\").attr({role:\"log\",\"aria-live\":\"assertive\",\"aria-relevant\":\"additions\"}).addClass(\"ui-helper-hidden-accessible\").appendTo(this.document[0].body);},_setOption:function _setOption(key,value){var that=this;if(key===\"disabled\"){this[value?\"_disable\":\"_enable\"]();this.options[key]=value;// disable element style changes\nreturn;}this._super(key,value);if(key===\"content\"){$.each(this.tooltips,function(id,tooltipData){that._updateContent(tooltipData.element);});}},_disable:function _disable(){var that=this;// close open tooltips\n$.each(this.tooltips,function(id,tooltipData){var event=$.Event(\"blur\");event.target=event.currentTarget=tooltipData.element[0];that.close(event,true);});// remove title attributes to prevent native tooltips\nthis.element.find(this.options.items).addBack().each(function(){var element=$(this);if(element.is(\"[title]\")){element.data(\"ui-tooltip-title\",element.attr(\"title\")).removeAttr(\"title\");}});},_enable:function _enable(){// restore title attributes\nthis.element.find(this.options.items).addBack().each(function(){var element=$(this);if(element.data(\"ui-tooltip-title\")){element.attr(\"title\",element.data(\"ui-tooltip-title\"));}});},open:function open(event){var that=this,target=$(event?event.target:this.element)// we need closest here due to mouseover bubbling,\n// but always pointing at the same event target\n.closest(this.options.items);// No element to show a tooltip for or the tooltip is already open\nif(!target.length||target.data(\"ui-tooltip-id\")){return;}if(target.attr(\"title\")){target.data(\"ui-tooltip-title\",target.attr(\"title\"));}target.data(\"ui-tooltip-open\",true);// kill parent tooltips, custom or native, for hover\nif(event&&event.type===\"mouseover\"){target.parents().each(function(){var parent=$(this),blurEvent;if(parent.data(\"ui-tooltip-open\")){blurEvent=$.Event(\"blur\");blurEvent.target=blurEvent.currentTarget=this;that.close(blurEvent,true);}if(parent.attr(\"title\")){parent.uniqueId();that.parents[this.id]={element:this,title:parent.attr(\"title\")};parent.attr(\"title\",\"\");}});}this._registerCloseHandlers(event,target);this._updateContent(target,event);},_updateContent:function _updateContent(target,event){var content,contentOption=this.options.content,that=this,eventType=event?event.type:null;if(typeof contentOption===\"string\"){return this._open(event,target,contentOption);}content=contentOption.call(target[0],function(response){// IE may instantly serve a cached response for ajax requests\n// delay this call to _open so the other call to _open runs first\nthat._delay(function(){// Ignore async response if tooltip was closed already\nif(!target.data(\"ui-tooltip-open\")){return;}// jQuery creates a special event for focusin when it doesn't\n// exist natively. To improve performance, the native event\n// object is reused and the type is changed. Therefore, we can't\n// rely on the type being correct after the event finished\n// bubbling, so we set it back to the previous value. (#8740)\nif(event){event.type=eventType;}this._open(event,target,response);});});if(content){this._open(event,target,content);}},_open:function _open(event,target,content){var tooltipData,tooltip,delayedShow,a11yContent,positionOption=$.extend({},this.options.position);if(!content){return;}// Content can be updated multiple times. If the tooltip already\n// exists, then just update the content and bail.\ntooltipData=this._find(target);if(tooltipData){tooltipData.tooltip.find(\".ui-tooltip-content\").html(content);return;}// if we have a title, clear it to prevent the native tooltip\n// we have to check first to avoid defining a title if none exists\n// (we don't want to cause an element to start matching [title])\n//\n// We use removeAttr only for key events, to allow IE to export the correct\n// accessible attributes. For mouse events, set to empty string to avoid\n// native tooltip showing up (happens only when removing inside mouseover).\nif(target.is(\"[title]\")){if(event&&event.type===\"mouseover\"){target.attr(\"title\",\"\");}else{target.removeAttr(\"title\");}}tooltipData=this._tooltip(target);tooltip=tooltipData.tooltip;this._addDescribedBy(target,tooltip.attr(\"id\"));tooltip.find(\".ui-tooltip-content\").html(content);// Support: Voiceover on OS X, JAWS on IE <= 9\n// JAWS announces deletions even when aria-relevant=\"additions\"\n// Voiceover will sometimes re-read the entire log region's contents from the beginning\nthis.liveRegion.children().hide();if(content.clone){a11yContent=content.clone();a11yContent.removeAttr(\"id\").find(\"[id]\").removeAttr(\"id\");}else{a11yContent=content;}$(\"
\").html(a11yContent).appendTo(this.liveRegion);function position(event){positionOption.of=event;if(tooltip.is(\":hidden\")){return;}tooltip.position(positionOption);}if(this.options.track&&event&&/^mouse/.test(event.type)){this._on(this.document,{mousemove:position});// trigger once to override element-relative positioning\nposition(event);}else{tooltip.position($.extend({of:target},this.options.position));}tooltip.hide();this._show(tooltip,this.options.show);// Handle tracking tooltips that are shown with a delay (#8644). As soon\n// as the tooltip is visible, position the tooltip using the most recent\n// event.\nif(this.options.show&&this.options.show.delay){delayedShow=this.delayedShow=setInterval(function(){if(tooltip.is(\":visible\")){position(positionOption.of);clearInterval(delayedShow);}},$.fx.interval);}this._trigger(\"open\",event,{tooltip:tooltip});},_registerCloseHandlers:function _registerCloseHandlers(event,target){var events={keyup:function keyup(event){if(event.keyCode===$.ui.keyCode.ESCAPE){var fakeEvent=$.Event(event);fakeEvent.currentTarget=target[0];this.close(fakeEvent,true);}}};// Only bind remove handler for delegated targets. Non-delegated\n// tooltips will handle this in destroy.\nif(target[0]!==this.element[0]){events.remove=function(){this._removeTooltip(this._find(target).tooltip);};}if(!event||event.type===\"mouseover\"){events.mouseleave=\"close\";}if(!event||event.type===\"focusin\"){events.focusout=\"close\";}this._on(true,target,events);},close:function close(event){var tooltip,that=this,target=$(event?event.currentTarget:this.element),tooltipData=this._find(target);// The tooltip may already be closed\nif(!tooltipData){// We set ui-tooltip-open immediately upon open (in open()), but only set the\n// additional data once there's actually content to show (in _open()). So even if the\n// tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in\n// the period between open() and _open().\ntarget.removeData(\"ui-tooltip-open\");return;}tooltip=tooltipData.tooltip;// disabling closes the tooltip, so we need to track when we're closing\n// to avoid an infinite loop in case the tooltip becomes disabled on close\nif(tooltipData.closing){return;}// Clear the interval for delayed tracking tooltips\nclearInterval(this.delayedShow);// only set title if we had one before (see comment in _open())\n// If the title attribute has changed since open(), don't restore\nif(target.data(\"ui-tooltip-title\")&&!target.attr(\"title\")){target.attr(\"title\",target.data(\"ui-tooltip-title\"));}this._removeDescribedBy(target);tooltipData.hiding=true;tooltip.stop(true);this._hide(tooltip,this.options.hide,function(){that._removeTooltip($(this));});target.removeData(\"ui-tooltip-open\");this._off(target,\"mouseleave focusout keyup\");// Remove 'remove' binding only on delegated targets\nif(target[0]!==this.element[0]){this._off(target,\"remove\");}this._off(this.document,\"mousemove\");if(event&&event.type===\"mouseleave\"){$.each(this.parents,function(id,parent){$(parent.element).attr(\"title\",parent.title);delete that.parents[id];});}tooltipData.closing=true;this._trigger(\"close\",event,{tooltip:tooltip});if(!tooltipData.hiding){tooltipData.closing=false;}},_tooltip:function _tooltip(element){var tooltip=$(\"
\").attr(\"role\",\"tooltip\").addClass(\"ui-tooltip ui-widget ui-corner-all ui-widget-content \"+(this.options.tooltipClass||\"\")),id=tooltip.uniqueId().attr(\"id\");$(\"
\").addClass(\"ui-tooltip-content\").appendTo(tooltip);tooltip.appendTo(this.document[0].body);return this.tooltips[id]={element:element,tooltip:tooltip};},_find:function _find(target){var id=target.data(\"ui-tooltip-id\");return id?this.tooltips[id]:null;},_removeTooltip:function _removeTooltip(tooltip){tooltip.remove();delete this.tooltips[tooltip.attr(\"id\")];},_destroy:function _destroy(){var that=this;// close open tooltips\n$.each(this.tooltips,function(id,tooltipData){// Delegate to close method to handle common cleanup\nvar event=$.Event(\"blur\"),element=tooltipData.element;event.target=event.currentTarget=element[0];that.close(event,true);// Remove immediately; destroying an open tooltip doesn't use the\n// hide animation\n$(\"#\"+id).remove();// Restore the title\nif(element.data(\"ui-tooltip-title\")){// If the title attribute has changed since open(), don't restore\nif(!element.attr(\"title\")){element.attr(\"title\",element.data(\"ui-tooltip-title\"));}element.removeData(\"ui-tooltip-title\");}});this.liveRegion.remove();}});/*!\n * jQuery UI Effects 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/category/effects-core/\n */var dataSpace=\"ui-effects-\",// Create a local jQuery because jQuery Color relies on it and the\n// global may not exist with AMD and a custom build (#10199)\njQuery=$;$.effects={effect:{}};/*!\n * jQuery Color Animations v2.1.2\n * https://github.com/jquery/jquery-color\n *\n * Copyright 2014 jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * Date: Wed Jan 16 08:47:09 2013 -0600\n */(function(jQuery,undefined){var stepHooks=\"backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor\",// plusequals test for += 100 -= 100\nrplusequals=/^([\\-+])=\\s*(\\d+\\.?\\d*)/,// a set of RE's that can match strings and generate color tuples.\nstringParsers=[{re:/rgba?\\(\\s*(\\d{1,3})\\s*,\\s*(\\d{1,3})\\s*,\\s*(\\d{1,3})\\s*(?:,\\s*(\\d?(?:\\.\\d+)?)\\s*)?\\)/,parse:function parse(execResult){return[execResult[1],execResult[2],execResult[3],execResult[4]];}},{re:/rgba?\\(\\s*(\\d+(?:\\.\\d+)?)\\%\\s*,\\s*(\\d+(?:\\.\\d+)?)\\%\\s*,\\s*(\\d+(?:\\.\\d+)?)\\%\\s*(?:,\\s*(\\d?(?:\\.\\d+)?)\\s*)?\\)/,parse:function parse(execResult){return[execResult[1]*2.55,execResult[2]*2.55,execResult[3]*2.55,execResult[4]];}},{// this regex ignores A-F because it's compared against an already lowercased string\nre:/#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,parse:function parse(execResult){return[parseInt(execResult[1],16),parseInt(execResult[2],16),parseInt(execResult[3],16)];}},{// this regex ignores A-F because it's compared against an already lowercased string\nre:/#([a-f0-9])([a-f0-9])([a-f0-9])/,parse:function parse(execResult){return[parseInt(execResult[1]+execResult[1],16),parseInt(execResult[2]+execResult[2],16),parseInt(execResult[3]+execResult[3],16)];}},{re:/hsla?\\(\\s*(\\d+(?:\\.\\d+)?)\\s*,\\s*(\\d+(?:\\.\\d+)?)\\%\\s*,\\s*(\\d+(?:\\.\\d+)?)\\%\\s*(?:,\\s*(\\d?(?:\\.\\d+)?)\\s*)?\\)/,space:\"hsla\",parse:function parse(execResult){return[execResult[1],execResult[2]/100,execResult[3]/100,execResult[4]];}}],// jQuery.Color( )\ncolor=jQuery.Color=function(color,green,blue,alpha){return new jQuery.Color.fn.parse(color,green,blue,alpha);},spaces={rgba:{props:{red:{idx:0,type:\"byte\"},green:{idx:1,type:\"byte\"},blue:{idx:2,type:\"byte\"}}},hsla:{props:{hue:{idx:0,type:\"degrees\"},saturation:{idx:1,type:\"percent\"},lightness:{idx:2,type:\"percent\"}}}},propTypes={\"byte\":{floor:true,max:255},\"percent\":{max:1},\"degrees\":{mod:360,floor:true}},support=color.support={},// element for support tests\nsupportElem=jQuery(\"
\")[0],// colors = jQuery.Color.names\ncolors,// local aliases of functions called often\neach=jQuery.each;// determine rgba support immediately\nsupportElem.style.cssText=\"background-color:rgba(1,1,1,.5)\";support.rgba=supportElem.style.backgroundColor.indexOf(\"rgba\")>-1;// define cache name and alpha properties\n// for rgba and hsla spaces\neach(spaces,function(spaceName,space){space.cache=\"_\"+spaceName;space.props.alpha={idx:3,type:\"percent\",def:1};});function clamp(value,prop,allowEmpty){var type=propTypes[prop.type]||{};if(value==null){return allowEmpty||!prop.def?null:prop.def;}// ~~ is an short way of doing floor for positive numbers\nvalue=type.floor?~~value:parseFloat(value);// IE will pass in empty strings as value for alpha,\n// which will hit this case\nif(isNaN(value)){return prop.def;}if(type.mod){// we add mod before modding to make sure that negatives values\n// get converted properly: -10 -> 350\nreturn(value+type.mod)%type.mod;}// for now all property types without mod have min and max\nreturn 0>value?0:type.maxtype.mod/2){startValue+=type.mod;}else if(startValue-endValue>type.mod/2){startValue-=type.mod;}}result[index]=clamp((endValue-startValue)*distance+startValue,prop);}});return this[spaceName](result);},blend:function blend(opaque){// if we are already opaque - return ourself\nif(this._rgba[3]===1){return this;}var rgb=this._rgba.slice(),a=rgb.pop(),blend=color(opaque)._rgba;return color(jQuery.map(rgb,function(v,i){return(1-a)*blend[i]+a*v;}));},toRgbaString:function toRgbaString(){var prefix=\"rgba(\",rgba=jQuery.map(this._rgba,function(v,i){return v==null?i>2?1:0:v;});if(rgba[3]===1){rgba.pop();prefix=\"rgb(\";}return prefix+rgba.join()+\")\";},toHslaString:function toHslaString(){var prefix=\"hsla(\",hsla=jQuery.map(this.hsla(),function(v,i){if(v==null){v=i>2?1:0;}// catch 1 and 2\nif(i&&i<3){v=Math.round(v*100)+\"%\";}return v;});if(hsla[3]===1){hsla.pop();prefix=\"hsl(\";}return prefix+hsla.join()+\")\";},toHexString:function toHexString(includeAlpha){var rgba=this._rgba.slice(),alpha=rgba.pop();if(includeAlpha){rgba.push(~~(alpha*255));}return\"#\"+jQuery.map(rgba,function(v){// default to 0 when nulls exist\nv=(v||0).toString(16);return v.length===1?\"0\"+v:v;}).join(\"\");},toString:function toString(){return this._rgba[3]===0?\"transparent\":this.toRgbaString();}});color.fn.parse.prototype=color.fn;// hsla conversions adapted from:\n// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021\nfunction hue2rgb(p,q,h){h=(h+1)%1;if(h*6<1){return p+(q-p)*h*6;}if(h*2<1){return q;}if(h*3<2){return p+(q-p)*(2/3-h)*6;}return p;}spaces.hsla.to=function(rgba){if(rgba[0]==null||rgba[1]==null||rgba[2]==null){return[null,null,null,rgba[3]];}var r=rgba[0]/255,g=rgba[1]/255,b=rgba[2]/255,a=rgba[3],max=Math.max(r,g,b),min=Math.min(r,g,b),diff=max-min,add=max+min,l=add*0.5,h,s;if(min===max){h=0;}else if(r===max){h=60*(g-b)/diff+360;}else if(g===max){h=60*(b-r)/diff+120;}else{h=60*(r-g)/diff+240;}// chroma (diff) == 0 means greyscale which, by definition, saturation = 0%\n// otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)\nif(diff===0){s=0;}else if(l<=0.5){s=diff/add;}else{s=diff/(2-add);}return[Math.round(h)%360,s,l,a==null?1:a];};spaces.hsla.from=function(hsla){if(hsla[0]==null||hsla[1]==null||hsla[2]==null){return[null,null,null,hsla[3]];}var h=hsla[0]/360,s=hsla[1],l=hsla[2],a=hsla[3],q=l<=0.5?l*(1+s):l+s-l*s,p=2*l-q;return[Math.round(hue2rgb(p,q,h+1/3)*255),Math.round(hue2rgb(p,q,h)*255),Math.round(hue2rgb(p,q,h-1/3)*255),a];};each(spaces,function(spaceName,space){var props=space.props,cache=space.cache,to=space.to,from=space.from;// makes rgba() and hsla()\ncolor.fn[spaceName]=function(value){// generate a cache for this space if it doesn't exist\nif(to&&!this[cache]){this[cache]=to(this._rgba);}if(value===undefined){return this[cache].slice();}var ret,type=jQuery.type(value),arr=type===\"array\"||type===\"object\"?value:arguments,local=this[cache].slice();each(props,function(key,prop){var val=arr[type===\"object\"?key:prop.idx];if(val==null){val=local[prop.idx];}local[prop.idx]=clamp(val,prop);});if(from){ret=color(from(local));ret[cache]=local;return ret;}else{return color(local);}};// makes red() green() blue() alpha() hue() saturation() lightness()\neach(props,function(key,prop){// alpha is included in more than one space\nif(color.fn[key]){return;}color.fn[key]=function(value){var vtype=jQuery.type(value),fn=key===\"alpha\"?this._hsla?\"hsla\":\"rgba\":spaceName,local=this[fn](),cur=local[prop.idx],match;if(vtype===\"undefined\"){return cur;}if(vtype===\"function\"){value=value.call(this,cur);vtype=jQuery.type(value);}if(value==null&&prop.empty){return this;}if(vtype===\"string\"){match=rplusequals.exec(value);if(match){value=cur+parseFloat(match[2])*(match[1]===\"+\"?1:-1);}}local[prop.idx]=value;return this[fn](local);};});});// add cssHook and .fx.step function for each named hook.\n// accept a space separated string of properties\ncolor.hook=function(hook){var hooks=hook.split(\" \");each(hooks,function(i,hook){jQuery.cssHooks[hook]={set:function set(elem,value){var parsed,curElem,backgroundColor=\"\";if(value!==\"transparent\"&&(jQuery.type(value)!==\"string\"||(parsed=stringParse(value)))){value=color(parsed||value);if(!support.rgba&&value._rgba[3]!==1){curElem=hook===\"backgroundColor\"?elem.parentNode:elem;while((backgroundColor===\"\"||backgroundColor===\"transparent\")&&curElem&&curElem.style){try{backgroundColor=jQuery.css(curElem,\"backgroundColor\");curElem=curElem.parentNode;}catch(e){}}value=value.blend(backgroundColor&&backgroundColor!==\"transparent\"?backgroundColor:\"_default\");}value=value.toRgbaString();}try{elem.style[hook]=value;}catch(e){// wrapped to prevent IE from throwing errors on \"invalid\" values like 'auto' or 'inherit'\n}}};jQuery.fx.step[hook]=function(fx){if(!fx.colorInit){fx.start=color(fx.elem,hook);fx.end=color(fx.end);fx.colorInit=true;}jQuery.cssHooks[hook].set(fx.elem,fx.start.transition(fx.end,fx.pos));};});};color.hook(stepHooks);jQuery.cssHooks.borderColor={expand:function expand(value){var expanded={};each([\"Top\",\"Right\",\"Bottom\",\"Left\"],function(i,part){expanded[\"border\"+part+\"Color\"]=value;});return expanded;}};// Basic color names only.\n// Usage of any of the other color names requires adding yourself or including\n// jquery.color.svg-names.js.\ncolors=jQuery.Color.names={// 4.1. Basic color keywords\naqua:\"#00ffff\",black:\"#000000\",blue:\"#0000ff\",fuchsia:\"#ff00ff\",gray:\"#808080\",green:\"#008000\",lime:\"#00ff00\",maroon:\"#800000\",navy:\"#000080\",olive:\"#808000\",purple:\"#800080\",red:\"#ff0000\",silver:\"#c0c0c0\",teal:\"#008080\",white:\"#ffffff\",yellow:\"#ffff00\",// 4.2.3. \"transparent\" color keyword\ntransparent:[null,null,null,0],_default:\"#ffffff\"};})(jQuery);/******************************************************************************/ /****************************** CLASS ANIMATIONS ******************************/ /******************************************************************************/(function(){var classAnimationActions=[\"add\",\"remove\",\"toggle\"],shorthandStyles={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};$.each([\"borderLeftStyle\",\"borderRightStyle\",\"borderBottomStyle\",\"borderTopStyle\"],function(_,prop){$.fx.step[prop]=function(fx){if(fx.end!==\"none\"&&!fx.setAttr||fx.pos===1&&!fx.setAttr){jQuery.style(fx.elem,prop,fx.end);fx.setAttr=true;}};});function getElementStyles(elem){var key,len,style=elem.ownerDocument.defaultView?elem.ownerDocument.defaultView.getComputedStyle(elem,null):elem.currentStyle,styles={};if(style&&style.length&&style[0]&&style[style[0]]){len=style.length;while(len--){key=style[len];if(typeof style[key]===\"string\"){styles[$.camelCase(key)]=style[key];}}// support: Opera, IE <9\n}else{for(key in style){if(typeof style[key]===\"string\"){styles[key]=style[key];}}}return styles;}function styleDifference(oldStyle,newStyle){var diff={},name,value;for(name in newStyle){value=newStyle[name];if(oldStyle[name]!==value){if(!shorthandStyles[name]){if($.fx.step[name]||!isNaN(parseFloat(value))){diff[name]=value;}}}}return diff;}// support: jQuery <1.8\nif(!$.fn.addBack){$.fn.addBack=function(selector){return this.add(selector==null?this.prevObject:this.prevObject.filter(selector));};}$.effects.animateClass=function(value,duration,easing,callback){var o=$.speed(duration,easing,callback);return this.queue(function(){var animated=$(this),baseClass=animated.attr(\"class\")||\"\",applyClassChange,allAnimations=o.children?animated.find(\"*\").addBack():animated;// map the animated objects to store the original styles.\nallAnimations=allAnimations.map(function(){var el=$(this);return{el:el,start:getElementStyles(this)};});// apply class change\napplyClassChange=function applyClassChange(){$.each(classAnimationActions,function(i,action){if(value[action]){animated[action+\"Class\"](value[action]);}});};applyClassChange();// map all animated objects again - calculate new styles and diff\nallAnimations=allAnimations.map(function(){this.end=getElementStyles(this.el[0]);this.diff=styleDifference(this.start,this.end);return this;});// apply original class\nanimated.attr(\"class\",baseClass);// map all animated objects again - this time collecting a promise\nallAnimations=allAnimations.map(function(){var styleInfo=this,dfd=$.Deferred(),opts=$.extend({},o,{queue:false,complete:function complete(){dfd.resolve(styleInfo);}});this.el.animate(this.diff,opts);return dfd.promise();});// once all animations have completed:\n$.when.apply($,allAnimations.get()).done(function(){// set the final class\napplyClassChange();// for each animated element,\n// clear all css properties that were animated\n$.each(arguments,function(){var el=this.el;$.each(this.diff,function(key){el.css(key,\"\");});});// this is guarnteed to be there if you use jQuery.speed()\n// it also handles dequeuing the next anim...\no.complete.call(animated[0]);});});};$.fn.extend({addClass:function(orig){return function(classNames,speed,easing,callback){return speed?$.effects.animateClass.call(this,{add:classNames},speed,easing,callback):orig.apply(this,arguments);};}($.fn.addClass),removeClass:function(orig){return function(classNames,speed,easing,callback){return arguments.length>1?$.effects.animateClass.call(this,{remove:classNames},speed,easing,callback):orig.apply(this,arguments);};}($.fn.removeClass),toggleClass:function(orig){return function(classNames,force,speed,easing,callback){if(typeof force===\"boolean\"||force===undefined){if(!speed){// without speed parameter\nreturn orig.apply(this,arguments);}else{return $.effects.animateClass.call(this,force?{add:classNames}:{remove:classNames},speed,easing,callback);}}else{// without force parameter\nreturn $.effects.animateClass.call(this,{toggle:classNames},force,speed,easing);}};}($.fn.toggleClass),switchClass:function switchClass(remove,add,speed,easing,callback){return $.effects.animateClass.call(this,{add:add,remove:remove},speed,easing,callback);}});})();/******************************************************************************/ /*********************************** EFFECTS **********************************/ /******************************************************************************/(function(){$.extend($.effects,{version:\"1.11.4\",// Saves a set of properties in a data storage\nsave:function save(element,set){for(var i=0;i
\").addClass(\"ui-effects-wrapper\").css({fontSize:\"100%\",background:\"transparent\",border:\"none\",margin:0,padding:0}),// Store the size in case width/height are defined in % - Fixes #5245\nsize={width:element.width(),height:element.height()},active=document.activeElement;// support: Firefox\n// Firefox incorrectly exposes anonymous content\n// https://bugzilla.mozilla.org/show_bug.cgi?id=561664\ntry{active.id;}catch(e){active=document.body;}element.wrap(wrapper);// Fixes #7595 - Elements lose focus when wrapped.\nif(element[0]===active||$.contains(element[0],active)){$(active).focus();}wrapper=element.parent();//Hotfix for jQuery 1.4 since some change in wrap() seems to actually lose the reference to the wrapped element\n// transfer positioning properties to the wrapper\nif(element.css(\"position\")===\"static\"){wrapper.css({position:\"relative\"});element.css({position:\"relative\"});}else{$.extend(props,{position:element.css(\"position\"),zIndex:element.css(\"z-index\")});$.each([\"top\",\"left\",\"bottom\",\"right\"],function(i,pos){props[pos]=element.css(pos);if(isNaN(parseInt(props[pos],10))){props[pos]=\"auto\";}});element.css({position:\"relative\",top:0,left:0,right:\"auto\",bottom:\"auto\"});}element.css(size);return wrapper.css(props).show();},removeWrapper:function removeWrapper(element){var active=document.activeElement;if(element.parent().is(\".ui-effects-wrapper\")){element.parent().replaceWith(element);// Fixes #7595 - Elements lose focus when wrapped.\nif(element[0]===active||$.contains(element[0],active)){$(active).focus();}}return element;},setTransition:function setTransition(element,list,factor,value){value=value||{};$.each(list,function(i,x){var unit=element.cssUnit(x);if(unit[0]>0){value[x]=unit[0]*factor+unit[1];}});return value;}});// return an effect options object for the given parameters:\nfunction _normalizeArguments(effect,options,speed,callback){// allow passing all options as the first parameter\nif($.isPlainObject(effect)){options=effect;effect=effect.effect;}// convert to an object\neffect={effect:effect};// catch (effect, null, ...)\nif(options==null){options={};}// catch (effect, callback)\nif($.isFunction(options)){callback=options;speed=null;options={};}// catch (effect, speed, ?)\nif(typeof options===\"number\"||$.fx.speeds[options]){callback=speed;speed=options;options={};}// catch (effect, options, callback)\nif($.isFunction(speed)){callback=speed;speed=null;}// add options to effect\nif(options){$.extend(effect,options);}speed=speed||options.duration;effect.duration=$.fx.off?0:typeof speed===\"number\"?speed:speed in $.fx.speeds?$.fx.speeds[speed]:$.fx.speeds._default;effect.complete=callback||options.complete;return effect;}function standardAnimationOption(option){// Valid standard speeds (nothing, number, named speed)\nif(!option||typeof option===\"number\"||$.fx.speeds[option]){return true;}// Invalid strings - treat as \"normal\" speed\nif(typeof option===\"string\"&&!$.effects.effect[option]){return true;}// Complete callback\nif($.isFunction(option)){return true;}// Options hash (but not naming an effect)\nif(_typeof(option)===\"object\"&&!option.effect){return true;}// Didn't match any standard API\nreturn false;}$.fn.extend({effect:function/* effect, options, speed, callback */effect(){var args=_normalizeArguments.apply(this,arguments),mode=args.mode,queue=args.queue,effectMethod=$.effects.effect[args.effect];if($.fx.off||!effectMethod){// delegate to the original method (e.g., .show()) if possible\nif(mode){return this[mode](args.duration,args.complete);}else{return this.each(function(){if(args.complete){args.complete.call(this);}});}}function run(next){var elem=$(this),complete=args.complete,mode=args.mode;function done(){if($.isFunction(complete)){complete.call(elem[0]);}if($.isFunction(next)){next();}}// If the element already has the correct final state, delegate to\n// the core methods so the internal tracking of \"olddisplay\" works.\nif(elem.is(\":hidden\")?mode===\"hide\":mode===\"show\"){elem[mode]();done();}else{effectMethod.call(elem[0],args,done);}}return queue===false?this.each(run):this.queue(queue||\"fx\",run);},show:function(orig){return function(option){if(standardAnimationOption(option)){return orig.apply(this,arguments);}else{var args=_normalizeArguments.apply(this,arguments);args.mode=\"show\";return this.effect.call(this,args);}};}($.fn.show),hide:function(orig){return function(option){if(standardAnimationOption(option)){return orig.apply(this,arguments);}else{var args=_normalizeArguments.apply(this,arguments);args.mode=\"hide\";return this.effect.call(this,args);}};}($.fn.hide),toggle:function(orig){return function(option){if(standardAnimationOption(option)||typeof option===\"boolean\"){return orig.apply(this,arguments);}else{var args=_normalizeArguments.apply(this,arguments);args.mode=\"toggle\";return this.effect.call(this,args);}};}($.fn.toggle),// helper functions\ncssUnit:function cssUnit(key){var style=this.css(key),val=[];$.each([\"em\",\"px\",\"%\",\"pt\"],function(i,unit){if(style.indexOf(unit)>0){val=[parseFloat(style),unit];}});return val;}});})();/******************************************************************************/ /*********************************** EASING ***********************************/ /******************************************************************************/(function(){// based on easing equations from Robert Penner (http://www.robertpenner.com/easing)\nvar baseEasings={};$.each([\"Quad\",\"Cubic\",\"Quart\",\"Quint\",\"Expo\"],function(i,name){baseEasings[name]=function(p){return Math.pow(p,i+2);};});$.extend(baseEasings,{Sine:function Sine(p){return 1-Math.cos(p*Math.PI/2);},Circ:function Circ(p){return 1-Math.sqrt(1-p*p);},Elastic:function Elastic(p){return p===0||p===1?p:-Math.pow(2,8*(p-1))*Math.sin(((p-1)*80-7.5)*Math.PI/15);},Back:function Back(p){return p*p*(3*p-2);},Bounce:function Bounce(p){var pow2,bounce=4;while(p<((pow2=Math.pow(2,--bounce))-1)/11){}return 1/Math.pow(4,3-bounce)-7.5625*Math.pow((pow2*3-2)/22-p,2);}});$.each(baseEasings,function(name,easeIn){$.easing[\"easeIn\"+name]=easeIn;$.easing[\"easeOut\"+name]=function(p){return 1-easeIn(1-p);};$.easing[\"easeInOut\"+name]=function(p){return p<0.5?easeIn(p*2)/2:1-easeIn(p*-2+2)/2;};});})();var effect=$.effects;/*!\n * jQuery UI Effects Blind 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/blind-effect/\n */var effectBlind=$.effects.effect.blind=function(o,done){// Create element\nvar el=$(this),rvertical=/up|down|vertical/,rpositivemotion=/up|left|vertical|horizontal/,props=[\"position\",\"top\",\"bottom\",\"left\",\"right\",\"height\",\"width\"],mode=$.effects.setMode(el,o.mode||\"hide\"),direction=o.direction||\"up\",vertical=rvertical.test(direction),ref=vertical?\"height\":\"width\",ref2=vertical?\"top\":\"left\",motion=rpositivemotion.test(direction),animation={},show=mode===\"show\",wrapper,distance,margin;// if already wrapped, the wrapper's properties are my property. #6245\nif(el.parent().is(\".ui-effects-wrapper\")){$.effects.save(el.parent(),props);}else{$.effects.save(el,props);}el.show();wrapper=$.effects.createWrapper(el).css({overflow:\"hidden\"});distance=wrapper[ref]();margin=parseFloat(wrapper.css(ref2))||0;animation[ref]=show?distance:0;if(!motion){el.css(vertical?\"bottom\":\"right\",0).css(vertical?\"top\":\"left\",\"auto\").css({position:\"absolute\"});animation[ref2]=show?margin:distance+margin;}// start at 0 if we are showing\nif(show){wrapper.css(ref,0);if(!motion){wrapper.css(ref2,margin+distance);}}// Animate\nwrapper.animate(animation,{duration:o.duration,easing:o.easing,queue:false,complete:function complete(){if(mode===\"hide\"){el.hide();}$.effects.restore(el,props);$.effects.removeWrapper(el);done();}});};/*!\n * jQuery UI Effects Bounce 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/bounce-effect/\n */var effectBounce=$.effects.effect.bounce=function(o,done){var el=$(this),props=[\"position\",\"top\",\"bottom\",\"left\",\"right\",\"height\",\"width\"],// defaults:\nmode=$.effects.setMode(el,o.mode||\"effect\"),hide=mode===\"hide\",show=mode===\"show\",direction=o.direction||\"up\",distance=o.distance,times=o.times||5,// number of internal animations\nanims=times*2+(show||hide?1:0),speed=o.duration/anims,easing=o.easing,// utility:\nref=direction===\"up\"||direction===\"down\"?\"top\":\"left\",motion=direction===\"up\"||direction===\"left\",i,upAnim,downAnim,// we will need to re-assemble the queue to stack our animations in place\nqueue=el.queue(),queuelen=queue.length;// Avoid touching opacity to prevent clearType and PNG issues in IE\nif(show||hide){props.push(\"opacity\");}$.effects.save(el,props);el.show();$.effects.createWrapper(el);// Create Wrapper\n// default distance for the BIGGEST bounce is the outer Distance / 3\nif(!distance){distance=el[ref===\"top\"?\"outerHeight\":\"outerWidth\"]()/3;}if(show){downAnim={opacity:1};downAnim[ref]=0;// if we are showing, force opacity 0 and set the initial position\n// then do the \"first\" animation\nel.css(\"opacity\",0).css(ref,motion?-distance*2:distance*2).animate(downAnim,speed,easing);}// start at the smallest distance if we are hiding\nif(hide){distance=distance/Math.pow(2,times-1);}downAnim={};downAnim[ref]=0;// Bounces up/down/left/right then back to 0 -- times * 2 animations happen here\nfor(i=0;i
