## the index structure for redwood. interacts with ferret. require 'fileutils' require 'ferret' begin require 'chronic' $have_chronic = true rescue LoadError => e Redwood::log "optional 'chronic' library not found (run 'gem install chronic' to install)" $have_chronic = false end module Redwood class Index class LockError < StandardError def initialize h @h = h end def method_missing m; @h[m.to_s] end end include Singleton attr_reader :index alias ferret index def initialize dir=BASE_DIR @dir = dir @sources = {} @sources_dirty = false wsa = Ferret::Analysis::WhiteSpaceAnalyzer.new false sa = Ferret::Analysis::StandardAnalyzer.new [], true @analyzer = Ferret::Analysis::PerFieldAnalyzer.new wsa @analyzer[:body] = sa @analyzer[:subject] = sa @qparser ||= Ferret::QueryParser.new :default_field => :body, :analyzer => @analyzer, :or_default => false @lock = Lockfile.new lockfile, :retries => 0, :max_age => nil self.class.i_am_the_instance self end def lockfile; File.join @dir, "lock" end def lock Redwood::log "locking #{lockfile}..." begin @lock.lock rescue Lockfile::MaxTriesLockError raise LockError, @lock.lockinfo_on_disk end end def start_lock_update_thread @lock_update_thread = Redwood::reporting_thread("lock update") do while true sleep 30 @lock.touch_yourself end end end def stop_lock_update_thread @lock_update_thread.kill if @lock_update_thread @lock_update_thread = nil end def fancy_lock_error_message_for e secs = Time.now - e.mtime mins = secs.to_i / 60 time = if mins == 0 "#{secs.to_i} seconds" else "#{mins} minutes" end <<EOS Error: the sup index is locked by another process! User '#{e.user}' on host '#{e.host}' is running #{e.pname} with pid #{e.pid}. The process was alive as of #{time} ago. EOS end def lock_or_die begin lock rescue LockError => e $stderr.puts fancy_lock_error_message_for(e) $stderr.puts <<EOS You can wait for the process to finish, or, if it crashed and left a stale lock file behind, you can manually delete #{@lock.path}. EOS exit end end def unlock if @lock && @lock.locked? Redwood::log "unlocking #{lockfile}..." @lock.unlock end end def load load_sources load_index end def save Redwood::log "saving index and sources..." FileUtils.mkdir_p @dir unless File.exists? @dir save_sources save_index end def add_source source raise "duplicate source!" if @sources.include? source @sources_dirty = true max = @sources.max_of { |id, s| s.is_a?(DraftLoader) || s.is_a?(SentLoader) ? 0 : id } source.id ||= (max || 0) + 1 ##source.id += 1 while @sources.member? source.id @sources[source.id] = source end def sources ## favour the inbox by listing non-archived sources first @sources.values.sort_by { |s| s.id }.partition { |s| !s.archived? }.flatten end def source_for uri; sources.find { |s| s.is_source_for? uri }; end def usual_sources; sources.find_all { |s| s.usual? }; end def load_index dir=File.join(@dir, "ferret") if File.exists? dir Redwood::log "loading index..." @index = Ferret::Index::Index.new(:path => dir, :analyzer => @analyzer) Redwood::log "loaded index of #{@index.size} messages" else Redwood::log "creating index..." field_infos = Ferret::Index::FieldInfos.new :store => :yes field_infos.add_field :message_id, :index => :untokenized field_infos.add_field :source_id field_infos.add_field :source_info field_infos.add_field :date, :index => :untokenized field_infos.add_field :body field_infos.add_field :label field_infos.add_field :subject field_infos.add_field :from field_infos.add_field :to field_infos.add_field :refs field_infos.add_field :snippet, :index => :no, :term_vector => :no field_infos.create_index dir @index = Ferret::Index::Index.new(:path => dir, :analyzer => @analyzer) end end ## Syncs the message to the index: deleting if it's already there, ## and adding either way. Index state will be determined by m.labels. ## ## docid and entry can be specified if they're already known. def sync_message m, docid=nil, entry=nil, opts={} docid, entry = load_entry_for_id m.id unless docid && entry raise "no source info for message #{m.id}" unless m.source && m.source_info raise "trying to delete non-corresponding entry #{docid} with index message-id #{@index[docid][:message_id].inspect} and parameter message id #{m.id.inspect}" if docid && @index[docid][:message_id] != m.id source_id = if m.source.is_a? Integer m.source