.style.overflow = null; if (this.options.dismissible) { document.removeEventListener('keydown', this.handleKeydownBound); } this.animateOut(); return this; } }], [{ key: 'init', value: function init($els, options) { var arr = []; $els.each(function () { arr.push(new Modal($(this), options)); }); return arr; } }, { key: 'defaults', get: function () { return _defaults; } }]); return Modal; }(); /** * @static * @memberof Modal */ Modal._increment = 0; /** * @static * @memberof Modal */ Modal._count = 0; window.Materialize.Modal = Modal; $.fn.modal = function (methodOrOptions) { // Call plugin method if valid method name is passed in if (Modal.prototype[methodOrOptions]) { // Getter methods if (methodOrOptions.slice(0, 3) === 'get') { return this.first()[0].M_Modal[methodOrOptions](); // Void methods } else { return this.each(function () { this.M_Modal[methodOrOptions](); }); } // Initialize plugin if options or no argument is passed in } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { Modal.init(this, arguments[0]); return this; // Return error if an unrecognized method name is passed in } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal'); } }; })(jQuery); ;(function ($) { $.fn.materialbox = function () { return this.each(function () { if ($(this).hasClass('initialized')) { return; } $(this).addClass('initialized'); var overlayActive = false; var doneAnimating = true; var inDuration = 275; var outDuration = 200; var origin = $(this); var placeholder = $('
').addClass('material-placeholder'); var originalWidth = 0; var originalHeight = 0; var ancestorsChanged; var ancestor; var originInlineStyles = origin.attr('style'); origin.wrap(placeholder); // Start click handler origin.on('click', function () { var placeholder = origin.parent('.material-placeholder'); var windowWidth = window.innerWidth; var windowHeight = window.innerHeight; var originalWidth = origin.width(); var originalHeight = origin.height(); // If already modal, return to original if (doneAnimating === false) { returnToOriginal(); return false; } else if (overlayActive && doneAnimating === true) { returnToOriginal(); return false; } // Set states doneAnimating = false; origin.addClass('active'); overlayActive = true; // Set positioning for placeholder placeholder.css({ width: placeholder[0].getBoundingClientRect().width, height: placeholder[0].getBoundingClientRect().height, position: 'relative', top: 0, left: 0 }); // Find ancestor with overflow: hidden; and remove it ancestorsChanged = undefined; ancestor = placeholder[0].parentNode; var count = 0; while (ancestor !== null && !$(ancestor).is(document)) { var curr = $(ancestor); if (curr.css('overflow') !== 'visible') { curr.css('overflow', 'visible'); if (ancestorsChanged === undefined) { ancestorsChanged = curr; } else { ancestorsChanged = ancestorsChanged.add(curr); } } ancestor = ancestor.parentNode; } // Set css on origin origin.css({ position: 'absolute', 'z-index': 1000, 'will-change': 'left, top, width, height' }).data('width', originalWidth).data('height', originalHeight); // Add overlay var overlay = $('
').css({ opacity: 0 }).click(function () { if (doneAnimating === true) returnToOriginal(); }); // Put before in origin image to preserve z-index layering. origin.before(overlay); // Set dimensions if needed var overlayOffset = overlay[0].getBoundingClientRect(); overlay.css({ width: windowWidth, height: windowHeight, left: -1 * overlayOffset.left, top: -1 * overlayOffset.top }); // Animate Overlay overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' }); // Add and animate caption if it exists if (origin.data('caption') !== "") { var $photo_caption = $('
'); $photo_caption.text(origin.data('caption')); $('body').append($photo_caption); $photo_caption.css({ "display": "inline" }); $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' }); } // Resize Image var ratio = 0; var widthPercent = originalWidth / windowWidth; var heightPercent = originalHeight / windowHeight; var newWidth = 0; var newHeight = 0; if (widthPercent > heightPercent) { ratio = originalHeight / originalWidth; newWidth = windowWidth * 0.9; newHeight = windowWidth * 0.9 * ratio; } else { ratio = originalWidth / originalHeight; newWidth = windowHeight * 0.9 * ratio; newHeight = windowHeight * 0.9; } // Animate image + set z-index if (origin.hasClass('responsive-img')) { origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false, complete: function () { origin.css({ left: 0, top: 0 }).velocity({ height: newHeight, width: newWidth, left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 }, { duration: inDuration, queue: false, easing: 'easeOutQuad', complete: function () { doneAnimating = true; } }); } // End Complete }); // End Velocity } else { origin.css('left', 0).css('top', 0).velocity({ height: newHeight, width: newWidth, left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 }, { duration: inDuration, queue: false, easing: 'easeOutQuad', complete: function () { doneAnimating = true; } }); // End Velocity } // Handle Exit triggers $(window).on('scroll.materialbox', function () { if (overlayActive) { returnToOriginal(); } }); $(window).on('resize.materialbox', function () { if (overlayActive) { returnToOriginal(); } }); $(document).on('keyup.materialbox', function (e) { // ESC key if (e.keyCode === 27 && doneAnimating === true && overlayActive) { returnToOriginal(); } }); }); // End click handler // This function returns the modaled image to the original spot function returnToOriginal() { doneAnimating = false; var placeholder = origin.parent('.material-placeholder'); var windowWidth = window.innerWidth; var windowHeight = window.innerHeight; var originalWidth = origin.data('width'); var originalHeight = origin.data('height'); origin.velocity("stop", true); $('#materialbox-overlay').velocity("stop", true); $('.materialbox-caption').velocity("stop", true); // disable exit handlers $(window).off('scroll.materialbox'); $(document).off('keyup.materialbox'); $(window).off('resize.materialbox'); $('#materialbox-overlay').velocity({ opacity: 0 }, { duration: outDuration, // Delay prevents animation overlapping queue: false, easing: 'easeOutQuad', complete: function () { // Remove Overlay overlayActive = false; $(this).remove(); } }); // Resize Image origin.velocity({ width: originalWidth, height: originalHeight, left: 0, top: 0 }, { duration: outDuration, queue: false, easing: 'easeOutQuad', complete: function () { placeholder.css({ height: '', width: '', position: '', top: '', left: '' }); origin.removeAttr('style'); origin.attr('style', originInlineStyles); // Remove class origin.removeClass('active'); doneAnimating = true; // Remove overflow overrides on ancestors if (ancestorsChanged) { ancestorsChanged.css('overflow', ''); } } }); // Remove Caption + reset css settings on image $('.materialbox-caption').velocity({ opacity: 0 }, { duration: outDuration, // Delay prevents animation overlapping queue: false, easing: 'easeOutQuad', complete: function () { $(this).remove(); } }); } }); }; $(document).ready(function () { $('.materialboxed').materialbox(); }); })(jQuery); ;(function ($) { $.fn.parallax = function () { var window_width = $(window).width(); // Parallax Scripts return this.each(function (i) { var $this = $(this); $this.addClass('parallax'); function updateParallax(initial) { var container_height; if (window_width < 601) { container_height = $this.height() > 0 ? $this.height() : $this.children("img").height(); } else { container_height = $this.height() > 0 ? $this.height() : 500; } var $img = $this.children("img").first(); var img_height = $img.height(); var parallax_dist = img_height - container_height; var bottom = $this.offset().top + container_height; var top = $this.offset().top; var scrollTop = $(window).scrollTop(); var windowHeight = window.innerHeight; var windowBottom = scrollTop + windowHeight; var percentScrolled = (windowBottom - top) / (container_height + windowHeight); var parallax = Math.round(parallax_dist * percentScrolled); if (initial) { $img.css('display', 'block'); } if (bottom > scrollTop && top < scrollTop + windowHeight) { $img.css('transform', "translate3D(-50%," + parallax + "px, 0)"); } } // Wait for image load $this.children("img").one("load", function () { updateParallax(true); }).each(function () { if (this.complete) $(this).trigger("load"); }); $(window).scroll(function () { window_width = $(window).width(); updateParallax(false); }); $(window).resize(function () { window_width = $(window).width(); updateParallax(false); }); }); }; })(jQuery); ;(function ($) { var methods = { init: function (options) { var defaults = { onShow: null, swipeable: false, responsiveThreshold: Infinity // breakpoint for swipeable }; options = $.extend(defaults, options); var namespace = Materialize.objectSelectorString($(this)); return this.each(function (i) { var uniqueNamespace = namespace + i; // For each set of tabs, we want to keep track of // which tab is active and its associated content var $this = $(this), window_width = $(window).width(); var $active, $content, $links = $this.find('li.tab a'), $tabs_width = $this.width(), $tabs_content = $(), $tabs_wrapper, $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length, $indicator, index = prev_index = 0, clicked = false, clickedTimeout, transition = 300; // Finds right attribute for indicator based on active tab. // el: jQuery Object var calcRightPos = function (el) { return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft()); }; // Finds left attribute for indicator based on active tab. // el: jQuery Object var calcLeftPos = function (el) { return Math.floor(el.position().left + $this.scrollLeft()); }; // Animates Indicator to active tab. // prev_index: Number var animateIndicator = function (prev_index) { if (index - prev_index >= 0) { $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 }); } else { $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 }); } }; // Change swipeable according to responsive threshold if (options.swipeable) { if (window_width > options.responsiveThreshold) { options.swipeable = false; } } // If the location.hash matches one of the links, use that as the active tab. $active = $($links.filter('[href="' + location.hash + '"]')); // If no match is found, use the first link or any with class 'active' as the initial active tab. if ($active.length === 0) { $active = $(this).find('li.tab a.active').first(); } if ($active.length === 0) { $active = $(this).find('li.tab a').first(); } $active.addClass('active'); index = $links.index($active); if (index < 0) { index = 0; } if ($active[0] !== undefined) { $content = $($active[0].hash); $content.addClass('active'); } // append indicator then set indicator width to tab width if (!$this.find('.indicator').length) { $this.append('
  • '); } $indicator = $this.find('.indicator'); // we make sure that the indicator is at the end of the tabs $this.append($indicator); if ($this.is(":visible")) { // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)}); // $indicator.css({"left": index * $tab_width}); setTimeout(function () { $indicator.css({ "right": calcRightPos($active) }); $indicator.css({ "left": calcLeftPos($active) }); }, 0); } $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () { $tabs_width = $this.width(); $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; if (index < 0) { index = 0; } if ($tab_width !== 0 && $tabs_width !== 0) { $indicator.css({ "right": calcRightPos($active) }); $indicator.css({ "left": calcLeftPos($active) }); } }); // Initialize Tabs Content. if (options.swipeable) { // TODO: Duplicate calls with swipeable? handle multiple div wrapping. $links.each(function () { var $curr_content = $(Materialize.escapeHash(this.hash)); $curr_content.addClass('carousel-item'); $tabs_content = $tabs_content.add($curr_content); }); $tabs_wrapper = $tabs_content.wrapAll(''); $tabs_content.css('display', ''); $('.tabs-content.carousel').carousel({ fullWidth: true, noWrap: true, onCycleTo: function (item) { if (!clicked) { var prev_index = index; index = $tabs_wrapper.index(item); $active.removeClass('active'); $active = $links.eq(index); $active.addClass('active'); animateIndicator(prev_index); if (typeof options.onShow === "function") { options.onShow.call($this[0], $content); } } } }); } else { // Hide the remaining content $links.not($active).each(function () { $(Materialize.escapeHash(this.hash)).hide(); }); } // Bind the click event handler $this.off('click.tabs').on('click.tabs', 'a', function (e) { if ($(this).parent().hasClass('disabled')) { e.preventDefault(); return; } // Act as regular link if target attribute is specified. if (!!$(this).attr("target")) { return; } clicked = true; $tabs_width = $this.width(); $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; // Make the old tab inactive. $active.removeClass('active'); var $oldContent = $content; // Update the variables with the new link and content $active = $(this); $content = $(Materialize.escapeHash(this.hash)); $links = $this.find('li.tab a'); var activeRect = $active.position(); // Make the tab active. $active.addClass('active'); prev_index = index; index = $links.index($(this)); if (index < 0) { index = 0; } // Change url to current tab // window.location.hash = $active.attr('href'); // Swap content if (options.swipeable) { if ($tabs_content.length) { $tabs_content.carousel('set', index, function () { if (typeof options.onShow === "function") { options.onShow.call($this[0], $content); } }); } } else { if ($content !== undefined) { $content.show(); $content.addClass('active'); if (typeof options.onShow === "function") { options.onShow.call(this, $content); } } if ($oldContent !== undefined && !$oldContent.is($content)) { $oldContent.hide(); $oldContent.removeClass('active'); } } // Reset clicked state clickedTimeout = setTimeout(function () { clicked = false; }, transition); // Update indicator animateIndicator(prev_index); // Prevent the anchor's default click action e.preventDefault(); }); }); }, select_tab: function (id) { this.find('a[href="#' + id + '"]').trigger('click'); } }; $.fn.tabs = function (methodOrOptions) { if (methods[methodOrOptions]) { return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { // Default to "init" return methods.init.apply(this, arguments); } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs'); } }; $(document).ready(function () { $('ul.tabs').tabs(); }); })(jQuery); ;(function ($) { $.fn.tooltip = function (options) { var timeout = null, margin = 5; // Defaults var defaults = { delay: 350, tooltip: '', position: 'bottom', html: false }; // Remove tooltip from the activator if (options === "remove") { this.each(function () { $('#' + $(this).attr('data-tooltip-id')).remove(); $(this).removeAttr('data-tooltip-id'); $(this).off('mouseenter.tooltip mouseleave.tooltip'); }); return false; } options = $.extend(defaults, options); return this.each(function () { var tooltipId = Materialize.guid(); var origin = $(this); // Destroy old tooltip if (origin.attr('data-tooltip-id')) { $('#' + origin.attr('data-tooltip-id')).remove(); } origin.attr('data-tooltip-id', tooltipId); // Get attributes. var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop; var setAttributes = function () { allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html; tooltipDelay = origin.attr('data-delay'); tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay; tooltipPosition = origin.attr('data-position'); tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition; tooltipText = origin.attr('data-tooltip'); tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText; }; setAttributes(); var renderTooltipEl = function () { var tooltip = $('
    '); // Create Text span if (allowHtml) { tooltipText = $('').html(tooltipText); } else { tooltipText = $('').text(tooltipText); } // Create tooltip tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId); // Create backdrop backdrop = $('
    '); backdrop.appendTo(tooltip); return tooltip; }; tooltipEl = renderTooltipEl(); // Destroy previously binded events origin.off('mouseenter.tooltip mouseleave.tooltip'); // Mouse In var started = false, timeoutRef; origin.on({ 'mouseenter.tooltip': function (e) { var showTooltip = function () { setAttributes(); started = true; tooltipEl.velocity('stop'); backdrop.velocity('stop'); tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' }); // Tooltip positioning var originWidth = origin.outerWidth(); var originHeight = origin.outerHeight(); var tooltipHeight = tooltipEl.outerHeight(); var tooltipWidth = tooltipEl.outerWidth(); var tooltipVerticalMovement = '0px'; var tooltipHorizontalMovement = '0px'; var backdropOffsetWidth = backdrop[0].offsetWidth; var backdropOffsetHeight = backdrop[0].offsetHeight; var scaleXFactor = 8; var scaleYFactor = 8; var scaleFactor = 0; var targetTop, targetLeft, newCoordinates; if (tooltipPosition === "top") { // Top Position targetTop = origin.offset().top - tooltipHeight - margin; targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); tooltipVerticalMovement = '-10px'; backdrop.css({ bottom: 0, left: 0, borderRadius: '14px 14px 0 0', transformOrigin: '50% 100%', marginTop: tooltipHeight, marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2 }); } // Left Position else if (tooltipPosition === "left") { targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; targetLeft = origin.offset().left - tooltipWidth - margin; newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); tooltipHorizontalMovement = '-10px'; backdrop.css({ top: '-7px', right: 0, width: '14px', height: '14px', borderRadius: '14px 0 0 14px', transformOrigin: '95% 50%', marginTop: tooltipHeight / 2, marginLeft: tooltipWidth }); } // Right Position else if (tooltipPosition === "right") { targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; targetLeft = origin.offset().left + originWidth + margin; newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); tooltipHorizontalMovement = '+10px'; backdrop.css({ top: '-7px', left: 0, width: '14px', height: '14px', borderRadius: '0 14px 14px 0', transformOrigin: '5% 50%', marginTop: tooltipHeight / 2, marginLeft: '0px' }); } else { // Bottom Position targetTop = origin.offset().top + origin.outerHeight() + margin; targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); tooltipVerticalMovement = '+10px'; backdrop.css({ top: 0, left: 0, marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2 }); } // Set tooptip css placement tooltipEl.css({ top: newCoordinates.y, left: newCoordinates.x }); // Calculate Scale to fill scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth); scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight); scaleFactor = Math.max(scaleXFactor, scaleYFactor); tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false }); backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' }); }; timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval // Mouse Out }, 'mouseleave.tooltip': function () { // Reset State started = false; clearTimeout(timeoutRef); // Animate back setTimeout(function () { if (started !== true) { tooltipEl.velocity({ opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false }); backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, { duration: 225, queue: false, complete: function () { backdrop.css({ visibility: 'hidden' }); tooltipEl.css({ visibility: 'hidden' }); started = false; } }); } }, 225); } }); }); }; var repositionWithinScreen = function (x, y, width, height) { var newX = x; var newY = y; if (newX < 0) { newX = 4; } else if (newX + width > window.innerWidth) { newX -= newX + width - window.innerWidth; } if (newY < 0) { newY = 4; } else if (newY + height > window.innerHeight + $(window).scrollTop) { newY -= newY + height - window.innerHeight; } return { x: newX, y: newY }; }; $(document).ready(function () { $('.tooltipped').tooltip(); }); })(jQuery); ; /*! * Waves v0.6.4 * http://fian.my.id/Waves * * Copyright 2014 Alfiana E. Sibuea and other contributors * Released under the MIT license * https://github.com/fians/Waves/blob/master/LICENSE */ ;(function (window) { 'use strict'; var Waves = Waves || {}; var $$ = document.querySelectorAll.bind(document); // Find exact position of element function isWindow(obj) { return obj !== null && obj === obj.window; } function getWindow(elem) { return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView; } function offset(elem) { var docElem, win, box = { top: 0, left: 0 }, doc = elem && elem.ownerDocument; docElem = doc.documentElement; if (typeof elem.getBoundingClientRect !== typeof undefined) { box = elem.getBoundingClientRect(); } win = getWindow(doc); return { top: box.top + win.pageYOffset - docElem.clientTop, left: box.left + win.pageXOffset - docElem.clientLeft }; } function convertStyle(obj) { var style = ''; for (var a in obj) { if (obj.hasOwnProperty(a)) { style += a + ':' + obj[a] + ';'; } } return style; } var Effect = { // Effect delay duration: 750, show: function (e, element) { // Disable right click if (e.button === 2) { return false; } var el = element || this; // Create ripple var ripple = document.createElement('div'); ripple.className = 'waves-ripple'; el.appendChild(ripple); // Get click coordinate and element witdh var pos = offset(el); var relativeY = e.pageY - pos.top; var relativeX = e.pageX - pos.left; var scale = 'scale(' + el.clientWidth / 100 * 10 + ')'; // Support for touch devices if ('touches' in e) { relativeY = e.touches[0].pageY - pos.top; relativeX = e.touches[0].pageX - pos.left; } // Attach data to element ripple.setAttribute('data-hold', Date.now()); ripple.setAttribute('data-scale', scale); ripple.setAttribute('data-x', relativeX); ripple.setAttribute('data-y', relativeY); // Set ripple position var rippleStyle = { 'top': relativeY + 'px', 'left': relativeX + 'px' }; ripple.className = ripple.className + ' waves-notransition'; ripple.setAttribute('style', convertStyle(rippleStyle)); ripple.className = ripple.className.replace('waves-notransition', ''); // Scale the ripple rippleStyle['-webkit-transform'] = scale; rippleStyle['-moz-transform'] = scale; rippleStyle['-ms-transform'] = scale; rippleStyle['-o-transform'] = scale; rippleStyle.transform = scale; rippleStyle.opacity = '1'; rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms'; rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms'; rippleStyle['-o-transition-duration'] = Effect.duration + 'ms'; rippleStyle['transition-duration'] = Effect.duration + 'ms'; rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; ripple.setAttribute('style', convertStyle(rippleStyle)); }, hide: function (e) { TouchHandler.touchup(e); var el = this; var width = el.clientWidth * 1.4; // Get first ripple var ripple = null; var ripples = el.getElementsByClassName('waves-ripple'); if (ripples.length > 0) { ripple = ripples[ripples.length - 1]; } else { return false; } var relativeX = ripple.getAttribute('data-x'); var relativeY = ripple.getAttribute('data-y'); var scale = ripple.getAttribute('data-scale'); // Get delay beetween mousedown and mouse leave var diff = Date.now() - Number(ripple.getAttribute('data-hold')); var delay = 350 - diff; if (delay < 0) { delay = 0; } // Fade out ripple after delay setTimeout(function () { var style = { 'top': relativeY + 'px', 'left': relativeX + 'px', 'opacity': '0', // Duration '-webkit-transition-duration': Effect.duration + 'ms', '-moz-transition-duration': Effect.duration + 'ms', '-o-transition-duration': Effect.duration + 'ms', 'transition-duration': Effect.duration + 'ms', '-webkit-transform': scale, '-moz-transform': scale, '-ms-transform': scale, '-o-transform': scale, 'transform': scale }; ripple.setAttribute('style', convertStyle(style)); setTimeout(function () { try { el.removeChild(ripple); } catch (e) { return false; } }, Effect.duration); }, delay); }, // Little hack to make can perform waves effect wrapInput: function (elements) { for (var a = 0; a < elements.length; a++) { var el = elements[a]; if (el.tagName.toLowerCase() === 'input') { var parent = el.parentNode; // If input already have parent just pass through if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) { continue; } // Put element class and style to the specified parent var wrapper = document.createElement('i'); wrapper.className = el.className + ' waves-input-wrapper'; var elementStyle = el.getAttribute('style'); if (!elementStyle) { elementStyle = ''; } wrapper.setAttribute('style', elementStyle); el.className = 'waves-button-input'; el.removeAttribute('style'); // Put element as child parent.replaceChild(wrapper, el); wrapper.appendChild(el); } } } }; /** * Disable mousedown event for 500ms during and after touch */ var TouchHandler = { /* uses an integer rather than bool so there's no issues with * needing to clear timeouts if another touch event occurred * within the 500ms. Cannot mouseup between touchstart and * touchend, nor in the 500ms after touchend. */ touches: 0, allowEvent: function (e) { var allow = true; if (e.type === 'touchstart') { TouchHandler.touches += 1; //push } else if (e.type === 'touchend' || e.type === 'touchcancel') { setTimeout(function () { if (TouchHandler.touches > 0) { TouchHandler.touches -= 1; //pop after 500ms } }, 500); } else if (e.type === 'mousedown' && TouchHandler.touches > 0) { allow = false; } return allow; }, touchup: function (e) { TouchHandler.allowEvent(e); } }; /** * Delegated click handler for .waves-effect element. * returns null when .waves-effect element not in "click tree" */ function getWavesEffectElement(e) { if (TouchHandler.allowEvent(e) === false) { return null; } var element = null; var target = e.target || e.srcElement; while (target.parentNode !