/******/ (() => { // webpackBootstrap /******/ var __webpack_modules__ = ([ /* 0 */, /* 1 */ /***/ (() => { window.up = { version: '3.2.1' }; /***/ }), /* 2 */ /***/ (() => { up.mockable = function (originalFn) { if (window.jasmine) { let name = originalFn.name; let obj = { [name]: originalFn }; let mockableFn = function () { return obj[name].apply(this, arguments); }; mockableFn.mock = () => spyOn(obj, name); return mockableFn; } else { return originalFn; } }; /***/ }), /* 3 */ /***/ (() => { up.util = (function () { function noop() { } function asyncNoop() { return Promise.resolve(); } function memoize(func) { let cachedValue, cached; return function (...args) { if (cached) { return cachedValue; } else { cached = true; return cachedValue = func.apply(this, args); } }; } const NORMALIZE_URL_DEFAULTS = { host: 'cross-domain', }; function normalizeURL(url, options) { options = newOptions(options, NORMALIZE_URL_DEFAULTS); const parts = parseURL(url); let normalized = ''; if (options.host === 'cross-domain') { options.host = isCrossOrigin(parts); } if (options.host) { normalized += parts.protocol + "//" + parts.host; } let { pathname } = parts; if (options.trailingSlash === false && pathname !== '/') { pathname = pathname.replace(/\/$/, ''); } normalized += pathname; if (options.search !== false) { normalized += parts.search; } if (options.hash !== false) { normalized += parts.hash; } return normalized; } function matchURLs(leftURL, rightURL) { return normalizeURL(leftURL) === normalizeURL(rightURL); } const APP_PROTOCOL = location.protocol; const APP_HOSTNAME = location.hostname; function isCrossOrigin(urlOrAnchor) { if (isString(urlOrAnchor) && (urlOrAnchor.indexOf('//') === -1)) { return false; } const parts = parseURL(urlOrAnchor); return (APP_HOSTNAME !== parts.hostname) || (APP_PROTOCOL !== parts.protocol); } function parseURL(url) { if (url.pathname) { return url; } let link = document.createElement('a'); link.href = url; return link; } function normalizeMethod(method) { return method ? method.toUpperCase() : 'GET'; } function methodAllowsPayload(method) { return (method !== 'GET') && (method !== 'HEAD'); } function iteratee(block) { if (isString(block)) { return item => item[block]; } else { return block; } } function map(list, block) { if (list.length === 0) { return []; } block = iteratee(block); let mapped = []; let i = 0; for (let item of list) { mapped.push(block(item, i++)); } return mapped; } function mapObject(array, pairer) { const merger = function (object, pair) { object[pair[0]] = pair[1]; return object; }; return map(array, pairer).reduce(merger, {}); } function each(array, block) { let i = 0; for (let item of array) { block(item, i++); } } function isNull(object) { return object === null; } function isUndefined(object) { return object === undefined; } const isDefined = negate(isUndefined); function isMissing(object) { return isUndefined(object) || isNull(object); } const isGiven = negate(isMissing); function isBlank(value) { if (isMissing(value)) { return true; } if (isObject(value) && value[isBlank.key]) { return value[isBlank.key](); } if (isString(value) || isList(value)) { return value.length === 0; } if (isOptions(value)) { return Object.keys(value).length === 0; } return false; } isBlank.key = 'up.util.isBlank'; function presence(value, tester = isPresent) { if (tester(value)) { return value; } } const isPresent = negate(isBlank); function isFunction(object) { return typeof (object) === 'function'; } function isString(object) { return (typeof (object) === 'string') || object instanceof String; } function isBoolean(object) { return (typeof (object) === 'boolean') || object instanceof Boolean; } function isNumber(object) { return (typeof (object) === 'number') || object instanceof Number; } function isOptions(object) { return (typeof (object) === 'object') && !isNull(object) && (isUndefined(object.constructor) || (object.constructor === Object)); } function isObject(object) { const typeOfResult = typeof (object); return ((typeOfResult === 'object') && !isNull(object)) || (typeOfResult === 'function'); } function isElement(object) { return object instanceof Element; } function isRegExp(object) { return object instanceof RegExp; } function isError(object) { return object instanceof Error; } function isJQuery(object) { return up.browser.canJQuery() && object instanceof jQuery; } function isElementish(object) { return !!(object && (object.addEventListener || object[0]?.addEventListener)); } function isPromise(object) { return isObject(object) && isFunction(object.then); } const { isArray } = Array; function isFormData(object) { return object instanceof FormData; } function toArray(value) { return isArray(value) ? value : copyArrayLike(value); } function isList(value) { return isArray(value) || isNodeList(value) || isArguments(value) || isJQuery(value) || isHTMLCollection(value); } function isNodeList(value) { return value instanceof NodeList; } function isHTMLCollection(value) { return value instanceof HTMLCollection; } function isArguments(value) { return Object.prototype.toString.call(value) === '[object Arguments]'; } function nullToUndefined(value) { if (!isNull(value)) { return value; } } function wrapList(value) { if (isList(value)) { return value; } else if (isMissing(value)) { return []; } else { return [value]; } } function copy(value) { if (isObject(value) && value[copy.key]) { value = value[copy.key](); } else if (isList(value)) { value = copyArrayLike(value); } else if (isOptions(value)) { value = Object.assign({}, value); } return value; } function copyArrayLike(arrayLike) { return Array.prototype.slice.call(arrayLike); } copy.key = 'up.util.copy'; Date.prototype[copy.key] = function () { return new Date(+this); }; function merge(...sources) { return Object.assign({}, ...sources); } function mergeDefined(...sources) { const result = {}; for (let source of sources) { if (source) { for (let key in source) { const value = source[key]; if (isDefined(value)) { result[key] = value; } } } } return result; } function newOptions(object, defaults) { if (defaults) { return merge(defaults, object); } else if (object) { return copy(object); } else { return {}; } } function parseArgIntoOptions(args, argKey) { let options = extractOptions(args); if (isDefined(args[0])) { options = copy(options); options[argKey] = args[0]; } return options; } function findInList(list, tester) { tester = iteratee(tester); let match; for (let element of list) { if (tester(element)) { match = element; break; } } return match; } function some(list, tester) { return !!findResult(list, tester); } function findResult(list, tester) { tester = iteratee(tester); let i = 0; for (let item of list) { const result = tester(item, i++); if (result) { return result; } } } function every(list, tester) { tester = iteratee(tester); let match = true; let i = 0; for (let item of list) { if (!tester(item, i++)) { match = false; break; } } return match; } function compact(array) { return filterList(array, isGiven); } function filterMap(list, mapping) { return filterList(map(list, mapping), isDefined); } function compactObject(object) { return pickBy(object, isGiven); } function uniq(array) { if (array.length < 2) { return array; } return Array.from(new Set(array)); } function uniqBy(array, mapper) { if (array.length < 2) { return array; } mapper = iteratee(mapper); const seenElements = new Set(); return filterList(array, function (elem, index) { const mapped = mapper(elem, index); if (seenElements.has(mapped)) { return false; } else { seenElements.add(mapped); return true; } }); } function filterList(list, tester) { tester = iteratee(tester); const matches = []; each(list, function (element, index) { if (tester(element, index)) { return matches.push(element); } }); return matches; } function reject(list, tester) { tester = negate(iteratee(tester)); return filterList(list, tester); } function intersect(array1, array2) { return filterList(array1, element => contains(array2, element)); } function scheduleTimer(millis, callback) { return setTimeout(callback, millis); } function queueTask(task) { return setTimeout(task); } function queueMicrotask(task) { return Promise.resolve().then(task); } function last(value) { return value[value.length - 1]; } function contains(value, subValue) { return value.indexOf(subValue) >= 0; } function objectContains(object, subObject) { const reducedValue = pick(object, Object.keys(subObject)); return isEqual(subObject, reducedValue); } function pick(object, keys) { const filtered = {}; for (let key of keys) { if (key in object) { filtered[key] = object[key]; } } return filtered; } function pickBy(object, tester) { tester = iteratee(tester); const filtered = {}; for (let key in object) { const value = object[key]; if (tester(value, key, object)) { filtered[key] = object[key]; } } return filtered; } function omit(object, keys) { return pickBy(object, (_value, key) => !contains(keys, key)); } function unresolvablePromise() { return new Promise(noop); } function remove(array, element) { const index = array.indexOf(element); if (index >= 0) { array.splice(index, 1); return element; } } function evalOption(value, ...args) { return isFunction(value) ? value(...args) : value; } function evalAutoOption(value, autoMeans, ...args) { value = evalOption(value, ...args); if (value === 'auto') { value = evalOption(autoMeans, ...args); } return value; } const ESCAPE_HTML_ENTITY_MAP = { "&": "&", "<": "<", ">": ">", '"': '"', "'": ''' }; function escapeHTML(string) { return string.replace(/[&<>"']/g, char => ESCAPE_HTML_ENTITY_MAP[char]); } function escapeRegExp(string) { return string.replace(/[\\^$*+?.()|[\]{}]/g, '\\$&'); } function pluckKey(object, key) { const value = object[key]; delete object[key]; return value; } function renameKey(object, oldKey, newKey) { return object[newKey] = pluckKey(object, oldKey); } function extractLastArg(args, tester) { if (tester(last(args))) { return args.pop(); } } function extractCallback(args) { return extractLastArg(args, isFunction); } function extractOptions(args) { return extractLastArg(args, isOptions) || {}; } function identity(arg) { return arg; } function sequence(functions) { functions = compact(functions); return (...args) => map(functions, fn => fn(...args)); } function flatten(array) { const flattened = []; for (let object of array) { if (isList(object)) { flattened.push(...object); } else { flattened.push(object); } } return flattened; } function flatMap(array, block) { return flatten(map(array, block)); } function always(promise, callback = identity) { return promise.then(callback, callback); } function newDeferred() { let resolveFn; let rejectFn; const nativePromise = new Promise(function (givenResolve, givenReject) { resolveFn = givenResolve; rejectFn = givenReject; }); nativePromise.resolve = resolveFn; nativePromise.reject = rejectFn; return nativePromise; } function isBasicObjectProperty(k) { return Object.prototype.hasOwnProperty(k); } function isEqual(a, b) { if (a?.valueOf) { a = a.valueOf(); } if (b?.valueOf) { b = b.valueOf(); } if (typeof (a) !== typeof (b)) { return false; } else if (isList(a) && isList(b)) { return isEqualList(a, b); } else if (isObject(a) && a[isEqual.key]) { return a[isEqual.key](b); } else if (isOptions(a) && isOptions(b)) { const aKeys = Object.keys(a); const bKeys = Object.keys(b); if (isEqualList(aKeys, bKeys)) { return every(aKeys, aKey => isEqual(a[aKey], b[aKey])); } else { return false; } } else { return a === b; } } isEqual.key = 'up.util.isEqual'; function isEqualList(a, b) { return (a.length === b.length) && every(a, (elem, index) => isEqual(elem, b[index])); } const PARSE_TOKEN_PATTERNS = { 'space/or': /\s+(?:or\s+)?/, 'or': /\s+or\s+/, 'comma': /\s*,\s*/ }; function parseTokens(value, options = {}) { if (isString(value)) { value = value.trim(); if (options.json && /^\[.*]$/.test(value)) { return JSON.parse(value); } else { let separator = options.separator || 'space/or'; let pattern = PARSE_TOKEN_PATTERNS[separator]; return value.split(pattern); } } else { return wrapList(value); } } function wrapValue(constructor, ...args) { return (args[0] instanceof constructor) ? args[0] : new constructor(...args); } let nextUid = 0; function uid() { return nextUid++; } function reverse(list) { return copy(list).reverse(); } function renameKeys(object, renameKeyFn) { const renamed = {}; for (let key in object) { renamed[renameKeyFn(key)] = object[key]; } return renamed; } function camelToKebabCase(str) { return str.replace(/[A-Z]/g, char => '-' + char.toLowerCase()); } function lowerCaseFirst(str) { return str[0].toLowerCase() + str.slice(1); } function upperCaseFirst(str) { return str[0].toUpperCase() + str.slice(1); } function defineGetter(object, prop, get) { Object.defineProperty(object, prop, { get }); } function defineDelegates(object, props, targetProvider) { for (let prop of props) { Object.defineProperty(object, prop, { get() { const target = targetProvider.call(this); let value = target[prop]; if (isFunction(value)) { value = value.bind(target); } return value; }, set(newValue) { const target = targetProvider.call(this); target[prop] = newValue; } }); } } function stringifyArg(arg, placeholder = '%o') { let string; const maxLength = 200; if (placeholder === '%c') { return ''; } if (placeholder === '%s' && isGiven(arg)) { arg = arg.toString(); } if (isString(arg)) { string = arg.trim().replace(/[\n\r\t ]+/g, ' '); if (placeholder === '%o') { string = JSON.stringify(string); } } else if (isUndefined(arg)) { string = 'undefined'; } else if (isNumber(arg) || isFunction(arg)) { string = arg.toString(); } else if (isArray(arg)) { string = `[${map(arg, stringifyArg).join(', ')}]`; } else if (isJQuery(arg)) { string = `$(${map(arg, stringifyArg).join(', ')})`; } else if (isElement(arg)) { string = `<${arg.tagName.toLowerCase()}`; for (let attr of ['id', 'up-id', 'name', 'class']) { let value = arg.getAttribute(attr); if (value) { string += ` ${attr}="${value}"`; } } string += ">"; } else if (isRegExp(arg) || isError(arg)) { string = arg.toString(); } else { try { string = JSON.stringify(arg); } catch (error) { if (error.name === 'TypeError') { string = '(circular structure)'; } else { throw error; } } } if (string.length > maxLength) { string = `${string.substr(0, maxLength)}…${last(string)}`; } return string; } const SPRINTF_PLACEHOLDERS = /%[oOdisfc]/g; function sprintf(message, ...args) { return message.replace(SPRINTF_PLACEHOLDERS, (placeholder) => stringifyArg(args.shift(), placeholder)); } function negate(fn) { return function (...args) { return !fn(...args); }; } function useMemoizeCacheEntry(cacheEntry) { if (cacheEntry.error) { throw cacheEntry.error; } else { return cacheEntry.value; } } function buildMemoizeCacheEntry(oldImpl, self, args) { try { return { value: oldImpl.apply(self, args) }; } catch (e) { return { error: e }; } } function memoizeMethod(object, propOrProps) { for (let prop of wrapList(propOrProps)) { let oldImpl = object[prop]; object[prop] = function (...args) { var _a; let cache = this[_a = `__${prop}MemoizeCache`] || (this[_a] = {}); let cacheKey = JSON.stringify(args); cache[cacheKey] || (cache[cacheKey] = buildMemoizeCacheEntry(oldImpl, this, args)); return useMemoizeCacheEntry(cache[cacheKey]); }; } } function safeStringifyJSON(value) { let json = JSON.stringify(value); return escapeHighASCII(json); } function escapeHighASCII(string) { let unicodeEscape = (char) => "\\u" + char.charCodeAt(0).toString(16).padStart(4, '0'); return string.replace(/[^\x00-\x7F]/g, unicodeEscape); } function variant(source, changes = {}) { let variant = Object.create(source); Object.assign(variant, changes); return variant; } return { parseURL, normalizeURL, matchURLs, normalizeMethod, methodAllowsPayload, copy, copyArrayLike, merge, mergeDefined, options: newOptions, parseArgIntoOptions, each, map, flatMap, mapObject, findResult, some, every, find: findInList, filter: filterList, filterMap: filterMap, reject, intersect, compact, compactObject, uniq, uniqBy, last, isNull, isDefined, isUndefined, isGiven, isMissing, isPresent, isBlank, presence, isObject, isFunction, isString, isBoolean, isNumber, isElement, isJQuery, isElementish, isPromise, isOptions, isArray, isFormData, isList, isRegExp, timer: scheduleTimer, contains, objectContains, toArray, pick, pickBy, omit, unresolvablePromise, remove, memoize, pluckKey, renameKey, extractOptions, extractCallback, noop, asyncNoop, identity, escapeHTML, escapeRegExp, sequence, evalOption, evalAutoOption, flatten, newDeferred, always, isBasicObjectProperty, isCrossOrigin, task: queueTask, microtask: queueMicrotask, isEqual, parseTokens, wrapList, wrapValue, uid, upperCaseFirst, lowerCaseFirst, getter: defineGetter, delegate: defineDelegates, reverse, camelToKebabCase, nullToUndefined, sprintf, renameKeys, negate, memoizeMethod, safeStringifyJSON, variant, }; })(); /***/ }), /* 4 */ /***/ (() => { up.error = (function () { function fail(...args) { throw new up.Error(args); } function isCritical(error) { return (typeof error !== 'object') || ((error.name !== 'AbortError') && !(error instanceof up.RenderResult) && !(error instanceof up.Response)); } function muteUncriticalRejection(promise) { return promise.catch(rethrowCritical); } function muteUncriticalSync(block) { try { return block(); } catch (e) { rethrowCritical(e); } } function rethrowCritical(value) { if (isCritical(value)) { throw value; } } return { fail, rethrowCritical, isCritical, muteUncriticalRejection, muteUncriticalSync, }; })(); up.fail = up.error.fail; /***/ }), /* 5 */ /***/ (() => { up.migrate = { config: {} }; /***/ }), /* 6 */ /***/ (() => { up.browser = (function () { const u = up.util; function submitForm(form) { form.submit(); } function canPushState() { return up.protocol.initialRequestMethod() === 'GET'; } function canJQuery() { return !!window.jQuery; } const canEval = u.memoize(function () { try { return new Function('return true')(); } catch { return false; } }); function popCookie(name) { let value = document.cookie.match(new RegExp(name + "=(\\w+)"))?.[1]; if (value) { document.cookie = name + '=;Max-Age=0;Path=/'; return value; } } function assertConfirmed(options) { const confirmed = !options.confirm || window.confirm(options.confirm); if (!confirmed) { throw new up.Aborted('User canceled action'); } return true; } return { submitForm, canPushState, canJQuery, canEval, assertConfirmed, popCookie, }; })(); /***/ }), /* 7 */ /***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => { __webpack_require__(8); up.element = (function () { const u = up.util; function first(...args) { const selector = args.pop(); const root = args[0] || document; return root.querySelector(selector); } function subtree(root, selector) { const results = []; if (root.matches(selector)) { results.push(root); } results.push(...root.querySelectorAll(selector)); return results; } function isInSubtree(root, selectorOrElement) { const element = getOne(selectorOrElement); return Node.prototype.contains.call(root, element); } function ancestor(element, selector) { let parentElement = element.parentElement; if (parentElement) { if (parentElement.matches(selector)) { return parentElement; } else { return ancestor(parentElement, selector); } } } function around(element, selector) { return getList(element.closest(selector), subtree(element, selector)); } function getOne(...args) { const value = args.pop(); if (u.isElement(value)) { return value; } else if (u.isString(value)) { return first(...args, value); } else if (u.isList(value)) { if (value.length > 1) { up.fail('up.element.get(): Cannot cast multiple elements (%o) to a single element', value); } return value[0]; } else { return value; } } function getList(...args) { return u.flatMap(args, valueToList); } function valueToList(value) { if (u.isString(value)) { return document.querySelectorAll(value); } else { return u.wrapList(value); } } function hide(element) { element.setAttribute('hidden', ''); } function show(element) { element.removeAttribute('hidden'); if (element.style.display === 'none') { element.style.display = ''; } } function toggle(element, newVisible) { if (newVisible == null) { newVisible = !isVisible(element); } (newVisible ? show : hide)(element); } function toggleAttr(element, attr, value, newPresent) { if (newPresent == null) { newPresent = !element.hasAttribute(attr); } if (newPresent) { return element.setAttribute(attr, value); } else { return element.removeAttribute(attr); } } function setAttrs(element, attrs) { for (let key in attrs) { const value = attrs[key]; if (u.isGiven(value)) { element.setAttribute(key, value); } else { element.removeAttribute(key); } } } function setTemporaryAttrs(element, attrs) { const oldAttrs = {}; for (let key of Object.keys(attrs)) { oldAttrs[key] = element.getAttribute(key); } setAttrs(element, attrs); return () => setAttrs(element, oldAttrs); } function metaContent(name) { const selector = "meta" + attrSelector('name', name); return first(selector)?.getAttribute('content'); } function insertBefore(existingElement, newElement) { existingElement.insertAdjacentElement('beforebegin', newElement); } function createFromSelector(selector, attrs) { let { includePath } = parseSelector(selector); let rootElement; let depthElement; let previousElement; for (let includeSegment of includePath) { let { tagName, id, classNames, attributes } = includeSegment; if (!tagName || tagName === '*') { tagName = 'div'; } depthElement = document.createElement(tagName); if (!rootElement) { rootElement = depthElement; } if (id) { depthElement.id = id; } for (let className of classNames) { depthElement.classList.add(className); } for (let attributeName in attributes) { let attributeValue = attributes[attributeName]; depthElement.setAttribute(attributeName, attributeValue || ''); } previousElement?.appendChild(depthElement); previousElement = depthElement; } if (attrs) { let value; if (value = u.pluckKey(attrs, 'class')) { for (let klass of u.wrapList(value)) { rootElement.classList.add(klass); } } if (value = u.pluckKey(attrs, 'style')) { setInlineStyle(rootElement, value); } if (value = u.pluckKey(attrs, 'text')) { rootElement.textContent = value; } if (value = u.pluckKey(attrs, 'content')) { rootElement.innerHTML = value; } setAttrs(rootElement, attrs); } return rootElement; } function parseSelector(selector) { let excludeRaw; const includeRaw = selector.replace(/:not\([^)]+\)/, function (match) { excludeRaw = match; return ''; }); const [includeSelectorWithoutAttrValues, attrValues] = removeAttrSelectorValues(includeRaw); const includeSegments = includeSelectorWithoutAttrValues.split(/[ >]+/); let includePath = includeSegments.map(function (depthSelector) { let parsed = { tagName: null, classNames: [], id: null, attributes: {} }; depthSelector = depthSelector.replace(/^[\w-*]+/, function (match) { parsed.tagName = match; return ''; }); depthSelector = depthSelector.replace(/#([\w-]+)/, function (_match, id) { parsed.id = id; return ''; }); depthSelector = depthSelector.replace(/\.([\w-]+)/g, function (_match, className) { parsed.classNames.push(className); return ''; }); if (attrValues.length) { depthSelector = replaceAttrSelectors(depthSelector, function ({ name }) { parsed.attributes[name] = attrValues.shift(); return ''; }); } if (depthSelector) { up.fail('Cannot parse selector: ' + selector); } return parsed; }); return { includePath, includeRaw, excludeRaw, }; } const ATTR_SELECTOR_PATTERN = /\[([\w-]+)(?:([~|^$*]?=)(["'])?([^\3\]]*?)\3)?]/g; function replaceAttrSelectors(string, replacement) { return string.replace(ATTR_SELECTOR_PATTERN, function (_match, name, operator, quote, value) { if (value) { value = value.replace(/\\([\\"'])/, '$1'); } return replacement({ name, operator, quote, value }); }); } function removeAttrSelectorValues(selector) { let values = []; selector = replaceAttrSelectors(selector, function ({ name, value }) { values.push(value); return `[${name}]`; }); return [selector, values]; } function affix(parent, ...args) { let position, selector; const attributes = u.extractOptions(args); if (args.length === 2) { [position, selector] = args; } else { position = 'beforeend'; selector = args[0]; } const element = createFromSelector(selector, attributes); parent.insertAdjacentElement(position, element); return element; } const SINGLETON_TAG_NAMES = ['HTML', 'BODY', 'HEAD', 'TITLE']; const isSingleton = up.mockable(element => element.matches(SINGLETON_TAG_NAMES.join(','))); function elementTagName(element) { return element.tagName.toLowerCase(); } function attrSelector(attribute, value) { if (u.isGiven(value)) { value = value.replace(/"/g, '\\"'); return `[${attribute}="${value}"]`; } else { return `[${attribute}]`; } } function idSelector(id) { if (id.match(/^[a-z0-9\-_]+$/i)) { return `#${id}`; } else { return attrSelector('id', id); } } function classSelector(klass) { klass = klass.replace(/[^\w-]/g, '\\$&'); return `.${klass}`; } function createBrokenDocumentFromHTML(html) { return new DOMParser().parseFromString(html, 'text/html'); } function fixScriptish(scriptish) { let clone = document.createElement(scriptish.tagName); for (let { name, value } of scriptish.attributes) { clone.setAttribute(name, value); } clone.textContent = scriptish.innerHTML; scriptish.replaceWith(clone); } function createFromHTML(html) { const range = document.createRange(); range.setStart(document.body, 0); const fragment = range.createContextualFragment(html.trim()); let elements = fragment.childNodes; if (elements.length !== 1) { throw new Error('HTML must have a single root element'); } return elements[0]; } function getRoot() { return document.documentElement; } function paint(element) { element.offsetHeight; } function concludeCSSTransition(element) { const undo = setTemporaryStyle(element, { transition: 'none' }); paint(element); return undo; } function hasCSSTransition(elementOrStyleHash) { let styleHash; if (u.isOptions(elementOrStyleHash)) { styleHash = elementOrStyleHash; } else { styleHash = computedStyle(elementOrStyleHash); } const prop = styleHash.transitionProperty; const duration = styleHash.transitionDuration; const noTransition = ((prop === 'none') || ((prop === 'all') && (duration === 0))); return !noTransition; } function fixedToAbsolute(element) { const elementRectAsFixed = element.getBoundingClientRect(); element.style.position = 'absolute'; const offsetParentRect = element.offsetParent.getBoundingClientRect(); setInlineStyle(element, { left: elementRectAsFixed.left - computedStyleNumber(element, 'margin-left') - offsetParentRect.left, top: elementRectAsFixed.top - computedStyleNumber(element, 'margin-top') - offsetParentRect.top, right: '', bottom: '' }); } function setMissingAttrs(element, attrs) { for (let key in attrs) { setMissingAttr(element, key, attrs[key]); } } function setMissingAttr(element, key, value) { if (u.isMissing(element.getAttribute(key))) { element.setAttribute(key, value); } } function unwrap(wrapper) { preservingFocus(function () { const parent = wrapper.parentNode; const wrappedNodes = u.toArray(wrapper.childNodes); u.each(wrappedNodes, wrappedNode => parent.insertBefore(wrappedNode, wrapper)); parent.removeChild(wrapper); }); } function wrapChildren(element) { let childNode; const wrapper = document.createElement('up-wrapper'); while ((childNode = element.firstChild)) { wrapper.appendChild(childNode); } element.appendChild(wrapper); return wrapper; } function isWrapper(element) { return element.matches('up-wrapper'); } function preservingFocus(fn) { const oldFocusElement = document.activeElement; try { return fn(); } finally { if (oldFocusElement && oldFocusElement !== document.activeElement) { oldFocusElement.focus({ preventScroll: true }); } } } function stringAttr(element, attribute) { return u.nullToUndefined(element.getAttribute(attribute)); } function booleanAttr(element, attribute, pass) { if (!element.hasAttribute(attribute)) return; const value = stringAttr(element, attribute); switch (value) { case 'false': { return false; } case 'true': case '': case attribute: { return true; } default: { if (pass) { return value; } else { return true; } } } } function booleanOrStringAttr(element, attribute) { return booleanAttr(element, attribute, true); } function numberAttr(element, attribute) { let value = element.getAttribute(attribute); if (value) { value = value.replace(/_/g, ''); if (value.match(/^[\d.]+$/)) { return parseFloat(value); } } } function jsonAttr(element, attribute) { let json = element.getAttribute?.(attribute)?.trim(); if (json) { return JSON.parse(json); } } function callbackAttr(link, attr, { exposedKeys = [], mainKey = 'event' } = {}) { let code = link.getAttribute(attr); if (code) { const callback = up.NonceableCallback.fromString(code).toFunction(mainKey, ...exposedKeys); return function (event) { const exposedValues = Object.values(u.pick(event, exposedKeys)); return callback.call(link, event, ...exposedValues); }; } } function closestAttr(element, attr, parseFn = stringAttr) { let match = element.closest('[' + attr + ']'); if (match) { return parseFn(match, attr); } } function setTemporaryStyle(element, newStyles) { const oldStyles = inlineStyle(element, Object.keys(newStyles)); setInlineStyle(element, newStyles); return () => setInlineStyle(element, oldStyles); } function addTemporaryClass(element, klass) { element.classList.add(klass); return () => element.classList.remove(klass); } function setTemporaryAttr(element, attr, value) { element.setAttribute(attr, value); return () => element.removeAttribute(element, attr); } function computedStyle(element, props) { const style = window.getComputedStyle(element); return extractFromStyleObject(style, props); } function computedStyleNumber(element, prop) { const rawValue = computedStyle(element, prop); if (u.isGiven(rawValue)) { return parseFloat(rawValue); } } function inlineStyle(element, props) { const { style } = element; return extractFromStyleObject(style, props); } function extractFromStyleObject(style, keyOrKeys) { if (u.isString(keyOrKeys)) { return style[keyOrKeys]; } else { return u.pick(style, keyOrKeys); } } function setInlineStyle(element, props) { if (u.isString(props)) { element.setAttribute('style', props); } else { const { style } = element; for (let key in props) { let value = props[key]; value = normalizeStyleValueForWrite(key, value); style[key] = value; } } } function normalizeStyleValueForWrite(key, value) { if (u.isMissing(value)) { value = ''; } else if (CSS_LENGTH_PROPS.has(key.toLowerCase().replace(/-/, ''))) { value = cssLength(value); } return value; } const CSS_LENGTH_PROPS = new Set([ 'top', 'right', 'bottom', 'left', 'padding', 'paddingtop', 'paddingright', 'paddingbottom', 'paddingleft', 'margin', 'margintop', 'marginright', 'marginbottom', 'marginleft', 'borderwidth', 'bordertopwidth', 'borderrightwidth', 'borderbottomwidth', 'borderleftwidth', 'width', 'height', 'maxwidth', 'maxheight', 'minwidth', 'minheight', ]); function cssLength(obj) { if (u.isNumber(obj) || (u.isString(obj) && /^\d+$/.test(obj))) { return obj.toString() + "px"; } else { return obj; } } function isVisible(element) { return !!