else m.source.id or raise "unregistered source #{m.source} (id #{m.source.id.inspect})" end snippet = if m.snippet_contains_encrypted_content? && $config[:discard_snippets_from_encrypted_messages] "" else m.snippet end ## write the new document to the index. if the entry already exists in the ## index, reuse it (which avoids having to reload the entry from the source, ## which can be quite expensive for e.g. large threads of IMAP actions.) ## ## exception: if the index entry belongs to an earlier version of the ## message, use everything from the new message instead, but union the ## flags. this allows messages sent to mailing lists to have their header ## updated and to have flags set properly. ## ## minor hack: messages in sources with lower ids have priority over ## messages in sources with higher ids. so messages in the inbox will ## override everyone, and messages in the sent box will be overridden ## by everyone else. ## ## written in this manner to support previous versions of the index which ## did not keep around the entry body. upgrading is thus seamless. entry ||= {} labels = m.labels.uniq # override because this is the new state, unless... ## if we are a later version of a message, ignore what's in the index, ## but merge in the labels. if entry[:source_id] && entry[:source_info] && entry[:label] && ((entry[:source_id].to_i > source_id) || (entry[:source_info].to_i < m.source_info)) labels = (entry[:label].split(/\s+/).map { |l| l.intern } + m.labels).uniq #Redwood::log "found updated version of message #{m.id}: #{m.subj}" #Redwood::log "previous version was at #{entry[:source_id].inspect}:#{entry[:source_info].inspect}, this version at #{source_id.inspect}:#{m.source_info.inspect}" #Redwood::log "merged labels are #{labels.inspect} (index #{entry[:label].inspect}, message #{m.labels.inspect})" entry = {} end ## if force_overwite is true, ignore what's in the index. this is used ## primarily by sup-sync to force index updates. entry = {} if opts[:force_overwrite] d = { :message_id => m.id, :source_id => source_id, :source_info => m.source_info, :date => (entry[:date] || m.date.to_indexable_s), :body => (entry[:body] || m.indexable_content), :snippet => snippet, # always override :label => labels.uniq.join(" "), :from => (entry[:from] || (m.from ? m.from.indexable_content : "")), :to => (entry[:to] || (m.to + m.cc + m.bcc).map { |x| x.indexable_content }.join(" ")), :subject => (entry[:subject] || wrap_subj(Message.normalize_subj(m.subj))), :refs => (entry[:refs] || (m.refs + m.replytos).uniq.join(" ")), } @index.delete docid if docid @index.add_document d docid, entry = load_entry_for_id m.id ## this hasn't been triggered in a long time. TODO: decide whether it's still a problem. raise "just added message #{m.id.inspect} but couldn't find it in a search" unless docid true end def save_index fn=File.join(@dir, "ferret") # don't have to do anything, apparently end def contains_id? id @index.search(Ferret::Search::TermQuery.new(:message_id, id)).total_hits > 0 end def contains? m; contains_id? m.id; end def size; @index.size; end ## you should probably not call this on a block that doesn't break ## rather quickly because the results can be very large. EACH_BY_DATE_NUM = 100 def each_id_by_date opts={} return if @index.size == 0 # otherwise ferret barfs ###TODO: remove this once my ferret patch is accepted query = build_query opts offset = 0 while true results = @index.search(query, :sort => "date DESC", :limit => EACH_BY_DATE_NUM, :offset => offset) Redwood::log "got #{results.total_hits} results for query (offset #{offset}) #{query.inspect}" results.hits.each { |hit| yield @index[hit.doc][:message_id], lambda { build_message hit.doc } } break if offset >= results.total_hits - EACH_BY_DATE_NUM offset += EACH_BY_DATE_NUM end end def num_results_for opts={} return 0 if @index.size == 0 # otherwise ferret barfs ###TODO: remove this once my ferret patch is accepted q = build_query opts index.search(q, :limit => 1).total_hits end ## yield all messages in the thread containing 'm' by repeatedly ## querying the index. yields pairs of message ids and ## message-building lambdas, so that building an unwanted message ## can be skipped in the block if desired. ## ## only two options, :limit and :skip_killed. if :skip_killed is ## true, stops