== null) { if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) { element = target; break; } target = target.parentNode; } return element; } /** * Bubble the click and show effect if .waves-effect elem was found */ function showEffect(e) { var element = getWavesEffectElement(e); if (element !== null) { Effect.show(e, element); if ('ontouchstart' in window) { element.addEventListener('touchend', Effect.hide, false); element.addEventListener('touchcancel', Effect.hide, false); } element.addEventListener('mouseup', Effect.hide, false); element.addEventListener('mouseleave', Effect.hide, false); element.addEventListener('dragend', Effect.hide, false); } } Waves.displayEffect = function (options) { options = options || {}; if ('duration' in options) { Effect.duration = options.duration; } //Wrap input inside tag Effect.wrapInput($$('.waves-effect')); if ('ontouchstart' in window) { document.body.addEventListener('touchstart', showEffect, false); } document.body.addEventListener('mousedown', showEffect, false); }; /** * Attach Waves to an input element (or any element which doesn't * bubble mouseup/mousedown events). * Intended to be used with dynamically loaded forms/inputs, or * where the user doesn't want a delegated click handler. */ Waves.attach = function (element) { //FUTURE: automatically add waves classes and allow users // to specify them with an options param? Eg. light/classic/button if (element.tagName.toLowerCase() === 'input') { Effect.wrapInput([element]); element = element.parentNode; } if ('ontouchstart' in window) { element.addEventListener('touchstart', showEffect, false); } element.addEventListener('mousedown', showEffect, false); }; window.Waves = Waves; document.addEventListener('DOMContentLoaded', function () { Waves.displayEffect(); }, false); })(window); ;(function ($) { 'use strict'; var _defaults = { displayLength: Infinity, inDuration: 300, outDuration: 375, className: undefined, completeCallback: undefined, activationPercent: 0.8 }; var Toast = function () { function Toast(message, displayLength, className, completeCallback) { _classCallCheck(this, Toast); if (!message) { return; } /** * Options for the toast * @member Toast#options */ this.options = { displayLength: displayLength, className: className, completeCallback: completeCallback }; this.options = $.extend({}, Toast.defaults, this.options); this.message = message; /** * Describes current pan state toast * @type {Boolean} */ this.panning = false; /** * Time remaining until toast is removed */ this.timeRemaining = this.options.displayLength; if (Toast._toasts.length === 0) { Toast._createContainer(); } // Create new toast Toast._toasts.push(this); var toastElement = this.createToast(); toastElement.M_Toast = this; this.el = toastElement; this._animateIn(); this.setTimer(); } _createClass(Toast, [{ key: 'createToast', /** * Create toast and append it to toast container */ value: function createToast() { var toast = document.createElement('div'); toast.classList.add('toast'); // Add custom classes onto toast if (this.options.className) { var classes = this.options.className.split(' '); var i = void 0, count = void 0; for (i = 0, count = classes.length; i < count; i++) { toast.classList.add(classes[i]); } } // Set content if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') { toast.appendChild(this.message); // Check if it is jQuery object } else if (this.message instanceof jQuery) { $(toast).append(this.message); // Insert as text; } else { toast.innerHTML = this.message; } // Append toasft Toast._container.appendChild(toast); return toast; } /** * Animate in toast */ }, { key: '_animateIn', value: function _animateIn() { // Animate toast in Vel(this.el, { top: 0, opacity: 1 }, { duration: 300, easing: 'easeOutCubic', queue: false }); } /** * Create setInterval which automatically removes toast when timeRemaining >= 0 * has been reached */ }, { key: 'setTimer', value: function setTimer() { var _this3 = this; if (this.timeRemaining !== Infinity) { this.counterInterval = setInterval(function () { // If toast is not being dragged, decrease its time remaining if (!_this3.panning) { _this3.timeRemaining -= 20; } // Animate toast out if (_this3.timeRemaining <= 0) { _this3.remove(); } }, 20); } } /** * Dismiss toast with animation */ }, { key: 'remove', value: function remove() { var _this4 = this; window.clearInterval(this.counterInterval); var activationDistance = this.el.offsetWidth * this.options.activationPercent; if (this.wasSwiped) { this.el.style.transition = 'transform .05s, opacity .05s'; this.el.style.transform = 'translateX(' + activationDistance + 'px)'; this.el.style.opacity = 0; } Vel(this.el, { opacity: 0, marginTop: '-40px' }, { duration: this.options.outDuration, easing: 'easeOutExpo', queue: false, complete: function () { // Call the optional callback if (typeof _this4.options.completeCallback === 'function') { _this4.options.completeCallback(); } // Remove toast from DOM _this4.el.parentNode.removeChild(_this4.el); Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1); if (Toast._toasts.length === 0) { Toast._removeContainer(); } } }); } }], [{ key: '_createContainer', /** * Append toast container and add event handlers */ value: function _createContainer() { var container = document.createElement('div'); container.setAttribute('id', 'toast-container'); // Add event handler container.addEventListener('touchstart', Toast._onDragStart); container.addEventListener('touchmove', Toast._onDragMove); container.addEventListener('touchend', Toast._onDragEnd); container.addEventListener('mousedown', Toast._onDragStart); document.addEventListener('mousemove', Toast._onDragMove); document.addEventListener('mouseup', Toast._onDragEnd); document.body.appendChild(container); Toast._container = container; } /** * Remove toast container and event handlers */ }, { key: '_removeContainer', value: function _removeContainer() { // Add event handler document.removeEventListener('mousemove', Toast._onDragMove); document.removeEventListener('mouseup', Toast._onDragEnd); Toast._container.parentNode.removeChild(Toast._container); Toast._container = null; } /** * Begin drag handler * @param {Event} e */ }, { key: '_onDragStart', value: function _onDragStart(e) { if (e.target && $(e.target).closest('.toast').length) { var $toast = $(e.target).closest('.toast'); var toast = $toast[0].M_Toast; toast.panning = true; Toast._draggedToast = toast; toast.el.classList.add('panning'); toast.el.style.transition = null; toast.startingXPos = Toast._xPos(e); toast.time = Date.now(); toast.xPos = Toast._xPos(e); } } /** * Drag move handler * @param {Event} e */ }, { key: '_onDragMove', value: function _onDragMove(e) { if (!!Toast._draggedToast) { e.preventDefault(); var toast = Toast._draggedToast; toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e)); toast.xPos = Toast._xPos(e); toast.velocityX = toast.deltaX / (Date.now() - toast.time); toast.time = Date.now(); var totalDeltaX = toast.xPos - toast.startingXPos; var activationDistance = toast.el.offsetWidth * toast.options.activationPercent; toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)'; toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance); } } /** * End drag handler * @param {Event} e */ }, { key: '_onDragEnd', value: function _onDragEnd(e) { if (!!Toast._draggedToast) { var toast = Toast._draggedToast; toast.panning = false; toast.el.classList.remove('panning'); var totalDeltaX = toast.xPos - toast.startingXPos; var activationDistance = toast.el.offsetWidth * toast.options.activationPercent; var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1; // Remove toast if (shouldBeDismissed) { toast.wasSwiped = true; toast.remove(); // Animate toast back to original position } else { toast.el.style.transition = 'transform .2s, opacity .2s'; toast.el.style.transform = null; toast.el.style.opacity = null; } Toast._draggedToast = null; } } /** * Get x position of mouse or touch event * @param {Event} e */ }, { key: '_xPos', value: function _xPos(e) { if (e.targetTouches && e.targetTouches.length >= 1) { return e.targetTouches[0].clientX; } // mouse event return e.clientX; } /** * Remove all toasts */ }, { key: 'removeAll', value: function removeAll() { for (var toastIndex in Toast._toasts) { Toast._toasts[toastIndex].remove(); } } }, { key: 'defaults', get: function () { return _defaults; } }]); return Toast; }(); /** * @static * @memberof Toast * @type {Array.} */ Toast._toasts = []; /** * @static * @memberof Toast */ Toast._container = null; /** * @static * @memberof Toast * @type {Toast} */ Toast._draggedToast = null; window.Materialize.Toast = Toast; window.Materialize.toast = function (message, displayLength, className, completeCallback) { return new Toast(message, displayLength, className, completeCallback); }; })(jQuery); ;(function ($) { var methods = { init: function (options) { var defaults = { menuWidth: 300, edge: 'left', closeOnClick: false, draggable: true, onOpen: null, onClose: null }; options = $.extend(defaults, options); $(this).each(function () { var $this = $(this); var menuId = $this.attr('data-activates'); var menu = $("#" + menuId); // Set to width if (options.menuWidth != 300) { menu.css('width', options.menuWidth); } // Add Touch Area var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]'); if (options.draggable) { // Regenerate dragTarget if ($dragTarget.length) { $dragTarget.remove(); } $dragTarget = $('
    ').attr('data-sidenav', menuId); $('body').append($dragTarget); } else { $dragTarget = $(); } if (options.edge == 'left') { menu.css('transform', 'translateX(-100%)'); $dragTarget.css({ 'left': 0 }); // Add Touch Area } else { menu.addClass('right-aligned') // Change text-alignment to right .css('transform', 'translateX(100%)'); $dragTarget.css({ 'right': 0 }); // Add Touch Area } // If fixed sidenav, bring menu out if (menu.hasClass('fixed')) { if (window.innerWidth > 992) { menu.css('transform', 'translateX(0)'); } } // Window resize to reset on large screens fixed if (menu.hasClass('fixed')) { $(window).resize(function () { if (window.innerWidth > 992) { // Close menu if window is resized bigger than 992 and user has fixed sidenav if ($('#sidenav-overlay').length !== 0 && menuOut) { removeMenu(true); } else { // menu.removeAttr('style'); menu.css('transform', 'translateX(0%)'); // menu.css('width', options.menuWidth); } } else if (menuOut === false) { if (options.edge === 'left') { menu.css('transform', 'translateX(-100%)'); } else { menu.css('transform', 'translateX(100%)'); } } }); } // if closeOnClick, then add close event for all a tags in side sideNav if (options.closeOnClick === true) { menu.on("click.itemclick", "a:not(.collapsible-header)", function () { if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) { removeMenu(); } }); } var removeMenu = function (restoreNav) { panning = false; menuOut = false; // Reenable scrolling $('body').css({ overflow: '', width: '' }); $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { $(this).remove(); } }); if (options.edge === 'left') { // Reset phantom div $dragTarget.css({ width: '', right: '', left: '0' }); menu.velocity({ 'translateX': '-100%' }, { duration: 200, queue: false, easing: 'easeOutCubic', complete: function () { if (restoreNav === true) { // Restore Fixed sidenav menu.removeAttr('style'); menu.css('width', options.menuWidth); } } }); } else { // Reset phantom div $dragTarget.css({ width: '', right: '0', left: '' }); menu.velocity({ 'translateX': '100%' }, { duration: 200, queue: false, easing: 'easeOutCubic', complete: function () { if (restoreNav === true) { // Restore Fixed sidenav menu.removeAttr('style'); menu.css('width', options.menuWidth); } } }); } // Callback if (typeof options.onClose === 'function') { options.onClose.call(this, menu); } }; // Touch Event var panning = false; var menuOut = false; if (options.draggable) { $dragTarget.on('click', function () { if (menuOut) { removeMenu(); } }); $dragTarget.hammer({ prevent_default: false }).on('pan', function (e) { if (e.gesture.pointerType == "touch") { var direction = e.gesture.direction; var x = e.gesture.center.x; var y = e.gesture.center.y; var velocityX = e.gesture.velocityX; // Vertical scroll bugfix if (x === 0 && y === 0) { return; } // Disable Scrolling var $body = $('body'); var $overlay = $('#sidenav-overlay'); var oldWidth = $body.innerWidth(); $body.css('overflow', 'hidden'); $body.width(oldWidth); // If overlay does not exist, create one and if it is clicked, close menu if ($overlay.length === 0) { $overlay = $('
    '); $overlay.css('opacity', 0).click(function () { removeMenu(); }); // Run 'onOpen' when sidenav is opened via touch/swipe if applicable if (typeof options.onOpen === 'function') { options.onOpen.call(this, menu); } $('body').append($overlay); } // Keep within boundaries if (options.edge === 'left') { if (x > options.menuWidth) { x = options.menuWidth; } else if (x < 0) { x = 0; } } if (options.edge === 'left') { // Left Direction if (x < options.menuWidth / 2) { menuOut = false; } // Right Direction else if (x >= options.menuWidth / 2) { menuOut = true; } menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)'); } else { // Left Direction if (x < window.innerWidth - options.menuWidth / 2) { menuOut = true; } // Right Direction else if (x >= window.innerWidth - options.menuWidth / 2) { menuOut = false; } var rightPos = x - options.menuWidth / 2; if (rightPos < 0) { rightPos = 0; } menu.css('transform', 'translateX(' + rightPos + 'px)'); } // Percentage overlay var overlayPerc; if (options.edge === 'left') { overlayPerc = x / options.menuWidth; $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); } else { overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth); $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); } } }).on('panend', function (e) { if (e.gesture.pointerType == "touch") { var $overlay = $('#sidenav-overlay'); var velocityX = e.gesture.velocityX; var x = e.gesture.center.x; var leftPos = x - options.menuWidth; var rightPos = x - options.menuWidth / 2; if (leftPos > 0) { leftPos = 0; } if (rightPos < 0) { rightPos = 0; } panning = false; if (options.edge === 'left') { // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut if (menuOut && velocityX <= 0.3 || velocityX < -0.5) { // Return menu to open if (leftPos !== 0) { menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); $dragTarget.css({ width: '50%', right: 0, left: '' }); menuOut = true; } else if (!menuOut || velocityX > 0.3) { // Enable Scrolling $('body').css({ overflow: '', width: '' }); // Slide menu closed menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { // Run 'onClose' when sidenav is closed via touch/swipe if applicable if (typeof options.onClose === 'function') { options.onClose.call(this, menu); } $(this).remove(); } }); $dragTarget.css({ width: '10px', right: '', left: 0 }); } } else { if (menuOut && velocityX >= -0.3 || velocityX > 0.5) { // Return menu to open if (rightPos !== 0) { menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); $dragTarget.css({ width: '50%', right: '', left: 0 }); menuOut = true; } else if (!menuOut || velocityX < -0.3) { // Enable Scrolling $('body').css({ overflow: '', width: '' }); // Slide menu closed menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { // Run 'onClose' when sidenav is closed via touch/swipe if applicable if (typeof options.onClose === 'function') { options.onClose.call(this, menu); } $(this).remove(); } }); $dragTarget.css({ width: '10px', right: 0, left: '' }); } } } }); } $this.off('click.sidenav').on('click.sidenav', function () { if (menuOut === true) { menuOut = false; panning = false; removeMenu(); } else { // Disable Scrolling var $body = $('body'); var $overlay = $('
    '); var oldWidth = $body.innerWidth(); $body.css('overflow', 'hidden'); $body.width(oldWidth); // Push current drag target on top of DOM tree $('body').append($dragTarget); if (options.edge === 'left') { $dragTarget.css({ width: '50%', right: 0, left: '' }); menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } else { $dragTarget.css({ width: '50%', right: '', left: 0 }); menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } // Overlay close on click $overlay.css('opacity', 0).click(function () { menuOut = false; panning = false; removeMenu(); $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad', complete: function () { $(this).remove(); } }); }); // Append body $('body').append($overlay); $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad', complete: function () { menuOut = true; panning = false; } }); // Callback if (typeof options.onOpen === 'function') { options.onOpen.call(this, menu); } } return false; }); }); }, destroy: function () { var $overlay = $('#sidenav-overlay'); var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]'); $overlay.trigger('click'); $dragTarget.remove(); $(this).off('click'); $overlay.remove(); }, show: function () { this.trigger('click'); }, hide: function () { $('#sidenav-overlay').trigger('click'); } }; $.fn.sideNav = function (methodOrOptions) { if (methods[methodOrOptions]) { return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { // Default to "init" return methods.init.apply(this, arguments); } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav'); } }; // Plugin end })(jQuery); ; /** * Extend jquery with a scrollspy plugin. * This watches the window scroll and fires events when elements are scrolled into viewport. * * throttle() and getTime() taken from Underscore.js * https://github.com/jashkenas/underscore * * @author Copyright 2013 John Smart * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE * @see https://github.com/thesmart * @version 0.1.2 */ (function ($) { var jWindow = $(window); var elements = []; var elementsInView = []; var isSpying = false; var ticks = 0; var unique_id = 1; var offset = { top: 0, right: 0, bottom: 0, left: 0 /** * Find elements that are within the boundary * @param {number} top * @param {number} right * @param {number} bottom * @param {number} left * @return {jQuery} A collection of elements */ };function findElements(top, right, bottom, left) { var hits = $(); $.each(elements, function (i, element) { if (element.height() > 0) { var elTop = element.offset().top, elLeft = element.offset().left, elRight = elLeft + element.width(), elBottom = elTop + element.height(); var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top); if (isIntersect) { hits.push(element); } } }); return hits; } /** * Called when the user scrolls the window */ function onScroll(scrollOffset) { // unique tick id ++ticks; // viewport rectangle var top = jWindow.scrollTop(), left = jWindow.scrollLeft(), right = left + jWindow.width(), bottom = top + jWindow.height(); // determine which elements are in view var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left); $.each(intersections, function (i, element) { var lastTick = element.data('scrollSpy:ticks'); if (typeof lastTick != 'number') { // entered into view element.triggerHandler('scrollSpy:enter'); } // update tick id element.data('scrollSpy:ticks', ticks); }); // determine which elements are no longer in view $.each(elementsInView, function (i, element) { var lastTick = element.data('scrollSpy:ticks'); if (typeof lastTick == 'number' && lastTick !