(element.offsetWidth || element.offsetHeight || element.getClientRects().length); } function upAttrs(element) { const upAttributePattern = /^up-/; const attrs = {}; for (let attribute of element.attributes) { const { name } = attribute; if (name.match(upAttributePattern)) { attrs[name] = attribute.value; } } return attrs; } function cleanJQuery(element) { if (up.browser.canJQuery()) { jQuery(element).remove(); } } return { subtree, isInSubtree, closestAttr, ancestor, around, get: getOne, list: getList, toggle, hide, show, metaContent, insertBefore, createFromSelector, setAttrs, setTemporaryAttrs, affix, idSelector, classSelector, isSingleton, attrSelector, tagName: elementTagName, createBrokenDocumentFromHTML, fixScriptish, createFromHTML, get root() { return getRoot(); }, paint, concludeCSSTransition, hasCSSTransition, fixedToAbsolute, setMissingAttrs, setMissingAttr, unwrap, wrapChildren, isWrapper, attr: stringAttr, booleanAttr, numberAttr, jsonAttr, callbackAttr, booleanOrStringAttr, setTemporaryStyle, style: computedStyle, styleNumber: computedStyleNumber, inlineStyle, setStyle: setInlineStyle, isVisible, upAttrs, toggleAttr, addTemporaryClass, setTemporaryAttr, cleanJQuery, parseSelector, }; })(); /***/ }), /* 8 */ /***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => { "use strict"; __webpack_require__.r(__webpack_exports__); // extracted by mini-css-extract-plugin /***/ }), /* 9 */ /***/ (() => { up.Error = class Error extends window.Error { constructor(message, props = {}) { if (Array.isArray(message)) { message = up.util.sprintf(...message); } super(message); let name = 'up.' + this.constructor.name; Object.assign(this, { name }, props); } }; /***/ }), /* 10 */ /***/ (() => { up.NotImplemented = class NotImplemented extends up.Error { }; /***/ }), /* 11 */ /***/ (() => { up.Aborted = class Aborted extends up.Error { constructor(message) { super(message, { name: 'AbortError' }); } }; /***/ }), /* 12 */ /***/ (() => { up.CannotCompile = class CannotCompile extends up.Error { }; /***/ }), /* 13 */ /***/ (() => { up.CannotMatch = class CannotMatch extends up.Error { }; /***/ }), /* 14 */ /***/ (() => { up.CannotParse = class CannotParse extends up.Error { }; /***/ }), /* 15 */ /***/ (() => { up.CannotTarget = class CannotTarget extends up.Error { }; /***/ }), /* 16 */ /***/ (() => { up.Offline = class Offline extends up.Error { }; /***/ }), /* 17 */ /***/ (() => { const u = up.util; up.Record = class Record { keys() { throw 'Return an array of keys'; } defaults(_options) { return {}; } constructor(options) { Object.assign(this, this.defaults(options), this.attributes(options)); } attributes(source = this) { return u.pick(source, this.keys()); } [u.copy.key]() { return u.variant(this); } [u.isEqual.key](other) { return (this.constructor === other.constructor) && u.isEqual(this.attributes(), other.attributes()); } }; /***/ }), /* 18 */ /***/ (() => { up.Config = class Config { constructor(blueprintFn = (() => ({}))) { this.blueprintFn = blueprintFn; this.reset(); } reset() { Object.assign(this, this.blueprintFn()); } }; /***/ }), /* 19 */ /***/ (() => { let enabledKey = 'up.log.enabled'; let enabled = false; try { enabled = !!sessionStorage?.getItem(enabledKey); } catch { } up.LogConfig = class LogConfig extends up.Config { constructor() { super(() => ({ banner: true, format: true, })); } get enabled() { return enabled; } set enabled(newEnabled) { enabled = newEnabled; try { sessionStorage?.setItem(enabledKey, newEnabled ? '1' : ''); } catch { } } }; /***/ }), /* 20 */ /***/ (() => { const u = up.util; up.FIFOCache = class FIFOCache { constructor({ capacity = 10, normalizeKey = u.identity } = {}) { this.map = new Map(); this.capacity = capacity; this.normalizeKey = normalizeKey; } get(key) { key = this.normalizeKey(key); return this.map.get(key); } set(key, value) { if (this.map.size === this.capacity) { let oldestKey = this.map.keys().next().value; this.map.delete(oldestKey); } key = this.normalizeKey(key); this.map.set(key, value); } clear() { this.map.clear(); } }; /***/ }), /* 21 */ /***/ (() => { up.Rect = class Rect extends up.Record { keys() { return [ 'left', 'top', 'width', 'height' ]; } get bottom() { return this.top + this.height; } get right() { return this.left + this.width; } static fromElement(element) { return new (this)(element.getBoundingClientRect()); } }; /***/ }), /* 22 */ /***/ (() => { const e = up.element; up.BodyShifter = class BodyShifter { constructor() { this.unshiftFns = []; this.reset(); } reset() { this.unshiftNow(); this.shiftCount = 0; } shift() { this.shiftCount++; if (this.shiftCount > 1) { return; } const scrollbarTookSpace = up.viewport.rootHasReducedWidthFromScrollbar(); const overflowElement = up.viewport.rootOverflowElement(); this.changeStyle(overflowElement, { overflowY: 'hidden' }); if (!scrollbarTookSpace) { return; } const { body } = document; const scrollbarWidth = up.viewport.scrollbarWidth(); const bodyRightPadding = e.styleNumber(body, 'paddingRight'); const bodyRightShift = scrollbarWidth + bodyRightPadding; this.changeStyle(body, { paddingRight: bodyRightShift }); for (let anchor of up.viewport.anchoredRight()) { const elementRight = e.styleNumber(anchor, 'right'); const elementRightShift = scrollbarWidth + elementRight; this.changeStyle(anchor, { right: elementRightShift }); } } changeStyle(element, styles) { this.unshiftFns.push(e.setTemporaryStyle(element, styles)); } unshift() { this.shiftCount--; if (this.shiftCount == 0) { this.unshiftNow(); } } unshiftNow() { let unshiftFn; while (unshiftFn = this.unshiftFns.pop()) { unshiftFn(); } } }; /***/ }), /* 23 */ /***/ (() => { const u = up.util; up.Change = class Change { constructor(options) { this.options = options; } execute() { throw new up.NotImplemented(); } onFinished(renderResult) { return this.options.onFinished?.(renderResult); } improveHistoryValue(existingValue, newValue) { if ((existingValue === false) || u.isString(existingValue)) { return existingValue; } else { return newValue; } } deriveFailOptions() { return up.RenderOptions.deriveFailOptions(this.options); } }; /***/ }), /* 24 */ /***/ (() => { const u = up.util; const e = up.element; up.Change.Addition = class Addition extends up.Change { constructor(options) { super(options); this.responseDoc = options.responseDoc; this.acceptLayer = options.acceptLayer; this.dismissLayer = options.dismissLayer; this.eventPlans = options.eventPlans || []; this.response = options.meta?.response; } handleLayerChangeRequests() { if (this.layer.isOverlay()) { this.tryAcceptLayerFromServer(); this.abortWhenLayerClosed(); this.layer.tryAcceptForLocation(this.responseOption()); this.abortWhenLayerClosed(); this.tryDismissLayerFromServer(); this.abortWhenLayerClosed(); this.layer.tryDismissForLocation(this.responseOption()); this.abortWhenLayerClosed(); } this.layer.asCurrent(() => { for (let eventPlan of this.eventPlans) { up.emit({ ...eventPlan, ...this.responseOption() }); this.abortWhenLayerClosed(); } }); } tryAcceptLayerFromServer() { if (u.isDefined(this.acceptLayer) && this.layer.isOverlay()) { this.layer.accept(this.acceptLayer, this.responseOption()); } } tryDismissLayerFromServer() { if (u.isDefined(this.dismissLayer) && this.layer.isOverlay()) { this.layer.dismiss(this.dismissLayer, this.responseOption()); } } abortWhenLayerClosed() { if (this.layer.isClosed()) { throw new up.Aborted('Layer was closed'); } } setSource({ oldElement, newElement, source }) { if (source === 'keep') { source = (oldElement && up.fragment.source(oldElement)); } if (source) { e.setMissingAttr(newElement, 'up-source', u.normalizeURL(source, { hash: false })); } } setTime({ newElement, time }) { e.setMissingAttr(newElement, 'up-time', time ? time.toUTCString() : false); } setETag({ newElement, etag }) { e.setMissingAttr(newElement, 'up-etag', etag || false); } setReloadAttrs(options) { this.setSource(options); this.setTime(options); this.setETag(options); } responseOption() { return { response: this.response }; } }; /***/ }), /* 25 */ /***/ (() => { var _a; const u = up.util; up.RenderJob = (_a = class RenderJob { constructor(options) { this.options = up.RenderOptions.preprocess(options); this.rendered = this.execute(); } async execute() { try { let result = await this.makeChange(); this.runResultCallbacks(result); return result; } catch (error) { this.runResultCallbacks(error) || this.options.onError?.(error); throw error; } } runResultCallbacks(result) { if (result instanceof up.RenderResult) { if (!result.none) result.options.onRendered?.(result); result.finished.then(result.options.onFinished, u.noop); return true; } } get finished() { return this.awaitFinished(); } async awaitFinished() { try { let result = await this.rendered; return await result.finished; } catch (error) { if (error instanceof up.RenderResult) { throw await error.finished; } else { throw error; } } } makeChange() { this.guardRender(); if (this.options.url) { let onRequest = (request) => this.handleAbortOption(request); this.change = new up.Change.FromURL({ ...this.options, onRequest }); } else if (this.options.response) { this.change = new up.Change.FromResponse(this.options); this.handleAbortOption(null); } else { this.change = new up.Change.FromContent(this.options); this.handleAbortOption(null); } return this.change.execute(); } guardRender() { up.browser.assertConfirmed(this.options); let guardEvent = u.pluckKey(this.options, 'guardEvent'); if (guardEvent) { guardEvent.renderOptions = this.options; if (up.emit(guardEvent, { target: this.options.origin }).defaultPrevented) { let message = `Rendering was prevented by ${guardEvent.type} listener`; up.puts('up.render()', message); throw new up.Aborted(message); } } up.RenderOptions.assertContentGiven(this.options); } handleAbortOption(request) { let { abort } = this.options; if (!abort || !up.network.isBusy()) return; let { fragments, layer, origin } = this.change.getPreflightProps(); let abortOptions = { except: request, logOnce: ['up.render()', 'Change with { abort } option will abort other requests'], }; if (abort === 'target') { up.fragment.abort(fragments, abortOptions); } else if (abort === 'layer') { up.fragment.abort({ ...abortOptions, layer }); } else if (abort === 'all' || abort === true) { up.fragment.abort({ ...abortOptions, layer: 'any' }); } else if (u.isFunction(abort)) { abort(abortOptions); } else { up.fragment.abort(abort, { ...abortOptions, layer, origin }); } } }, (() => { u.delegate(_a.prototype, ['then', 'catch', 'finally'], function () { return this.rendered; }); })(), _a); /***/ }), /* 26 */ /***/ (() => { up.Change.Removal = class Removal extends up.Change { }; /***/ }), /* 27 */ /***/ (() => { up.Change.DestroyFragment = class DestroyFragment extends up.Change.Removal { constructor(options) { super(options); this.layer = up.layer.get(options) || up.layer.current; this.element = this.options.element; this.animation = this.options.animation; this.log = this.options.log; } async execute() { this.parent = this.element.parentNode; up.fragment.markAsDestroying(this.element); if (up.motion.willAnimate(this.element, this.animation, this.options)) { this.emitDestroyed(); await this.animate(); this.wipe(); this.onFinished(); } else { this.wipe(); this.emitDestroyed(); this.onFinished(); } } animate() { return up.motion.animate(this.element, this.animation, this.options); } wipe() { this.layer.asCurrent(() => { up.fragment.abort(this.element); up.syntax.clean(this.element, { layer: this.layer }); up.element.cleanJQuery(this.element); this.element.remove(); }); } emitDestroyed() { up.fragment.emitDestroyed(this.element, { parent: this.parent, log: this.log }); } }; /***/ }), /* 28 */ /***/ (() => { let u = up.util; up.Change.OpenLayer = class OpenLayer extends up.Change.Addition { constructor(options) { super(options); this.target = options.target; this.origin = options.origin; this.baseLayer = options.baseLayer; } getPreflightProps() { return { mode: this.options.mode, context: this.buildLayer().context, origin: this.options.origin, target: this.target, layer: this.baseLayer, fragments: u.compact([up.fragment.get(':main', { layer: this.baseLayer })]), }; } execute(responseDoc, onApplicable) { if (this.target === ':none') { this.content = document.createElement('up-none'); } else { this.content = responseDoc.select(this.target); } if (!this.content || this.baseLayer.isClosed()) { throw new up.CannotMatch(); } onApplicable(); up.puts('up.render()', `Opening element "${this.target}" in new overlay`); this.options.title = this.improveHistoryValue(this.options.title, responseDoc.getTitle()); if (this.emitOpenEvent().defaultPrevented) { throw new up.Aborted('Open event was prevented'); } this.layer = this.buildLayer(); this.baseLayer.peel({ history: !this.layer.history }); up.layer.stack.push(this.layer); this.layer.createElements(this.content); this.layer.setupHandlers(); this.handleHistory(); this.setReloadAttrs({ newElement: this.content, source: this.options.source }); responseDoc.finalizeElement(this.content); up.hello(this.layer.element, { ...this.options, layer: this.layer }); this.handleLayerChangeRequests(); this.handleScroll(); let renderResult = new up.RenderResult({ layer: this.layer, fragments: [this.content], target: this.target, }); renderResult.finished = this.finish(renderResult); this.layer.opening = false; this.emitOpenedEvent(); this.abortWhenLayerClosed(); return renderResult; } async finish(renderResult) { await this.layer.startOpenAnimation(); this.abortWhenLayerClosed(); this.handleFocus(); return renderResult; } buildLayer() { const buildOptions = { ...this.options, opening: true }; const beforeNew = optionsWithLayerDefaults => { return this.options = up.RenderOptions.finalize(optionsWithLayerDefaults); }; return up.layer.build(buildOptions, beforeNew); } handleHistory() { if (this.layer.history === 'auto') { this.layer.history = up.fragment.hasAutoHistory(this.content); } this.layer.parent.saveHistory(); this.layer.updateHistory(this.options); } handleFocus() { this.baseLayer.overlayFocus?.moveToBack(); this.layer.overlayFocus.moveToFront(); const fragmentFocus = new up.FragmentFocus({ fragment: this.content, layer: this.layer, autoMeans: ['autofocus', 'layer'] }); fragmentFocus.process(this.options.focus); } handleScroll() { const scrollingOptions = { ...this.options, fragment: this.content, layer: this.layer, autoMeans: ['hash', 'layer'] }; const scrolling = new up.FragmentScrolling(scrollingOptions); scrolling.process(this.options.scroll); } emitOpenEvent() { return up.emit('up:layer:open', { origin: this.origin, baseLayer: this.baseLayer, layerOptions: this.options, log: "Opening new overlay" }); } emitOpenedEvent() { return this.layer.emit('up:layer:opened', { origin: this.origin, callback: this.layer.callback('onOpened'), log: `Opened new ${this.layer}` }); } }; /***/ }), /* 29 */ /***/ (() => { var _a; const u = up.util; const e = up.element; up.Change.UpdateLayer = (_a = class UpdateLayer extends up.Change.Addition { constructor(options) { options = up.RenderOptions.finalize(options); super(options); this.layer = options.layer; this.target = options.target; this.context = options.context; this.useKeep = options.useKeep; this.steps = up.fragment.parseTargetSteps(this.target, this.options); } getPreflightProps() { this.matchPreflight(); return { layer: this.layer, mode: this.layer.mode, context: u.merge(this.layer.context, this.context), origin: this.options.origin, target: this.bestPreflightSelector(), fragments: this.getFragments(), }; } bestPreflightSelector() { this.matchPreflight(); return u.map(this.steps, 'selector').join(', ') || ':none'; } getFragments() { this.matchPreflight(); return u.map(this.steps, 'oldElement'); } execute(responseDoc, onApplicable) { this.responseDoc = responseDoc; this.matchPostflight(); onApplicable(); if (this.steps.length) { up.puts('up.render()', `Updating "${this.bestPreflightSelector()}" in ${this.layer}`); } else { up.puts('up.render()', 'Nothing was rendered'); } this.options.title = this.improveHistoryValue(this.options.title, this.responseDoc.getTitle()); this.setScrollAndFocusOptions(); if (this.options.saveScroll) { up.viewport.saveScroll({ layer: this.layer }); } if (this.options.saveFocus) { up.viewport.saveFocus({ layer: this.layer }); } if (this.options.peel) { this.layer.peel({ history: !this.hasHistory() }); } if (this.options.abort !== false) { up.fragment.abort(this.getFragments(), { reason: 'Fragment is being replaced' }); } Object.assign(this.layer.context, this.context); if (this.hasHistory()) { this.layer.updateHistory(this.options); } this.handleLayerChangeRequests(); this.renderResult = new up.RenderResult({ layer: this.layer, target: this.target, }); this.steps.reverse(); const motionEndPromises = this.steps.map(step => this.executeStep(step)); this.renderResult.finished = this.finish(motionEndPromises); if (!this.steps.length) { this.handleFocus(null, this.options); this.handleScroll(null, this.options); } return this.renderResult; } async finish(motionEndPromises) { await Promise.all(motionEndPromises); this.abortWhenLayerClosed(); return this.renderResult; } addToResult(fragment) { let newFragments = fragment.matches('up-wrapper') ? fragment.children : [fragment]; this.renderResult.fragments.unshift(...newFragments); } executeStep(step) { this.setReloadAttrs(step); switch (step.placement) { case 'swap': { let keepPlan = this.findKeepPlan(step); if (keepPlan) { this.handleFocus(step.oldElement, step); this.handleScroll(step.oldElement, step); return Promise.resolve(); } else { this.preserveKeepables(step); const parent = step.oldElement.parentNode; const morphOptions = { ...step, beforeStart() { up.fragment.markAsDestroying(step.oldElement); }, afterInsert: () => { this.responseDoc.finalizeElement(step.newElement); this.restoreKeepables(step); up.hello(step.newElement, step); this.addToResult(step.newElement); }, beforeDetach: () => { up.syntax.clean(step.oldElement, { layer: this.layer }); }, afterDetach() { up.element.cleanJQuery(); up.fragment.emitDestroyed(step.oldElement, { parent, log: false }); }, scrollNew: () => { this.handleFocus(step.newElement, step); this.handleScroll(step.newElement, step); } }; return up.morph(step.oldElement, step.newElement, step.transition, morphOptions); } } case 'content': { let oldWrapper = e.wrapChildren(step.oldElement); let newWrapper = e.wrapChildren(step.newElement); let wrapperStep = { ...step, placement: 'swap', oldElement: oldWrapper, newElement: newWrapper, focus: false }; return this.executeStep(wrapperStep).then(() => { e.unwrap(newWrapper); this.handleFocus(step.oldElement, step); }); } case 'before': case 'after': { let wrapper = e.wrapChildren(step.newElement); let position = step.placement === 'before' ? 'afterbegin' : 'beforeend'; step.oldElement.insertAdjacentElement(position, wrapper); this.responseDoc.finalizeElement(wrapper); up.hello(wrapper, step); this.addToResult(wrapper); this.handleFocus(wrapper, step); this.handleScroll(wrapper, step); return up.animate(wrapper, step.transition, step).then(() => e.unwrap(wrapper)); } default: { up.fail('Unknown placement: %o', step.placement); } } } findKeepPlan(options) { if (!this.useKeep) { return; } const { oldElement, newElement } = options; let doKeep = e.booleanAttr(oldElement, 'up-keep'); if (!doKeep) { return; } let partner; let partnerSelector = up.fragment.toTarget(oldElement); const lookupOpts = { layer: this.layer }; if (options.descendantsOnly) { partner = up.fragment.get(newElement, partnerSelector, lookupOpts); } else { partner = up.fragment.subtree(newElement, partnerSelector, lookupOpts)[0]; } if (partner && e.booleanAttr(partner, 'up-keep')) { const plan = { oldElement, newElement: partner, newData: up.syntax.data(partner) }; if (!up.fragment.emitKeep(plan).defaultPrevented) { return plan; } } } preserveKeepables(step) { const keepPlans = []; if (this.useKeep) { for (let keepable of step.oldElement.querySelectorAll('[up-keep]')) { let keepPlan = this.findKeepPlan({ ...step, oldElement: keepable, descendantsOnly: true }); if (keepPlan) { const keepableClone = keepable.cloneNode(true); keepable.insertAdjacentElement('beforebegin', keepableClone); let viewports = up.viewport.subtree(keepPlan.oldElement); keepPlan.revivers = viewports.map(function (viewport) { let cursorProps = up.viewport.copyCursorProps(viewport); return () => up.viewport.copyCursorProps(cursorProps, viewport); }); if (this.willChangeElement(document.body)) { keepPlan.newElement.replaceWith(keepable); } else { document.body.append(keepable); } keepPlans.push(keepPlan); } } } step.keepPlans = keepPlans; } restoreKeepables(step) { for (let keepPlan of step.keepPlans) { keepPlan.newElement.replaceWith(keepPlan.oldElement); for (let reviver of keepPlan.revivers) { reviver(); } } } matchPreflight() { this.filterSteps((step) => { const finder = new up.FragmentFinder(step); step.oldElement || (step.oldElement = finder.find()); if (step.oldElement) { return true; } else if (!step.maybe) { throw new up.CannotMatch(); } }); this.resolveOldNesting(); } matchPostflight() { this.matchPreflight(); if (this.options.useHungry) { this.addHungrySteps(); } this.filterSteps((step) => { step.newElement = this.responseDoc.select(step.selector); if (step.newElement) { return true; } else if (!step.maybe) { throw new up.CannotMatch(); } }); this.resolveOldNesting(); } filterSteps(condition) { this.steps = u.filter(this.steps, condition); } addHungrySteps() { const hungrySolutions = up.radio.hungrySolutions({ layer: this.layer, history: this.hasHistory(), origin: this.options.origin }); for (let { element: oldElement, target: selector } of hungrySolutions) { const transition = e.booleanOrStringAttr(oldElement, 'transition'); const step = { selector, oldElement, transition, placement: 'swap', maybe: true }; this.steps.push(step); } } containedByRivalStep(steps, candidateStep) { return u.some(steps, function (rivalStep) { return (rivalStep !== candidateStep) && ((rivalStep.placement === 'swap') || (rivalStep.placement === 'content')) && rivalStep.oldElement.contains(candidateStep.oldElement); }); } resolveOldNesting() { let compressed = u.uniqBy(this.steps, 'oldElement'); compressed = u.reject(compressed, step => this.containedByRivalStep(compressed, step)); this.steps = compressed; } setScrollAndFocusOptions() { this.steps.forEach((step, i) => { if (i > 0) { step.scroll = false; step.focus = false; } if ((step.placement === 'swap') || (step.placement === 'content')) { step.scrollBehavior = 'instant'; } }); this.focusCapsule = up.FocusCapsule.preserve(this.layer); } handleFocus(fragment, options) { const fragmentFocus = new up.FragmentFocus({ ...options, fragment, layer: this.layer, focusCapsule: this.focusCapsule, autoMeans: up.fragment.config.autoFocus, }); return fragmentFocus.process(options.focus); } handleScroll(fragment, options) { const scrolling = new up.FragmentScrolling({ ...options, fragment, layer: this.layer, autoMeans: up.fragment.config.autoScroll }); return scrolling.process(options.scroll); } hasHistory() { return u.evalAutoOption(this.options.history, this.hasAutoHistory.bind(this)); } hasAutoHistory() { const oldFragments = u.map(this.steps, 'oldElement'); return u.some(oldFragments, up.fragment.hasAutoHistory); } willChangeElement(element) { return u.some(this.steps, (step) => step.oldElement.contains(element)); } }, (() => { u.memoizeMethod(_a.prototype, [ 'matchPreflight', 'matchPostflight', 'hasHistory', ]); })(), _a); /***/ }), /* 30 */ /***/ (() => { const u = up.util; up.Change.CloseLayer = class CloseLayer extends up.Change.Removal { constructor(options) { super(options); this.verb = options.verb; this.layer = up.layer.get(options); this.origin = options.origin; this.value = options.value; this.preventable = options.preventable ?? true; this.response = options.response; this.history = options.history ?? true; } execute() { if (!this.layer.isOpen()) { return Promise.resolve(); } up.browser.assertConfirmed(this.options); if (this.emitCloseEvent().defaultPrevented && this.preventable) { throw new up.Aborted('Close event was prevented'); } up.fragment.abort({ reason: 'Layer is closing', layer: this.layer }); const { parent } = this.layer; this.layer.peel(); this.layer.stack.remove(this.layer); if (this.history) { parent.restoreHistory(); } this.handleFocus(parent); this.layer.teardownHandlers(); this.layer.destroyElements(this.options); this.emitClosedEvent(parent); } emitCloseEvent() { let event = this.layer.emit(this.buildEvent(`up:layer:${this.verb}`), { callback: this.layer.callback(`on${u.upperCaseFirst(this.verb)}`), log: [`Will ${this.verb} ${this.layer} with value %o`, this.value] }); this.value = event.value; return event; } emitClosedEvent(formerParent) { const verbPast = `${this.verb}ed`; const verbPastUpperCaseFirst = u.upperCaseFirst(verbPast); return this.layer.emit(this.buildEvent(`up:layer:${verbPast}`), { baseLayer: formerParent, callback: this.layer.callback(`on${verbPastUpperCaseFirst}`), ensureBubbles: true, log: [`${verbPastUpperCaseFirst} ${this.layer} with value %o`, this.value] }); } buildEvent(name) { return up.event.build(name, { layer: this.layer, value: this.value, origin: this.origin, response: this.response, }); } handleFocus(formerParent) { this.layer.overlayFocus.teardown(); formerParent.overlayFocus?.moveToFront(); let newFocusElement = this.layer.origin || formerParent.element; newFocusElement.focus({ preventScroll: true }); } }; /***/ }), /* 31 */ /***/ (() => { var _a; const u = up.util; up.Change.FromURL = (_a = class FromURL extends up.Change { constructor(options) { super(options); this.options.layer = up.layer.getAll(this.options); this.options.normalizeLayerOptions = false; } execute() { let newPageReason = this.newPageReason(); if (newPageReason) { up.puts('up.render()', newPageReason); up.network.loadPage(this.options); return u.unresolvablePromise(); } this.request = up.request(this.getRequestAttrs()); this.options.onRequest?.(this.request); up.feedback.showAroundRequest(this.request, this.options); up.form.disableWhile(this.request, this.options); if (this.options.preload) { return this.request; } return u.always(this.request, responseOrError => this.onRequestSettled(responseOrError)); } newPageReason() { if (u.isCrossOrigin(this.options.url)) { return 'Loading cross-origin content in new page'; } if (!up.browser.canPushState()) { return 'Loading content in new page to restore history support'; } } getRequestAttrs() { const successAttrs = this.preflightPropsForRenderOptions(this.options); const failAttrs = this.preflightPropsForRenderOptions(this.deriveFailOptions(), { optional: true }); return { ...this.options, ...successAttrs, ...u.renameKeys(failAttrs, up.fragment.failKey) }; } getPreflightProps() { return this.getRequestAttrs(); } preflightPropsForRenderOptions(renderOptions, requestAttributesOptions) { const preview = new up.Change.FromContent({ ...renderOptions, preview: true }); return preview.getPreflightProps(requestAttributesOptions); } onRequestSettled(response) { if (response instanceof up.Response) { return this.onRequestSettledWithResponse(response); } else { return this.onRequestSettledWithError(response); } } onRequestSettledWithResponse(response) { return new up.Change.FromResponse({ ...this.options, response }).execute(); } onRequestSettledWithError(error) { if (error instanceof up.Offline) { this.request.emit('up:fragment:offline', { callback: this.options.onOffline, renderOptions: this.options, retry: (retryOptions) => up.render({ ...this.options, ...retryOptions }), log: ['Cannot load fragment from %s: %s', this.request.description, error.reason], }); } throw error; } }, (() => { u.memoizeMethod(_a.prototype, [ 'getRequestAttrs', ]); })(), _a); /***/ }), /* 32 */ /***/ (() => { var _a; const u = up.util; up.Change.FromResponse = (_a = class FromResponse extends up.Change { constructor(options) { super(options); this.response = options.response; this.request = this.response.request; } execute() { if (up.fragment.config.skipResponse(this.loadedEventProps())) { this.skip(); } else { this.request.assertEmitted('up:fragment:loaded', { ...this.loadedEventProps(), callback: this.options.onLoaded, log: ['Loaded fragment from %s', this.response.description], skip: () => this.skip() }); } let fail = u.evalOption(this.options.fail, this.response) ?? !this.response.ok; if (fail) { throw this.updateContentFromResponse(this.deriveFailOptions()); } return this.updateContentFromResponse(this.options); } skip() { up.puts('up.render()', 'Skipping ' + this.response.description); this.options.target = ':none'; this.options.failTarget = ':none'; } updateContentFromResponse(finalRenderOptions) { if (finalRenderOptions.failPrefixForced) { up.puts('up.render()', 'Rendering failed response using fail-prefixed options (https://unpoly.com/failed-responses)'); } this.augmentOptionsFromResponse(finalRenderOptions); finalRenderOptions.meta = this.compilerPassMeta(); let result = new up.Change.FromContent(finalRenderOptions).execute(); result.finished = this.finish(result, finalRenderOptions); return result; } async finish(renderResult, originalRenderOptions) { renderResult = await renderResult.finished; if (up.fragment.shouldRevalidate(this.request, this.response, originalRenderOptions)) { renderResult = await this.revalidate(renderResult, originalRenderOptions); } return renderResult; } async revalidate(renderResult, originalRenderOptions) { let target = originalRenderOptions.target; if (/:(before|after)/.test(target)) { up.warn('up.render()', 'Cannot revalidate cache when prepending/appending (target %s)', target); } else { up.puts('up.render()', 'Revalidating cached response for target "%s"', target); let verifyResult = await up.reload(renderResult.target, { ...originalRenderOptions, layer: renderResult.layer, onFinished: null, scroll: false, focus: 'keep', transition: false, cache: false, confirm: false, feedback: false, abort: false, expiredResponse: this.response, }); if (!verifyResult.none) { renderResult = verifyResult; } } return renderResult; } loadedEventProps() { const { expiredResponse } = this.options; return { request: this.request, response: this.response, renderOptions: this.options, revalidating: !!expiredResponse, expiredResponse, }; } compilerPassMeta() { return u.pick(this.loadedEventProps(), [ 'revalidating', 'response' ]); } augmentOptionsFromResponse(renderOptions) { const responseURL = this.response.url; let serverLocation = responseURL; let hash = this.request.hash; if (hash) { renderOptions.hash = hash; serverLocation += hash; } const isReloadable = (this.response.method === 'GET'); if (isReloadable) { renderOptions.source = this.improveHistoryValue(renderOptions.source, responseURL); } else { renderOptions.source = this.improveHistoryValue(renderOptions.source, 'keep'); renderOptions.history = !!renderOptions.location; } renderOptions.location = this.improveHistoryValue(renderOptions.location, serverLocation); renderOptions.title = this.improveHistoryValue(renderOptions.title, this.response.title); renderOptions.eventPlans = this.response.eventPlans; let serverTarget = this.response.target; if (serverTarget) { renderOptions.target = serverTarget; } renderOptions.acceptLayer = this.response.acceptLayer; renderOptions.dismissLayer = this.response.dismissLayer; renderOptions.document = this.response.text; if (this.response.none) { renderOptions.target = ':none'; } renderOptions.context = u.merge(renderOptions.context, this.response.context); renderOptions.cspNonces = this.response.cspNonces; renderOptions.time ?? (renderOptions.time = this.response.lastModified); renderOptions.etag ?? (renderOptions.etag = this.response.etag); } }, (() => { u.memoizeMethod(_a.prototype, [ 'loadedEventProps', ]); })(), _a); /***/ }), /* 33 */ /***/ (() => { var _a; const u = up.util; up.Change.FromContent = (_a = class FromContent extends up.Change { constructor(options) { super(options); this.layers = u.filter(up.layer.getAll(this.options), this.isRenderableLayer); this.origin = this.options.origin; this.preview = this.options.preview; this.mode = this.options.mode; if (this.origin) { this.originLayer = up.layer.get(this.origin); } } isRenderableLayer(layer) { return (layer === 'new') || layer.isOpen(); } getPlans() { var _a; let plans = []; if (this.options.fragment) { (_a = this.options).target || (_a.target = this.getResponseDoc().rootSelector()); } this.expandIntoPlans(plans, this.layers, this.options.target); this.expandIntoPlans(plans, this.layers, this.options.fallback); return plans; } expandIntoPlans(plans, layers, targets) { for (let layer of layers) { for (let target of this.expandTargets(targets, layer)) { const props = { ...this.options, target, layer, defaultPlacement: this.defaultPlacement() }; const change = layer === 'new' ? new up.Change.OpenLayer(props) : new up.Change.UpdateLayer(props); plans.push(change); } } } expandTargets(targets, layer) { return up.fragment.expandTargets(targets, { layer, mode: this.mode, origin: this.origin }); } execute() { if (this.options.preload) { return Promise.resolve(); } return this.seekPlan(this.executePlan.bind(this)) || this.cannotMatchPostflightTarget(); } executePlan(matchedPlan) { let result = matchedPlan.execute(this.getResponseDoc(), this.onPlanApplicable.bind(this, matchedPlan)); result.options = this.options; return result; } onPlanApplicable(plan) { let primaryPlan = this.getPlans()[0]; if (plan !