loading any thread if a message with a :killed flag ## is found. SAME_SUBJECT_DATE_LIMIT = 7 MAX_CLAUSES = 1000 def each_message_in_thread_for m, opts={} #Redwood::log "Building thread for #{m.id}: #{m.subj}" messages = {} searched = {} num_queries = 0 pending = [m.id] if $config[:thread_by_subject] # do subject queries date_min = m.date - (SAME_SUBJECT_DATE_LIMIT * 12 * 3600) date_max = m.date + (SAME_SUBJECT_DATE_LIMIT * 12 * 3600) q = Ferret::Search::BooleanQuery.new true sq = Ferret::Search::PhraseQuery.new(:subject) wrap_subj(Message.normalize_subj(m.subj)).split(/\s+/).each do |t| sq.add_term t end q.add_query sq, :must q.add_query Ferret::Search::RangeQuery.new(:date, :>= => date_min.to_indexable_s, :<= => date_max.to_indexable_s), :must q = build_query :qobj => q p1 = @index.search(q).hits.map { |hit| @index[hit.doc][:message_id] } Redwood::log "found #{p1.size} results for subject query #{q}" p2 = @index.search(q.to_s, :limit => :all).hits.map { |hit| @index[hit.doc][:message_id] } Redwood::log "found #{p2.size} results in string form" pending = (pending + p1 + p2).uniq end until pending.empty? || (opts[:limit] && messages.size >= opts[:limit]) q = Ferret::Search::BooleanQuery.new true # this disappeared in newer ferrets... wtf. # q.max_clause_count = 2048 lim = [MAX_CLAUSES / 2, pending.length].min pending[0 ... lim].each do |id| searched[id] = true q.add_query Ferret::Search::TermQuery.new(:message_id, id), :should q.add_query Ferret::Search::TermQuery.new(:refs, id), :should end pending = pending[lim .. -1] q = build_query :qobj => q num_queries += 1 killed = false @index.search_each(q, :limit => :all) do |docid, score| break if opts[:limit] && messages.size >= opts[:limit] if @index[docid][:label].split(/\s+/).include?("killed") && opts[:skip_killed] killed = true break end mid = @index[docid][:message_id] unless messages.member?(mid) #Redwood::log "got #{mid} as a child of #{id}" messages[mid] ||= lambda { build_message docid } refs = @index[docid][:refs].split(" ") pending += refs.select { |id| !searched[id] } end end end if killed Redwood::log "thread for #{m.id} is killed, ignoring" false else Redwood::log "ran #{num_queries} queries to build thread of #{messages.size + 1} messages for #{m.id}: #{m.subj}" if num_queries > 0 messages.each { |mid, builder| yield mid, builder } true end end ## builds a message object from a ferret result def build_message docid doc = @index[docid] source = @sources[doc[:source_id].to_i] #puts "building message #{doc[:message_id]} (#{source}##{doc[:source_info]})" raise "invalid source #{doc[:source_id]}" unless source fake_header = { "date" => Time.at(doc[:date].to_i), "subject" => unwrap_subj(doc[:subject]), "from" => doc[:from], "to" => doc[:to].split(/\s+/).join(", "), # reformat "message-id" => doc[:message_id], "references" => doc[:refs].split(/\s+/).map { |x| "<#{x}>" }.join(" "), } Message.new :source => source, :source_info => doc[:source_info].to_i, :labels => doc[:label].split(" ").map { |s| s.intern }, :snippet => doc[:snippet], :header => fake_header end def fresh_thread_id; @next_thread_id += 1; end def wrap_subj subj; "__START_SUBJECT__ #{subj} __END_SUBJECT__"; end def unwrap_subj subj; subj =~ /__START_SUBJECT__ (.*?) __END_SUBJECT__/ && $1; end def drop_entry docno; @index.delete docno; end def load_entry_for_id mid results = @index.search(Ferret::Search::TermQuery.new(:message_id, mid)) return if results.total_hits == 0 docid = results.hits[0].doc [docid, @index[docid]] end def load_contacts emails, h={} q = Ferret::Search::BooleanQuery.new true emails.each do |e| qq = Ferret::Search::BooleanQuery.new true qq.add_query Ferret::Search::TermQuery.new(:from, e), :should qq.add_query Ferret::Search::TermQuery.new(:to, e), :should q.add_query qq end q.add_query Ferret::Search::TermQuery.new(:label, "spam"), :must_not Redwood::log "contact search: #{q}" contacts = {} num = h[:num] || 20 @index.search_each(q, :sort => "date DESC", :limit => :all) do |docid, score| break if contacts.size >= num #Redwood::log "got message #{docid} to: #{@index[docid][:to].inspect} and from: #{@index[docid][:from].inspect}" f = @index[docid][:from] t = @index[docid][:to] if AccountManager.is_account_email? f t.split(" ").each { |e| contacts[PersonManager.person_for(e)] = true } else