== ticks) { // exited from view element.triggerHandler('scrollSpy:exit'); element.data('scrollSpy:ticks', null); } }); // remember elements in view for next tick elementsInView = intersections; } /** * Called when window is resized */ function onWinSize() { jWindow.trigger('scrollSpy:winSize'); } /** * Enables ScrollSpy using a selector * @param {jQuery|string} selector The elements collection, or a selector * @param {Object=} options Optional. throttle : number -> scrollspy throttling. Default: 100 ms offsetTop : number -> offset from top. Default: 0 offsetRight : number -> offset from right. Default: 0 offsetBottom : number -> offset from bottom. Default: 0 offsetLeft : number -> offset from left. Default: 0 activeClass : string -> Class name to be added to the active link. Default: active * @returns {jQuery} */ $.scrollSpy = function (selector, options) { var defaults = { throttle: 100, scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll activeClass: 'active', getActiveElement: function (id) { return 'a[href="#' + id + '"]'; } }; options = $.extend(defaults, options); var visible = []; selector = $(selector); selector.each(function (i, element) { elements.push($(element)); $(element).data("scrollSpy:id", i); // Smooth scroll to section $('a[href="#' + $(element).attr('id') + '"]').click(function (e) { e.preventDefault(); var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1; $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' }); }); }); offset.top = options.offsetTop || 0; offset.right = options.offsetRight || 0; offset.bottom = options.offsetBottom || 0; offset.left = options.offsetLeft || 0; var throttledScroll = Materialize.throttle(function () { onScroll(options.scrollOffset); }, options.throttle || 100); var readyScroll = function () { $(document).ready(throttledScroll); }; if (!isSpying) { jWindow.on('scroll', readyScroll); jWindow.on('resize', readyScroll); isSpying = true; } // perform a scan once, after current execution context, and after dom is ready setTimeout(readyScroll, 0); selector.on('scrollSpy:enter', function () { visible = $.grep(visible, function (value) { return value.height() != 0; }); var $this = $(this); if (visible[0]) { $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) { visible.unshift($(this)); } else { visible.push($(this)); } } else { visible.push($(this)); } $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); }); selector.on('scrollSpy:exit', function () { visible = $.grep(visible, function (value) { return value.height() != 0; }); if (visible[0]) { $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); var $this = $(this); visible = $.grep(visible, function (value) { return value.attr('id') != $this.attr('id'); }); if (visible[0]) { // Check if empty $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); } } }); return selector; }; /** * Listen for window resize events * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms * @returns {jQuery} $(window) */ $.winSizeSpy = function (options) { $.winSizeSpy = function () { return jWindow; }; // lock from multiple calls options = options || { throttle: 100 }; return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100)); }; /** * Enables ScrollSpy on a collection of elements * e.g. $('.scrollSpy').scrollSpy() * @param {Object=} options Optional. throttle : number -> scrollspy throttling. Default: 100 ms offsetTop : number -> offset from top. Default: 0 offsetRight : number -> offset from right. Default: 0 offsetBottom : number -> offset from bottom. Default: 0 offsetLeft : number -> offset from left. Default: 0 * @returns {jQuery} */ $.fn.scrollSpy = function (options) { return $.scrollSpy($(this), options); }; })(jQuery); ;(function ($) { $(document).ready(function () { // Function to update labels of text fields Materialize.updateTextFields = function () { var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; $(input_selector).each(function (index, element) { var $this = $(this); if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) { $this.siblings('label').addClass('active'); } else if ($(element)[0].validity) { $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true); } else { $this.siblings('label').removeClass('active'); } }); }; // Text based inputs var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; // Add active if form auto complete $(document).on('change', input_selector, function () { if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) { $(this).siblings('label').addClass('active'); } validate_field($(this)); }); // Add active if input element has been pre-populated on document ready $(document).ready(function () { Materialize.updateTextFields(); }); // HTML DOM FORM RESET handling $(document).on('reset', function (e) { var formReset = $(e.target); if (formReset.is('form')) { formReset.find(input_selector).removeClass('valid').removeClass('invalid'); formReset.find(input_selector).each(function () { if ($(this).attr('value') === '') { $(this).siblings('label').removeClass('active'); } }); // Reset select formReset.find('select.initialized').each(function () { var reset_text = formReset.find('option[selected]').text(); formReset.siblings('input.select-dropdown').val(reset_text); }); } }); // Add active when element has focus $(document).on('focus', input_selector, function () { $(this).siblings('label, .prefix').addClass('active'); }); $(document).on('blur', input_selector, function () { var $inputElement = $(this); var selector = ".prefix"; if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) { selector += ", label"; } $inputElement.siblings(selector).removeClass('active'); validate_field($inputElement); }); window.validate_field = function (object) { var hasLength = object.attr('data-length') !== undefined; var lenAttr = parseInt(object.attr('data-length')); var len = object.val().length; if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) { if (object.hasClass('validate')) { object.removeClass('valid'); object.removeClass('invalid'); } } else { if (object.hasClass('validate')) { // Check for character counter attributes if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) { object.removeClass('invalid'); object.addClass('valid'); } else { object.removeClass('valid'); object.addClass('invalid'); } } } }; // Radio and Checkbox focus class var radio_checkbox = 'input[type=radio], input[type=checkbox]'; $(document).on('keyup.radio', radio_checkbox, function (e) { // TAB, check if tabbing to radio or checkbox. if (e.which === 9) { $(this).addClass('tabbed'); var $this = $(this); $this.one('blur', function (e) { $(this).removeClass('tabbed'); }); return; } }); // Textarea Auto Resize var hiddenDiv = $('.hiddendiv').first(); if (!hiddenDiv.length) { hiddenDiv = $('
    '); $('body').append(hiddenDiv); } var text_area_selector = '.materialize-textarea'; function textareaAutoResize($textarea) { // Set font properties of hiddenDiv var fontFamily = $textarea.css('font-family'); var fontSize = $textarea.css('font-size'); var lineHeight = $textarea.css('line-height'); var padding = $textarea.css('padding'); if (fontSize) { hiddenDiv.css('font-size', fontSize); } if (fontFamily) { hiddenDiv.css('font-family', fontFamily); } if (lineHeight) { hiddenDiv.css('line-height', lineHeight); } if (padding) { hiddenDiv.css('padding', padding); } // Set original-height, if none if (!$textarea.data('original-height')) { $textarea.data('original-height', $textarea.height()); } if ($textarea.attr('wrap') === 'off') { hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre'); } hiddenDiv.text($textarea.val() + '\n'); var content = hiddenDiv.html().replace(/\n/g, '
    '); hiddenDiv.html(content); // When textarea is hidden, width goes crazy. // Approximate with half of window size if ($textarea.is(':visible')) { hiddenDiv.css('width', $textarea.width()); } else { hiddenDiv.css('width', $(window).width() / 2); } /** * Resize if the new height is greater than the * original height of the textarea */ if ($textarea.data('original-height') <= hiddenDiv.height()) { $textarea.css('height', hiddenDiv.height()); } else if ($textarea.val().length < $textarea.data('previous-length')) { /** * In case the new height is less than original height, it * means the textarea has less text than before * So we set the height to the original one */ $textarea.css('height', $textarea.data('original-height')); } $textarea.data('previous-length', $textarea.val().length); } $(text_area_selector).each(function () { var $textarea = $(this); /** * Instead of resizing textarea on document load, * store the original height and the original length */ $textarea.data('original-height', $textarea.height()); $textarea.data('previous-length', $textarea.val().length); }); $('body').on('keyup keydown autoresize', text_area_selector, function () { textareaAutoResize($(this)); }); // File Input Path $(document).on('change', '.file-field input[type="file"]', function () { var file_field = $(this).closest('.file-field'); var path_input = file_field.find('input.file-path'); var files = $(this)[0].files; var file_names = []; for (var i = 0; i < files.length; i++) { file_names.push(files[i].name); } path_input.val(file_names.join(", ")); path_input.trigger('change'); }); /**************** * Range Input * ****************/ var range_type = 'input[type=range]'; var range_mousedown = false; var left; $(range_type).each(function () { var thumb = $(''); $(this).after(thumb); }); var showRangeBubble = function (thumb) { var paddingLeft = parseInt(thumb.parent().css('padding-left')); var marginLeft = -7 + paddingLeft + 'px'; thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' }); }; var calcRangeOffset = function (range) { var width = range.width() - 15; var max = parseFloat(range.attr('max')); var min = parseFloat(range.attr('min')); var percent = (parseFloat(range.val()) - min) / (max - min); return percent * width; }; var range_wrapper = '.range-field'; $(document).on('change', range_type, function (e) { var thumb = $(this).siblings('.thumb'); thumb.find('.value').html($(this).val()); if (!thumb.hasClass('active')) { showRangeBubble(thumb); } var offsetLeft = calcRangeOffset($(this)); thumb.addClass('active').css('left', offsetLeft); }); $(document).on('mousedown touchstart', range_type, function (e) { var thumb = $(this).siblings('.thumb'); // If thumb indicator does not exist yet, create it if (thumb.length <= 0) { thumb = $(''); $(this).after(thumb); } // Set indicator value thumb.find('.value').html($(this).val()); range_mousedown = true; $(this).addClass('active'); if (!thumb.hasClass('active')) { showRangeBubble(thumb); } if (e.type !== 'input') { var offsetLeft = calcRangeOffset($(this)); thumb.addClass('active').css('left', offsetLeft); } }); $(document).on('mouseup touchend', range_wrapper, function () { range_mousedown = false; $(this).removeClass('active'); }); $(document).on('input mousemove touchmove', range_wrapper, function (e) { var thumb = $(this).children('.thumb'); var left; var input = $(this).find(range_type); if (range_mousedown) { if (!thumb.hasClass('active')) { showRangeBubble(thumb); } var offsetLeft = calcRangeOffset(input); thumb.addClass('active').css('left', offsetLeft); thumb.find('.value').html(thumb.siblings(range_type).val()); } }); $(document).on('mouseout touchleave', range_wrapper, function () { if (!range_mousedown) { var thumb = $(this).children('.thumb'); var paddingLeft = parseInt($(this).css('padding-left')); var marginLeft = 7 + paddingLeft + 'px'; if (thumb.hasClass('active')) { thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 }); } thumb.removeClass('active'); } }); /************************** * Auto complete plugin * *************************/ $.fn.autocomplete = function (options) { // Defaults var defaults = { data: {}, limit: Infinity, onAutocomplete: null, minLength: 1 }; options = $.extend(defaults, options); return this.each(function () { var $input = $(this); var data = options.data, count = 0, activeIndex = -1, oldVal, $inputDiv = $input.closest('.input-field'); // Div to append on // Check if data isn't empty if (!$.isEmptyObject(data)) { var $autocomplete = $(''); var $oldAutocomplete; // Append autocomplete element. // Prevent double structure init. if ($inputDiv.length) { $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first(); if (!$oldAutocomplete.length) { $inputDiv.append($autocomplete); // Set ul in body } } else { $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content'); if (!$oldAutocomplete.length) { $input.after($autocomplete); } } if ($oldAutocomplete.length) { $autocomplete = $oldAutocomplete; } // Highlight partial match. var highlight = function (string, $el) { var img = $el.find('img'); var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""), matchEnd = matchStart + string.length - 1, beforeMatch = $el.text().slice(0, matchStart), matchText = $el.text().slice(matchStart, matchEnd + 1), afterMatch = $el.text().slice(matchEnd + 1); $el.html("" + beforeMatch + "" + matchText + "" + afterMatch + ""); if (img.length) { $el.prepend(img); } }; // Reset current element position var resetCurrentElement = function () { activeIndex = -1; $autocomplete.find('.active').removeClass('active'); }; // Remove autocomplete elements var removeAutocomplete = function () { $autocomplete.empty(); resetCurrentElement(); oldVal = undefined; }; $input.off('blur.autocomplete').on('blur.autocomplete', function () { removeAutocomplete(); }); // Perform search $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) { // Reset count. count = 0; var val = $input.val().toLowerCase(); // Don't capture enter or arrow key usage. if (e.which === 13 || e.which === 38 || e.which === 40) { return; } // Check if the input isn't empty if (oldVal !== val) { removeAutocomplete(); if (val.length >= options.minLength) { for (var key in data) { if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) { // Break if past limit if (count >= options.limit) { break; } var autocompleteOption = $('
  • '); if (!!data[key]) { autocompleteOption.append('' + key + ''); } else { autocompleteOption.append('' + key + ''); } $autocomplete.append(autocompleteOption); highlight(val, autocompleteOption); count++; } } } } // Update oldVal oldVal = val; }); $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) { // Arrow keys and enter key usage var keyCode = e.which, liElement, numItems = $autocomplete.children('li').length, $active = $autocomplete.children('.active').first(); // select element on Enter if (keyCode === 13 && activeIndex >= 0) { liElement = $autocomplete.children('li').eq(activeIndex); if (liElement.length) { liElement.trigger('mousedown.autocomplete'); e.preventDefault(); } return; } // Capture up and down key if (keyCode === 38 || keyCode === 40) { e.preventDefault(); if (keyCode === 38 && activeIndex > 0) { activeIndex--; } if (keyCode === 40 && activeIndex < numItems - 1) { activeIndex++; } $active.removeClass('active'); if (activeIndex >= 0) { $autocomplete.children('li').eq(activeIndex).addClass('active'); } } }); // Set input value $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () { var text = $(this).text().trim(); $input.val(text); $input.trigger('change'); removeAutocomplete(); // Handle onAutocomplete callback. if (typeof options.onAutocomplete === "function") { options.onAutocomplete.call(this, text); } }); // Empty data } else { $input.off('keyup.autocomplete focus.autocomplete'); } }); }; }); // End of $(document).ready /******************* * Select Plugin * ******************/ $.fn.material_select = function (callback) { $(this).each(function () { var $select = $(this); if ($select.hasClass('browser-default')) { return; // Continue to next (return false breaks out of entire loop) } var multiple = $select.attr('multiple') ? true : false, lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt if (lastID) { $select.parent().find('span.caret').remove(); $select.parent().find('input').remove(); $select.unwrap(); $('ul#select-options-' + lastID).remove(); } // If destroying the select, remove the selelct-id and reset it to it's uninitialized state. if (callback === 'destroy') { $select.removeAttr('data-select-id').removeClass('initialized'); $(window).off('click.select'); return; } var uniqueID = Materialize.guid(); $select.attr('data-select-id', uniqueID); var wrapper = $('
    '); wrapper.addClass($select.attr('class')); if ($select.is(':disabled')) wrapper.addClass('disabled'); var options = $(''), selectChildren = $select.children('option, optgroup'), valuesSelected = [], optionsHover = false; var label = $select.find('option:selected').html() || $select.find('option:first').html() || ""; // Function that renders and appends the option taking into // account type and possible image icon. var appendOptionWithIcon = function (select, option, type) { // Add disabled attr if disabled var disabledClass = option.is(':disabled') ? 'disabled ' : ''; var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : ''; var multipleCheckbox = multiple ? '' : ''; // add icons var icon_url = option.data('icon'); var classes = option.attr('class'); if (!!icon_url) { var classString = ''; if (!!classes) classString = ' class="' + classes + '"'; // Check for multiple type. options.append($('
  • ' + multipleCheckbox + option.html() + '
  • ')); return true; } // Check for multiple type. options.append($('
  • ' + multipleCheckbox + option.html() + '
  • ')); }; /* Create dropdown structure. */ if (selectChildren.length) { selectChildren.each(function () { if ($(this).is('option')) { // Direct descendant option. if (multiple) { appendOptionWithIcon($select, $(this), 'multiple'); } else { appendOptionWithIcon($select, $(this)); } } else if ($(this).is('optgroup')) { // Optgroup. var selectOptions = $(this).children('option'); options.append($('
  • ' + $(this).attr('label') + '
  • ')); selectOptions.each(function () { appendOptionWithIcon($select, $(this), 'optgroup-option'); }); } }); } options.find('li:not(.optgroup)').each(function (i) { $(this).click(function (e) { // Check if option element is disabled if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) { var selected = true; if (multiple) { $('input[type="checkbox"]', this).prop('checked', function (i, v) { return !v; }); selected = toggleEntryFromArray(valuesSelected, i, $select); $newSelect.trigger('focus'); } else { options.find('li').removeClass('active'); $(this).toggleClass('active'); $newSelect.val($(this).text()); } activateOption(options, $(this)); $select.find('option').eq(i).prop('selected', selected); // Trigger onchange() event $select.trigger('change'); if (typeof callback !== 'undefined') callback(); } e.stopPropagation(); }); }); // Wrap Elements $select.wrap(wrapper); // Add Select Display Element var dropdownIcon = $(''); // escape double quotes var sanitizedLabelHtml = label.replace(/"/g, '"'); var $newSelect = $(''); $select.before($newSelect); $newSelect.before(dropdownIcon); $newSelect.after(options); // Check if section element is disabled if (!$select.is(':disabled')) { $newSelect.dropdown({ 'hover': false }); } // Copy tabindex if ($select.attr('tabindex')) { $($newSelect[0]).attr('tabindex', $select.attr('tabindex')); } $select.addClass('initialized'); $newSelect.on({ 'focus': function () { if ($('ul.select-dropdown').not(options[0]).is(':visible')) { $('input.select-dropdown').trigger('close'); $(window).off('click.select'); } if (!options.is(':visible')) { $(this).trigger('open', ['focus']); var label = $(this).val(); if (multiple && label.indexOf(',') >= 0) { label = label.split(',')[0]; } var selectedOption = options.find('li').filter(function () { return $(this).text().toLowerCase() === label.toLowerCase(); })[0]; activateOption(options, selectedOption, true); $(window).off('click.select').on('click.select', function () { multiple && (optionsHover || $newSelect.trigger('close')); $(window).off('click.select'); }); } }, 'click': function (e) { e.stopPropagation(); } }); $newSelect.on('blur', function () { if (!multiple) { $(this).trigger('close'); $(window).off('click.select'); } options.find('li.selected').removeClass('selected'); }); options.hover(function () { optionsHover = true; }, function () { optionsHover = false; }); // Add initial multiple selections. if (multiple) { $select.find("option:selected:not(:disabled)").each(function () { var index = $(this).index(); toggleEntryFromArray(valuesSelected, index, $select); options.find("li").eq(index).find(":checkbox").prop("checked", true); }); } /** * Make option as selected and scroll to selected position * @param {jQuery} collection Select options jQuery element * @param {Element} newOption element of the new option * @param {Boolean} firstActivation If on first activation of select */ var activateOption = function (collection, newOption, firstActivation) { if (newOption) { collection.find('li.selected').removeClass('selected'); var option = $(newOption); option.addClass('selected'); if (!multiple || !!firstActivation) { options.scrollTo(option); } } }; // Allow user to search by typing // this array is cleared after 1 second var filterQuery = [], onKeyDown = function (e) { // TAB - switch to another input if (e.which == 9) { $newSelect.trigger('close'); return; } // ARROW DOWN WHEN SELECT IS CLOSED - open select options if (e.which == 40 && !options.is(':visible')) { $newSelect.trigger('open'); return; } // ENTER WHEN SELECT IS CLOSED - submit form if (e.which == 13 && !options.is(':visible')) { return; } e.preventDefault(); // CASE WHEN USER TYPE LETTERS var letter = String.fromCharCode(e.which).toLowerCase(), nonLetters = [9, 13, 27, 38, 40]; if (letter && nonLetters.indexOf(e.which) === -1) { filterQuery.push(letter); var string = filterQuery.join(''), newOption = options.find('li').filter(function () { return $(this).text().toLowerCase().indexOf(string) === 0; })[0]; if (newOption) { activateOption(options, newOption); } } // ENTER - select option and close when select options are opened if (e.which == 13) { var activeOption = options.find('li.selected:not(.disabled)')[0]; if (activeOption) { $(activeOption).trigger('click'); if (!multiple) { $newSelect.trigger('close'); } } } // ARROW DOWN - move to next not disabled option if (e.which == 40) { if (options.find('li.selected').length) { newOption = options.find('li.selected').next('li:not(.disabled)')[0]; } else { newOption = options.find('li:not(.disabled)')[0]; } activateOption(options, newOption); } // ESC - close options if (e.which == 27) { $newSelect.trigger('close'); } // ARROW UP - move to previous not disabled option if (e.which == 38) { newOption = options.find('li.selected').prev('li:not(.disabled)')[0]; if (newOption) activateOption(options, newOption); } // Automaticaly clean filter query so user can search again by starting letters setTimeout(function () { filterQuery = []; }, 1000); }; $newSelect.on('keydown', onKeyDown); }); function toggleEntryFromArray(entriesArray, entryIndex, select) { var index = entriesArray.indexOf(entryIndex), notAdded = index === -1; if (notAdded) { entriesArray.push(entryIndex); } else { entriesArray.splice(index, 1); } select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active'); // use notAdded instead of true (to detect if the option is selected or not) select.find('option').eq(entryIndex).prop('selected', notAdded); setValueToInput(entriesArray, select); return notAdded; } function setValueToInput(entriesArray, select) { var value = ''; for (var i = 0, count = entriesArray.length; i < count; i++) { var text = select.find('option').eq(entriesArray[i]).text(); i === 0 ? value += text : value += ', ' + text; } if (value === '') { value = select.find('option:disabled').eq(0).text(); } select.siblings('input.select-dropdown').val(value); } }; })(jQuery); ;(function ($) { var methods = { init: function (options) { var defaults = { indicators: true, height: 400, transition: 500, interval: 6000 }; options = $.extend(defaults, options); return this.each(function () { // For each slider, we want to keep track of // which slide is active and its associated content var $this = $(this); var $slider = $this.find('ul.slides').first(); var $slides = $slider.find('> li'); var $active_index = $slider.find('.active').index(); var $active, $indicators, $interval; if ($active_index != -1) { $active = $slides.eq($active_index); } // Transitions the caption depending on alignment function captionTransition(caption, duration) { if (caption.hasClass("center-align")) { caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false }); } else if (caption.hasClass("right-align")) { caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false }); } else if (caption.hasClass("left-align")) { caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false }); } } // This function will transition the slide to any index of the next slide function moveToSlide(index) { // Wrap around indices. if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1; $active_index = $slider.find('.active').index(); // Only do if index changes if ($active_index != index) { $active = $slides.eq($active_index); $caption = $active.find('.caption'); $active.removeClass('active'); $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad', complete: function () { $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false }); } }); captionTransition($caption, options.transition); // Update indicators if (options.indicators) { $indicators.eq($active_index).removeClass('active'); } $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' }); $slides.eq(index).addClass('active'); // Update indicators if (options.indicators) { $indicators.eq(index).addClass('active'); } } } // Set height of slider // If fullscreen, do nothing if (!$this.hasClass('fullscreen')) { if (options.indicators) { // Add height if indicators are present $this.height(options.height + 40); } else { $this.height(options.height); } $slider.height(options.height); } // Set initial positions of captions $slides.find('.caption').each(function () { captionTransition($(this), 0); }); // Move img src into background-image $slides.find('img').each(function () { var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=='; if ($(this).attr('src') !== placeholderBase64) { $(this).css('background-image', 'url("' + $(this).attr('src') + '")'); $(this).attr('src', placeholderBase64); } }); // dynamically add indicators if (options.indicators) { $indicators = $(''); $slides.each(function (index) { var $indicator = $('