1){queue.splice.apply(queue,[1,0].concat(queue.splice(queuelen,anims+1)));}el.dequeue();};/*!\n * jQuery UI Effects Clip 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/clip-effect/\n */var effectClip=$.effects.effect.clip=function(o,done){// Create element\nvar el=$(this),props=[\"position\",\"top\",\"bottom\",\"left\",\"right\",\"height\",\"width\"],mode=$.effects.setMode(el,o.mode||\"hide\"),show=mode===\"show\",direction=o.direction||\"vertical\",vert=direction===\"vertical\",size=vert?\"height\":\"width\",position=vert?\"top\":\"left\",animation={},wrapper,animate,distance;// Save & Show\n$.effects.save(el,props);el.show();// Create Wrapper\nwrapper=$.effects.createWrapper(el).css({overflow:\"hidden\"});animate=el[0].tagName===\"IMG\"?wrapper:el;distance=animate[size]();// Shift\nif(show){animate.css(size,0);animate.css(position,distance/2);}// Create Animation Object:\nanimation[size]=show?distance:0;animation[position]=show?0:distance/2;// Animate\nanimate.animate(animation,{queue:false,duration:o.duration,easing:o.easing,complete:function complete(){if(!show){el.hide();}$.effects.restore(el,props);$.effects.removeWrapper(el);done();}});};/*!\n * jQuery UI Effects Drop 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/drop-effect/\n */var effectDrop=$.effects.effect.drop=function(o,done){var el=$(this),props=[\"position\",\"top\",\"bottom\",\"left\",\"right\",\"opacity\",\"height\",\"width\"],mode=$.effects.setMode(el,o.mode||\"hide\"),show=mode===\"show\",direction=o.direction||\"left\",ref=direction===\"up\"||direction===\"down\"?\"top\":\"left\",motion=direction===\"up\"||direction===\"left\"?\"pos\":\"neg\",animation={opacity:show?1:0},distance;// Adjust\n$.effects.save(el,props);el.show();$.effects.createWrapper(el);distance=o.distance||el[ref===\"top\"?\"outerHeight\":\"outerWidth\"](true)/2;if(show){el.css(\"opacity\",0).css(ref,motion===\"pos\"?-distance:distance);}// Animation\nanimation[ref]=(show?motion===\"pos\"?\"+=\":\"-=\":motion===\"pos\"?\"-=\":\"+=\")+distance;// Animate\nel.animate(animation,{queue:false,duration:o.duration,easing:o.easing,complete:function complete(){if(mode===\"hide\"){el.hide();}$.effects.restore(el,props);$.effects.removeWrapper(el);done();}});};/*!\n * jQuery UI Effects Explode 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/explode-effect/\n */var effectExplode=$.effects.effect.explode=function(o,done){var rows=o.pieces?Math.round(Math.sqrt(o.pieces)):3,cells=rows,el=$(this),mode=$.effects.setMode(el,o.mode||\"hide\"),show=mode===\"show\",// show and then visibility:hidden the element before calculating offset\noffset=el.show().css(\"visibility\",\"hidden\").offset(),// width and height of a piece\nwidth=Math.ceil(el.outerWidth()/cells),height=Math.ceil(el.outerHeight()/rows),pieces=[],// loop\ni,j,left,top,mx,my;// children animate complete:\nfunction childComplete(){pieces.push(this);if(pieces.length===rows*cells){animComplete();}}// clone the element for each row and cell.\nfor(i=0;i\ntop=offset.top+i*height;my=i-(rows-1)/2;for(j=0;j\").css({position:\"absolute\",visibility:\"visible\",left:-j*width,top:-i*height})// select the wrapper - make it overflow: hidden and absolute positioned based on\n// where the original was located +left and +top equal to the size of pieces\n.parent().addClass(\"ui-effects-explode\").css({position:\"absolute\",overflow:\"hidden\",width:width,height:height,left:left+(show?mx*width:0),top:top+(show?my*height:0),opacity:show?0:1}).animate({left:left+(show?0:mx*width),top:top+(show?0:my*height),opacity:show?1:0},o.duration||500,o.easing,childComplete);}}function animComplete(){el.css({visibility:\"visible\"});$(pieces).remove();if(!show){el.hide();}done();}};/*!\n * jQuery UI Effects Fade 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/fade-effect/\n */var effectFade=$.effects.effect.fade=function(o,done){var el=$(this),mode=$.effects.setMode(el,o.mode||\"toggle\");el.animate({opacity:mode},{queue:false,duration:o.duration,easing:o.easing,complete:done});};/*!\n * jQuery UI Effects Fold 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/fold-effect/\n */var effectFold=$.effects.effect.fold=function(o,done){// Create element\nvar el=$(this),props=[\"position\",\"top\",\"bottom\",\"left\",\"right\",\"height\",\"width\"],mode=$.effects.setMode(el,o.mode||\"hide\"),show=mode===\"show\",hide=mode===\"hide\",size=o.size||15,percent=/([0-9]+)%/.exec(size),horizFirst=!!o.horizFirst,widthFirst=show!==horizFirst,ref=widthFirst?[\"width\",\"height\"]:[\"height\",\"width\"],duration=o.duration/2,wrapper,distance,animation1={},animation2={};$.effects.save(el,props);el.show();// Create Wrapper\nwrapper=$.effects.createWrapper(el).css({overflow:\"hidden\"});distance=widthFirst?[wrapper.width(),wrapper.height()]:[wrapper.height(),wrapper.width()];if(percent){size=parseInt(percent[1],10)/100*distance[hide?0:1];}if(show){wrapper.css(horizFirst?{height:0,width:size}:{height:size,width:0});}// Animation\nanimation1[ref[0]]=show?distance[0]:size;animation2[ref[1]]=show?distance[1]:0;// Animate\nwrapper.animate(animation1,duration,o.easing).animate(animation2,duration,o.easing,function(){if(hide){el.hide();}$.effects.restore(el,props);$.effects.removeWrapper(el);done();});};/*!\n * jQuery UI Effects Highlight 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/highlight-effect/\n */var effectHighlight=$.effects.effect.highlight=function(o,done){var elem=$(this),props=[\"backgroundImage\",\"backgroundColor\",\"opacity\"],mode=$.effects.setMode(elem,o.mode||\"show\"),animation={backgroundColor:elem.css(\"backgroundColor\")};if(mode===\"hide\"){animation.opacity=0;}$.effects.save(elem,props);elem.show().css({backgroundImage:\"none\",backgroundColor:o.color||\"#ffff99\"}).animate(animation,{queue:false,duration:o.duration,easing:o.easing,complete:function complete(){if(mode===\"hide\"){elem.hide();}$.effects.restore(elem,props);done();}});};/*!\n * jQuery UI Effects Size 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/size-effect/\n */var effectSize=$.effects.effect.size=function(o,done){// Create element\nvar original,baseline,factor,el=$(this),props0=[\"position\",\"top\",\"bottom\",\"left\",\"right\",\"width\",\"height\",\"overflow\",\"opacity\"],// Always restore\nprops1=[\"position\",\"top\",\"bottom\",\"left\",\"right\",\"overflow\",\"opacity\"],// Copy for children\nprops2=[\"width\",\"height\",\"overflow\"],cProps=[\"fontSize\"],vProps=[\"borderTopWidth\",\"borderBottomWidth\",\"paddingTop\",\"paddingBottom\"],hProps=[\"borderLeftWidth\",\"borderRightWidth\",\"paddingLeft\",\"paddingRight\"],// Set options\nmode=$.effects.setMode(el,o.mode||\"effect\"),restore=o.restore||mode!==\"effect\",scale=o.scale||\"both\",origin=o.origin||[\"middle\",\"center\"],position=el.css(\"position\"),props=restore?props0:props1,zero={height:0,width:0,outerHeight:0,outerWidth:0};if(mode===\"show\"){el.show();}original={height:el.height(),width:el.width(),outerHeight:el.outerHeight(),outerWidth:el.outerWidth()};if(o.mode===\"toggle\"&&mode===\"show\"){el.from=o.to||zero;el.to=o.from||original;}else{el.from=o.from||(mode===\"show\"?zero:original);el.to=o.to||(mode===\"hide\"?zero:original);}// Set scaling factor\nfactor={from:{y:el.from.height/original.height,x:el.from.width/original.width},to:{y:el.to.height/original.height,x:el.to.width/original.width}};// Scale the css box\nif(scale===\"box\"||scale===\"both\"){// Vertical props scaling\nif(factor.from.y!==factor.to.y){props=props.concat(vProps);el.from=$.effects.setTransition(el,vProps,factor.from.y,el.from);el.to=$.effects.setTransition(el,vProps,factor.to.y,el.to);}// Horizontal props scaling\nif(factor.from.x!==factor.to.x){props=props.concat(hProps);el.from=$.effects.setTransition(el,hProps,factor.from.x,el.from);el.to=$.effects.setTransition(el,hProps,factor.to.x,el.to);}}// Scale the content\nif(scale===\"content\"||scale===\"both\"){// Vertical props scaling\nif(factor.from.y!==factor.to.y){props=props.concat(cProps).concat(props2);el.from=$.effects.setTransition(el,cProps,factor.from.y,el.from);el.to=$.effects.setTransition(el,cProps,factor.to.y,el.to);}}$.effects.save(el,props);el.show();$.effects.createWrapper(el);el.css(\"overflow\",\"hidden\").css(el.from);// Adjust\nif(origin){// Calculate baseline shifts\nbaseline=$.effects.getBaseline(origin,original);el.from.top=(original.outerHeight-el.outerHeight())*baseline.y;el.from.left=(original.outerWidth-el.outerWidth())*baseline.x;el.to.top=(original.outerHeight-el.to.outerHeight)*baseline.y;el.to.left=(original.outerWidth-el.to.outerWidth)*baseline.x;}el.css(el.from);// set top & left\n// Animate\nif(scale===\"content\"||scale===\"both\"){// Scale the children\n// Add margins/font-size\nvProps=vProps.concat([\"marginTop\",\"marginBottom\"]).concat(cProps);hProps=hProps.concat([\"marginLeft\",\"marginRight\"]);props2=props0.concat(vProps).concat(hProps);el.find(\"*[width]\").each(function(){var child=$(this),c_original={height:child.height(),width:child.width(),outerHeight:child.outerHeight(),outerWidth:child.outerWidth()};if(restore){$.effects.save(child,props2);}child.from={height:c_original.height*factor.from.y,width:c_original.width*factor.from.x,outerHeight:c_original.outerHeight*factor.from.y,outerWidth:c_original.outerWidth*factor.from.x};child.to={height:c_original.height*factor.to.y,width:c_original.width*factor.to.x,outerHeight:c_original.height*factor.to.y,outerWidth:c_original.width*factor.to.x};// Vertical props scaling\nif(factor.from.y!==factor.to.y){child.from=$.effects.setTransition(child,vProps,factor.from.y,child.from);child.to=$.effects.setTransition(child,vProps,factor.to.y,child.to);}// Horizontal props scaling\nif(factor.from.x!==factor.to.x){child.from=$.effects.setTransition(child,hProps,factor.from.x,child.from);child.to=$.effects.setTransition(child,hProps,factor.to.x,child.to);}// Animate children\nchild.css(child.from);child.animate(child.to,o.duration,o.easing,function(){// Restore children\nif(restore){$.effects.restore(child,props2);}});});}// Animate\nel.animate(el.to,{queue:false,duration:o.duration,easing:o.easing,complete:function complete(){if(el.to.opacity===0){el.css(\"opacity\",el.from.opacity);}if(mode===\"hide\"){el.hide();}$.effects.restore(el,props);if(!restore){// we need to calculate our new positioning based on the scaling\nif(position===\"static\"){el.css({position:\"relative\",top:el.to.top,left:el.to.left});}else{$.each([\"top\",\"left\"],function(idx,pos){el.css(pos,function(_,str){var val=parseInt(str,10),toRef=idx?el.to.left:el.to.top;// if original was \"auto\", recalculate the new value from wrapper\nif(str===\"auto\"){return toRef+\"px\";}return val+toRef+\"px\";});});}}$.effects.removeWrapper(el);done();}});};/*!\n * jQuery UI Effects Scale 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/scale-effect/\n */var effectScale=$.effects.effect.scale=function(o,done){// Create element\nvar el=$(this),options=$.extend(true,{},o),mode=$.effects.setMode(el,o.mode||\"effect\"),percent=parseInt(o.percent,10)||(parseInt(o.percent,10)===0?0:mode===\"hide\"?0:100),direction=o.direction||\"both\",origin=o.origin,original={height:el.height(),width:el.width(),outerHeight:el.outerHeight(),outerWidth:el.outerWidth()},factor={y:direction!==\"horizontal\"?percent/100:1,x:direction!==\"vertical\"?percent/100:1};// We are going to pass this effect to the size effect:\noptions.effect=\"size\";options.queue=false;options.complete=done;// Set default origin and restore for show/hide\nif(mode!==\"effect\"){options.origin=origin||[\"middle\",\"center\"];options.restore=true;}options.from=o.from||(mode===\"show\"?{height:0,width:0,outerHeight:0,outerWidth:0}:original);options.to={height:original.height*factor.y,width:original.width*factor.x,outerHeight:original.outerHeight*factor.y,outerWidth:original.outerWidth*factor.x};// Fade option to support puff\nif(options.fade){if(mode===\"show\"){options.from.opacity=0;options.to.opacity=1;}if(mode===\"hide\"){options.from.opacity=1;options.to.opacity=0;}}// Animate\nel.effect(options);};/*!\n * jQuery UI Effects Puff 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/puff-effect/\n */var effectPuff=$.effects.effect.puff=function(o,done){var elem=$(this),mode=$.effects.setMode(elem,o.mode||\"hide\"),hide=mode===\"hide\",percent=parseInt(o.percent,10)||150,factor=percent/100,original={height:elem.height(),width:elem.width(),outerHeight:elem.outerHeight(),outerWidth:elem.outerWidth()};$.extend(o,{effect:\"scale\",queue:false,fade:true,mode:mode,complete:done,percent:hide?percent:100,from:hide?original:{height:original.height*factor,width:original.width*factor,outerHeight:original.outerHeight*factor,outerWidth:original.outerWidth*factor}});elem.effect(o);};/*!\n * jQuery UI Effects Pulsate 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/pulsate-effect/\n */var effectPulsate=$.effects.effect.pulsate=function(o,done){var elem=$(this),mode=$.effects.setMode(elem,o.mode||\"show\"),show=mode===\"show\",hide=mode===\"hide\",showhide=show||mode===\"hide\",// showing or hiding leaves of the \"last\" animation\nanims=(o.times||5)*2+(showhide?1:0),duration=o.duration/anims,animateTo=0,queue=elem.queue(),queuelen=queue.length,i;if(show||!elem.is(\":visible\")){elem.css(\"opacity\",0).show();animateTo=1;}// anims - 1 opacity \"toggles\"\nfor(i=1;i
1){queue.splice.apply(queue,[1,0].concat(queue.splice(queuelen,anims+1)));}elem.dequeue();};/*!\n * jQuery UI Effects Shake 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/shake-effect/\n */var effectShake=$.effects.effect.shake=function(o,done){var el=$(this),props=[\"position\",\"top\",\"bottom\",\"left\",\"right\",\"height\",\"width\"],mode=$.effects.setMode(el,o.mode||\"effect\"),direction=o.direction||\"left\",distance=o.distance||20,times=o.times||3,anims=times*2+1,speed=Math.round(o.duration/anims),ref=direction===\"up\"||direction===\"down\"?\"top\":\"left\",positiveMotion=direction===\"up\"||direction===\"left\",animation={},animation1={},animation2={},i,// we will need to re-assemble the queue to stack our animations in place\nqueue=el.queue(),queuelen=queue.length;$.effects.save(el,props);el.show();$.effects.createWrapper(el);// Animation\nanimation[ref]=(positiveMotion?\"-=\":\"+=\")+distance;animation1[ref]=(positiveMotion?\"+=\":\"-=\")+distance*2;animation2[ref]=(positiveMotion?\"-=\":\"+=\")+distance*2;// Animate\nel.animate(animation,speed,o.easing);// Shakes\nfor(i=1;i1){queue.splice.apply(queue,[1,0].concat(queue.splice(queuelen,anims+1)));}el.dequeue();};/*!\n * jQuery UI Effects Slide 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/slide-effect/\n */var effectSlide=$.effects.effect.slide=function(o,done){// Create element\nvar el=$(this),props=[\"position\",\"top\",\"bottom\",\"left\",\"right\",\"width\",\"height\"],mode=$.effects.setMode(el,o.mode||\"show\"),show=mode===\"show\",direction=o.direction||\"left\",ref=direction===\"up\"||direction===\"down\"?\"top\":\"left\",positiveMotion=direction===\"up\"||direction===\"left\",distance,animation={};// Adjust\n$.effects.save(el,props);el.show();distance=o.distance||el[ref===\"top\"?\"outerHeight\":\"outerWidth\"](true);$.effects.createWrapper(el).css({overflow:\"hidden\"});if(show){el.css(ref,positiveMotion?isNaN(distance)?\"-\"+distance:-distance:distance);}// Animation\nanimation[ref]=(show?positiveMotion?\"+=\":\"-=\":positiveMotion?\"-=\":\"+=\")+distance;// Animate\nel.animate(animation,{queue:false,duration:o.duration,easing:o.easing,complete:function complete(){if(mode===\"hide\"){el.hide();}$.effects.restore(el,props);$.effects.removeWrapper(el);done();}});};/*!\n * jQuery UI Effects Transfer 1.11.4\n * http://jqueryui.com\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license.\n * http://jquery.org/license\n *\n * http://api.jqueryui.com/transfer-effect/\n */var effectTransfer=$.effects.effect.transfer=function(o,done){var elem=$(this),target=$(o.to),targetFixed=target.css(\"position\")===\"fixed\",body=$(\"body\"),fixTop=targetFixed?body.scrollTop():0,fixLeft=targetFixed?body.scrollLeft():0,endPosition=target.offset(),animation={top:endPosition.top-fixTop,left:endPosition.left-fixLeft,height:target.innerHeight(),width:target.innerWidth()},startPosition=elem.offset(),transfer=$(\"\").appendTo(document.body).addClass(o.className).css({top:startPosition.top-fixTop,left:startPosition.left-fixLeft,height:elem.innerHeight(),width:elem.innerWidth(),position:targetFixed?\"fixed\":\"absolute\"}).animate(animation,o.duration,o.easing,function(){transfer.remove();done();});};});\n\n//# sourceURL=webpack://SequenceServer/./public/packages/jquery-ui@1.11.4.js?");
/***/ }),
/***/ "./node_modules/bootstrap/dist/js/npm.js":
/*!***********************************************!*\
!*** ./node_modules/bootstrap/dist/js/npm.js ***!
\***********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("// This file is autogenerated via the `commonjs` Grunt task. You can require() this file in a CommonJS environment.\n__webpack_require__(/*! ../../js/transition.js */ \"./node_modules/bootstrap/js/transition.js\")\n__webpack_require__(/*! ../../js/alert.js */ \"./node_modules/bootstrap/js/alert.js\")\n__webpack_require__(/*! ../../js/button.js */ \"./node_modules/bootstrap/js/button.js\")\n__webpack_require__(/*! ../../js/carousel.js */ \"./node_modules/bootstrap/js/carousel.js\")\n__webpack_require__(/*! ../../js/collapse.js */ \"./node_modules/bootstrap/js/collapse.js\")\n__webpack_require__(/*! ../../js/dropdown.js */ \"./node_modules/bootstrap/js/dropdown.js\")\n__webpack_require__(/*! ../../js/modal.js */ \"./node_modules/bootstrap/js/modal.js\")\n__webpack_require__(/*! ../../js/tooltip.js */ \"./node_modules/bootstrap/js/tooltip.js\")\n__webpack_require__(/*! ../../js/popover.js */ \"./node_modules/bootstrap/js/popover.js\")\n__webpack_require__(/*! ../../js/scrollspy.js */ \"./node_modules/bootstrap/js/scrollspy.js\")\n__webpack_require__(/*! ../../js/tab.js */ \"./node_modules/bootstrap/js/tab.js\")\n__webpack_require__(/*! ../../js/affix.js */ \"./node_modules/bootstrap/js/affix.js\")\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/dist/js/npm.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/affix.js":
/*!********************************************!*\
!*** ./node_modules/bootstrap/js/affix.js ***!
\********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: affix.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#affix\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // AFFIX CLASS DEFINITION\n // ======================\n\n var Affix = function (element, options) {\n this.options = $.extend({}, Affix.DEFAULTS, options)\n\n var target = this.options.target === Affix.DEFAULTS.target ? $(this.options.target) : $(document).find(this.options.target)\n\n this.$target = target\n .on('scroll.bs.affix.data-api', $.proxy(this.checkPosition, this))\n .on('click.bs.affix.data-api', $.proxy(this.checkPositionWithEventLoop, this))\n\n this.$element = $(element)\n this.affixed = null\n this.unpin = null\n this.pinnedOffset = null\n\n this.checkPosition()\n }\n\n Affix.VERSION = '3.4.1'\n\n Affix.RESET = 'affix affix-top affix-bottom'\n\n Affix.DEFAULTS = {\n offset: 0,\n target: window\n }\n\n Affix.prototype.getState = function (scrollHeight, height, offsetTop, offsetBottom) {\n var scrollTop = this.$target.scrollTop()\n var position = this.$element.offset()\n var targetHeight = this.$target.height()\n\n if (offsetTop != null && this.affixed == 'top') return scrollTop < offsetTop ? 'top' : false\n\n if (this.affixed == 'bottom') {\n if (offsetTop != null) return (scrollTop + this.unpin <= position.top) ? false : 'bottom'\n return (scrollTop + targetHeight <= scrollHeight - offsetBottom) ? false : 'bottom'\n }\n\n var initializing = this.affixed == null\n var colliderTop = initializing ? scrollTop : position.top\n var colliderHeight = initializing ? targetHeight : height\n\n if (offsetTop != null && scrollTop <= offsetTop) return 'top'\n if (offsetBottom != null && (colliderTop + colliderHeight >= scrollHeight - offsetBottom)) return 'bottom'\n\n return false\n }\n\n Affix.prototype.getPinnedOffset = function () {\n if (this.pinnedOffset) return this.pinnedOffset\n this.$element.removeClass(Affix.RESET).addClass('affix')\n var scrollTop = this.$target.scrollTop()\n var position = this.$element.offset()\n return (this.pinnedOffset = position.top - scrollTop)\n }\n\n Affix.prototype.checkPositionWithEventLoop = function () {\n setTimeout($.proxy(this.checkPosition, this), 1)\n }\n\n Affix.prototype.checkPosition = function () {\n if (!this.$element.is(':visible')) return\n\n var height = this.$element.height()\n var offset = this.options.offset\n var offsetTop = offset.top\n var offsetBottom = offset.bottom\n var scrollHeight = Math.max($(document).height(), $(document.body).height())\n\n if (typeof offset != 'object') offsetBottom = offsetTop = offset\n if (typeof offsetTop == 'function') offsetTop = offset.top(this.$element)\n if (typeof offsetBottom == 'function') offsetBottom = offset.bottom(this.$element)\n\n var affix = this.getState(scrollHeight, height, offsetTop, offsetBottom)\n\n if (this.affixed != affix) {\n if (this.unpin != null) this.$element.css('top', '')\n\n var affixType = 'affix' + (affix ? '-' + affix : '')\n var e = $.Event(affixType + '.bs.affix')\n\n this.$element.trigger(e)\n\n if (e.isDefaultPrevented()) return\n\n this.affixed = affix\n this.unpin = affix == 'bottom' ? this.getPinnedOffset() : null\n\n this.$element\n .removeClass(Affix.RESET)\n .addClass(affixType)\n .trigger(affixType.replace('affix', 'affixed') + '.bs.affix')\n }\n\n if (affix == 'bottom') {\n this.$element.offset({\n top: scrollHeight - height - offsetBottom\n })\n }\n }\n\n\n // AFFIX PLUGIN DEFINITION\n // =======================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.affix')\n var options = typeof option == 'object' && option\n\n if (!data) $this.data('bs.affix', (data = new Affix(this, options)))\n if (typeof option == 'string') data[option]()\n })\n }\n\n var old = $.fn.affix\n\n $.fn.affix = Plugin\n $.fn.affix.Constructor = Affix\n\n\n // AFFIX NO CONFLICT\n // =================\n\n $.fn.affix.noConflict = function () {\n $.fn.affix = old\n return this\n }\n\n\n // AFFIX DATA-API\n // ==============\n\n $(window).on('load', function () {\n $('[data-spy=\"affix\"]').each(function () {\n var $spy = $(this)\n var data = $spy.data()\n\n data.offset = data.offset || {}\n\n if (data.offsetBottom != null) data.offset.bottom = data.offsetBottom\n if (data.offsetTop != null) data.offset.top = data.offsetTop\n\n Plugin.call($spy, data)\n })\n })\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/affix.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/alert.js":
/*!********************************************!*\
!*** ./node_modules/bootstrap/js/alert.js ***!
\********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: alert.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#alerts\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // ALERT CLASS DEFINITION\n // ======================\n\n var dismiss = '[data-dismiss=\"alert\"]'\n var Alert = function (el) {\n $(el).on('click', dismiss, this.close)\n }\n\n Alert.VERSION = '3.4.1'\n\n Alert.TRANSITION_DURATION = 150\n\n Alert.prototype.close = function (e) {\n var $this = $(this)\n var selector = $this.attr('data-target')\n\n if (!selector) {\n selector = $this.attr('href')\n selector = selector && selector.replace(/.*(?=#[^\\s]*$)/, '') // strip for ie7\n }\n\n selector = selector === '#' ? [] : selector\n var $parent = $(document).find(selector)\n\n if (e) e.preventDefault()\n\n if (!$parent.length) {\n $parent = $this.closest('.alert')\n }\n\n $parent.trigger(e = $.Event('close.bs.alert'))\n\n if (e.isDefaultPrevented()) return\n\n $parent.removeClass('in')\n\n function removeElement() {\n // detach from parent, fire event then clean up data\n $parent.detach().trigger('closed.bs.alert').remove()\n }\n\n $.support.transition && $parent.hasClass('fade') ?\n $parent\n .one('bsTransitionEnd', removeElement)\n .emulateTransitionEnd(Alert.TRANSITION_DURATION) :\n removeElement()\n }\n\n\n // ALERT PLUGIN DEFINITION\n // =======================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.alert')\n\n if (!data) $this.data('bs.alert', (data = new Alert(this)))\n if (typeof option == 'string') data[option].call($this)\n })\n }\n\n var old = $.fn.alert\n\n $.fn.alert = Plugin\n $.fn.alert.Constructor = Alert\n\n\n // ALERT NO CONFLICT\n // =================\n\n $.fn.alert.noConflict = function () {\n $.fn.alert = old\n return this\n }\n\n\n // ALERT DATA-API\n // ==============\n\n $(document).on('click.bs.alert.data-api', dismiss, Alert.prototype.close)\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/alert.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/button.js":
/*!*********************************************!*\
!*** ./node_modules/bootstrap/js/button.js ***!
\*********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: button.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#buttons\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // BUTTON PUBLIC CLASS DEFINITION\n // ==============================\n\n var Button = function (element, options) {\n this.$element = $(element)\n this.options = $.extend({}, Button.DEFAULTS, options)\n this.isLoading = false\n }\n\n Button.VERSION = '3.4.1'\n\n Button.DEFAULTS = {\n loadingText: 'loading...'\n }\n\n Button.prototype.setState = function (state) {\n var d = 'disabled'\n var $el = this.$element\n var val = $el.is('input') ? 'val' : 'html'\n var data = $el.data()\n\n state += 'Text'\n\n if (data.resetText == null) $el.data('resetText', $el[val]())\n\n // push to event loop to allow forms to submit\n setTimeout($.proxy(function () {\n $el[val](data[state] == null ? this.options[state] : data[state])\n\n if (state == 'loadingText') {\n this.isLoading = true\n $el.addClass(d).attr(d, d).prop(d, true)\n } else if (this.isLoading) {\n this.isLoading = false\n $el.removeClass(d).removeAttr(d).prop(d, false)\n }\n }, this), 0)\n }\n\n Button.prototype.toggle = function () {\n var changed = true\n var $parent = this.$element.closest('[data-toggle=\"buttons\"]')\n\n if ($parent.length) {\n var $input = this.$element.find('input')\n if ($input.prop('type') == 'radio') {\n if ($input.prop('checked')) changed = false\n $parent.find('.active').removeClass('active')\n this.$element.addClass('active')\n } else if ($input.prop('type') == 'checkbox') {\n if (($input.prop('checked')) !== this.$element.hasClass('active')) changed = false\n this.$element.toggleClass('active')\n }\n $input.prop('checked', this.$element.hasClass('active'))\n if (changed) $input.trigger('change')\n } else {\n this.$element.attr('aria-pressed', !this.$element.hasClass('active'))\n this.$element.toggleClass('active')\n }\n }\n\n\n // BUTTON PLUGIN DEFINITION\n // ========================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.button')\n var options = typeof option == 'object' && option\n\n if (!data) $this.data('bs.button', (data = new Button(this, options)))\n\n if (option == 'toggle') data.toggle()\n else if (option) data.setState(option)\n })\n }\n\n var old = $.fn.button\n\n $.fn.button = Plugin\n $.fn.button.Constructor = Button\n\n\n // BUTTON NO CONFLICT\n // ==================\n\n $.fn.button.noConflict = function () {\n $.fn.button = old\n return this\n }\n\n\n // BUTTON DATA-API\n // ===============\n\n $(document)\n .on('click.bs.button.data-api', '[data-toggle^=\"button\"]', function (e) {\n var $btn = $(e.target).closest('.btn')\n Plugin.call($btn, 'toggle')\n if (!($(e.target).is('input[type=\"radio\"], input[type=\"checkbox\"]'))) {\n // Prevent double click on radios, and the double selections (so cancellation) on checkboxes\n e.preventDefault()\n // The target component still receive the focus\n if ($btn.is('input,button')) $btn.trigger('focus')\n else $btn.find('input:visible,button:visible').first().trigger('focus')\n }\n })\n .on('focus.bs.button.data-api blur.bs.button.data-api', '[data-toggle^=\"button\"]', function (e) {\n $(e.target).closest('.btn').toggleClass('focus', /^focus(in)?$/.test(e.type))\n })\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/button.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/carousel.js":
/*!***********************************************!*\
!*** ./node_modules/bootstrap/js/carousel.js ***!