== primaryPlan) { up.puts('up.render()', 'Could not match primary target "%s". Updating a fallback target "%s".', primaryPlan.target, plan.target); } } getResponseDoc() { if (this.preview) return; const docOptions = u.pick(this.options, [ 'target', 'content', 'fragment', 'document', 'html', 'cspNonces', 'origin', ]); up.migrate.handleResponseDocOptions?.(docOptions); if (this.defaultPlacement() === 'content') { docOptions.target = this.firstExpandedTarget(docOptions.target); } return new up.ResponseDoc(docOptions); } defaultPlacement() { if (!this.options.document && !this.options.fragment) { return 'content'; } } firstExpandedTarget(target) { return this.expandTargets(target || ':main', this.layers[0])[0]; } getPreflightProps(opts = {}) { const getPlanProps = plan => plan.getPreflightProps(); return this.seekPlan(getPlanProps) || opts.optional || this.cannotMatchPreflightTarget(); } cannotMatchPreflightTarget() { this.cannotMatchTarget('Could not find target in current page'); } cannotMatchPostflightTarget() { this.cannotMatchTarget('Could not find common target in current page and response'); } cannotMatchTarget(reason) { let message; if (this.getPlans().length) { const planTargets = u.uniq(u.map(this.getPlans(), 'target')); const humanizedLayerOption = up.layer.optionToString(this.options.layer); message = [reason + " (tried selectors %o in %s)", planTargets, humanizedLayerOption]; } else if (this.layers.length) { if (this.options.failPrefixForced) { message = 'No target selector given for failed responses (https://unpoly.com/failed-responses)'; } else { message = 'No target selector given'; } } else { message = 'Could not find a layer to render in. You may have passed a non-existing layer reference, or a detached element.'; } throw new up.CannotMatch(message); } seekPlan(fn) { for (let plan of this.getPlans()) { try { return fn(plan); } catch (error) { if (!(error instanceof up.CannotMatch)) { throw error; } } } } }, (() => { u.memoizeMethod(_a.prototype, [ 'getPlans', 'getResponseDoc', 'getPreflightProps', ]); })(), _a); /***/ }), /* 34 */ /***/ (() => { const u = up.util; up.CompilerPass = class CompilerPass { constructor(root, compilers, { layer, data, dataMap, meta }) { layer || (layer = up.layer.get(root) || up.layer.current); this.root = root; this.compilers = compilers; this.layer = layer; this.data = data; this.dataMap = dataMap; this.meta = { layer, ...meta }; this.errors = []; } run() { this.layer.asCurrent(() => { this.setCompileData(); for (let compiler of this.compilers) { this.runCompiler(compiler); } }); if (this.errors.length) { throw new up.CannotCompile('Errors while compiling', { errors: this.errors }); } } setCompileData() { if (this.data) { this.root.upCompileData = this.data; } if (this.dataMap) { for (let selector in this.dataMap) { for (let match of this.select(selector)) { match.upCompileData = this.dataMap[selector]; } } } } runCompiler(compiler) { const matches = this.selectOnce(compiler); if (!matches.length) { return; } if (!compiler.isDefault) { up.puts('up.hello()', 'Compiling %d× "%s" on %s', matches.length, compiler.selector, this.layer); } if (compiler.batch) { this.compileBatch(compiler, matches); } else { for (let match of matches) { this.compileOneElement(compiler, match); } } return up.migrate.postCompile?.(matches, compiler); } compileOneElement(compiler, element) { const compileArgs = [element]; if (compiler.length !== 1) { const data = up.syntax.data(element); compileArgs.push(data, this.meta); } const result = this.applyCompilerFunction(compiler, element, compileArgs); let destructorOrDestructors = this.destructorPresence(result); if (destructorOrDestructors) { up.destructor(element, destructorOrDestructors); } } compileBatch(compiler, elements) { const compileArgs = [elements]; if (compiler.length !== 1) { const dataList = u.map(elements, up.syntax.data); compileArgs.push(dataList, this.meta); } const result = this.applyCompilerFunction(compiler, elements, compileArgs); if (this.destructorPresence(result)) { up.fail('Compilers with { batch: true } cannot return destructors'); } } applyCompilerFunction(compiler, elementOrElements, compileArgs) { try { return compiler.apply(elementOrElements, compileArgs); } catch (error) { this.errors.push(error); up.log.error('up.hello()', 'While compiling %o: %o', elementOrElements, error); } } destructorPresence(result) { if (u.isFunction(result) || (u.isArray(result) && (u.every(result, u.isFunction)))) { return result; } } select(selector) { return up.fragment.subtree(this.root, u.evalOption(selector), { layer: this.layer }); } selectOnce(compiler) { let matches = this.select(compiler.selector); return u.filter(matches, (element) => { let appliedCompilers = (element.upAppliedCompilers || (element.upAppliedCompilers = new Set())); if (!appliedCompilers.has(compiler)) { appliedCompilers.add(compiler); return true; } }); } }; /***/ }), /* 35 */ /***/ (() => { const u = up.util; const e = up.element; up.CSSTransition = class CSSTransition { constructor(element, lastFrameKebab, options) { this.element = element; this.lastFrameKebab = lastFrameKebab; this.lastFrameKeysKebab = Object.keys(this.lastFrameKebab); if (u.some(this.lastFrameKeysKebab, key => key.match(/A-Z/))) { up.fail('Animation keys must be kebab-case'); } this.finishEvent = options.finishEvent; this.duration = options.duration; this.easing = options.easing; this.finished = false; } start() { if (this.lastFrameKeysKebab.length === 0) { this.finished = true; return Promise.resolve(); } this.deferred = u.newDeferred(); this.pauseOldTransition(); this.startTime = new Date(); this.startFallbackTimer(); this.listenToFinishEvent(); this.listenToTransitionEnd(); this.startMotion(); return this.deferred; } listenToFinishEvent() { if (this.finishEvent) { this.stopListenToFinishEvent = up.on(this.element, this.finishEvent, this.onFinishEvent.bind(this)); } } onFinishEvent(event) { event.stopPropagation(); this.finish(); } startFallbackTimer() { const timingTolerance = 100; this.fallbackTimer = u.timer((this.duration + timingTolerance), () => { this.finish(); }); } stopFallbackTimer() { clearTimeout(this.fallbackTimer); } listenToTransitionEnd() { this.stopListenToTransitionEnd = up.on(this.element, 'transitionend', this.onTransitionEnd.bind(this)); } onTransitionEnd(event) { if (event.target !== this.element) { return; } const elapsed = new Date() - this.startTime; if (elapsed <= (0.25 * this.duration)) { return; } const completedPropertyKebab = event.propertyName; if (!u.contains(this.lastFrameKeysKebab, completedPropertyKebab)) { return; } this.finish(); } finish() { if (this.finished) { return; } this.finished = true; this.stopFallbackTimer(); this.stopListenToFinishEvent?.(); this.stopListenToTransitionEnd?.(); e.concludeCSSTransition(this.element); this.resumeOldTransition(); this.deferred.resolve(); } pauseOldTransition() { const oldTransition = e.style(this.element, [ 'transitionProperty', 'transitionDuration', 'transitionDelay', 'transitionTimingFunction' ]); if (e.hasCSSTransition(oldTransition)) { if (oldTransition.transitionProperty !== 'all') { const oldTransitionProperties = oldTransition.transitionProperty.split(/\s*,\s*/); const oldTransitionFrameKebab = e.style(this.element, oldTransitionProperties); this.setOldTransitionTargetFrame = e.setTemporaryStyle(this.element, oldTransitionFrameKebab); } this.setOldTransition = e.concludeCSSTransition(this.element); } } resumeOldTransition() { this.setOldTransitionTargetFrame?.(); this.setOldTransition?.(); } startMotion() { e.setStyle(this.element, { transitionProperty: Object.keys(this.lastFrameKebab).join(', '), transitionDuration: `${this.duration}ms`, transitionTimingFunction: this.easing }); e.setStyle(this.element, this.lastFrameKebab); } }; /***/ }), /* 36 */ /***/ (() => { const u = up.util; up.DestructorPass = class DestructorPass { constructor(fragment, options) { this.fragment = fragment; this.options = options; this.errors = []; } run() { for (let cleanable of this.selectCleanables()) { let destructors = u.pluckKey(cleanable, 'upDestructors'); if (destructors) { for (let destructor of destructors) { this.applyDestructorFunction(destructor, cleanable); } } cleanable.classList.remove('up-can-clean'); } if (this.errors.length) { throw new up.Error('Errors while destroying', { errors: this.errors }); } } selectCleanables() { const selectOptions = { ...this.options, destroying: true }; return up.fragment.subtree(this.fragment, '.up-can-clean', selectOptions); } applyDestructorFunction(destructor, element) { try { destructor(); } catch (error) { this.errors.push(error); up.log.error('up.destroy()', 'While destroying %o: %o', element, error); } } }; /***/ }), /* 37 */ /***/ (() => { const u = up.util; const e = up.element; up.EventEmitter = class EventEmitter extends up.Record { keys() { return [ 'target', 'event', 'baseLayer', 'callback', 'log', 'ensureBubbles', ]; } emit() { this.logEmission(); if (this.baseLayer) { this.baseLayer.asCurrent(() => this.dispatchEvent()); } else { this.dispatchEvent(); } return this.event; } dispatchEvent() { this.target.dispatchEvent(this.event); if (this.ensureBubbles && !this.target.isConnected) { document.dispatchEvent(this.event); } this.callback?.(this.event); } assertEmitted() { const event = this.emit(); if (event.defaultPrevented) { throw new up.Aborted(`Event ${event.type} was prevented`); } } logEmission() { if (!up.log.config.enabled) { return; } let message = this.log; let messageArgs; if (u.isArray(message)) { [message, ...messageArgs] = message; } else { messageArgs = []; } const { type } = this.event; if (u.isString(message)) { up.puts(type, message, ...messageArgs); } else if (message !== false) { up.puts(type, `Event ${type}`); } } static fromEmitArgs(args, defaults = {}) { let options = u.extractOptions(args); options = u.merge(defaults, options); if (u.isElementish(args[0])) { options.target = e.get(args.shift()); } else if (args[0] instanceof up.Layer) { options.layer = args.shift(); } let layer; if (u.isGiven(options.layer)) { layer = up.layer.get(options.layer); options.target || (options.target = layer.element); options.baseLayer || (options.baseLayer = layer); } if (options.baseLayer) { options.baseLayer = up.layer.get(options.baseLayer); } if (u.isString(options.target)) { options.target = up.fragment.get(options.target, { layer: options.layer }); } else if (!options.target) { options.target = document; } if (args[0]?.preventDefault) { options.event = args[0]; options.log ?? (options.log = args[0].log); } else if (u.isString(args[0])) { options.event = up.event.build(args[0], options); } else { options.event = up.event.build(options); } return new (this)(options); } }; /***/ }), /* 38 */ /***/ (() => { const u = up.util; up.EventListener = class EventListener extends up.Record { keys() { return [ 'element', 'eventType', 'selector', 'callback', 'guard', 'baseLayer', 'passive', 'once', 'beforeBoot', ]; } constructor(attributes) { super(attributes); this.key = this.constructor.buildKey(attributes); this.isDefault = up.framework.evaling; this.beforeBoot ?? (this.beforeBoot = this.eventType.indexOf('up:framework:') === 0); this.nativeCallback = this.nativeCallback.bind(this); } bind() { var _a; const map = ((_a = this.element).upEventListeners || (_a.upEventListeners = {})); if (map[this.key]) { up.fail('up.on(): The %o callback %o cannot be registered more than once', this.eventType, this.callback); } map[this.key] = this; this.element.addEventListener(...this.addListenerArgs()); } addListenerArgs() { let options = u.compactObject(u.pick(this, ['once', 'passive'])); return [this.eventType, this.nativeCallback, options]; } unbind() { let map = this.element.upEventListeners; if (map) { delete map[this.key]; } this.element.removeEventListener(...this.addListenerArgs()); } nativeCallback(event) { if (up.framework.beforeBoot && !this.beforeBoot) { return; } let element = event.target; if (this.selector) { element = element.closest(u.evalOption(this.selector)); } if (this.guard && !this.guard(event)) { return; } if (element) { const args = [event, element]; const expectedArgCount = this.callback.length; if (expectedArgCount !== 1 && expectedArgCount !== 2) { const data = up.syntax.data(element); args.push(data); } if (this.eventType === 'click' && element.disabled) { return; } const applyCallback = this.callback.bind(element, ...args); if (this.baseLayer) { this.baseLayer.asCurrent(applyCallback); } else { applyCallback(); } } } static fromElement(attributes) { let map = attributes.element.upEventListeners; if (map) { const key = this.buildKey(attributes); return map[key]; } } static buildKey(attributes) { var _a; (_a = attributes.callback).upUid || (_a.upUid = u.uid()); return [ attributes.eventType, attributes.selector, attributes.callback.upUid ].join('|'); } static allNonDefault(element) { let map = element.upEventListeners; if (map) { const listeners = Object.values(map); return u.reject(listeners, 'isDefault'); } else { return []; } } }; /***/ }), /* 39 */ /***/ (() => { const u = up.util; up.EventListenerGroup = class EventListenerGroup extends up.Record { keys() { return [ 'elements', 'eventTypes', 'selector', 'callback', 'guard', 'baseLayer', 'passive', 'once', 'beforeBoot', ]; } bind() { const unbindFns = []; this.eachListenerAttributes(function (attrs) { const listener = new up.EventListener(attrs); listener.bind(); return unbindFns.push(listener.unbind.bind(listener)); }); return u.sequence(unbindFns); } eachListenerAttributes(fn) { for (let element of this.elements) { for (let eventType of this.eventTypes) { fn(this.listenerAttributes(element, eventType)); } } } listenerAttributes(element, eventType) { return { ...this.attributes(), element, eventType }; } unbind() { this.eachListenerAttributes(function (attrs) { let listener = up.EventListener.fromElement(attrs); if (listener) { listener.unbind(); } }); } static fromBindArgs(args, defaults) { args = u.copy(args); const callback = args.pop(); let elements; if (args[0].addEventListener) { elements = [args.shift()]; } else if (u.isJQuery(args[0]) || (u.isList(args[0]) && args[0][0].addEventListener)) { elements = args.shift(); } else { elements = [document]; } let eventTypes = u.parseTokens(args.shift()); let fixTypes = up.migrate.fixEventTypes; if (fixTypes) { eventTypes = fixTypes(eventTypes); } const options = u.extractOptions(args); const selector = args[0]; const attributes = { elements, eventTypes, selector, callback, ...options, ...defaults }; return new (this)(attributes); } }; /***/ }), /* 40 */ /***/ (() => { const u = up.util; up.FieldWatcher = class FieldWatcher { constructor(form, fields, options, callback) { this.callback = callback; this.form = form; this.fields = fields; this.options = options; this.batch = options.batch; this.unbindFns = []; } fieldOptions(field) { let options = u.copy(this.options); return up.form.watchOptions(field, options, { defaults: { event: 'input' } }); } start() { this.scheduledValues = null; this.processedValues = this.readFieldValues(); this.currentTimer = null; this.callbackRunning = false; for (let field of this.fields) { this.watchField(field); } } watchField(field) { let fieldOptions = this.fieldOptions(field); this.unbindFns.push(up.on(field, fieldOptions.event, (event) => this.check(event, fieldOptions))); this.unbindFns.push(up.fragment.onAborted(field, () => this.cancelTimer())); } stop() { for (let unbindFn of this.unbindFns) unbindFn(); this.cancelTimer(); } cancelTimer() { clearTimeout(this.currentTimer); this.currentTimer = null; } isAnyFieldAttached() { return u.some(this.fields, 'isConnected'); } scheduleValues(values, event, fieldOptions) { this.cancelTimer(); this.scheduledValues = values; let delay = u.evalOption(fieldOptions.delay, event); this.currentTimer = u.timer(delay, () => { this.currentTimer = null; if (this.isAnyFieldAttached()) { this.scheduledFieldOptions = fieldOptions; this.requestCallback(); } else { this.scheduledValues = null; } }); } isNewValues(values) { return !u.isEqual(values, this.processedValues) && !u.isEqual(this.scheduledValues, values); } async requestCallback() { let fieldOptions = this.scheduledFieldOptions; if ((this.scheduledValues !== null) && !this.currentTimer && !this.callbackRunning) { const diff = this.changedValues(this.processedValues, this.scheduledValues); this.processedValues = this.scheduledValues; this.scheduledValues = null; this.callbackRunning = true; this.scheduledFieldOptions = null; let callbackOptions = { ...fieldOptions, disable: false }; const callbackReturnValues = []; if (this.batch) { callbackReturnValues.push(this.callback(diff, callbackOptions)); } else { for (let name in diff) { const value = diff[name]; callbackReturnValues.push(this.callback(value, name, callbackOptions)); } } if (u.some(callbackReturnValues, u.isPromise)) { let callbackDone = Promise.allSettled(callbackReturnValues); up.form.disableWhile(callbackDone, fieldOptions); await callbackDone; } this.callbackRunning = false; this.requestCallback(); } } changedValues(previous, next) { const changes = {}; let keys = Object.keys(previous); keys = keys.concat(Object.keys(next)); keys = u.uniq(keys); for (let key of keys) { const previousValue = previous[key]; const nextValue = next[key]; if (!u.isEqual(previousValue, nextValue)) { changes[key] = nextValue; } } return changes; } readFieldValues() { return up.Params.fromFields(this.fields).toObject(); } check(event, fieldOptions) { const values = this.readFieldValues(); if (this.isNewValues(values)) { this.scheduleValues(values, event, fieldOptions); } } }; /***/ }), /* 41 */ /***/ (() => { const u = up.util; up.FormValidator = class FormValidator { constructor(form) { this.form = form; this.dirtySolutions = []; this.nextRenderTimer = null; this.rendering = false; this.resetNextRenderPromise(); this.honorAbort(); } honorAbort() { up.fragment.onAborted(this.form, { around: true }, ({ target }) => this.unscheduleSolutionsWithin(target)); } unscheduleSolutionsWithin(container) { this.dirtySolutions = u.reject(this.dirtySolutions, ({ element }) => container.contains(element)); } resetNextRenderPromise() { this.nextRenderPromise = u.newDeferred(); } watchContainer(fieldOrForm) { let { event } = this.originOptions(fieldOrForm); let guard = () => up.fragment.isAlive(fieldOrForm); let callback = () => up.error.muteUncriticalRejection(this.validate({ origin: fieldOrForm })); up.on(fieldOrForm, event, { guard }, callback); } validate(options = {}) { let solutions = this.getSolutions(options); this.dirtySolutions.push(...solutions); this.scheduleNextRender(); return this.nextRenderPromise; } getSolutions(options) { let solutions = this.getTargetSelectorSolutions(options) || this.getFieldSolutions(options) || this.getElementSolutions(options.origin); for (let solution of solutions) { solution.renderOptions = this.originOptions(solution.origin, options); solution.target = up.fragment.resolveOrigin(solution.target, solution); } return solutions; } getFieldSolutions({ origin, ...options }) { if (up.form.isField(origin)) { return this.getValidateAttrSolutions(origin) || this.getFormGroupSolutions(origin, options); } } getFormGroupSolutions(field, { formGroup = true }) { if (!formGroup) return; let solution = up.form.groupSolution(field); if (solution) { up.puts('up.validate()', 'Validating form group of field %o', field); return [solution]; } } getTargetSelectorSolutions({ target, origin }) { if (u.isString(target) && target) { up.puts('up.validate()', 'Validating target "%s"', target); let simpleSelectors = up.fragment.splitTarget(target); return u.compact(simpleSelectors.map(function (simpleSelector) { let element = up.fragment.get(simpleSelector, { origin }); if (element) { return { element, target: simpleSelector, origin }; } else { up.fail('Validation target "%s" does not match an element', simpleSelector); } })); } } getElementSolutions(element) { up.puts('up.validate()', 'Validating element %o', element); return [{ element, target: up.fragment.toTarget(element), origin: element }]; } getValidateAttrSolutions(field) { let containerWithAttr = field.closest('[up-validate]'); if (containerWithAttr) { let target = containerWithAttr.getAttribute('up-validate'); return this.getTargetSelectorSolutions({ target, origin: field }); } } originOptions(element, overrideOptions) { return up.form.watchOptions(element, overrideOptions, { defaults: { event: 'change' } }); } scheduleNextRender() { let solutionDelays = this.dirtySolutions.map((solution) => solution.renderOptions.delay); let shortestDelay = Math.min(...solutionDelays) || 0; this.unscheduleNextRender(); this.nextRenderTimer = u.timer(shortestDelay, () => this.renderDirtySolutions()); } unscheduleNextRender() { clearTimeout(this.nextRenderTimer); } renderDirtySolutions() { up.error.muteUncriticalRejection(this.doRenderDirtySolutions()); } async doRenderDirtySolutions() { this.dirtySolutions = u.filter(this.dirtySolutions, ({ element, origin }) => up.fragment.isAlive(element) && up.fragment.isAlive(origin)); if (!this.dirtySolutions.length || this.rendering) { return; } let dirtySolutions = this.dirtySolutions; this.dirtySolutions = []; let dirtyOrigins = u.map(dirtySolutions, 'origin'); let dirtyFields = u.flatMap(dirtyOrigins, up.form.fields); let dirtyNames = u.uniq(u.map(dirtyFields, 'name')); let dataMap = this.buildDataMap(dirtySolutions); let dirtyRenderOptionsList = u.map(dirtySolutions, 'renderOptions'); let options = u.mergeDefined(...dirtyRenderOptionsList, { dataMap }, up.form.destinationOptions(this.form)); options.target = u.map(dirtySolutions, 'target').join(', '); options.feedback = u.some(dirtyRenderOptionsList, 'feedback'); options.origin = this.form; options.focus ?? (options.focus = 'keep'); options.failOptions = false; options.params = up.Params.merge(options.params, ...u.map(dirtyRenderOptionsList, 'params')); options.headers = u.merge(...u.map(dirtyRenderOptionsList, 'headers')); options.headers[up.protocol.headerize('validate')] = dirtyNames.join(' ') || ':unknown'; options.guardEvent = up.event.build('up:form:validate', { fields: dirtyFields, log: 'Validating form', params: options.params }); this.rendering = true; let renderingPromise = this.nextRenderPromise; this.resetNextRenderPromise(); options.disable = false; for (let solution of dirtySolutions) { up.form.disableWhile(renderingPromise, { disable: solution.renderOptions.disable, origin: solution.origin, }); } try { renderingPromise.resolve(up.render(options)); await renderingPromise; } finally { this.rendering = false; this.renderDirtySolutions(); } } buildDataMap(solutions) { let dataMap = {}; for (let solution of solutions) { let data = u.pluckKey(solution.renderOptions, 'data'); let keepData = u.pluckKey(solution.renderOptions, 'keepData'); if (keepData) { data = up.data(solution.element); } if (data) { dataMap[solution.target] = data; } } return dataMap; } static forElement(element) { let form = up.form.get(element); return form.upFormValidator || (form.upFormValidator = new this(form)); } }; /***/ }), /* 42 */ /***/ (() => { up.FocusCapsule = class FocusCapsule { constructor(target, cursorProps) { this.target = target; this.cursorProps = cursorProps; } restore(layer, options) { let rediscoveredElement = up.fragment.get(this.target, { layer }); if (rediscoveredElement) { up.viewport.copyCursorProps(this.cursorProps, rediscoveredElement); up.focus(rediscoveredElement, options); return true; } } static preserve(layer) { let focusedElement = up.viewport.focusedElementWithin(layer.element); if (!focusedElement) return; let target = up.fragment.tryToTarget(focusedElement); if (!target) return; const cursorProps = up.viewport.copyCursorProps(focusedElement); return new this(target, cursorProps); } }; /***/ }), /* 43 */ /***/ (() => { const u = up.util; up.FragmentProcessor = class FragmentProcessor extends up.Record { keys() { return [ 'fragment', 'autoMeans', 'origin', 'layer' ]; } process(opt) { let preprocessed = this.preprocess(opt); return this.tryProcess(preprocessed); } preprocess(opt) { return u.parseTokens(opt, { separator: 'or' }); } tryProcess(opt) { if (u.isArray(opt)) { return this.processArray(opt); } if (u.isFunction(opt)) { return this.tryProcess(opt(this.fragment, this.attributes())); } if (u.isElement(opt)) { return this.processElement(opt); } if (u.isString(opt)) { if (opt === 'auto') { return this.tryProcess(this.autoMeans); } let match = opt.match(/^(.+?)-if-(.+?)$/); if (match) { return this.resolveCondition(match[2]) && this.process(match[1]); } } return this.processPrimitive(opt); } processArray(array) { return u.find(array, opt => this.tryProcess(opt)); } resolveCondition(condition) { if (condition === 'main') { return this.fragment && up.fragment.contains(this.fragment, ':main'); } } findSelector(selector) { const lookupOpts = { layer: this.layer, origin: this.origin }; let matchWithinFragment = this.fragment && up.fragment.get(this.fragment, selector, lookupOpts); let match = matchWithinFragment || up.fragment.get(selector, lookupOpts); if (match) { return match; } else { up.warn('up.render()', 'Could not find an element matching "%s"', selector); } } }; /***/ }), /* 44 */ /***/ (() => { const DESCENDANT_SELECTOR = /^([^ >+(]+) (.+)$/; up.FragmentFinder = class FragmentFinder { constructor(options) { this.options = options; this.origin = options.origin; this.selector = options.selector; this.externalRoot = options.externalRoot; } find() { return this.findAroundOrigin() || this.findInLayer(); } findAroundOrigin() { if (this.origin && up.fragment.config.matchAroundOrigin && this.origin.isConnected) { return this.findClosest() || this.findInVicinity(); } } findClosest() { return up.fragment.closest(this.origin, this.selector, this.options); } findInVicinity() { let parts = this.selector.match(DESCENDANT_SELECTOR); if (parts) { let parent = up.fragment.closest(this.origin, parts[1], this.options); if (parent) { return up.fragment.getDumb(parent, parts[2]); } } } findInLayer() { if (this.externalRoot) { return up.fragment.subtree(this.externalRoot, this.selector, this.options)[0]; } else { return up.fragment.getDumb(this.selector, this.options); } } }; /***/ }), /* 45 */ /***/ (() => { const u = up.util; const e = up.element; const PREVENT_SCROLL_OPTIONS = { preventScroll: true }; up.FragmentFocus = class FragmentFocus extends up.FragmentProcessor { keys() { return super.keys().concat([ 'hash', 'focusCapsule' ]); } processPrimitive(opt) { switch (opt) { case 'keep': return this.restoreLostFocus(); case 'restore': return this.restorePreviousFocusForLocation(); case 'target': case true: return this.focusElement(this.fragment); case 'layer': return this.focusElement(this.layer.getFocusElement()); case 'main': return this.focusSelector(':main'); case 'hash': return this.focusHash(); case 'autofocus': return this.autofocus(); default: if (u.isString(opt)) { return this.focusSelector(opt); } } } processElement(element) { return this.focusElement(element); } resolveCondition(condition) { if (condition === 'lost') { return this.wasFocusLost(); } else { return super.resolveCondition(condition); } } focusSelector(selector) { let match = this.findSelector(selector); return this.focusElement(match); } restoreLostFocus() { if (this.wasFocusLost()) { return this.focusCapsule?.restore(this.layer, PREVENT_SCROLL_OPTIONS); } } restorePreviousFocusForLocation() { return up.viewport.restoreFocus({ layer: this.layer }); } autofocus() { let autofocusElement = this.fragment && e.subtree(this.fragment, '[autofocus]')[0]; if (autofocusElement) { return this.focusElement(autofocusElement); } } focusElement(element) { if (element) { up.focus(element, { force: true, ...PREVENT_SCROLL_OPTIONS }); return true; } } focusHash() { let hashTarget = up.viewport.firstHashTarget(this.hash, { layer: this.layer }); if (hashTarget) { return this.focusElement(hashTarget); } } wasFocusLost() { return !this.layer.hasFocus(); } }; /***/ }), /* 46 */ /***/ (() => { const e = up.element; up.FragmentPolling = class FragmentPolling { constructor(fragment) { this.options = {}; this.state = 'initialized'; this.setFragment(fragment); this.abortable = true; } static forFragment(fragment) { return fragment.upPolling || (fragment.upPolling = new this(fragment)); } onPollAttributeObserved() { this.start(); } onFragmentDestroyed() { this.stop(); } onFragmentAborted() { if (this.abortable) { this.stop(); } } start() { if (this.state !== 'started') { this.state = 'started'; this.scheduleReload(); } } stop() { if (this.state === 'started') { clearTimeout(this.reloadTimer); this.state = 'stopped'; } } forceStart(options) { Object.assign(this.options, options); this.forceStarted = true; this.start(); } forceStop() { this.stop(); this.forceStarted = false; } scheduleReload(delay = this.getInterval()) { this.reloadTimer = setTimeout(() => this.reload(), delay); } reload() { if (this.state !