  • '); // Handle clicks on indicators $indicator.click(function () { var $parent = $slider.parent(); var curr_index = $parent.find($(this)).index(); moveToSlide(curr_index); // reset interval clearInterval($interval); $interval = setInterval(function () { $active_index = $slider.find('.active').index(); if ($slides.length == $active_index + 1) $active_index = 0; // loop to start else $active_index += 1; moveToSlide($active_index); }, options.transition + options.interval); }); $indicators.append($indicator); }); $this.append($indicators); $indicators = $this.find('ul.indicators').find('li.indicator-item'); } if ($active) { $active.show(); } else { $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); $active_index = 0; $active = $slides.eq($active_index); // Update indicators if (options.indicators) { $indicators.eq($active_index).addClass('active'); } } // Adjust height to current slide $active.find('img').each(function () { $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); }); // auto scroll $interval = setInterval(function () { $active_index = $slider.find('.active').index(); moveToSlide($active_index + 1); }, options.transition + options.interval); // HammerJS, Swipe navigation // Touch Event var panning = false; var swipeLeft = false; var swipeRight = false; $this.hammer({ prevent_default: false }).on('pan', function (e) { if (e.gesture.pointerType === "touch") { // reset interval clearInterval($interval); var direction = e.gesture.direction; var x = e.gesture.deltaX; var velocityX = e.gesture.velocityX; var velocityY = e.gesture.velocityY; $curr_slide = $slider.find('.active'); if (Math.abs(velocityX) > Math.abs(velocityY)) { $curr_slide.velocity({ translateX: x }, { duration: 50, queue: false, easing: 'easeOutQuad' }); } // Swipe Left if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) { swipeRight = true; } // Swipe Right else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) { swipeLeft = true; } // Make Slide Behind active slide visible var next_slide; if (swipeLeft) { next_slide = $curr_slide.next(); if (next_slide.length === 0) { next_slide = $slides.first(); } next_slide.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } if (swipeRight) { next_slide = $curr_slide.prev(); if (next_slide.length === 0) { next_slide = $slides.last(); } next_slide.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } } }).on('panend', function (e) { if (e.gesture.pointerType === "touch") { $curr_slide = $slider.find('.active'); panning = false; curr_index = $slider.find('.active').index(); if (!swipeRight && !swipeLeft || $slides.length <= 1) { // Return to original spot $curr_slide.velocity({ translateX: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad' }); } else if (swipeLeft) { moveToSlide(curr_index + 1); $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', complete: function () { $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); } }); } else if (swipeRight) { moveToSlide(curr_index - 1); $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', complete: function () { $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); } }); } swipeLeft = false; swipeRight = false; // Restart interval clearInterval($interval); $interval = setInterval(function () { $active_index = $slider.find('.active').index(); if ($slides.length == $active_index + 1) $active_index = 0; // loop to start else $active_index += 1; moveToSlide($active_index); }, options.transition + options.interval); } }); $this.on('sliderPause', function () { clearInterval($interval); }); $this.on('sliderStart', function () { clearInterval($interval); $interval = setInterval(function () { $active_index = $slider.find('.active').index(); if ($slides.length == $active_index + 1) $active_index = 0; // loop to start else $active_index += 1; moveToSlide($active_index); }, options.transition + options.interval); }); $this.on('sliderNext', function () { $active_index = $slider.find('.active').index(); moveToSlide($active_index + 1); }); $this.on('sliderPrev', function () { $active_index = $slider.find('.active').index(); moveToSlide($active_index - 1); }); }); }, pause: function () { $(this).trigger('sliderPause'); }, start: function () { $(this).trigger('sliderStart'); }, next: function () { $(this).trigger('sliderNext'); }, prev: function () { $(this).trigger('sliderPrev'); } }; $.fn.slider = function (methodOrOptions) { if (methods[methodOrOptions]) { return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { // Default to "init" return methods.init.apply(this, arguments); } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip'); } }; // Plugin end })(jQuery); ;(function ($) { $(document).ready(function () { $(document).on('click.card', '.card', function (e) { if ($(this).find('> .card-reveal').length) { var $card = $(e.target).closest('.card'); if ($card.data('initialOverflow') === undefined) { $card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow')); } if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) { // Make Reveal animate down and display none $(this).find('.card-reveal').velocity({ translateY: 0 }, { duration: 225, queue: false, easing: 'easeInOutQuad', complete: function () { $(this).css({ display: 'none' }); $card.css('overflow', $card.data('initialOverflow')); } }); } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) { $card.css('overflow', 'hidden'); $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' }); } } }); }); })(jQuery); ;(function ($) { var materialChipsDefaults = { data: [], placeholder: '', secondaryPlaceholder: '', autocompleteOptions: {} }; $(document).ready(function () { // Handle removal of static chips. $(document).on('click', '.chip .close', function (e) { var $chips = $(this).closest('.chips'); if ($chips.attr('data-initialized')) { return; } $(this).closest('.chip').remove(); }); }); $.fn.material_chip = function (options) { var self = this; this.$el = $(this); this.$document = $(document); this.SELS = { CHIPS: '.chips', CHIP: '.chip', INPUT: 'input', DELETE: '.material-icons', SELECTED_CHIP: '.selected' }; if ('data' === options) { return this.$el.data('chips'); } var curr_options = $.extend({}, materialChipsDefaults, options); self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data); // Initialize this.init = function () { var i = 0; var chips; self.$el.each(function () { var $chips = $(this); var chipId = Materialize.guid(); self.chipId = chipId; if (!curr_options.data || !(curr_options.data instanceof Array)) { curr_options.data = []; } $chips.data('chips', curr_options.data); $chips.attr('data-index', i); $chips.attr('data-initialized', true); if (!$chips.hasClass(self.SELS.CHIPS)) { $chips.addClass('chips'); } self.chips($chips, chipId); i++; }); }; this.handleEvents = function () { var SELS = self.SELS; self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) { $(e.target).find(SELS.INPUT).focus(); }); self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) { var $chip = $(e.target); if ($chip.length) { var wasSelected = $chip.hasClass('selected'); var $chips = $chip.closest(SELS.CHIPS); $(SELS.CHIP).removeClass('selected'); if (!wasSelected) { self.selectChip($chip.index(), $chips); } } }); self.$document.off('keydown.chips').on('keydown.chips', function (e) { if ($(e.target).is('input, textarea')) { return; } // delete var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP); var $chips = $chip.closest(SELS.CHIPS); var length = $chip.siblings(SELS.CHIP).length; var index; if (!$chip.length) { return; } if (e.which === 8 || e.which === 46) { e.preventDefault(); index = $chip.index(); self.deleteChip(index, $chips); var selectIndex = null; if (index + 1 < length) { selectIndex = index; } else if (index === length || index + 1 === length) { selectIndex = length - 1; } if (selectIndex < 0) selectIndex = null; if (null !== selectIndex) { self.selectChip(selectIndex, $chips); } if (!length) $chips.find('input').focus(); // left } else if (e.which === 37) { index = $chip.index() - 1; if (index < 0) { return; } $(SELS.CHIP).removeClass('selected'); self.selectChip(index, $chips); // right } else if (e.which === 39) { index = $chip.index() + 1; $(SELS.CHIP).removeClass('selected'); if (index > length) { $chips.find('input').focus(); return; } self.selectChip(index, $chips); } }); self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { var $currChips = $(e.target).closest(SELS.CHIPS); $currChips.addClass('focus'); $currChips.siblings('label, .prefix').addClass('active'); $(SELS.CHIP).removeClass('selected'); }); self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { var $currChips = $(e.target).closest(SELS.CHIPS); $currChips.removeClass('focus'); // Remove active if empty if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) { $currChips.siblings('label').removeClass('active'); } $currChips.siblings('.prefix').removeClass('active'); }); self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { var $target = $(e.target); var $chips = $target.closest(SELS.CHIPS); var chipsLength = $chips.children(SELS.CHIP).length; // enter if (13 === e.which) { // Override enter if autocompleting. if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) { return; } e.preventDefault(); self.addChip({ tag: $target.val() }, $chips); $target.val(''); return; } // delete or left if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) { e.preventDefault(); self.selectChip(chipsLength - 1, $chips); $target.blur(); return; } }); // Click on delete icon in chip. self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) { var $target = $(e.target); var $chips = $target.closest(SELS.CHIPS); var $chip = $target.closest(SELS.CHIP); e.stopPropagation(); self.deleteChip($chip.index(), $chips); $chips.find('input').focus(); }); }; this.chips = function ($chips, chipId) { $chips.empty(); $chips.data('chips').forEach(function (elem) { $chips.append(self.renderChip(elem)); }); $chips.append($('')); self.setPlaceholder($chips); // Set for attribute for label var label = $chips.next('label'); if (label.length) { label.attr('for', chipId); if ($chips.data('chips') !== undefined && $chips.data('chips').length) { label.addClass('active'); } } // Setup autocomplete if needed. var input = $('#' + chipId); if (self.hasAutocomplete) { curr_options.autocompleteOptions.onAutocomplete = function (val) { self.addChip({ tag: val }, $chips); input.val(''); input.focus(); }; input.autocomplete(curr_options.autocompleteOptions); } }; /** * Render chip jQuery element. * @param {Object} elem * @return {jQuery} */ this.renderChip = function (elem) { if (!elem.tag) return; var $renderedChip = $('
    '); $renderedChip.text(elem.tag); if (elem.image) { $renderedChip.prepend($('').attr('src', elem.image)); } $renderedChip.append($('close')); return $renderedChip; }; this.setPlaceholder = function ($chips) { if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) { $chips.find('input').prop('placeholder', curr_options.placeholder); } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) { $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder); } }; this.isValid = function ($chips, elem) { var chips = $chips.data('chips'); var exists = false; for (var i = 0; i < chips.length; i++) { if (chips[i].tag === elem.tag) { exists = true; return; } } return '' !== elem.tag && !exists; }; this.addChip = function (elem, $chips) { if (!self.isValid($chips, elem)) { return; } var $renderedChip = self.renderChip(elem); var newData = []; var oldData = $chips.data('chips'); for (var i = 0; i < oldData.length; i++) { newData.push(oldData[i]); } newData.push(elem); $chips.data('chips', newData); $renderedChip.insertBefore($chips.find('input')); $chips.trigger('chip.add', elem); self.setPlaceholder($chips); }; this.deleteChip = function (chipIndex, $chips) { var chip = $chips.data('chips')[chipIndex]; $chips.find('.chip').eq(chipIndex).remove(); var newData = []; var oldData = $chips.data('chips'); for (var i = 0; i < oldData.length; i++) { if (i !== chipIndex) { newData.push(oldData[i]); } } $chips.data('chips', newData); $chips.trigger('chip.delete', chip); self.setPlaceholder($chips); }; this.selectChip = function (chipIndex, $chips) { var $chip = $chips.find('.chip').eq(chipIndex); if ($chip && false === $chip.hasClass('selected')) { $chip.addClass('selected'); $chips.trigger('chip.select', $chips.data('chips')[chipIndex]); } }; this.getChipsElement = function (index, $chips) { return $chips.eq(index); }; // init this.init(); this.handleEvents(); }; })(jQuery); ;(function ($) { $.fn.pushpin = function (options) { // Defaults var defaults = { top: 0, bottom: Infinity, offset: 0 }; // Remove pushpin event and classes if (options === "remove") { this.each(function () { if (id = $(this).data('pushpin-id')) { $(window).off('scroll.' + id); $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style'); } }); return false; } options = $.extend(defaults, options); $index = 0; return this.each(function () { var $uniqueId = Materialize.guid(), $this = $(this), $original_offset = $(this).offset().top; function removePinClasses(object) { object.removeClass('pin-top'); object.removeClass('pinned'); object.removeClass('pin-bottom'); } function updateElements(objects, scrolled) { objects.each(function () { // Add position fixed (because its between top and bottom) if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) { removePinClasses($(this)); $(this).css('top', options.offset); $(this).addClass('pinned'); } // Add pin-top (when scrolled position is above top) if (scrolled < options.top && !$(this).hasClass('pin-top')) { removePinClasses($(this)); $(this).css('top', 0); $(this).addClass('pin-top'); } // Add pin-bottom (when scrolled position is below bottom) if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) { removePinClasses($(this)); $(this).addClass('pin-bottom'); $(this).css('top', options.bottom - $original_offset); } }); } $(this).data('pushpin-id', $uniqueId); updateElements($this, $(window).scrollTop()); $(window).on('scroll.' + $uniqueId, function () { var $scrolled = $(window).scrollTop() + options.offset; updateElements($this, $scrolled); }); }); }; })(jQuery);;(function ($) { $(document).ready(function () { // jQuery reverse $.fn.reverse = [].reverse; // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs! $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { var $this = $(this); openFABMenu($this); }); $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { var $this = $(this); closeFABMenu($this); }); // Toggle-on-click behaviour. $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) { var $this = $(this); var $menu = $this.parent(); if ($menu.hasClass('active')) { closeFABMenu($menu); } else { openFABMenu($menu); } }); // Toolbar transition behaviour. $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) { var $this = $(this); var $menu = $this.parent(); FABtoToolbar($menu); }); }); $.fn.extend({ openFAB: function () { openFABMenu($(this)); }, closeFAB: function () { closeFABMenu($(this)); }, openToolbar: function () { FABtoToolbar($(this)); }, closeToolbar: function () { toolbarToFAB($(this)); } }); var openFABMenu = function (btn) { var $this = btn; if ($this.hasClass('active') === false) { // Get direction option var horizontal = $this.hasClass('horizontal'); var offsetY, offsetX; if (horizontal === true) { offsetX = 40; } else { offsetY = 40; } $this.addClass('active'); $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 }); var time = 0; $this.find('ul .btn-floating').reverse().each(function () { $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time }); time += 40; }); } }; var closeFABMenu = function (btn) { var $this = btn; // Get direction option var horizontal = $this.hasClass('horizontal'); var offsetY, offsetX; if (horizontal === true) { offsetX = 40; } else { offsetY = 40; } $this.removeClass('active'); var time = 0; $this.find('ul .btn-floating').velocity("stop", true); $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 }); }; /** * Transform FAB into toolbar * @param {Object} object jQuery object */ var FABtoToolbar = function (btn) { if (btn.attr('data-open') === "true") { return; } var offsetX, offsetY, scaleFactor; var windowWidth = window.innerWidth; var windowHeight = window.innerHeight; var btnRect = btn[0].getBoundingClientRect(); var anchor = btn.find('> a').first(); var menu = btn.find('> ul').first(); var backdrop = $('
    '); var fabColor = anchor.css('background-color'); anchor.append(backdrop); offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2; offsetY = windowHeight - btnRect.bottom; scaleFactor = windowWidth / backdrop.width(); btn.attr('data-origin-bottom', btnRect.bottom); btn.attr('data-origin-left', btnRect.left); btn.attr('data-origin-width', btnRect.width); // Set initial state btn.addClass('active'); btn.attr('data-open', true); btn.css({ 'text-align': 'center', width: '100%', bottom: 0, left: 0, transform: 'translateX(' + offsetX + 'px)', transition: 'none' }); anchor.css({ transform: 'translateY(' + -offsetY + 'px)', transition: 'none' }); backdrop.css({ 'background-color': fabColor }); setTimeout(function () { btn.css({ transform: '', transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s' }); anchor.css({ overflow: 'visible', transform: '', transition: 'transform .2s' }); setTimeout(function () { btn.css({ overflow: 'hidden', 'background-color': fabColor }); backdrop.css({ transform: 'scale(' + scaleFactor + ')', transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' }); menu.find('> li > a').css({ opacity: 1 }); // Scroll to close. $(window).on('scroll.fabToolbarClose', function () { toolbarToFAB(btn); $(window).off('scroll.fabToolbarClose'); $(document).off('click.fabToolbarClose'); }); $(document).on('click.fabToolbarClose', function (e) { if (!$(e.target).closest(menu).length) { toolbarToFAB(btn); $(window).off('scroll.fabToolbarClose'); $(document).off('click.fabToolbarClose'); } }); }, 100); }, 0); }; /** * Transform toolbar back into FAB * @param {Object} object jQuery object */ var toolbarToFAB = function (btn) { if (btn.attr('data-open') !== "true") { return; } var offsetX, offsetY, scaleFactor; var windowWidth = window.innerWidth; var windowHeight = window.innerHeight; var btnWidth = btn.attr('data-origin-width'); var btnBottom = btn.attr('data-origin-bottom'); var btnLeft = btn.attr('data-origin-left'); var anchor = btn.find('> .btn-floating').first(); var menu = btn.find('> ul').first(); var backdrop = btn.find('.fab-backdrop'); var fabColor = anchor.css('background-color'); offsetX = btnLeft - windowWidth / 2 + btnWidth / 2; offsetY = windowHeight - btnBottom; scaleFactor = windowWidth / backdrop.width(); // Hide backdrop btn.removeClass('active'); btn.attr('data-open', false); btn.css({ 'background-color': 'transparent', transition: 'none' }); anchor.css({ transition: 'none' }); backdrop.css({ transform: 'scale(0)', 'background-color': fabColor }); menu.find('> li > a').css({ opacity: '' }); setTimeout(function () { backdrop.remove(); // Set initial state. btn.css({ 'text-align': '', width: '', bottom: '', left: '', overflow: '', 'background-color': '', transform: 'translate3d(' + -offsetX + 'px,0,0)' }); anchor.css({ overflow: '', transform: 'translate3d(0,' + offsetY + 'px,0)' }); setTimeout(function () { btn.css({ transform: 'translate3d(0,0,0)', transition: 'transform .2s' }); anchor.css({ transform: 'translate3d(0,0,0)', transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' }); }, 20); }, 200); }; })(jQuery); ;(function ($) { // Image transition function Materialize.fadeInImage = function (selectorOrEl) { var element; if (typeof selectorOrEl === 'string') { element = $(selectorOrEl); } else if (typeof selectorOrEl === 'object') { element = selectorOrEl; } else { return; } element.css({ opacity: 0 }); $(element).velocity({ opacity: 1 }, { duration: 650, queue: false, easing: 'easeOutSine' }); $(element).velocity({ opacity: 1 }, { duration: 1300, queue: false, easing: 'swing', step: function (now, fx) { fx.start = 100; var grayscale_setting = now / 100; var brightness_setting = 150 - (100 - now) / 1.75; if (brightness_setting < 100) { brightness_setting = 100; } if (now >= 0) { $(this).css({ "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)", "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)" }); } } }); }; // Horizontal staggered list Materialize.showStaggeredList = function (selectorOrEl) { var element; if (typeof selectorOrEl === 'string') { element = $(selectorOrEl); } else if (typeof selectorOrEl === 'object') { element = selectorOrEl; } else { return; } var time = 0; element.find('li').velocity({ translateX: "-100px" }, { duration: 0 }); element.find('li').each(function () { $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] }); time += 120; }); }; $(document).ready(function () { // Hardcoded .staggered-list scrollFire // var staggeredListOptions = []; // $('ul.staggered-list').each(function (i) { // var label = 'scrollFire-' + i; // $(this).addClass(label); // staggeredListOptions.push( // {selector: 'ul.staggered-list.' + label, // offset: 200, // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'}); // }); // scrollFire(staggeredListOptions); // HammerJS, Swipe navigation // Touch Event var swipeLeft = false; var swipeRight = false; // Dismissible Collections $('.dismissable').each(function () { $(this).hammer({ prevent_default: false }).on('pan', function (e) { if (e.gesture.pointerType === "touch") { var $this = $(this); var direction = e.gesture.direction; var x = e.gesture.deltaX; var velocityX = e.gesture.velocityX; $this.velocity({ translateX: x }, { duration: 50, queue: false, easing: 'easeOutQuad' }); // Swipe Left if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) { swipeLeft = true; } // Swipe Right if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) { swipeRight = true; } } }).on('panend', function (e) { // Reset if collection is moved back into original position if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) { swipeRight = false; swipeLeft = false; } if (e.gesture.pointerType === "touch") { var $this = $(this); if (swipeLeft || swipeRight) { var fullWidth; if (swipeLeft) { fullWidth = $this.innerWidth(); } else { fullWidth = -1 * $this.innerWidth(); } $this.velocity({ translateX: fullWidth }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () { $this.css('border', 'none'); $this.velocity({ height: 0, padding: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { $this.remove(); } }); } }); } else { $this.velocity({ translateX: 0 }, { duration: 100, queue: false, easing: 'easeOutQuad' }); } swipeLeft = false; swipeRight = false; } }); }); // time = 0 // // Vertical Staggered list // $('ul.staggered-list.vertical li').velocity( // { translateY: "100px"}, // { duration: 0 }); // $('ul.staggered-list.vertical li').each(function() { // $(this).velocity( // { opacity: "1", translateY: "0"}, // { duration: 800, delay: time, easing: [60, 25] }); // time += 120; // }); // // Fade in and Scale // $('.fade-in.scale').velocity( // { scaleX: .4, scaleY: .4, translateX: -600}, // { duration: 0}); // $('.fade-in').each(function() { // $(this).velocity( // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0}, // { duration: 800, easing: [60, 10] }); // }); }); })(jQuery); ;(function ($) { var scrollFireEventsHandled = false; // Input: Array of JSON objects {selector, offset, callback} Materialize.scrollFire = function (options) { var onScroll = function () { var windowScroll = window.pageYOffset + window.innerHeight; for (var i = 0; i < options.length; i++) { // Get options from each line var value = options[i]; var selector = value.selector, offset = value.offset, callback = value.callback; var currentElement = document.querySelector(selector); if (currentElement !