\***********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: carousel.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#carousel\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // CAROUSEL CLASS DEFINITION\n // =========================\n\n var Carousel = function (element, options) {\n this.$element = $(element)\n this.$indicators = this.$element.find('.carousel-indicators')\n this.options = options\n this.paused = null\n this.sliding = null\n this.interval = null\n this.$active = null\n this.$items = null\n\n this.options.keyboard && this.$element.on('keydown.bs.carousel', $.proxy(this.keydown, this))\n\n this.options.pause == 'hover' && !('ontouchstart' in document.documentElement) && this.$element\n .on('mouseenter.bs.carousel', $.proxy(this.pause, this))\n .on('mouseleave.bs.carousel', $.proxy(this.cycle, this))\n }\n\n Carousel.VERSION = '3.4.1'\n\n Carousel.TRANSITION_DURATION = 600\n\n Carousel.DEFAULTS = {\n interval: 5000,\n pause: 'hover',\n wrap: true,\n keyboard: true\n }\n\n Carousel.prototype.keydown = function (e) {\n if (/input|textarea/i.test(e.target.tagName)) return\n switch (e.which) {\n case 37: this.prev(); break\n case 39: this.next(); break\n default: return\n }\n\n e.preventDefault()\n }\n\n Carousel.prototype.cycle = function (e) {\n e || (this.paused = false)\n\n this.interval && clearInterval(this.interval)\n\n this.options.interval\n && !this.paused\n && (this.interval = setInterval($.proxy(this.next, this), this.options.interval))\n\n return this\n }\n\n Carousel.prototype.getItemIndex = function (item) {\n this.$items = item.parent().children('.item')\n return this.$items.index(item || this.$active)\n }\n\n Carousel.prototype.getItemForDirection = function (direction, active) {\n var activeIndex = this.getItemIndex(active)\n var willWrap = (direction == 'prev' && activeIndex === 0)\n || (direction == 'next' && activeIndex == (this.$items.length - 1))\n if (willWrap && !this.options.wrap) return active\n var delta = direction == 'prev' ? -1 : 1\n var itemIndex = (activeIndex + delta) % this.$items.length\n return this.$items.eq(itemIndex)\n }\n\n Carousel.prototype.to = function (pos) {\n var that = this\n var activeIndex = this.getItemIndex(this.$active = this.$element.find('.item.active'))\n\n if (pos > (this.$items.length - 1) || pos < 0) return\n\n if (this.sliding) return this.$element.one('slid.bs.carousel', function () { that.to(pos) }) // yes, \"slid\"\n if (activeIndex == pos) return this.pause().cycle()\n\n return this.slide(pos > activeIndex ? 'next' : 'prev', this.$items.eq(pos))\n }\n\n Carousel.prototype.pause = function (e) {\n e || (this.paused = true)\n\n if (this.$element.find('.next, .prev').length && $.support.transition) {\n this.$element.trigger($.support.transition.end)\n this.cycle(true)\n }\n\n this.interval = clearInterval(this.interval)\n\n return this\n }\n\n Carousel.prototype.next = function () {\n if (this.sliding) return\n return this.slide('next')\n }\n\n Carousel.prototype.prev = function () {\n if (this.sliding) return\n return this.slide('prev')\n }\n\n Carousel.prototype.slide = function (type, next) {\n var $active = this.$element.find('.item.active')\n var $next = next || this.getItemForDirection(type, $active)\n var isCycling = this.interval\n var direction = type == 'next' ? 'left' : 'right'\n var that = this\n\n if ($next.hasClass('active')) return (this.sliding = false)\n\n var relatedTarget = $next[0]\n var slideEvent = $.Event('slide.bs.carousel', {\n relatedTarget: relatedTarget,\n direction: direction\n })\n this.$element.trigger(slideEvent)\n if (slideEvent.isDefaultPrevented()) return\n\n this.sliding = true\n\n isCycling && this.pause()\n\n if (this.$indicators.length) {\n this.$indicators.find('.active').removeClass('active')\n var $nextIndicator = $(this.$indicators.children()[this.getItemIndex($next)])\n $nextIndicator && $nextIndicator.addClass('active')\n }\n\n var slidEvent = $.Event('slid.bs.carousel', { relatedTarget: relatedTarget, direction: direction }) // yes, \"slid\"\n if ($.support.transition && this.$element.hasClass('slide')) {\n $next.addClass(type)\n if (typeof $next === 'object' && $next.length) {\n $next[0].offsetWidth // force reflow\n }\n $active.addClass(direction)\n $next.addClass(direction)\n $active\n .one('bsTransitionEnd', function () {\n $next.removeClass([type, direction].join(' ')).addClass('active')\n $active.removeClass(['active', direction].join(' '))\n that.sliding = false\n setTimeout(function () {\n that.$element.trigger(slidEvent)\n }, 0)\n })\n .emulateTransitionEnd(Carousel.TRANSITION_DURATION)\n } else {\n $active.removeClass('active')\n $next.addClass('active')\n this.sliding = false\n this.$element.trigger(slidEvent)\n }\n\n isCycling && this.cycle()\n\n return this\n }\n\n\n // CAROUSEL PLUGIN DEFINITION\n // ==========================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.carousel')\n var options = $.extend({}, Carousel.DEFAULTS, $this.data(), typeof option == 'object' && option)\n var action = typeof option == 'string' ? option : options.slide\n\n if (!data) $this.data('bs.carousel', (data = new Carousel(this, options)))\n if (typeof option == 'number') data.to(option)\n else if (action) data[action]()\n else if (options.interval) data.pause().cycle()\n })\n }\n\n var old = $.fn.carousel\n\n $.fn.carousel = Plugin\n $.fn.carousel.Constructor = Carousel\n\n\n // CAROUSEL NO CONFLICT\n // ====================\n\n $.fn.carousel.noConflict = function () {\n $.fn.carousel = old\n return this\n }\n\n\n // CAROUSEL DATA-API\n // =================\n\n var clickHandler = function (e) {\n var $this = $(this)\n var href = $this.attr('href')\n if (href) {\n href = href.replace(/.*(?=#[^\\s]+$)/, '') // strip for ie7\n }\n\n var target = $this.attr('data-target') || href\n var $target = $(document).find(target)\n\n if (!$target.hasClass('carousel')) return\n\n var options = $.extend({}, $target.data(), $this.data())\n var slideIndex = $this.attr('data-slide-to')\n if (slideIndex) options.interval = false\n\n Plugin.call($target, options)\n\n if (slideIndex) {\n $target.data('bs.carousel').to(slideIndex)\n }\n\n e.preventDefault()\n }\n\n $(document)\n .on('click.bs.carousel.data-api', '[data-slide]', clickHandler)\n .on('click.bs.carousel.data-api', '[data-slide-to]', clickHandler)\n\n $(window).on('load', function () {\n $('[data-ride=\"carousel\"]').each(function () {\n var $carousel = $(this)\n Plugin.call($carousel, $carousel.data())\n })\n })\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/carousel.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/collapse.js":
/*!***********************************************!*\
!*** ./node_modules/bootstrap/js/collapse.js ***!
\***********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: collapse.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#collapse\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n/* jshint latedef: false */\n\n+function ($) {\n 'use strict';\n\n // COLLAPSE PUBLIC CLASS DEFINITION\n // ================================\n\n var Collapse = function (element, options) {\n this.$element = $(element)\n this.options = $.extend({}, Collapse.DEFAULTS, options)\n this.$trigger = $('[data-toggle=\"collapse\"][href=\"#' + element.id + '\"],' +\n '[data-toggle=\"collapse\"][data-target=\"#' + element.id + '\"]')\n this.transitioning = null\n\n if (this.options.parent) {\n this.$parent = this.getParent()\n } else {\n this.addAriaAndCollapsedClass(this.$element, this.$trigger)\n }\n\n if (this.options.toggle) this.toggle()\n }\n\n Collapse.VERSION = '3.4.1'\n\n Collapse.TRANSITION_DURATION = 350\n\n Collapse.DEFAULTS = {\n toggle: true\n }\n\n Collapse.prototype.dimension = function () {\n var hasWidth = this.$element.hasClass('width')\n return hasWidth ? 'width' : 'height'\n }\n\n Collapse.prototype.show = function () {\n if (this.transitioning || this.$element.hasClass('in')) return\n\n var activesData\n var actives = this.$parent && this.$parent.children('.panel').children('.in, .collapsing')\n\n if (actives && actives.length) {\n activesData = actives.data('bs.collapse')\n if (activesData && activesData.transitioning) return\n }\n\n var startEvent = $.Event('show.bs.collapse')\n this.$element.trigger(startEvent)\n if (startEvent.isDefaultPrevented()) return\n\n if (actives && actives.length) {\n Plugin.call(actives, 'hide')\n activesData || actives.data('bs.collapse', null)\n }\n\n var dimension = this.dimension()\n\n this.$element\n .removeClass('collapse')\n .addClass('collapsing')[dimension](0)\n .attr('aria-expanded', true)\n\n this.$trigger\n .removeClass('collapsed')\n .attr('aria-expanded', true)\n\n this.transitioning = 1\n\n var complete = function () {\n this.$element\n .removeClass('collapsing')\n .addClass('collapse in')[dimension]('')\n this.transitioning = 0\n this.$element\n .trigger('shown.bs.collapse')\n }\n\n if (!$.support.transition) return complete.call(this)\n\n var scrollSize = $.camelCase(['scroll', dimension].join('-'))\n\n this.$element\n .one('bsTransitionEnd', $.proxy(complete, this))\n .emulateTransitionEnd(Collapse.TRANSITION_DURATION)[dimension](this.$element[0][scrollSize])\n }\n\n Collapse.prototype.hide = function () {\n if (this.transitioning || !this.$element.hasClass('in')) return\n\n var startEvent = $.Event('hide.bs.collapse')\n this.$element.trigger(startEvent)\n if (startEvent.isDefaultPrevented()) return\n\n var dimension = this.dimension()\n\n this.$element[dimension](this.$element[dimension]())[0].offsetHeight\n\n this.$element\n .addClass('collapsing')\n .removeClass('collapse in')\n .attr('aria-expanded', false)\n\n this.$trigger\n .addClass('collapsed')\n .attr('aria-expanded', false)\n\n this.transitioning = 1\n\n var complete = function () {\n this.transitioning = 0\n this.$element\n .removeClass('collapsing')\n .addClass('collapse')\n .trigger('hidden.bs.collapse')\n }\n\n if (!$.support.transition) return complete.call(this)\n\n this.$element\n [dimension](0)\n .one('bsTransitionEnd', $.proxy(complete, this))\n .emulateTransitionEnd(Collapse.TRANSITION_DURATION)\n }\n\n Collapse.prototype.toggle = function () {\n this[this.$element.hasClass('in') ? 'hide' : 'show']()\n }\n\n Collapse.prototype.getParent = function () {\n return $(document).find(this.options.parent)\n .find('[data-toggle=\"collapse\"][data-parent=\"' + this.options.parent + '\"]')\n .each($.proxy(function (i, element) {\n var $element = $(element)\n this.addAriaAndCollapsedClass(getTargetFromTrigger($element), $element)\n }, this))\n .end()\n }\n\n Collapse.prototype.addAriaAndCollapsedClass = function ($element, $trigger) {\n var isOpen = $element.hasClass('in')\n\n $element.attr('aria-expanded', isOpen)\n $trigger\n .toggleClass('collapsed', !isOpen)\n .attr('aria-expanded', isOpen)\n }\n\n function getTargetFromTrigger($trigger) {\n var href\n var target = $trigger.attr('data-target')\n || (href = $trigger.attr('href')) && href.replace(/.*(?=#[^\\s]+$)/, '') // strip for ie7\n\n return $(document).find(target)\n }\n\n\n // COLLAPSE PLUGIN DEFINITION\n // ==========================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.collapse')\n var options = $.extend({}, Collapse.DEFAULTS, $this.data(), typeof option == 'object' && option)\n\n if (!data && options.toggle && /show|hide/.test(option)) options.toggle = false\n if (!data) $this.data('bs.collapse', (data = new Collapse(this, options)))\n if (typeof option == 'string') data[option]()\n })\n }\n\n var old = $.fn.collapse\n\n $.fn.collapse = Plugin\n $.fn.collapse.Constructor = Collapse\n\n\n // COLLAPSE NO CONFLICT\n // ====================\n\n $.fn.collapse.noConflict = function () {\n $.fn.collapse = old\n return this\n }\n\n\n // COLLAPSE DATA-API\n // =================\n\n $(document).on('click.bs.collapse.data-api', '[data-toggle=\"collapse\"]', function (e) {\n var $this = $(this)\n\n if (!$this.attr('data-target')) e.preventDefault()\n\n var $target = getTargetFromTrigger($this)\n var data = $target.data('bs.collapse')\n var option = data ? 'toggle' : $this.data()\n\n Plugin.call($target, option)\n })\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/collapse.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/dropdown.js":
/*!***********************************************!*\
!*** ./node_modules/bootstrap/js/dropdown.js ***!
\***********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: dropdown.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#dropdowns\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // DROPDOWN CLASS DEFINITION\n // =========================\n\n var backdrop = '.dropdown-backdrop'\n var toggle = '[data-toggle=\"dropdown\"]'\n var Dropdown = function (element) {\n $(element).on('click.bs.dropdown', this.toggle)\n }\n\n Dropdown.VERSION = '3.4.1'\n\n function getParent($this) {\n var selector = $this.attr('data-target')\n\n if (!selector) {\n selector = $this.attr('href')\n selector = selector && /#[A-Za-z]/.test(selector) && selector.replace(/.*(?=#[^\\s]*$)/, '') // strip for ie7\n }\n\n var $parent = selector !== '#' ? $(document).find(selector) : null\n\n return $parent && $parent.length ? $parent : $this.parent()\n }\n\n function clearMenus(e) {\n if (e && e.which === 3) return\n $(backdrop).remove()\n $(toggle).each(function () {\n var $this = $(this)\n var $parent = getParent($this)\n var relatedTarget = { relatedTarget: this }\n\n if (!$parent.hasClass('open')) return\n\n if (e && e.type == 'click' && /input|textarea/i.test(e.target.tagName) && $.contains($parent[0], e.target)) return\n\n $parent.trigger(e = $.Event('hide.bs.dropdown', relatedTarget))\n\n if (e.isDefaultPrevented()) return\n\n $this.attr('aria-expanded', 'false')\n $parent.removeClass('open').trigger($.Event('hidden.bs.dropdown', relatedTarget))\n })\n }\n\n Dropdown.prototype.toggle = function (e) {\n var $this = $(this)\n\n if ($this.is('.disabled, :disabled')) return\n\n var $parent = getParent($this)\n var isActive = $parent.hasClass('open')\n\n clearMenus()\n\n if (!isActive) {\n if ('ontouchstart' in document.documentElement && !$parent.closest('.navbar-nav').length) {\n // if mobile we use a backdrop because click events don't delegate\n $(document.createElement('div'))\n .addClass('dropdown-backdrop')\n .insertAfter($(this))\n .on('click', clearMenus)\n }\n\n var relatedTarget = { relatedTarget: this }\n $parent.trigger(e = $.Event('show.bs.dropdown', relatedTarget))\n\n if (e.isDefaultPrevented()) return\n\n $this\n .trigger('focus')\n .attr('aria-expanded', 'true')\n\n $parent\n .toggleClass('open')\n .trigger($.Event('shown.bs.dropdown', relatedTarget))\n }\n\n return false\n }\n\n Dropdown.prototype.keydown = function (e) {\n if (!/(38|40|27|32)/.test(e.which) || /input|textarea/i.test(e.target.tagName)) return\n\n var $this = $(this)\n\n e.preventDefault()\n e.stopPropagation()\n\n if ($this.is('.disabled, :disabled')) return\n\n var $parent = getParent($this)\n var isActive = $parent.hasClass('open')\n\n if (!isActive && e.which != 27 || isActive && e.which == 27) {\n if (e.which == 27) $parent.find(toggle).trigger('focus')\n return $this.trigger('click')\n }\n\n var desc = ' li:not(.disabled):visible a'\n var $items = $parent.find('.dropdown-menu' + desc)\n\n if (!$items.length) return\n\n var index = $items.index(e.target)\n\n if (e.which == 38 && index > 0) index-- // up\n if (e.which == 40 && index < $items.length - 1) index++ // down\n if (!~index) index = 0\n\n $items.eq(index).trigger('focus')\n }\n\n\n // DROPDOWN PLUGIN DEFINITION\n // ==========================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.dropdown')\n\n if (!data) $this.data('bs.dropdown', (data = new Dropdown(this)))\n if (typeof option == 'string') data[option].call($this)\n })\n }\n\n var old = $.fn.dropdown\n\n $.fn.dropdown = Plugin\n $.fn.dropdown.Constructor = Dropdown\n\n\n // DROPDOWN NO CONFLICT\n // ====================\n\n $.fn.dropdown.noConflict = function () {\n $.fn.dropdown = old\n return this\n }\n\n\n // APPLY TO STANDARD DROPDOWN ELEMENTS\n // ===================================\n\n $(document)\n .on('click.bs.dropdown.data-api', clearMenus)\n .on('click.bs.dropdown.data-api', '.dropdown form', function (e) { e.stopPropagation() })\n .on('click.bs.dropdown.data-api', toggle, Dropdown.prototype.toggle)\n .on('keydown.bs.dropdown.data-api', toggle, Dropdown.prototype.keydown)\n .on('keydown.bs.dropdown.data-api', '.dropdown-menu', Dropdown.prototype.keydown)\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/dropdown.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/modal.js":
/*!********************************************!*\
!*** ./node_modules/bootstrap/js/modal.js ***!
\********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: modal.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#modals\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // MODAL CLASS DEFINITION\n // ======================\n\n var Modal = function (element, options) {\n this.options = options\n this.$body = $(document.body)\n this.$element = $(element)\n this.$dialog = this.$element.find('.modal-dialog')\n this.$backdrop = null\n this.isShown = null\n this.originalBodyPad = null\n this.scrollbarWidth = 0\n this.ignoreBackdropClick = false\n this.fixedContent = '.navbar-fixed-top, .navbar-fixed-bottom'\n\n if (this.options.remote) {\n this.$element\n .find('.modal-content')\n .load(this.options.remote, $.proxy(function () {\n this.$element.trigger('loaded.bs.modal')\n }, this))\n }\n }\n\n Modal.VERSION = '3.4.1'\n\n Modal.TRANSITION_DURATION = 300\n Modal.BACKDROP_TRANSITION_DURATION = 150\n\n Modal.DEFAULTS = {\n backdrop: true,\n keyboard: true,\n show: true\n }\n\n Modal.prototype.toggle = function (_relatedTarget) {\n return this.isShown ? this.hide() : this.show(_relatedTarget)\n }\n\n Modal.prototype.show = function (_relatedTarget) {\n var that = this\n var e = $.Event('show.bs.modal', { relatedTarget: _relatedTarget })\n\n this.$element.trigger(e)\n\n if (this.isShown || e.isDefaultPrevented()) return\n\n this.isShown = true\n\n this.checkScrollbar()\n this.setScrollbar()\n this.$body.addClass('modal-open')\n\n this.escape()\n this.resize()\n\n this.$element.on('click.dismiss.bs.modal', '[data-dismiss=\"modal\"]', $.proxy(this.hide, this))\n\n this.$dialog.on('mousedown.dismiss.bs.modal', function () {\n that.$element.one('mouseup.dismiss.bs.modal', function (e) {\n if ($(e.target).is(that.$element)) that.ignoreBackdropClick = true\n })\n })\n\n this.backdrop(function () {\n var transition = $.support.transition && that.$element.hasClass('fade')\n\n if (!that.$element.parent().length) {\n that.$element.appendTo(that.$body) // don't move modals dom position\n }\n\n that.$element\n .show()\n .scrollTop(0)\n\n that.adjustDialog()\n\n if (transition) {\n that.$element[0].offsetWidth // force reflow\n }\n\n that.$element.addClass('in')\n\n that.enforceFocus()\n\n var e = $.Event('shown.bs.modal', { relatedTarget: _relatedTarget })\n\n transition ?\n that.$dialog // wait for modal to slide in\n .one('bsTransitionEnd', function () {\n that.$element.trigger('focus').trigger(e)\n })\n .emulateTransitionEnd(Modal.TRANSITION_DURATION) :\n that.$element.trigger('focus').trigger(e)\n })\n }\n\n Modal.prototype.hide = function (e) {\n if (e) e.preventDefault()\n\n e = $.Event('hide.bs.modal')\n\n this.$element.trigger(e)\n\n if (!this.isShown || e.isDefaultPrevented()) return\n\n this.isShown = false\n\n this.escape()\n this.resize()\n\n $(document).off('focusin.bs.modal')\n\n this.$element\n .removeClass('in')\n .off('click.dismiss.bs.modal')\n .off('mouseup.dismiss.bs.modal')\n\n this.$dialog.off('mousedown.dismiss.bs.modal')\n\n $.support.transition && this.$element.hasClass('fade') ?\n this.$element\n .one('bsTransitionEnd', $.proxy(this.hideModal, this))\n .emulateTransitionEnd(Modal.TRANSITION_DURATION) :\n this.hideModal()\n }\n\n Modal.prototype.enforceFocus = function () {\n $(document)\n .off('focusin.bs.modal') // guard against infinite focus loop\n .on('focusin.bs.modal', $.proxy(function (e) {\n if (document !== e.target &&\n this.$element[0] !== e.target &&\n !this.$element.has(e.target).length) {\n this.$element.trigger('focus')\n }\n }, this))\n }\n\n Modal.prototype.escape = function () {\n if (this.isShown && this.options.keyboard) {\n this.$element.on('keydown.dismiss.bs.modal', $.proxy(function (e) {\n e.which == 27 && this.hide()\n }, this))\n } else if (!this.isShown) {\n this.$element.off('keydown.dismiss.bs.modal')\n }\n }\n\n Modal.prototype.resize = function () {\n if (this.isShown) {\n $(window).on('resize.bs.modal', $.proxy(this.handleUpdate, this))\n } else {\n $(window).off('resize.bs.modal')\n }\n }\n\n Modal.prototype.hideModal = function () {\n var that = this\n this.$element.hide()\n this.backdrop(function () {\n that.$body.removeClass('modal-open')\n that.resetAdjustments()\n that.resetScrollbar()\n that.$element.trigger('hidden.bs.modal')\n })\n }\n\n Modal.prototype.removeBackdrop = function () {\n this.$backdrop && this.$backdrop.remove()\n this.$backdrop = null\n }\n\n Modal.prototype.backdrop = function (callback) {\n var that = this\n var animate = this.$element.hasClass('fade') ? 'fade' : ''\n\n if (this.isShown && this.options.backdrop) {\n var doAnimate = $.support.transition && animate\n\n this.$backdrop = $(document.createElement('div'))\n .addClass('modal-backdrop ' + animate)\n .appendTo(this.$body)\n\n this.$element.on('click.dismiss.bs.modal', $.proxy(function (e) {\n if (this.ignoreBackdropClick) {\n this.ignoreBackdropClick = false\n return\n }\n if (e.target !== e.currentTarget) return\n this.options.backdrop == 'static'\n ? this.$element[0].focus()\n : this.hide()\n }, this))\n\n if (doAnimate) this.$backdrop[0].offsetWidth // force reflow\n\n this.$backdrop.addClass('in')\n\n if (!callback) return\n\n doAnimate ?\n this.$backdrop\n .one('bsTransitionEnd', callback)\n .emulateTransitionEnd(Modal.BACKDROP_TRANSITION_DURATION) :\n callback()\n\n } else if (!this.isShown && this.$backdrop) {\n this.$backdrop.removeClass('in')\n\n var callbackRemove = function () {\n that.removeBackdrop()\n callback && callback()\n }\n $.support.transition && this.$element.hasClass('fade') ?\n this.$backdrop\n .one('bsTransitionEnd', callbackRemove)\n .emulateTransitionEnd(Modal.BACKDROP_TRANSITION_DURATION) :\n callbackRemove()\n\n } else if (callback) {\n callback()\n }\n }\n\n // these following methods are used to handle overflowing modals\n\n Modal.prototype.handleUpdate = function () {\n this.adjustDialog()\n }\n\n Modal.prototype.adjustDialog = function () {\n var modalIsOverflowing = this.$element[0].scrollHeight > document.documentElement.clientHeight\n\n this.$element.css({\n paddingLeft: !this.bodyIsOverflowing && modalIsOverflowing ? this.scrollbarWidth : '',\n paddingRight: this.bodyIsOverflowing && !modalIsOverflowing ? this.scrollbarWidth : ''\n })\n }\n\n Modal.prototype.resetAdjustments = function () {\n this.$element.css({\n paddingLeft: '',\n paddingRight: ''\n })\n }\n\n Modal.prototype.checkScrollbar = function () {\n var fullWindowWidth = window.innerWidth\n if (!fullWindowWidth) { // workaround for missing window.innerWidth in IE8\n var documentElementRect = document.documentElement.getBoundingClientRect()\n fullWindowWidth = documentElementRect.right - Math.abs(documentElementRect.left)\n }\n this.bodyIsOverflowing = document.body.clientWidth < fullWindowWidth\n this.scrollbarWidth = this.measureScrollbar()\n }\n\n Modal.prototype.setScrollbar = function () {\n var bodyPad = parseInt((this.$body.css('padding-right') || 0), 10)\n this.originalBodyPad = document.body.style.paddingRight || ''\n var scrollbarWidth = this.scrollbarWidth\n if (this.bodyIsOverflowing) {\n this.$body.css('padding-right', bodyPad + scrollbarWidth)\n $(this.fixedContent).each(function (index, element) {\n var actualPadding = element.style.paddingRight\n var calculatedPadding = $(element).css('padding-right')\n $(element)\n .data('padding-right', actualPadding)\n .css('padding-right', parseFloat(calculatedPadding) + scrollbarWidth + 'px')\n })\n }\n }\n\n Modal.prototype.resetScrollbar = function () {\n this.$body.css('padding-right', this.originalBodyPad)\n $(this.fixedContent).each(function (index, element) {\n var padding = $(element).data('padding-right')\n $(element).removeData('padding-right')\n element.style.paddingRight = padding ? padding : ''\n })\n }\n\n Modal.prototype.measureScrollbar = function () { // thx walsh\n var scrollDiv = document.createElement('div')\n scrollDiv.className = 'modal-scrollbar-measure'\n this.$body.append(scrollDiv)\n var scrollbarWidth = scrollDiv.offsetWidth - scrollDiv.clientWidth\n this.$body[0].removeChild(scrollDiv)\n return scrollbarWidth\n }\n\n\n // MODAL PLUGIN DEFINITION\n // =======================\n\n function Plugin(option, _relatedTarget) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.modal')\n var options = $.extend({}, Modal.DEFAULTS, $this.data(), typeof option == 'object' && option)\n\n if (!data) $this.data('bs.modal', (data = new Modal(this, options)))\n if (typeof option == 'string') data[option](_relatedTarget)\n else if (options.show) data.show(_relatedTarget)\n })\n }\n\n var old = $.fn.modal\n\n $.fn.modal = Plugin\n $.fn.modal.Constructor = Modal\n\n\n // MODAL NO CONFLICT\n // =================\n\n $.fn.modal.noConflict = function () {\n $.fn.modal = old\n return this\n }\n\n\n // MODAL DATA-API\n // ==============\n\n $(document).on('click.bs.modal.data-api', '[data-toggle=\"modal\"]', function (e) {\n var $this = $(this)\n var href = $this.attr('href')\n var target = $this.attr('data-target') ||\n (href && href.replace(/.*(?=#[^\\s]+$)/, '')) // strip for ie7\n\n var $target = $(document).find(target)\n var option = $target.data('bs.modal') ? 'toggle' : $.extend({ remote: !/#/.test(href) && href }, $target.data(), $this.data())\n\n if ($this.is('a')) e.preventDefault()\n\n $target.one('show.bs.modal', function (showEvent) {\n if (showEvent.isDefaultPrevented()) return // only register focus restorer if modal will actually get shown\n $target.one('hidden.bs.modal', function () {\n $this.is(':visible') && $this.trigger('focus')\n })\n })\n Plugin.call($target, option, this)\n })\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/modal.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/popover.js":
/*!**********************************************!*\
!*** ./node_modules/bootstrap/js/popover.js ***!
\**********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: popover.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#popovers\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // POPOVER PUBLIC CLASS DEFINITION\n // ===============================\n\n var Popover = function (element, options) {\n this.init('popover', element, options)\n }\n\n if (!$.fn.tooltip) throw new Error('Popover requires tooltip.js')\n\n Popover.VERSION = '3.4.1'\n\n Popover.DEFAULTS = $.extend({}, $.fn.tooltip.Constructor.DEFAULTS, {\n placement: 'right',\n trigger: 'click',\n content: '',\n template: ''\n })\n\n\n // NOTE: POPOVER EXTENDS tooltip.js\n // ================================\n\n Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype)\n\n Popover.prototype.constructor = Popover\n\n Popover.prototype.getDefaults = function () {\n return Popover.DEFAULTS\n }\n\n Popover.prototype.setContent = function () {\n var $tip = this.tip()\n var title = this.getTitle()\n var content = this.getContent()\n\n if (this.options.html) {\n var typeContent = typeof content\n\n if (this.options.sanitize) {\n title = this.sanitizeHtml(title)\n\n if (typeContent === 'string') {\n content = this.sanitizeHtml(content)\n }\n }\n\n $tip.find('.popover-title').html(title)\n $tip.find('.popover-content').children().detach().end()[\n typeContent === 'string' ? 'html' : 'append'\n ](content)\n } else {\n $tip.find('.popover-title').text(title)\n $tip.find('.popover-content').children().detach().end().text(content)\n }\n\n $tip.removeClass('fade top bottom left right in')\n\n // IE8 doesn't accept hiding via the `:empty` pseudo selector, we have to do\n // this manually by checking the contents.\n if (!$tip.find('.popover-title').html()) $tip.find('.popover-title').hide()\n }\n\n Popover.prototype.hasContent = function () {\n return this.getTitle() || this.getContent()\n }\n\n Popover.prototype.getContent = function () {\n var $e = this.$element\n var o = this.options\n\n return $e.attr('data-content')\n || (typeof o.content == 'function' ?\n o.content.call($e[0]) :\n o.content)\n }\n\n Popover.prototype.arrow = function () {\n return (this.$arrow = this.$arrow || this.tip().find('.arrow'))\n }\n\n\n // POPOVER PLUGIN DEFINITION\n // =========================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.popover')\n var options = typeof option == 'object' && option\n\n if (!data && /destroy|hide/.test(option)) return\n if (!data) $this.data('bs.popover', (data = new Popover(this, options)))\n if (typeof option == 'string') data[option]()\n })\n }\n\n var old = $.fn.popover\n\n $.fn.popover = Plugin\n $.fn.popover.Constructor = Popover\n\n\n // POPOVER NO CONFLICT\n // ===================\n\n $.fn.popover.noConflict = function () {\n $.fn.popover = old\n return this\n }\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/popover.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/scrollspy.js":
/*!************************************************!*\
!*** ./node_modules/bootstrap/js/scrollspy.js ***!
\************************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: scrollspy.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#scrollspy\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // SCROLLSPY CLASS DEFINITION\n // ==========================\n\n function ScrollSpy(element, options) {\n this.$body = $(document.body)\n this.$scrollElement = $(element).is(document.body) ? $(window) : $(element)\n this.options = $.extend({}, ScrollSpy.DEFAULTS, options)\n this.selector = (this.options.target || '') + ' .nav li > a'\n this.offsets = []\n this.targets = []\n this.activeTarget = null\n this.scrollHeight = 0\n\n this.$scrollElement.on('scroll.bs.scrollspy', $.proxy(this.process, this))\n this.refresh()\n this.process()\n }\n\n ScrollSpy.VERSION = '3.4.1'\n\n ScrollSpy.DEFAULTS = {\n offset: 10\n }\n\n ScrollSpy.prototype.getScrollHeight = function () {\n return this.$scrollElement[0].scrollHeight || Math.max(this.$body[0].scrollHeight, document.documentElement.scrollHeight)\n }\n\n ScrollSpy.prototype.refresh = function () {\n var that = this\n var offsetMethod = 'offset'\n var offsetBase = 0\n\n this.offsets = []\n this.targets = []\n this.scrollHeight = this.getScrollHeight()\n\n if (!$.isWindow(this.$scrollElement[0])) {\n offsetMethod = 'position'\n offsetBase = this.$scrollElement.scrollTop()\n }\n\n this.$body\n .find(this.selector)\n .map(function () {\n var $el = $(this)\n var href = $el.data('target') || $el.attr('href')\n var $href = /^#./.test(href) && $(href)\n\n return ($href\n && $href.length\n && $href.is(':visible')\n && [[$href[offsetMethod]().top + offsetBase, href]]) || null\n })\n .sort(function (a, b) { return a[0] - b[0] })\n .each(function () {\n that.offsets.push(this[0])\n that.targets.push(this[1])\n })\n }\n\n ScrollSpy.prototype.process = function () {\n var scrollTop = this.$scrollElement.scrollTop() + this.options.offset\n var scrollHeight = this.getScrollHeight()\n var maxScroll = this.options.offset + scrollHeight - this.$scrollElement.height()\n var offsets = this.offsets\n var targets = this.targets\n var activeTarget = this.activeTarget\n var i\n\n if (this.scrollHeight != scrollHeight) {\n this.refresh()\n }\n\n if (scrollTop >= maxScroll) {\n return activeTarget != (i = targets[targets.length - 1]) && this.activate(i)\n }\n\n if (activeTarget && scrollTop < offsets[0]) {\n this.activeTarget = null\n return this.clear()\n }\n\n for (i = offsets.length; i--;) {\n activeTarget != targets[i]\n && scrollTop >= offsets[i]\n && (offsets[i + 1] === undefined || scrollTop < offsets[i + 1])\n && this.activate(targets[i])\n }\n }\n\n ScrollSpy.prototype.activate = function (target) {\n this.activeTarget = target\n\n this.clear()\n\n var selector = this.selector +\n '[data-target=\"' + target + '\"],' +\n this.selector + '[href=\"' + target + '\"]'\n\n var active = $(selector)\n .parents('li')\n .addClass('active')\n\n if (active.parent('.dropdown-menu').length) {\n active = active\n .closest('li.dropdown')\n .addClass('active')\n }\n\n active.trigger('activate.bs.scrollspy')\n }\n\n ScrollSpy.prototype.clear = function () {\n $(this.selector)\n .parentsUntil(this.options.target, '.active')\n .removeClass('active')\n }\n\n\n // SCROLLSPY PLUGIN DEFINITION\n // ===========================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.scrollspy')\n var options = typeof option == 'object' && option\n\n if (!data) $this.data('bs.scrollspy', (data = new ScrollSpy(this, options)))\n if (typeof option == 'string') data[option]()\n })\n }\n\n var old = $.fn.scrollspy\n\n $.fn.scrollspy = Plugin\n $.fn.scrollspy.Constructor = ScrollSpy\n\n\n // SCROLLSPY NO CONFLICT\n // =====================\n\n $.fn.scrollspy.noConflict = function () {\n $.fn.scrollspy = old\n return this\n }\n\n\n // SCROLLSPY DATA-API\n // ==================\n\n $(window).on('load.bs.scrollspy.data-api', function () {\n $('[data-spy=\"scroll\"]').each(function () {\n var $spy = $(this)\n Plugin.call($spy, $spy.data())\n })\n })\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/scrollspy.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/tab.js":
/*!******************************************!*\
!*** ./node_modules/bootstrap/js/tab.js ***!