== 'started') { return; } let issue = up.radio.pollIssue(this.fragment); if (issue) { up.puts('[up-poll]', `Will not poll: ${issue}`); let reconsiderDisabledDelay = Math.min(10 * 1000, this.getInterval()); this.scheduleReload(reconsiderDisabledDelay); } else { this.reloadNow(); } } reloadNow() { let reloadOptions = { url: this.options.url, fail: false, background: true, }; let oldAbortable = this.abortable; this.abortable = false; up.reload(this.fragment, reloadOptions).then(this.onReloadSuccess.bind(this), this.onReloadFailure.bind(this)); this.abortable = oldAbortable; } onReloadSuccess({ fragment }) { if (fragment) { this.onFragmentSwapped(fragment); } else { this.scheduleReload(); } } onReloadFailure(reason) { this.scheduleReload(); up.error.rethrowCritical(reason); } onFragmentSwapped(newFragment) { this.stop(); if (this.forceStarted && up.fragment.matches(this.fragment, newFragment)) { this.constructor.forFragment(newFragment).forceStart(this.options); } } setFragment(newFragment) { this.fragment = newFragment; up.destructor(newFragment, () => this.onFragmentDestroyed()); up.fragment.onAborted(newFragment, () => this.onFragmentAborted()); } getInterval() { let interval = this.options.interval ?? e.numberAttr(this.fragment, 'up-interval') ?? up.radio.config.pollInterval; return up.radio.config.stretchPollInterval(interval); } }; /***/ }), /* 47 */ /***/ (() => { const u = up.util; up.FragmentScrolling = class FragmentScrolling extends up.FragmentProcessor { keys() { return super.keys().concat([ 'hash', 'mode', 'revealTop', 'revealMax', 'revealSnap', 'scrollBehavior', ]); } processPrimitive(opt) { switch (opt) { case 'reset': return this.reset(); case 'layer': return this.revealLayer(); case 'main': return this.revealSelector(':main'); case 'restore': return this.restore(); case 'hash': return this.hash && up.viewport.revealHash(this.hash, this.attributes()); case 'target': case 'reveal': case true: return this.revealElement(this.fragment); default: if (u.isString(opt)) { return this.revealSelector(opt); } } } processElement(element) { return this.revealElement(element); } revealElement(element) { if (element) { up.reveal(element, this.attributes()); return true; } } revealSelector(selector) { let match = this.findSelector(selector); return this.revealElement(match); } revealLayer() { return this.revealElement(this.layer.getBoxElement()); } reset() { up.viewport.resetScroll({ ...this.attributes(), around: this.fragment }); return true; } restore() { return up.viewport.restoreScroll({ ...this.attributes(), around: this.fragment }); } }; /***/ }), /* 48 */ /***/ (() => { const e = up.element; const u = up.util; up.Layer = class Layer extends up.Record { keys() { return [ 'element', 'stack', 'history', 'mode', 'context', 'lastScrollTops', 'lastFocusCapsules', ]; } defaults() { return { context: {}, lastScrollTops: up.viewport.newStateCache(), lastFocusCapsules: up.viewport.newStateCache() }; } constructor(options = {}) { super(options); if (!this.mode) { throw "missing { mode } option"; } } setupHandlers() { up.link.convertClicks(this); } teardownHandlers() { } mainTargets() { return up.layer.mainTargets(this.mode); } sync() { } accept() { throw new up.NotImplemented(); } dismiss() { throw new up.NotImplemented(); } peel(options) { this.stack.peel(this, options); } evalOption(option) { return u.evalOption(option, this); } isCurrent() { return this.stack.isCurrent(this); } isFront() { return this.stack.isFront(this); } isRoot() { return this.stack.isRoot(this); } isOverlay() { return this.stack.isOverlay(this); } isOpen() { return this.stack.isOpen(this); } isClosed() { return this.stack.isClosed(this); } get parent() { return this.stack.parentOf(this); } get child() { return this.stack.childOf(this); } get ancestors() { return this.stack.ancestorsOf(this); } get descendants() { return this.stack.descendantsOf(this); } get index() { return this.stack.indexOf(this); } getContentElement() { return this.contentElement || this.element; } getBoxElement() { return this.boxElement || this.element; } getFocusElement() { return this.getBoxElement(); } getFirstSwappableElement() { throw new up.NotImplemented(); } contains(element) { return element.closest(up.layer.anySelector()) === this.element; } on(...args) { return this.buildEventListenerGroup(args).bind(); } off(...args) { return this.buildEventListenerGroup(args).unbind(); } buildEventListenerGroup(args) { return up.EventListenerGroup.fromBindArgs(args, { guard: (event) => this.containsEventTarget(event), elements: [this.element], baseLayer: this }); } containsEventTarget(event) { return this.contains(event.target); } wasHitByMouseEvent(event) { const hittableElement = document.elementFromPoint(event.clientX, event.clientY); return !hittableElement || this.contains(hittableElement); } buildEventEmitter(args) { return up.EventEmitter.fromEmitArgs(args, { layer: this }); } emit(...args) { return this.buildEventEmitter(args).emit(); } isDetached() { return !this.element.isConnected; } saveHistory() { if (this.isHistoryVisible()) { this.savedTitle = document.title; this.savedLocation = up.history.location; } } restoreHistory() { if (!this.showsLiveHistory()) { return; } if (this.savedLocation) { up.history.push(this.savedLocation); } if (this.savedTitle) { document.title = this.savedTitle; } } asCurrent(fn) { return this.stack.asCurrent(this, fn); } updateHistory(options) { if (u.isString(options.location)) { this.location = options.location; } if (u.isString(options.title)) { this.title = options.title; } } isHistoryVisible() { return this.history && (this.isRoot() || this.parent.isHistoryVisible()); } showsLiveHistory() { return this.isHistoryVisible() && this.isFront() && (up.history.config.enabled || this.isRoot()); } get title() { if (this.showsLiveHistory()) { return document.title; } else { return this.savedTitle; } } set title(title) { this.savedTitle = title; if (this.showsLiveHistory()) { document.title = title; } } get location() { if (this.showsLiveHistory()) { return up.history.location; } else { return this.savedLocation; } } set location(location) { const previousLocation = this.location; location = up.history.normalizeURL(location); if (previousLocation !== location || this.opening) { this.savedLocation = location; if (this.showsLiveHistory()) { up.history.push(location); } if (!this.opening) { this.emit('up:layer:location:changed', { location }); } } } selector(part) { return this.constructor.selector(part); } static selector(_part) { throw new up.NotImplemented(); } toString() { throw new up.NotImplemented(); } affix(...args) { return e.affix(this.getFirstSwappableElement(), ...args); } [u.isEqual.key](other) { return (this.constructor === other.constructor) && (this.element === other.element); } hasFocus() { let focusedElement = document.activeElement; return focusedElement !== document.body && this.element.contains(focusedElement); } reset() { Object.assign(this, this.defaults()); } }; /***/ }), /* 49 */ /***/ (() => { const e = up.element; const u = up.util; up.Layer.Overlay = class Overlay extends up.Layer { keys() { return super.keys().concat([ 'position', 'align', 'size', 'origin', 'class', 'backdrop', 'openAnimation', 'closeAnimation', 'openDuration', 'closeDuration', 'openEasing', 'closeEasing', 'backdropOpenAnimation', 'backdropCloseAnimation', 'dismissable', 'dismissLabel', 'dismissAriaLabel', 'onOpened', 'onAccept', 'onAccepted', 'onDismiss', 'onDismissed', 'acceptEvent', 'dismissEvent', 'acceptLocation', 'dismissLocation', 'opening' ]); } constructor(options) { super(options); if (this.dismissable === true) { this.dismissable = ['button', 'key', 'outside']; } else if (this.dismissable === false) { this.dismissable = []; } else { this.dismissable = u.parseTokens(this.dismissable); } if (this.acceptLocation) { this.acceptLocation = new up.URLPattern(this.acceptLocation); } if (this.dismissLocation) { this.dismissLocation = new up.URLPattern(this.dismissLocation); } } callback(name) { let fn = this[name]; if (fn) { return fn.bind(this); } } createElement(parentElement) { this.nesting || (this.nesting = this.suggestVisualNesting()); const elementAttrs = u.compactObject(u.pick(this, ['align', 'position', 'size', 'class', 'nesting'])); this.element = this.affixPart(parentElement, null, elementAttrs); } createBackdropElement(parentElement) { this.backdropElement = this.affixPart(parentElement, 'backdrop'); } createViewportElement(parentElement) { this.viewportElement = this.affixPart(parentElement, 'viewport', { 'up-viewport': '' }); } createBoxElement(parentElement) { this.boxElement = this.affixPart(parentElement, 'box'); } createContentElement(parentElement, content) { this.contentElement = this.affixPart(parentElement, 'content'); this.contentElement.appendChild(content); } createDismissElement(parentElement) { this.dismissElement = this.affixPart(parentElement, 'dismiss', { 'up-dismiss': '":button"', 'aria-label': this.dismissAriaLabel }); return e.affix(this.dismissElement, 'span[aria-hidden="true"]', { text: this.dismissLabel }); } affixPart(parentElement, part, options = {}) { return e.affix(parentElement, this.selector(part), options); } static selector(part) { return u.compact(['up', this.mode, part]).join('-'); } suggestVisualNesting() { const { parent } = this; if (this.mode === parent.mode) { return 1 + parent.suggestVisualNesting(); } else { return 0; } } setupHandlers() { super.setupHandlers(); this.overlayFocus = new up.OverlayFocus(this); if (this.supportsDismissMethod('button')) { this.createDismissElement(this.getBoxElement()); } if (this.supportsDismissMethod('outside')) { if (this.viewportElement) { up.on(this.viewportElement, 'up:click', event => { if (event.target === this.viewportElement) { this.onOutsideClicked(event, true); } }); } else { this.unbindParentClicked = this.parent.on('up:click', (event, element) => { if (!up.layer.isWithinForeignOverlay(element)) { const originClicked = this.origin && this.origin.contains(element); this.onOutsideClicked(event, originClicked); } }); } } if (this.supportsDismissMethod('key')) { this.unbindEscapePressed = up.event.onEscape(event => this.onEscapePressed(event)); } this.registerClickCloser('up-accept', (value, closeOptions) => { this.accept(value, closeOptions); }); this.registerClickCloser('up-dismiss', (value, closeOptions) => { this.dismiss(value, closeOptions); }); up.migrate.registerLayerCloser?.(this); this.registerEventCloser(this.acceptEvent, this.accept); this.registerEventCloser(this.dismissEvent, this.dismiss); this.on('up:click', 'label[for]', (event, label) => this.onLabelClicked(event, label)); } onLabelClicked(event, label) { let id = label.getAttribute('for'); let fieldSelector = up.form.fieldSelector(e.idSelector(id)); let fieldsAnywhere = up.fragment.all(fieldSelector, { layer: 'any' }); let fieldsInLayer = up.fragment.all(fieldSelector, { layer: this }); if (fieldsAnywhere.length > 1 && fieldsInLayer[0] !== fieldsAnywhere[0]) { event.preventDefault(); const field = fieldsInLayer[0]; field.focus(); if (field.matches('input[type=checkbox], input[type=radio]')) { field.click(); } } } onOutsideClicked(event, halt) { up.log.putsEvent(event); if (halt) up.event.halt(event); this.dismiss(':outside', { origin: event.target }); } onEscapePressed(event) { if (this.isFront()) { let field = up.form.focusedField(); if (field) { field.blur(); } else if (this.supportsDismissMethod('key')) { up.event.halt(event, { log: true }); this.dismiss(':key'); } } } registerClickCloser(attribute, closeFn) { let selector = `[${attribute}]`; this.on('up:click', selector, function (event) { up.event.halt(event, { log: true }); const origin = event.target.closest(selector); const value = e.jsonAttr(origin, attribute); const closeOptions = { origin }; const parser = new up.OptionsParser(origin, closeOptions); parser.booleanOrString('animation'); parser.string('easing'); parser.number('duration'); parser.string('confirm'); up.error.muteUncriticalSync(() => closeFn(value, closeOptions)); }); } registerEventCloser(eventTypes, closeFn) { if (!eventTypes) { return; } return this.on(eventTypes, event => { event.preventDefault(); closeFn.call(this, event, { response: event.response }); }); } tryAcceptForLocation(options) { this.tryCloseForLocation(this.acceptLocation, this.accept, options); } tryDismissForLocation(options) { this.tryCloseForLocation(this.dismissLocation, this.dismiss, options); } tryCloseForLocation(urlPattern, closeFn, options) { let location, resolution; if (urlPattern && (location = this.location) && (resolution = urlPattern.recognize(location))) { const closeValue = { ...resolution, location }; closeFn.call(this, closeValue, options); } } teardownHandlers() { super.teardownHandlers(); this.unbindParentClicked?.(); this.unbindEscapePressed?.(); this.overlayFocus.teardown(); } destroyElements(options) { const animation = () => { return this.startCloseAnimation(options); }; const onFinished = () => { this.onElementsRemoved(); options.onFinished?.(); }; const destroyOptions = { ...options, animation, onFinished, log: false }; up.destroy(this.element, destroyOptions); } onElementsRemoved() { } startAnimation(options = {}) { const boxDone = up.animate(this.getBoxElement(), options.boxAnimation, options); let backdropDone; if (this.backdrop && !up.motion.isNone(options.boxAnimation)) { backdropDone = up.animate(this.backdropElement, options.backdropAnimation, options); } return Promise.all([boxDone, backdropDone]); } startOpenAnimation(options = {}) { return this.startAnimation({ boxAnimation: options.animation ?? this.evalOption(this.openAnimation), backdropAnimation: 'fade-in', easing: options.easing || this.openEasing, duration: options.duration || this.openDuration }).then(() => { return this.wasEverVisible = true; }); } startCloseAnimation(options = {}) { const boxAnimation = this.wasEverVisible && (options.animation ?? this.evalOption(this.closeAnimation)); return this.startAnimation({ boxAnimation, backdropAnimation: 'fade-out', easing: options.easing || this.closeEasing, duration: options.duration || this.closeDuration }); } accept(value = null, options = {}) { return this.executeCloseChange('accept', value, options); } dismiss(value = null, options = {}) { return this.executeCloseChange('dismiss', value, options); } supportsDismissMethod(method) { return u.contains(this.dismissable, method); } executeCloseChange(verb, value, options) { options = { ...options, verb, value, layer: this }; return new up.Change.CloseLayer(options).execute(); } getFirstSwappableElement() { return this.getContentElement().children[0]; } toString() { return `${this.mode} overlay`; } }; /***/ }), /* 50 */ /***/ (() => { up.Layer.OverlayWithTether = class OverlayWithTether extends up.Layer.Overlay { createElements(content) { if (!this.origin) { up.fail('Missing { origin } option'); } this.tether = new up.Tether({ anchor: this.origin, align: this.align, position: this.position }); this.createElement(this.tether.parent); this.createContentElement(this.element, content); this.tether.start(this.element); } onElementsRemoved() { this.tether.stop(); } sync() { if (this.isOpen()) { if (this.isDetached() || this.tether.isDetached()) { this.dismiss(':detached', { animation: false, preventable: false }); } else { this.tether.sync(); } } } }; /***/ }), /* 51 */ /***/ (() => { var _a; up.Layer.OverlayWithViewport = (_a = class OverlayWithViewport extends up.Layer.Overlay { static getParentElement() { return document.body; } createElements(content) { this.shiftBody(); this.createElement(this.constructor.getParentElement()); if (this.backdrop) { this.createBackdropElement(this.element); } this.createViewportElement(this.element); this.createBoxElement(this.viewportElement); this.createContentElement(this.boxElement, content); } onElementsRemoved() { this.unshiftBody(); } shiftBody() { this.constructor.bodyShifter.shift(); } unshiftBody() { this.constructor.bodyShifter.unshift(); } sync() { if (this.isDetached() && this.isOpen()) { this.constructor.getParentElement().appendChild(this.element); } } }, _a.bodyShifter = new up.BodyShifter(), _a); /***/ }), /* 52 */ /***/ (() => { var _a; const e = up.element; up.Layer.Root = (_a = class Root extends up.Layer { get element() { return e.root; } constructor(options) { super(options); this.setupHandlers(); } getFirstSwappableElement() { return document.body; } static selector() { return 'html'; } setupHandlers() { if (!this.element.upHandlersApplied) { this.element.upHandlersApplied = true; super.setupHandlers(); } } sync() { this.setupHandlers(); } accept() { this.cannotCloseRoot(); } dismiss() { this.cannotCloseRoot(); } cannotCloseRoot() { up.fail('Cannot close the root layer'); } toString() { return "root layer"; } }, _a.mode = 'root', _a); /***/ }), /* 53 */ /***/ (() => { var _a; up.Layer.Modal = (_a = class Modal extends up.Layer.OverlayWithViewport { }, _a.mode = 'modal', _a); /***/ }), /* 54 */ /***/ (() => { var _a; up.Layer.Popup = (_a = class Popup extends up.Layer.OverlayWithTether { }, _a.mode = 'popup', _a); /***/ }), /* 55 */ /***/ (() => { var _a; up.Layer.Drawer = (_a = class Drawer extends up.Layer.OverlayWithViewport { }, _a.mode = 'drawer', _a); /***/ }), /* 56 */ /***/ (() => { var _a; up.Layer.Cover = (_a = class Cover extends up.Layer.OverlayWithViewport { }, _a.mode = 'cover', _a); /***/ }), /* 57 */ /***/ (() => { const u = up.util; const e = up.element; up.LayerLookup = class LayerLookup { constructor(stack, ...args) { this.stack = stack; const options = u.parseArgIntoOptions(args, 'layer'); if (options.normalizeLayerOptions !== false) { up.layer.normalizeOptions(options); } this.values = u.parseTokens(options.layer); this.origin = options.origin; this.baseLayer = options.baseLayer || this.originLayer() || this.stack.current; if (u.isString(this.baseLayer)) { const recursiveOptions = { ...options, baseLayer: this.stack.current, normalizeLayerOptions: false }; this.baseLayer = new this.constructor(this.stack, this.baseLayer, recursiveOptions).first(); } } originLayer() { if (this.origin) { return this.forElement(this.origin); } } first() { return this.all()[0]; } all() { let results = u.flatMap(this.values, value => this.resolveValue(value)); results = u.compact(results); results = u.uniq(results); return results; } forElement(element) { element = e.get(element); return u.find(this.stack.reversed(), layer => layer.contains(element)); } forIndex(value) { return this.stack[value]; } resolveValue(value) { if (value instanceof up.Layer) { return value; } if (u.isNumber(value)) { return this.forIndex(value); } if (/^\d+$/.test(value)) { return this.forIndex(Number(value)); } if (u.isElementish(value)) { return this.forElement(value); } switch (value) { case 'any': return [this.baseLayer, ...this.stack.reversed()]; case 'current': return this.baseLayer; case 'closest': return this.stack.selfAndAncestorsOf(this.baseLayer); case 'parent': return this.baseLayer.parent; case 'ancestor': case 'ancestors': return this.baseLayer.ancestors; case 'child': return this.baseLayer.child; case 'descendant': case 'descendants': return this.baseLayer.descendants; case 'new': return 'new'; case 'root': return this.stack.root; case 'overlay': case 'overlays': return u.reverse(this.stack.overlays); case 'front': return this.stack.front; case 'origin': return this.originLayer(); default: return up.fail("Unknown { layer } option: %o", value); } } }; /***/ }), /* 58 */ /***/ (() => { const u = up.util; up.LayerStack = class LayerStack extends Array { constructor() { super(); Object.setPrototypeOf(this, up.LayerStack.prototype); this.currentOverrides = []; this.push(this.buildRoot()); } buildRoot() { return up.layer.build({ mode: 'root', stack: this }); } remove(layer) { u.remove(this, layer); } peel(layer, options) { const descendants = u.reverse(layer.descendants); const dismissOptions = { ...options, preventable: false }; for (let descendant of descendants) { descendant.dismiss(':peel', dismissOptions); } } reset() { this.peel(this.root, { animation: false }); this.currentOverrides = []; this.root.reset(); } isOpen(layer) { return layer.index >= 0; } isClosed(layer) { return !this.isOpen(layer); } parentOf(layer) { return this[layer.index - 1]; } childOf(layer) { return this[layer.index + 1]; } ancestorsOf(layer) { return u.reverse(this.slice(0, layer.index)); } selfAndAncestorsOf(layer) { return [layer, ...layer.ancestors]; } descendantsOf(layer) { return this.slice(layer.index + 1); } isRoot(layer) { return this[0] === layer; } isOverlay(layer) { return !this.isRoot(layer); } isCurrent(layer) { return this.current === layer; } isFront(layer) { return this.front === layer; } get(...args) { return this.getAll(...args)[0]; } getAll(...args) { return new up.LayerLookup(this, ...args).all(); } sync() { for (let layer of this) { layer.sync(); } } asCurrent(layer, fn) { try { this.currentOverrides.push(layer); return fn(); } finally { this.currentOverrides.pop(); } } reversed() { return u.reverse(this); } dismissOverlays(value = null, options = {}) { options.dismissable = false; for (let overlay of u.reverse(this.overlays)) { overlay.dismiss(value, options); } } [u.copy.key]() { return u.copyArrayLike(this); } get count() { return this.length; } get root() { return this[0]; } get overlays() { return this.root.descendants; } get current() { return u.last(this.currentOverrides) || this.front; } get front() { return u.last(this); } }; /***/ }), /* 59 */ /***/ (() => { up.LinkFeedbackURLs = class LinkFeedbackURLs { constructor(link) { const normalize = up.feedback.normalizeURL; this.isSafe = up.link.isSafe(link); if (this.isSafe) { const href = link.getAttribute('href'); if (href && (href !== '#')) { this.href = normalize(href); } const upHREF = link.getAttribute('up-href'); if (upHREF) { this.upHREF = normalize(upHREF); } const alias = link.getAttribute('up-alias'); if (alias) { this.aliasPattern = new up.URLPattern(alias, normalize); } } } isCurrent(normalizedLocation) { return this.isSafe && !!((this.href && (this.href === normalizedLocation)) || (this.upHREF && (this.upHREF === normalizedLocation)) || (this.aliasPattern && this.aliasPattern.test(normalizedLocation, false))); } }; /***/ }), /* 60 */ /***/ (() => { const u = up.util; const e = up.element; up.LinkPreloader = class LinkPreloader { constructor() { this.considerPreload = this.considerPreload.bind(this); } watchLink(link) { if (up.link.isSafe(link)) { this.on(link, 'mouseenter', event => this.considerPreload(event, true)); this.on(link, 'mousedown touchstart', event => this.considerPreload(event)); this.on(link, 'mouseleave', event => this.stopPreload(event)); } } on(link, eventTypes, callback) { up.on(link, eventTypes, { passive: true }, callback); } considerPreload(event, applyDelay) { const link = event.target; if (link !== this.currentLink) { this.reset(); this.currentLink = link; if (up.link.shouldFollowEvent(event, link)) { if (applyDelay) { this.preloadAfterDelay(event, link); } else { this.preloadNow(event, link); } } } } stopPreload(event) { if (event.target === this.currentLink) { return this.reset(); } } reset() { if (!this.currentLink) { return; } clearTimeout(this.timer); if (this.currentRequest?.background) { this.currentRequest.abort(); } this.currentLink = undefined; this.currentRequest = undefined; } preloadAfterDelay(event, link) { const delay = e.numberAttr(link, 'up-preload-delay') ?? up.link.config.preloadDelay; this.timer = u.timer(delay, () => this.preloadNow(event, link)); } preloadNow(event, link) { if (!link.isConnected) { this.reset(); return; } const onQueued = request => { return this.currentRequest = request; }; up.log.putsEvent(event); up.error.muteUncriticalRejection(up.link.preload(link, { onQueued })); this.queued = true; } }; /***/ }), /* 61 */ /***/ (() => { const u = up.util; const e = up.element; up.MotionController = class MotionController { constructor(name) { this.activeClass = `up-${name}`; this.selector = `.${this.activeClass}`; this.finishEvent = `up:${name}:finish`; this.finishCount = 0; this.clusterCount = 0; } startFunction(cluster, startMotion, memory = {}) { cluster = e.list(cluster); const mutedAnimator = () => up.error.muteUncriticalRejection(startMotion()); memory.trackMotion = memory.trackMotion ?? up.motion.isEnabled(); if (memory.trackMotion === false) { return mutedAnimator(); } else { memory.trackMotion = false; this.finish(cluster); this.markCluster(cluster); let promise = this.whileForwardingFinishEvent(cluster, mutedAnimator); promise = promise.then(() => this.unmarkCluster(cluster)); return promise; } } finish(elements) { this.finishCount++; if ((this.clusterCount === 0) || !up.motion.isEnabled()) { return; } elements = this.expandFinishRequest(elements); for (let element of elements) { this.finishOneElement(element); } return up.migrate.formerlyAsync?.('up.motion.finish()'); } expandFinishRequest(elements) { if (elements) { return u.flatMap(elements, el => e.list(el.closest(this.selector), el.querySelectorAll(this.selector))); } else { return document.querySelectorAll(this.selector); } } isActive(element) { return element.classList.contains(this.activeClass); } finishOneElement(element) { this.emitFinishEvent(element); } emitFinishEvent(element, eventAttrs = {}) { eventAttrs = { target: element, log: false, ...eventAttrs }; return up.emit(this.finishEvent, eventAttrs); } markCluster(cluster) { this.clusterCount++; this.toggleActive(cluster, true); } unmarkCluster(cluster) { this.clusterCount--; this.toggleActive(cluster, false); } toggleActive(cluster, isActive) { for (let element of cluster) { element.classList.toggle(this.activeClass, isActive); } } whileForwardingFinishEvent(cluster, fn) { if (cluster.length < 2) { return fn(); } const doForward = (event) => { if (!event.forwarded) { for (let element of cluster) { if (element !== event.target && this.isActive(element)) { this.emitFinishEvent(element, { forwarded: true }); } } } }; const unbindFinish = up.on(cluster, this.finishEvent, doForward); return fn().then(unbindFinish); } async reset() { await this.finish(); this.finishCount = 0; this.clusterCount = 0; } }; /***/ }), /* 62 */ /***/ (() => { const u = up.util; const e = up.element; up.NonceableCallback = class NonceableCallback { constructor(script, nonce) { this.script = script; this.nonce = nonce; } static fromString(string) { let match = string.match(/^(nonce-([^\s]+)\s)?(.*)$/); return new this(match[3], match[2]); } toFunction(...argNames) { if (up.browser.canEval()) { return new Function(...argNames, this.script); } else if (this.nonce) { let callbackThis = this; return function (...args) { return callbackThis.runAsNoncedFunction(this, argNames, args); }; } else { return this.cannotRun.bind(this); } } toString() { return `nonce-${this.nonce} ${this.script}`; } cannotRun() { throw new Error(`Your Content Security Policy disallows inline JavaScript (${this.script}). See https://unpoly.com/csp for solutions.`); } runAsNoncedFunction(thisArg, argNames, args) { let wrappedScript = ` try { up.noncedEval.value = (function(${argNames.join(',')}) { ${this.script} }).apply(up.noncedEval.thisArg, up.noncedEval.args) } catch (error) { up.noncedEval.error = error } `; let script; try { up.noncedEval = { args, thisArg: thisArg }; script = up.element.affix(document.body, 'script', { nonce: this.nonce, text: wrappedScript }); if (up.noncedEval.error) { throw up.noncedEval.error; } else { return up.noncedEval.value; } } finally { up.noncedEval = undefined; if (script) { script.remove(); } } } allowedBy(allowedNonces) { return this.nonce && u.contains(allowedNonces, this.nonce); } static adoptNonces(element, allowedNonces) { if (!allowedNonces?.length) { return; } const getPageNonce = u.memoize(up.protocol.cspNonce); u.each(up.protocol.config.nonceableAttributes, (attribute) => { let matches = e.subtree(element, `[${attribute}^="nonce-"]`); u.each(matches, (match) => { let attributeValue = match.getAttribute(attribute); let callback = this.fromString(attributeValue); let warn = (message, ...args) => up.log.warn('up.render()', `Cannot use callback [${attribute}="${attributeValue}"]: ${message}`, ...args); if (!callback.allowedBy(allowedNonces)) { return warn("Callback's CSP nonce (%o) does not match response header (%o)", callback.nonce, allowedNonces); } let pageNonce = getPageNonce(); if (!pageNonce) { return warn("Current page's CSP nonce is unknown"); } callback.nonce = pageNonce; match.setAttribute(attribute, callback.toString()); }); }); } }; /***/ }), /* 63 */ /***/ (() => { const u = up.util; const e = up.element; up.OptionsParser = class OptionsParser { constructor(element, options, parserOptions = {}) { this.options = options; this.element = element; this.fail = parserOptions.fail; this.closest = parserOptions.closest; this.attrPrefix = parserOptions.attrPrefix || 'up-'; this.defaults = parserOptions.defaults || {}; } string(key, keyOptions) { this.parse(e.attr, key, keyOptions); } boolean(key, keyOptions) { this.parse(e.booleanAttr, key, keyOptions); } number(key, keyOptions) { this.parse(e.numberAttr, key, keyOptions); } booleanOrString(key, keyOptions) { this.parse(e.booleanOrStringAttr, key, keyOptions); } json(key, keyOptions) { this.parse(e.jsonAttr, key, keyOptions); } callback(key, keyOptions = {}) { let parser = (link, attr) => e.callbackAttr(link, attr, keyOptions); this.parse(parser, key, keyOptions); } parse(attrValueFn, key, keyOptions = {}) { const attrNames = u.wrapList(keyOptions.attr ?? this.attrNameForKey(key)); let value = this.options[key]; for (let attrName of attrNames) { value ?? (value = this.parseFromAttr(attrValueFn, this.element, attrName)); } value ?? (value = keyOptions.default ?? this.defaults[key]); let normalizeFn = keyOptions.normalize; if (normalizeFn) { value = normalizeFn(value); } if (u.isDefined(value)) { this.options[key] = value; } let failKey; if (this.fail && (failKey = up.fragment.failKey(key))) { const failAttrNames = u.compact(u.map(attrNames, (attrName) => this.deriveFailAttrName(attrName))); this.parse(attrValueFn, failKey, { ...keyOptions, attr: failAttrNames }); } } parseFromAttr(attrValueFn, element, attrName) { if (this.closest) { return e.closestAttr(element, attrName, attrValueFn); } else { return attrValueFn(element, attrName); } } deriveFailAttrName(attr) { return this.deriveFailAttrNameForPrefix(attr, this.attrPrefix + 'on-') || this.deriveFailAttrNameForPrefix(attr, this.attrPrefix); } deriveFailAttrNameForPrefix(attr, prefix) { if (attr.startsWith(prefix)) { return `${prefix}fail-${attr.substring(prefix.length)}`; } } attrNameForKey(option) { return `${this.attrPrefix}${u.camelToKebabCase(option)}`; } }; /***/ }), /* 64 */ /***/ (() => { const e = up.element; const u = up.util; up.OverlayFocus = class OverlayFocus { constructor(layer) { this.layer = layer; this.focusElement = this.layer.getFocusElement(); } moveToFront() { if (this.enabled) { return; } this.enabled = true; this.untrapFocus = up.on('focusin', event => this.onFocus(event)); this.unsetAttrs = e.setTemporaryAttrs(this.focusElement, { 'tabindex': '0', 'role': 'dialog', 'aria-modal': 'true' }); this.focusTrapBefore = e.affix(this.focusElement, 'beforebegin', 'up-focus-trap[tabindex=0]'); this.focusTrapAfter = e.affix(this.focusElement, 'afterend', 'up-focus-trap[tabindex=0]'); } moveToBack() { this.teardown(); } teardown() { if (!this.enabled) { return; } this.enabled = false; this.untrapFocus(); this.unsetAttrs(); this.focusTrapBefore.remove(); this.focusTrapAfter.remove(); } onFocus(event) { const { target } = event; if (this.processingFocusEvent || up.layer.isWithinForeignOverlay(target)) { return; } this.processingFocusEvent = true; if (target === this.focusTrapBefore) { this.focusEnd(); } else if ((target === this.focusTrapAfter) || !this.layer.contains(target)) { this.focusStart(); } this.processingFocusEvent = false; } focusStart(focusOptions) { up.focus(this.focusElement, focusOptions); } focusEnd() { this.focusLastDescendant(this.layer.getBoxElement()) || this.focusStart(); } focusLastDescendant(element) { for (let child of u.reverse(element.children)) { if (up.viewport.tryFocus(child) || this.focusLastDescendant(child)) { return true; } } } }; /***/ }), /* 65 */ /***/ (() => { const u = up.util; const e = up.element; up.Params = class Params { constructor(raw) { this.clear(); this.addAll(raw); } clear() { this.entries = []; } [u.copy.key]() { return new up.Params(this); } toObject() { const obj = {}; for (let entry of this.entries) { const { name, value } = entry; if (!u.isBasicObjectProperty(name)) { if (this.isArrayKey(name)) { obj[name] || (obj[name] = []); obj[name].push(value); } else { obj[name] = value; } } } return obj; } toArray() { return this.entries; } toFormData() { const formData = new FormData(); for (let entry of this.entries) { formData.append(entry.name, entry.value); } if (!formData.entries) { formData.originalArray = this.entries; } return formData; } toQuery() { let parts = u.map(this.entries, this.arrayEntryToQuery.bind(this)); parts = u.compact(parts); return parts.join('&'); } arrayEntryToQuery(entry) { const { value } = entry; if (this.isBinaryValue(value)) { return; } let query = encodeURIComponent(entry.name); if (u.isGiven(value)) { query += "="; query += encodeURIComponent(value); } return query; } isBinaryValue(value) { return value instanceof Blob; } hasBinaryValues() { const values = u.map(this.entries, 'value'); return u.some(values, this.isBinaryValue); } toURL(base) { let parts = [base, this.toQuery()]; parts = u.filter(parts, u.isPresent); const separator = u.contains(base, '?') ? '&' : '?'; return parts.join(separator); } add(name, value) { this.entries.push({ name, value }); } addAll(raw) { if (u.isMissing(raw)) { } else if (raw instanceof this.constructor) { this.entries.push(...raw.entries); } else if (u.isArray(raw)) { this.entries.push(...raw); } else if (u.isString(raw)) { this.addAllFromQuery(raw); } else if (u.isFormData(raw)) { this.addAllFromFormData(raw); } else if (u.isObject(raw)) { this.addAllFromObject(raw); } else { up.fail("Unsupport params type: %o", raw); } } addAllFromObject(object) { for (let key in object) { const value = object[key]; const valueElements = u.isArray(value) ? value : [value]; for (let valueElement of valueElements) { this.add(key, valueElement); } } } addAllFromQuery(query) { for (let part of query.split('&')) { if (part) { let [name, value] = part.split('='); name = decodeURIComponent(name); if (u.isGiven(value)) { value = decodeURIComponent(value); } else { value = null; } this.add(name, value); } } } addAllFromFormData(formData) { for (let value of formData.entries()) { this.add(...value); } } set(name, value) { this.delete(name); this.add(name, value); } delete(name) { this.entries = u.reject(this.entries, this.matchEntryFn(name)); } matchEntryFn(name) { return entry => entry.name === name; } get(name) { if (this.isArrayKey(name)) { return this.getAll(name); } else { return this.getFirst(name); } } getFirst(name) { const entry = u.find(this.entries, this.matchEntryFn(name)); return entry?.value; } getAll(name) { if (this.isArrayKey(name)) { return this.getAll(name); } else { const entries = u.map(this.entries, this.matchEntryFn(name)); return u.map(entries, 'value'); } } isArrayKey(key) { return key.endsWith('[]'); } [u.isBlank.key]() { return this.entries.length === 0; } static fromForm(form) { form = up.fragment.get(form); return this.fromFields(up.form.fields(form)); } static fromFields(fields) { const params = new (this)(); for (let field of u.wrapList(fields)) { params.addField(field); } return params; } addField(field) { field = e.get(field); let name = field.name; if (name && !field.disabled) { const { tagName } = field; const { type } = field; if (tagName === 'SELECT') { for (let option of field.querySelectorAll('option')) { if (option.selected) { this.add(name, option.value); } } } else if ((type === 'checkbox') || (type === 'radio')) { if (field.checked) { this.add(name, field.value); } } else if (type === 'file') { for (let file of field.files) { this.add(name, file); } } else { return this.add(name, field.value); } } } [u.isEqual.key](other) { return (this.constructor === other.constructor) && u.isEqual(this.entries, other.entries); } static fromURL(url) { const params = new (this)(); const urlParts = u.parseURL(url); let query = urlParts.search; if (query) { query = query.replace(/^\?