== null) { var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset; if (windowScroll > elementOffset + offset) { if (value.done !== true) { if (typeof callback === 'function') { callback.call(this, currentElement); } else if (typeof callback === 'string') { var callbackFunc = new Function(callback); callbackFunc(currentElement); } value.done = true; } } } } }; var throttledScroll = Materialize.throttle(function () { onScroll(); }, options.throttle || 100); if (!scrollFireEventsHandled) { window.addEventListener("scroll", throttledScroll); window.addEventListener("resize", throttledScroll); scrollFireEventsHandled = true; } // perform a scan once, after current execution context, and after dom is ready setTimeout(throttledScroll, 0); }; })(jQuery); ; /*! * pickadate.js v3.5.0, 2014/04/13 * By Amsul, http://amsul.ca * Hosted on http://amsul.github.io/pickadate.js * Licensed under MIT */ (function (factory) { Materialize.Picker = factory(jQuery); })(function ($) { var $window = $(window); var $document = $(document); var $html = $(document.documentElement); /** * The picker constructor that creates a blank picker. */ function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) { // If there’s no element, return the picker constructor. if (!ELEMENT) return PickerConstructor; var IS_DEFAULT_THEME = false, // The state of the picker. STATE = { id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date())) }, // Merge the defaults and options passed. SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {}, // Merge the default classes with the settings classes. CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass), // The element node wrapper into a jQuery object. $ELEMENT = $(ELEMENT), // Pseudo picker constructor. PickerInstance = function () { return this.start(); }, // The picker prototype. P = PickerInstance.prototype = { constructor: PickerInstance, $node: $ELEMENT, /** * Initialize everything */ start: function () { // If it’s already started, do nothing. if (STATE && STATE.start) return P; // Update the picker states. STATE.methods = {}; STATE.start = true; STATE.open = false; STATE.type = ELEMENT.type; // Confirm focus state, convert into text input to remove UA stylings, // and set as readonly to prevent keyboard popup. ELEMENT.autofocus = ELEMENT == getActiveElement(); ELEMENT.readOnly = !SETTINGS.editable; ELEMENT.id = ELEMENT.id || STATE.id; if (ELEMENT.type != 'text') { ELEMENT.type = 'text'; } // Create a new picker component with the settings. P.component = new COMPONENT(P, SETTINGS); // Create the picker root with a holder and then prepare it. P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"')); prepareElementRoot(); // If there’s a format for the hidden input element, create the element. if (SETTINGS.formatSubmit) { prepareElementHidden(); } // Prepare the input element. prepareElement(); // Insert the root as specified in the settings. if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root); // Bind the default component and settings events. P.on({ start: P.component.onStart, render: P.component.onRender, stop: P.component.onStop, open: P.component.onOpen, close: P.component.onClose, set: P.component.onSet }).on({ start: SETTINGS.onStart, render: SETTINGS.onRender, stop: SETTINGS.onStop, open: SETTINGS.onOpen, close: SETTINGS.onClose, set: SETTINGS.onSet }); // Once we’re all set, check the theme in use. IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]); // If the element has autofocus, open the picker. if (ELEMENT.autofocus) { P.open(); } // Trigger queued the “start” and “render” events. return P.trigger('start').trigger('render'); }, //start /** * Render a new picker */ render: function (entireComponent) { // Insert a new component holder in the root or box. if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open)); // Trigger the queued “render” events. return P.trigger('render'); }, //render /** * Destroy everything */ stop: function () { // If it’s already stopped, do nothing. if (!STATE.start) return P; // Then close the picker. P.close(); // Remove the hidden field. if (P._hidden) { P._hidden.parentNode.removeChild(P._hidden); } // Remove the root. P.$root.remove(); // Remove the input class, remove the stored data, and unbind // the events (after a tick for IE - see `P.close`). $ELEMENT.removeClass(CLASSES.input).removeData(NAME); setTimeout(function () { $ELEMENT.off('.' + STATE.id); }, 0); // Restore the element state ELEMENT.type = STATE.type; ELEMENT.readOnly = false; // Trigger the queued “stop” events. P.trigger('stop'); // Reset the picker states. STATE.methods = {}; STATE.start = false; return P; }, //stop /** * Open up the picker */ open: function (dontGiveFocus) { // If it’s already open, do nothing. if (STATE.open) return P; // Add the “active” class. $ELEMENT.addClass(CLASSES.active); aria(ELEMENT, 'expanded', true); // * A Firefox bug, when `html` has `overflow:hidden`, results in // killing transitions :(. So add the “opened” state on the next tick. // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 setTimeout(function () { // Add the “opened” class to the picker root. P.$root.addClass(CLASSES.opened); aria(P.$root[0], 'hidden', false); }, 0); // If we have to give focus, bind the element and doc events. if (dontGiveFocus !== false) { // Set it as open. STATE.open = true; // Prevent the page from scrolling. if (IS_DEFAULT_THEME) { $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth()); } // Pass focus to the root element’s jQuery object. // * Workaround for iOS8 to bring the picker’s root into view. P.$root.eq(0).focus(); // Bind the document events. $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) { var target = event.target; // If the target of the event is not the element, close the picker picker. // * Don’t worry about clicks or focusins on the root because those don’t bubble up. // Also, for Firefox, a click on an `option` element bubbles up directly // to the doc. So make sure the target wasn't the doc. // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling, // which causes the picker to unexpectedly close when right-clicking it. So make // sure the event wasn’t a right-click. if (target != ELEMENT && target != document && event.which != 3) { // If the target was the holder that covers the screen, // keep the element focused to maintain tabindex. P.close(target === P.$root.children()[0]); } }).on('keydown.' + STATE.id, function (event) { var // Get the keycode. keycode = event.keyCode, // Translate that to a selection change. keycodeToMove = P.component.key[keycode], // Grab the target. target = event.target; // On escape, close the picker and give focus. if (keycode == 27) { P.close(true); } // Check if there is a key movement or “enter” keypress on the element. else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) { // Prevent the default action to stop page movement. event.preventDefault(); // Trigger the key movement action. if (keycodeToMove) { PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]); } // On “enter”, if the highlighted item isn’t disabled, set the value and close. else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) { P.set('select', P.component.item.highlight); if (SETTINGS.closeOnSelect) { P.close(true); } } } // If the target is within the root and “enter” is pressed, // prevent the default action and trigger a click on the target instead. else if ($.contains(P.$root[0], target) && keycode == 13) { event.preventDefault(); target.click(); } }); } // Trigger the queued “open” events. return P.trigger('open'); }, //open /** * Close the picker */ close: function (giveFocus) { // If we need to give focus, do it before changing states. if (giveFocus) { // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :| // The focus is triggered *after* the close has completed - causing it // to open again. So unbind and rebind the event at the next tick. P.$root.off('focus.toOpen').eq(0).focus(); setTimeout(function () { P.$root.on('focus.toOpen', handleFocusToOpenEvent); }, 0); } // Remove the “active” class. $ELEMENT.removeClass(CLASSES.active); aria(ELEMENT, 'expanded', false); // * A Firefox bug, when `html` has `overflow:hidden`, results in // killing transitions :(. So remove the “opened” state on the next tick. // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 setTimeout(function () { // Remove the “opened” and “focused” class from the picker root. P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused); aria(P.$root[0], 'hidden', true); }, 0); // If it’s already closed, do nothing more. if (!STATE.open) return P; // Set it as closed. STATE.open = false; // Allow the page to scroll. if (IS_DEFAULT_THEME) { $html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth()); } // Unbind the document events. $document.off('.' + STATE.id); // Trigger the queued “close” events. return P.trigger('close'); }, //close /** * Clear the values */ clear: function (options) { return P.set('clear', null, options); }, //clear /** * Set something */ set: function (thing, value, options) { var thingItem, thingValue, thingIsObject = $.isPlainObject(thing), thingObject = thingIsObject ? thing : {}; // Make sure we have usable options. options = thingIsObject && $.isPlainObject(value) ? value : options || {}; if (thing) { // If the thing isn’t an object, make it one. if (!thingIsObject) { thingObject[thing] = value; } // Go through the things of items to set. for (thingItem in thingObject) { // Grab the value of the thing. thingValue = thingObject[thingItem]; // First, if the item exists and there’s a value, set it. if (thingItem in P.component.item) { if (thingValue === undefined) thingValue = null; P.component.set(thingItem, thingValue, options); } // Then, check to update the element value and broadcast a change. if (thingItem == 'select' || thingItem == 'clear') { $ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change'); } } // Render a new picker. P.render(); } // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`. return options.muted ? P : P.trigger('set', thingObject); }, //set /** * Get something */ get: function (thing, format) { // Make sure there’s something to get. thing = thing || 'value'; // If a picker state exists, return that. if (STATE[thing] != null) { return STATE[thing]; } // Return the submission value, if that. if (thing == 'valueSubmit') { if (P._hidden) { return P._hidden.value; } thing = 'value'; } // Return the value, if that. if (thing == 'value') { return ELEMENT.value; } // Check if a component item exists, return that. if (thing in P.component.item) { if (typeof format == 'string') { var thingValue = P.component.get(thing); return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : ''; } return P.component.get(thing); } }, //get /** * Bind events on the things. */ on: function (thing, method, internal) { var thingName, thingMethod, thingIsObject = $.isPlainObject(thing), thingObject = thingIsObject ? thing : {}; if (thing) { // If the thing isn’t an object, make it one. if (!thingIsObject) { thingObject[thing] = method; } // Go through the things to bind to. for (thingName in thingObject) { // Grab the method of the thing. thingMethod = thingObject[thingName]; // If it was an internal binding, prefix it. if (internal) { thingName = '_' + thingName; } // Make sure the thing methods collection exists. STATE.methods[thingName] = STATE.methods[thingName] || []; // Add the method to the relative method collection. STATE.methods[thingName].push(thingMethod); } } return P; }, //on /** * Unbind events on the things. */ off: function () { var i, thingName, names = arguments; for (i = 0, namesCount = names.length; i < namesCount; i += 1) { thingName = names[i]; if (thingName in STATE.methods) { delete STATE.methods[thingName]; } } return P; }, /** * Fire off method events. */ trigger: function (name, data) { var _trigger = function (name) { var methodList = STATE.methods[name]; if (methodList) { methodList.map(function (method) { PickerConstructor._.trigger(method, P, [data]); }); } }; _trigger('_' + name); _trigger(name); return P; } //trigger //PickerInstance.prototype /** * Wrap the picker holder components together. */ };function createWrappedComponent() { // Create a picker wrapper holder return PickerConstructor._.node('div', // Create a picker wrapper node PickerConstructor._.node('div', // Create a picker frame PickerConstructor._.node('div', // Create a picker box node PickerConstructor._.node('div', // Create the components nodes. P.component.nodes(STATE.open), // The picker box class CLASSES.box), // Picker wrap class CLASSES.wrap), // Picker frame class CLASSES.frame), // Picker holder class CLASSES.holder); //endreturn } //createWrappedComponent /** * Prepare the input element with all bindings. */ function prepareElement() { $ELEMENT. // Store the picker data by component name. data(NAME, P). // Add the “input” class name. addClass(CLASSES.input). // Remove the tabindex. attr('tabindex', -1). // If there’s a `data-value`, update the value of the element. val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value); // Only bind keydown events if the element isn’t editable. if (!SETTINGS.editable) { $ELEMENT. // On focus/click, focus onto the root to open it up. on('focus.' + STATE.id + ' click.' + STATE.id, function (event) { event.preventDefault(); P.$root.eq(0).focus(); }). // Handle keyboard event based on the picker being opened or not. on('keydown.' + STATE.id, handleKeydownEvent); } // Update the aria attributes. aria(ELEMENT, { haspopup: true, expanded: false, readonly: false, owns: ELEMENT.id + '_root' }); } /** * Prepare the root picker element with all bindings. */ function prepareElementRoot() { P.$root.on({ // For iOS8. keydown: handleKeydownEvent, // When something within the root is focused, stop from bubbling // to the doc and remove the “focused” state from the root. focusin: function (event) { P.$root.removeClass(CLASSES.focused); event.stopPropagation(); }, // When something within the root holder is clicked, stop it // from bubbling to the doc. 'mousedown click': function (event) { var target = event.target; // Make sure the target isn’t the root holder so it can bubble up. if (target != P.$root.children()[0]) { event.stopPropagation(); // * For mousedown events, cancel the default action in order to // prevent cases where focus is shifted onto external elements // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120). // Also, for Firefox, don’t prevent action on the `option` element. if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) { event.preventDefault(); // Re-focus onto the root so that users can click away // from elements focused within the picker. P.$root.eq(0).focus(); } } } }). // Add/remove the “target” class on focus and blur. on({ focus: function () { $ELEMENT.addClass(CLASSES.target); }, blur: function () { $ELEMENT.removeClass(CLASSES.target); } }). // Open the picker and adjust the root “focused” state on('focus.toOpen', handleFocusToOpenEvent). // If there’s a click on an actionable element, carry out the actions. on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () { var $target = $(this), targetData = $target.data(), targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled), // * For IE, non-focusable elements can be active elements as well // (http://stackoverflow.com/a/2684561). activeElement = getActiveElement(); activeElement = activeElement && (activeElement.type || activeElement.href); // If it’s disabled or nothing inside is actively focused, re-focus the element. if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) { P.$root.eq(0).focus(); } // If something is superficially changed, update the `highlight` based on the `nav`. if (!targetDisabled && targetData.nav) { P.set('highlight', P.component.item.highlight, { nav: targetData.nav }); } // If something is picked, set `select` then close with focus. else if (!targetDisabled && 'pick' in targetData) { P.set('select', targetData.pick); if (SETTINGS.closeOnSelect) { P.close(true); } } // If a “clear” button is pressed, empty the values and close with focus. else if (targetData.clear) { P.clear(); if (SETTINGS.closeOnSelect) { P.close(true); } } else if (targetData.close) { P.close(true); } }); //P.$root aria(P.$root[0], 'hidden', true); } /** * Prepare the hidden input element along with all bindings. */ function prepareElementHidden() { var name; if (SETTINGS.hiddenName === true) { name = ELEMENT.name; ELEMENT.name = ''; } else { name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit']; name = name[0] + ELEMENT.name + name[1]; } P._hidden = $('')[0]; $ELEMENT. // If the value changes, update the hidden input with the correct format. on('change.' + STATE.id, function () { P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : ''; }); // Insert the hidden input as specified in the settings. if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden); } // For iOS8. function handleKeydownEvent(event) { var keycode = event.keyCode, // Check if one of the delete keys was pressed. isKeycodeDelete = /^(8|46)$/.test(keycode); // For some reason IE clears the input value on “escape”. if (keycode == 27) { P.close(); return false; } // Check if `space` or `delete` was pressed or the picker is closed with a key movement. if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) { // Prevent it from moving the page and bubbling to doc. event.preventDefault(); event.stopPropagation(); // If `delete` was pressed, clear the values and close the picker. // Otherwise open the picker. if (isKeycodeDelete) { P.clear().close(); } else { P.open(); } } } // Separated for IE function handleFocusToOpenEvent(event) { // Stop the event from propagating to the doc. event.stopPropagation(); // If it’s a focus event, add the “focused” class to the root. if (event.type == 'focus') { P.$root.addClass(CLASSES.focused); } // And then finally open the picker. P.open(); } // Return a new picker instance. return new PickerInstance(); } //PickerConstructor /** * The default classes and prefix to use for the HTML classes. */ PickerConstructor.klasses = function (prefix) { prefix = prefix || 'picker'; return { picker: prefix, opened: prefix + '--opened', focused: prefix + '--focused', input: prefix + '__input', active: prefix + '__input--active', target: prefix + '__input--target', holder: prefix + '__holder', frame: prefix + '__frame', wrap: prefix + '__wrap', box: prefix + '__box' }; }; //PickerConstructor.klasses /** * Check if the default theme is being used. */ function isUsingDefaultTheme(element) { var theme, prop = 'position'; // For IE. if (element.currentStyle) { theme = element.currentStyle[prop]; } // For normal browsers. else if (window.getComputedStyle) { theme = getComputedStyle(element)[prop]; } return theme == 'fixed'; } /** * Get the width of the browser’s scrollbar. * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js */ function getScrollbarWidth() { if ($html.height() <= $window.height()) { return 0; } var $outer = $('
    ').appendTo('body'); // Get the width without scrollbars. var widthWithoutScroll = $outer[0].offsetWidth; // Force adding scrollbars. $outer.css('overflow', 'scroll'); // Add the inner div. var $inner = $('