\******************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: tab.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#tabs\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // TAB CLASS DEFINITION\n // ====================\n\n var Tab = function (element) {\n // jscs:disable requireDollarBeforejQueryAssignment\n this.element = $(element)\n // jscs:enable requireDollarBeforejQueryAssignment\n }\n\n Tab.VERSION = '3.4.1'\n\n Tab.TRANSITION_DURATION = 150\n\n Tab.prototype.show = function () {\n var $this = this.element\n var $ul = $this.closest('ul:not(.dropdown-menu)')\n var selector = $this.data('target')\n\n if (!selector) {\n selector = $this.attr('href')\n selector = selector && selector.replace(/.*(?=#[^\\s]*$)/, '') // strip for ie7\n }\n\n if ($this.parent('li').hasClass('active')) return\n\n var $previous = $ul.find('.active:last a')\n var hideEvent = $.Event('hide.bs.tab', {\n relatedTarget: $this[0]\n })\n var showEvent = $.Event('show.bs.tab', {\n relatedTarget: $previous[0]\n })\n\n $previous.trigger(hideEvent)\n $this.trigger(showEvent)\n\n if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) return\n\n var $target = $(document).find(selector)\n\n this.activate($this.closest('li'), $ul)\n this.activate($target, $target.parent(), function () {\n $previous.trigger({\n type: 'hidden.bs.tab',\n relatedTarget: $this[0]\n })\n $this.trigger({\n type: 'shown.bs.tab',\n relatedTarget: $previous[0]\n })\n })\n }\n\n Tab.prototype.activate = function (element, container, callback) {\n var $active = container.find('> .active')\n var transition = callback\n && $.support.transition\n && ($active.length && $active.hasClass('fade') || !!container.find('> .fade').length)\n\n function next() {\n $active\n .removeClass('active')\n .find('> .dropdown-menu > .active')\n .removeClass('active')\n .end()\n .find('[data-toggle=\"tab\"]')\n .attr('aria-expanded', false)\n\n element\n .addClass('active')\n .find('[data-toggle=\"tab\"]')\n .attr('aria-expanded', true)\n\n if (transition) {\n element[0].offsetWidth // reflow for transition\n element.addClass('in')\n } else {\n element.removeClass('fade')\n }\n\n if (element.parent('.dropdown-menu').length) {\n element\n .closest('li.dropdown')\n .addClass('active')\n .end()\n .find('[data-toggle=\"tab\"]')\n .attr('aria-expanded', true)\n }\n\n callback && callback()\n }\n\n $active.length && transition ?\n $active\n .one('bsTransitionEnd', next)\n .emulateTransitionEnd(Tab.TRANSITION_DURATION) :\n next()\n\n $active.removeClass('in')\n }\n\n\n // TAB PLUGIN DEFINITION\n // =====================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.tab')\n\n if (!data) $this.data('bs.tab', (data = new Tab(this)))\n if (typeof option == 'string') data[option]()\n })\n }\n\n var old = $.fn.tab\n\n $.fn.tab = Plugin\n $.fn.tab.Constructor = Tab\n\n\n // TAB NO CONFLICT\n // ===============\n\n $.fn.tab.noConflict = function () {\n $.fn.tab = old\n return this\n }\n\n\n // TAB DATA-API\n // ============\n\n var clickHandler = function (e) {\n e.preventDefault()\n Plugin.call($(this), 'show')\n }\n\n $(document)\n .on('click.bs.tab.data-api', '[data-toggle=\"tab\"]', clickHandler)\n .on('click.bs.tab.data-api', '[data-toggle=\"pill\"]', clickHandler)\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/tab.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/tooltip.js":
/*!**********************************************!*\
!*** ./node_modules/bootstrap/js/tooltip.js ***!
\**********************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: tooltip.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#tooltip\n * Inspired by the original jQuery.tipsy by Jason Frame\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n+function ($) {\n 'use strict';\n\n var DISALLOWED_ATTRIBUTES = ['sanitize', 'whiteList', 'sanitizeFn']\n\n var uriAttrs = [\n 'background',\n 'cite',\n 'href',\n 'itemtype',\n 'longdesc',\n 'poster',\n 'src',\n 'xlink:href'\n ]\n\n var ARIA_ATTRIBUTE_PATTERN = /^aria-[\\w-]*$/i\n\n var DefaultWhitelist = {\n // Global attributes allowed on any supplied element below.\n '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],\n a: ['target', 'href', 'title', 'rel'],\n area: [],\n b: [],\n br: [],\n col: [],\n code: [],\n div: [],\n em: [],\n hr: [],\n h1: [],\n h2: [],\n h3: [],\n h4: [],\n h5: [],\n h6: [],\n i: [],\n img: ['src', 'alt', 'title', 'width', 'height'],\n li: [],\n ol: [],\n p: [],\n pre: [],\n s: [],\n small: [],\n span: [],\n sub: [],\n sup: [],\n strong: [],\n u: [],\n ul: []\n }\n\n /**\n * A pattern that recognizes a commonly useful subset of URLs that are safe.\n *\n * Shoutout to Angular 7 https://github.com/angular/angular/blob/7.2.4/packages/core/src/sanitization/url_sanitizer.ts\n */\n var SAFE_URL_PATTERN = /^(?:(?:https?|mailto|ftp|tel|file):|[^&:/?#]*(?:[/?#]|$))/gi\n\n /**\n * A pattern that matches safe data URLs. Only matches image, video and audio types.\n *\n * Shoutout to Angular 7 https://github.com/angular/angular/blob/7.2.4/packages/core/src/sanitization/url_sanitizer.ts\n */\n var DATA_URL_PATTERN = /^data:(?:image\\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\\/(?:mpeg|mp4|ogg|webm)|audio\\/(?:mp3|oga|ogg|opus));base64,[a-z0-9+/]+=*$/i\n\n function allowedAttribute(attr, allowedAttributeList) {\n var attrName = attr.nodeName.toLowerCase()\n\n if ($.inArray(attrName, allowedAttributeList) !== -1) {\n if ($.inArray(attrName, uriAttrs) !== -1) {\n return Boolean(attr.nodeValue.match(SAFE_URL_PATTERN) || attr.nodeValue.match(DATA_URL_PATTERN))\n }\n\n return true\n }\n\n var regExp = $(allowedAttributeList).filter(function (index, value) {\n return value instanceof RegExp\n })\n\n // Check if a regular expression validates the attribute.\n for (var i = 0, l = regExp.length; i < l; i++) {\n if (attrName.match(regExp[i])) {\n return true\n }\n }\n\n return false\n }\n\n function sanitizeHtml(unsafeHtml, whiteList, sanitizeFn) {\n if (unsafeHtml.length === 0) {\n return unsafeHtml\n }\n\n if (sanitizeFn && typeof sanitizeFn === 'function') {\n return sanitizeFn(unsafeHtml)\n }\n\n // IE 8 and below don't support createHTMLDocument\n if (!document.implementation || !document.implementation.createHTMLDocument) {\n return unsafeHtml\n }\n\n var createdDocument = document.implementation.createHTMLDocument('sanitization')\n createdDocument.body.innerHTML = unsafeHtml\n\n var whitelistKeys = $.map(whiteList, function (el, i) { return i })\n var elements = $(createdDocument.body).find('*')\n\n for (var i = 0, len = elements.length; i < len; i++) {\n var el = elements[i]\n var elName = el.nodeName.toLowerCase()\n\n if ($.inArray(elName, whitelistKeys) === -1) {\n el.parentNode.removeChild(el)\n\n continue\n }\n\n var attributeList = $.map(el.attributes, function (el) { return el })\n var whitelistedAttributes = [].concat(whiteList['*'] || [], whiteList[elName] || [])\n\n for (var j = 0, len2 = attributeList.length; j < len2; j++) {\n if (!allowedAttribute(attributeList[j], whitelistedAttributes)) {\n el.removeAttribute(attributeList[j].nodeName)\n }\n }\n }\n\n return createdDocument.body.innerHTML\n }\n\n // TOOLTIP PUBLIC CLASS DEFINITION\n // ===============================\n\n var Tooltip = function (element, options) {\n this.type = null\n this.options = null\n this.enabled = null\n this.timeout = null\n this.hoverState = null\n this.$element = null\n this.inState = null\n\n this.init('tooltip', element, options)\n }\n\n Tooltip.VERSION = '3.4.1'\n\n Tooltip.TRANSITION_DURATION = 150\n\n Tooltip.DEFAULTS = {\n animation: true,\n placement: 'top',\n selector: false,\n template: '',\n trigger: 'hover focus',\n title: '',\n delay: 0,\n html: false,\n container: false,\n viewport: {\n selector: 'body',\n padding: 0\n },\n sanitize : true,\n sanitizeFn : null,\n whiteList : DefaultWhitelist\n }\n\n Tooltip.prototype.init = function (type, element, options) {\n this.enabled = true\n this.type = type\n this.$element = $(element)\n this.options = this.getOptions(options)\n this.$viewport = this.options.viewport && $(document).find($.isFunction(this.options.viewport) ? this.options.viewport.call(this, this.$element) : (this.options.viewport.selector || this.options.viewport))\n this.inState = { click: false, hover: false, focus: false }\n\n if (this.$element[0] instanceof document.constructor && !this.options.selector) {\n throw new Error('`selector` option must be specified when initializing ' + this.type + ' on the window.document object!')\n }\n\n var triggers = this.options.trigger.split(' ')\n\n for (var i = triggers.length; i--;) {\n var trigger = triggers[i]\n\n if (trigger == 'click') {\n this.$element.on('click.' + this.type, this.options.selector, $.proxy(this.toggle, this))\n } else if (trigger != 'manual') {\n var eventIn = trigger == 'hover' ? 'mouseenter' : 'focusin'\n var eventOut = trigger == 'hover' ? 'mouseleave' : 'focusout'\n\n this.$element.on(eventIn + '.' + this.type, this.options.selector, $.proxy(this.enter, this))\n this.$element.on(eventOut + '.' + this.type, this.options.selector, $.proxy(this.leave, this))\n }\n }\n\n this.options.selector ?\n (this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) :\n this.fixTitle()\n }\n\n Tooltip.prototype.getDefaults = function () {\n return Tooltip.DEFAULTS\n }\n\n Tooltip.prototype.getOptions = function (options) {\n var dataAttributes = this.$element.data()\n\n for (var dataAttr in dataAttributes) {\n if (dataAttributes.hasOwnProperty(dataAttr) && $.inArray(dataAttr, DISALLOWED_ATTRIBUTES) !== -1) {\n delete dataAttributes[dataAttr]\n }\n }\n\n options = $.extend({}, this.getDefaults(), dataAttributes, options)\n\n if (options.delay && typeof options.delay == 'number') {\n options.delay = {\n show: options.delay,\n hide: options.delay\n }\n }\n\n if (options.sanitize) {\n options.template = sanitizeHtml(options.template, options.whiteList, options.sanitizeFn)\n }\n\n return options\n }\n\n Tooltip.prototype.getDelegateOptions = function () {\n var options = {}\n var defaults = this.getDefaults()\n\n this._options && $.each(this._options, function (key, value) {\n if (defaults[key] != value) options[key] = value\n })\n\n return options\n }\n\n Tooltip.prototype.enter = function (obj) {\n var self = obj instanceof this.constructor ?\n obj : $(obj.currentTarget).data('bs.' + this.type)\n\n if (!self) {\n self = new this.constructor(obj.currentTarget, this.getDelegateOptions())\n $(obj.currentTarget).data('bs.' + this.type, self)\n }\n\n if (obj instanceof $.Event) {\n self.inState[obj.type == 'focusin' ? 'focus' : 'hover'] = true\n }\n\n if (self.tip().hasClass('in') || self.hoverState == 'in') {\n self.hoverState = 'in'\n return\n }\n\n clearTimeout(self.timeout)\n\n self.hoverState = 'in'\n\n if (!self.options.delay || !self.options.delay.show) return self.show()\n\n self.timeout = setTimeout(function () {\n if (self.hoverState == 'in') self.show()\n }, self.options.delay.show)\n }\n\n Tooltip.prototype.isInStateTrue = function () {\n for (var key in this.inState) {\n if (this.inState[key]) return true\n }\n\n return false\n }\n\n Tooltip.prototype.leave = function (obj) {\n var self = obj instanceof this.constructor ?\n obj : $(obj.currentTarget).data('bs.' + this.type)\n\n if (!self) {\n self = new this.constructor(obj.currentTarget, this.getDelegateOptions())\n $(obj.currentTarget).data('bs.' + this.type, self)\n }\n\n if (obj instanceof $.Event) {\n self.inState[obj.type == 'focusout' ? 'focus' : 'hover'] = false\n }\n\n if (self.isInStateTrue()) return\n\n clearTimeout(self.timeout)\n\n self.hoverState = 'out'\n\n if (!self.options.delay || !self.options.delay.hide) return self.hide()\n\n self.timeout = setTimeout(function () {\n if (self.hoverState == 'out') self.hide()\n }, self.options.delay.hide)\n }\n\n Tooltip.prototype.show = function () {\n var e = $.Event('show.bs.' + this.type)\n\n if (this.hasContent() && this.enabled) {\n this.$element.trigger(e)\n\n var inDom = $.contains(this.$element[0].ownerDocument.documentElement, this.$element[0])\n if (e.isDefaultPrevented() || !inDom) return\n var that = this\n\n var $tip = this.tip()\n\n var tipId = this.getUID(this.type)\n\n this.setContent()\n $tip.attr('id', tipId)\n this.$element.attr('aria-describedby', tipId)\n\n if (this.options.animation) $tip.addClass('fade')\n\n var placement = typeof this.options.placement == 'function' ?\n this.options.placement.call(this, $tip[0], this.$element[0]) :\n this.options.placement\n\n var autoToken = /\\s?auto?\\s?/i\n var autoPlace = autoToken.test(placement)\n if (autoPlace) placement = placement.replace(autoToken, '') || 'top'\n\n $tip\n .detach()\n .css({ top: 0, left: 0, display: 'block' })\n .addClass(placement)\n .data('bs.' + this.type, this)\n\n this.options.container ? $tip.appendTo($(document).find(this.options.container)) : $tip.insertAfter(this.$element)\n this.$element.trigger('inserted.bs.' + this.type)\n\n var pos = this.getPosition()\n var actualWidth = $tip[0].offsetWidth\n var actualHeight = $tip[0].offsetHeight\n\n if (autoPlace) {\n var orgPlacement = placement\n var viewportDim = this.getPosition(this.$viewport)\n\n placement = placement == 'bottom' && pos.bottom + actualHeight > viewportDim.bottom ? 'top' :\n placement == 'top' && pos.top - actualHeight < viewportDim.top ? 'bottom' :\n placement == 'right' && pos.right + actualWidth > viewportDim.width ? 'left' :\n placement == 'left' && pos.left - actualWidth < viewportDim.left ? 'right' :\n placement\n\n $tip\n .removeClass(orgPlacement)\n .addClass(placement)\n }\n\n var calculatedOffset = this.getCalculatedOffset(placement, pos, actualWidth, actualHeight)\n\n this.applyPlacement(calculatedOffset, placement)\n\n var complete = function () {\n var prevHoverState = that.hoverState\n that.$element.trigger('shown.bs.' + that.type)\n that.hoverState = null\n\n if (prevHoverState == 'out') that.leave(that)\n }\n\n $.support.transition && this.$tip.hasClass('fade') ?\n $tip\n .one('bsTransitionEnd', complete)\n .emulateTransitionEnd(Tooltip.TRANSITION_DURATION) :\n complete()\n }\n }\n\n Tooltip.prototype.applyPlacement = function (offset, placement) {\n var $tip = this.tip()\n var width = $tip[0].offsetWidth\n var height = $tip[0].offsetHeight\n\n // manually read margins because getBoundingClientRect includes difference\n var marginTop = parseInt($tip.css('margin-top'), 10)\n var marginLeft = parseInt($tip.css('margin-left'), 10)\n\n // we must check for NaN for ie 8/9\n if (isNaN(marginTop)) marginTop = 0\n if (isNaN(marginLeft)) marginLeft = 0\n\n offset.top += marginTop\n offset.left += marginLeft\n\n // $.fn.offset doesn't round pixel values\n // so we use setOffset directly with our own function B-0\n $.offset.setOffset($tip[0], $.extend({\n using: function (props) {\n $tip.css({\n top: Math.round(props.top),\n left: Math.round(props.left)\n })\n }\n }, offset), 0)\n\n $tip.addClass('in')\n\n // check to see if placing tip in new offset caused the tip to resize itself\n var actualWidth = $tip[0].offsetWidth\n var actualHeight = $tip[0].offsetHeight\n\n if (placement == 'top' && actualHeight != height) {\n offset.top = offset.top + height - actualHeight\n }\n\n var delta = this.getViewportAdjustedDelta(placement, offset, actualWidth, actualHeight)\n\n if (delta.left) offset.left += delta.left\n else offset.top += delta.top\n\n var isVertical = /top|bottom/.test(placement)\n var arrowDelta = isVertical ? delta.left * 2 - width + actualWidth : delta.top * 2 - height + actualHeight\n var arrowOffsetPosition = isVertical ? 'offsetWidth' : 'offsetHeight'\n\n $tip.offset(offset)\n this.replaceArrow(arrowDelta, $tip[0][arrowOffsetPosition], isVertical)\n }\n\n Tooltip.prototype.replaceArrow = function (delta, dimension, isVertical) {\n this.arrow()\n .css(isVertical ? 'left' : 'top', 50 * (1 - delta / dimension) + '%')\n .css(isVertical ? 'top' : 'left', '')\n }\n\n Tooltip.prototype.setContent = function () {\n var $tip = this.tip()\n var title = this.getTitle()\n\n if (this.options.html) {\n if (this.options.sanitize) {\n title = sanitizeHtml(title, this.options.whiteList, this.options.sanitizeFn)\n }\n\n $tip.find('.tooltip-inner').html(title)\n } else {\n $tip.find('.tooltip-inner').text(title)\n }\n\n $tip.removeClass('fade in top bottom left right')\n }\n\n Tooltip.prototype.hide = function (callback) {\n var that = this\n var $tip = $(this.$tip)\n var e = $.Event('hide.bs.' + this.type)\n\n function complete() {\n if (that.hoverState != 'in') $tip.detach()\n if (that.$element) { // TODO: Check whether guarding this code with this `if` is really necessary.\n that.$element\n .removeAttr('aria-describedby')\n .trigger('hidden.bs.' + that.type)\n }\n callback && callback()\n }\n\n this.$element.trigger(e)\n\n if (e.isDefaultPrevented()) return\n\n $tip.removeClass('in')\n\n $.support.transition && $tip.hasClass('fade') ?\n $tip\n .one('bsTransitionEnd', complete)\n .emulateTransitionEnd(Tooltip.TRANSITION_DURATION) :\n complete()\n\n this.hoverState = null\n\n return this\n }\n\n Tooltip.prototype.fixTitle = function () {\n var $e = this.$element\n if ($e.attr('title') || typeof $e.attr('data-original-title') != 'string') {\n $e.attr('data-original-title', $e.attr('title') || '').attr('title', '')\n }\n }\n\n Tooltip.prototype.hasContent = function () {\n return this.getTitle()\n }\n\n Tooltip.prototype.getPosition = function ($element) {\n $element = $element || this.$element\n\n var el = $element[0]\n var isBody = el.tagName == 'BODY'\n\n var elRect = el.getBoundingClientRect()\n if (elRect.width == null) {\n // width and height are missing in IE8, so compute them manually; see https://github.com/twbs/bootstrap/issues/14093\n elRect = $.extend({}, elRect, { width: elRect.right - elRect.left, height: elRect.bottom - elRect.top })\n }\n var isSvg = window.SVGElement && el instanceof window.SVGElement\n // Avoid using $.offset() on SVGs since it gives incorrect results in jQuery 3.\n // See https://github.com/twbs/bootstrap/issues/20280\n var elOffset = isBody ? { top: 0, left: 0 } : (isSvg ? null : $element.offset())\n var scroll = { scroll: isBody ? document.documentElement.scrollTop || document.body.scrollTop : $element.scrollTop() }\n var outerDims = isBody ? { width: $(window).width(), height: $(window).height() } : null\n\n return $.extend({}, elRect, scroll, outerDims, elOffset)\n }\n\n Tooltip.prototype.getCalculatedOffset = function (placement, pos, actualWidth, actualHeight) {\n return placement == 'bottom' ? { top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2 } :\n placement == 'top' ? { top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2 } :\n placement == 'left' ? { top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth } :\n /* placement == 'right' */ { top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width }\n\n }\n\n Tooltip.prototype.getViewportAdjustedDelta = function (placement, pos, actualWidth, actualHeight) {\n var delta = { top: 0, left: 0 }\n if (!this.$viewport) return delta\n\n var viewportPadding = this.options.viewport && this.options.viewport.padding || 0\n var viewportDimensions = this.getPosition(this.$viewport)\n\n if (/right|left/.test(placement)) {\n var topEdgeOffset = pos.top - viewportPadding - viewportDimensions.scroll\n var bottomEdgeOffset = pos.top + viewportPadding - viewportDimensions.scroll + actualHeight\n if (topEdgeOffset < viewportDimensions.top) { // top overflow\n delta.top = viewportDimensions.top - topEdgeOffset\n } else if (bottomEdgeOffset > viewportDimensions.top + viewportDimensions.height) { // bottom overflow\n delta.top = viewportDimensions.top + viewportDimensions.height - bottomEdgeOffset\n }\n } else {\n var leftEdgeOffset = pos.left - viewportPadding\n var rightEdgeOffset = pos.left + viewportPadding + actualWidth\n if (leftEdgeOffset < viewportDimensions.left) { // left overflow\n delta.left = viewportDimensions.left - leftEdgeOffset\n } else if (rightEdgeOffset > viewportDimensions.right) { // right overflow\n delta.left = viewportDimensions.left + viewportDimensions.width - rightEdgeOffset\n }\n }\n\n return delta\n }\n\n Tooltip.prototype.getTitle = function () {\n var title\n var $e = this.$element\n var o = this.options\n\n title = $e.attr('data-original-title')\n || (typeof o.title == 'function' ? o.title.call($e[0]) : o.title)\n\n return title\n }\n\n Tooltip.prototype.getUID = function (prefix) {\n do prefix += ~~(Math.random() * 1000000)\n while (document.getElementById(prefix))\n return prefix\n }\n\n Tooltip.prototype.tip = function () {\n if (!this.$tip) {\n this.$tip = $(this.options.template)\n if (this.$tip.length != 1) {\n throw new Error(this.type + ' `template` option must consist of exactly 1 top-level element!')\n }\n }\n return this.$tip\n }\n\n Tooltip.prototype.arrow = function () {\n return (this.$arrow = this.$arrow || this.tip().find('.tooltip-arrow'))\n }\n\n Tooltip.prototype.enable = function () {\n this.enabled = true\n }\n\n Tooltip.prototype.disable = function () {\n this.enabled = false\n }\n\n Tooltip.prototype.toggleEnabled = function () {\n this.enabled = !this.enabled\n }\n\n Tooltip.prototype.toggle = function (e) {\n var self = this\n if (e) {\n self = $(e.currentTarget).data('bs.' + this.type)\n if (!self) {\n self = new this.constructor(e.currentTarget, this.getDelegateOptions())\n $(e.currentTarget).data('bs.' + this.type, self)\n }\n }\n\n if (e) {\n self.inState.click = !self.inState.click\n if (self.isInStateTrue()) self.enter(self)\n else self.leave(self)\n } else {\n self.tip().hasClass('in') ? self.leave(self) : self.enter(self)\n }\n }\n\n Tooltip.prototype.destroy = function () {\n var that = this\n clearTimeout(this.timeout)\n this.hide(function () {\n that.$element.off('.' + that.type).removeData('bs.' + that.type)\n if (that.$tip) {\n that.$tip.detach()\n }\n that.$tip = null\n that.$arrow = null\n that.$viewport = null\n that.$element = null\n })\n }\n\n Tooltip.prototype.sanitizeHtml = function (unsafeHtml) {\n return sanitizeHtml(unsafeHtml, this.options.whiteList, this.options.sanitizeFn)\n }\n\n // TOOLTIP PLUGIN DEFINITION\n // =========================\n\n function Plugin(option) {\n return this.each(function () {\n var $this = $(this)\n var data = $this.data('bs.tooltip')\n var options = typeof option == 'object' && option\n\n if (!data && /destroy|hide/.test(option)) return\n if (!data) $this.data('bs.tooltip', (data = new Tooltip(this, options)))\n if (typeof option == 'string') data[option]()\n })\n }\n\n var old = $.fn.tooltip\n\n $.fn.tooltip = Plugin\n $.fn.tooltip.Constructor = Tooltip\n\n\n // TOOLTIP NO CONFLICT\n // ===================\n\n $.fn.tooltip.noConflict = function () {\n $.fn.tooltip = old\n return this\n }\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/tooltip.js?");
/***/ }),
/***/ "./node_modules/bootstrap/js/transition.js":
/*!*************************************************!*\
!*** ./node_modules/bootstrap/js/transition.js ***!
\*************************************************/
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
eval("/* provided dependency */ var jQuery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\");\n/* ========================================================================\n * Bootstrap: transition.js v3.4.1\n * https://getbootstrap.com/docs/3.4/javascript/#transitions\n * ========================================================================\n * Copyright 2011-2019 Twitter, Inc.\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n * ======================================================================== */\n\n\n+function ($) {\n 'use strict';\n\n // CSS TRANSITION SUPPORT (Shoutout: https://modernizr.com/)\n // ============================================================\n\n function transitionEnd() {\n var el = document.createElement('bootstrap')\n\n var transEndEventNames = {\n WebkitTransition : 'webkitTransitionEnd',\n MozTransition : 'transitionend',\n OTransition : 'oTransitionEnd otransitionend',\n transition : 'transitionend'\n }\n\n for (var name in transEndEventNames) {\n if (el.style[name] !== undefined) {\n return { end: transEndEventNames[name] }\n }\n }\n\n return false // explicit for ie8 ( ._.)\n }\n\n // https://blog.alexmaccaw.com/css-transitions\n $.fn.emulateTransitionEnd = function (duration) {\n var called = false\n var $el = this\n $(this).one('bsTransitionEnd', function () { called = true })\n var callback = function () { if (!called) $($el).trigger($.support.transition.end) }\n setTimeout(callback, duration)\n return this\n }\n\n $(function () {\n $.support.transition = transitionEnd()\n\n if (!$.support.transition) return\n\n $.event.special.bsTransitionEnd = {\n bindType: $.support.transition.end,\n delegateType: $.support.transition.end,\n handle: function (e) {\n if ($(e.target).is(this)) return e.handleObj.handler.apply(this, arguments)\n }\n }\n })\n\n}(jQuery);\n\n\n//# sourceURL=webpack://SequenceServer/./node_modules/bootstrap/js/transition.js?");
/***/ }),
/***/ "./node_modules/d3/d3.js":
/*!*******************************!*\
!*** ./node_modules/d3/d3.js ***!