/, ''); params.addAll(query); } return params; } static stripURL(url) { return u.normalizeURL(url, { search: false }); } static merge(...objects) { return objects.reduce(function (allParams, params) { allParams.addAll(params); return allParams; }, new up.Params()); } }; /***/ }), /* 66 */ /***/ (() => { const e = up.element; const TRANSITION_DELAY = 300; up.ProgressBar = class ProgressBar { constructor() { this.step = 0; this.element = e.affix(document.body, 'up-progress-bar'); this.element.style.transition = `width ${TRANSITION_DELAY}ms ease-out`; this.moveTo(0); up.element.paint(this.element); this.width = 31; this.nextStep(); } nextStep() { let diff; if (this.width < 80) { if (Math.random() < 0.15) { diff = 7 + (5 * Math.random()); } else { diff = 1.5 + (0.5 * Math.random()); } } else { diff = 0.13 * (100 - this.width) * Math.random(); } this.moveTo(this.width + diff); this.step++; const nextStepDelay = TRANSITION_DELAY + (this.step * 40); this.timeout = setTimeout(this.nextStep.bind(this), nextStepDelay); } moveTo(width) { this.width = width; this.element.style.width = `${width}vw`; } destroy() { clearTimeout(this.timeout); this.element.remove(); } conclude() { clearTimeout(this.timeout); this.moveTo(100); setTimeout(this.destroy.bind(this), TRANSITION_DELAY); } }; /***/ }), /* 67 */ /***/ (() => { const u = up.util; up.RenderOptions = (function () { const GLOBAL_DEFAULTS = { useHungry: true, useKeep: true, source: true, saveScroll: true, saveFocus: true, focus: 'keep', abort: 'target', failOptions: true, }; const PRELOAD_OVERRIDES = { abort: false, confirm: false, feedback: false, cache: true, background: true, }; const PREFLIGHT_KEYS = [ 'url', 'method', 'origin', 'headers', 'params', 'cache', 'fallback', 'abort', 'abortable', 'confirm', 'feedback', 'origin', 'baseLayer', 'fail', 'onError', ]; const SHARED_KEYS = PREFLIGHT_KEYS.concat([ 'keep', 'hungry', 'history', 'source', 'saveScroll', 'navigate', ]); const CONTENT_KEYS = [ 'url', 'response', 'content', 'fragment', 'document', ]; const LATE_KEYS = [ 'history', 'focus', 'scroll', ]; function navigateDefaults(options) { if (options.navigate) { return up.fragment.config.navigateOptions; } } function preloadOverrides(options) { if (options.preload) { return PRELOAD_OVERRIDES; } } function preprocess(options) { up.migrate.preprocessRenderOptions?.(options); const defaults = u.merge(GLOBAL_DEFAULTS, navigateDefaults(options)); return u.merge(u.omit(defaults, LATE_KEYS), { defaults }, options, preloadOverrides(options)); } function finalize(preprocessedOptions, lateDefaults) { return u.merge(preprocessedOptions.defaults, lateDefaults, preprocessedOptions); } function assertContentGiven(options) { if (!u.some(CONTENT_KEYS, contentKey => u.isGiven(options[contentKey]))) { if (options.defaultToEmptyContent) { options.content = ''; } else { up.fail('up.render() needs either { ' + CONTENT_KEYS.join(', ') + ' } option'); } } } function failOverrides(options) { const overrides = {}; for (let key in options) { const value = options[key]; let unprefixed = up.fragment.successKey(key); if (unprefixed) { overrides[unprefixed] = value; } } return overrides; } function deriveFailOptions(preprocessedOptions) { if (preprocessedOptions.failOptions) { return { ...preprocessedOptions.defaults, ...u.pick(preprocessedOptions, SHARED_KEYS), ...failOverrides(preprocessedOptions), ...{ failPrefixForced: true } }; } else { return { ...preprocessedOptions, ...failOverrides(preprocessedOptions), }; } } return { preprocess, finalize, assertContentGiven, deriveFailOptions, }; })(); /***/ }), /* 68 */ /***/ (() => { up.RenderResult = class RenderResult extends up.Record { keys() { return [ 'fragments', 'layer', 'target', 'options', 'finished', ]; } defaults() { return { fragments: [], }; } get none() { return !this.fragments.length; } get fragment() { return this.fragments[0]; } }; /***/ }), /* 69 */ /***/ (() => { var _a; const u = up.util; up.Request = (_a = class Request extends up.Record { keys() { return [ 'method', 'url', 'hash', 'params', 'target', 'failTarget', 'headers', 'timeout', 'background', 'cache', 'expireCache', 'evictCache', 'layer', 'mode', 'context', 'failLayer', 'failMode', 'failContext', 'origin', 'fragments', 'builtAt', 'wrapMethod', 'contentType', 'payload', 'onQueued', 'onLoading', 'fail', 'abortable', 'badResponseTime', ]; } defaults() { return { state: 'new', abortable: true, headers: {}, timeout: up.network.config.timeout, builtAt: new Date(), }; } constructor(options) { super(options); this.params = new up.Params(this.params); if (this.wrapMethod == null) { this.wrapMethod = up.network.config.wrapMethod; } this.normalize(); if ((this.target || this.layer || this.origin) && !options.basic) { const layerLookupOptions = { origin: this.origin }; this.layer = up.layer.get(this.layer, layerLookupOptions); this.failLayer = up.layer.get(this.failLayer || this.layer, layerLookupOptions); this.context || (this.context = this.layer.context || {}); this.failContext || (this.failContext = this.failLayer.context || {}); this.mode || (this.mode = this.layer.mode); this.failMode || (this.failMode = this.failLayer.mode); } this.deferred = u.newDeferred(); this.badResponseTime ?? (this.badResponseTime = u.evalOption(up.network.config.badResponseTime, this)); this.addAutoHeaders(); } get xhr() { return this._xhr ?? (this._xhr = new XMLHttpRequest()); } get fragments() { if (this._fragments) { return this._fragments; } else if (this.target) { let steps = up.fragment.parseTargetSteps(this.target); let selectors = u.map(steps, 'selector'); let lookupOpts = { origin: this.origin, layer: this.layer }; return u.compact(u.map(selectors, (selector) => up.fragment.get(selector, lookupOpts))); } } set fragments(value) { this._fragments = value; } get fragment() { return this.fragments?.[0]; } normalize() { this.method = u.normalizeMethod(this.method); this.extractHashFromURL(); this.transferParamsToURL(); this.url = u.normalizeURL(this.url); } evictExpensiveAttrs() { u.task(() => { this.layer = undefined; this.failLayer = undefined; this.origin = undefined; this.fragments = undefined; }); } extractHashFromURL() { let match = this.url?.match(/^([^#]*)(#.+)$/); if (match) { this.url = match[1]; return this.hash = match[2]; } } transferParamsToURL() { if (!this.url || this.allowsPayload() || u.isBlank(this.params)) { return; } this.url = this.params.toURL(this.url); this.params.clear(); } isSafe() { return up.network.isSafeMethod(this.method); } allowsPayload() { return u.methodAllowsPayload(this.method); } will302RedirectWithGET() { return this.isSafe() || (this.method === 'POST'); } willCache() { return u.evalAutoOption(this.cache, up.network.config.autoCache, this); } runQueuedCallbacks() { u.always(this, () => this.evictExpensiveAttrs()); this.onQueued?.(this); } load() { if (this.state !== 'new') return; if (this.emitLoad()) { this.state = 'loading'; this.normalize(); this.onLoading?.(); this.expired = false; new up.Request.XHRRenderer(this).buildAndSend({ onload: () => this.onXHRLoad(), onerror: () => this.onXHRError(), ontimeout: () => this.onXHRTimeout(), onabort: () => this.onXHRAbort() }); return true; } else { this.abort({ reason: 'Prevented by event listener' }); } } emitLoad() { let event = this.emit('up:request:load', { log: ['Loading %s', this.description] }); return !event.defaultPrevented; } loadPage() { up.network.abort(); new up.Request.FormRenderer(this).buildAndSubmit(); } onXHRLoad() { const response = this.extractResponseFromXHR(); const log = 'Loaded ' + response.description; this.emit('up:request:loaded', { request: response.request, response, log }); this.respondWith(response); } onXHRError() { this.setOfflineState('Network error'); } onXHRTimeout() { this.setOfflineState('Timeout'); } onXHRAbort() { this.setAbortedState(); } abort({ reason } = {}) { if (this.setAbortedState(reason) && this._xhr) { this._xhr.abort(); } } setAbortedState(reason) { if (this.isSettled()) return; let message = 'Aborted request to ' + this.description + (reason ? ': ' + reason : ''); this.state = 'aborted'; this.deferred.reject(new up.Aborted(message)); this.emit('up:request:aborted', { log: message }); return true; } setOfflineState(reason) { if (this.isSettled()) return; let message = 'Cannot load request to ' + this.description + (reason ? ': ' + reason : ''); this.state = 'offline'; this.deferred.reject(new up.Offline(message)); this.emit('up:request:offline', { log: message }); } respondWith(response) { this.response = response; if (this.isSettled()) return; this.state = 'loaded'; if (response.ok) { this.deferred.resolve(response); } else { this.deferred.reject(response); } } isSettled() { return (this.state !== 'new') && (this.state !== 'loading') && (this.state !== 'tracking'); } csrfHeader() { return up.protocol.csrfHeader(); } csrfParam() { return up.protocol.csrfParam(); } csrfToken() { if (!this.isSafe() && !this.isCrossOrigin()) { return up.protocol.csrfToken(); } } isCrossOrigin() { return u.isCrossOrigin(this.url); } extractResponseFromXHR() { const responseAttrs = { method: this.method, url: this.url, request: this, xhr: this.xhr, text: this.xhr.responseText, status: this.xhr.status, title: up.protocol.titleFromXHR(this.xhr), target: up.protocol.targetFromXHR(this.xhr), acceptLayer: up.protocol.acceptLayerFromXHR(this.xhr), dismissLayer: up.protocol.dismissLayerFromXHR(this.xhr), eventPlans: up.protocol.eventPlansFromXHR(this.xhr), context: up.protocol.contextFromXHR(this.xhr), expireCache: up.protocol.expireCacheFromXHR(this.xhr), evictCache: up.protocol.evictCacheFromXHR(this.xhr), fail: this.fail, }; let methodFromResponse = up.protocol.methodFromXHR(this.xhr); let urlFromResponse = up.protocol.locationFromXHR(this.xhr); if (urlFromResponse) { if (!u.matchURLs(this.url, urlFromResponse)) { methodFromResponse || (methodFromResponse = 'GET'); } responseAttrs.url = urlFromResponse; } if (methodFromResponse) { responseAttrs.method = methodFromResponse; } return new up.Response(responseAttrs); } buildEventEmitter(args) { return up.EventEmitter.fromEmitArgs(args, { layer: this.layer, request: this, origin: this.origin }); } emit(...args) { return this.buildEventEmitter(args).emit(); } assertEmitted(...args) { this.buildEventEmitter(args).assertEmitted(); } get description() { return this.method + ' ' + this.url; } isPartOfSubtree(subtreeElements) { if (!this.fragments || !subtreeElements) { return false; } subtreeElements = u.wrapList(subtreeElements); return u.some(this.fragments, function (fragment) { return u.some(subtreeElements, (subtreeElement) => subtreeElement.contains(fragment)); }); } get age() { return new Date() - this.builtAt; } header(name) { return this.headers[name]; } addAutoHeaders() { for (let key of ['target', 'failTarget', 'mode', 'failMode', 'context', 'failContext']) { this.addAutoHeader(up.protocol.headerize(key), this[key]); } let csrfHeader, csrfToken; if ((csrfHeader = this.csrfHeader()) && (csrfToken = this.csrfToken())) { this.addAutoHeader(csrfHeader, csrfToken); } this.addAutoHeader(up.protocol.headerize('version'), up.version); } addAutoHeader(name, value) { if (u.isMissing(value)) { return; } if (u.isOptions(value) || u.isArray(value)) { value = u.safeStringifyJSON(value); } this.headers[name] = value; } static tester(condition, { except } = {}) { let testFn; if (u.isFunction(condition)) { testFn = condition; } else if (condition instanceof this) { testFn = (request) => condition === request; } else if (u.isString(condition)) { let pattern = new up.URLPattern(condition); testFn = (request) => pattern.test(request.url); } else { testFn = (_request) => condition; } if (except) { return (request) => !up.cache.willHaveSameResponse(request, except) && testFn(request); } else { return testFn; } } }, (() => { u.delegate(_a.prototype, ['then', 'catch', 'finally'], function () { return this.deferred; }); })(), _a); /***/ }), /* 70 */ /***/ (() => { const u = up.util; up.Request.Cache = class Cache { constructor() { this.reset(); } reset() { this.varyInfo = {}; this.map = new Map(); } cacheKey(request) { let influencingHeaders = this.getPreviousInfluencingHeaders(request); let varyPart = u.flatMap(influencingHeaders, (headerName) => [headerName, request.header(headerName)]); return [request.description, ...varyPart].join(':'); } getPreviousInfluencingHeaders(request) { var _a, _b; return ((_a = this.varyInfo)[_b = request.description] || (_a[_b] = new Set())); } get(request) { request = this.wrap(request); let cacheKey = this.cacheKey(request); let cachedRequest = this.map.get(cacheKey); if (cachedRequest) { if (this.isUsable(cachedRequest)) { return cachedRequest; } else { this.map.delete(cacheKey); } } } get capacity() { return up.network.config.cacheSize; } isUsable(request) { return request.age < up.network.config.cacheEvictAge; } async put(request) { request = this.wrap(request); this.makeRoom(); let cacheKey = this.updateCacheKey(request); this.map.set(cacheKey, request); } updateCacheKey(request) { let oldCacheKey = this.cacheKey(request); let { response } = request; if (response) { this.mergePreviousHeaderNames(request, response); let newCacheKey = this.cacheKey(request); this.renameMapKey(oldCacheKey, newCacheKey); return newCacheKey; } else { return oldCacheKey; } } renameMapKey(oldKey, newKey) { if (oldKey !== newKey && this.map.has(oldKey)) { this.map.set(newKey, this.map.get(oldKey)); this.map.delete(oldKey); } } mergePreviousHeaderNames(request, response) { let headersInfluencingResponse = response.ownInfluncingHeaders; if (headersInfluencingResponse.length) { let previousInfluencingHeaders = this.getPreviousInfluencingHeaders(request); for (let headerName of headersInfluencingResponse) { previousInfluencingHeaders.add(headerName); } } } alias(existingCachedRequest, newRequest) { existingCachedRequest = this.get(existingCachedRequest); if (!existingCachedRequest) return; newRequest = this.wrap(newRequest); this.track(existingCachedRequest, newRequest, { force: true }); this.put(newRequest); return newRequest; } async track(existingRequest, newRequest, options = {}) { newRequest.trackedRequest = existingRequest; newRequest.state = 'tracking'; let value = await u.always(existingRequest); if (value instanceof up.Response) { if (options.force || this.isCacheCompatible(existingRequest, newRequest)) { newRequest.fromCache = true; value = u.variant(value, { request: newRequest }); newRequest.respondWith(value); u.delegate(newRequest, ['expired', 'state'], () => existingRequest); } else { delete newRequest.trackedRequest; newRequest.state = 'new'; options.onIncompatible?.(newRequest); } } else { newRequest.state = existingRequest.state; newRequest.deferred.reject(value); } } willHaveSameResponse(existingRequest, newRequest) { return existingRequest === newRequest || existingRequest === newRequest.trackedRequest; } delete(request) { request = this.wrap(request); let cacheKey = this.cacheKey(request); this.map.delete(cacheKey); } evict(condition = true, testerOptions) { this.eachMatch(condition, testerOptions, (request) => this.delete(request)); } expire(condition = true, testerOptions) { this.eachMatch(condition, testerOptions, (request) => request.expired = true); } makeRoom() { while (this.map.size >= this.capacity) { let oldestKey = this.map.keys().next().value; this.map.delete(oldestKey); } } eachMatch(condition = true, testerOptions, fn) { let tester = up.Request.tester(condition, testerOptions); let results = u.filter(this.map.values(), tester); u.each(results, fn); } isCacheCompatible(request1, request2) { return this.cacheKey(request1) === this.cacheKey(request2); } wrap(requestOrOptions) { return u.wrapValue(up.Request, requestOrOptions); } }; /***/ }), /* 71 */ /***/ (() => { const u = up.util; up.Request.Queue = class Queue { constructor() { this.reset(); } reset() { this.queuedRequests = []; this.currentRequests = []; this.emittedLate = false; } get allRequests() { return this.currentRequests.concat(this.queuedRequests); } asap(request) { request.runQueuedCallbacks(); u.always(request, responseOrError => this.onRequestSettled(request, responseOrError)); this.scheduleSlowTimer(request); this.queueRequest(request); u.microtask(() => this.poke()); } promoteToForeground(request) { if (request.background) { request.background = false; this.scheduleSlowTimer(request); } } scheduleSlowTimer(request) { let timeUntilLate = Math.max(request.badResponseTime - request.age, 0); u.timer(timeUntilLate, () => this.checkLate()); } getMaxConcurrency() { return u.evalOption(up.network.config.concurrency); } hasConcurrencyLeft() { const maxConcurrency = this.getMaxConcurrency(); return (maxConcurrency === -1) || (this.currentRequests.length < maxConcurrency); } isBusy() { return this.currentRequests.length > 0 || this.queuedRequests.length > 0; } queueRequest(request) { this.queuedRequests.push(request); } pluckNextRequest() { let request = u.find(this.queuedRequests, request => !request.background); request || (request = this.queuedRequests[0]); return u.remove(this.queuedRequests, request); } sendRequestNow(request) { if (request.load()) { this.currentRequests.push(request); } } onRequestSettled(request, responseOrError) { u.remove(this.currentRequests, request) || u.remove(this.queuedRequests, request); if ((responseOrError instanceof up.Response) && responseOrError.ok) { up.network.registerAliasForRedirect(request, responseOrError); } this.checkLate(); u.microtask(() => this.poke()); } poke() { let request; if (this.hasConcurrencyLeft() && (request = this.pluckNextRequest())) { return this.sendRequestNow(request); } } abort(...args) { let options = u.extractOptions(args); let { except, reason, logOnce } = options; let conditions = args[0] ?? true; let tester = up.Request.tester(conditions, { except }); for (let list of [this.currentRequests, this.queuedRequests]) { const abortableRequests = u.filter(list, tester); for (let abortableRequest of abortableRequests) { if (logOnce) { up.puts(...logOnce); logOnce = null; } abortableRequest.abort({ reason }); u.remove(list, abortableRequest); } } } checkLate() { const currentLate = this.isLate(); if (this.emittedLate !== currentLate) { this.emittedLate = currentLate; if (currentLate) { up.emit('up:network:late', { log: 'Server is slow to respond' }); } else { up.emit('up:network:recover', { log: 'Slow requests were loaded' }); } } } isLate() { const allForegroundRequests = u.reject(this.allRequests, 'background'); const timerTolerance = 1; return u.some(allForegroundRequests, (request) => request.age >= (request.badResponseTime - timerTolerance)); } }; /***/ }), /* 72 */ /***/ (() => { const u = up.util; const e = up.element; const HTML_FORM_METHODS = ['GET', 'POST']; up.Request.FormRenderer = class FormRenderer { constructor(request) { this.request = request; } buildAndSubmit() { this.params = u.copy(this.request.params); let action = this.request.url; let { method } = this.request; const paramsFromQuery = up.Params.fromURL(action); this.params.addAll(paramsFromQuery); action = up.Params.stripURL(action); if (!u.contains(HTML_FORM_METHODS, method)) { method = up.protocol.wrapMethod(method, this.params); } this.form = e.affix(document.body, 'form.up-request-loader', { method, action }); let contentType = this.request.contentType; if (contentType) { this.form.setAttribute('enctype', contentType); } let csrfParam, csrfToken; if ((csrfParam = this.request.csrfParam()) && (csrfToken = this.request.csrfToken())) { this.params.add(csrfParam, csrfToken); } u.each(this.params.toArray(), this.addField.bind(this)); up.browser.submitForm(this.form); } addField(attrs) { e.affix(this.form, 'input[type=hidden]', attrs); } }; /***/ }), /* 73 */ /***/ (() => { var _a; const CONTENT_TYPE_URL_ENCODED = 'application/x-www-form-urlencoded'; const CONTENT_TYPE_FORM_DATA = 'multipart/form-data'; const u = up.util; up.Request.XHRRenderer = (_a = class XHRRenderer { constructor(request) { this.request = request; } buildAndSend(handlers) { const xhr = this.request.xhr; this.params = u.copy(this.request.params); if (this.request.timeout) { xhr.timeout = this.request.timeout; } xhr.open(this.getMethod(), this.request.url); let contentType = this.getContentType(); if (contentType) { xhr.setRequestHeader('Content-Type', contentType); } for (let headerName in this.request.headers) { let headerValue = this.request.headers[headerName]; xhr.setRequestHeader(headerName, headerValue); } Object.assign(xhr, handlers); xhr.send(this.getPayload()); } getMethod() { if (!this.method) { this.method = this.request.method; if (this.request.wrapMethod && !this.request.will302RedirectWithGET()) { this.method = up.protocol.wrapMethod(this.method, this.params); } } return this.method; } getContentType() { this.finalizePayload(); return this.contentType; } getPayload() { this.finalizePayload(); return this.payload; } finalizePayload() { this.payload = this.request.payload; this.contentType = this.request.contentType; if (!this.payload && this.request.allowsPayload()) { if (!this.contentType) { this.contentType = this.params.hasBinaryValues() ? CONTENT_TYPE_FORM_DATA : CONTENT_TYPE_URL_ENCODED; } if (this.contentType === CONTENT_TYPE_FORM_DATA) { this.contentType = null; this.payload = this.params.toFormData(); } else { this.payload = this.params.toQuery().replace(/%20/g, '+'); } } } }, (() => { u.memoizeMethod(_a.prototype, [ 'finalizePayload', ]); })(), _a); /***/ }), /* 74 */ /***/ (() => { const u = up.util; up.Response = class Response extends up.Record { keys() { return [ 'method', 'url', 'text', 'status', 'request', 'xhr', 'target', 'title', 'acceptLayer', 'dismissLayer', 'eventPlans', 'context', 'expireCache', 'evictCache', 'headers', 'loadedAt', 'fail', ]; } defaults() { return { headers: {}, loadedAt: new Date() }; } get ok() { return !u.evalOption(this.fail ?? up.network.config.fail, this); } get none() { return !this.text; } isCacheable() { return this.ok && !this.none; } header(name) { return this.headers[name] || this.xhr?.getResponseHeader(name); } get ownInfluncingHeaders() { let influencingHeaders = up.protocol.influencingHeadersFromResponse(this); return u.filter(influencingHeaders, (headerName) => this.request.header(headerName)); } get contentType() { return this.header('Content-Type'); } get cspNonces() { return up.protocol.cspNoncesFromHeader(this.header('Content-Security-Policy')); } get lastModified() { let header = this.header('Last-Modified'); if (header) { return new Date(header); } } get etag() { return this.header('ETag'); } get json() { return this.parsedJSON || (this.parsedJSON = JSON.parse(this.text)); } get age() { let now = new Date(); return now - this.loadedAt; } get expired() { return this.age > up.network.config.cacheExpireAge || this.request.expired; } get description() { return `HTTP ${this.status} response to ${this.request.description}`; } }; /***/ }), /* 75 */ /***/ (() => { var _a; const u = up.util; const e = up.element; up.ResponseDoc = (_a = class ResponseDoc { constructor(options) { this.root = this.parseDocument(options) || this.parseFragment(options) || this.parseContent(options); if (!up.fragment.config.runScripts) { this.root.querySelectorAll('script').forEach((e) => e.remove()); } this.cspNonces = options.cspNonces; if (options.origin) { let originSelector = up.fragment.tryToTarget(options.origin); if (originSelector) { this.rediscoveredOrigin = this.select(originSelector); } } } parseDocument(options) { let document = this.parse(options.document, e.createBrokenDocumentFromHTML); if (document) { this.scriptishNeedFix = true; return document; } } parseContent(options) { let content = options.content || ''; let target = options.target || up.fail("must pass a { target } when passing { content }"); target = u.map(up.fragment.parseTargetSteps(target), 'selector').join(','); const matchingElement = e.createFromSelector(target); if (u.isString(content)) { matchingElement.innerHTML = content; } else { matchingElement.appendChild(content); } return matchingElement; } parseFragment(options) { return this.parse(options.fragment); } parse(value, parseFn = e.createFromHTML) { if (u.isString(value)) { value = parseFn(value); } return value; } rootSelector() { return up.fragment.toTarget(this.root); } getTitle() { return this.root.querySelector('head title')?.textContent; } select(selector) { let finder = new up.FragmentFinder({ selector: selector, origin: this.rediscoveredOrigin, externalRoot: this.root, }); return finder.find(); } finalizeElement(element) { up.NonceableCallback.adoptNonces(element, this.cspNonces); if (this.scriptishNeedFix) { element.querySelectorAll('noscript, script').forEach(e.fixScriptish); } } }, (() => { u.memoizeMethod(_a.prototype, 'getTitle'); })(), _a); /***/ }), /* 76 */ /***/ (() => { const e = up.element; const u = up.util; up.RevealMotion = class RevealMotion { constructor(element, options = {}) { this.element = element; this.options = options; this.viewport = e.get(this.options.viewport) || up.viewport.get(this.element); this.obstructionsLayer = up.layer.get(this.viewport); const viewportConfig = up.viewport.config; this.snap = this.options.snap ?? this.options.revealSnap ?? viewportConfig.revealSnap; this.padding = this.options.padding ?? this.options.revealPadding ?? viewportConfig.revealPadding; this.top = this.options.top ?? this.options.revealTop ?? viewportConfig.revealTop; this.max = this.options.max ?? this.options.revealMax ?? viewportConfig.revealMax; this.topObstructions = viewportConfig.fixedTop; this.bottomObstructions = viewportConfig.fixedBottom; } start() { const viewportRect = this.getViewportRect(this.viewport); const elementRect = up.Rect.fromElement(this.element); if (this.max) { const maxPixels = u.evalOption(this.max, this.element); elementRect.height = Math.min(elementRect.height, maxPixels); } this.addPadding(elementRect); this.substractObstructions(viewportRect); if (viewportRect.height < 0) { up.fail('Viewport has no visible area'); } const originalScrollTop = this.viewport.scrollTop; let newScrollTop = originalScrollTop; if (this.top || (elementRect.height > viewportRect.height)) { const diff = elementRect.top - viewportRect.top; newScrollTop += diff; } else if (elementRect.top < viewportRect.top) { newScrollTop -= (viewportRect.top - elementRect.top); } else if (elementRect.bottom > viewportRect.bottom) { newScrollTop += (elementRect.bottom - viewportRect.bottom); } else { } if (u.isNumber(this.snap) && (newScrollTop < this.snap) && (elementRect.top < (0.5 * viewportRect.height))) { newScrollTop = 0; } if (newScrollTop !== originalScrollTop) { this.viewport.scrollTo({ ...this.options, top: newScrollTop }); } } getViewportRect() { if (up.viewport.isRoot(this.viewport)) { return new up.Rect({ left: 0, top: 0, width: up.viewport.rootWidth(), height: up.viewport.rootHeight() }); } else { return up.Rect.fromElement(this.viewport); } } addPadding(elementRect) { elementRect.top -= this.padding; elementRect.height += 2 * this.padding; } selectObstructions(selectors) { let elements = up.fragment.all(selectors.join(','), { layer: this.obstructionsLayer }); return u.filter(elements, e.isVisible); } substractObstructions(viewportRect) { for (let obstruction of this.selectObstructions(this.topObstructions)) { let obstructionRect = up.Rect.fromElement(obstruction); let diff = obstructionRect.bottom - viewportRect.top; if (diff > 0) { viewportRect.top += diff; viewportRect.height -= diff; } } for (let obstruction of this.selectObstructions(this.bottomObstructions)) { let obstructionRect = up.Rect.fromElement(obstruction); let diff = viewportRect.bottom - obstructionRect.top; if (diff > 0) { viewportRect.height -= diff; } } } }; /***/ }), /* 77 */ /***/ (() => { const u = up.util; up.Selector = class Selector { constructor(selectors, filters = []) { this.selectors = selectors; this.filters = filters; this.unionSelector = this.selectors.join(',') || 'match-none'; } matches(element) { return element.matches(this.unionSelector) && this.passesFilter(element); } closest(element) { let parentElement; if (this.matches(element)) { return element; } else if (parentElement = element.parentElement) { return this.closest(parentElement); } } passesFilter(element) { return u.every(this.filters, filter => filter(element)); } descendants(root) { const results = u.flatMap(this.selectors, selector => root.querySelectorAll(selector)); return u.filter(results, element => this.passesFilter(element)); } subtree(root) { const results = []; if (!