    ').appendTo($outer); // Get the width with scrollbars. var widthWithScroll = $inner[0].offsetWidth; // Remove the divs. $outer.remove(); // Return the difference between the widths. return widthWithoutScroll - widthWithScroll; } /** * PickerConstructor helper methods. */ PickerConstructor._ = { /** * Create a group of nodes. Expects: * ` { min: {Integer}, max: {Integer}, i: {Integer}, node: {String}, item: {Function} } * ` */ group: function (groupObject) { var // Scope for the looped object loopObjectScope, // Create the nodes list nodesList = '', // The counter starts from the `min` counter = PickerConstructor._.trigger(groupObject.min, groupObject); // Loop from the `min` to `max`, incrementing by `i` for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) { // Trigger the `item` function within scope of the object loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]); // Splice the subgroup and create nodes out of the sub nodes nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node loopObjectScope[1], // the classes loopObjectScope[2] // the attributes ); } // Return the list of nodes return nodesList; }, //group /** * Create a dom node string */ node: function (wrapper, item, klass, attribute) { // If the item is false-y, just return an empty string if (!item) return ''; // If the item is an array, do a join item = $.isArray(item) ? item.join('') : item; // Check for the class klass = klass ? ' class="' + klass + '"' : ''; // Check for any attributes attribute = attribute ? ' ' + attribute : ''; // Return the wrapped item return '<' + wrapper + klass + attribute + '>' + item + ''; }, //node /** * Lead numbers below 10 with a zero. */ lead: function (number) { return (number < 10 ? '0' : '') + number; }, /** * Trigger a function otherwise return the value. */ trigger: function (callback, scope, args) { return typeof callback == 'function' ? callback.apply(scope, args || []) : callback; }, /** * If the second character is a digit, length is 2 otherwise 1. */ digits: function (string) { return (/\d/.test(string[1]) ? 2 : 1 ); }, /** * Tell if something is a date object. */ isDate: function (value) { return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate()); }, /** * Tell if something is an integer. */ isInteger: function (value) { return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0; }, /** * Create ARIA attribute strings. */ ariaAttr: ariaAttr //PickerConstructor._ /** * Extend the picker with a component and defaults. */ };PickerConstructor.extend = function (name, Component) { // Extend jQuery. $.fn[name] = function (options, action) { // Grab the component data. var componentData = this.data(name); // If the picker is requested, return the data object. if (options == 'picker') { return componentData; } // If the component data exists and `options` is a string, carry out the action. if (componentData && typeof options == 'string') { return PickerConstructor._.trigger(componentData[options], componentData, [action]); } // Otherwise go through each matched element and if the component // doesn’t exist, create a new picker using `this` element // and merging the defaults and options with a deep copy. return this.each(function () { var $this = $(this); if (!$this.data(name)) { new PickerConstructor(this, name, Component, options); } }); }; // Set the defaults. $.fn[name].defaults = Component.defaults; }; //PickerConstructor.extend function aria(element, attribute, value) { if ($.isPlainObject(attribute)) { for (var key in attribute) { ariaSet(element, key, attribute[key]); } } else { ariaSet(element, attribute, value); } } function ariaSet(element, attribute, value) { element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value); } function ariaAttr(attribute, data) { if (!$.isPlainObject(attribute)) { attribute = { attribute: data }; } data = ''; for (var key in attribute) { var attr = (key == 'role' ? '' : 'aria-') + key, attrVal = attribute[key]; data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'; } return data; } // IE8 bug throws an error for activeElements within iframes. function getActiveElement() { try { return document.activeElement; } catch (err) {} } // Expose the picker constructor. return PickerConstructor; }); ; /*! * Date picker for pickadate.js v3.5.0 * http://amsul.github.io/pickadate.js/date.htm */ (function (factory) { factory(Materialize.Picker, jQuery); })(function (Picker, $) { /** * Globals and constants */ var DAYS_IN_WEEK = 7, WEEKS_IN_CALENDAR = 6, _ = Picker._; /** * The date picker constructor */ function DatePicker(picker, settings) { var calendar = this, element = picker.$node[0], elementValue = element.value, elementDataValue = picker.$node.data('value'), valueString = elementDataValue || elementValue, formatString = elementDataValue ? settings.formatSubmit : settings.format, isRTL = function () { return element.currentStyle ? // For IE. element.currentStyle.direction == 'rtl' : // For normal browsers. getComputedStyle(picker.$root[0]).direction == 'rtl'; }; calendar.settings = settings; calendar.$node = picker.$node; // The queue of methods that will be used to build item objects. calendar.queue = { min: 'measure create', max: 'measure create', now: 'now create', select: 'parse create validate', highlight: 'parse navigate create validate', view: 'parse create validate viewset', disable: 'deactivate', enable: 'activate' // The component's item object. };calendar.item = {}; calendar.item.clear = null; calendar.item.disable = (settings.disable || []).slice(0); calendar.item.enable = -function (collectionDisabled) { return collectionDisabled[0] === true ? collectionDisabled.shift() : -1; }(calendar.item.disable); calendar.set('min', settings.min).set('max', settings.max).set('now'); // When there’s a value, set the `select`, which in turn // also sets the `highlight` and `view`. if (valueString) { calendar.set('select', valueString, { format: formatString }); } // If there’s no value, default to highlighting “today”. else { calendar.set('select', null).set('highlight', calendar.item.now); } // The keycode to movement mapping. calendar.key = { 40: 7, // Down 38: -7, // Up 39: function () { return isRTL() ? -1 : 1; }, // Right 37: function () { return isRTL() ? 1 : -1; }, // Left go: function (timeChange) { var highlightedObject = calendar.item.highlight, targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange); calendar.set('highlight', targetDate, { interval: timeChange }); this.render(); } // Bind some picker events. };picker.on('render', function () { picker.$root.find('.' + settings.klass.selectMonth).on('change', function () { var value = this.value; if (value) { picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]); picker.$root.find('.' + settings.klass.selectMonth).trigger('focus'); } }); picker.$root.find('.' + settings.klass.selectYear).on('change', function () { var value = this.value; if (value) { picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]); picker.$root.find('.' + settings.klass.selectYear).trigger('focus'); } }); }, 1).on('open', function () { var includeToday = ''; if (calendar.disabled(calendar.get('now'))) { includeToday = ':not(.' + settings.klass.buttonToday + ')'; } picker.$root.find('button' + includeToday + ', select').attr('disabled', false); }, 1).on('close', function () { picker.$root.find('button, select').attr('disabled', true); }, 1); } //DatePicker /** * Set a datepicker item object. */ DatePicker.prototype.set = function (type, value, options) { var calendar = this, calendarItem = calendar.item; // If the value is `null` just set it immediately. if (value === null) { if (type == 'clear') type = 'select'; calendarItem[type] = value; return calendar; } // Otherwise go through the queue of methods, and invoke the functions. // Update this as the time unit, and set the final value as this item. // * In the case of `enable`, keep the queue but set `disable` instead. // And in the case of `flip`, keep the queue but set `enable` instead. calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) { value = calendar[method](type, value, options); return value; }).pop(); // Check if we need to cascade through more updates. if (type == 'select') { calendar.set('highlight', calendarItem.select, options); } else if (type == 'highlight') { calendar.set('view', calendarItem.highlight, options); } else if (type.match(/^(flip|min|max|disable|enable)$/)) { if (calendarItem.select && calendar.disabled(calendarItem.select)) { calendar.set('select', calendarItem.select, options); } if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) { calendar.set('highlight', calendarItem.highlight, options); } } return calendar; }; //DatePicker.prototype.set /** * Get a datepicker item object. */ DatePicker.prototype.get = function (type) { return this.item[type]; }; //DatePicker.prototype.get /** * Create a picker date object. */ DatePicker.prototype.create = function (type, value, options) { var isInfiniteValue, calendar = this; // If there’s no value, use the type as the value. value = value === undefined ? type : value; // If it’s infinity, update the value. if (value == -Infinity || value == Infinity) { isInfiniteValue = value; } // If it’s an object, use the native date object. else if ($.isPlainObject(value) && _.isInteger(value.pick)) { value = value.obj; } // If it’s an array, convert it into a date and make sure // that it’s a valid date – otherwise default to today. else if ($.isArray(value)) { value = new Date(value[0], value[1], value[2]); value = _.isDate(value) ? value : calendar.create().obj; } // If it’s a number or date object, make a normalized date. else if (_.isInteger(value) || _.isDate(value)) { value = calendar.normalize(new Date(value), options); } // If it’s a literal true or any other case, set it to now. else /*if ( value === true )*/{ value = calendar.now(type, value, options); } // Return the compiled object. return { year: isInfiniteValue || value.getFullYear(), month: isInfiniteValue || value.getMonth(), date: isInfiniteValue || value.getDate(), day: isInfiniteValue || value.getDay(), obj: isInfiniteValue || value, pick: isInfiniteValue || value.getTime() }; }; //DatePicker.prototype.create /** * Create a range limit object using an array, date object, * literal “true”, or integer relative to another time. */ DatePicker.prototype.createRange = function (from, to) { var calendar = this, createDate = function (date) { if (date === true || $.isArray(date) || _.isDate(date)) { return calendar.create(date); } return date; }; // Create objects if possible. if (!_.isInteger(from)) { from = createDate(from); } if (!_.isInteger(to)) { to = createDate(to); } // Create relative dates. if (_.isInteger(from) && $.isPlainObject(to)) { from = [to.year, to.month, to.date + from]; } else if (_.isInteger(to) && $.isPlainObject(from)) { to = [from.year, from.month, from.date + to]; } return { from: createDate(from), to: createDate(to) }; }; //DatePicker.prototype.createRange /** * Check if a date unit falls within a date range object. */ DatePicker.prototype.withinRange = function (range, dateUnit) { range = this.createRange(range.from, range.to); return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick; }; /** * Check if two date range objects overlap. */ DatePicker.prototype.overlapRanges = function (one, two) { var calendar = this; // Convert the ranges into comparable dates. one = calendar.createRange(one.from, one.to); two = calendar.createRange(two.from, two.to); return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to); }; /** * Get the date today. */ DatePicker.prototype.now = function (type, value, options) { value = new Date(); if (options && options.rel) { value.setDate(value.getDate() + options.rel); } return this.normalize(value, options); }; /** * Navigate to next/prev month. */ DatePicker.prototype.navigate = function (type, value, options) { var targetDateObject, targetYear, targetMonth, targetDate, isTargetArray = $.isArray(value), isTargetObject = $.isPlainObject(value), viewsetObject = this.item.view; /*, safety = 100*/ if (isTargetArray || isTargetObject) { if (isTargetObject) { targetYear = value.year; targetMonth = value.month; targetDate = value.date; } else { targetYear = +value[0]; targetMonth = +value[1]; targetDate = +value[2]; } // If we’re navigating months but the view is in a different // month, navigate to the view’s year and month. if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) { targetYear = viewsetObject.year; targetMonth = viewsetObject.month; } // Figure out the expected target year and month. targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1); targetYear = targetDateObject.getFullYear(); targetMonth = targetDateObject.getMonth(); // If the month we’re going to doesn’t have enough days, // keep decreasing the date until we reach the month’s last date. while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) { targetDate -= 1; /*safety -= 1 if ( !safety ) { throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.' }*/ } value = [targetYear, targetMonth, targetDate]; } return value; }; //DatePicker.prototype.navigate /** * Normalize a date by setting the hours to midnight. */ DatePicker.prototype.normalize = function (value /*, options*/) { value.setHours(0, 0, 0, 0); return value; }; /** * Measure the range of dates. */ DatePicker.prototype.measure = function (type, value /*, options*/) { var calendar = this; // If it’s anything false-y, remove the limits. if (!value) { value = type == 'min' ? -Infinity : Infinity; } // If it’s a string, parse it. else if (typeof value == 'string') { value = calendar.parse(type, value); } // If it's an integer, get a date relative to today. else if (_.isInteger(value)) { value = calendar.now(type, value, { rel: value }); } return value; }; ///DatePicker.prototype.measure /** * Create a viewset object based on navigation. */ DatePicker.prototype.viewset = function (type, dateObject /*, options*/) { return this.create([dateObject.year, dateObject.month, 1]); }; /** * Validate a date as enabled and shift if needed. */ DatePicker.prototype.validate = function (type, dateObject, options) { var calendar = this, // Keep a reference to the original date. originalDateObject = dateObject, // Make sure we have an interval. interval = options && options.interval ? options.interval : 1, // Check if the calendar enabled dates are inverted. isFlippedBase = calendar.item.enable === -1, // Check if we have any enabled dates after/before now. hasEnabledBeforeTarget, hasEnabledAfterTarget, // The min & max limits. minLimitObject = calendar.item.min, maxLimitObject = calendar.item.max, // Check if we’ve reached the limit during shifting. reachedMin, reachedMax, // Check if the calendar is inverted and at least one weekday is enabled. hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) { // If there’s a date, check where it is relative to the target. if ($.isArray(value)) { var dateTime = calendar.create(value).pick; if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true; } // Return only integers for enabled weekdays. return _.isInteger(value); }).length; /*, safety = 100*/ // Cases to validate for: // [1] Not inverted and date disabled. // [2] Inverted and some dates enabled. // [3] Not inverted and out of range. // // Cases to **not** validate for: // • Navigating months. // • Not inverted and date enabled. // • Inverted and all dates disabled. // • ..and anything else. if (!options || !options.nav) if ( /* 1 */!isFlippedBase && calendar.disabled(dateObject) || /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) || /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) { // When inverted, flip the direction if there aren’t any enabled weekdays // and there are no enabled dates in the direction of the interval. if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) { interval *= -1; } // Keep looping until we reach an enabled date. while ( /*safety &&*/calendar.disabled(dateObject)) { /*safety -= 1 if ( !safety ) { throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.' }*/ // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval. if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) { dateObject = originalDateObject; interval = interval > 0 ? 1 : -1; } // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit. if (dateObject.pick <= minLimitObject.pick) { reachedMin = true; interval = 1; dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]); } else if (dateObject.pick >= maxLimitObject.pick) { reachedMax = true; interval = -1; dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]); } // If we’ve reached both limits, just break out of the loop. if (reachedMin && reachedMax) { break; } // Finally, create the shifted date using the interval and keep looping. dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]); } } //endif // Return the date object settled on. return dateObject; }; //DatePicker.prototype.validate /** * Check if a date is disabled. */ DatePicker.prototype.disabled = function (dateToVerify) { var calendar = this, // Filter through the disabled dates to check if this is one. isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) { // If the date is a number, match the weekday with 0index and `firstDay` check. if (_.isInteger(dateToDisable)) { return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7; } // If it’s an array or a native JS date, create and match the exact date. if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) { return dateToVerify.pick === calendar.create(dateToDisable).pick; } // If it’s an object, match a date within the “from” and “to” range. if ($.isPlainObject(dateToDisable)) { return calendar.withinRange(dateToDisable, dateToVerify); } }); // If this date matches a disabled date, confirm it’s not inverted. isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) { return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted; }).length; // Check the calendar “enabled” flag and respectively flip the // disabled state. Then also check if it’s beyond the min/max limits. return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick; }; //DatePicker.prototype.disabled /** * Parse a string into a usable type. */ DatePicker.prototype.parse = function (type, value, options) { var calendar = this, parsingObject = {}; // If it’s already parsed, we’re good. if (!value || typeof value != 'string') { return value; } // We need a `.format` to parse the value with. if (!(options && options.format)) { options = options || {}; options.format = calendar.settings.format; } // Convert the format into an array and then map through it. calendar.formats.toArray(options.format).map(function (label) { var // Grab the formatting label. formattingLabel = calendar.formats[label], // The format length is from the formatting label function or the // label length without the escaping exclamation (!) mark. formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length; // If there's a format label, split the value up to the format length. // Then add it to the parsing object with appropriate label. if (formattingLabel) { parsingObject[label] = value.substr(0, formatLength); } // Update the value as the substring from format length to end. value = value.substr(formatLength); }); // Compensate for month 0index. return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d]; }; //DatePicker.prototype.parse /** * Various formats to display the object in. */ DatePicker.prototype.formats = function () { // Return the length of the first word in a collection. function getWordLengthFromCollection(string, collection, dateObject) { // Grab the first word from the string. var word = string.match(/\w+/)[0]; // If there's no month index, add it to the date object if (!dateObject.mm && !dateObject.m) { dateObject.m = collection.indexOf(word) + 1; } // Return the length of the word. return word.length; } // Get the length of the first word in a string. function getFirstWordLength(string) { return string.match(/\w+/)[0].length; } return { d: function (string, dateObject) { // If there's string, then get the digits length. // Otherwise return the selected date. return string ? _.digits(string) : dateObject.date; }, dd: function (string, dateObject) { // If there's a string, then the length is always 2. // Otherwise return the selected date with a leading zero. return string ? 2 : _.lead(dateObject.date); }, ddd: function (string, dateObject) { // If there's a string, then get the length of the first word. // Otherwise return the short selected weekday. return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day]; }, dddd: function (string, dateObject) { // If there's a string, then get the length of the first word. // Otherwise return the full selected weekday. return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day]; }, m: function (string, dateObject) { // If there's a string, then get the length of the digits // Otherwise return the selected month with 0index compensation. return string ? _.digits(string) : dateObject.month + 1; }, mm: function (string, dateObject) { // If there's a string, then the length is always 2. // Otherwise return the selected month with 0index and leading zero. return string ? 2 : _.lead(dateObject.month + 1); }, mmm: function (string, dateObject) { var collection = this.settings.monthsShort; // If there's a string, get length of the relevant month from the short // months collection. Otherwise return the selected month from that collection. return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]; }, mmmm: function (string, dateObject) { var collection = this.settings.monthsFull; // If there's a string, get length of the relevant month from the full // months collection. Otherwise return the selected month from that collection. return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]; }, yy: function (string, dateObject) { // If there's a string, then the length is always 2. // Otherwise return the selected year by slicing out the first 2 digits. return string ? 2 : ('' + dateObject.year).slice(2); }, yyyy: function (string, dateObject) { // If there's a string, then the length is always 4. // Otherwise return the selected year. return string ? 4 : dateObject.year; }, // Create an array by splitting the formatting string passed. toArray: function (formatString) { return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g); }, // Format an object into a string using the formatting options. toString: function (formatString, itemObject) { var calendar = this; return calendar.formats.toArray(formatString).map(function (label) { return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, ''); }).join(''); } }; }(); //DatePicker.prototype.formats /** * Check if two date units are the exact. */ DatePicker.prototype.isDateExact = function (one, two) { var calendar = this; // When we’re working with weekdays, do a direct comparison. if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') { return one === two; } // When we’re working with date representations, compare the “pick” value. if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) { return calendar.create(one).pick === calendar.create(two).pick; } // When we’re working with range objects, compare the “from” and “to”. if ($.isPlainObject(one) && $.isPlainObject(two)) { return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to); } return false; }; /** * Check if two date units overlap. */ DatePicker.prototype.isDateOverlap = function (one, two) { var calendar = this, firstDay = calendar.settings.firstDay ? 