\*******************************/
/***/ ((module, exports, __webpack_require__) => {
eval("var __WEBPACK_AMD_DEFINE_FACTORY__, __WEBPACK_AMD_DEFINE_RESULT__;!function() {\n var d3 = {\n version: \"3.5.17\"\n };\n var d3_arraySlice = [].slice, d3_array = function(list) {\n return d3_arraySlice.call(list);\n };\n var d3_document = this.document;\n function d3_documentElement(node) {\n return node && (node.ownerDocument || node.document || node).documentElement;\n }\n function d3_window(node) {\n return node && (node.ownerDocument && node.ownerDocument.defaultView || node.document && node || node.defaultView);\n }\n if (d3_document) {\n try {\n d3_array(d3_document.documentElement.childNodes)[0].nodeType;\n } catch (e) {\n d3_array = function(list) {\n var i = list.length, array = new Array(i);\n while (i--) array[i] = list[i];\n return array;\n };\n }\n }\n if (!Date.now) Date.now = function() {\n return +new Date();\n };\n if (d3_document) {\n try {\n d3_document.createElement(\"DIV\").style.setProperty(\"opacity\", 0, \"\");\n } catch (error) {\n var d3_element_prototype = this.Element.prototype, d3_element_setAttribute = d3_element_prototype.setAttribute, d3_element_setAttributeNS = d3_element_prototype.setAttributeNS, d3_style_prototype = this.CSSStyleDeclaration.prototype, d3_style_setProperty = d3_style_prototype.setProperty;\n d3_element_prototype.setAttribute = function(name, value) {\n d3_element_setAttribute.call(this, name, value + \"\");\n };\n d3_element_prototype.setAttributeNS = function(space, local, value) {\n d3_element_setAttributeNS.call(this, space, local, value + \"\");\n };\n d3_style_prototype.setProperty = function(name, value, priority) {\n d3_style_setProperty.call(this, name, value + \"\", priority);\n };\n }\n }\n d3.ascending = d3_ascending;\n function d3_ascending(a, b) {\n return a < b ? -1 : a > b ? 1 : a >= b ? 0 : NaN;\n }\n d3.descending = function(a, b) {\n return b < a ? -1 : b > a ? 1 : b >= a ? 0 : NaN;\n };\n d3.min = function(array, f) {\n var i = -1, n = array.length, a, b;\n if (arguments.length === 1) {\n while (++i < n) if ((b = array[i]) != null && b >= b) {\n a = b;\n break;\n }\n while (++i < n) if ((b = array[i]) != null && a > b) a = b;\n } else {\n while (++i < n) if ((b = f.call(array, array[i], i)) != null && b >= b) {\n a = b;\n break;\n }\n while (++i < n) if ((b = f.call(array, array[i], i)) != null && a > b) a = b;\n }\n return a;\n };\n d3.max = function(array, f) {\n var i = -1, n = array.length, a, b;\n if (arguments.length === 1) {\n while (++i < n) if ((b = array[i]) != null && b >= b) {\n a = b;\n break;\n }\n while (++i < n) if ((b = array[i]) != null && b > a) a = b;\n } else {\n while (++i < n) if ((b = f.call(array, array[i], i)) != null && b >= b) {\n a = b;\n break;\n }\n while (++i < n) if ((b = f.call(array, array[i], i)) != null && b > a) a = b;\n }\n return a;\n };\n d3.extent = function(array, f) {\n var i = -1, n = array.length, a, b, c;\n if (arguments.length === 1) {\n while (++i < n) if ((b = array[i]) != null && b >= b) {\n a = c = b;\n break;\n }\n while (++i < n) if ((b = array[i]) != null) {\n if (a > b) a = b;\n if (c < b) c = b;\n }\n } else {\n while (++i < n) if ((b = f.call(array, array[i], i)) != null && b >= b) {\n a = c = b;\n break;\n }\n while (++i < n) if ((b = f.call(array, array[i], i)) != null) {\n if (a > b) a = b;\n if (c < b) c = b;\n }\n }\n return [ a, c ];\n };\n function d3_number(x) {\n return x === null ? NaN : +x;\n }\n function d3_numeric(x) {\n return !isNaN(x);\n }\n d3.sum = function(array, f) {\n var s = 0, n = array.length, a, i = -1;\n if (arguments.length === 1) {\n while (++i < n) if (d3_numeric(a = +array[i])) s += a;\n } else {\n while (++i < n) if (d3_numeric(a = +f.call(array, array[i], i))) s += a;\n }\n return s;\n };\n d3.mean = function(array, f) {\n var s = 0, n = array.length, a, i = -1, j = n;\n if (arguments.length === 1) {\n while (++i < n) if (d3_numeric(a = d3_number(array[i]))) s += a; else --j;\n } else {\n while (++i < n) if (d3_numeric(a = d3_number(f.call(array, array[i], i)))) s += a; else --j;\n }\n if (j) return s / j;\n };\n d3.quantile = function(values, p) {\n var H = (values.length - 1) * p + 1, h = Math.floor(H), v = +values[h - 1], e = H - h;\n return e ? v + e * (values[h] - v) : v;\n };\n d3.median = function(array, f) {\n var numbers = [], n = array.length, a, i = -1;\n if (arguments.length === 1) {\n while (++i < n) if (d3_numeric(a = d3_number(array[i]))) numbers.push(a);\n } else {\n while (++i < n) if (d3_numeric(a = d3_number(f.call(array, array[i], i)))) numbers.push(a);\n }\n if (numbers.length) return d3.quantile(numbers.sort(d3_ascending), .5);\n };\n d3.variance = function(array, f) {\n var n = array.length, m = 0, a, d, s = 0, i = -1, j = 0;\n if (arguments.length === 1) {\n while (++i < n) {\n if (d3_numeric(a = d3_number(array[i]))) {\n d = a - m;\n m += d / ++j;\n s += d * (a - m);\n }\n }\n } else {\n while (++i < n) {\n if (d3_numeric(a = d3_number(f.call(array, array[i], i)))) {\n d = a - m;\n m += d / ++j;\n s += d * (a - m);\n }\n }\n }\n if (j > 1) return s / (j - 1);\n };\n d3.deviation = function() {\n var v = d3.variance.apply(this, arguments);\n return v ? Math.sqrt(v) : v;\n };\n function d3_bisector(compare) {\n return {\n left: function(a, x, lo, hi) {\n if (arguments.length < 3) lo = 0;\n if (arguments.length < 4) hi = a.length;\n while (lo < hi) {\n var mid = lo + hi >>> 1;\n if (compare(a[mid], x) < 0) lo = mid + 1; else hi = mid;\n }\n return lo;\n },\n right: function(a, x, lo, hi) {\n if (arguments.length < 3) lo = 0;\n if (arguments.length < 4) hi = a.length;\n while (lo < hi) {\n var mid = lo + hi >>> 1;\n if (compare(a[mid], x) > 0) hi = mid; else lo = mid + 1;\n }\n return lo;\n }\n };\n }\n var d3_bisect = d3_bisector(d3_ascending);\n d3.bisectLeft = d3_bisect.left;\n d3.bisect = d3.bisectRight = d3_bisect.right;\n d3.bisector = function(f) {\n return d3_bisector(f.length === 1 ? function(d, x) {\n return d3_ascending(f(d), x);\n } : f);\n };\n d3.shuffle = function(array, i0, i1) {\n if ((m = arguments.length) < 3) {\n i1 = array.length;\n if (m < 2) i0 = 0;\n }\n var m = i1 - i0, t, i;\n while (m) {\n i = Math.random() * m-- | 0;\n t = array[m + i0], array[m + i0] = array[i + i0], array[i + i0] = t;\n }\n return array;\n };\n d3.permute = function(array, indexes) {\n var i = indexes.length, permutes = new Array(i);\n while (i--) permutes[i] = array[indexes[i]];\n return permutes;\n };\n d3.pairs = function(array) {\n var i = 0, n = array.length - 1, p0, p1 = array[0], pairs = new Array(n < 0 ? 0 : n);\n while (i < n) pairs[i] = [ p0 = p1, p1 = array[++i] ];\n return pairs;\n };\n d3.transpose = function(matrix) {\n if (!(n = matrix.length)) return [];\n for (var i = -1, m = d3.min(matrix, d3_transposeLength), transpose = new Array(m); ++i < m; ) {\n for (var j = -1, n, row = transpose[i] = new Array(n); ++j < n; ) {\n row[j] = matrix[j][i];\n }\n }\n return transpose;\n };\n function d3_transposeLength(d) {\n return d.length;\n }\n d3.zip = function() {\n return d3.transpose(arguments);\n };\n d3.keys = function(map) {\n var keys = [];\n for (var key in map) keys.push(key);\n return keys;\n };\n d3.values = function(map) {\n var values = [];\n for (var key in map) values.push(map[key]);\n return values;\n };\n d3.entries = function(map) {\n var entries = [];\n for (var key in map) entries.push({\n key: key,\n value: map[key]\n });\n return entries;\n };\n d3.merge = function(arrays) {\n var n = arrays.length, m, i = -1, j = 0, merged, array;\n while (++i < n) j += arrays[i].length;\n merged = new Array(j);\n while (--n >= 0) {\n array = arrays[n];\n m = array.length;\n while (--m >= 0) {\n merged[--j] = array[m];\n }\n }\n return merged;\n };\n var abs = Math.abs;\n d3.range = function(start, stop, step) {\n if (arguments.length < 3) {\n step = 1;\n if (arguments.length < 2) {\n stop = start;\n start = 0;\n }\n }\n if ((stop - start) / step === Infinity) throw new Error(\"infinite range\");\n var range = [], k = d3_range_integerScale(abs(step)), i = -1, j;\n start *= k, stop *= k, step *= k;\n if (step < 0) while ((j = start + step * ++i) > stop) range.push(j / k); else while ((j = start + step * ++i) < stop) range.push(j / k);\n return range;\n };\n function d3_range_integerScale(x) {\n var k = 1;\n while (x * k % 1) k *= 10;\n return k;\n }\n function d3_class(ctor, properties) {\n for (var key in properties) {\n Object.defineProperty(ctor.prototype, key, {\n value: properties[key],\n enumerable: false\n });\n }\n }\n d3.map = function(object, f) {\n var map = new d3_Map();\n if (object instanceof d3_Map) {\n object.forEach(function(key, value) {\n map.set(key, value);\n });\n } else if (Array.isArray(object)) {\n var i = -1, n = object.length, o;\n if (arguments.length === 1) while (++i < n) map.set(i, object[i]); else while (++i < n) map.set(f.call(object, o = object[i], i), o);\n } else {\n for (var key in object) map.set(key, object[key]);\n }\n return map;\n };\n function d3_Map() {\n this._ = Object.create(null);\n }\n var d3_map_proto = \"__proto__\", d3_map_zero = \"\\x00\";\n d3_class(d3_Map, {\n has: d3_map_has,\n get: function(key) {\n return this._[d3_map_escape(key)];\n },\n set: function(key, value) {\n return this._[d3_map_escape(key)] = value;\n },\n remove: d3_map_remove,\n keys: d3_map_keys,\n values: function() {\n var values = [];\n for (var key in this._) values.push(this._[key]);\n return values;\n },\n entries: function() {\n var entries = [];\n for (var key in this._) entries.push({\n key: d3_map_unescape(key),\n value: this._[key]\n });\n return entries;\n },\n size: d3_map_size,\n empty: d3_map_empty,\n forEach: function(f) {\n for (var key in this._) f.call(this, d3_map_unescape(key), this._[key]);\n }\n });\n function d3_map_escape(key) {\n return (key += \"\") === d3_map_proto || key[0] === d3_map_zero ? d3_map_zero + key : key;\n }\n function d3_map_unescape(key) {\n return (key += \"\")[0] === d3_map_zero ? key.slice(1) : key;\n }\n function d3_map_has(key) {\n return d3_map_escape(key) in this._;\n }\n function d3_map_remove(key) {\n return (key = d3_map_escape(key)) in this._ && delete this._[key];\n }\n function d3_map_keys() {\n var keys = [];\n for (var key in this._) keys.push(d3_map_unescape(key));\n return keys;\n }\n function d3_map_size() {\n var size = 0;\n for (var key in this._) ++size;\n return size;\n }\n function d3_map_empty() {\n for (var key in this._) return false;\n return true;\n }\n d3.nest = function() {\n var nest = {}, keys = [], sortKeys = [], sortValues, rollup;\n function map(mapType, array, depth) {\n if (depth >= keys.length) return rollup ? rollup.call(nest, array) : sortValues ? array.sort(sortValues) : array;\n var i = -1, n = array.length, key = keys[depth++], keyValue, object, setter, valuesByKey = new d3_Map(), values;\n while (++i < n) {\n if (values = valuesByKey.get(keyValue = key(object = array[i]))) {\n values.push(object);\n } else {\n valuesByKey.set(keyValue, [ object ]);\n }\n }\n if (mapType) {\n object = mapType();\n setter = function(keyValue, values) {\n object.set(keyValue, map(mapType, values, depth));\n };\n } else {\n object = {};\n setter = function(keyValue, values) {\n object[keyValue] = map(mapType, values, depth);\n };\n }\n valuesByKey.forEach(setter);\n return object;\n }\n function entries(map, depth) {\n if (depth >= keys.length) return map;\n var array = [], sortKey = sortKeys[depth++];\n map.forEach(function(key, keyMap) {\n array.push({\n key: key,\n values: entries(keyMap, depth)\n });\n });\n return sortKey ? array.sort(function(a, b) {\n return sortKey(a.key, b.key);\n }) : array;\n }\n nest.map = function(array, mapType) {\n return map(mapType, array, 0);\n };\n nest.entries = function(array) {\n return entries(map(d3.map, array, 0), 0);\n };\n nest.key = function(d) {\n keys.push(d);\n return nest;\n };\n nest.sortKeys = function(order) {\n sortKeys[keys.length - 1] = order;\n return nest;\n };\n nest.sortValues = function(order) {\n sortValues = order;\n return nest;\n };\n nest.rollup = function(f) {\n rollup = f;\n return nest;\n };\n return nest;\n };\n d3.set = function(array) {\n var set = new d3_Set();\n if (array) for (var i = 0, n = array.length; i < n; ++i) set.add(array[i]);\n return set;\n };\n function d3_Set() {\n this._ = Object.create(null);\n }\n d3_class(d3_Set, {\n has: d3_map_has,\n add: function(key) {\n this._[d3_map_escape(key += \"\")] = true;\n return key;\n },\n remove: d3_map_remove,\n values: d3_map_keys,\n size: d3_map_size,\n empty: d3_map_empty,\n forEach: function(f) {\n for (var key in this._) f.call(this, d3_map_unescape(key));\n }\n });\n d3.behavior = {};\n function d3_identity(d) {\n return d;\n }\n d3.rebind = function(target, source) {\n var i = 1, n = arguments.length, method;\n while (++i < n) target[method = arguments[i]] = d3_rebind(target, source, source[method]);\n return target;\n };\n function d3_rebind(target, source, method) {\n return function() {\n var value = method.apply(source, arguments);\n return value === source ? target : value;\n };\n }\n function d3_vendorSymbol(object, name) {\n if (name in object) return name;\n name = name.charAt(0).toUpperCase() + name.slice(1);\n for (var i = 0, n = d3_vendorPrefixes.length; i < n; ++i) {\n var prefixName = d3_vendorPrefixes[i] + name;\n if (prefixName in object) return prefixName;\n }\n }\n var d3_vendorPrefixes = [ \"webkit\", \"ms\", \"moz\", \"Moz\", \"o\", \"O\" ];\n function d3_noop() {}\n d3.dispatch = function() {\n var dispatch = new d3_dispatch(), i = -1, n = arguments.length;\n while (++i < n) dispatch[arguments[i]] = d3_dispatch_event(dispatch);\n return dispatch;\n };\n function d3_dispatch() {}\n d3_dispatch.prototype.on = function(type, listener) {\n var i = type.indexOf(\".\"), name = \"\";\n if (i >= 0) {\n name = type.slice(i + 1);\n type = type.slice(0, i);\n }\n if (type) return arguments.length < 2 ? this[type].on(name) : this[type].on(name, listener);\n if (arguments.length === 2) {\n if (listener == null) for (type in this) {\n if (this.hasOwnProperty(type)) this[type].on(name, null);\n }\n return this;\n }\n };\n function d3_dispatch_event(dispatch) {\n var listeners = [], listenerByName = new d3_Map();\n function event() {\n var z = listeners, i = -1, n = z.length, l;\n while (++i < n) if (l = z[i].on) l.apply(this, arguments);\n return dispatch;\n }\n event.on = function(name, listener) {\n var l = listenerByName.get(name), i;\n if (arguments.length < 2) return l && l.on;\n if (l) {\n l.on = null;\n listeners = listeners.slice(0, i = listeners.indexOf(l)).concat(listeners.slice(i + 1));\n listenerByName.remove(name);\n }\n if (listener) listeners.push(listenerByName.set(name, {\n on: listener\n }));\n return dispatch;\n };\n return event;\n }\n d3.event = null;\n function d3_eventPreventDefault() {\n d3.event.preventDefault();\n }\n function d3_eventSource() {\n var e = d3.event, s;\n while (s = e.sourceEvent) e = s;\n return e;\n }\n function d3_eventDispatch(target) {\n var dispatch = new d3_dispatch(), i = 0, n = arguments.length;\n while (++i < n) dispatch[arguments[i]] = d3_dispatch_event(dispatch);\n dispatch.of = function(thiz, argumentz) {\n return function(e1) {\n try {\n var e0 = e1.sourceEvent = d3.event;\n e1.target = target;\n d3.event = e1;\n dispatch[e1.type].apply(thiz, argumentz);\n } finally {\n d3.event = e0;\n }\n };\n };\n return dispatch;\n }\n d3.requote = function(s) {\n return s.replace(d3_requote_re, \"\\\\$&\");\n };\n var d3_requote_re = /[\\\\\\^\\$\\*\\+\\?\\|\\[\\]\\(\\)\\.\\{\\}]/g;\n var d3_subclass = {}.__proto__ ? function(object, prototype) {\n object.__proto__ = prototype;\n } : function(object, prototype) {\n for (var property in prototype) object[property] = prototype[property];\n };\n function d3_selection(groups) {\n d3_subclass(groups, d3_selectionPrototype);\n return groups;\n }\n var d3_select = function(s, n) {\n return n.querySelector(s);\n }, d3_selectAll = function(s, n) {\n return n.querySelectorAll(s);\n }, d3_selectMatches = function(n, s) {\n var d3_selectMatcher = n.matches || n[d3_vendorSymbol(n, \"matchesSelector\")];\n d3_selectMatches = function(n, s) {\n return d3_selectMatcher.call(n, s);\n };\n return d3_selectMatches(n, s);\n };\n if (typeof Sizzle === \"function\") {\n d3_select = function(s, n) {\n return Sizzle(s, n)[0] || null;\n };\n d3_selectAll = Sizzle;\n d3_selectMatches = Sizzle.matchesSelector;\n }\n d3.selection = function() {\n return d3.select(d3_document.documentElement);\n };\n var d3_selectionPrototype = d3.selection.prototype = [];\n d3_selectionPrototype.select = function(selector) {\n var subgroups = [], subgroup, subnode, group, node;\n selector = d3_selection_selector(selector);\n for (var j = -1, m = this.length; ++j < m; ) {\n subgroups.push(subgroup = []);\n subgroup.parentNode = (group = this[j]).parentNode;\n for (var i = -1, n = group.length; ++i < n; ) {\n if (node = group[i]) {\n subgroup.push(subnode = selector.call(node, node.__data__, i, j));\n if (subnode && \"__data__\" in node) subnode.__data__ = node.__data__;\n } else {\n subgroup.push(null);\n }\n }\n }\n return d3_selection(subgroups);\n };\n function d3_selection_selector(selector) {\n return typeof selector === \"function\" ? selector : function() {\n return d3_select(selector, this);\n };\n }\n d3_selectionPrototype.selectAll = function(selector) {\n var subgroups = [], subgroup, node;\n selector = d3_selection_selectorAll(selector);\n for (var j = -1, m = this.length; ++j < m; ) {\n for (var group = this[j], i = -1, n = group.length; ++i < n; ) {\n if (node = group[i]) {\n subgroups.push(subgroup = d3_array(selector.call(node, node.__data__, i, j)));\n subgroup.parentNode = node;\n }\n }\n }\n return d3_selection(subgroups);\n };\n function d3_selection_selectorAll(selector) {\n return typeof selector === \"function\" ? selector : function() {\n return d3_selectAll(selector, this);\n };\n }\n var d3_nsXhtml = \"http://www.w3.org/1999/xhtml\";\n var d3_nsPrefix = {\n svg: \"http://www.w3.org/2000/svg\",\n xhtml: d3_nsXhtml,\n xlink: \"http://www.w3.org/1999/xlink\",\n xml: \"http://www.w3.org/XML/1998/namespace\",\n xmlns: \"http://www.w3.org/2000/xmlns/\"\n };\n d3.ns = {\n prefix: d3_nsPrefix,\n qualify: function(name) {\n var i = name.indexOf(\":\"), prefix = name;\n if (i >= 0 && (prefix = name.slice(0, i)) !== \"xmlns\") name = name.slice(i + 1);\n return d3_nsPrefix.hasOwnProperty(prefix) ? {\n space: d3_nsPrefix[prefix],\n local: name\n } : name;\n }\n };\n d3_selectionPrototype.attr = function(name, value) {\n if (arguments.length < 2) {\n if (typeof name === \"string\") {\n var node = this.node();\n name = d3.ns.qualify(name);\n return name.local ? node.getAttributeNS(name.space, name.local) : node.getAttribute(name);\n }\n for (value in name) this.each(d3_selection_attr(value, name[value]));\n return this;\n }\n return this.each(d3_selection_attr(name, value));\n };\n function d3_selection_attr(name, value) {\n name = d3.ns.qualify(name);\n function attrNull() {\n this.removeAttribute(name);\n }\n function attrNullNS() {\n this.removeAttributeNS(name.space, name.local);\n }\n function attrConstant() {\n this.setAttribute(name, value);\n }\n function attrConstantNS() {\n this.setAttributeNS(name.space, name.local, value);\n }\n function attrFunction() {\n var x = value.apply(this, arguments);\n if (x == null) this.removeAttribute(name); else this.setAttribute(name, x);\n }\n function attrFunctionNS() {\n var x = value.apply(this, arguments);\n if (x == null) this.removeAttributeNS(name.space, name.local); else this.setAttributeNS(name.space, name.local, x);\n }\n return value == null ? name.local ? attrNullNS : attrNull : typeof value === \"function\" ? name.local ? attrFunctionNS : attrFunction : name.local ? attrConstantNS : attrConstant;\n }\n function d3_collapse(s) {\n return s.trim().replace(/\\s+/g, \" \");\n }\n d3_selectionPrototype.classed = function(name, value) {\n if (arguments.length < 2) {\n if (typeof name === \"string\") {\n var node = this.node(), n = (name = d3_selection_classes(name)).length, i = -1;\n if (value = node.classList) {\n while (++i < n) if (!value.contains(name[i])) return false;\n } else {\n value = node.getAttribute(\"class\");\n while (++i < n) if (!d3_selection_classedRe(name[i]).test(value)) return false;\n }\n return true;\n }\n for (value in name) this.each(d3_selection_classed(value, name[value]));\n return this;\n }\n return this.each(d3_selection_classed(name, value));\n };\n function d3_selection_classedRe(name) {\n return new RegExp(\"(?:^|\\\\s+)\" + d3.requote(name) + \"(?:\\\\s+|$)\", \"g\");\n }\n function d3_selection_classes(name) {\n return (name + \"\").trim().split(/^|\\s+/);\n }\n function d3_selection_classed(name, value) {\n name = d3_selection_classes(name).map(d3_selection_classedName);\n var n = name.length;\n function classedConstant() {\n var i = -1;\n while (++i < n) name[i](this, value);\n }\n function classedFunction() {\n var i = -1, x = value.apply(this, arguments);\n while (++i < n) name[i](this, x);\n }\n return typeof value === \"function\" ? classedFunction : classedConstant;\n }\n function d3_selection_classedName(name) {\n var re = d3_selection_classedRe(name);\n return function(node, value) {\n if (c = node.classList) return value ? c.add(name) : c.remove(name);\n var c = node.getAttribute(\"class\") || \"\";\n if (value) {\n re.lastIndex = 0;\n if (!re.test(c)) node.setAttribute(\"class\", d3_collapse(c + \" \" + name));\n } else {\n node.setAttribute(\"class\", d3_collapse(c.replace(re, \" \")));\n }\n };\n }\n d3_selectionPrototype.style = function(name, value, priority) {\n var n = arguments.length;\n if (n < 3) {\n if (typeof name !== \"string\") {\n if (n < 2) value = \"\";\n for (priority in name) this.each(d3_selection_style(priority, name[priority], value));\n return this;\n }\n if (n < 2) {\n var node = this.node();\n return d3_window(node).getComputedStyle(node, null).getPropertyValue(name);\n }\n priority = \"\";\n }\n return this.each(d3_selection_style(name, value, priority));\n };\n function d3_selection_style(name, value, priority) {\n function styleNull() {\n this.style.removeProperty(name);\n }\n function styleConstant() {\n this.style.setProperty(name, value, priority);\n }\n function styleFunction() {\n var x = value.apply(this, arguments);\n if (x == null) this.style.removeProperty(name); else this.style.setProperty(name, x, priority);\n }\n return value == null ? styleNull : typeof value === \"function\" ? styleFunction : styleConstant;\n }\n d3_selectionPrototype.property = function(name, value) {\n if (arguments.length < 2) {\n if (typeof name === \"string\") return this.node()[name];\n for (value in name) this.each(d3_selection_property(value, name[value]));\n return this;\n }\n return this.each(d3_selection_property(name, value));\n };\n function d3_selection_property(name, value) {\n function propertyNull() {\n delete this[name];\n }\n function propertyConstant() {\n this[name] = value;\n }\n function propertyFunction() {\n var x = value.apply(this, arguments);\n if (x == null) delete this[name]; else this[name] = x;\n }\n return value == null ? propertyNull : typeof value === \"function\" ? propertyFunction : propertyConstant;\n }\n d3_selectionPrototype.text = function(value) {\n return arguments.length ? this.each(typeof value === \"function\" ? function() {\n var v = value.apply(this, arguments);\n this.textContent = v == null ? \"\" : v;\n } : value == null ? function() {\n this.textContent = \"\";\n } : function() {\n this.textContent = value;\n }) : this.node().textContent;\n };\n d3_selectionPrototype.html = function(value) {\n return arguments.length ? this.each(typeof value === \"function\" ? function() {\n var v = value.apply(this, arguments);\n this.innerHTML = v == null ? \"\" : v;\n } : value == null ? function() {\n this.innerHTML = \"\";\n } : function() {\n this.innerHTML = value;\n }) : this.node().innerHTML;\n };\n d3_selectionPrototype.append = function(name) {\n name = d3_selection_creator(name);\n return this.select(function() {\n return this.appendChild(name.apply(this, arguments));\n });\n };\n function d3_selection_creator(name) {\n function create() {\n var document = this.ownerDocument, namespace = this.namespaceURI;\n return namespace === d3_nsXhtml && document.documentElement.namespaceURI === d3_nsXhtml ? document.createElement(name) : document.createElementNS(namespace, name);\n }\n function createNS() {\n return this.ownerDocument.createElementNS(name.space, name.local);\n }\n return typeof name === \"function\" ? name : (name = d3.ns.qualify(name)).local ? createNS : create;\n }\n d3_selectionPrototype.insert = function(name, before) {\n name = d3_selection_creator(name);\n before = d3_selection_selector(before);\n return this.select(function() {\n return this.insertBefore(name.apply(this, arguments), before.apply(this, arguments) || null);\n });\n };\n d3_selectionPrototype.remove = function() {\n return this.each(d3_selectionRemove);\n };\n function d3_selectionRemove() {\n var parent = this.parentNode;\n if (parent) parent.removeChild(this);\n }\n d3_selectionPrototype.data = function(value, key) {\n var i = -1, n = this.length, group, node;\n if (!arguments.length) {\n value = new Array(n = (group = this[0]).length);\n while (++i < n) {\n if (node = group[i]) {\n value[i] = node.__data__;\n }\n }\n return value;\n }\n function bind(group, groupData) {\n var i, n = group.length, m = groupData.length, n0 = Math.min(n, m), updateNodes = new Array(m), enterNodes = new Array(m), exitNodes = new Array(n), node, nodeData;\n if (key) {\n var nodeByKeyValue = new d3_Map(), keyValues = new Array(n), keyValue;\n for (i = -1; ++i < n; ) {\n if (node = group[i]) {\n if (nodeByKeyValue.has(keyValue = key.call(node, node.__data__, i))) {\n exitNodes[i] = node;\n } else {\n nodeByKeyValue.set(keyValue, node);\n }\n keyValues[i] = keyValue;\n }\n }\n for (i = -1; ++i < m; ) {\n if (!(node = nodeByKeyValue.get(keyValue = key.call(groupData, nodeData = groupData[i], i)))) {\n enterNodes[i] = d3_selection_dataNode(nodeData);\n } else if (node !== true) {\n updateNodes[i] = node;\n node.__data__ = nodeData;\n }\n nodeByKeyValue.set(keyValue, true);\n }\n for (i = -1; ++i < n; ) {\n if (i in keyValues && nodeByKeyValue.get(keyValues[i]) !== true) {\n exitNodes[i] = group[i];\n }\n }\n } else {\n for (i = -1; ++i < n0; ) {\n node = group[i];\n nodeData = groupData[i];\n if (node) {\n node.__data__ = nodeData;\n updateNodes[i] = node;\n } else {\n enterNodes[i] = d3_selection_dataNode(nodeData);\n }\n }\n for (;i < m; ++i) {\n enterNodes[i] = d3_selection_dataNode(groupData[i]);\n }\n for (;i < n; ++i) {\n exitNodes[i] = group[i];\n }\n }\n enterNodes.update = updateNodes;\n enterNodes.parentNode = updateNodes.parentNode = exitNodes.parentNode = group.parentNode;\n enter.push(enterNodes);\n update.push(updateNodes);\n exit.push(exitNodes);\n }\n var enter = d3_selection_enter([]), update = d3_selection([]), exit = d3_selection([]);\n if (typeof value === \"function\") {\n while (++i < n) {\n bind(group = this[i], value.call(group, group.parentNode.__data__, i));\n }\n } else {\n while (++i < n) {\n bind(group = this[i], value);\n }\n }\n update.enter = function() {\n return enter;\n };\n update.exit = function() {\n return exit;\n };\n return update;\n };\n function d3_selection_dataNode(data) {\n return {\n __data__: data\n };\n }\n d3_selectionPrototype.datum = function(value) {\n return arguments.length ? this.property(\"__data__\", value) : this.property(\"__data__\");\n };\n d3_selectionPrototype.filter = function(filter) {\n var subgroups = [], subgroup, group, node;\n if (typeof filter !== \"function\") filter = d3_selection_filter(filter);\n for (var j = 0, m = this.length; j < m; j++) {\n subgroups.push(subgroup = []);\n subgroup.parentNode = (group = this[j]).parentNode;\n for (var i = 0, n = group.length; i < n; i++) {\n if ((node = group[i]) && filter.call(node, node.__data__, i, j)) {\n subgroup.push(node);\n }\n }\n }\n return d3_selection(subgroups);\n };\n function d3_selection_filter(selector) {\n return function() {\n return d3_selectMatches(this, selector);\n };\n }\n d3_selectionPrototype.order = function() {\n for (var j = -1, m = this.length; ++j < m; ) {\n for (var group = this[j], i = group.length - 1, next = group[i], node; --i >= 0; ) {\n if (node = group[i]) {\n if (next && next !