(root instanceof Document) && this.matches(root)) { results.push(root); } results.push(...this.descendants(root)); return results; } }; /***/ }), /* 78 */ /***/ (() => { const u = up.util; const e = up.element; up.Tether = class Tether { constructor(options) { up.migrate.handleTetherOptions?.(options); this.anchor = options.anchor; this.align = options.align; this.position = options.position; this.alignAxis = (this.position === 'top') || (this.position === 'bottom') ? 'horizontal' : 'vertical'; this.viewport = up.viewport.get(this.anchor); this.parent = this.viewport === e.root ? document.body : this.viewport; this.syncOnScroll = !this.viewport.contains(this.anchor.offsetParent); } start(element) { this.element = element; this.element.style.position = 'absolute'; this.setOffset(0, 0); this.sync(); this.changeEventSubscription('on'); } stop() { this.changeEventSubscription('off'); } changeEventSubscription(fn) { let doScheduleSync = this.scheduleSync.bind(this); up[fn](window, 'resize', doScheduleSync); if (this.syncOnScroll) { up[fn](this.viewport, 'scroll', doScheduleSync); } } scheduleSync() { clearTimeout(this.syncTimer); return this.syncTimer = u.task(this.sync.bind(this)); } isDetached() { return !this.parent.isConnected || !this.anchor.isConnected; } sync() { const elementBox = this.element.getBoundingClientRect(); const elementMargin = { top: e.styleNumber(this.element, 'marginTop'), right: e.styleNumber(this.element, 'marginRight'), bottom: e.styleNumber(this.element, 'marginBottom'), left: e.styleNumber(this.element, 'marginLeft') }; const anchorBox = this.anchor.getBoundingClientRect(); let left; let top; switch (this.alignAxis) { case 'horizontal': { switch (this.position) { case 'top': top = anchorBox.top - elementMargin.bottom - elementBox.height; break; case 'bottom': top = anchorBox.top + anchorBox.height + elementMargin.top; break; } switch (this.align) { case 'left': left = anchorBox.left + elementMargin.left; break; case 'center': left = anchorBox.left + (0.5 * (anchorBox.width - elementBox.width)); break; case 'right': left = (anchorBox.left + anchorBox.width) - elementBox.width - elementMargin.right; break; } break; } case 'vertical': { switch (this.align) { case 'top': top = anchorBox.top + elementMargin.top; break; case 'center': top = anchorBox.top + (0.5 * (anchorBox.height - elementBox.height)); break; case 'bottom': top = (anchorBox.top + anchorBox.height) - elementBox.height - elementMargin.bottom; break; } switch (this.position) { case 'left': left = anchorBox.left - elementMargin.right - elementBox.width; break; case 'right': left = anchorBox.left + anchorBox.width + elementMargin.left; break; } break; } } if (u.isDefined(left) || u.isDefined(top)) { this.moveTo(left, top); } else { up.fail('Invalid tether constraints: %o', this.describeConstraints()); } } describeConstraints() { return { position: this.position, align: this.align }; } moveTo(targetLeft, targetTop) { const elementBox = this.element.getBoundingClientRect(); this.setOffset((targetLeft - elementBox.left) + this.offsetLeft, (targetTop - elementBox.top) + this.offsetTop); } setOffset(left, top) { this.offsetLeft = left; this.offsetTop = top; e.setStyle(this.element, { left, top }); } }; /***/ }), /* 79 */ /***/ (() => { const u = up.util; up.URLPattern = class URLPattern { constructor(fullPattern, normalizeURL = u.normalizeURL) { this.normalizeURL = normalizeURL; this.groups = []; const positiveList = []; const negativeList = []; for (let pattern of u.parseTokens(fullPattern)) { if (pattern[0] === '-') { negativeList.push(pattern.substring(1)); } else { positiveList.push(pattern); } } this.positiveRegexp = this.buildRegexp(positiveList, true); this.negativeRegexp = this.buildRegexp(negativeList, false); } buildRegexp(list, capture) { if (!list.length) { return; } list = list.map((url) => { if (url[0] === '*') { url = '/' + url; } url = this.normalizeURL(url); url = u.escapeRegExp(url); return url; }); let reCode = list.join('|'); reCode = reCode.replace(/\\\*/g, '.*?'); reCode = reCode.replace(/(:|\\\$)([a-z][\w-]*)/ig, (match, type, name) => { if (type === '\\$') { if (capture) { this.groups.push({ name, cast: Number }); } return '(\\d+)'; } else { if (capture) { this.groups.push({ name, cast: String }); } return '([^/?#]+)'; } }); return new RegExp('^(?:' + reCode + ')$'); } test(url, doNormalize = true) { if (doNormalize) { url = this.normalizeURL(url); } return this.positiveRegexp.test(url) && !this.isExcluded(url); } recognize(url, doNormalize = true) { if (doNormalize) { url = this.normalizeURL(url); } let match = this.positiveRegexp.exec(url); if (match && !this.isExcluded(url)) { const resolution = {}; this.groups.forEach((group, groupIndex) => { let value = match[groupIndex + 1]; if (value) { return resolution[group.name] = group.cast(value); } }); return resolution; } } isExcluded(url) { return this.negativeRegexp?.test(url); } }; /***/ }), /* 80 */ /***/ (() => { up.framework = (function () { let readyState = 'evaling'; function emitReset() { up.emit('up:framework:reset', { log: false }); } function boot() { if (readyState !== 'configuring') { console.error('Unpoly has already booted'); return; } let issue = supportIssue(); if (!issue) { readyState = 'booting'; up.emit('up:framework:boot', { log: false }); readyState = 'booted'; up.emit('up:framework:booted', { log: false }); } else { console.error("Unpoly cannot boot: %s", issue); } } function mustBootManually() { let unpolyScript = document.currentScript; if (unpolyScript?.async) { return true; } if (unpolyScript?.getAttribute('up-boot') === 'manual') { return true; } if (document.readyState === 'complete') { return true; } } function onEvaled() { up.emit('up:framework:evaled', { log: false }); if (mustBootManually()) { console.debug('Call up.boot() after you have configured Unpoly'); } else { document.addEventListener('DOMContentLoaded', boot); } readyState = 'configuring'; } function startExtension() { if (readyState !== 'configuring') { throw new Error('Unpoly extensions must be loaded before booting'); } readyState = 'evaling'; } function stopExtension() { readyState = 'configuring'; } function isSupported() { return !supportIssue(); } function supportIssue() { for (let feature of ['URL', 'Proxy', 'Promise', 'DOMParser', 'FormData']) { if (!window[feature]) { return `Browser doesn't support the ${feature} API`; } } if (document.compatMode === 'BackCompat') { return 'Browser is in quirks mode (missing DOCTYPE?)'; } } return { onEvaled, boot, startExtension, stopExtension, reset: emitReset, get evaling() { return readyState === 'evaling'; }, get booted() { return readyState === 'booted'; }, get beforeBoot() { return readyState !== 'booting' && readyState !== 'booted'; }, isSupported, }; })(); up.boot = up.framework.boot; /***/ }), /* 81 */ /***/ (() => { up.event = (function () { const u = up.util; const e = up.element; function reset() { for (let globalElement of [window, document, e.root, document.body]) { for (let listener of up.EventListener.allNonDefault(globalElement)) { listener.unbind(); } } } function on(...args) { return buildListenerGroup(args).bind(); } function off(...args) { return buildListenerGroup(args).unbind(); } function buildListenerGroup(args, options) { return up.EventListenerGroup.fromBindArgs(args, options); } function buildEmitter(args) { return up.EventEmitter.fromEmitArgs(args); } function emit(...args) { return buildEmitter(args).emit(); } function build(...args) { const props = u.extractOptions(args); const type = args[0] || props.type || up.fail('Expected event type to be passed as string argument or { type } property'); const event = document.createEvent('Event'); event.initEvent(type, true, true); Object.assign(event, u.omit(props, ['type', 'target'])); return event; } function assertEmitted(...args) { return buildEmitter(args).assertEmitted(); } function onEscape(listener) { return on('keydown', function (event) { if (event.key === 'Escape') { return listener(event); } }); } function halt(event, options = {}) { if (options.log) up.log.putsEvent(event); event.stopImmediatePropagation(); event.preventDefault(); } const keyModifiers = ['metaKey', 'shiftKey', 'ctrlKey', 'altKey']; function isUnmodified(event) { return (u.isUndefined(event.button) || (event.button === 0)) && !u.some(keyModifiers, modifier => event[modifier]); } function fork(originalEvent, newType, copyKeys = []) { const newEvent = up.event.build(newType, u.pick(originalEvent, copyKeys)); newEvent.originalEvent = originalEvent; ['stopPropagation', 'stopImmediatePropagation', 'preventDefault'].forEach(function (key) { const originalMethod = newEvent[key]; return newEvent[key] = function () { originalEvent[key](); return originalMethod.call(newEvent); }; }); if (originalEvent.defaultPrevented) { newEvent.preventDefault(); } return newEvent; } function executeEmitAttr(event, element) { if (!isUnmodified(event)) { return; } const eventType = e.attr(element, 'up-emit'); const eventProps = e.jsonAttr(element, 'up-emit-props'); const forkedEvent = fork(event, eventType); Object.assign(forkedEvent, eventProps); up.emit(element, forkedEvent); } on('up:click', 'a[up-emit]', executeEmitAttr); on('up:framework:reset', reset); return { on, off, build, emit, assertEmitted, onEscape, halt, isUnmodified, fork, keyModifiers, }; })(); up.on = up.event.on; up.off = up.event.off; up.emit = up.event.emit; /***/ }), /* 82 */ /***/ (() => { up.protocol = (function () { const u = up.util; const e = up.element; const headerize = function (camel) { const header = camel.replace(/(^.|[A-Z])/g, char => '-' + char.toUpperCase()); return 'X-Up' + header; }; const extractHeader = function (xhr, shortHeader, parseFn = u.identity) { let value = xhr.getResponseHeader(headerize(shortHeader)); if (value) { return parseFn(value); } }; function targetFromXHR(xhr) { return extractHeader(xhr, 'target'); } function parseModifyCacheValue(value) { if (value === 'false') { return false; } else { return value; } } function evictCacheFromXHR(xhr) { return extractHeader(xhr, 'evictCache', parseModifyCacheValue); } function expireCacheFromXHR(xhr) { return extractHeader(xhr, 'expireCache') || up.migrate.clearCacheFromXHR?.(xhr); } function contextFromXHR(xhr) { return extractHeader(xhr, 'context', JSON.parse); } function methodFromXHR(xhr) { return extractHeader(xhr, 'method', u.normalizeMethod); } function titleFromXHR(xhr) { return up.migrate.titleFromXHR?.(xhr) ?? extractHeader(xhr, 'title', JSON.parse); } function eventPlansFromXHR(xhr) { return extractHeader(xhr, 'events', JSON.parse); } function acceptLayerFromXHR(xhr) { return extractHeader(xhr, 'acceptLayer', JSON.parse); } function dismissLayerFromXHR(xhr) { return extractHeader(xhr, 'dismissLayer', JSON.parse); } const initialRequestMethod = u.memoize(function () { return u.normalizeMethod(up.browser.popCookie('_up_method')); }); function locationFromXHR(xhr) { return extractHeader(xhr, 'location') || xhr.responseURL; } function influencingHeadersFromResponse(response) { let varyHeaderValue = response.header('Vary'); return u.parseTokens(varyHeaderValue, { separator: 'comma' }); } const config = new up.Config(() => ({ methodParam: '_method', csrfParam() { return e.metaContent('csrf-param'); }, csrfToken() { return e.metaContent('csrf-token'); }, cspNonce() { return e.metaContent('csp-nonce'); }, csrfHeader: 'X-CSRF-Token', nonceableAttributes: [ 'up-watch', 'up-on-accepted', 'up-on-dismissed', 'up-on-loaded', 'up-on-rendered', 'up-on-finished', 'up-on-error', 'up-on-offlne', ], })); function csrfHeader() { return u.evalOption(config.csrfHeader); } function csrfParam() { return u.evalOption(config.csrfParam); } function csrfToken() { return u.evalOption(config.csrfToken); } function cspNonce() { return u.evalOption(config.cspNonce); } function cspNoncesFromHeader(cspHeader) { let nonces = []; if (cspHeader) { let parts = cspHeader.split(/\s*;\s*/); for (let part of parts) { if (part.indexOf('script-src') === 0) { let noncePattern = /'nonce-([^']+)'/g; let match; while (match = noncePattern.exec(part)) { nonces.push(match[1]); } } } } return nonces; } function wrapMethod(method, params) { params.add(config.methodParam, method); return 'POST'; } function reset() { config.reset(); } up.on('up:framework:reset', reset); return { config, reset, locationFromXHR, titleFromXHR, targetFromXHR, methodFromXHR, acceptLayerFromXHR, contextFromXHR, dismissLayerFromXHR, eventPlansFromXHR, expireCacheFromXHR, evictCacheFromXHR, csrfHeader, csrfParam, csrfToken, cspNonce, initialRequestMethod, headerize, wrapMethod, cspNoncesFromHeader, influencingHeadersFromResponse, }; })(); /***/ }), /* 83 */ /***/ (() => { up.log = (function () { const u = up.util; const config = new up.LogConfig(); function reset() { config.reset(); } function printToStandard(...args) { if (config.enabled) { printToStream('log', ...args); } } const printToWarn = (...args) => printToStream('warn', ...args); const printToError = (...args) => printToStream('error', ...args); function printToStream(stream, trace, message, ...args) { printToStreamStyled(stream, trace, '', message, ...args); } function printToStreamStyled(stream, trace, customStyles, message, ...args) { if (message) { if (config.format) { console[stream](`%c${trace}%c ${message}`, 'color: #666666; padding: 1px 3px; border: 1px solid #bbbbbb; border-radius: 2px; font-size: 90%; display: inline-block;' + customStyles, '', ...args); } else { console[stream](`[${trace}] ${u.sprintf(message, ...args)}`); } } } function printUserEvent(event) { if (config.enabled) { event = event.originalEvent || event; let color = '#5566cc'; printToStreamStyled('log', event.type, `color: white; border-color: ${color}; background-color: ${color}`, 'Interaction on %o', event.target); } } function printBanner() { if (!config.banner) { return; } const logo = " __ _____ ___ ___ / /_ __\n" + `/ // / _ \\/ _ \\/ _ \\/ / // / ${up.version}\n` + "\\___/_//_/ .__/\\___/_/\\_. / \n" + " / / / /\n\n"; let text = ""; if (!up.migrate.loaded) { text += "Load unpoly-migrate.js to enable deprecated APIs.\n\n"; } if (config.enabled) { text += "Call `up.log.disable()` to disable logging for this session."; } else { text += "Call `up.log.enable()` to enable logging for this session."; } const color = 'color: #777777'; if (config.format) { console.log('%c' + logo + '%c' + text, 'font-family: monospace;' + color, color); } else { console.log(logo + text); } } up.on('up:framework:boot', printBanner); up.on('up:framework:reset', reset); function enable() { config.enabled = true; } function disable() { config.enabled = false; } return { puts: printToStandard, putsEvent: printUserEvent, error: printToError, warn: printToWarn, config, enable, disable, }; })(); up.puts = up.log.puts; up.warn = up.log.warn; /***/ }), /* 84 */ /***/ (() => { up.syntax = (function () { const u = up.util; const SYSTEM_MACRO_PRIORITIES = { '[up-back]': -100, '[up-content]': -200, '[up-drawer]': -200, '[up-modal]': -200, '[up-cover]': -200, '[up-popup]': -200, '[up-tooltip]': -200, '[up-dash]': -200, '[up-expand]': -300, '[data-method]': -400, '[data-confirm]': -400, }; let registeredCompilers = []; let registeredMacros = []; function registerCompiler(...args) { const compiler = buildCompiler(args); return insertCompiler(registeredCompilers, compiler); } function registerMacro(...args) { const macro = buildCompiler(args); if (up.framework.evaling) { macro.priority || (macro.priority = detectSystemMacroPriority(macro.selector) || up.fail('Unregistered priority for system macro %o', macro.selector)); } return insertCompiler(registeredMacros, macro); } function detectSystemMacroPriority(macroSelector) { macroSelector = u.evalOption(macroSelector); for (let substr in SYSTEM_MACRO_PRIORITIES) { const priority = SYSTEM_MACRO_PRIORITIES[substr]; if (macroSelector.indexOf(substr) >= 0) { return priority; } } } const parseCompilerArgs = function (args) { const defaults = u.extractOptions(args); const selector = args.shift(); const callback = args.pop(); const options = { ...defaults, ...u.extractOptions(args) }; return [selector, options, callback]; }; function buildCompiler(args) { let [selector, options, callback] = parseCompilerArgs(args); options = u.options(options, { selector, isDefault: up.framework.evaling, priority: 0, batch: false, }); return Object.assign(callback, options); } function insertCompiler(queue, newCompiler) { let existingCompiler; let index = 0; while ((existingCompiler = queue[index]) && (existingCompiler.priority >= newCompiler.priority)) { index += 1; } queue.splice(index, 0, newCompiler); if (up.framework.booted) { if (newCompiler.priority === 0) { for (let layer of up.layer.stack) { compile(layer.element, { layer, compilers: [newCompiler] }); } } else { up.puts('up.compiler()', 'Compiler %s was registered after booting Unpoly. Compiler will run for future fragments only.', newCompiler.selector); } } return newCompiler; } function compile(fragment, options) { let compilers = options.compilers || registeredMacros.concat(registeredCompilers); const pass = new up.CompilerPass(fragment, compilers, options); pass.run(); } function registerDestructor(element, destructor) { let destructors = element.upDestructors; if (!destructors) { destructors = []; element.upDestructors = destructors; element.classList.add('up-can-clean'); } if (u.isArray(destructor)) { destructors.push(...destructor); } else { destructors.push(destructor); } } function hello(element, options = {}) { element = up.fragment.get(element, options); up.puts('up.hello()', "Compiling fragment %o", element); compile(element, options); up.fragment.emitInserted(element); return element; } function clean(fragment, options = {}) { new up.DestructorPass(fragment, options).run(); } function readData(element) { element = up.fragment.get(element); return element.upData || (element.upData = buildData(element)); } function buildData(element) { if (!element.getAttribute) { return {}; } let rawJSON = element.getAttribute('up-data'); let parsedJSON; if (rawJSON) { parsedJSON = JSON.parse(rawJSON); if (!u.isOptions(parsedJSON)) { return parsedJSON; } } return { ...element.dataset, ...parsedJSON, ...element.upCompileData, }; } function reset() { registeredCompilers = u.filter(registeredCompilers, 'isDefault'); registeredMacros = u.filter(registeredMacros, 'isDefault'); } up.on('up:framework:reset', reset); return { compiler: registerCompiler, macro: registerMacro, destructor: registerDestructor, hello, clean, data: readData, }; })(); up.compiler = up.syntax.compiler; up.destructor = up.syntax.destructor; up.macro = up.syntax.macro; up.data = up.syntax.data; up.hello = up.syntax.hello; /***/ }), /* 85 */ /***/ (() => { up.history = (function () { const u = up.util; const e = up.element; const config = new up.Config(() => ({ enabled: true, restoreTargets: ['body'] })); let previousLocation; let nextPreviousLocation; function reset() { config.reset(); previousLocation = undefined; nextPreviousLocation = undefined; trackCurrentLocation(); } const DEFAULT_NORMALIZE_OPTIONS = { hash: true }; function normalizeURL(url, options) { options = u.merge(DEFAULT_NORMALIZE_OPTIONS, options); return u.normalizeURL(url, options); } function currentLocation(normalizeOptions) { return normalizeURL(location.href, normalizeOptions); } function trackCurrentLocation() { const url = currentLocation(); if (nextPreviousLocation !== url) { previousLocation = nextPreviousLocation; nextPreviousLocation = url; } } trackCurrentLocation(); const ADDITIONAL_NORMALIZE_OPTIONS_FOR_COMPARISON = { trailingSlash: false }; function isLocation(url, options) { options = u.merge(ADDITIONAL_NORMALIZE_OPTIONS_FOR_COMPARISON, options); return normalizeURL(url, options) === currentLocation(options); } function replace(location, options = {}) { location = normalizeURL(location); if (manipulate('replaceState', location) && (options.event !== false)) { emitLocationChanged({ location, reason: 'replace', log: `Replaced state for ${location}` }); } } function push(location) { location = normalizeURL(location); if (!isLocation(location) && manipulate('pushState', location)) { emitLocationChanged({ location, reason: 'push', log: `Advanced to location ${location}` }); } } function emitLocationChanged(props) { let event = up.event.build('up:location:changed', props); up.migrate?.renamedProperty?.(event, 'url', 'location'); up.emit(event); } function manipulate(method, url) { if (config.enabled) { const state = buildState(); window.history[method](state, '', url); trackCurrentLocation(); return true; } } function buildState() { return { up: {} }; } function restoreStateOnPop(state) { if (!state?.up) { up.puts('popstate', 'Ignoring a history state not owned by Unpoly'); return; } let location = currentLocation(); if (up.emit('up:location:restore', { location, log: `Restoring location ${location}` }).defaultPrevented) { return; } up.render({ url: location, target: config.restoreTargets, fail: false, history: true, location, peel: true, layer: 'root', cache: true, saveScroll: false, scroll: ['restore', 'auto'], saveFocus: false, focus: ['restore', 'auto'], }); } function onPop(event) { trackCurrentLocation(); let location = currentLocation(); emitLocationChanged({ location, reason: 'pop', log: `Navigated to history entry ${location}` }); up.viewport.saveFocus({ location: previousLocation }); up.viewport.saveScroll({ location: previousLocation }); restoreStateOnPop(event.state); } function register() { window.addEventListener('popstate', onPop); if (up.protocol.initialRequestMethod() === 'GET') { replace(currentLocation(), { event: false }); } } up.on('up:framework:boot', function () { if ('jasmine' in window) { register(); } else { setTimeout(register, 100); } }); up.macro('a[up-back], [up-href][up-back]', function (link) { if (previousLocation) { e.setMissingAttrs(link, { 'up-href': previousLocation, 'up-scroll': 'restore' }); link.removeAttribute('up-back'); up.link.makeFollowable(link); } }); up.on('up:framework:reset', reset); return { config, push, replace, get location() { return currentLocation(); }, get previousLocation() { return previousLocation; }, normalizeURL, isLocation }; })(); /***/ }), /* 86 */ /***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => { __webpack_require__(87); const u = up.util; const e = up.element; up.fragment = (function () { function upTagName(element) { let tagName = e.tagName(element); if (tagName.startsWith('up-')) { return tagName; } } const config = new up.Config(() => ({ badTargetClasses: [/^up-/], targetDerivers: [ '[up-id]', '[id]', 'html', 'head', 'body', 'main', '[up-main]', upTagName, 'link[rel][type]', 'link[rel=preload][href]', 'link[rel=preconnect][href]', 'link[rel=prefetch][href]', 'link[rel]', 'meta[property]', '*[name]', 'form[action]', 'a[href]', '[class]', 'form', ], verifyDerivedTarget: true, navigateOptions: { cache: 'auto', revalidate: 'auto', feedback: true, fallback: true, focus: 'auto', scroll: 'auto', history: 'auto', peel: true, }, matchAroundOrigin: true, runScripts: true, autoHistoryTargets: [':main'], autoFocus: ['hash', 'autofocus', 'main-if-main', 'keep', 'target-if-lost'], autoScroll: ['hash', 'layer-if-main'], autoRevalidate: (response) => response.expired, skipResponse: defaultSkipResponse })); u.delegate(config, ['mainTargets'], () => up.layer.config.any); function reset() { config.reset(); } function defaultSkipResponse({ response, expiredResponse }) { return !response.text || response.text === expiredResponse?.text; } function sourceOf(element, options = {}) { element = getSmart(element, options); return e.closestAttr(element, 'up-source'); } function timeOf(element) { let value = e.closestAttr(element, 'up-time'); if (value && value !== 'false') { if (/^\d+$/.test(value)) { value = Number(value) * 1000; } return new Date(value); } } function etagOf(element) { let value = e.closestAttr(element, 'up-etag'); if (value && value !== 'false') { return value; } } const render = up.mockable((...args) => { let options = parseTargetAndOptions(args); return new up.RenderJob(options); }); const navigate = up.mockable((...args) => { const options = parseTargetAndOptions(args); return render({ ...options, navigate: true }); }); function emitFragmentInserted(element) { return up.emit(element, 'up:fragment:inserted', { log: ['Inserted fragment %o', element], }); } function emitFragmentKeep(keepPlan) { const log = ['Keeping fragment %o', keepPlan.oldElement]; const callback = e.callbackAttr(keepPlan.oldElement, 'up-on-keep', { exposedKeys: ['newFragment', 'newData'] }); return emitFromKeepPlan(keepPlan, 'up:fragment:keep', { log, callback }); } function emitFromKeepPlan(keepPlan, eventType, emitDetails) { const keepable = keepPlan.oldElement; const event = up.event.build(eventType, { newFragment: keepPlan.newElement, newData: keepPlan.newData }); return up.emit(keepable, event, emitDetails); } function emitFragmentDestroyed(fragment, options) { const log = options.log ?? ['Destroyed fragment %o', fragment]; const parent = options.parent || document; return up.emit(parent, 'up:fragment:destroyed', { fragment, parent, log }); } function isNotDestroying(element) { return !element.closest('.up-destroying'); } function isAlive(fragment) { return fragment.isConnected && isNotDestroying(fragment); } function getSmart(...args) { const options = u.extractOptions(args); const selector = args.pop(); const root = args[0]; if (u.isElementish(selector)) { return e.get(selector); } if (root) { return getDumb(root, selector, options); } return new up.FragmentFinder({ selector, origin: options.origin, layer: options.layer }).find(); } function getDumb(...args) { return getAll(...args)[0]; } const CSS_HAS_SUFFIX_PATTERN = /:has\(([^)]+)\)$/; function getAll(...args) { const options = u.extractOptions(args); let selectorString = args.pop(); const root = args[0]; if (u.isElement(selectorString)) { return [selectorString]; } if (u.isList(selectorString)) { return selectorString; } let selector = buildSelector(selectorString, root, options); return selector.descendants(root || document); } function getSubtree(element, selector, options = {}) { selector = buildSelector(selector, element, options); return selector.subtree(element); } function contains(element, selector) { return getSubtree(element, selector).length > 0; } function closest(element, selector, options) { element = e.get(element); selector = buildSelector(selector, element, options); return selector.closest(element); } function destroy(...args) { const options = parseTargetAndOptions(args); if (options.element = getSmart(options.target, options)) { new up.Change.DestroyFragment(options).execute(); } return up.migrate.formerlyAsync?.('up.destroy()'); } function parseTargetAndOptions(args) { const options = u.parseArgIntoOptions(args, 'target'); if (u.isElement(options.target)) { options.origin || (options.origin = options.target); } return options; } function markFragmentAsDestroying(element) { element.classList.add('up-destroying'); element.setAttribute('aria-hidden', 'true'); } function reload(...args) { const options = parseTargetAndOptions(args); options.target || (options.target = ':main'); const element = getSmart(options.target, options); options.url || (options.url = sourceOf(element)); options.headers = u.merge(options.headers, conditionalHeaders(element)); if (options.keepData || e.booleanAttr(element, 'up-keep-data')) { options.data = up.data(element); } up.migrate.postprocessReloadOptions?.(options); return render(options); } function conditionalHeaders(element) { let headers = {}; let time = timeOf(element); if (time) { headers['If-Modified-Since'] = time.toUTCString(); } let etag = etagOf(element); if (etag) { headers['If-None-Match'] = etag; } return headers; } function visit(url, options) { return navigate({ ...options, url }); } const KEY_PATTERN = /^(onFail|on|fail)?(.+)$/; function successKey(key) { let match = KEY_PATTERN.exec(key); if (match) { let [_, prefix, suffix] = match; switch (prefix) { case 'onFail': return 'on' + u.upperCaseFirst(suffix); case 'fail': return u.lowerCaseFirst(suffix); } } } function failKey(key) { let match = KEY_PATTERN.exec(key); if (match) { let [_, prefix, suffix] = match; switch (prefix) { case 'on': return 'onFail' + u.upperCaseFirst(suffix); case undefined: return 'fail' + u.upperCaseFirst(suffix); } } } function toTarget(element, options) { return u.presence(element, u.isString) || tryToTarget(element, options) || cannotTarget(element); } function isTargetable(element) { return !!tryToTarget(element); } function untargetableMessage(element) { return `Cannot derive good target selector from a <${e.tagName(element)}> element without identifying attributes. Try setting an [id] or configure up.fragment.config.targetDerivers.`; } function cannotTarget(element) { throw new up.CannotTarget(untargetableMessage(element)); } function tryToTarget(element, options) { return u.findResult(config.targetDerivers, function (deriver) { let target = deriveTarget(element, deriver); if (target && isGoodTarget(target, element, options)) { return target; } }); } function deriveTarget(element, deriver) { if (u.isFunction(deriver)) { return deriver(element); } else if (element.matches(deriver)) { try { return deriveTargetFromPattern(element, deriver); } catch (e) { if (e instanceof up.CannotParse) { return deriver; } else { throw e; } } } } function deriveTargetFromPattern(element, deriver) { let { includePath, excludeRaw } = up.element.parseSelector(deriver); if (includePath.length !== 1) { throw new up.CannotParse(deriver); } let { tagName, id, classNames, attributes } = includePath[0]; let result = ''; if (tagName === '*') { result += e.tagName(element); } else if (tagName) { result += tagName; } for (let className of classNames) { result += e.classSelector(className); } if (id) { result += e.idSelector(id); } for (let attributeName in attributes) { let attributeValue = attributes[attributeName] || element.getAttribute(attributeName); if (attributeName === 'id') { result += e.idSelector(attributeValue); } else if (attributeName === 'class') { for (let goodClass of goodClassesForTarget(element)) { result += e.classSelector(goodClass); } } else { result += e.attrSelector(attributeName, attributeValue); } } if (excludeRaw) { result += excludeRaw; } return result; } function isGoodTarget(target, element, options = {}) { return !element.isConnected || !config.verifyDerivedTarget || up.fragment.get(target, { layer: element, ...options }) === element; } function matchesPattern(pattern, str) { if (u.isRegExp(pattern)) { return pattern.test(str); } else { return pattern === str; } } function goodClassesForTarget(element) { let isGood = (klass) => !u.some(config.badTargetClasses, (badTargetClass) => matchesPattern(badTargetClass, klass)); return u.filter(element.classList, isGood); } function modernResolveOrigin(target, { origin } = {}) { return target.replace(/:origin\b/, function (match) { if (origin) { return toTarget(origin); } else { up.fail('Missing { origin } element to resolve "%s" reference (found in %s)', match, target); } }); } function resolveOrigin(...args) { return (up.migrate.resolveOrigin || modernResolveOrigin)(...args); } function expandTargets(targets, options = {}) { const { layer } = options; if (layer !