1 : 0; // When we’re working with a weekday index, compare the days. if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) { one = one % 7 + firstDay; return one === calendar.create(two).day + 1; } if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) { two = two % 7 + firstDay; return two === calendar.create(one).day + 1; } // When we’re working with range objects, check if the ranges overlap. if ($.isPlainObject(one) && $.isPlainObject(two)) { return calendar.overlapRanges(one, two); } return false; }; /** * Flip the “enabled” state. */ DatePicker.prototype.flipEnable = function (val) { var itemObject = this.item; itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1); }; /** * Mark a collection of dates as “disabled”. */ DatePicker.prototype.deactivate = function (type, datesToDisable) { var calendar = this, disabledItems = calendar.item.disable.slice(0); // If we’re flipping, that’s all we need to do. if (datesToDisable == 'flip') { calendar.flipEnable(); } else if (datesToDisable === false) { calendar.flipEnable(1); disabledItems = []; } else if (datesToDisable === true) { calendar.flipEnable(-1); disabledItems = []; } // Otherwise go through the dates to disable. else { datesToDisable.map(function (unitToDisable) { var matchFound; // When we have disabled items, check for matches. // If something is matched, immediately break out. for (var index = 0; index < disabledItems.length; index += 1) { if (calendar.isDateExact(unitToDisable, disabledItems[index])) { matchFound = true; break; } } // If nothing was found, add the validated unit to the collection. if (!matchFound) { if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) { disabledItems.push(unitToDisable); } } }); } // Return the updated collection. return disabledItems; }; //DatePicker.prototype.deactivate /** * Mark a collection of dates as “enabled”. */ DatePicker.prototype.activate = function (type, datesToEnable) { var calendar = this, disabledItems = calendar.item.disable, disabledItemsCount = disabledItems.length; // If we’re flipping, that’s all we need to do. if (datesToEnable == 'flip') { calendar.flipEnable(); } else if (datesToEnable === true) { calendar.flipEnable(1); disabledItems = []; } else if (datesToEnable === false) { calendar.flipEnable(-1); disabledItems = []; } // Otherwise go through the disabled dates. else { datesToEnable.map(function (unitToEnable) { var matchFound, disabledUnit, index, isExactRange; // Go through the disabled items and try to find a match. for (index = 0; index < disabledItemsCount; index += 1) { disabledUnit = disabledItems[index]; // When an exact match is found, remove it from the collection. if (calendar.isDateExact(disabledUnit, unitToEnable)) { matchFound = disabledItems[index] = null; isExactRange = true; break; } // When an overlapped match is found, add the “inverted” state to it. else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) { if ($.isPlainObject(unitToEnable)) { unitToEnable.inverted = true; matchFound = unitToEnable; } else if ($.isArray(unitToEnable)) { matchFound = unitToEnable; if (!matchFound[3]) matchFound.push('inverted'); } else if (_.isDate(unitToEnable)) { matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted']; } break; } } // If a match was found, remove a previous duplicate entry. if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) { if (calendar.isDateExact(disabledItems[index], unitToEnable)) { disabledItems[index] = null; break; } } // In the event that we’re dealing with an exact range of dates, // make sure there are no “inverted” dates because of it. if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) { if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) { disabledItems[index] = null; break; } } // If something is still matched, add it into the collection. if (matchFound) { disabledItems.push(matchFound); } }); } // Return the updated collection. return disabledItems.filter(function (val) { return val != null; }); }; //DatePicker.prototype.activate /** * Create a string for the nodes in the picker. */ DatePicker.prototype.nodes = function (isOpen) { var calendar = this, settings = calendar.settings, calendarItem = calendar.item, nowObject = calendarItem.now, selectedObject = calendarItem.select, highlightedObject = calendarItem.highlight, viewsetObject = calendarItem.view, disabledCollection = calendarItem.disable, minLimitObject = calendarItem.min, maxLimitObject = calendarItem.max, // Create the calendar table head using a copy of weekday labels collection. // * We do a copy so we don't mutate the original array. tableHead = function (collection, fullCollection) { // If the first day should be Monday, move Sunday to the end. if (settings.firstDay) { collection.push(collection.shift()); fullCollection.push(fullCollection.shift()); } // Create and return the table head group. return _.node('thead', _.node('tr', _.group({ min: 0, max: DAYS_IN_WEEK - 1, i: 1, node: 'th', item: function (counter) { return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"']; } }))); //endreturn // Materialize modified }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)), //tableHead // Create the nav for next/prev month. createMonthNav = function (next) { // Otherwise, return the created month tag. return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + ( // If the focused month is outside the range, disabled the button. next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({ role: 'button', controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn }, //createMonthNav // Create the month label. //Materialize modified createMonthLabel = function (override) { var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull; // Materialize modified if (override == "short_months") { monthsCollection = settings.monthsShort; } // If there are months to select, add a dropdown menu. if (settings.selectMonths && override == undefined) { return _.node('select', _.group({ min: 0, max: 11, i: 1, node: 'option', item: function (loopedMonth) { return [ // The looped month and no classes. monthsCollection[loopedMonth], 0, // Set the value and selected index. 'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')]; } }), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"'); } // Materialize modified if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month]; // If there's a need for a month selector return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month); }, //createMonthLabel // Create the year label. // Materialize modified createYearLabel = function (override) { var focusedYear = viewsetObject.year, // If years selector is set to a literal "true", set it to 5. Otherwise // divide in half to get half before and half after focused year. numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2); // If there are years to select, add a dropdown menu. if (numberYears) { var minYear = minLimitObject.year, maxYear = maxLimitObject.year, lowestYear = focusedYear - numberYears, highestYear = focusedYear + numberYears; // If the min year is greater than the lowest year, increase the highest year // by the difference and set the lowest year to the min year. if (minYear > lowestYear) { highestYear += minYear - lowestYear; lowestYear = minYear; } // If the max year is less than the highest year, decrease the lowest year // by the lower of the two: available and needed years. Then set the // highest year to the max year. if (maxYear < highestYear) { var availableYears = lowestYear - minYear, neededYears = highestYear - maxYear; lowestYear -= availableYears > neededYears ? neededYears : availableYears; highestYear = maxYear; } if (settings.selectYears && override == undefined) { return _.node('select', _.group({ min: lowestYear, max: highestYear, i: 1, node: 'option', item: function (loopedYear) { return [ // The looped year and no classes. loopedYear, 0, // Set the value and selected index. 'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')]; } }), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"'); } } // Materialize modified if (override == "raw") return _.node('div', focusedYear); // Otherwise just return the year focused return _.node('div', focusedYear, settings.klass.year); }; //createYearLabel // Materialize modified createDayLabel = function () { if (selectedObject != null) return selectedObject.date;else return nowObject.date; }; createWeekdayLabel = function () { var display_day; if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day; var weekday = settings.weekdaysShort[display_day]; return weekday; }; // Create and return the entire calendar. return _.node( // Date presentation View 'div', _.node( // Div for Year 'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node( // Div for short Month 'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node( // Div for Day 'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) + // Calendar container _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({ min: 0, max: WEEKS_IN_CALENDAR - 1, i: 1, node: 'tr', item: function (rowCounter) { // If Monday is the first day and the month starts on Sunday, shift the date back a week. var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0; return [_.group({ min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index max: function () { return this.min + DAYS_IN_WEEK - 1; }, i: 1, node: 'td', item: function (targetDate) { // Convert the time date from a relative date to a target date. targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]); var isSelected = selectedObject && selectedObject.pick == targetDate.pick, isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick, isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick, formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]); return [_.node('div', targetDate.date, function (klasses) { // Add the `infocus` or `outfocus` classes based on month in view. klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus); // Add the `today` class if needed. if (nowObject.pick == targetDate.pick) { klasses.push(settings.klass.now); } // Add the `selected` class if something's selected and the time matches. if (isSelected) { klasses.push(settings.klass.selected); } // Add the `highlighted` class if something's highlighted and the time matches. if (isHighlighted) { klasses.push(settings.klass.highlighted); } // Add the `disabled` class if something's disabled and the object matches. if (isDisabled) { klasses.push(settings.klass.disabled); } return klasses.join(' '); }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({ role: 'gridcell', label: formattedDate, selected: isSelected && calendar.$node.val() === formattedDate ? true : null, activedescendant: isHighlighted ? true : null, disabled: isDisabled ? true : null }) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn } })]; //endreturn } })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({ role: 'grid', controls: calendar.$node[0].id, readonly: true })), settings.klass.calendar_container) // end calendar + // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”. _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn }; //DatePicker.prototype.nodes /** * The date picker defaults. */ DatePicker.defaults = function (prefix) { return { // The title label to use for the month nav buttons labelMonthNext: 'Next month', labelMonthPrev: 'Previous month', // The title label to use for the dropdown selectors labelMonthSelect: 'Select a month', labelYearSelect: 'Select a year', // Months and weekdays monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'], monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // Materialize modified weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'], // Today and clear today: 'Today', clear: 'Clear', close: 'Ok', // Picker close behavior (Prevent a change in behaviour for backwards compatibility) closeOnSelect: false, // The format to show on the `input` element format: 'd mmmm, yyyy', // Classes klass: { table: prefix + 'table', header: prefix + 'header', // Materialize Added klasses date_display: prefix + 'date-display', day_display: prefix + 'day-display', month_display: prefix + 'month-display', year_display: prefix + 'year-display', calendar_container: prefix + 'calendar-container', // end navPrev: prefix + 'nav--prev', navNext: prefix + 'nav--next', navDisabled: prefix + 'nav--disabled', month: prefix + 'month', year: prefix + 'year', selectMonth: prefix + 'select--month', selectYear: prefix + 'select--year', weekdays: prefix + 'weekday', day: prefix + 'day', disabled: prefix + 'day--disabled', selected: prefix + 'day--selected', highlighted: prefix + 'day--highlighted', now: prefix + 'day--today', infocus: prefix + 'day--infocus', outfocus: prefix + 'day--outfocus', footer: prefix + 'footer', buttonClear: prefix + 'button--clear', buttonToday: prefix + 'button--today', buttonClose: prefix + 'button--close' } }; }(Picker.klasses().picker + '__'); /** * Extend the picker to add the date picker. */ Picker.extend('pickadate', DatePicker); }); ; /*! * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/) * Copyright 2014 Wang Shenwei. * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE) * * Further modified * Copyright 2015 Ching Yaw Hao. */ (function () { var $ = window.jQuery, $win = $(window), $doc = $(document); // Can I use inline svg ? var svgNS = 'http://www.w3.org/2000/svg', svgSupported = 'SVGAngle' in window && function () { var supported, el = document.createElement('div'); el.innerHTML = ''; supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS; el.innerHTML = ''; return supported; }(); // Can I use transition ? var transitionSupported = function () { var style = document.createElement('div').style; return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style; }(); // Listen touch events in touch screen device, instead of mouse events in desktop. var touchSupported = 'ontouchstart' in window, mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''), mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''), mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : ''); // Vibrate the device if supported var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null; function createSvgElement(name) { return document.createElementNS(svgNS, name); } function leadingZero(num) { return (num < 10 ? '0' : '') + num; } // Get a unique id var idCounter = 0; function uniqueId(prefix) { var id = ++idCounter + ''; return prefix ? prefix + id : id; } // Clock size var dialRadius = 135, outerRadius = 105, // innerRadius = 80 on 12 hour clock innerRadius = 80, tickRadius = 20, diameter = dialRadius * 2, duration = transitionSupported ? 350 : 1; // Popover template var tpl = ['
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '', ':', '', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '
    ', '', '
    ', '
    ', '
    ', '
    ', '
    ', '
    '].join(''); // ClockPicker function ClockPicker(element, options) { var popover = $(tpl), plate = popover.find('.clockpicker-plate'), holder = popover.find('.picker__holder'), hoursView = popover.find('.clockpicker-hours'), minutesView = popover.find('.clockpicker-minutes'), amPmBlock = popover.find('.clockpicker-am-pm-block'), isInput = element.prop('tagName') === 'INPUT', input = isInput ? element : element.find('input'), label = $("label[for=" + input.attr("id") + "]"), self = this; this.id = uniqueId('cp'); this.element = element; this.holder = holder; this.options = options; this.isAppended = false; this.isShown = false; this.currentView = 'hours'; this.isInput = isInput; this.input = input; this.label = label; this.popover = popover; this.plate = plate; this.hoursView = hoursView; this.minutesView = minutesView; this.amPmBlock = amPmBlock; this.spanHours = popover.find('.clockpicker-span-hours'); this.spanMinutes = popover.find('.clockpicker-span-minutes'); this.spanAmPm = popover.find('.clockpicker-span-am-pm'); this.footer = popover.find('.picker__footer'); this.amOrPm = "PM"; // Setup for for 12 hour clock if option is selected if (options.twelvehour) { if (!options.ampmclickable) { this.spanAmPm.empty(); $('
    AM
    ').appendTo(this.spanAmPm); $('
    PM
    ').appendTo(this.spanAmPm); } else { this.spanAmPm.empty(); $('
    AM
    ').on("click", function () { self.spanAmPm.children('#click-am').addClass("text-primary"); self.spanAmPm.children('#click-pm').removeClass("text-primary"); self.amOrPm = "AM"; }).appendTo(this.spanAmPm); $('
    PM
    ').on("click", function () { self.spanAmPm.children('#click-pm').addClass("text-primary"); self.spanAmPm.children('#click-am').removeClass("text-primary"); self.amOrPm = 'PM'; }).appendTo(this.spanAmPm); } } // Add buttons to footer $('').click($.proxy(this.clear, this)).appendTo(this.footer); $('').click($.proxy(this.hide, this)).appendTo(this.footer); $('').click($.proxy(this.done, this)).appendTo(this.footer); this.spanHours.click($.proxy(this.toggleView, this, 'hours')); this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes')); // Show or toggle input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this)); // Build ticks var tickTpl = $('
    '), i, tick, radian, radius; // Hours view if (options.twelvehour) { for (i = 1; i < 13; i += 1) { tick = tickTpl.clone(); radian = i / 6 * Math.PI; radius = outerRadius; tick.css({ left: dialRadius + Math.sin(radian) * radius - tickRadius, top: dialRadius - Math.cos(radian) * radius - tickRadius }); tick.html(i === 0 ? '00' : i); hoursView.append(tick); tick.on(mousedownEvent, mousedown); } } else { for (i = 0; i < 24; i += 1) { tick = tickTpl.clone(); radian = i / 6 * Math.PI; var inner = i > 0 && i < 13; radius = inner ? innerRadius : outerRadius; tick.css({ left: dialRadius + Math.sin(radian) * radius - tickRadius, top: dialRadius - Math.cos(radian) * radius - tickRadius }); tick.html(i === 0 ? '00' : i); hoursView.append(tick); tick.on(mousedownEvent, mousedown); } } // Minutes view for (i = 0; i < 60; i += 5) { tick = tickTpl.clone(); radian = i / 30 * Math.PI; tick.css({ left: dialRadius + Math.sin(radian) * outerRadius - tickRadius, top: dialRadius - Math.cos(radian) * outerRadius - tickRadius }); tick.html(leadingZero(i)); minutesView.append(tick); tick.on(mousedownEvent, mousedown); } // Clicking on minutes view space plate.on(mousedownEvent, function (e) { if ($(e.target).closest('.clockpicker-tick').length === 0) { mousedown(e, true); } }); // Mousedown or touchstart function mousedown(e, space) { var offset = plate.offset(), isTouch = /^touch/.test(e.type), x0 = offset.left + dialRadius, y0 = offset.top + dialRadius, dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0, z = Math.sqrt(dx * dx + dy * dy), moved = false; // When clicking on minutes view space, check the mouse position if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) { return; } e.preventDefault(); // Set cursor style of body after 200ms var movingTimer = setTimeout(function () { self.popover.addClass('clockpicker-moving'); }, 200); // Clock self.setHand(dx, dy, !space, true); // Mousemove on document $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) { e.preventDefault(); var isTouch = /^touch/.test(e.type), x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0; if (!moved && x === dx && y === dy) { // Clicking in chrome on windows will trigger a mousemove event return; } moved = true; self.setHand(x, y, false, true); }); // Mouseup on document $doc.off(mouseupEvent).on(mouseupEvent, function (e) { $doc.off(mouseupEvent); e.preventDefault(); var isTouch = /^touch/.test(e.type), x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0, y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0; if ((space || moved) && x === dx && y === dy) { self.setHand(x, y); } if (self.currentView === 'hours') { self.toggleView('minutes', duration / 2); } else if (options.autoclose) { self.minutesView.addClass('clockpicker-dial-out'); setTimeout(function () { self.done(); }, duration / 2); } plate.prepend(canvas); // Reset cursor style of body clearTimeout(movingTimer); self.popover.removeClass('clockpicker-moving'); // Unbind mousemove event $doc.off(mousemoveEvent); }); } if (svgSupported) { // Draw clock hands and others var canvas = popover.find('.clockpicker-canvas'), svg = createSvgElement('svg'); svg.setAttribute('class', 'clockpicker-svg'); svg.setAttribute('width', diameter); svg.setAttribute('height', diameter); var g = createSvgElement('g'); g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')'); var bearing = createSvgElement('circle'); bearing.setAttribute('class', 'clockpicker-canvas-bearing'); bearing.setAttribute('cx', 0); bearing.setAttribute('cy', 0); bearing.setAttribute('r', 4); var hand = createSvgElement('line'); hand.setAttribute('x1', 0); hand.setAttribute('y1', 0); var bg = createSvgElement('circle'); bg.setAttribute('class', 'clockpicker-canvas-bg'); bg.setAttribute('r', tickRadius); g.appendChild(hand); g.appendChild(bg); g.appendChild(bearing); svg.appendChild(g); canvas.append(svg); this.hand = hand; this.bg = bg; this.bearing = bearing; this.g = g; this.canvas = canvas; } raiseCallback(this.options.init); } function raiseCallback(callbackFunction) { if (callbackFunction && typeof callbackFunction === "function") callbackFunction(); } // Default options ClockPicker.DEFAULTS = { 'default': '', // default time, 'now' or '13:14' e.g. fromnow: 0, // set default time to * milliseconds from now (using with default = 'now') donetext: 'Ok', // done button text cleartext: 'Clear', canceltext: 'Cancel', autoclose: false, // auto close when minute is selected ampmclickable: true, // set am/pm button on itself darktheme: false, // set to dark theme twelvehour: true, // change to 12 hour AM/PM clock from 24 hour vibrate: true // vibrate the device when dragging clock hand }; // Show or hide popover ClockPicker.prototype.toggle = function () { this[this.isShown ? 'hide' : 'show'](); }; // Set popover position ClockPicker.prototype.locate = function () { var element = this.element, popover = this.popover, offset = element.offset(), width = element.outerWidth(), height = element.outerHeight(), align = this.options.align, self = this; popover.show(); }; // Show popover ClockPicker.prototype.show = function (e) { // Not show again if (this.isShown) { return; } raiseCallback(this.options.beforeShow); $(':input').each(function () { $(this).attr('tabindex', -1); }); var self = this; // Initialize this.input.blur(); this.popover.addClass('picker--opened'); this.input.addClass('picker__input picker__input--active'); $(document.body).css('overflow', 'hidden'); // Get the time var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':'); if (this.options.twelvehour && !(typeof value[1] === 'undefined')) { if (value[1].indexOf("AM") > 0) { this.amOrPm = 'AM'; } else { this.amOrPm = 'PM'; } value[1] = value[1].replace("AM", "").replace("PM", ""); } if (value[0] === 'now') { var now = new Date(+new Date() + this.options.fromnow); value = [now.getHours(), now.getMinutes()]; if (this.options.twelvehour) { this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM'; } } this.hours = +value[0] || 0; this.minutes = +value[1] || 0; this.spanHours.html(this.hours); this.spanMinutes.html(leadingZero(this.minutes)); if (!this.isAppended) { // Append popover to body this.popover.insertAfter(this.input); if (this.options.twelvehour) { if (this.amOrPm === 'PM') { this.spanAmPm.children('#click-pm').addClass("text-primary"); this.spanAmPm.children('#click-am').removeClass("text-primary"); } else { this.spanAmPm.children('#click-am').addClass("text-primary"); this.spanAmPm.children('#click-pm').removeClass("text-primary"); } } // Reset position when resize $win.on('resize.clockpicker' + this.id, function () { if (self.isShown) { self.locate(); } }); this.isAppended = true; } // Toggle to hours view this.toggleView('hours'); // Set position this.locate(); this.isShown = true; // Hide when clicking or tabbing on any element except the clock and input $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) { var target = $(e.target); if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) { self.hide(); } }); // Hide when ESC is pressed $doc.on('keyup.clockpicker.' + this.id, function (e) { if (e.keyCode === 27) { self.hide(); } }); raiseCallback(this.options.afterShow); }; // Hide popover ClockPicker.prototype.hide = function () { raiseCallback(this.options.beforeHide); this.input.removeClass('picker__input picker__input--active'); this.popover.removeClass('picker--opened'); $(document.body).css('overflow', 'visible'); this.isShown = false; $(':input').each(function (index) { $(this).attr('tabindex', index + 1); }); // Unbinding events on document $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id); $doc.off('keyup.clockpicker.' + this.id); this.popover.hide(); raiseCallback(this.options.afterHide); }; // Toggle to hours or minutes view ClockPicker.prototype.toggleView = function (view, delay) { var raiseAfterHourSelect = false; if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") { raiseCallback(this.options.beforeHourSelect); raiseAfterHourSelect = true; } var isHours = view === 'hours', nextView = isHours ? this.hoursView : this.minutesView, hideView = isHours ? this.minutesView : this.hoursView; this.currentView = view; this.spanHours.toggleClass('text-primary', isHours); this.spanMinutes.toggleClass('text-primary', !isHours); // Let's make transitions hideView.addClass('clockpicker-dial-out'); nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out'); // Reset clock hand this.resetClock(delay); // After transitions ended clearTimeout(this.toggleViewTimer); this.toggleViewTimer = setTimeout(function () { hideView.css('visibility', 'hidden'); }, duration); if (raiseAfterHourSelect) { raiseCallback(this.options.afterHourSelect); } }; // Reset clock hand ClockPicker.prototype.resetClock = function (delay) { var view = this.currentView, value = this[view], isHours = view === 'hours', unit = Math.PI / (isHours ? 