== node.nextSibling) next.parentNode.insertBefore(node, next);\n next = node;\n }\n }\n }\n return this;\n };\n d3_selectionPrototype.sort = function(comparator) {\n comparator = d3_selection_sortComparator.apply(this, arguments);\n for (var j = -1, m = this.length; ++j < m; ) this[j].sort(comparator);\n return this.order();\n };\n function d3_selection_sortComparator(comparator) {\n if (!arguments.length) comparator = d3_ascending;\n return function(a, b) {\n return a && b ? comparator(a.__data__, b.__data__) : !a - !b;\n };\n }\n d3_selectionPrototype.each = function(callback) {\n return d3_selection_each(this, function(node, i, j) {\n callback.call(node, node.__data__, i, j);\n });\n };\n function d3_selection_each(groups, callback) {\n for (var j = 0, m = groups.length; j < m; j++) {\n for (var group = groups[j], i = 0, n = group.length, node; i < n; i++) {\n if (node = group[i]) callback(node, i, j);\n }\n }\n return groups;\n }\n d3_selectionPrototype.call = function(callback) {\n var args = d3_array(arguments);\n callback.apply(args[0] = this, args);\n return this;\n };\n d3_selectionPrototype.empty = function() {\n return !this.node();\n };\n d3_selectionPrototype.node = function() {\n for (var j = 0, m = this.length; j < m; j++) {\n for (var group = this[j], i = 0, n = group.length; i < n; i++) {\n var node = group[i];\n if (node) return node;\n }\n }\n return null;\n };\n d3_selectionPrototype.size = function() {\n var n = 0;\n d3_selection_each(this, function() {\n ++n;\n });\n return n;\n };\n function d3_selection_enter(selection) {\n d3_subclass(selection, d3_selection_enterPrototype);\n return selection;\n }\n var d3_selection_enterPrototype = [];\n d3.selection.enter = d3_selection_enter;\n d3.selection.enter.prototype = d3_selection_enterPrototype;\n d3_selection_enterPrototype.append = d3_selectionPrototype.append;\n d3_selection_enterPrototype.empty = d3_selectionPrototype.empty;\n d3_selection_enterPrototype.node = d3_selectionPrototype.node;\n d3_selection_enterPrototype.call = d3_selectionPrototype.call;\n d3_selection_enterPrototype.size = d3_selectionPrototype.size;\n d3_selection_enterPrototype.select = function(selector) {\n var subgroups = [], subgroup, subnode, upgroup, group, node;\n for (var j = -1, m = this.length; ++j < m; ) {\n upgroup = (group = this[j]).update;\n subgroups.push(subgroup = []);\n subgroup.parentNode = group.parentNode;\n for (var i = -1, n = group.length; ++i < n; ) {\n if (node = group[i]) {\n subgroup.push(upgroup[i] = subnode = selector.call(group.parentNode, node.__data__, i, j));\n subnode.__data__ = node.__data__;\n } else {\n subgroup.push(null);\n }\n }\n }\n return d3_selection(subgroups);\n };\n d3_selection_enterPrototype.insert = function(name, before) {\n if (arguments.length < 2) before = d3_selection_enterInsertBefore(this);\n return d3_selectionPrototype.insert.call(this, name, before);\n };\n function d3_selection_enterInsertBefore(enter) {\n var i0, j0;\n return function(d, i, j) {\n var group = enter[j].update, n = group.length, node;\n if (j != j0) j0 = j, i0 = 0;\n if (i >= i0) i0 = i + 1;\n while (!(node = group[i0]) && ++i0 < n) ;\n return node;\n };\n }\n d3.select = function(node) {\n var group;\n if (typeof node === \"string\") {\n group = [ d3_select(node, d3_document) ];\n group.parentNode = d3_document.documentElement;\n } else {\n group = [ node ];\n group.parentNode = d3_documentElement(node);\n }\n return d3_selection([ group ]);\n };\n d3.selectAll = function(nodes) {\n var group;\n if (typeof nodes === \"string\") {\n group = d3_array(d3_selectAll(nodes, d3_document));\n group.parentNode = d3_document.documentElement;\n } else {\n group = d3_array(nodes);\n group.parentNode = null;\n }\n return d3_selection([ group ]);\n };\n d3_selectionPrototype.on = function(type, listener, capture) {\n var n = arguments.length;\n if (n < 3) {\n if (typeof type !== \"string\") {\n if (n < 2) listener = false;\n for (capture in type) this.each(d3_selection_on(capture, type[capture], listener));\n return this;\n }\n if (n < 2) return (n = this.node()[\"__on\" + type]) && n._;\n capture = false;\n }\n return this.each(d3_selection_on(type, listener, capture));\n };\n function d3_selection_on(type, listener, capture) {\n var name = \"__on\" + type, i = type.indexOf(\".\"), wrap = d3_selection_onListener;\n if (i > 0) type = type.slice(0, i);\n var filter = d3_selection_onFilters.get(type);\n if (filter) type = filter, wrap = d3_selection_onFilter;\n function onRemove() {\n var l = this[name];\n if (l) {\n this.removeEventListener(type, l, l.$);\n delete this[name];\n }\n }\n function onAdd() {\n var l = wrap(listener, d3_array(arguments));\n onRemove.call(this);\n this.addEventListener(type, this[name] = l, l.$ = capture);\n l._ = listener;\n }\n function removeAll() {\n var re = new RegExp(\"^__on([^.]+)\" + d3.requote(type) + \"$\"), match;\n for (var name in this) {\n if (match = name.match(re)) {\n var l = this[name];\n this.removeEventListener(match[1], l, l.$);\n delete this[name];\n }\n }\n }\n return i ? listener ? onAdd : onRemove : listener ? d3_noop : removeAll;\n }\n var d3_selection_onFilters = d3.map({\n mouseenter: \"mouseover\",\n mouseleave: \"mouseout\"\n });\n if (d3_document) {\n d3_selection_onFilters.forEach(function(k) {\n if (\"on\" + k in d3_document) d3_selection_onFilters.remove(k);\n });\n }\n function d3_selection_onListener(listener, argumentz) {\n return function(e) {\n var o = d3.event;\n d3.event = e;\n argumentz[0] = this.__data__;\n try {\n listener.apply(this, argumentz);\n } finally {\n d3.event = o;\n }\n };\n }\n function d3_selection_onFilter(listener, argumentz) {\n var l = d3_selection_onListener(listener, argumentz);\n return function(e) {\n var target = this, related = e.relatedTarget;\n if (!related || related !== target && !(related.compareDocumentPosition(target) & 8)) {\n l.call(target, e);\n }\n };\n }\n var d3_event_dragSelect, d3_event_dragId = 0;\n function d3_event_dragSuppress(node) {\n var name = \".dragsuppress-\" + ++d3_event_dragId, click = \"click\" + name, w = d3.select(d3_window(node)).on(\"touchmove\" + name, d3_eventPreventDefault).on(\"dragstart\" + name, d3_eventPreventDefault).on(\"selectstart\" + name, d3_eventPreventDefault);\n if (d3_event_dragSelect == null) {\n d3_event_dragSelect = \"onselectstart\" in node ? false : d3_vendorSymbol(node.style, \"userSelect\");\n }\n if (d3_event_dragSelect) {\n var style = d3_documentElement(node).style, select = style[d3_event_dragSelect];\n style[d3_event_dragSelect] = \"none\";\n }\n return function(suppressClick) {\n w.on(name, null);\n if (d3_event_dragSelect) style[d3_event_dragSelect] = select;\n if (suppressClick) {\n var off = function() {\n w.on(click, null);\n };\n w.on(click, function() {\n d3_eventPreventDefault();\n off();\n }, true);\n setTimeout(off, 0);\n }\n };\n }\n d3.mouse = function(container) {\n return d3_mousePoint(container, d3_eventSource());\n };\n var d3_mouse_bug44083 = this.navigator && /WebKit/.test(this.navigator.userAgent) ? -1 : 0;\n function d3_mousePoint(container, e) {\n if (e.changedTouches) e = e.changedTouches[0];\n var svg = container.ownerSVGElement || container;\n if (svg.createSVGPoint) {\n var point = svg.createSVGPoint();\n if (d3_mouse_bug44083 < 0) {\n var window = d3_window(container);\n if (window.scrollX || window.scrollY) {\n svg = d3.select(\"body\").append(\"svg\").style({\n position: \"absolute\",\n top: 0,\n left: 0,\n margin: 0,\n padding: 0,\n border: \"none\"\n }, \"important\");\n var ctm = svg[0][0].getScreenCTM();\n d3_mouse_bug44083 = !(ctm.f || ctm.e);\n svg.remove();\n }\n }\n if (d3_mouse_bug44083) point.x = e.pageX, point.y = e.pageY; else point.x = e.clientX, \n point.y = e.clientY;\n point = point.matrixTransform(container.getScreenCTM().inverse());\n return [ point.x, point.y ];\n }\n var rect = container.getBoundingClientRect();\n return [ e.clientX - rect.left - container.clientLeft, e.clientY - rect.top - container.clientTop ];\n }\n d3.touch = function(container, touches, identifier) {\n if (arguments.length < 3) identifier = touches, touches = d3_eventSource().changedTouches;\n if (touches) for (var i = 0, n = touches.length, touch; i < n; ++i) {\n if ((touch = touches[i]).identifier === identifier) {\n return d3_mousePoint(container, touch);\n }\n }\n };\n d3.behavior.drag = function() {\n var event = d3_eventDispatch(drag, \"drag\", \"dragstart\", \"dragend\"), origin = null, mousedown = dragstart(d3_noop, d3.mouse, d3_window, \"mousemove\", \"mouseup\"), touchstart = dragstart(d3_behavior_dragTouchId, d3.touch, d3_identity, \"touchmove\", \"touchend\");\n function drag() {\n this.on(\"mousedown.drag\", mousedown).on(\"touchstart.drag\", touchstart);\n }\n function dragstart(id, position, subject, move, end) {\n return function() {\n var that = this, target = d3.event.target.correspondingElement || d3.event.target, parent = that.parentNode, dispatch = event.of(that, arguments), dragged = 0, dragId = id(), dragName = \".drag\" + (dragId == null ? \"\" : \"-\" + dragId), dragOffset, dragSubject = d3.select(subject(target)).on(move + dragName, moved).on(end + dragName, ended), dragRestore = d3_event_dragSuppress(target), position0 = position(parent, dragId);\n if (origin) {\n dragOffset = origin.apply(that, arguments);\n dragOffset = [ dragOffset.x - position0[0], dragOffset.y - position0[1] ];\n } else {\n dragOffset = [ 0, 0 ];\n }\n dispatch({\n type: \"dragstart\"\n });\n function moved() {\n var position1 = position(parent, dragId), dx, dy;\n if (!position1) return;\n dx = position1[0] - position0[0];\n dy = position1[1] - position0[1];\n dragged |= dx | dy;\n position0 = position1;\n dispatch({\n type: \"drag\",\n x: position1[0] + dragOffset[0],\n y: position1[1] + dragOffset[1],\n dx: dx,\n dy: dy\n });\n }\n function ended() {\n if (!position(parent, dragId)) return;\n dragSubject.on(move + dragName, null).on(end + dragName, null);\n dragRestore(dragged);\n dispatch({\n type: \"dragend\"\n });\n }\n };\n }\n drag.origin = function(x) {\n if (!arguments.length) return origin;\n origin = x;\n return drag;\n };\n return d3.rebind(drag, event, \"on\");\n };\n function d3_behavior_dragTouchId() {\n return d3.event.changedTouches[0].identifier;\n }\n d3.touches = function(container, touches) {\n if (arguments.length < 2) touches = d3_eventSource().touches;\n return touches ? d3_array(touches).map(function(touch) {\n var point = d3_mousePoint(container, touch);\n point.identifier = touch.identifier;\n return point;\n }) : [];\n };\n var ε = 1e-6, ε2 = ε * ε, π = Math.PI, τ = 2 * π, τε = τ - ε, halfπ = π / 2, d3_radians = π / 180, d3_degrees = 180 / π;\n function d3_sgn(x) {\n return x > 0 ? 1 : x < 0 ? -1 : 0;\n }\n function d3_cross2d(a, b, c) {\n return (b[0] - a[0]) * (c[1] - a[1]) - (b[1] - a[1]) * (c[0] - a[0]);\n }\n function d3_acos(x) {\n return x > 1 ? 0 : x < -1 ? π : Math.acos(x);\n }\n function d3_asin(x) {\n return x > 1 ? halfπ : x < -1 ? -halfπ : Math.asin(x);\n }\n function d3_sinh(x) {\n return ((x = Math.exp(x)) - 1 / x) / 2;\n }\n function d3_cosh(x) {\n return ((x = Math.exp(x)) + 1 / x) / 2;\n }\n function d3_tanh(x) {\n return ((x = Math.exp(2 * x)) - 1) / (x + 1);\n }\n function d3_haversin(x) {\n return (x = Math.sin(x / 2)) * x;\n }\n var ρ = Math.SQRT2, ρ2 = 2, ρ4 = 4;\n d3.interpolateZoom = function(p0, p1) {\n var ux0 = p0[0], uy0 = p0[1], w0 = p0[2], ux1 = p1[0], uy1 = p1[1], w1 = p1[2], dx = ux1 - ux0, dy = uy1 - uy0, d2 = dx * dx + dy * dy, i, S;\n if (d2 < ε2) {\n S = Math.log(w1 / w0) / ρ;\n i = function(t) {\n return [ ux0 + t * dx, uy0 + t * dy, w0 * Math.exp(ρ * t * S) ];\n };\n } else {\n var d1 = Math.sqrt(d2), b0 = (w1 * w1 - w0 * w0 + ρ4 * d2) / (2 * w0 * ρ2 * d1), b1 = (w1 * w1 - w0 * w0 - ρ4 * d2) / (2 * w1 * ρ2 * d1), r0 = Math.log(Math.sqrt(b0 * b0 + 1) - b0), r1 = Math.log(Math.sqrt(b1 * b1 + 1) - b1);\n S = (r1 - r0) / ρ;\n i = function(t) {\n var s = t * S, coshr0 = d3_cosh(r0), u = w0 / (ρ2 * d1) * (coshr0 * d3_tanh(ρ * s + r0) - d3_sinh(r0));\n return [ ux0 + u * dx, uy0 + u * dy, w0 * coshr0 / d3_cosh(ρ * s + r0) ];\n };\n }\n i.duration = S * 1e3;\n return i;\n };\n d3.behavior.zoom = function() {\n var view = {\n x: 0,\n y: 0,\n k: 1\n }, translate0, center0, center, size = [ 960, 500 ], scaleExtent = d3_behavior_zoomInfinity, duration = 250, zooming = 0, mousedown = \"mousedown.zoom\", mousemove = \"mousemove.zoom\", mouseup = \"mouseup.zoom\", mousewheelTimer, touchstart = \"touchstart.zoom\", touchtime, event = d3_eventDispatch(zoom, \"zoomstart\", \"zoom\", \"zoomend\"), x0, x1, y0, y1;\n if (!d3_behavior_zoomWheel) {\n d3_behavior_zoomWheel = \"onwheel\" in d3_document ? (d3_behavior_zoomDelta = function() {\n return -d3.event.deltaY * (d3.event.deltaMode ? 120 : 1);\n }, \"wheel\") : \"onmousewheel\" in d3_document ? (d3_behavior_zoomDelta = function() {\n return d3.event.wheelDelta;\n }, \"mousewheel\") : (d3_behavior_zoomDelta = function() {\n return -d3.event.detail;\n }, \"MozMousePixelScroll\");\n }\n function zoom(g) {\n g.on(mousedown, mousedowned).on(d3_behavior_zoomWheel + \".zoom\", mousewheeled).on(\"dblclick.zoom\", dblclicked).on(touchstart, touchstarted);\n }\n zoom.event = function(g) {\n g.each(function() {\n var dispatch = event.of(this, arguments), view1 = view;\n if (d3_transitionInheritId) {\n d3.select(this).transition().each(\"start.zoom\", function() {\n view = this.__chart__ || {\n x: 0,\n y: 0,\n k: 1\n };\n zoomstarted(dispatch);\n }).tween(\"zoom:zoom\", function() {\n var dx = size[0], dy = size[1], cx = center0 ? center0[0] : dx / 2, cy = center0 ? center0[1] : dy / 2, i = d3.interpolateZoom([ (cx - view.x) / view.k, (cy - view.y) / view.k, dx / view.k ], [ (cx - view1.x) / view1.k, (cy - view1.y) / view1.k, dx / view1.k ]);\n return function(t) {\n var l = i(t), k = dx / l[2];\n this.__chart__ = view = {\n x: cx - l[0] * k,\n y: cy - l[1] * k,\n k: k\n };\n zoomed(dispatch);\n };\n }).each(\"interrupt.zoom\", function() {\n zoomended(dispatch);\n }).each(\"end.zoom\", function() {\n zoomended(dispatch);\n });\n } else {\n this.__chart__ = view;\n zoomstarted(dispatch);\n zoomed(dispatch);\n zoomended(dispatch);\n }\n });\n };\n zoom.translate = function(_) {\n if (!arguments.length) return [ view.x, view.y ];\n view = {\n x: +_[0],\n y: +_[1],\n k: view.k\n };\n rescale();\n return zoom;\n };\n zoom.scale = function(_) {\n if (!arguments.length) return view.k;\n view = {\n x: view.x,\n y: view.y,\n k: null\n };\n scaleTo(+_);\n rescale();\n return zoom;\n };\n zoom.scaleExtent = function(_) {\n if (!arguments.length) return scaleExtent;\n scaleExtent = _ == null ? d3_behavior_zoomInfinity : [ +_[0], +_[1] ];\n return zoom;\n };\n zoom.center = function(_) {\n if (!arguments.length) return center;\n center = _ && [ +_[0], +_[1] ];\n return zoom;\n };\n zoom.size = function(_) {\n if (!arguments.length) return size;\n size = _ && [ +_[0], +_[1] ];\n return zoom;\n };\n zoom.duration = function(_) {\n if (!arguments.length) return duration;\n duration = +_;\n return zoom;\n };\n zoom.x = function(z) {\n if (!arguments.length) return x1;\n x1 = z;\n x0 = z.copy();\n view = {\n x: 0,\n y: 0,\n k: 1\n };\n return zoom;\n };\n zoom.y = function(z) {\n if (!arguments.length) return y1;\n y1 = z;\n y0 = z.copy();\n view = {\n x: 0,\n y: 0,\n k: 1\n };\n return zoom;\n };\n function location(p) {\n return [ (p[0] - view.x) / view.k, (p[1] - view.y) / view.k ];\n }\n function point(l) {\n return [ l[0] * view.k + view.x, l[1] * view.k + view.y ];\n }\n function scaleTo(s) {\n view.k = Math.max(scaleExtent[0], Math.min(scaleExtent[1], s));\n }\n function translateTo(p, l) {\n l = point(l);\n view.x += p[0] - l[0];\n view.y += p[1] - l[1];\n }\n function zoomTo(that, p, l, k) {\n that.__chart__ = {\n x: view.x,\n y: view.y,\n k: view.k\n };\n scaleTo(Math.pow(2, k));\n translateTo(center0 = p, l);\n that = d3.select(that);\n if (duration > 0) that = that.transition().duration(duration);\n that.call(zoom.event);\n }\n function rescale() {\n if (x1) x1.domain(x0.range().map(function(x) {\n return (x - view.x) / view.k;\n }).map(x0.invert));\n if (y1) y1.domain(y0.range().map(function(y) {\n return (y - view.y) / view.k;\n }).map(y0.invert));\n }\n function zoomstarted(dispatch) {\n if (!zooming++) dispatch({\n type: \"zoomstart\"\n });\n }\n function zoomed(dispatch) {\n rescale();\n dispatch({\n type: \"zoom\",\n scale: view.k,\n translate: [ view.x, view.y ]\n });\n }\n function zoomended(dispatch) {\n if (!--zooming) dispatch({\n type: \"zoomend\"\n }), center0 = null;\n }\n function mousedowned() {\n var that = this, dispatch = event.of(that, arguments), dragged = 0, subject = d3.select(d3_window(that)).on(mousemove, moved).on(mouseup, ended), location0 = location(d3.mouse(that)), dragRestore = d3_event_dragSuppress(that);\n d3_selection_interrupt.call(that);\n zoomstarted(dispatch);\n function moved() {\n dragged = 1;\n translateTo(d3.mouse(that), location0);\n zoomed(dispatch);\n }\n function ended() {\n subject.on(mousemove, null).on(mouseup, null);\n dragRestore(dragged);\n zoomended(dispatch);\n }\n }\n function touchstarted() {\n var that = this, dispatch = event.of(that, arguments), locations0 = {}, distance0 = 0, scale0, zoomName = \".zoom-\" + d3.event.changedTouches[0].identifier, touchmove = \"touchmove\" + zoomName, touchend = \"touchend\" + zoomName, targets = [], subject = d3.select(that), dragRestore = d3_event_dragSuppress(that);\n started();\n zoomstarted(dispatch);\n subject.on(mousedown, null).on(touchstart, started);\n function relocate() {\n var touches = d3.touches(that);\n scale0 = view.k;\n touches.forEach(function(t) {\n if (t.identifier in locations0) locations0[t.identifier] = location(t);\n });\n return touches;\n }\n function started() {\n var target = d3.event.target;\n d3.select(target).on(touchmove, moved).on(touchend, ended);\n targets.push(target);\n var changed = d3.event.changedTouches;\n for (var i = 0, n = changed.length; i < n; ++i) {\n locations0[changed[i].identifier] = null;\n }\n var touches = relocate(), now = Date.now();\n if (touches.length === 1) {\n if (now - touchtime < 500) {\n var p = touches[0];\n zoomTo(that, p, locations0[p.identifier], Math.floor(Math.log(view.k) / Math.LN2) + 1);\n d3_eventPreventDefault();\n }\n touchtime = now;\n } else if (touches.length > 1) {\n var p = touches[0], q = touches[1], dx = p[0] - q[0], dy = p[1] - q[1];\n distance0 = dx * dx + dy * dy;\n }\n }\n function moved() {\n var touches = d3.touches(that), p0, l0, p1, l1;\n d3_selection_interrupt.call(that);\n for (var i = 0, n = touches.length; i < n; ++i, l1 = null) {\n p1 = touches[i];\n if (l1 = locations0[p1.identifier]) {\n if (l0) break;\n p0 = p1, l0 = l1;\n }\n }\n if (l1) {\n var distance1 = (distance1 = p1[0] - p0[0]) * distance1 + (distance1 = p1[1] - p0[1]) * distance1, scale1 = distance0 && Math.sqrt(distance1 / distance0);\n p0 = [ (p0[0] + p1[0]) / 2, (p0[1] + p1[1]) / 2 ];\n l0 = [ (l0[0] + l1[0]) / 2, (l0[1] + l1[1]) / 2 ];\n scaleTo(scale1 * scale0);\n }\n touchtime = null;\n translateTo(p0, l0);\n zoomed(dispatch);\n }\n function ended() {\n if (d3.event.touches.length) {\n var changed = d3.event.changedTouches;\n for (var i = 0, n = changed.length; i < n; ++i) {\n delete locations0[changed[i].identifier];\n }\n for (var identifier in locations0) {\n return void relocate();\n }\n }\n d3.selectAll(targets).on(zoomName, null);\n subject.on(mousedown, mousedowned).on(touchstart, touchstarted);\n dragRestore();\n zoomended(dispatch);\n }\n }\n function mousewheeled() {\n var dispatch = event.of(this, arguments);\n if (mousewheelTimer) clearTimeout(mousewheelTimer); else d3_selection_interrupt.call(this), \n translate0 = location(center0 = center || d3.mouse(this)), zoomstarted(dispatch);\n mousewheelTimer = setTimeout(function() {\n mousewheelTimer = null;\n zoomended(dispatch);\n }, 50);\n d3_eventPreventDefault();\n scaleTo(Math.pow(2, d3_behavior_zoomDelta() * .002) * view.k);\n translateTo(center0, translate0);\n zoomed(dispatch);\n }\n function dblclicked() {\n var p = d3.mouse(this), k = Math.log(view.k) / Math.LN2;\n zoomTo(this, p, location(p), d3.event.shiftKey ? Math.ceil(k) - 1 : Math.floor(k) + 1);\n }\n return d3.rebind(zoom, event, \"on\");\n };\n var d3_behavior_zoomInfinity = [ 0, Infinity ], d3_behavior_zoomDelta, d3_behavior_zoomWheel;\n d3.color = d3_color;\n function d3_color() {}\n d3_color.prototype.toString = function() {\n return this.rgb() + \"\";\n };\n d3.hsl = d3_hsl;\n function d3_hsl(h, s, l) {\n return this instanceof d3_hsl ? void (this.h = +h, this.s = +s, this.l = +l) : arguments.length < 2 ? h instanceof d3_hsl ? new d3_hsl(h.h, h.s, h.l) : d3_rgb_parse(\"\" + h, d3_rgb_hsl, d3_hsl) : new d3_hsl(h, s, l);\n }\n var d3_hslPrototype = d3_hsl.prototype = new d3_color();\n d3_hslPrototype.brighter = function(k) {\n k = Math.pow(.7, arguments.length ? k : 1);\n return new d3_hsl(this.h, this.s, this.l / k);\n };\n d3_hslPrototype.darker = function(k) {\n k = Math.pow(.7, arguments.length ? k : 1);\n return new d3_hsl(this.h, this.s, k * this.l);\n };\n d3_hslPrototype.rgb = function() {\n return d3_hsl_rgb(this.h, this.s, this.l);\n };\n function d3_hsl_rgb(h, s, l) {\n var m1, m2;\n h = isNaN(h) ? 0 : (h %= 360) < 0 ? h + 360 : h;\n s = isNaN(s) ? 0 : s < 0 ? 0 : s > 1 ? 1 : s;\n l = l < 0 ? 0 : l > 1 ? 1 : l;\n m2 = l <= .5 ? l * (1 + s) : l + s - l * s;\n m1 = 2 * l - m2;\n function v(h) {\n if (h > 360) h -= 360; else if (h < 0) h += 360;\n if (h < 60) return m1 + (m2 - m1) * h / 60;\n if (h < 180) return m2;\n if (h < 240) return m1 + (m2 - m1) * (240 - h) / 60;\n return m1;\n }\n function vv(h) {\n return Math.round(v(h) * 255);\n }\n return new d3_rgb(vv(h + 120), vv(h), vv(h - 120));\n }\n d3.hcl = d3_hcl;\n function d3_hcl(h, c, l) {\n return this instanceof d3_hcl ? void (this.h = +h, this.c = +c, this.l = +l) : arguments.length < 2 ? h instanceof d3_hcl ? new d3_hcl(h.h, h.c, h.l) : h instanceof d3_lab ? d3_lab_hcl(h.l, h.a, h.b) : d3_lab_hcl((h = d3_rgb_lab((h = d3.rgb(h)).r, h.g, h.b)).l, h.a, h.b) : new d3_hcl(h, c, l);\n }\n var d3_hclPrototype = d3_hcl.prototype = new d3_color();\n d3_hclPrototype.brighter = function(k) {\n return new d3_hcl(this.h, this.c, Math.min(100, this.l + d3_lab_K * (arguments.length ? k : 1)));\n };\n d3_hclPrototype.darker = function(k) {\n return new d3_hcl(this.h, this.c, Math.max(0, this.l - d3_lab_K * (arguments.length ? k : 1)));\n };\n d3_hclPrototype.rgb = function() {\n return d3_hcl_lab(this.h, this.c, this.l).rgb();\n };\n function d3_hcl_lab(h, c, l) {\n if (isNaN(h)) h = 0;\n if (isNaN(c)) c = 0;\n return new d3_lab(l, Math.cos(h *= d3_radians) * c, Math.sin(h) * c);\n }\n d3.lab = d3_lab;\n function d3_lab(l, a, b) {\n return this instanceof d3_lab ? void (this.l = +l, this.a = +a, this.b = +b) : arguments.length < 2 ? l instanceof d3_lab ? new d3_lab(l.l, l.a, l.b) : l instanceof d3_hcl ? d3_hcl_lab(l.h, l.c, l.l) : d3_rgb_lab((l = d3_rgb(l)).r, l.g, l.b) : new d3_lab(l, a, b);\n }\n var d3_lab_K = 18;\n var d3_lab_X = .95047, d3_lab_Y = 1, d3_lab_Z = 1.08883;\n var d3_labPrototype = d3_lab.prototype = new d3_color();\n d3_labPrototype.brighter = function(k) {\n return new d3_lab(Math.min(100, this.l + d3_lab_K * (arguments.length ? k : 1)), this.a, this.b);\n };\n d3_labPrototype.darker = function(k) {\n return new d3_lab(Math.max(0, this.l - d3_lab_K * (arguments.length ? k : 1)), this.a, this.b);\n };\n d3_labPrototype.rgb = function() {\n return d3_lab_rgb(this.l, this.a, this.b);\n };\n function d3_lab_rgb(l, a, b) {\n var y = (l + 16) / 116, x = y + a / 500, z = y - b / 200;\n x = d3_lab_xyz(x) * d3_lab_X;\n y = d3_lab_xyz(y) * d3_lab_Y;\n z = d3_lab_xyz(z) * d3_lab_Z;\n return new d3_rgb(d3_xyz_rgb(3.2404542 * x - 1.5371385 * y - .4985314 * z), d3_xyz_rgb(-.969266 * x + 1.8760108 * y + .041556 * z), d3_xyz_rgb(.0556434 * x - .2040259 * y + 1.0572252 * z));\n }\n function d3_lab_hcl(l, a, b) {\n return l > 0 ? new d3_hcl(Math.atan2(b, a) * d3_degrees, Math.sqrt(a * a + b * b), l) : new d3_hcl(NaN, NaN, l);\n }\n function d3_lab_xyz(x) {\n return x > .206893034 ? x * x * x : (x - 4 / 29) / 7.787037;\n }\n function d3_xyz_lab(x) {\n return x > .008856 ? Math.pow(x, 1 / 3) : 7.787037 * x + 4 / 29;\n }\n function d3_xyz_rgb(r) {\n return Math.round(255 * (r <= .00304 ? 12.92 * r : 1.055 * Math.pow(r, 1 / 2.4) - .055));\n }\n d3.rgb = d3_rgb;\n function d3_rgb(r, g, b) {\n return this instanceof d3_rgb ? void (this.r = ~~r, this.g = ~~g, this.b = ~~b) : arguments.length < 2 ? r instanceof d3_rgb ? new d3_rgb(r.r, r.g, r.b) : d3_rgb_parse(\"\" + r, d3_rgb, d3_hsl_rgb) : new d3_rgb(r, g, b);\n }\n function d3_rgbNumber(value) {\n return new d3_rgb(value >> 16, value >> 8 & 255, value & 255);\n }\n function d3_rgbString(value) {\n return d3_rgbNumber(value) + \"\";\n }\n var d3_rgbPrototype = d3_rgb.prototype = new d3_color();\n d3_rgbPrototype.brighter = function(k) {\n k = Math.pow(.7, arguments.length ? k : 1);\n var r = this.r, g = this.g, b = this.b, i = 30;\n if (!r && !g && !b) return new d3_rgb(i, i, i);\n if (r && r < i) r = i;\n if (g && g < i) g = i;\n if (b && b < i) b = i;\n return new d3_rgb(Math.min(255, r / k), Math.min(255, g / k), Math.min(255, b / k));\n };\n d3_rgbPrototype.darker = function(k) {\n k = Math.pow(.7, arguments.length ? k : 1);\n return new d3_rgb(k * this.r, k * this.g, k * this.b);\n };\n d3_rgbPrototype.hsl = function() {\n return d3_rgb_hsl(this.r, this.g, this.b);\n };\n d3_rgbPrototype.toString = function() {\n return \"#\" + d3_rgb_hex(this.r) + d3_rgb_hex(this.g) + d3_rgb_hex(this.b);\n };\n function d3_rgb_hex(v) {\n return v < 16 ? \"0\" + Math.max(0, v).toString(16) : Math.min(255, v).toString(16);\n }\n function d3_rgb_parse(format, rgb, hsl) {\n var r = 0, g = 0, b = 0, m1, m2, color;\n m1 = /([a-z]+)\\((.*)\\)/.exec(format = format.toLowerCase());\n if (m1) {\n m2 = m1[2].split(\",\");\n switch (m1[1]) {\n case \"hsl\":\n {\n return hsl(parseFloat(m2[0]), parseFloat(m2[1]) / 100, parseFloat(m2[2]) / 100);\n }\n\n case \"rgb\":\n {\n return rgb(d3_rgb_parseNumber(m2[0]), d3_rgb_parseNumber(m2[1]), d3_rgb_parseNumber(m2[2]));\n }\n }\n }\n if (color = d3_rgb_names.get(format)) {\n return rgb(color.r, color.g, color.b);\n }\n if (format != null && format.charAt(0) === \"#\" && !isNaN(color = parseInt(format.slice(1), 16))) {\n if (format.length === 4) {\n r = (color & 3840) >> 4;\n r = r >> 4 | r;\n g = color & 240;\n g = g >> 4 | g;\n b = color & 15;\n b = b << 4 | b;\n } else if (format.length === 7) {\n r = (color & 16711680) >> 16;\n g = (color & 65280) >> 8;\n b = color & 255;\n }\n }\n return rgb(r, g, b);\n }\n function d3_rgb_hsl(r, g, b) {\n var min = Math.min(r /= 255, g /= 255, b /= 255), max = Math.max(r, g, b), d = max - min, h, s, l = (max + min) / 2;\n if (d) {\n s = l < .5 ? d / (max + min) : d / (2 - max - min);\n if (r == max) h = (g - b) / d + (g < b ? 6 : 0); else if (g == max) h = (b - r) / d + 2; else h = (r - g) / d + 4;\n h *= 60;\n } else {\n h = NaN;\n s = l > 0 && l < 1 ? 