== 'new' && !(layer instanceof up.Layer)) { up.fail('Must pass an up.Layer as { layer } option, but got %o', layer); } targets = u.copy(u.wrapList(targets)); const expanded = []; while (targets.length) { const target = targets.shift(); if (target === ':main' || target === true) { const mode = layer === 'new' ? options.mode : layer.mode; targets.unshift(...up.layer.mainTargets(mode)); } else if (target === ':layer') { if (layer !== 'new' && !layer.opening) { targets.unshift(layer.getFirstSwappableElement()); } } else if (u.isElementish(target)) { expanded.push(toTarget(target, options)); } else if (u.isString(target)) { expanded.push(resolveOrigin(target, options)); } else { } } return u.uniq(expanded); } function buildSelector(selector, element, options = {}) { const filters = []; if (!options.destroying) { filters.push(isNotDestroying); } let elementOutsideDocumentGiven = element && !document.contains(element); let expandTargetLayer; if (elementOutsideDocumentGiven || options.layer === 'any') { expandTargetLayer = up.layer.root; } else { options.layer ?? (options.layer = element); const layers = up.layer.getAll(options); filters.push(match => u.some(layers, layer => layer.contains(match))); expandTargetLayer = layers[0]; } let expandedTargets = up.fragment.expandTargets(selector, { ...options, layer: expandTargetLayer }); expandedTargets = expandedTargets.map(function (target) { target = target.replace(CSS_HAS_SUFFIX_PATTERN, function (match, descendantSelector) { filters.push(element => element.querySelector(descendantSelector)); return ''; }); return target || '*'; }); return new up.Selector(expandedTargets, filters); } function splitTarget(target) { return u.parseTokens(target, { separator: 'comma' }); } function parseTargetSteps(target, options = {}) { let defaultPlacement = options.defaultPlacement || 'swap'; let steps = []; let simpleSelectors = splitTarget(target); for (let selector of simpleSelectors) { if (selector === ':none') continue; let placement = defaultPlacement; let maybe = false; selector = selector.replace(/\b::?(before|after)\b/, (_match, customPlacement) => { placement = customPlacement; return ''; }); selector = selector.replace(/\b:maybe\b/, () => { maybe = true; return ''; }); const step = { ...options, selector, placement, maybe }; steps.push(step); } return steps; } function hasAutoHistory(fragment) { if (contains(fragment, config.autoHistoryTargets)) { return true; } else { up.puts('up.render()', "Will not auto-update history because fragment doesn't contain a selector from up.fragment.config.autoHistoryTargets"); return false; } } function matches(element, selector, options = {}) { element = e.get(element); if (u.isElement(selector)) { let target = tryToTarget(selector); return target && element.matches(target); } else { selector = buildSelector(selector, element, options); return selector.matches(element); } } function shouldRevalidate(request, response, options = {}) { return request.fromCache && u.evalAutoOption(options.revalidate, config.autoRevalidate, response); } function abort(...args) { let options = parseTargetAndOptions(args); let testFn; let { reason } = options; let elements; if (options.target) { elements = getAll(options.target, options); testFn = (request) => request.isPartOfSubtree(elements); reason || (reason = 'Aborting requests within fragment'); } else { let layers = up.layer.getAll(options); elements = u.map(layers, 'element'); testFn = (request) => u.contains(layers, request.layer); reason || (reason = 'Aborting requests within ' + layers.join(', ')); } let testFnWithAbortable = (request) => request.abortable && testFn(request); up.network.abort(testFnWithAbortable, { ...options, reason }); for (let element of elements) { up.emit(element, 'up:fragment:aborted', { log: false }); } } function onAborted(fragment, ...args) { let callback = u.extractCallback(args); let options = u.extractOptions(args); let guard = (event) => event.target.contains(fragment) || (options.around && fragment.contains(event.target)); let unsubscribe = up.on('up:fragment:aborted', { guard }, callback); up.destructor(fragment, unsubscribe); return unsubscribe; } up.on('up:framework:boot', function () { const { documentElement } = document; documentElement.setAttribute('up-source', u.normalizeURL(location.href, { hash: false })); up.hello(documentElement); if (!up.browser.canPushState()) { return up.warn('Cannot push history changes. Next fragment update will load in a new page.'); } }); up.on('up:framework:reset', reset); return { config, reload, destroy, render, navigate, get: getSmart, getDumb, all: getAll, subtree: getSubtree, contains, closest, source: sourceOf, visit, markAsDestroying: markFragmentAsDestroying, emitInserted: emitFragmentInserted, emitDestroyed: emitFragmentDestroyed, emitKeep: emitFragmentKeep, successKey, failKey, expandTargets, resolveOrigin, toTarget, tryToTarget, isTargetable, matches, hasAutoHistory, time: timeOf, etag: etagOf, shouldRevalidate, abort, onAborted, splitTarget, parseTargetSteps, isAlive, }; })(); up.reload = up.fragment.reload; up.destroy = up.fragment.destroy; up.render = up.fragment.render; up.navigate = up.fragment.navigate; up.visit = up.fragment.visit; u.delegate(up, ['context'], () => up.layer.current); /***/ }), /* 87 */ /***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => { "use strict"; __webpack_require__.r(__webpack_exports__); // extracted by mini-css-extract-plugin /***/ }), /* 88 */ /***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => { __webpack_require__(89); up.viewport = (function () { const u = up.util; const e = up.element; const f = up.fragment; const config = new up.Config(() => ({ viewportSelectors: ['[up-viewport]', '[up-fixed]'], fixedTop: ['[up-fixed~=top]'], fixedBottom: ['[up-fixed~=bottom]'], anchoredRight: ['[up-anchored~=right]', '[up-fixed~=top]', '[up-fixed~=bottom]', '[up-fixed~=right]'], revealSnap: 200, revealPadding: 0, revealTop: false, revealMax() { return 0.5 * window.innerHeight; }, })); function reset() { config.reset(); } function anchoredRight() { const selector = config.anchoredRight.join(','); return f.all(selector, { layer: 'root' }); } function reveal(element, options) { options = u.options(options); element = f.get(element, options); if (!(options.layer = up.layer.get(element))) { up.fail('Cannot reveal a detached element'); } if (options.peel) { options.layer.peel(); } const motion = new up.RevealMotion(element, options); motion.start(); return up.migrate.formerlyAsync?.('up.reveal()') || true; } function doFocus(element, options = {}) { if (options.force) { makeFocusable(element); } element.focus({ preventScroll: true }); if (!options.preventScroll) { return reveal(element); } } function tryFocus(element, options) { doFocus(element, options); return element === document.activeElement; } function makeFocusable(element) { if (!element.hasAttribute('tabindex') && element.tabIndex === -1) { element.setAttribute('tabindex', '-1'); element.classList.add('up-focusable-content'); } } function revealHash(hash = location.hash, options) { let match = firstHashTarget(hash, options); if (match) { return up.reveal(match, { top: true }); } } function allSelector() { return [rootSelector(), ...config.viewportSelectors].join(','); } function closest(target, options = {}) { const element = f.get(target, options); return element.closest(allSelector()); } function getSubtree(element, options = {}) { element = f.get(element, options); return e.subtree(element, allSelector()); } function getAround(element, options = {}) { element = f.get(element, options); return e.around(element, allSelector()); } function getAll(options = {}) { return f.all(allSelector(), options); } function rootSelector() { return getRoot().tagName; } function getRoot() { return document.scrollingElement; } function rootWidth() { return e.root.clientWidth; } function rootHeight() { return e.root.clientHeight; } function isRoot(element) { return element === getRoot(); } function rootHasReducedWidthFromScrollbar() { return window.innerWidth > document.documentElement.offsetWidth; } function rootOverflowElement() { const { body } = document; const html = document.documentElement; const element = u.find([html, body], wasChosenAsOverflowingElement); return element || getRoot(); } function wasChosenAsOverflowingElement(element) { const overflowY = e.style(element, 'overflow-y'); return overflowY === 'auto' || overflowY === 'scroll'; } const scrollbarWidth = u.memoize(function () { const outerStyle = { position: 'absolute', top: '0', left: '0', width: '100px', height: '100px', overflowY: 'scroll' }; const outer = up.element.affix(document.body, '[up-viewport]', { style: outerStyle }); const width = outer.offsetWidth - outer.clientWidth; outer.remove(); return width; }); function scrollTopKey(viewport) { return up.fragment.tryToTarget(viewport); } function fixedElements(root = document) { const queryParts = ['[up-fixed]'].concat(config.fixedTop).concat(config.fixedBottom); return root.querySelectorAll(queryParts.join(',')); } function saveScroll(...args) { const [viewports, options] = parseOptions(args); const location = options.location || options.layer.location; if (location) { const tops = getScrollTopsForSave(viewports); options.layer.lastScrollTops.set(location, tops); } } function getScrollTopsForSave(viewports) { let tops = {}; for (let viewport of viewports) { let key = scrollTopKey(viewport); if (key) { tops[key] = viewport.scrollTop; } else { up.warn('up.viewport.saveScroll()', 'Cannot save scroll positions for untargetable viewport %o', viewport); } } return tops; } function restoreScroll(...args) { const [viewports, options] = parseOptions(args); const { location } = options.layer; const locationScrollTops = options.layer.lastScrollTops.get(location); if (locationScrollTops) { setScrollTops(viewports, locationScrollTops); up.puts('up.viewport.restoreScroll()', 'Restored scroll positions to %o', locationScrollTops); return true; } else { return false; } } function saveFocus(options = {}) { const layer = up.layer.get(options); const location = options.location || layer.location; if (location) { const focusCapsule = up.FocusCapsule.preserve(layer); layer.lastFocusCapsules.set(location, focusCapsule); } } function restoreFocus(options = {}) { const layer = up.layer.get(options); const location = options.location || layer.location; const locationCapsule = options.layer.lastFocusCapsules.get(location); if (locationCapsule && locationCapsule.restore(layer)) { up.puts('up.viewport.restoreFocus()', 'Restored focus to "%s"', locationCapsule.target); return true; } else { return false; } } function newStateCache() { return new up.FIFOCache({ capacity: 30, normalizeKey: up.history.normalizeURL }); } function parseOptions(args) { const options = u.copy(u.extractOptions(args)); options.layer = up.layer.get(options); let viewports; if (args[0]) { viewports = [closest(args[0], options)]; } else if (options.around) { viewports = getAround(options.around, options); } else { viewports = getAll(options); } return [viewports, options]; } function resetScroll(...args) { const [viewports, _options] = parseOptions(args); setScrollTops(viewports, {}); } function setScrollTops(viewports, tops) { for (let viewport of viewports) { const key = scrollTopKey(viewport); viewport.scrollTop = tops[key] || 0; } } function absolutize(element, options = {}) { const viewport = closest(element); const viewportRect = viewport.getBoundingClientRect(); const originalRect = element.getBoundingClientRect(); const boundsRect = new up.Rect({ left: originalRect.left - viewportRect.left, top: originalRect.top - viewportRect.top, width: originalRect.width, height: originalRect.height }); options.afterMeasure?.(); e.setStyle(element, { position: element.style.position === 'static' ? 'static' : 'relative', top: 'auto', right: 'auto', bottom: 'auto', left: 'auto', width: '100%', height: '100%' }); const bounds = e.createFromSelector('up-bounds'); e.insertBefore(element, bounds); bounds.appendChild(element); const moveBounds = function (diffX, diffY) { boundsRect.left += diffX; boundsRect.top += diffY; return e.setStyle(bounds, boundsRect); }; moveBounds(0, 0); const newElementRect = element.getBoundingClientRect(); moveBounds(originalRect.left - newElementRect.left, originalRect.top - newElementRect.top); u.each(fixedElements(element), e.fixedToAbsolute); return { bounds, moveBounds }; } function firstHashTarget(hash, options = {}) { if (hash = pureHash(hash)) { const selector = [ e.attrSelector('id', hash), 'a' + e.attrSelector('name', hash) ].join(','); return f.get(selector, options); } } function pureHash(value) { return value?.replace(/^#/, ''); } function focusedElementWithin(scopeElement) { const focusedElement = document.activeElement; if (e.isInSubtree(scopeElement, focusedElement)) { return focusedElement; } } const CURSOR_PROPS = ['selectionStart', 'selectionEnd', 'scrollLeft', 'scrollTop']; function copyCursorProps(from, to = {}) { for (let key of CURSOR_PROPS) { try { to[key] = from[key]; } catch (error) { } } return to; } let userScrolled = false; up.on('scroll', { once: true, beforeBoot: true }, () => userScrolled = true); up.on('up:framework:boot', function () { u.task(function () { if (!userScrolled) { return revealHash(); } }); }); up.on(window, 'hashchange', () => revealHash()); up.on('up:framework:reset', reset); return { reveal, revealHash, firstHashTarget, config, get: closest, subtree: getSubtree, around: getAround, get root() { return getRoot(); }, rootWidth, rootHeight, rootHasReducedWidthFromScrollbar, rootOverflowElement, isRoot, scrollbarWidth, saveScroll, restoreScroll, resetScroll, saveFocus, restoreFocus, anchoredRight, absolutize, focus: doFocus, tryFocus, newStateCache, focusedElementWithin, copyCursorProps }; })(); up.focus = up.viewport.focus; up.reveal = up.viewport.reveal; /***/ }), /* 89 */ /***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => { "use strict"; __webpack_require__.r(__webpack_exports__); // extracted by mini-css-extract-plugin /***/ }), /* 90 */ /***/ (() => { up.motion = (function () { const u = up.util; const e = up.element; let namedAnimations = {}; let namedTransitions = {}; const motionController = new up.MotionController('motion'); const config = new up.Config(() => ({ duration: 175, easing: 'ease', enabled: !matchMedia('(prefers-reduced-motion: reduce)').matches })); function pickDefault(registry) { return u.pickBy(registry, value => value.isDefault); } function reset() { motionController.reset(); namedAnimations = pickDefault(namedAnimations); namedTransitions = pickDefault(namedTransitions); config.reset(); } function isEnabled() { return config.enabled; } function animate(element, animation, options) { element = up.fragment.get(element); options = u.options(options); const animationFn = findAnimationFn(animation); const willRun = willAnimate(element, animation, options); if (willRun) { const runNow = () => animationFn(element, options); return motionController.startFunction(element, runNow, options); } else { return skipAnimate(element, animation); } } function willAnimate(element, animationOrTransition, options) { applyConfig(options); return isEnabled() && !isNone(animationOrTransition) && (options.duration > 0) && !e.isSingleton(element); } function skipAnimate(element, animation) { if (u.isOptions(animation)) { e.setStyle(element, animation); } return Promise.resolve(); } function animateNow(element, lastFrame, options) { options = { ...options, finishEvent: motionController.finishEvent }; const cssTransition = new up.CSSTransition(element, lastFrame, options); return cssTransition.start(); } function applyConfig(options) { options.easing || (options.easing = config.easing); options.duration || (options.duration = config.duration); } function findNamedAnimation(name) { return namedAnimations[name] || up.fail("Unknown animation %o", name); } function finish(element) { return motionController.finish(element); } function morph(oldElement, newElement, transitionObject, options) { options = u.options(options); applyConfig(options); oldElement = up.fragment.get(oldElement); newElement = up.fragment.get(newElement); const transitionFn = findTransitionFn(transitionObject); const willMorph = willAnimate(oldElement, transitionFn, options); const beforeStart = u.pluckKey(options, 'beforeStart') || u.noop; const afterInsert = u.pluckKey(options, 'afterInsert') || u.noop; const beforeDetach = u.pluckKey(options, 'beforeDetach') || u.noop; const afterDetach = u.pluckKey(options, 'afterDetach') || u.noop; const scrollNew = u.pluckKey(options, 'scrollNew') || u.noop; beforeStart(); if (willMorph) { if (motionController.isActive(oldElement) && (options.trackMotion === false)) { return transitionFn(oldElement, newElement, options); } up.puts('up.morph()', 'Morphing %o to %o with transition %O', oldElement, newElement, transitionObject); const viewport = up.viewport.get(oldElement); const scrollTopBeforeReveal = viewport.scrollTop; const oldRemote = up.viewport.absolutize(oldElement, { afterMeasure() { e.insertBefore(oldElement, newElement); afterInsert(); } }); const trackable = async function () { scrollNew(); const scrollTopAfterReveal = viewport.scrollTop; oldRemote.moveBounds(0, scrollTopAfterReveal - scrollTopBeforeReveal); await transitionFn(oldElement, newElement, options); beforeDetach(); oldRemote.bounds.remove(); afterDetach(); }; return motionController.startFunction([oldElement, newElement], trackable, options); } else { beforeDetach(); swapElementsDirectly(oldElement, newElement); afterInsert(); afterDetach(); scrollNew(); return Promise.resolve(); } } function findTransitionFn(object) { if (isNone(object)) { return undefined; } else if (u.isFunction(object)) { return object; } else if (u.isArray(object)) { return composeTransitionFn(...object); } else if (u.isString(object)) { let namedTransition; if (object.indexOf('/') >= 0) { return composeTransitionFn(...object.split('/')); } else if (namedTransition = namedTransitions[object]) { return findTransitionFn(namedTransition); } } else { return up.fail("Unknown transition %o", object); } } function composeTransitionFn(oldAnimation, newAnimation) { if (!isNone(oldAnimation) && !isNone(newAnimation)) { const oldAnimationFn = findAnimationFn(oldAnimation) || u.asyncNoop; const newAnimationFn = findAnimationFn(newAnimation) || u.asyncNoop; return (oldElement, newElement, options) => Promise.all([ oldAnimationFn(oldElement, options), newAnimationFn(newElement, options) ]); } } function findAnimationFn(object) { if (isNone(object)) { return undefined; } else if (u.isFunction(object)) { return object; } else if (u.isString(object)) { return findNamedAnimation(object); } else if (u.isOptions(object)) { return (element, options) => animateNow(element, object, options); } else { return up.fail('Unknown animation %o', object); } } const swapElementsDirectly = up.mockable(function (oldElement, newElement) { oldElement.replaceWith(newElement); }); function registerTransition(name, transition) { const fn = findTransitionFn(transition); fn.isDefault = up.framework.evaling; namedTransitions[name] = fn; } function registerAnimation(name, animation) { const fn = findAnimationFn(animation); fn.isDefault = up.framework.evaling; namedAnimations[name] = fn; } up.on('up:framework:boot', function () { if (!isEnabled()) { up.puts('up.motion', 'Animations are disabled'); } }); function isNone(animationOrTransition) { return !animationOrTransition || animationOrTransition === 'none'; } function registerOpacityAnimation(name, from, to) { registerAnimation(name, function (element, options) { element.style.opacity = 0; e.setStyle(element, { opacity: from }); return animateNow(element, { opacity: to }, options); }); } registerOpacityAnimation('fade-in', 0, 1); registerOpacityAnimation('fade-out', 1, 0); function translateCSS(dx, dy) { return { transform: `translate(${dx}px, ${dy}px)` }; } function noTranslateCSS() { return { transform: null }; } function untranslatedBox(element) { e.setStyle(element, noTranslateCSS()); return element.getBoundingClientRect(); } function registerMoveAnimations(direction, boxToTransform) { const animationToName = `move-to-${direction}`; const animationFromName = `move-from-${direction}`; registerAnimation(animationToName, function (element, options) { const box = untranslatedBox(element); const transform = boxToTransform(box); return animateNow(element, transform, options); }); registerAnimation(animationFromName, function (element, options) { const box = untranslatedBox(element); const transform = boxToTransform(box); e.setStyle(element, transform); return animateNow(element, noTranslateCSS(), options); }); } registerMoveAnimations('top', function (box) { const travelDistance = box.top + box.height; return translateCSS(0, -travelDistance); }); registerMoveAnimations('bottom', function (box) { const travelDistance = up.viewport.rootHeight() - box.top; return translateCSS(0, travelDistance); }); registerMoveAnimations('left', function (box) { const travelDistance = box.left + box.width; return translateCSS(-travelDistance, 0); }); registerMoveAnimations('right', function (box) { const travelDistance = up.viewport.rootWidth() - box.left; return translateCSS(travelDistance, 0); }); registerTransition('cross-fade', ['fade-out', 'fade-in']); registerTransition('move-left', ['move-to-left', 'move-from-right']); registerTransition('move-right', ['move-to-right', 'move-from-left']); registerTransition('move-up', ['move-to-top', 'move-from-bottom']); registerTransition('move-down', ['move-to-bottom', 'move-from-top']); up.on('up:framework:reset', reset); return { morph, animate, finish, finishCount() { return motionController.finishCount; }, transition: registerTransition, animation: registerAnimation, config, isEnabled, isNone, willAnimate, swapElementsDirectly }; })(); up.transition = up.motion.transition; up.animation = up.motion.animation; up.morph = up.motion.morph; up.animate = up.motion.animate; /***/ }), /* 91 */ /***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => { __webpack_require__(92); const u = up.util; up.network = (function () { const config = new up.Config(() => ({ concurrency() { return shouldReduceRequests() ? 3 : 6; }, wrapMethod: true, cacheSize: 70, cacheExpireAge: 15 * 1000, cacheEvictAge: 90 * 60 * 1000, badDownlink: 0.6, badRTT: 750, badResponseTime: 400, fail(response) { return (response.status < 200 || response.status > 299) && response.status !== 304; }, autoCache(request) { return request.isSafe(); }, expireCache(request, _response) { return !request.isSafe(); }, evictCache: false, progressBar: true, timeout: 90000, })); const queue = new up.Request.Queue(); const cache = new up.Request.Cache(); let progressBar = null; function reset() { abortRequests(); queue.reset(); config.reset(); cache.reset(); progressBar?.destroy(); progressBar = null; } function makeRequest(...args) { const options = parseRequestOptions(args); const request = new up.Request(options); processRequest(request); return request; } function parseRequestOptions(args) { const options = u.extractOptions(args); if (!options.url) { options.url = args[0]; } up.migrate.handleRequestOptions?.(options); return options; } function processRequest(request) { useCachedRequest(request) || queueRequest(request); } function useCachedRequest(newRequest) { let cachedRequest; if (newRequest.willCache() && (cachedRequest = cache.get(newRequest))) { up.puts('up.request()', 'Re-using previous request to %s', newRequest.description); if (!newRequest.background) { queue.promoteToForeground(cachedRequest); } cache.track(cachedRequest, newRequest, { onIncompatible: processRequest }); return true; } } function queueRequest(request) { handleCaching(request); queue.asap(request); return true; } function handleCaching(request) { if (request.willCache()) { cache.put(request); request.onLoading = () => cache.put(request); } u.always(request, function (responseOrError) { let expireCache = responseOrError.expireCache ?? request.expireCache ?? u.evalOption(config.expireCache, request, responseOrError); if (expireCache) { cache.expire(expireCache, { except: request }); } let evictCache = responseOrError.evictCache ?? request.evictCache ?? u.evalOption(config.evictCache, request, responseOrError); if (evictCache) { cache.evict(evictCache, { except: request }); } if (cache.get(request)) { cache.put(request); } if (!responseOrError.isCacheable?.()) { cache.evict(request); } }); } function isBusy() { return queue.isBusy(); } function loadPage(requestsAttrs) { new up.Request(requestsAttrs).loadPage(); } function shouldReduceRequests() { let netInfo = navigator.connection; if (netInfo) { return (netInfo.rtt && (netInfo.rtt > config.badRTT)) || (netInfo.downlink && (netInfo.downlink < config.badDownlink)); } } function abortRequests(...args) { up.migrate.preprocessAbortArgs?.(args); queue.abort(...args); } function registerAliasForRedirect(request, response) { if (request.cache && response.url && request.url !== response.url) { const newRequest = u.variant(request, { method: response.method, url: response.url }); cache.alias(request, newRequest); } } function isSafeMethod(method) { return u.contains(['GET', 'OPTIONS', 'HEAD'], u.normalizeMethod(method)); } function onLate() { if (u.evalOption(config.progressBar)) { progressBar = new up.ProgressBar(); } } function onRecover() { progressBar?.conclude(); } up.on('up:network:late', onLate); up.on('up:network:recover', onRecover); up.on('up:framework:reset', reset); return { request: makeRequest, cache, isBusy, isSafeMethod, config, abort: abortRequests, registerAliasForRedirect, queue, shouldReduceRequests, loadPage, }; })(); up.request = up.network.request; up.cache = up.network.cache; /***/ }), /* 92 */ /***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => { "use strict"; __webpack_require__.r(__webpack_exports__); // extracted by mini-css-extract-plugin /***/ }), /* 93 */ /***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => { __webpack_require__(94); const u = up.util; const e = up.element; up.layer = (function () { const LAYER_CLASSES = [ up.Layer.Root, up.Layer.Modal, up.Layer.Popup, up.Layer.Drawer, up.Layer.Cover ]; const config = new up.Config(function () { const newConfig = { mode: 'modal', any: { mainTargets: [ "[up-main='']", 'main', ':layer' ] }, root: { mainTargets: ['[up-main~=root]'], history: true }, overlay: { mainTargets: ['[up-main~=overlay]'], openAnimation: 'fade-in', closeAnimation: 'fade-out', dismissLabel: '×', dismissAriaLabel: 'Dismiss dialog', dismissable: true, history: 'auto' }, cover: { mainTargets: ['[up-main~=cover]'] }, drawer: { mainTargets: ['[up-main~=drawer]'], backdrop: true, position: 'left', size: 'medium', openAnimation(layer) { switch (layer.position) { case 'left': return 'move-from-left'; case 'right': return 'move-from-right'; } }, closeAnimation(layer) { switch (layer.position) { case 'left': return 'move-to-left'; case 'right': return 'move-to-right'; } } }, modal: { mainTargets: ['[up-main~=modal]'], backdrop: true, size: 'medium' }, popup: { mainTargets: ['[up-main~=popup]'], position: 'bottom', size: 'medium', align: 'left', dismissable: 'outside key' }, foreignOverlaySelectors: ['dialog'] }; for (let Class of LAYER_CLASSES) { newConfig[Class.mode].Class = Class; } return newConfig; }); let stack = null; let handlers = []; function mainTargets(mode) { return u.flatMap(modeConfigs(mode), 'mainTargets'); } function modeConfigs(mode) { if (mode === 'root') { return [config.root, config.any]; } else { return [config[mode], config.overlay, config.any]; } } function normalizeOptions(options) { up.migrate.handleLayerOptions?.(options); if (u.isGiven(options.layer)) { let match = String(options.layer).match(/^(new|shatter|swap)( (\w+))?/); if (match) { options.layer = 'new'; const openMethod = match[1]; const shorthandMode = match[3]; options.mode || (options.mode = shorthandMode || config.mode); if (openMethod === 'swap') { if (up.layer.isOverlay()) { options.baseLayer = 'parent'; } } else if (openMethod === 'shatter') { options.baseLayer = 'root'; } } } else { if (options.mode) { options.layer = 'new'; } else if (u.isElementish(options.target)) { options.layer = stack.get(options.target, { normalizeLayerOptions: false }); } else if (options.origin) { options.layer = 'origin'; } else { options.layer = 'current'; } } if (!options.context) { options.context = {}; } options.baseLayer = stack.get('current', { ...options, normalizeLayerOptions: false }); } function build(options, beforeNew) { const { mode } = options; const { Class } = config[mode]; const configs = u.reverse(modeConfigs(mode)); let handleDeprecatedConfig = up.migrate.handleLayerConfig; if (handleDeprecatedConfig) { configs.forEach(handleDeprecatedConfig); } options.openAnimation ?? (options.openAnimation = u.pluckKey(options, 'animation')); options = u.mergeDefined(...configs, { mode, stack }, options); if (beforeNew) { options = beforeNew(options); } return new Class(options); } function openCallbackAttr(link, attr) { return e.callbackAttr(link, attr, { exposedKeys: ['layer'] }); } function closeCallbackAttr(link, attr) { return e.callbackAttr(link, attr, { exposedKeys: ['layer', 'value', 'response'] }); } function reset() { config.reset(); stack.reset(); handlers = u.filter(handlers, 'isDefault'); } async function open(options) { options = u.options(options, { layer: 'new', defaultToEmptyContent: true, navigate: true }); let result = await up.render(options); return result.layer; } function ask(options) { return new Promise(function (resolve, reject) { options = { ...options, onAccepted: (event) => resolve(event.value), onDismissed: (event) => reject(event.value) }; open(options); }); } function anySelector() { return u.map(LAYER_CLASSES, Class => Class.selector()).join(','); } function optionToString(option) { if (u.isString(option)) { return `layer "${option}"`; } else { return option.toString(); } } function isWithinForeignOverlay(element) { let selector = config.foreignOverlaySelectors.join(','); return !!