contacts[PersonManager.person_for(f)] = true end end contacts.keys.compact end def load_sources fn=Redwood::SOURCE_FN source_array = (Redwood::load_yaml_obj(fn) || []).map { |o| Recoverable.new o } @sources = Hash[*(source_array).map { |s| [s.id, s] }.flatten] @sources_dirty = false end def has_any_from_source_with_label? source, label q = Ferret::Search::BooleanQuery.new q.add_query Ferret::Search::TermQuery.new("source_id", source.id.to_s), :must q.add_query Ferret::Search::TermQuery.new("label", label.to_s), :must index.search(q, :limit => 1).total_hits > 0 end protected ## do any specialized parsing ## returns nil and flashes error message if parsing failed def parse_user_query_string s extraopts = {} subs = s.gsub(/\b(to|from):(\S+)\b/) do field, name = $1, $2 if(p = ContactManager.contact_for(name)) [field, p.email] elsif name == "me" [field, "(" + AccountManager.user_emails.join("||") + ")"] else [field, name] end.join(":") end ## if we see a label:deleted or a label:spam term anywhere in the query ## string, we set the extra load_spam or load_deleted options to true. ## bizarre? well, because the query allows arbitrary parenthesized boolean ## expressions, without fully parsing the query, we can't tell whether ## the user is explicitly directing us to search spam messages or not. ## e.g. if the string is -(-(-(-(-label:spam)))), does the user want to ## search spam messages or not? ## ## so, we rely on the fact that turning these extra options ON turns OFF ## the adding of "-label:deleted" or "-label:spam" terms at the very ## final stage of query processing. if the user wants to search spam ## messages, not adding that is the right thing; if he doesn't want to ## search spam messages, then not adding it won't have any effect. extraopts[:load_spam] = true if subs =~ /\blabel:spam\b/ extraopts[:load_deleted] = true if subs =~ /\blabel:deleted\b/ ## gmail style "is" operator subs = subs.gsub(/\b(is):(\S+)\b/) do field, label = $1, $2 case label when "read" "-label:unread" when "spam" extraopts[:load_spam] = true "label:spam" when "deleted" extraopts[:load_deleted] = true "label:deleted" else "label:#{$2}" end end if $have_chronic chronic_failure = false subs = subs.gsub(/\b(before|on|in|during|after):(\((.+?)\)\B|(\S+)\b)/) do break if chronic_failure field, datestr = $1, ($3 || $4) realdate = Chronic.parse(datestr, :guess => false, :context => :none) if realdate case field when "after" Redwood::log "chronic: translated #{field}:#{datestr} to #{realdate.end}" "date:(>= #{sprintf "%012d", realdate.end.to_i})" when "before" Redwood::log "chronic: translated #{field}:#{datestr} to #{realdate.begin}" "date:(<= #{sprintf "%012d", realdate.begin.to_i})" else Redwood::log "chronic: translated #{field}:#{datestr} to #{realdate}" "date:(<= #{sprintf "%012d", realdate.end.to_i}) date:(>= #{sprintf "%012d", realdate.begin.to_i})" end else BufferManager.flash "Can't understand date #{datestr.inspect}!" chronic_failure = true end end subs = nil if chronic_failure end if subs [@qparser.parse(subs), extraopts] else nil end end def build_query opts query = Ferret::Search::BooleanQuery.new query.add_query opts[:qobj], :must if opts[:qobj] labels = ([opts[:label]] + (opts[:labels] || [])).compact labels.each { |t| query.add_query Ferret::Search::TermQuery.new("label", t.to_s), :must } if opts[:participants] q2 = Ferret::Search::BooleanQuery.new opts[:participants].each do |p| q2.add_query Ferret::Search::TermQuery.new("from", p.email), :should q2.add_query Ferret::Search::TermQuery.new("to", p.email), :should end query.add_query q2, :must end query.add_query Ferret::Search::TermQuery.new("label", "spam"), :must_not unless opts[:load_spam] || labels.include?(:spam) query.add_query Ferret::Search::TermQuery.new("label", "deleted"), :must_not unless opts[:load_deleted] || labels.include?(:deleted) query.add_query Ferret::Search::TermQuery.new("label", "killed"), :must_not if opts[:skip_killed] query end def save_sources fn=Redwood::SOURCE_FN if @sources_dirty || @sources.any? { |id, s| s.dirty? } bakfn = fn + ".bak" if File.exists? fn File.chmod 0600, fn FileUtils.mv fn, bakfn, :force => true unless File.exists?(bakfn) && File.size(fn) == 0 end Redwood::save_yaml_obj sources.sort_by { |s| s.id.to_i }, fn, true File.chmod 0600, fn end @sources_dirty = false end end end