0 : h;\n }\n return new d3_hsl(h, s, l);\n }\n function d3_rgb_lab(r, g, b) {\n r = d3_rgb_xyz(r);\n g = d3_rgb_xyz(g);\n b = d3_rgb_xyz(b);\n var x = d3_xyz_lab((.4124564 * r + .3575761 * g + .1804375 * b) / d3_lab_X), y = d3_xyz_lab((.2126729 * r + .7151522 * g + .072175 * b) / d3_lab_Y), z = d3_xyz_lab((.0193339 * r + .119192 * g + .9503041 * b) / d3_lab_Z);\n return d3_lab(116 * y - 16, 500 * (x - y), 200 * (y - z));\n }\n function d3_rgb_xyz(r) {\n return (r /= 255) <= .04045 ? r / 12.92 : Math.pow((r + .055) / 1.055, 2.4);\n }\n function d3_rgb_parseNumber(c) {\n var f = parseFloat(c);\n return c.charAt(c.length - 1) === \"%\" ? Math.round(f * 2.55) : f;\n }\n var d3_rgb_names = d3.map({\n aliceblue: 15792383,\n antiquewhite: 16444375,\n aqua: 65535,\n aquamarine: 8388564,\n azure: 15794175,\n beige: 16119260,\n bisque: 16770244,\n black: 0,\n blanchedalmond: 16772045,\n blue: 255,\n blueviolet: 9055202,\n brown: 10824234,\n burlywood: 14596231,\n cadetblue: 6266528,\n chartreuse: 8388352,\n chocolate: 13789470,\n coral: 16744272,\n cornflowerblue: 6591981,\n cornsilk: 16775388,\n crimson: 14423100,\n cyan: 65535,\n darkblue: 139,\n darkcyan: 35723,\n darkgoldenrod: 12092939,\n darkgray: 11119017,\n darkgreen: 25600,\n darkgrey: 11119017,\n darkkhaki: 12433259,\n darkmagenta: 9109643,\n darkolivegreen: 5597999,\n darkorange: 16747520,\n darkorchid: 10040012,\n darkred: 9109504,\n darksalmon: 15308410,\n darkseagreen: 9419919,\n darkslateblue: 4734347,\n darkslategray: 3100495,\n darkslategrey: 3100495,\n darkturquoise: 52945,\n darkviolet: 9699539,\n deeppink: 16716947,\n deepskyblue: 49151,\n dimgray: 6908265,\n dimgrey: 6908265,\n dodgerblue: 2003199,\n firebrick: 11674146,\n floralwhite: 16775920,\n forestgreen: 2263842,\n fuchsia: 16711935,\n gainsboro: 14474460,\n ghostwhite: 16316671,\n gold: 16766720,\n goldenrod: 14329120,\n gray: 8421504,\n green: 32768,\n greenyellow: 11403055,\n grey: 8421504,\n honeydew: 15794160,\n hotpink: 16738740,\n indianred: 13458524,\n indigo: 4915330,\n ivory: 16777200,\n khaki: 15787660,\n lavender: 15132410,\n lavenderblush: 16773365,\n lawngreen: 8190976,\n lemonchiffon: 16775885,\n lightblue: 11393254,\n lightcoral: 15761536,\n lightcyan: 14745599,\n lightgoldenrodyellow: 16448210,\n lightgray: 13882323,\n lightgreen: 9498256,\n lightgrey: 13882323,\n lightpink: 16758465,\n lightsalmon: 16752762,\n lightseagreen: 2142890,\n lightskyblue: 8900346,\n lightslategray: 7833753,\n lightslategrey: 7833753,\n lightsteelblue: 11584734,\n lightyellow: 16777184,\n lime: 65280,\n limegreen: 3329330,\n linen: 16445670,\n magenta: 16711935,\n maroon: 8388608,\n mediumaquamarine: 6737322,\n mediumblue: 205,\n mediumorchid: 12211667,\n mediumpurple: 9662683,\n mediumseagreen: 3978097,\n mediumslateblue: 8087790,\n mediumspringgreen: 64154,\n mediumturquoise: 4772300,\n mediumvioletred: 13047173,\n midnightblue: 1644912,\n mintcream: 16121850,\n mistyrose: 16770273,\n moccasin: 16770229,\n navajowhite: 16768685,\n navy: 128,\n oldlace: 16643558,\n olive: 8421376,\n olivedrab: 7048739,\n orange: 16753920,\n orangered: 16729344,\n orchid: 14315734,\n palegoldenrod: 15657130,\n palegreen: 10025880,\n paleturquoise: 11529966,\n palevioletred: 14381203,\n papayawhip: 16773077,\n peachpuff: 16767673,\n peru: 13468991,\n pink: 16761035,\n plum: 14524637,\n powderblue: 11591910,\n purple: 8388736,\n rebeccapurple: 6697881,\n red: 16711680,\n rosybrown: 12357519,\n royalblue: 4286945,\n saddlebrown: 9127187,\n salmon: 16416882,\n sandybrown: 16032864,\n seagreen: 3050327,\n seashell: 16774638,\n sienna: 10506797,\n silver: 12632256,\n skyblue: 8900331,\n slateblue: 6970061,\n slategray: 7372944,\n slategrey: 7372944,\n snow: 16775930,\n springgreen: 65407,\n steelblue: 4620980,\n tan: 13808780,\n teal: 32896,\n thistle: 14204888,\n tomato: 16737095,\n turquoise: 4251856,\n violet: 15631086,\n wheat: 16113331,\n white: 16777215,\n whitesmoke: 16119285,\n yellow: 16776960,\n yellowgreen: 10145074\n });\n d3_rgb_names.forEach(function(key, value) {\n d3_rgb_names.set(key, d3_rgbNumber(value));\n });\n function d3_functor(v) {\n return typeof v === \"function\" ? v : function() {\n return v;\n };\n }\n d3.functor = d3_functor;\n d3.xhr = d3_xhrType(d3_identity);\n function d3_xhrType(response) {\n return function(url, mimeType, callback) {\n if (arguments.length === 2 && typeof mimeType === \"function\") callback = mimeType, \n mimeType = null;\n return d3_xhr(url, mimeType, response, callback);\n };\n }\n function d3_xhr(url, mimeType, response, callback) {\n var xhr = {}, dispatch = d3.dispatch(\"beforesend\", \"progress\", \"load\", \"error\"), headers = {}, request = new XMLHttpRequest(), responseType = null;\n if (this.XDomainRequest && !(\"withCredentials\" in request) && /^(http(s)?:)?\\/\\//.test(url)) request = new XDomainRequest();\n \"onload\" in request ? request.onload = request.onerror = respond : request.onreadystatechange = function() {\n request.readyState > 3 && respond();\n };\n function respond() {\n var status = request.status, result;\n if (!status && d3_xhrHasResponse(request) || status >= 200 && status < 300 || status === 304) {\n try {\n result = response.call(xhr, request);\n } catch (e) {\n dispatch.error.call(xhr, e);\n return;\n }\n dispatch.load.call(xhr, result);\n } else {\n dispatch.error.call(xhr, request);\n }\n }\n request.onprogress = function(event) {\n var o = d3.event;\n d3.event = event;\n try {\n dispatch.progress.call(xhr, request);\n } finally {\n d3.event = o;\n }\n };\n xhr.header = function(name, value) {\n name = (name + \"\").toLowerCase();\n if (arguments.length < 2) return headers[name];\n if (value == null) delete headers[name]; else headers[name] = value + \"\";\n return xhr;\n };\n xhr.mimeType = function(value) {\n if (!arguments.length) return mimeType;\n mimeType = value == null ? null : value + \"\";\n return xhr;\n };\n xhr.responseType = function(value) {\n if (!arguments.length) return responseType;\n responseType = value;\n return xhr;\n };\n xhr.response = function(value) {\n response = value;\n return xhr;\n };\n [ \"get\", \"post\" ].forEach(function(method) {\n xhr[method] = function() {\n return xhr.send.apply(xhr, [ method ].concat(d3_array(arguments)));\n };\n });\n xhr.send = function(method, data, callback) {\n if (arguments.length === 2 && typeof data === \"function\") callback = data, data = null;\n request.open(method, url, true);\n if (mimeType != null && !(\"accept\" in headers)) headers[\"accept\"] = mimeType + \",*/*\";\n if (request.setRequestHeader) for (var name in headers) request.setRequestHeader(name, headers[name]);\n if (mimeType != null && request.overrideMimeType) request.overrideMimeType(mimeType);\n if (responseType != null) request.responseType = responseType;\n if (callback != null) xhr.on(\"error\", callback).on(\"load\", function(request) {\n callback(null, request);\n });\n dispatch.beforesend.call(xhr, request);\n request.send(data == null ? null : data);\n return xhr;\n };\n xhr.abort = function() {\n request.abort();\n return xhr;\n };\n d3.rebind(xhr, dispatch, \"on\");\n return callback == null ? xhr : xhr.get(d3_xhr_fixCallback(callback));\n }\n function d3_xhr_fixCallback(callback) {\n return callback.length === 1 ? function(error, request) {\n callback(error == null ? request : null);\n } : callback;\n }\n function d3_xhrHasResponse(request) {\n var type = request.responseType;\n return type && type !== \"text\" ? request.response : request.responseText;\n }\n d3.dsv = function(delimiter, mimeType) {\n var reFormat = new RegExp('[\"' + delimiter + \"\\n]\"), delimiterCode = delimiter.charCodeAt(0);\n function dsv(url, row, callback) {\n if (arguments.length < 3) callback = row, row = null;\n var xhr = d3_xhr(url, mimeType, row == null ? response : typedResponse(row), callback);\n xhr.row = function(_) {\n return arguments.length ? xhr.response((row = _) == null ? response : typedResponse(_)) : row;\n };\n return xhr;\n }\n function response(request) {\n return dsv.parse(request.responseText);\n }\n function typedResponse(f) {\n return function(request) {\n return dsv.parse(request.responseText, f);\n };\n }\n dsv.parse = function(text, f) {\n var o;\n return dsv.parseRows(text, function(row, i) {\n if (o) return o(row, i - 1);\n var a = new Function(\"d\", \"return {\" + row.map(function(name, i) {\n return JSON.stringify(name) + \": d[\" + i + \"]\";\n }).join(\",\") + \"}\");\n o = f ? function(row, i) {\n return f(a(row), i);\n } : a;\n });\n };\n dsv.parseRows = function(text, f) {\n var EOL = {}, EOF = {}, rows = [], N = text.length, I = 0, n = 0, t, eol;\n function token() {\n if (I >= N) return EOF;\n if (eol) return eol = false, EOL;\n var j = I;\n if (text.charCodeAt(j) === 34) {\n var i = j;\n while (i++ < N) {\n if (text.charCodeAt(i) === 34) {\n if (text.charCodeAt(i + 1) !== 34) break;\n ++i;\n }\n }\n I = i + 2;\n var c = text.charCodeAt(i + 1);\n if (c === 13) {\n eol = true;\n if (text.charCodeAt(i + 2) === 10) ++I;\n } else if (c === 10) {\n eol = true;\n }\n return text.slice(j + 1, i).replace(/\"\"/g, '\"');\n }\n while (I < N) {\n var c = text.charCodeAt(I++), k = 1;\n if (c === 10) eol = true; else if (c === 13) {\n eol = true;\n if (text.charCodeAt(I) === 10) ++I, ++k;\n } else if (c !== delimiterCode) continue;\n return text.slice(j, I - k);\n }\n return text.slice(j);\n }\n while ((t = token()) !== EOF) {\n var a = [];\n while (t !== EOL && t !== EOF) {\n a.push(t);\n t = token();\n }\n if (f && (a = f(a, n++)) == null) continue;\n rows.push(a);\n }\n return rows;\n };\n dsv.format = function(rows) {\n if (Array.isArray(rows[0])) return dsv.formatRows(rows);\n var fieldSet = new d3_Set(), fields = [];\n rows.forEach(function(row) {\n for (var field in row) {\n if (!fieldSet.has(field)) {\n fields.push(fieldSet.add(field));\n }\n }\n });\n return [ fields.map(formatValue).join(delimiter) ].concat(rows.map(function(row) {\n return fields.map(function(field) {\n return formatValue(row[field]);\n }).join(delimiter);\n })).join(\"\\n\");\n };\n dsv.formatRows = function(rows) {\n return rows.map(formatRow).join(\"\\n\");\n };\n function formatRow(row) {\n return row.map(formatValue).join(delimiter);\n }\n function formatValue(text) {\n return reFormat.test(text) ? '\"' + text.replace(/\\\"/g, '\"\"') + '\"' : text;\n }\n return dsv;\n };\n d3.csv = d3.dsv(\",\", \"text/csv\");\n d3.tsv = d3.dsv(\"\t\", \"text/tab-separated-values\");\n var d3_timer_queueHead, d3_timer_queueTail, d3_timer_interval, d3_timer_timeout, d3_timer_frame = this[d3_vendorSymbol(this, \"requestAnimationFrame\")] || function(callback) {\n setTimeout(callback, 17);\n };\n d3.timer = function() {\n d3_timer.apply(this, arguments);\n };\n function d3_timer(callback, delay, then) {\n var n = arguments.length;\n if (n < 2) delay = 0;\n if (n < 3) then = Date.now();\n var time = then + delay, timer = {\n c: callback,\n t: time,\n n: null\n };\n if (d3_timer_queueTail) d3_timer_queueTail.n = timer; else d3_timer_queueHead = timer;\n d3_timer_queueTail = timer;\n if (!d3_timer_interval) {\n d3_timer_timeout = clearTimeout(d3_timer_timeout);\n d3_timer_interval = 1;\n d3_timer_frame(d3_timer_step);\n }\n return timer;\n }\n function d3_timer_step() {\n var now = d3_timer_mark(), delay = d3_timer_sweep() - now;\n if (delay > 24) {\n if (isFinite(delay)) {\n clearTimeout(d3_timer_timeout);\n d3_timer_timeout = setTimeout(d3_timer_step, delay);\n }\n d3_timer_interval = 0;\n } else {\n d3_timer_interval = 1;\n d3_timer_frame(d3_timer_step);\n }\n }\n d3.timer.flush = function() {\n d3_timer_mark();\n d3_timer_sweep();\n };\n function d3_timer_mark() {\n var now = Date.now(), timer = d3_timer_queueHead;\n while (timer) {\n if (now >= timer.t && timer.c(now - timer.t)) timer.c = null;\n timer = timer.n;\n }\n return now;\n }\n function d3_timer_sweep() {\n var t0, t1 = d3_timer_queueHead, time = Infinity;\n while (t1) {\n if (t1.c) {\n if (t1.t < time) time = t1.t;\n t1 = (t0 = t1).n;\n } else {\n t1 = t0 ? t0.n = t1.n : d3_timer_queueHead = t1.n;\n }\n }\n d3_timer_queueTail = t0;\n return time;\n }\n function d3_format_precision(x, p) {\n return p - (x ? Math.ceil(Math.log(x) / Math.LN10) : 1);\n }\n d3.round = function(x, n) {\n return n ? Math.round(x * (n = Math.pow(10, n))) / n : Math.round(x);\n };\n var d3_formatPrefixes = [ \"y\", \"z\", \"a\", \"f\", \"p\", \"n\", \"µ\", \"m\", \"\", \"k\", \"M\", \"G\", \"T\", \"P\", \"E\", \"Z\", \"Y\" ].map(d3_formatPrefix);\n d3.formatPrefix = function(value, precision) {\n var i = 0;\n if (value = +value) {\n if (value < 0) value *= -1;\n if (precision) value = d3.round(value, d3_format_precision(value, precision));\n i = 1 + Math.floor(1e-12 + Math.log(value) / Math.LN10);\n i = Math.max(-24, Math.min(24, Math.floor((i - 1) / 3) * 3));\n }\n return d3_formatPrefixes[8 + i / 3];\n };\n function d3_formatPrefix(d, i) {\n var k = Math.pow(10, abs(8 - i) * 3);\n return {\n scale: i > 8 ? function(d) {\n return d / k;\n } : function(d) {\n return d * k;\n },\n symbol: d\n };\n }\n function d3_locale_numberFormat(locale) {\n var locale_decimal = locale.decimal, locale_thousands = locale.thousands, locale_grouping = locale.grouping, locale_currency = locale.currency, formatGroup = locale_grouping && locale_thousands ? function(value, width) {\n var i = value.length, t = [], j = 0, g = locale_grouping[0], length = 0;\n while (i > 0 && g > 0) {\n if (length + g + 1 > width) g = Math.max(1, width - length);\n t.push(value.substring(i -= g, i + g));\n if ((length += g + 1) > width) break;\n g = locale_grouping[j = (j + 1) % locale_grouping.length];\n }\n return t.reverse().join(locale_thousands);\n } : d3_identity;\n return function(specifier) {\n var match = d3_format_re.exec(specifier), fill = match[1] || \" \", align = match[2] || \">\", sign = match[3] || \"-\", symbol = match[4] || \"\", zfill = match[5], width = +match[6], comma = match[7], precision = match[8], type = match[9], scale = 1, prefix = \"\", suffix = \"\", integer = false, exponent = true;\n if (precision) precision = +precision.substring(1);\n if (zfill || fill === \"0\" && align === \"=\") {\n zfill = fill = \"0\";\n align = \"=\";\n }\n switch (type) {\n case \"n\":\n comma = true;\n type = \"g\";\n break;\n\n case \"%\":\n scale = 100;\n suffix = \"%\";\n type = \"f\";\n break;\n\n case \"p\":\n scale = 100;\n suffix = \"%\";\n type = \"r\";\n break;\n\n case \"b\":\n case \"o\":\n case \"x\":\n case \"X\":\n if (symbol === \"#\") prefix = \"0\" + type.toLowerCase();\n\n case \"c\":\n exponent = false;\n\n case \"d\":\n integer = true;\n precision = 0;\n break;\n\n case \"s\":\n scale = -1;\n type = \"r\";\n break;\n }\n if (symbol === \"$\") prefix = locale_currency[0], suffix = locale_currency[1];\n if (type == \"r\" && !precision) type = \"g\";\n if (precision != null) {\n if (type == \"g\") precision = Math.max(1, Math.min(21, precision)); else if (type == \"e\" || type == \"f\") precision = Math.max(0, Math.min(20, precision));\n }\n type = d3_format_types.get(type) || d3_format_typeDefault;\n var zcomma = zfill && comma;\n return function(value) {\n var fullSuffix = suffix;\n if (integer && value % 1) return \"\";\n var negative = value < 0 || value === 0 && 1 / value < 0 ? (value = -value, \"-\") : sign === \"-\" ? \"\" : sign;\n if (scale < 0) {\n var unit = d3.formatPrefix(value, precision);\n value = unit.scale(value);\n fullSuffix = unit.symbol + suffix;\n } else {\n value *= scale;\n }\n value = type(value, precision);\n var i = value.lastIndexOf(\".\"), before, after;\n if (i < 0) {\n var j = exponent ? value.lastIndexOf(\"e\") : -1;\n if (j < 0) before = value, after = \"\"; else before = value.substring(0, j), after = value.substring(j);\n } else {\n before = value.substring(0, i);\n after = locale_decimal + value.substring(i + 1);\n }\n if (!zfill && comma) before = formatGroup(before, Infinity);\n var length = prefix.length + before.length + after.length + (zcomma ? 0 : negative.length), padding = length < width ? new Array(length = width - length + 1).join(fill) : \"\";\n if (zcomma) before = formatGroup(padding + before, padding.length ? width - after.length : Infinity);\n negative += prefix;\n value = before + after;\n return (align === \"<\" ? negative + value + padding : align === \">\" ? padding + negative + value : align === \"^\" ? padding.substring(0, length >>= 1) + negative + value + padding.substring(length) : negative + (zcomma ? value : padding + value)) + fullSuffix;\n };\n };\n }\n var d3_format_re = /(?:([^{])?([<>=^]))?([+\\- ])?([$#])?(0)?(\\d+)?(,)?(\\.-?\\d+)?([a-z%])?/i;\n var d3_format_types = d3.map({\n b: function(x) {\n return x.toString(2);\n },\n c: function(x) {\n return String.fromCharCode(x);\n },\n o: function(x) {\n return x.toString(8);\n },\n x: function(x) {\n return x.toString(16);\n },\n X: function(x) {\n return x.toString(16).toUpperCase();\n },\n g: function(x, p) {\n return x.toPrecision(p);\n },\n e: function(x, p) {\n return x.toExponential(p);\n },\n f: function(x, p) {\n return x.toFixed(p);\n },\n r: function(x, p) {\n return (x = d3.round(x, d3_format_precision(x, p))).toFixed(Math.max(0, Math.min(20, d3_format_precision(x * (1 + 1e-15), p))));\n }\n });\n function d3_format_typeDefault(x) {\n return x + \"\";\n }\n var d3_time = d3.time = {}, d3_date = Date;\n function d3_date_utc() {\n this._ = new Date(arguments.length > 1 ? Date.UTC.apply(this, arguments) : arguments[0]);\n }\n d3_date_utc.prototype = {\n getDate: function() {\n return this._.getUTCDate();\n },\n getDay: function() {\n return this._.getUTCDay();\n },\n getFullYear: function() {\n return this._.getUTCFullYear();\n },\n getHours: function() {\n return this._.getUTCHours();\n },\n getMilliseconds: function() {\n return this._.getUTCMilliseconds();\n },\n getMinutes: function() {\n return this._.getUTCMinutes();\n },\n getMonth: function() {\n return this._.getUTCMonth();\n },\n getSeconds: function() {\n return this._.getUTCSeconds();\n },\n getTime: function() {\n return this._.getTime();\n },\n getTimezoneOffset: function() {\n return 0;\n },\n valueOf: function() {\n return this._.valueOf();\n },\n setDate: function() {\n d3_time_prototype.setUTCDate.apply(this._, arguments);\n },\n setDay: function() {\n d3_time_prototype.setUTCDay.apply(this._, arguments);\n },\n setFullYear: function() {\n d3_time_prototype.setUTCFullYear.apply(this._, arguments);\n },\n setHours: function() {\n d3_time_prototype.setUTCHours.apply(this._, arguments);\n },\n setMilliseconds: function() {\n d3_time_prototype.setUTCMilliseconds.apply(this._, arguments);\n },\n setMinutes: function() {\n d3_time_prototype.setUTCMinutes.apply(this._, arguments);\n },\n setMonth: function() {\n d3_time_prototype.setUTCMonth.apply(this._, arguments);\n },\n setSeconds: function() {\n d3_time_prototype.setUTCSeconds.apply(this._, arguments);\n },\n setTime: function() {\n d3_time_prototype.setTime.apply(this._, arguments);\n }\n };\n var d3_time_prototype = Date.prototype;\n function d3_time_interval(local, step, number) {\n function round(date) {\n var d0 = local(date), d1 = offset(d0, 1);\n return date - d0 < d1 - date ? d0 : d1;\n }\n function ceil(date) {\n step(date = local(new d3_date(date - 1)), 1);\n return date;\n }\n function offset(date, k) {\n step(date = new d3_date(+date), k);\n return date;\n }\n function range(t0, t1, dt) {\n var time = ceil(t0), times = [];\n if (dt > 1) {\n while (time < t1) {\n if (!(number(time) % dt)) times.push(new Date(+time));\n step(time, 1);\n }\n } else {\n while (time < t1) times.push(new Date(+time)), step(time, 1);\n }\n return times;\n }\n function range_utc(t0, t1, dt) {\n try {\n d3_date = d3_date_utc;\n var utc = new d3_date_utc();\n utc._ = t0;\n return range(utc, t1, dt);\n } finally {\n d3_date = Date;\n }\n }\n local.floor = local;\n local.round = round;\n local.ceil = ceil;\n local.offset = offset;\n local.range = range;\n var utc = local.utc = d3_time_interval_utc(local);\n utc.floor = utc;\n utc.round = d3_time_interval_utc(round);\n utc.ceil = d3_time_interval_utc(ceil);\n utc.offset = d3_time_interval_utc(offset);\n utc.range = range_utc;\n return local;\n }\n function d3_time_interval_utc(method) {\n return function(date, k) {\n try {\n d3_date = d3_date_utc;\n var utc = new d3_date_utc();\n utc._ = date;\n return method(utc, k)._;\n } finally {\n d3_date = Date;\n }\n };\n }\n d3_time.year = d3_time_interval(function(date) {\n date = d3_time.day(date);\n date.setMonth(0, 1);\n return date;\n }, function(date, offset) {\n date.setFullYear(date.getFullYear() + offset);\n }, function(date) {\n return date.getFullYear();\n });\n d3_time.years = d3_time.year.range;\n d3_time.years.utc = d3_time.year.utc.range;\n d3_time.day = d3_time_interval(function(date) {\n var day = new d3_date(2e3, 0);\n day.setFullYear(date.getFullYear(), date.getMonth(), date.getDate());\n return day;\n }, function(date, offset) {\n date.setDate(date.getDate() + offset);\n }, function(date) {\n return date.getDate() - 1;\n });\n d3_time.days = d3_time.day.range;\n d3_time.days.utc = d3_time.day.utc.range;\n d3_time.dayOfYear = function(date) {\n var year = d3_time.year(date);\n return Math.floor((date - year - (date.getTimezoneOffset() - year.getTimezoneOffset()) * 6e4) / 864e5);\n };\n [ \"sunday\", \"monday\", \"tuesday\", \"wednesday\", \"thursday\", \"friday\", \"saturday\" ].forEach(function(day, i) {\n i = 7 - i;\n var interval = d3_time[day] = d3_time_interval(function(date) {\n (date = d3_time.day(date)).setDate(date.getDate() - (date.getDay() + i) % 7);\n return date;\n }, function(date, offset) {\n date.setDate(date.getDate() + Math.floor(offset) * 7);\n }, function(date) {\n var day = d3_time.year(date).getDay();\n return Math.floor((d3_time.dayOfYear(date) + (day + i) % 7) / 7) - (day !== i);\n });\n d3_time[day + \"s\"] = interval.range;\n d3_time[day + \"s\"].utc = interval.utc.range;\n d3_time[day + \"OfYear\"] = function(date) {\n var day = d3_time.year(date).getDay();\n return Math.floor((d3_time.dayOfYear(date) + (day + i) % 7) / 7);\n };\n });\n d3_time.week = d3_time.sunday;\n d3_time.weeks = d3_time.sunday.range;\n d3_time.weeks.utc = d3_time.sunday.utc.range;\n d3_time.weekOfYear = d3_time.sundayOfYear;\n function d3_locale_timeFormat(locale) {\n var locale_dateTime = locale.dateTime, locale_date = locale.date, locale_time = locale.time, locale_periods = locale.periods, locale_days = locale.days, locale_shortDays = locale.shortDays, locale_months = locale.months, locale_shortMonths = locale.shortMonths;\n function d3_time_format(template) {\n var n = template.length;\n function format(date) {\n var string = [], i = -1, j = 0, c, p, f;\n while (++i < n) {\n if (template.charCodeAt(i) === 37) {\n string.push(template.slice(j, i));\n if ((p = d3_time_formatPads[c = template.charAt(++i)]) != null) c = template.charAt(++i);\n if (f = d3_time_formats[c]) c = f(date, p == null ? c === \"e\" ? \" \" : \"0\" : p);\n string.push(c);\n j = i + 1;\n }\n }\n string.push(template.slice(j, i));\n return string.join(\"\");\n }\n format.parse = function(string) {\n var d = {\n y: 1900,\n m: 0,\n d: 1,\n H: 0,\n M: 0,\n S: 0,\n L: 0,\n Z: null\n }, i = d3_time_parse(d, template, string, 0);\n if (i != string.length) return null;\n if (\"p\" in d) d.H = d.H % 12 + d.p * 12;\n var localZ = d.Z != null && d3_date !== d3_date_utc, date = new (localZ ? d3_date_utc : d3_date)();\n if (\"j\" in d) date.setFullYear(d.y, 0, d.j); else if (\"W\" in d || \"U\" in d) {\n if (!(\"w\" in d)) d.w = \"W\" in d ? 1 : 0;\n date.setFullYear(d.y, 0, 1);\n date.setFullYear(d.y, 0, \"W\" in d ? (d.w + 6) % 7 + d.W * 7 - (date.getDay() + 5) % 7 : d.w + d.U * 7 - (date.getDay() + 6) % 7);\n } else date.setFullYear(d.y, d.m, d.d);\n date.setHours(d.H + (d.Z / 100 | 0), d.M + d.Z % 100, d.S, d.L);\n return localZ ? date._ : date;\n };\n format.toString = function() {\n return template;\n };\n return format;\n }\n function d3_time_parse(date, template, string, j) {\n var c, p, t, i = 0, n = template.length, m = string.length;\n while (i < n) {\n if (j >= m) return -1;\n c = template.charCodeAt(i++);\n if (c === 37) {\n t = template.charAt(i++);\n p = d3_time_parsers[t in d3_time_formatPads ? template.charAt(i++) : t];\n if (!p || (j = p(date, string, j)) < 0) return -1;\n } else if (c != string.charCodeAt(j++)) {\n return -1;\n }\n }\n return j;\n }\n d3_time_format.utc = function(template) {\n var local = d3_time_format(template);\n function format(date) {\n try {\n d3_date = d3_date_utc;\n var utc = new d3_date();\n utc._ = date;\n return local(utc);\n } finally {\n d3_date = Date;\n }\n }\n format.parse = function(string) {\n try {\n d3_date = d3_date_utc;\n var date = local.parse(string);\n return date && date._;\n } finally {\n d3_date = Date;\n }\n };\n format.toString = local.toString;\n return format;\n };\n d3_time_format.multi = d3_time_format.utc.multi = d3_time_formatMulti;\n var d3_time_periodLookup = d3.map(), d3_time_dayRe = d3_time_formatRe(locale_days), d3_time_dayLookup = d3_time_formatLookup(locale_days), d3_time_dayAbbrevRe = d3_time_formatRe(locale_shortDays), d3_time_dayAbbrevLookup = d3_time_formatLookup(locale_shortDays), d3_time_monthRe = d3_time_formatRe(locale_months), d3_time_monthLookup = d3_time_formatLookup(locale_months), d3_time_monthAbbrevRe = d3_time_formatRe(locale_shortMonths), d3_time_monthAbbrevLookup = d3_time_formatLookup(locale_shortMonths);\n locale_periods.forEach(function(p, i) {\n d3_time_periodLookup.set(p.toLowerCase(), i);\n });\n var d3_time_formats = {\n a: function(d) {\n return locale_shortDays[d.getDay()];\n },\n A: function(d) {\n return locale_days[d.getDay()];\n },\n b: function(d) {\n return locale_shortMonths[d.getMonth()];\n },\n B: function(d) {\n return locale_months[d.getMonth()];\n },\n c: d3_time_format(locale_dateTime),\n d: function(d, p) {\n return d3_time_formatPad(d.getDate(), p, 2);\n },\n e: function(d, p) {\n return d3_time_formatPad(d.getDate(), p, 2);\n },\n H: function(d, p) {\n return d3_time_formatPad(d.getHours(), p, 2);\n },\n I: function(d, p) {\n return d3_time_formatPad(d.getHours() % 12 || 12, p, 2);\n },\n j: function(d, p) {\n return d3_time_formatPad(1 + d3_time.dayOfYear(d), p, 3);\n },\n L: function(d, p) {\n return d3_time_formatPad(d.getMilliseconds(), p, 3);\n },\n m: function(d, p) {\n return d3_time_formatPad(d.getMonth() + 1, p, 2);\n },\n M: function(d, p) {\n return d3_time_formatPad(d.getMinutes(), p, 2);\n },\n p: function(d) {\n return locale_periods[+(d.getHours() >= 12)];\n },\n S: function(d, p) {\n return d3_time_formatPad(d.getSeconds(), p, 2);\n },\n U: function(d, p) {\n return d3_time_formatPad(d3_time.sundayOfYear(d), p, 2);\n },\n w: function(d) {\n return d.getDay();\n },\n W: function(d, p) {\n return d3_time_formatPad(d3_time.mondayOfYear(d), p, 2);\n },\n x: d3_time_format(locale_date),\n X: d3_time_format(locale_time),\n y: function(d, p) {\n return d3_time_formatPad(d.getFullYear() % 100, p, 2);\n },\n Y: function(d, p) {\n return d3_time_formatPad(d.getFullYear() % 1e4, p, 4);\n },\n Z: d3_time_zone,\n \"%\": function() {\n return \"%\";\n }\n };\n var d3_time_parsers = {\n a: d3_time_parseWeekdayAbbrev,\n A: d3_time_parseWeekday,\n b: d3_time_parseMonthAbbrev,\n B: d3_time_parseMonth,\n c: d3_time_parseLocaleFull,\n d: d3_time_parseDay,\n e: d3_time_parseDay,\n H: d3_time_parseHour24,\n I: d3_time_parseHour24,\n j: d3_time_parseDayOfYear,\n L: d3_time_parseMilliseconds,\n m: d3_time_parseMonthNumber,\n M: d3_time_parseMinutes,\n p: d3_time_parseAmPm,\n S: d3_time_parseSeconds,\n U: d3_time_parseWeekNumberSunday,\n w: d3_time_parseWeekdayNumber,\n W: d3_time_parseWeekNumberMonday,\n x: d3_time_parseLocaleDate,\n X: d3_time_parseLocaleTime,\n y: d3_time_parseYear,\n Y: d3_time_parseFullYear,\n Z: d3_time_parseZone,\n \"%\": d3_time_parseLiteralPercent\n };\n function d3_time_parseWeekdayAbbrev(date, string, i) {\n d3_time_dayAbbrevRe.lastIndex = 0;\n var n = d3_time_dayAbbrevRe.exec(string.slice(i));\n return n ? (date.w = d3_time_dayAbbrevLookup.get(n[0].toLowerCase()), i + n[0].length) : -1;\n }\n function d3_time_parseWeekday(date, string, i) {\n d3_time_dayRe.lastIndex = 0;\n var n = d3_time_dayRe.exec(string.slice(i));\n return n ? (date.w = d3_time_dayLookup.get(n[0].toLowerCase()), i + n[0].length) : -1;\n }\n function d3_time_parseMonthAbbrev(date, string, i) {\n d3_time_monthAbbrevRe.lastIndex = 0;\n var n = d3_time_monthAbbrevRe.exec(string.slice(i));\n return n ? (date.m = d3_time_monthAbbrevLookup.get(n[0].toLowerCase()), i + n[0].length) : -1;\n }\n function d3_time_parseMonth(date, string, i) {\n d3_time_monthRe.lastIndex = 0;\n var n = d3_time_monthRe.exec(string.slice(i));\n return n ? (date.m = d3_time_monthLookup.get(n[0].toLowerCase()), i + n[0].length) : -1;\n }\n function d3_time_parseLocaleFull(date, string, i) {\n return d3_time_parse(date, d3_time_formats.c.toString(), string, i);\n }\n function d3_time_parseLocaleDate(date, string, i) {\n return d3_time_parse(date, d3_time_formats.x.toString(), string, i);\n }\n function d3_time_parseLocaleTime(date, string, i) {\n return d3_time_parse(date, d3_time_formats.X.toString(), string, i);\n }\n function d3_time_parseAmPm(date, string, i) {\n var n = d3_time_periodLookup.get(string.slice(i, i += 2).toLowerCase());\n return n == null ? -1 : (date.p = n, i);\n }\n return d3_time_format;\n }\n var d3_time_formatPads = {\n \"-\": \"\",\n _: \" \",\n \"0\": \"0\"\n }, d3_time_numberRe = /^\\s*\\d+/, d3_time_percentRe = /^%/;\n function d3_time_formatPad(value, fill, width) {\n var sign = value < 0 ? \"-\" : \"\", string = (sign ? -value : value) + \"\", length = string.length;\n return sign + (length < width ? new Array(width - length + 1).join(fill) + string : string);\n }\n function d3_time_formatRe(names) {\n return new RegExp(\"^(?:\" + names.map(d3.requote).join(\"|\") + \")\", \"i\");\n }\n function d3_time_formatLookup(names) {\n var map = new d3_Map(), i = -1, n = names.length;\n while (++i < n) map.set(names[i].toLowerCase(), i);\n return map;\n }\n function d3_time_parseWeekdayNumber(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 1));\n return n ? (date.w = +n[0], i + n[0].length) : -1;\n }\n function d3_time_parseWeekNumberSunday(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i));\n return n ? (date.U = +n[0], i + n[0].length) : -1;\n }\n function d3_time_parseWeekNumberMonday(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i));\n return n ? (date.W = +n[0], i + n[0].length) : -1;\n }\n function d3_time_parseFullYear(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 4));\n return n ? (date.y = +n[0], i + n[0].length) : -1;\n }\n function d3_time_parseYear(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 2));\n return n ? (date.y = d3_time_expandYear(+n[0]), i + n[0].length) : -1;\n }\n function d3_time_parseZone(date, string, i) {\n return /^[+-]\\d{4}$/.test(string = string.slice(i, i + 5)) ? (date.Z = -string, \n i + 5) : -1;\n }\n function d3_time_expandYear(d) {\n return d + (d > 68 ? 