(selector && element.closest(selector)); } up.on('up:fragment:destroyed', function () { stack.sync(); }); up.on('up:framework:evaled', function () { stack = new up.LayerStack(); }); up.on('up:framework:reset', reset); const api = { config, mainTargets, open, build, ask, normalizeOptions, openCallbackAttr, closeCallbackAttr, anySelector, optionToString, get stack() { return stack; }, isWithinForeignOverlay }; u.delegate(api, [ 'get', 'getAll', 'root', 'overlays', 'current', 'front', 'sync', 'count', 'dismissOverlays' ], () => stack); u.delegate(api, [ 'accept', 'dismiss', 'isRoot', 'isOverlay', 'isFront', 'on', 'off', 'emit', 'parent', 'history', 'location', 'mode', 'context', 'element', 'contains', 'size', 'affix' ], () => stack.current); return api; })(); /***/ }), /* 94 */ /***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => { "use strict"; __webpack_require__.r(__webpack_exports__); // extracted by mini-css-extract-plugin /***/ }), /* 95 */ /***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => { __webpack_require__(96); up.link = (function () { const u = up.util; const e = up.element; const linkPreloader = new up.LinkPreloader(); let lastMousedownTarget = null; const LINKS_WITH_LOCAL_HTML = ['a[up-content]', 'a[up-fragment]', 'a[up-document]']; const LINKS_WITH_REMOTE_HTML = ['a[href]', '[up-href]']; const ATTRIBUTES_SUGGESTING_FOLLOW = ['[up-follow]', '[up-target]', '[up-layer]', '[up-transition]', '[up-preload]', '[up-instant]', '[up-href]']; function combineFollowableSelectors(elementSelectors, attributeSelectors) { return u.flatMap(elementSelectors, elementSelector => attributeSelectors.map(attrSelector => elementSelector + attrSelector)); } const config = new up.Config(() => ({ followSelectors: combineFollowableSelectors(LINKS_WITH_REMOTE_HTML, ATTRIBUTES_SUGGESTING_FOLLOW).concat(LINKS_WITH_LOCAL_HTML), noFollowSelectors: ['[up-follow=false]', 'a[download]', 'a[target]', 'a[href^="#"]:not([up-content]):not([up-fragment]):not([up-document])', 'a[href^="javascript:"]'], instantSelectors: ['[up-instant]'], noInstantSelectors: ['[up-instant=false]', '[onclick]'], preloadSelectors: combineFollowableSelectors(LINKS_WITH_REMOTE_HTML, ['[up-preload]']), noPreloadSelectors: ['[up-preload=false]'], clickableSelectors: LINKS_WITH_LOCAL_HTML.concat(['[up-emit]', '[up-accept]', '[up-dismiss]', '[up-clickable]']), preloadDelay: 90, preloadEnabled: 'auto' })); function fullFollowSelector() { return config.followSelectors.join(','); } function fullPreloadSelector() { return config.preloadSelectors.join(','); } function fullInstantSelector() { return config.instantSelectors.join(','); } function fullClickableSelector() { return config.clickableSelectors.join(','); } function isFollowDisabled(link) { return link.matches(config.noFollowSelectors.join(',')) || u.isCrossOrigin(link); } function isPreloadDisabled(link) { return !up.browser.canPushState() || link.matches(config.noPreloadSelectors.join(',')) || isFollowDisabled(link) || !willCache(link); } function willCache(link) { const options = parseRequestOptions(link); if (options.url) { if (options.cache == null) { options.cache = 'auto'; } options.basic = true; const request = new up.Request(options); return request.willCache(); } } function isInstantDisabled(link) { return link.matches(config.noInstantSelectors.join(',')) || isFollowDisabled(link); } function reset() { lastMousedownTarget = null; config.reset(); linkPreloader.reset(); } const follow = up.mockable(function (link, options) { return up.render(followOptions(link, options)); }); function parseRequestOptions(link, options, parserOptions) { options = u.options(options); const parser = new up.OptionsParser(link, options, parserOptions); options.url = followURL(link, options); options.method = followMethod(link, options); parser.json('headers'); parser.json('params'); parser.booleanOrString('cache'); parser.booleanOrString('expireCache'); parser.booleanOrString('evictCache'); parser.booleanOrString('revalidate'); parser.booleanOrString('abort'); parser.boolean('abortable'); parser.boolean('background'); parser.string('contentType'); parser.number('badResponseTime'); parser.number('timeout'); return options; } function followOptions(link, options, parserOptions) { link = up.fragment.get(link); options = parseRequestOptions(link, options, parserOptions); const parser = new up.OptionsParser(link, options, { fail: true, ...parserOptions }); parser.boolean('feedback'); parser.boolean('fail'); options.origin || (options.origin = link); parser.boolean('navigate', { default: true }); parser.string('confirm', { attr: ['up-confirm', 'data-confirm'] }); parser.string('target'); parser.booleanOrString('fallback'); parser.string('content'); parser.string('fragment'); parser.string('document'); parser.boolean('useKeep'); parser.boolean('useHungry'); parser.callback('onLoaded'); parser.callback('onRendered', { mainKey: 'result' }); parser.callback('onFinished', { mainKey: 'result' }); parser.callback('onOffline', { mainKey: 'error' }); parser.callback('onError', { mainKey: 'error' }); parser.boolean('peel'); parser.string('layer'); parser.string('baseLayer'); parser.json('context'); parser.string('mode'); parser.string('align'); parser.string('position'); parser.string('class'); parser.string('size'); parser.booleanOrString('dismissable'); parser.parse(up.layer.openCallbackAttr, 'onOpened'); parser.parse(up.layer.closeCallbackAttr, 'onAccepted'); parser.parse(up.layer.closeCallbackAttr, 'onDismissed'); parser.string('acceptEvent'); parser.string('dismissEvent'); parser.string('acceptLocation'); parser.string('dismissLocation'); parser.booleanOrString('history'); parser.booleanOrString('focus'); parser.boolean('saveScroll'); parser.boolean('saveFocus'); parser.booleanOrString('scroll'); parser.boolean('revealTop'); parser.number('revealMax'); parser.number('revealPadding'); parser.number('revealSnap'); parser.string('scrollBehavior'); parser.booleanOrString('history'); parser.booleanOrString('location'); parser.booleanOrString('title'); parser.booleanOrString('animation'); parser.booleanOrString('transition'); parser.string('easing'); parser.number('duration'); if (!options.guardEvent) { options.guardEvent = up.event.build('up:link:follow', { log: 'Following link' }); } return options; } function preload(link, options) { link = up.fragment.get(link); let issue = preloadIssue(link); if (issue) { return Promise.reject(new up.Error(issue)); } const guardEvent = up.event.build('up:link:preload', { log: ['Preloading link %o', link] }); return follow(link, { abortable: false, ...options, guardEvent, preload: true }); } function preloadIssue(link) { if (!u.evalAutoOption(config.preloadEnabled, autoPreloadEnabled, link)) { return 'Preloading is disabled'; } else if (!isSafe(link)) { return 'Will not preload an unsafe link'; } } const autoPreloadEnabled = u.negate(up.network.shouldReduceRequests); function followMethod(link, options = {}) { return u.normalizeMethod(options.method || link.getAttribute('up-method') || link.getAttribute('data-method')); } function followURL(link, options = {}) { const url = options.url || link.getAttribute('up-href') || link.getAttribute('href'); if (url !== '#') { return url; } } function isFollowable(link) { link = up.fragment.get(link); return link.matches(fullFollowSelector()) && !isFollowDisabled(link); } function makeFollowable(link) { if (!isFollowable(link)) { link.setAttribute('up-follow', ''); } } function makeClickable(link) { if (link.matches('a[href], button')) { return; } e.setMissingAttrs(link, { tabindex: '0', role: 'link', 'up-clickable': '' }); link.addEventListener('keydown', function (event) { if ((event.key === 'Enter') || (event.key === 'Space')) { return forkEventAsUpClick(event); } }); } up.macro(fullClickableSelector, makeClickable); function shouldFollowEvent(event, link) { if (event.defaultPrevented || isFollowDisabled(link)) { return false; } const betterTargetSelector = `a, [up-href], ${up.form.fieldSelector()}`; const betterTarget = event.target.closest(betterTargetSelector); return !betterTarget || (betterTarget === link); } function isInstant(linkOrDescendant) { const element = linkOrDescendant.closest(fullInstantSelector()); return element && !isInstantDisabled(element); } function convertClicks(layer) { layer.on('click', function (event, element) { if (!up.event.isUnmodified(event)) { return; } if (isInstant(element) && lastMousedownTarget) { up.event.halt(event); } else if (layer.wasHitByMouseEvent(event) && !didUserDragAway(event)) { forkEventAsUpClick(event); } return lastMousedownTarget = null; }); layer.on('mousedown', function (event, element) { if (!up.event.isUnmodified(event)) { return; } lastMousedownTarget = event.target; if (isInstant(element)) { forkEventAsUpClick(event); } }); } function didUserDragAway(clickEvent) { return lastMousedownTarget && (lastMousedownTarget !== clickEvent.target); } function forkEventAsUpClick(originalEvent) { let forwardedProps = ['clientX', 'clientY', 'button', ...up.event.keyModifiers]; const newEvent = up.event.fork(originalEvent, 'up:click', forwardedProps); up.emit(originalEvent.target, newEvent, { log: false }); } function isSafe(link) { const method = followMethod(link); return up.network.isSafeMethod(method); } up.on('up:click', fullFollowSelector, function (event, link) { if (shouldFollowEvent(event, link)) { up.event.halt(event, { log: true }); up.focus(link, { preventScroll: true }); up.error.muteUncriticalRejection(follow(link)); } }); up.macro('[up-expand]', function (area) { const selector = area.getAttribute('up-expand') || 'a, [up-href]'; let childLink = e.get(area, selector); if (childLink) { const areaAttrs = e.upAttrs(childLink); if (!areaAttrs['up-href']) { areaAttrs['up-href'] = childLink.getAttribute('href'); } e.setMissingAttrs(area, areaAttrs); makeFollowable(area); } }); up.compiler(fullPreloadSelector, function (link) { if (!isPreloadDisabled(link)) { linkPreloader.watchLink(link); } }); up.on('up:framework:reset', reset); return { follow, followOptions, preload, makeFollowable, makeClickable, isSafe, isFollowable, shouldFollowEvent, followMethod, convertClicks, config, combineFollowableSelectors, preloadSelector: fullPreloadSelector, followSelector: fullFollowSelector, }; })(); up.follow = up.link.follow; /***/ }), /* 96 */ /***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => { "use strict"; __webpack_require__.r(__webpack_exports__); // extracted by mini-css-extract-plugin /***/ }), /* 97 */ /***/ (() => { up.form = (function () { const u = up.util; const e = up.element; const ATTRIBUTES_SUGGESTING_SUBMIT = ['[up-submit]', '[up-target]', '[up-layer]', '[up-transition]']; const config = new up.Config(() => ({ groupSelectors: ['[up-form-group]', 'fieldset', 'label', 'form'], fieldSelectors: ['select', 'input:not([type=submit]):not([type=image])', 'button[type]:not([type=submit])', 'textarea'], submitSelectors: up.link.combineFollowableSelectors(['form'], ATTRIBUTES_SUGGESTING_SUBMIT), noSubmitSelectors: ['[up-submit=false]', '[target]'], submitButtonSelectors: ['input[type=submit]', 'input[type=image]', 'button[type=submit]', 'button:not([type])'], watchInputEvents: ['input', 'change'], watchInputDelay: 0, watchChangeEvents: ['change'], })); function fullSubmitSelector() { return config.submitSelectors.join(','); } function reset() { config.reset(); } function fieldSelector(suffix = '') { return config.fieldSelectors.map(field => field + suffix).join(','); } function isField(element) { return element.matches(fieldSelector()); } function findFields(root) { root = e.get(root); let fields = e.subtree(root, fieldSelector()); if (root.matches('form[id]')) { const outsideFieldSelector = fieldSelector(e.attrSelector('form', root.getAttribute('id'))); const outsideFields = up.fragment.all(outsideFieldSelector, { layer: root }); fields.push(...outsideFields); fields = u.uniq(fields); } return fields; } function findSubmitButtons(root) { return e.subtree(root, submitButtonSelector()); } function submittingButton(form) { const selector = submitButtonSelector(); const focusedElement = document.activeElement; if (focusedElement && focusedElement.form === form) { if (focusedElement.matches(selector)) { return focusedElement; } } return e.get(form, selector); } function submitButtonSelector() { return config.submitButtonSelectors.join(','); } const submit = up.mockable((form, options) => { return up.render(submitOptions(form, options)); }); function submitOptions(form, options, parserOptions) { form = getForm(form); options = destinationOptions(form, options, parserOptions); let parser = new up.OptionsParser(form, options, parserOptions); parser.string('failTarget', { default: up.fragment.tryToTarget(form) }); parser.booleanOrString('disable'); options.guardEvent || (options.guardEvent = up.event.build('up:form:submit', { submitButton: options.submitButton, log: 'Submitting form', params: options.params })); options.origin || (options.origin = up.viewport.focusedElementWithin(form) || options.submitButton || form); Object.assign(options, up.link.followOptions(form, options, parserOptions)); return options; } function watchOptions(field, options, parserOptions = {}) { options = u.options(options); let parser = new up.OptionsParser(field, options, { ...parserOptions, closest: true, attrPrefix: 'up-watch-' }); parser.boolean('feedback'); parser.booleanOrString('disable'); parser.string('event'); parser.number('delay'); let config = up.form.config; if (options.event === 'input') { options.event = u.evalOption(config.watchInputEvents, field); options.delay ?? (options.delay = config.watchInputDelay); } else if (options.event === 'change') { options.event = u.evalOption(config.watchChangeEvents, field); } options.origin || (options.origin = field); return options; } function disableContainer(container) { let focusedElement = document.activeElement; let focusFallback; let controls = [...findFields(container), ...findSubmitButtons(container)]; for (let control of controls) { if (control === focusedElement) { focusFallback = findGroup(focusedElement); } raiseDisableStack(control); } if (focusFallback) { up.focus(focusFallback, { force: true, preventScroll: true }); } return function () { controls.forEach(lowerDisableStack); }; } function raiseDisableStack(control) { if (!control.upDisableCount) { control.upDisableCount || (control.upDisableCount = 0); control.upOriginalDisabled = control.disabled; } control.upDisableCount++; control.disabled = true; } function lowerDisableStack(control) { if (control.upDisableCount) { if (!control.disabled) { control.upDisableCount = 0; } else { control.upDisableCount--; if (!control.upDisableCount) { control.disabled = control.upOriginalDisabled; } } } } function disableWhile(promise, options) { let undoDisable = handleDisableOption(options); u.always(promise, undoDisable); } function handleDisableOption({ disable, origin }) { if (!disable) return u.noop; let missingOption = (key) => { up.fail("Cannot process { disable: '%s' } option without { %s }", disable, key); }; let getOrigin = () => origin || missingOption('origin'); let getOriginForm = () => getContainer(getOrigin()); let containers; if (disable === true) { containers = [getOriginForm()]; } else if (u.isString(disable)) { containers = up.fragment.subtree(getOriginForm(), disable, { origin }); } return u.sequence(containers.map(disableContainer)); } function destinationOptions(form, options, parserOptions) { options = u.options(options); form = getForm(form); const parser = new up.OptionsParser(form, options, parserOptions); parser.string('contentType', { attr: ['enctype', 'up-content-type'] }); parser.json('headers'); const params = up.Params.fromForm(form); const submitButton = submittingButton(form); if (submitButton) { options.submitButton = submitButton; params.addField(submitButton); options.method || (options.method = submitButton.getAttribute('formmethod')); options.url || (options.url = submitButton.getAttribute('formaction')); } params.addAll(options.params); options.params = params; parser.string('url', { attr: 'action', default: up.fragment.source(form) }); parser.string('method', { attr: ['up-method', 'data-method', 'method'], default: 'GET', normalize: u.normalizeMethod }); if (options.method === 'GET') { options.url = up.Params.stripURL(options.url); } return options; } up.on('up:click', submitButtonSelector, function (event, button) { const form = getForm(button); if (form && isSubmittable(form)) { button.focus(); } }); function watch(container, ...args) { let form = getForm(container); const fields = findFields(container); const unnamedFields = u.reject(fields, 'name'); if (unnamedFields.length) { up.puts('up.watch()', 'Will not watch fields without a [name]: %o', unnamedFields); } const callback = u.extractCallback(args) || watchCallbackFromElement(container) || up.fail('No callback given for up.watch()'); let options = u.extractOptions(args); const watch = new up.FieldWatcher(form, fields, options, callback); watch.start(); return () => watch.stop(); } function watchCallbackFromElement(element) { let rawCallback = element.getAttribute('up-watch'); if (rawCallback) { return up.NonceableCallback.fromString(rawCallback).toFunction('value', 'name').bind(element); } } function autosubmit(target, options) { return watch(target, options, (_value, _name, renderOptions) => submit(target, renderOptions)); } function getGroupSelectors() { return up.migrate.migratedFormGroupSelectors?.() || config.groupSelectors; } function findGroup(field) { return findGroupSolution(field).element; } function findGroupSolution(field) { return u.findResult(getGroupSelectors(), function (groupSelector) { let group = field.closest(groupSelector); if (group) { let goodDerivedGroupTarget = up.fragment.tryToTarget(group); let goodDerivedFieldTarget = up.fragment.tryToTarget(field); let groupHasFieldTarget = goodDerivedFieldTarget && (group !== field) && `${groupSelector}:has(${goodDerivedFieldTarget})`; let target = goodDerivedGroupTarget || groupHasFieldTarget; if (target) { return { target, element: group, origin: field }; } } }); } function validate(...args) { let options = parseValidateArgs(...args); let validator = up.FormValidator.forElement(options.origin); return validator.validate(options); } function parseValidateArgs(originOrTarget, ...args) { const options = u.extractOptions(args); if (options.origin) { options.target || (options.target = up.fragment.toTarget(originOrTarget)); } else { options.origin || (options.origin = up.fragment.get(originOrTarget)); } return options; } function switcherValues(field) { let value; let meta; if (field.matches('input[type=checkbox]')) { if (field.checked) { value = field.value; meta = ':checked'; } else { meta = ':unchecked'; } } else if (field.matches('input[type=radio]')) { const form = getContainer(field); const groupName = field.getAttribute('name'); const checkedButton = form.querySelector(`input[type=radio]${e.attrSelector('name', groupName)}:checked`); if (checkedButton) { meta = ':checked'; value = checkedButton.value; } else { meta = ':unchecked'; } } else { value = field.value; } const values = []; if (u.isPresent(value)) { values.push(value); values.push(':present'); } else { values.push(':blank'); } if (u.isPresent(meta)) { values.push(meta); } return values; } function switchTargets(switcher, options = {}) { const targetSelector = options.target || options.target || switcher.getAttribute('up-switch'); const form = getContainer(switcher); targetSelector || up.fail("No switch target given for %o", switcher); const fieldValues = switcherValues(switcher); for (let target of up.fragment.all(form, targetSelector)) { switchTarget(target, fieldValues); } } const switchTarget = up.mockable(function (target, fieldValues) { let show; fieldValues || (fieldValues = switcherValues(findSwitcherForTarget(target))); let hideValues = target.getAttribute('up-hide-for'); if (hideValues) { hideValues = parseSwitchTokens(hideValues); show = u.intersect(fieldValues, hideValues).length === 0; } else { let showValues = target.getAttribute('up-show-for'); showValues = showValues ? parseSwitchTokens(showValues) : [':present', ':checked']; show = u.intersect(fieldValues, showValues).length > 0; } e.toggle(target, show); target.classList.add('up-switched'); }); function parseSwitchTokens(str) { return u.parseTokens(str, { json: true }); } function findSwitcherForTarget(target) { const form = getContainer(target); const switchers = form.querySelectorAll('[up-switch]'); const switcher = u.find(switchers, function (switcher) { const targetSelector = switcher.getAttribute('up-switch'); return target.matches(targetSelector); }); return switcher || up.fail('Could not find [up-switch] field for %o', target); } function getForm(elementOrSelector, options = {}) { const element = up.fragment.get(elementOrSelector, options); return element.form || element.closest('form'); } function getContainer(element, options) { return getForm(element, options) || up.layer.get(element).element; } function focusedField() { return u.presence(document.activeElement, isField); } function isSubmittable(form) { form = up.fragment.get(form); return form.matches(fullSubmitSelector()) && !isSubmitDisabled(form); } function isSubmitDisabled(form) { return form.matches(config.noSubmitSelectors.join(',')); } up.on('submit', fullSubmitSelector, function (event, form) { if (event.defaultPrevented || isSubmitDisabled(form)) { return; } up.event.halt(event, { log: true }); up.error.muteUncriticalRejection(submit(form)); }); up.compiler(validatingFieldSelector, function (fieldOrForm) { let validator = up.FormValidator.forElement(fieldOrForm); validator.watchContainer(fieldOrForm); }); function validatingFieldSelector() { return config.fieldSelectors.map((selector) => `${selector}[up-validate], [up-validate] ${selector}`).join(', '); } up.compiler('[up-switch]', (switcher) => { switchTargets(switcher); }); up.on('change', '[up-switch]', (_event, switcher) => { switchTargets(switcher); }); up.compiler('[up-show-for]:not(.up-switched), [up-hide-for]:not(.up-switched)', (element) => { switchTarget(element); }); up.compiler('[up-watch]', (formOrField) => watch(formOrField)); up.compiler('[up-autosubmit]', (formOrField) => autosubmit(formOrField)); up.on('up:framework:reset', reset); return { config, submit, submitOptions, destinationOptions, watchOptions, isSubmittable, watch, validate, autosubmit, fieldSelector, fields: findFields, isField, submitButtons: findSubmitButtons, focusedField, switchTarget, disableWhile, disable: disableContainer, group: findGroup, groupSolution: findGroupSolution, groupSelectors: getGroupSelectors, get: getForm, }; })(); up.submit = up.form.submit; up.watch = up.form.watch; up.autosubmit = up.form.autosubmit; up.validate = up.form.validate; /***/ }), /* 98 */ /***/ (() => { up.feedback = (function () { const u = up.util; const e = up.element; const config = new up.Config(() => ({ currentClasses: ['up-current'], navSelectors: ['[up-nav]', 'nav'], })); function reset() { config.reset(); up.layer.root.feedbackLocation = null; } const CLASS_ACTIVE = 'up-active'; const CLASS_LOADING = 'up-loading'; const SELECTOR_LINK = 'a, [up-href]'; function navSelector() { return config.navSelectors.join(','); } function normalizeURL(url) { if (url) { return u.normalizeURL(url, { trailingSlash: false, hash: false }); } } function linkURLs(link) { return link.upFeedbackURLs || (link.upFeedbackURLs = new up.LinkFeedbackURLs(link)); } function updateFragment(fragment) { const layerOption = { layer: up.layer.get(fragment) }; if (up.fragment.closest(fragment, navSelector(), layerOption)) { const links = up.fragment.subtree(fragment, SELECTOR_LINK, layerOption); updateLinks(links, layerOption); } else { updateLinksWithinNavs(fragment, layerOption); } } function updateLinksWithinNavs(fragment, options) { const navs = up.fragment.subtree(fragment, navSelector(), options); const links = u.flatMap(navs, nav => e.subtree(nav, SELECTOR_LINK)); updateLinks(links, options); } function getNormalizedLayerLocation(layer) { return layer.feedbackLocation || normalizeURL(layer.location); } function updateLinks(links, options = {}) { if (!links.length) { return; } const layer = options.layer || up.layer.get(links[0]); let layerLocation = getNormalizedLayerLocation(layer); if (layerLocation) { for (let link of links) { const isCurrent = linkURLs(link).isCurrent(layerLocation); for (let currentClass of config.currentClasses) { link.classList.toggle(currentClass, isCurrent); } e.toggleAttr(link, 'aria-current', 'page', isCurrent); } } } function findActivatableArea(element) { return e.ancestor(element, SELECTOR_LINK) || element; } function showAroundRequest(request, options) { if (!options.feedback) { return; } let clean = (fn) => u.always(request, fn); let activeElement = getActiveElementFromRenderOptions(request); if (activeElement) { clean(e.addTemporaryClass(activeElement, CLASS_ACTIVE)); } for (let fragment of request.fragments) { clean(e.addTemporaryClass(fragment, CLASS_LOADING)); } } function getActiveElementFromRenderOptions(request) { let activeElement = request.origin; if (activeElement) { return findActivatableArea(activeElement); } } function updateLayerIfLocationChanged(layer) { const processedLocation = layer.feedbackLocation; const layerLocation = getNormalizedLayerLocation(layer.location); if (!processedLocation || (processedLocation !== layerLocation)) { layer.feedbackLocation = layerLocation; updateLinksWithinNavs(layer.element, { layer }); } } function onBrowserLocationChanged() { const frontLayer = up.layer.front; if (frontLayer.showsLiveHistory()) { updateLayerIfLocationChanged(frontLayer); } } up.on('up:location:changed', (_event) => { onBrowserLocationChanged(); }); up.on('up:fragment:inserted', (_event, newFragment) => { updateFragment(newFragment); }); up.on('up:layer:location:changed', (event) => { updateLayerIfLocationChanged(event.layer); }); up.on('up:framework:reset', reset); return { config, showAroundRequest, normalizeURL, }; })(); /***/ }), /* 99 */ /***/ (() => { up.radio = (function () { const u = up.util; const e = up.element; const config = new up.Config(() => ({ hungrySelectors: ['[up-hungry]'], pollInterval: 30000, stretchPollInterval: (interval) => interval * (up.network.shouldReduceRequests() ? 2 : 1), pollEnabled: 'auto', })); function reset() { config.reset(); } function hungrySolutions({ layer, history, origin }) { let hungrySelector = config.hungrySelectors.join(', '); let hungries = up.fragment.all(hungrySelector, { layer: 'any' }); return u.filterMap(hungries, (element) => { let target = up.fragment.tryToTarget(element, { origin }); if (!target) { up.warn('[up-hungry]', 'Ignoring untargetable fragment %o', element); return; } let ifHistory = e.booleanAttr(element, 'up-if-history'); if (ifHistory && !history) { return; } let ifLayer = e.attr(element, 'up-if-layer'); if (ifLayer !== 'any' && layer !== up.layer.get(element)) { return; } return { target, element }; }); } function startPolling(fragment, options = {}) { up.FragmentPolling.forFragment(fragment).forceStart(options); } function stopPolling(element) { up.FragmentPolling.forFragment(element).forceStop(); } function pollIssue(fragment) { let enabled = config.pollEnabled; if (enabled === false) { return 'User has disabled polling'; } if (enabled === 'auto') { if (document.hidden) { return 'Tab is hidden'; } if (!up.layer.get(fragment)?.isFront?.()) { return 'Fragment is on a background layer'; } } if (up.emit(fragment, 'up:fragment:poll', { log: ['Polling fragment', fragment] }).defaultPrevented) { return 'User prevented up:fragment:poll event'; } } up.compiler('[up-poll]', function (fragment) { if (!up.fragment.isTargetable(fragment)) { up.warn('[up-poll]', 'Ignoring untargetable fragment %o', fragment); return; } up.FragmentPolling.forFragment(fragment).onPollAttributeObserved(); }); up.on('up:framework:reset', reset); return { config, hungrySolutions, startPolling, stopPolling, pollIssue, }; })(); /***/ }), /* 100 */ /***/ (() => { (function () { const e = up.element; function isRails() { return window.Rails || window.jQuery?.rails; } for (let feature of ['method', 'confirm']) { const upAttribute = `up-${feature}`; const dataAttribute = `data-${feature}`; up.macro(`a[${dataAttribute}]`, function (link) { if (isRails() && up.link.isFollowable(link)) { e.setMissingAttr(link, upAttribute, link.getAttribute(dataAttribute)); link.removeAttribute(dataAttribute); } }); } })(); /***/ }) /******/ ]); /************************************************************************/ /******/ // The module cache /******/ var __webpack_module_cache__ = {}; /******/ /******/ // The require function /******/ function __webpack_require__(moduleId) { /******/ // Check if module is in cache /******/ var cachedModule = __webpack_module_cache__[moduleId]; /******/ if (cachedModule !== undefined) { /******/ return cachedModule.exports; /******/ } /******/ // Create a new module (and put it into the cache) /******/ var module = __webpack_module_cache__[moduleId] = { /******/ // no module.id needed /******/ // no module.loaded needed /******/ exports: {} /******/ }; /******/ /******/ // Execute the module function /******/ __webpack_modules__[moduleId](module, module.exports, __webpack_require__); /******/ /******/ // Return the exports of the module /******/ return module.exports; /******/ } /******/ /************************************************************************/ /******/ /* webpack/runtime/make namespace object */ /******/ (() => { /******/ // define __esModule on exports /******/ __webpack_require__.r = (exports) => { /******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) { /******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' }); /******/ } /******/ Object.defineProperty(exports, '__esModule', { value: true }); /******/ }; /******/ })(); /******/ /************************************************************************/ var __webpack_exports__ = {}; // This entry need to be wrapped in an IIFE because it need to be isolated against other modules in the chunk. (() => { __webpack_require__(1); __webpack_require__(2); __webpack_require__(3); __webpack_require__(4); __webpack_require__(5); __webpack_require__(6); __webpack_require__(7); __webpack_require__(9); __webpack_require__(10); __webpack_require__(11); __webpack_require__(12); __webpack_require__(13); __webpack_require__(14); __webpack_require__(15); __webpack_require__(16); __webpack_require__(17); __webpack_require__(18); __webpack_require__(19); __webpack_require__(20); __webpack_require__(21); __webpack_require__(22); __webpack_require__(23); __webpack_require__(24); __webpack_require__(25); __webpack_require__(26); __webpack_require__(27); __webpack_require__(28); __webpack_require__(29); __webpack_require__(30); __webpack_require__(31); __webpack_require__(32); __webpack_require__(33); __webpack_require__(34); __webpack_require__(35); __webpack_require__(36); __webpack_require__(37); __webpack_require__(38); __webpack_require__(39); __webpack_require__(40); __webpack_require__(41); __webpack_require__(42); __webpack_require__(43); __webpack_require__(44); __webpack_require__(45); __webpack_require__(46); __webpack_require__(47); __webpack_require__(48); __webpack_require__(49); __webpack_require__(50); __webpack_require__(51); __webpack_require__(52); __webpack_require__(53); __webpack_require__(54); __webpack_require__(55); __webpack_require__(56); __webpack_require__(57); __webpack_require__(58); __webpack_require__(59); __webpack_require__(60); __webpack_require__(61); __webpack_require__(62); __webpack_require__(63); __webpack_require__(64); __webpack_require__(65); __webpack_require__(66); __webpack_require__(67); __webpack_require__(68); __webpack_require__(69); __webpack_require__(70); __webpack_require__(71); __webpack_require__(72); __webpack_require__(73); __webpack_require__(74); __webpack_require__(75); __webpack_require__(76); __webpack_require__(77); __webpack_require__(78); __webpack_require__(79); __webpack_require__(80); __webpack_require__(81); __webpack_require__(82); __webpack_require__(83); __webpack_require__(84); __webpack_require__(85); __webpack_require__(86); __webpack_require__(88); __webpack_require__(90); __webpack_require__(91); __webpack_require__(93); __webpack_require__(95); __webpack_require__(97); __webpack_require__(98); __webpack_require__(99); __webpack_require__(100); up.framework.onEvaled(); })(); /******/ })() ;