6 : 30), radian = value * unit, radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius, x = Math.sin(radian) * radius, y = -Math.cos(radian) * radius, self = this; if (svgSupported && delay) { self.canvas.addClass('clockpicker-canvas-out'); setTimeout(function () { self.canvas.removeClass('clockpicker-canvas-out'); self.setHand(x, y); }, delay); } else this.setHand(x, y); }; // Set clock hand to (x, y) ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) { var radian = Math.atan2(x, -y), isHours = this.currentView === 'hours', unit = Math.PI / (isHours || roundBy5 ? 6 : 30), z = Math.sqrt(x * x + y * y), options = this.options, inner = isHours && z < (outerRadius + innerRadius) / 2, radius = inner ? innerRadius : outerRadius, value; if (options.twelvehour) { radius = outerRadius; } // Radian should in range [0, 2PI] if (radian < 0) { radian = Math.PI * 2 + radian; } // Get the round value value = Math.round(radian / unit); // Get the round radian radian = value * unit; // Correct the hours or minutes if (options.twelvehour) { if (isHours) { if (value === 0) value = 12; } else { if (roundBy5) value *= 5; if (value === 60) value = 0; } } else { if (isHours) { if (value === 12) value = 0; value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12; } else { if (roundBy5) value *= 5; if (value === 60) value = 0; } } // Once hours or minutes changed, vibrate the device if (this[this.currentView] !== value) { if (vibrate && this.options.vibrate) { // Do not vibrate too frequently if (!this.vibrateTimer) { navigator[vibrate](10); this.vibrateTimer = setTimeout($.proxy(function () { this.vibrateTimer = null; }, this), 100); } } } this[this.currentView] = value; if (isHours) { this['spanHours'].html(value); } else { this['spanMinutes'].html(leadingZero(value)); } // If svg is not supported, just add an active class to the tick if (!svgSupported) { this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () { var tick = $(this); tick.toggleClass('active', value === +tick.html()); }); return; } // Set clock hand and others' position var cx1 = Math.sin(radian) * (radius - tickRadius), cy1 = -Math.cos(radian) * (radius - tickRadius), cx2 = Math.sin(radian) * radius, cy2 = -Math.cos(radian) * radius; this.hand.setAttribute('x2', cx1); this.hand.setAttribute('y2', cy1); this.bg.setAttribute('cx', cx2); this.bg.setAttribute('cy', cy2); }; // Hours and minutes are selected ClockPicker.prototype.done = function () { raiseCallback(this.options.beforeDone); this.hide(); this.label.addClass('active'); var last = this.input.prop('value'), value = leadingZero(this.hours) + ':' + leadingZero(this.minutes); if (this.options.twelvehour) { value = value + this.amOrPm; } this.input.prop('value', value); if (value !== last) { this.input.triggerHandler('change'); if (!this.isInput) { this.element.trigger('change'); } } if (this.options.autoclose) this.input.trigger('blur'); raiseCallback(this.options.afterDone); }; // Clear input field ClockPicker.prototype.clear = function () { this.hide(); this.label.removeClass('active'); var last = this.input.prop('value'), value = ''; this.input.prop('value', value); if (value !== last) { this.input.triggerHandler('change'); if (!this.isInput) { this.element.trigger('change'); } } if (this.options.autoclose) { this.input.trigger('blur'); } }; // Remove clockpicker from input ClockPicker.prototype.remove = function () { this.element.removeData('clockpicker'); this.input.off('focus.clockpicker click.clockpicker'); if (this.isShown) { this.hide(); } if (this.isAppended) { $win.off('resize.clockpicker' + this.id); this.popover.remove(); } }; // Extends $.fn.clockpicker $.fn.pickatime = function (option) { var args = Array.prototype.slice.call(arguments, 1); return this.each(function () { var $this = $(this), data = $this.data('clockpicker'); if (!data) { var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option); $this.data('clockpicker', new ClockPicker($this, options)); } else { // Manual operatsions. show, hide, remove, e.g. if (typeof data[option] === 'function') { data[option].apply(data, args); } } }); }; })(); ;(function ($) { $.fn.characterCounter = function () { return this.each(function () { var $input = $(this); var $counterElement = $input.parent().find('span[class="character-counter"]'); // character counter has already been added appended to the parent container if ($counterElement.length) { return; } var itHasLengthAttribute = $input.attr('data-length') !== undefined; if (itHasLengthAttribute) { $input.on('input', updateCounter); $input.on('focus', updateCounter); $input.on('blur', removeCounterElement); addCounterElement($input); } }); }; function updateCounter() { var maxLength = +$(this).attr('data-length'), actualLength = +$(this).val().length, isValidLength = actualLength <= maxLength; $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength); addInputStyle(isValidLength, $(this)); } function addCounterElement($input) { var $counterElement = $input.parent().find('span[class="character-counter"]'); if ($counterElement.length) { return; } $counterElement = $('').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1); $input.parent().append($counterElement); } function removeCounterElement() { $(this).parent().find('span[class="character-counter"]').html(''); } function addInputStyle(isValidLength, $input) { var inputHasInvalidClass = $input.hasClass('invalid'); if (isValidLength && inputHasInvalidClass) { $input.removeClass('invalid'); } else if (!isValidLength && !inputHasInvalidClass) { $input.removeClass('valid'); $input.addClass('invalid'); } } $(document).ready(function () { $('input, textarea').characterCounter(); }); })(jQuery); ;(function ($) { var methods = { init: function (options) { var defaults = { duration: 200, // ms dist: -100, // zoom scale TODO: make this more intuitive as an option shift: 0, // spacing for center image padding: 0, // Padding between non center items fullWidth: false, // Change to full width styles indicators: false, // Toggle indicators noWrap: false, // Don't wrap around and cycle through items. onCycleTo: null // Callback for when a new slide is cycled to. }; options = $.extend(defaults, options); var namespace = Materialize.objectSelectorString($(this)); return this.each(function (i) { var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged; var $indicators = $('
      '); var scrollingTimeout = null; var oneTimeCallback = null; // Initialize var view = $(this); var hasMultipleSlides = view.find('.carousel-item').length > 1; var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides; var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides; var uniqueNamespace = view.attr('data-namespace') || namespace + i; view.attr('data-namespace', uniqueNamespace); // Options var setCarouselHeight = function (imageOnly) { var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first(); var firstImage = firstSlide.find('img').first(); if (firstImage.length) { if (firstImage[0].complete) { // If image won't trigger the load event var imageHeight = firstImage.height(); if (imageHeight > 0) { view.css('height', firstImage.height()); } else { // If image still has no height, use the natural dimensions to calculate var naturalWidth = firstImage[0].naturalWidth; var naturalHeight = firstImage[0].naturalHeight; var adjustedHeight = view.width() / naturalWidth * naturalHeight; view.css('height', adjustedHeight); } } else { // Get height when image is loaded normally firstImage.on('load', function () { view.css('height', $(this).height()); }); } } else if (!imageOnly) { var slideHeight = firstSlide.height(); view.css('height', slideHeight); } }; if (options.fullWidth) { options.dist = 0; setCarouselHeight(); // Offset fixed items when indicators. if (showIndicators) { view.find('.carousel-fixed-item').addClass('with-indicators'); } } // Don't double initialize. if (view.hasClass('initialized')) { // Recalculate variables $(window).trigger('resize'); // Redraw carousel. view.trigger('carouselNext', [0.000001]); return true; } view.addClass('initialized'); pressed = false; offset = target = 0; images = []; item_width = view.find('.carousel-item').first().innerWidth(); item_height = view.find('.carousel-item').first().innerHeight(); dim = item_width * 2 + options.padding; view.find('.carousel-item').each(function (i) { images.push($(this)[0]); if (showIndicators) { var $indicator = $('
    • '); // Add active to first by default. if (i === 0) { $indicator.addClass('active'); } // Handle clicks on indicators. $indicator.click(function (e) { e.stopPropagation(); var index = $(this).index(); cycleTo(index); }); $indicators.append($indicator); } }); if (showIndicators) { view.append($indicators); } count = images.length; function setupEvents() { if (typeof window.ontouchstart !== 'undefined') { view.on('touchstart.carousel', tap); view.on('touchmove.carousel', drag); view.on('touchend.carousel', release); } view.on('mousedown.carousel', tap); view.on('mousemove.carousel', drag); view.on('mouseup.carousel', release); view.on('mouseleave.carousel', release); view.on('click.carousel', click); } function xpos(e) { // touch event if (e.targetTouches && e.targetTouches.length >= 1) { return e.targetTouches[0].clientX; } // mouse event return e.clientX; } function ypos(e) { // touch event if (e.targetTouches && e.targetTouches.length >= 1) { return e.targetTouches[0].clientY; } // mouse event return e.clientY; } function wrap(x) { return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x; } function scroll(x) { // Track scrolling state scrolling = true; if (!view.hasClass('scrolling')) { view.addClass('scrolling'); } if (scrollingTimeout != null) { window.clearTimeout(scrollingTimeout); } scrollingTimeout = window.setTimeout(function () { scrolling = false; view.removeClass('scrolling'); }, options.duration); // Start actual scroll var i, half, delta, dir, tween, el, alignment, xTranslation; var lastCenter = center; offset = typeof x === 'number' ? x : offset; center = Math.floor((offset + dim / 2) / dim); delta = offset - center * dim; dir = delta < 0 ? 1 : -1; tween = -dir * delta * 2 / dim; half = count >> 1; if (!options.fullWidth) { alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) '; alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)'; } else { alignment = 'translateX(0)'; } // Set indicator active if (showIndicators) { var diff = center % count; var activeIndicator = $indicators.find('.indicator-item.active'); if (activeIndicator.index() !== diff) { activeIndicator.removeClass('active'); $indicators.find('.indicator-item').eq(diff).addClass('active'); } } // center // Don't show wrapped items. if (!noWrap || center >= 0 && center < count) { el = images[wrap(center)]; // Add active class to center item. if (!$(el).hasClass('active')) { view.find('.carousel-item').removeClass('active'); $(el).addClass('active'); } el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)'; el.style.zIndex = 0; if (options.fullWidth) { tweenedOpacity = 1; } else { tweenedOpacity = 1 - 0.2 * tween; } el.style.opacity = tweenedOpacity; el.style.display = 'block'; } for (i = 1; i <= half; ++i) { // right side if (options.fullWidth) { zTranslation = options.dist; tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1; } else { zTranslation = options.dist * (i * 2 + tween * dir); tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir); } // Don't show wrapped items. if (!noWrap || center + i < count) { el = images[wrap(center + i)]; el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; el.style.zIndex = -i; el.style.opacity = tweenedOpacity; el.style.display = 'block'; } // left side if (options.fullWidth) { zTranslation = options.dist; tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1; } else { zTranslation = options.dist * (i * 2 - tween * dir); tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir); } // Don't show wrapped items. if (!noWrap || center - i >= 0) { el = images[wrap(center - i)]; el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; el.style.zIndex = -i; el.style.opacity = tweenedOpacity; el.style.display = 'block'; } } // center // Don't show wrapped items. if (!noWrap || center >= 0 && center < count) { el = images[wrap(center)]; el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)'; el.style.zIndex = 0; if (options.fullWidth) { tweenedOpacity = 1; } else { tweenedOpacity = 1 - 0.2 * tween; } el.style.opacity = tweenedOpacity; el.style.display = 'block'; } // onCycleTo callback if (lastCenter !== center && typeof options.onCycleTo === "function") { var $curr_item = view.find('.carousel-item').eq(wrap(center)); options.onCycleTo.call(this, $curr_item, dragged); } // One time callback if (typeof oneTimeCallback === "function") { oneTimeCallback.call(this, $curr_item, dragged); oneTimeCallback = null; } } function track() { var now, elapsed, delta, v; now = Date.now(); elapsed = now - timestamp; timestamp = now; delta = offset - frame; frame = offset; v = 1000 * delta / (1 + elapsed); velocity = 0.8 * v + 0.2 * velocity; } function autoScroll() { var elapsed, delta; if (amplitude) { elapsed = Date.now() - timestamp; delta = amplitude * Math.exp(-elapsed / options.duration); if (delta > 2 || delta < -2) { scroll(target - delta); requestAnimationFrame(autoScroll); } else { scroll(target); } } } function click(e) { // Disable clicks if carousel was dragged. if (dragged) { e.preventDefault(); e.stopPropagation(); return false; } else if (!options.fullWidth) { var clickedIndex = $(e.target).closest('.carousel-item').index(); var diff = wrap(center) - clickedIndex; // Disable clicks if carousel was shifted by click if (diff !== 0) { e.preventDefault(); e.stopPropagation(); } cycleTo(clickedIndex); } } function cycleTo(n) { var diff = center % count - n; // Account for wraparound. if (!noWrap) { if (diff < 0) { if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; } } else if (diff > 0) { if (Math.abs(diff - count) < diff) { diff -= count; } } } // Call prev or next accordingly. if (diff < 0) { view.trigger('carouselNext', [Math.abs(diff)]); } else if (diff > 0) { view.trigger('carouselPrev', [diff]); } } function tap(e) { // Fixes firefox draggable image bug if (e.type === 'mousedown' && $(e.target).is('img')) { e.preventDefault(); } pressed = true; dragged = false; vertical_dragged = false; reference = xpos(e); referenceY = ypos(e); velocity = amplitude = 0; frame = offset; timestamp = Date.now(); clearInterval(ticker); ticker = setInterval(track, 100); } function drag(e) { var x, delta, deltaY; if (pressed) { x = xpos(e); y = ypos(e); delta = reference - x; deltaY = Math.abs(referenceY - y); if (deltaY < 30 && !vertical_dragged) { // If vertical scrolling don't allow dragging. if (delta > 2 || delta < -2) { dragged = true; reference = x; scroll(offset + delta); } } else if (dragged) { // If dragging don't allow vertical scroll. e.preventDefault(); e.stopPropagation(); return false; } else { // Vertical scrolling. vertical_dragged = true; } } if (dragged) { // If dragging don't allow vertical scroll. e.preventDefault(); e.stopPropagation(); return false; } } function release(e) { if (pressed) { pressed = false; } else { return; } clearInterval(ticker); target = offset; if (velocity > 10 || velocity < -10) { amplitude = 0.9 * velocity; target = offset + amplitude; } target = Math.round(target / dim) * dim; // No wrap of items. if (noWrap) { if (target >= dim * (count - 1)) { target = dim * (count - 1); } else if (target < 0) { target = 0; } } amplitude = target - offset; timestamp = Date.now(); requestAnimationFrame(autoScroll); if (dragged) { e.preventDefault(); e.stopPropagation(); } return false; } xform = 'transform'; ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) { var e = prefix + 'Transform'; if (typeof document.body.style[e] !== 'undefined') { xform = e; return false; } return true; }); var throttledResize = Materialize.throttle(function () { if (options.fullWidth) { item_width = view.find('.carousel-item').first().innerWidth(); var imageHeight = view.find('.carousel-item.active').height(); dim = item_width * 2 + options.padding; offset = center * 2 * item_width; target = offset; setCarouselHeight(true); } else { scroll(); } }, 200); $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize); setupEvents(); scroll(offset); $(this).on('carouselNext', function (e, n, callback) { if (n === undefined) { n = 1; } if (typeof callback === "function") { oneTimeCallback = callback; } target = dim * Math.round(offset / dim) + dim * n; if (offset !== target) { amplitude = target - offset; timestamp = Date.now(); requestAnimationFrame(autoScroll); } }); $(this).on('carouselPrev', function (e, n, callback) { if (n === undefined) { n = 1; } if (typeof callback === "function") { oneTimeCallback = callback; } target = dim * Math.round(offset / dim) - dim * n; if (offset !== target) { amplitude = target - offset; timestamp = Date.now(); requestAnimationFrame(autoScroll); } }); $(this).on('carouselSet', function (e, n, callback) { if (n === undefined) { n = 0; } if (typeof callback === "function") { oneTimeCallback = callback; } cycleTo(n); }); }); }, next: function (n, callback) { $(this).trigger('carouselNext', [n, callback]); }, prev: function (n, callback) { $(this).trigger('carouselPrev', [n, callback]); }, set: function (n, callback) { $(this).trigger('carouselSet', [n, callback]); }, destroy: function () { var uniqueNamespace = $(this).attr('data-namespace'); $(this).removeAttr('data-namespace'); $(this).removeClass('initialized'); $(this).find('.indicators').remove(); // Remove event handlers $(this).off('carouselNext carouselPrev carouselSet'); $(window).off('resize.carousel-' + uniqueNamespace); if (typeof window.ontouchstart !== 'undefined') { $(this).off('touchstart.carousel touchmove.carousel touchend.carousel'); } $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel'); } }; $.fn.carousel = function (methodOrOptions) { if (methods[methodOrOptions]) { return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { // Default to "init" return methods.init.apply(this, arguments); } else { $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel'); } }; // Plugin end })(jQuery); ;(function ($) { var methods = { init: function (options) { return this.each(function () { var origin = $('#' + $(this).attr('data-activates')); var screen = $('body'); // Creating tap target var tapTargetEl = $(this); var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper'); var tapTargetWave = tapTargetWrapper.find('.tap-target-wave'); var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin'); var tapTargetContentEl = tapTargetEl.find('.tap-target-content'); // Creating wrapper if (!tapTargetWrapper.length) { tapTargetWrapper = tapTargetEl.wrap($('
      ')).parent(); } // Creating content if (!tapTargetContentEl.length) { tapTargetContentEl = $('
      '); tapTargetEl.append(tapTargetContentEl); } // Creating foreground wave if (!tapTargetWave.length) { tapTargetWave = $('
      '); // Creating origin if (!tapTargetOriginEl.length) { tapTargetOriginEl = origin.clone(true, true); tapTargetOriginEl.addClass('tap-target-origin'); tapTargetOriginEl.removeAttr('id'); tapTargetOriginEl.removeAttr('style'); tapTargetWave.append(tapTargetOriginEl); } tapTargetWrapper.append(tapTargetWave); } // Open var openTapTarget = function () { if (tapTargetWrapper.is('.open')) { return; } // Adding open class tapTargetWrapper.addClass('open'); setTimeout(function () { tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) { closeTapTarget(); tapTargetOriginEl.off('click.tapTarget'); }); $(document).off('click.tapTarget').on('click.tapTarget', function (e) { closeTapTarget(); $(document).off('click.tapTarget'); }); var throttledCalc = Materialize.throttle(function () { calculateTapTarget(); }, 200); $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc); }, 0); }; // Close var closeTapTarget = function () { if (!tapTargetWrapper.is('.open')) { return; } tapTargetWrapper.removeClass('open'); tapTargetOriginEl.off('click.tapTarget'); $(document).off('click.tapTarget'); $(window).off('resize.tapTarget'); }; // Pre calculate var calculateTapTarget = function () { // Element or parent is fixed position? var isFixed = origin.css('position') === 'fixed'; if (!isFixed) { var parents = origin.parents(); for (var i = 0; i < parents.length; i++) { isFixed = $(parents[i]).css('position') == 'fixed'; if (isFixed) { break; } } } // Calculating origin var originWidth = origin.outerWidth(); var originHeight = origin.outerHeight(); var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top; var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left; // Calculating screen var windowWidth = $(window).width(); var windowHeight = $(window).height(); var centerX = windowWidth / 2; var centerY = windowHeight / 2; var isLeft = originLeft <= centerX; var isRight = originLeft > centerX; var isTop = originTop <= centerY; var isBottom = originTop > centerY; var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75; var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75; // Calculating tap target var tapTargetWidth = tapTargetEl.outerWidth(); var tapTargetHeight = tapTargetEl.outerHeight(); var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2; var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2; var tapTargetPosition = isFixed ? 'fixed' : 'absolute'; // Calculating content var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth; var tapTargetTextHeight = tapTargetHeight / 2; var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0; var tapTargetTextBottom = 0; var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0; var tapTargetTextRight = 0; var tapTargetTextPadding = originWidth; var tapTargetTextAlign = isBottom ? 'bottom' : 'top'; // Calculating wave var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2; var tapTargetWaveHeight = tapTargetWaveWidth; var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2; var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2; // Setting tap target var tapTargetWrapperCssObj = {}; tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ''; tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ''; tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ''; tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ''; tapTargetWrapperCssObj.position = tapTargetPosition; tapTargetWrapper.css(tapTargetWrapperCssObj); // Setting content tapTargetContentEl.css({ width: tapTargetTextWidth, height: tapTargetTextHeight, top: tapTargetTextTop, right: tapTargetTextRight, bottom: tapTargetTextBottom, left: tapTargetTextLeft, padding: tapTargetTextPadding, verticalAlign: tapTargetTextAlign }); // Setting wave tapTargetWave.css({ top: tapTargetWaveTop, left: tapTargetWaveLeft, width: tapTargetWaveWidth, height: tapTargetWaveHeight }); }; if (options == 'open') { calculateTapTarget(); openTapTarget(); } if (options == 'close') closeTapTarget(); }); }, open: function () {}, close: function () {} }; $.fn.tapTarget = function (methodOrOptions) { if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments); $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target'); }; })(jQuery);