1900 : 2e3);\n }\n function d3_time_parseMonthNumber(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 2));\n return n ? (date.m = n[0] - 1, i + n[0].length) : -1;\n }\n function d3_time_parseDay(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 2));\n return n ? (date.d = +n[0], i + n[0].length) : -1;\n }\n function d3_time_parseDayOfYear(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 3));\n return n ? (date.j = +n[0], i + n[0].length) : -1;\n }\n function d3_time_parseHour24(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 2));\n return n ? (date.H = +n[0], i + n[0].length) : -1;\n }\n function d3_time_parseMinutes(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 2));\n return n ? (date.M = +n[0], i + n[0].length) : -1;\n }\n function d3_time_parseSeconds(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 2));\n return n ? (date.S = +n[0], i + n[0].length) : -1;\n }\n function d3_time_parseMilliseconds(date, string, i) {\n d3_time_numberRe.lastIndex = 0;\n var n = d3_time_numberRe.exec(string.slice(i, i + 3));\n return n ? (date.L = +n[0], i + n[0].length) : -1;\n }\n function d3_time_zone(d) {\n var z = d.getTimezoneOffset(), zs = z > 0 ? \"-\" : \"+\", zh = abs(z) / 60 | 0, zm = abs(z) % 60;\n return zs + d3_time_formatPad(zh, \"0\", 2) + d3_time_formatPad(zm, \"0\", 2);\n }\n function d3_time_parseLiteralPercent(date, string, i) {\n d3_time_percentRe.lastIndex = 0;\n var n = d3_time_percentRe.exec(string.slice(i, i + 1));\n return n ? i + n[0].length : -1;\n }\n function d3_time_formatMulti(formats) {\n var n = formats.length, i = -1;\n while (++i < n) formats[i][0] = this(formats[i][0]);\n return function(date) {\n var i = 0, f = formats[i];\n while (!f[1](date)) f = formats[++i];\n return f[0](date);\n };\n }\n d3.locale = function(locale) {\n return {\n numberFormat: d3_locale_numberFormat(locale),\n timeFormat: d3_locale_timeFormat(locale)\n };\n };\n var d3_locale_enUS = d3.locale({\n decimal: \".\",\n thousands: \",\",\n grouping: [ 3 ],\n currency: [ \"$\", \"\" ],\n dateTime: \"%a %b %e %X %Y\",\n date: \"%m/%d/%Y\",\n time: \"%H:%M:%S\",\n periods: [ \"AM\", \"PM\" ],\n days: [ \"Sunday\", \"Monday\", \"Tuesday\", \"Wednesday\", \"Thursday\", \"Friday\", \"Saturday\" ],\n shortDays: [ \"Sun\", \"Mon\", \"Tue\", \"Wed\", \"Thu\", \"Fri\", \"Sat\" ],\n months: [ \"January\", \"February\", \"March\", \"April\", \"May\", \"June\", \"July\", \"August\", \"September\", \"October\", \"November\", \"December\" ],\n shortMonths: [ \"Jan\", \"Feb\", \"Mar\", \"Apr\", \"May\", \"Jun\", \"Jul\", \"Aug\", \"Sep\", \"Oct\", \"Nov\", \"Dec\" ]\n });\n d3.format = d3_locale_enUS.numberFormat;\n d3.geo = {};\n function d3_adder() {}\n d3_adder.prototype = {\n s: 0,\n t: 0,\n add: function(y) {\n d3_adderSum(y, this.t, d3_adderTemp);\n d3_adderSum(d3_adderTemp.s, this.s, this);\n if (this.s) this.t += d3_adderTemp.t; else this.s = d3_adderTemp.t;\n },\n reset: function() {\n this.s = this.t = 0;\n },\n valueOf: function() {\n return this.s;\n }\n };\n var d3_adderTemp = new d3_adder();\n function d3_adderSum(a, b, o) {\n var x = o.s = a + b, bv = x - a, av = x - bv;\n o.t = a - av + (b - bv);\n }\n d3.geo.stream = function(object, listener) {\n if (object && d3_geo_streamObjectType.hasOwnProperty(object.type)) {\n d3_geo_streamObjectType[object.type](object, listener);\n } else {\n d3_geo_streamGeometry(object, listener);\n }\n };\n function d3_geo_streamGeometry(geometry, listener) {\n if (geometry && d3_geo_streamGeometryType.hasOwnProperty(geometry.type)) {\n d3_geo_streamGeometryType[geometry.type](geometry, listener);\n }\n }\n var d3_geo_streamObjectType = {\n Feature: function(feature, listener) {\n d3_geo_streamGeometry(feature.geometry, listener);\n },\n FeatureCollection: function(object, listener) {\n var features = object.features, i = -1, n = features.length;\n while (++i < n) d3_geo_streamGeometry(features[i].geometry, listener);\n }\n };\n var d3_geo_streamGeometryType = {\n Sphere: function(object, listener) {\n listener.sphere();\n },\n Point: function(object, listener) {\n object = object.coordinates;\n listener.point(object[0], object[1], object[2]);\n },\n MultiPoint: function(object, listener) {\n var coordinates = object.coordinates, i = -1, n = coordinates.length;\n while (++i < n) object = coordinates[i], listener.point(object[0], object[1], object[2]);\n },\n LineString: function(object, listener) {\n d3_geo_streamLine(object.coordinates, listener, 0);\n },\n MultiLineString: function(object, listener) {\n var coordinates = object.coordinates, i = -1, n = coordinates.length;\n while (++i < n) d3_geo_streamLine(coordinates[i], listener, 0);\n },\n Polygon: function(object, listener) {\n d3_geo_streamPolygon(object.coordinates, listener);\n },\n MultiPolygon: function(object, listener) {\n var coordinates = object.coordinates, i = -1, n = coordinates.length;\n while (++i < n) d3_geo_streamPolygon(coordinates[i], listener);\n },\n GeometryCollection: function(object, listener) {\n var geometries = object.geometries, i = -1, n = geometries.length;\n while (++i < n) d3_geo_streamGeometry(geometries[i], listener);\n }\n };\n function d3_geo_streamLine(coordinates, listener, closed) {\n var i = -1, n = coordinates.length - closed, coordinate;\n listener.lineStart();\n while (++i < n) coordinate = coordinates[i], listener.point(coordinate[0], coordinate[1], coordinate[2]);\n listener.lineEnd();\n }\n function d3_geo_streamPolygon(coordinates, listener) {\n var i = -1, n = coordinates.length;\n listener.polygonStart();\n while (++i < n) d3_geo_streamLine(coordinates[i], listener, 1);\n listener.polygonEnd();\n }\n d3.geo.area = function(object) {\n d3_geo_areaSum = 0;\n d3.geo.stream(object, d3_geo_area);\n return d3_geo_areaSum;\n };\n var d3_geo_areaSum, d3_geo_areaRingSum = new d3_adder();\n var d3_geo_area = {\n sphere: function() {\n d3_geo_areaSum += 4 * π;\n },\n point: d3_noop,\n lineStart: d3_noop,\n lineEnd: d3_noop,\n polygonStart: function() {\n d3_geo_areaRingSum.reset();\n d3_geo_area.lineStart = d3_geo_areaRingStart;\n },\n polygonEnd: function() {\n var area = 2 * d3_geo_areaRingSum;\n d3_geo_areaSum += area < 0 ? 4 * π + area : area;\n d3_geo_area.lineStart = d3_geo_area.lineEnd = d3_geo_area.point = d3_noop;\n }\n };\n function d3_geo_areaRingStart() {\n var λ00, φ00, λ0, cosφ0, sinφ0;\n d3_geo_area.point = function(λ, φ) {\n d3_geo_area.point = nextPoint;\n λ0 = (λ00 = λ) * d3_radians, cosφ0 = Math.cos(φ = (φ00 = φ) * d3_radians / 2 + π / 4), \n sinφ0 = Math.sin(φ);\n };\n function nextPoint(λ, φ) {\n λ *= d3_radians;\n φ = φ * d3_radians / 2 + π / 4;\n var dλ = λ - λ0, sdλ = dλ >= 0 ? 1 : -1, adλ = sdλ * dλ, cosφ = Math.cos(φ), sinφ = Math.sin(φ), k = sinφ0 * sinφ, u = cosφ0 * cosφ + k * Math.cos(adλ), v = k * sdλ * Math.sin(adλ);\n d3_geo_areaRingSum.add(Math.atan2(v, u));\n λ0 = λ, cosφ0 = cosφ, sinφ0 = sinφ;\n }\n d3_geo_area.lineEnd = function() {\n nextPoint(λ00, φ00);\n };\n }\n function d3_geo_cartesian(spherical) {\n var λ = spherical[0], φ = spherical[1], cosφ = Math.cos(φ);\n return [ cosφ * Math.cos(λ), cosφ * Math.sin(λ), Math.sin(φ) ];\n }\n function d3_geo_cartesianDot(a, b) {\n return a[0] * b[0] + a[1] * b[1] + a[2] * b[2];\n }\n function d3_geo_cartesianCross(a, b) {\n return [ a[1] * b[2] - a[2] * b[1], a[2] * b[0] - a[0] * b[2], a[0] * b[1] - a[1] * b[0] ];\n }\n function d3_geo_cartesianAdd(a, b) {\n a[0] += b[0];\n a[1] += b[1];\n a[2] += b[2];\n }\n function d3_geo_cartesianScale(vector, k) {\n return [ vector[0] * k, vector[1] * k, vector[2] * k ];\n }\n function d3_geo_cartesianNormalize(d) {\n var l = Math.sqrt(d[0] * d[0] + d[1] * d[1] + d[2] * d[2]);\n d[0] /= l;\n d[1] /= l;\n d[2] /= l;\n }\n function d3_geo_spherical(cartesian) {\n return [ Math.atan2(cartesian[1], cartesian[0]), d3_asin(cartesian[2]) ];\n }\n function d3_geo_sphericalEqual(a, b) {\n return abs(a[0] - b[0]) < ε && abs(a[1] - b[1]) < ε;\n }\n d3.geo.bounds = function() {\n var λ0, φ0, λ1, φ1, λ_, λ__, φ__, p0, dλSum, ranges, range;\n var bound = {\n point: point,\n lineStart: lineStart,\n lineEnd: lineEnd,\n polygonStart: function() {\n bound.point = ringPoint;\n bound.lineStart = ringStart;\n bound.lineEnd = ringEnd;\n dλSum = 0;\n d3_geo_area.polygonStart();\n },\n polygonEnd: function() {\n d3_geo_area.polygonEnd();\n bound.point = point;\n bound.lineStart = lineStart;\n bound.lineEnd = lineEnd;\n if (d3_geo_areaRingSum < 0) λ0 = -(λ1 = 180), φ0 = -(φ1 = 90); else if (dλSum > ε) φ1 = 90; else if (dλSum < -ε) φ0 = -90;\n range[0] = λ0, range[1] = λ1;\n }\n };\n function point(λ, φ) {\n ranges.push(range = [ λ0 = λ, λ1 = λ ]);\n if (φ < φ0) φ0 = φ;\n if (φ > φ1) φ1 = φ;\n }\n function linePoint(λ, φ) {\n var p = d3_geo_cartesian([ λ * d3_radians, φ * d3_radians ]);\n if (p0) {\n var normal = d3_geo_cartesianCross(p0, p), equatorial = [ normal[1], -normal[0], 0 ], inflection = d3_geo_cartesianCross(equatorial, normal);\n d3_geo_cartesianNormalize(inflection);\n inflection = d3_geo_spherical(inflection);\n var dλ = λ - λ_, s = dλ > 0 ? 1 : -1, λi = inflection[0] * d3_degrees * s, antimeridian = abs(dλ) > 180;\n if (antimeridian ^ (s * λ_ < λi && λi < s * λ)) {\n var φi = inflection[1] * d3_degrees;\n if (φi > φ1) φ1 = φi;\n } else if (λi = (λi + 360) % 360 - 180, antimeridian ^ (s * λ_ < λi && λi < s * λ)) {\n var φi = -inflection[1] * d3_degrees;\n if (φi < φ0) φ0 = φi;\n } else {\n if (φ < φ0) φ0 = φ;\n if (φ > φ1) φ1 = φ;\n }\n if (antimeridian) {\n if (λ < λ_) {\n if (angle(λ0, λ) > angle(λ0, λ1)) λ1 = λ;\n } else {\n if (angle(λ, λ1) > angle(λ0, λ1)) λ0 = λ;\n }\n } else {\n if (λ1 >= λ0) {\n if (λ < λ0) λ0 = λ;\n if (λ > λ1) λ1 = λ;\n } else {\n if (λ > λ_) {\n if (angle(λ0, λ) > angle(λ0, λ1)) λ1 = λ;\n } else {\n if (angle(λ, λ1) > angle(λ0, λ1)) λ0 = λ;\n }\n }\n }\n } else {\n point(λ, φ);\n }\n p0 = p, λ_ = λ;\n }\n function lineStart() {\n bound.point = linePoint;\n }\n function lineEnd() {\n range[0] = λ0, range[1] = λ1;\n bound.point = point;\n p0 = null;\n }\n function ringPoint(λ, φ) {\n if (p0) {\n var dλ = λ - λ_;\n dλSum += abs(dλ) > 180 ? dλ + (dλ > 0 ? 360 : -360) : dλ;\n } else λ__ = λ, φ__ = φ;\n d3_geo_area.point(λ, φ);\n linePoint(λ, φ);\n }\n function ringStart() {\n d3_geo_area.lineStart();\n }\n function ringEnd() {\n ringPoint(λ__, φ__);\n d3_geo_area.lineEnd();\n if (abs(dλSum) > ε) λ0 = -(λ1 = 180);\n range[0] = λ0, range[1] = λ1;\n p0 = null;\n }\n function angle(λ0, λ1) {\n return (λ1 -= λ0) < 0 ? λ1 + 360 : λ1;\n }\n function compareRanges(a, b) {\n return a[0] - b[0];\n }\n function withinRange(x, range) {\n return range[0] <= range[1] ? range[0] <= x && x <= range[1] : x < range[0] || range[1] < x;\n }\n return function(feature) {\n φ1 = λ1 = -(λ0 = φ0 = Infinity);\n ranges = [];\n d3.geo.stream(feature, bound);\n var n = ranges.length;\n if (n) {\n ranges.sort(compareRanges);\n for (var i = 1, a = ranges[0], b, merged = [ a ]; i < n; ++i) {\n b = ranges[i];\n if (withinRange(b[0], a) || withinRange(b[1], a)) {\n if (angle(a[0], b[1]) > angle(a[0], a[1])) a[1] = b[1];\n if (angle(b[0], a[1]) > angle(a[0], a[1])) a[0] = b[0];\n } else {\n merged.push(a = b);\n }\n }\n var best = -Infinity, dλ;\n for (var n = merged.length - 1, i = 0, a = merged[n], b; i <= n; a = b, ++i) {\n b = merged[i];\n if ((dλ = angle(a[1], b[0])) > best) best = dλ, λ0 = b[0], λ1 = a[1];\n }\n }\n ranges = range = null;\n return λ0 === Infinity || φ0 === Infinity ? [ [ NaN, NaN ], [ NaN, NaN ] ] : [ [ λ0, φ0 ], [ λ1, φ1 ] ];\n };\n }();\n d3.geo.centroid = function(object) {\n d3_geo_centroidW0 = d3_geo_centroidW1 = d3_geo_centroidX0 = d3_geo_centroidY0 = d3_geo_centroidZ0 = d3_geo_centroidX1 = d3_geo_centroidY1 = d3_geo_centroidZ1 = d3_geo_centroidX2 = d3_geo_centroidY2 = d3_geo_centroidZ2 = 0;\n d3.geo.stream(object, d3_geo_centroid);\n var x = d3_geo_centroidX2, y = d3_geo_centroidY2, z = d3_geo_centroidZ2, m = x * x + y * y + z * z;\n if (m < ε2) {\n x = d3_geo_centroidX1, y = d3_geo_centroidY1, z = d3_geo_centroidZ1;\n if (d3_geo_centroidW1 < ε) x = d3_geo_centroidX0, y = d3_geo_centroidY0, z = d3_geo_centroidZ0;\n m = x * x + y * y + z * z;\n if (m < ε2) return [ NaN, NaN ];\n }\n return [ Math.atan2(y, x) * d3_degrees, d3_asin(z / Math.sqrt(m)) * d3_degrees ];\n };\n var d3_geo_centroidW0, d3_geo_centroidW1, d3_geo_centroidX0, d3_geo_centroidY0, d3_geo_centroidZ0, d3_geo_centroidX1, d3_geo_centroidY1, d3_geo_centroidZ1, d3_geo_centroidX2, d3_geo_centroidY2, d3_geo_centroidZ2;\n var d3_geo_centroid = {\n sphere: d3_noop,\n point: d3_geo_centroidPoint,\n lineStart: d3_geo_centroidLineStart,\n lineEnd: d3_geo_centroidLineEnd,\n polygonStart: function() {\n d3_geo_centroid.lineStart = d3_geo_centroidRingStart;\n },\n polygonEnd: function() {\n d3_geo_centroid.lineStart = d3_geo_centroidLineStart;\n }\n };\n function d3_geo_centroidPoint(λ, φ) {\n λ *= d3_radians;\n var cosφ = Math.cos(φ *= d3_radians);\n d3_geo_centroidPointXYZ(cosφ * Math.cos(λ), cosφ * Math.sin(λ), Math.sin(φ));\n }\n function d3_geo_centroidPointXYZ(x, y, z) {\n ++d3_geo_centroidW0;\n d3_geo_centroidX0 += (x - d3_geo_centroidX0) / d3_geo_centroidW0;\n d3_geo_centroidY0 += (y - d3_geo_centroidY0) / d3_geo_centroidW0;\n d3_geo_centroidZ0 += (z - d3_geo_centroidZ0) / d3_geo_centroidW0;\n }\n function d3_geo_centroidLineStart() {\n var x0, y0, z0;\n d3_geo_centroid.point = function(λ, φ) {\n λ *= d3_radians;\n var cosφ = Math.cos(φ *= d3_radians);\n x0 = cosφ * Math.cos(λ);\n y0 = cosφ * Math.sin(λ);\n z0 = Math.sin(φ);\n d3_geo_centroid.point = nextPoint;\n d3_geo_centroidPointXYZ(x0, y0, z0);\n };\n function nextPoint(λ, φ) {\n λ *= d3_radians;\n var cosφ = Math.cos(φ *= d3_radians), x = cosφ * Math.cos(λ), y = cosφ * Math.sin(λ), z = Math.sin(φ), w = Math.atan2(Math.sqrt((w = y0 * z - z0 * y) * w + (w = z0 * x - x0 * z) * w + (w = x0 * y - y0 * x) * w), x0 * x + y0 * y + z0 * z);\n d3_geo_centroidW1 += w;\n d3_geo_centroidX1 += w * (x0 + (x0 = x));\n d3_geo_centroidY1 += w * (y0 + (y0 = y));\n d3_geo_centroidZ1 += w * (z0 + (z0 = z));\n d3_geo_centroidPointXYZ(x0, y0, z0);\n }\n }\n function d3_geo_centroidLineEnd() {\n d3_geo_centroid.point = d3_geo_centroidPoint;\n }\n function d3_geo_centroidRingStart() {\n var λ00, φ00, x0, y0, z0;\n d3_geo_centroid.point = function(λ, φ) {\n λ00 = λ, φ00 = φ;\n d3_geo_centroid.point = nextPoint;\n λ *= d3_radians;\n var cosφ = Math.cos(φ *= d3_radians);\n x0 = cosφ * Math.cos(λ);\n y0 = cosφ * Math.sin(λ);\n z0 = Math.sin(φ);\n d3_geo_centroidPointXYZ(x0, y0, z0);\n };\n d3_geo_centroid.lineEnd = function() {\n nextPoint(λ00, φ00);\n d3_geo_centroid.lineEnd = d3_geo_centroidLineEnd;\n d3_geo_centroid.point = d3_geo_centroidPoint;\n };\n function nextPoint(λ, φ) {\n λ *= d3_radians;\n var cosφ = Math.cos(φ *= d3_radians), x = cosφ * Math.cos(λ), y = cosφ * Math.sin(λ), z = Math.sin(φ), cx = y0 * z - z0 * y, cy = z0 * x - x0 * z, cz = x0 * y - y0 * x, m = Math.sqrt(cx * cx + cy * cy + cz * cz), u = x0 * x + y0 * y + z0 * z, v = m && -d3_acos(u) / m, w = Math.atan2(m, u);\n d3_geo_centroidX2 += v * cx;\n d3_geo_centroidY2 += v * cy;\n d3_geo_centroidZ2 += v * cz;\n d3_geo_centroidW1 += w;\n d3_geo_centroidX1 += w * (x0 + (x0 = x));\n d3_geo_centroidY1 += w * (y0 + (y0 = y));\n d3_geo_centroidZ1 += w * (z0 + (z0 = z));\n d3_geo_centroidPointXYZ(x0, y0, z0);\n }\n }\n function d3_geo_compose(a, b) {\n function compose(x, y) {\n return x = a(x, y), b(x[0], x[1]);\n }\n if (a.invert && b.invert) compose.invert = function(x, y) {\n return x = b.invert(x, y), x && a.invert(x[0], x[1]);\n };\n return compose;\n }\n function d3_true() {\n return true;\n }\n function d3_geo_clipPolygon(segments, compare, clipStartInside, interpolate, listener) {\n var subject = [], clip = [];\n segments.forEach(function(segment) {\n if ((n = segment.length - 1) <= 0) return;\n var n, p0 = segment[0], p1 = segment[n];\n if (d3_geo_sphericalEqual(p0, p1)) {\n listener.lineStart();\n for (var i = 0; i < n; ++i) listener.point((p0 = segment[i])[0], p0[1]);\n listener.lineEnd();\n return;\n }\n var a = new d3_geo_clipPolygonIntersection(p0, segment, null, true), b = new d3_geo_clipPolygonIntersection(p0, null, a, false);\n a.o = b;\n subject.push(a);\n clip.push(b);\n a = new d3_geo_clipPolygonIntersection(p1, segment, null, false);\n b = new d3_geo_clipPolygonIntersection(p1, null, a, true);\n a.o = b;\n subject.push(a);\n clip.push(b);\n });\n clip.sort(compare);\n d3_geo_clipPolygonLinkCircular(subject);\n d3_geo_clipPolygonLinkCircular(clip);\n if (!subject.length) return;\n for (var i = 0, entry = clipStartInside, n = clip.length; i < n; ++i) {\n clip[i].e = entry = !entry;\n }\n var start = subject[0], points, point;\n while (1) {\n var current = start, isSubject = true;\n while (current.v) if ((current = current.n) === start) return;\n points = current.z;\n listener.lineStart();\n do {\n current.v = current.o.v = true;\n if (current.e) {\n if (isSubject) {\n for (var i = 0, n = points.length; i < n; ++i) listener.point((point = points[i])[0], point[1]);\n } else {\n interpolate(current.x, current.n.x, 1, listener);\n }\n current = current.n;\n } else {\n if (isSubject) {\n points = current.p.z;\n for (var i = points.length - 1; i >= 0; --i) listener.point((point = points[i])[0], point[1]);\n } else {\n interpolate(current.x, current.p.x, -1, listener);\n }\n current = current.p;\n }\n current = current.o;\n points = current.z;\n isSubject = !isSubject;\n } while (!current.v);\n listener.lineEnd();\n }\n }\n function d3_geo_clipPolygonLinkCircular(array) {\n if (!(n = array.length)) return;\n var n, i = 0, a = array[0], b;\n while (++i < n) {\n a.n = b = array[i];\n b.p = a;\n a = b;\n }\n a.n = b = array[0];\n b.p = a;\n }\n function d3_geo_clipPolygonIntersection(point, points, other, entry) {\n this.x = point;\n this.z = points;\n this.o = other;\n this.e = entry;\n this.v = false;\n this.n = this.p = null;\n }\n function d3_geo_clip(pointVisible, clipLine, interpolate, clipStart) {\n return function(rotate, listener) {\n var line = clipLine(listener), rotatedClipStart = rotate.invert(clipStart[0], clipStart[1]);\n var clip = {\n point: point,\n lineStart: lineStart,\n lineEnd: lineEnd,\n polygonStart: function() {\n clip.point = pointRing;\n clip.lineStart = ringStart;\n clip.lineEnd = ringEnd;\n segments = [];\n polygon = [];\n },\n polygonEnd: function() {\n clip.point = point;\n clip.lineStart = lineStart;\n clip.lineEnd = lineEnd;\n segments = d3.merge(segments);\n var clipStartInside = d3_geo_pointInPolygon(rotatedClipStart, polygon);\n if (segments.length) {\n if (!polygonStarted) listener.polygonStart(), polygonStarted = true;\n d3_geo_clipPolygon(segments, d3_geo_clipSort, clipStartInside, interpolate, listener);\n } else if (clipStartInside) {\n if (!polygonStarted) listener.polygonStart(), polygonStarted = true;\n listener.lineStart();\n interpolate(null, null, 1, listener);\n listener.lineEnd();\n }\n if (polygonStarted) listener.polygonEnd(), polygonStarted = false;\n segments = polygon = null;\n },\n sphere: function() {\n listener.polygonStart();\n listener.lineStart();\n interpolate(null, null, 1, listener);\n listener.lineEnd();\n listener.polygonEnd();\n }\n };\n function point(λ, φ) {\n var point = rotate(λ, φ);\n if (pointVisible(λ = point[0], φ = point[1])) listener.point(λ, φ);\n }\n function pointLine(λ, φ) {\n var point = rotate(λ, φ);\n line.point(point[0], point[1]);\n }\n function lineStart() {\n clip.point = pointLine;\n line.lineStart();\n }\n function lineEnd() {\n clip.point = point;\n line.lineEnd();\n }\n var segments;\n var buffer = d3_geo_clipBufferListener(), ringListener = clipLine(buffer), polygonStarted = false, polygon, ring;\n function pointRing(λ, φ) {\n ring.push([ λ, φ ]);\n var point = rotate(λ, φ);\n ringListener.point(point[0], point[1]);\n }\n function ringStart() {\n ringListener.lineStart();\n ring = [];\n }\n function ringEnd() {\n pointRing(ring[0][0], ring[0][1]);\n ringListener.lineEnd();\n var clean = ringListener.clean(), ringSegments = buffer.buffer(), segment, n = ringSegments.length;\n ring.pop();\n polygon.push(ring);\n ring = null;\n if (!n) return;\n if (clean & 1) {\n segment = ringSegments[0];\n var n = segment.length - 1, i = -1, point;\n if (n > 0) {\n if (!polygonStarted) listener.polygonStart(), polygonStarted = true;\n listener.lineStart();\n while (++i < n) listener.point((point = segment[i])[0], point[1]);\n listener.lineEnd();\n }\n return;\n }\n if (n > 1 && clean & 2) ringSegments.push(ringSegments.pop().concat(ringSegments.shift()));\n segments.push(ringSegments.filter(d3_geo_clipSegmentLength1));\n }\n return clip;\n };\n }\n function d3_geo_clipSegmentLength1(segment) {\n return segment.length > 1;\n }\n function d3_geo_clipBufferListener() {\n var lines = [], line;\n return {\n lineStart: function() {\n lines.push(line = []);\n },\n point: function(λ, φ) {\n line.push([ λ, φ ]);\n },\n lineEnd: d3_noop,\n buffer: function() {\n var buffer = lines;\n lines = [];\n line = null;\n return buffer;\n },\n rejoin: function() {\n if (lines.length > 1) lines.push(lines.pop().concat(lines.shift()));\n }\n };\n }\n function d3_geo_clipSort(a, b) {\n return ((a = a.x)[0] < 0 ? a[1] - halfπ - ε : halfπ - a[1]) - ((b = b.x)[0] < 0 ? b[1] - halfπ - ε : halfπ - b[1]);\n }\n var d3_geo_clipAntimeridian = d3_geo_clip(d3_true, d3_geo_clipAntimeridianLine, d3_geo_clipAntimeridianInterpolate, [ -π, -π / 2 ]);\n function d3_geo_clipAntimeridianLine(listener) {\n var λ0 = NaN, φ0 = NaN, sλ0 = NaN, clean;\n return {\n lineStart: function() {\n listener.lineStart();\n clean = 1;\n },\n point: function(λ1, φ1) {\n var sλ1 = λ1 > 0 ? π : -π, dλ = abs(λ1 - λ0);\n if (abs(dλ - π) < ε) {\n listener.point(λ0, φ0 = (φ0 + φ1) / 2 > 0 ? halfπ : -halfπ);\n listener.point(sλ0, φ0);\n listener.lineEnd();\n listener.lineStart();\n listener.point(sλ1, φ0);\n listener.point(λ1, φ0);\n clean = 0;\n } else if (sλ0 !== sλ1 && dλ >= π) {\n if (abs(λ0 - sλ0) < ε) λ0 -= sλ0 * ε;\n if (abs(λ1 - sλ1) < ε) λ1 -= sλ1 * ε;\n φ0 = d3_geo_clipAntimeridianIntersect(λ0, φ0, λ1, φ1);\n listener.point(sλ0, φ0);\n listener.lineEnd();\n listener.lineStart();\n listener.point(sλ1, φ0);\n clean = 0;\n }\n listener.point(λ0 = λ1, φ0 = φ1);\n sλ0 = sλ1;\n },\n lineEnd: function() {\n listener.lineEnd();\n λ0 = φ0 = NaN;\n },\n clean: function() {\n return 2 - clean;\n }\n };\n }\n function d3_geo_clipAntimeridianIntersect(λ0, φ0, λ1, φ1) {\n var cosφ0, cosφ1, sinλ0_λ1 = Math.sin(λ0 - λ1);\n return abs(sinλ0_λ1) > ε ? Math.atan((Math.sin(φ0) * (cosφ1 = Math.cos(φ1)) * Math.sin(λ1) - Math.sin(φ1) * (cosφ0 = Math.cos(φ0)) * Math.sin(λ0)) / (cosφ0 * cosφ1 * sinλ0_λ1)) : (φ0 + φ1) / 2;\n }\n function d3_geo_clipAntimeridianInterpolate(from, to, direction, listener) {\n var φ;\n if (from == null) {\n φ = direction * halfπ;\n listener.point(-π, φ);\n listener.point(0, φ);\n listener.point(π, φ);\n listener.point(π, 0);\n listener.point(π, -φ);\n listener.point(0, -φ);\n listener.point(-π, -φ);\n listener.point(-π, 0);\n listener.point(-π, φ);\n } else if (abs(from[0] - to[0]) > ε) {\n var s = from[0] < to[0] ? π : -π;\n φ = direction * s / 2;\n listener.point(-s, φ);\n listener.point(0, φ);\n listener.point(s, φ);\n } else {\n listener.point(to[0], to[1]);\n }\n }\n function d3_geo_pointInPolygon(point, polygon) {\n var meridian = point[0], parallel = point[1], meridianNormal = [ Math.sin(meridian), -Math.cos(meridian), 0 ], polarAngle = 0, winding = 0;\n d3_geo_areaRingSum.reset();\n for (var i = 0, n = polygon.length; i < n; ++i) {\n var ring = polygon[i], m = ring.length;\n if (!m) continue;\n var point0 = ring[0], λ0 = point0[0], φ0 = point0[1] / 2 + π / 4, sinφ0 = Math.sin(φ0), cosφ0 = Math.cos(φ0), j = 1;\n while (true) {\n if (j === m) j = 0;\n point = ring[j];\n var λ = point[0], φ = point[1] / 2 + π / 4, sinφ = Math.sin(φ), cosφ = Math.cos(φ), dλ = λ - λ0, sdλ = dλ >= 0 ? 1 : -1, adλ = sdλ * dλ, antimeridian = adλ > π, k = sinφ0 * sinφ;\n d3_geo_areaRingSum.add(Math.atan2(k * sdλ * Math.sin(adλ), cosφ0 * cosφ + k * Math.cos(adλ)));\n polarAngle += antimeridian ? dλ + sdλ * τ : dλ;\n if (antimeridian ^ λ0 >= meridian ^ λ >= meridian) {\n var arc = d3_geo_cartesianCross(d3_geo_cartesian(point0), d3_geo_cartesian(point));\n d3_geo_cartesianNormalize(arc);\n var intersection = d3_geo_cartesianCross(meridianNormal, arc);\n d3_geo_cartesianNormalize(intersection);\n var φarc = (antimeridian ^ dλ >= 0 ? -1 : 1) * d3_asin(intersection[2]);\n if (parallel > φarc || parallel === φarc && (arc[0] || arc[1])) {\n winding += antimeridian ^ dλ >= 0 ? 1 : -1;\n }\n }\n if (!j++) break;\n λ0 = λ, sinφ0 = sinφ, cosφ0 = cosφ, point0 = point;\n }\n }\n return (polarAngle < -ε || polarAngle < ε && d3_geo_areaRingSum < -ε) ^ winding & 1;\n }\n function d3_geo_clipCircle(radius) {\n var cr = Math.cos(radius), smallRadius = cr > 0, notHemisphere = abs(cr) > ε, interpolate = d3_geo_circleInterpolate(radius, 6 * d3_radians);\n return d3_geo_clip(visible, clipLine, interpolate, smallRadius ? [ 0, -radius ] : [ -π, radius - π ]);\n function visible(λ, φ) {\n return Math.cos(λ) * Math.cos(φ) > cr;\n }\n function clipLine(listener) {\n var point0, c0, v0, v00, clean;\n return {\n lineStart: function() {\n v00 = v0 = false;\n clean = 1;\n },\n point: function(λ, φ) {\n var point1 = [ λ, φ ], point2, v = visible(λ, φ), c = smallRadius ? v ? 0 : code(λ, φ) : v ? code(λ + (λ < 0 ? π : -π), φ) : 0;\n if (!point0 && (v00 = v0 = v)) listener.lineStart();\n if (v !== v0) {\n point2 = intersect(point0, point1);\n if (d3_geo_sphericalEqual(point0, point2) || d3_geo_sphericalEqual(point1, point2)) {\n point1[0] += ε;\n point1[1] += ε;\n v = visible(point1[0], point1[1]);\n }\n }\n if (v !== v0) {\n clean = 0;\n if (v) {\n listener.lineStart();\n point2 = intersect(point1, point0);\n listener.point(point2[0], point2[1]);\n } else {\n point2 = intersect(point0, point1);\n listener.point(point2[0], point2[1]);\n listener.lineEnd();\n }\n point0 = point2;\n } else if (notHemisphere && point0 && smallRadius ^ v) {\n var t;\n if (!(c & c0) && (t = intersect(point1, point0, true))) {\n clean = 0;\n if (smallRadius) {\n listener.lineStart();\n listener.point(t[0][0], t[0][1]);\n listener.point(t[1][0], t[1][1]);\n listener.lineEnd();\n } else {\n listener.point(t[1][0], t[1][1]);\n listener.lineEnd();\n listener.lineStart();\n listener.point(t[0][0], t[0][1]);\n }\n }\n }\n if (v && (!point0 || !d3_geo_sphericalEqual(point0, point1))) {\n listener.point(point1[0], point1[1]);\n }\n point0 = point1, v0 = v, c0 = c;\n },\n lineEnd: function() {\n if (v0) listener.lineEnd();\n point0 = null;\n },\n clean: function() {\n return clean | (v00 && v0) << 1;\n }\n };\n }\n function intersect(a, b, two) {\n var pa = d3_geo_cartesian(a), pb = d3_geo_cartesian(b);\n var n1 = [ 1, 0, 0 ], n2 = d3_geo_cartesianCross(pa, pb), n2n2 = d3_geo_cartesianDot(n2, n2), n1n2 = n2[0], determinant = n2n2 - n1n2 * n1n2;\n if (!determinant) return !two && a;\n var c1 = cr * n2n2 / determinant, c2 = -cr * n1n2 / determinant, n1xn2 = d3_geo_cartesianCross(n1, n2), A = d3_geo_cartesianScale(n1, c1), B = d3_geo_cartesianScale(n2, c2);\n d3_geo_cartesianAdd(A, B);\n var u = n1xn2, w = d3_geo_cartesianDot(A, u), uu = d3_geo_cartesianDot(u, u), t2 = w * w - uu * (d3_geo_cartesianDot(A, A) - 1);\n if (t2 < 0) return;\n var t = Math.sqrt(t2), q = d3_geo_cartesianScale(u, (-w - t) / uu);\n d3_geo_cartesianAdd(q, A);\n q = d3_geo_spherical(q);\n if (!two) return q;\n var λ0 = a[0], λ1 = b[0], φ0 = a[1], φ1 = b[1], z;\n if (λ1 < λ0) z = λ0, λ0 = λ1, λ1 = z;\n var δλ = λ1 - λ0, polar = abs(δλ - π) < ε, meridian = polar || δλ < ε;\n if (!polar && φ1 < φ0) z = φ0, φ0 = φ1, φ1 = z;\n if (meridian ? polar ? φ0 + φ1 > 0 ^ q[1] < (abs(q[0] - λ0) < ε ? φ0 : φ1) : φ0 <= q[1] && q[1] <= φ1 : δλ > π ^ (λ0 <= q[0] && q[0] <= λ1)) {\n var q1 = d3_geo_cartesianScale(u, (-w + t) / uu);\n d3_geo_cartesianAdd(q1, A);\n return [ q, d3_geo_spherical(q1) ];\n }\n }\n function code(λ, φ) {\n var r = smallRadius ? radius : π - radius, code = 0;\n if (λ < -r) code |= 1; else if (λ > r) code |= 2;\n if (φ < -r) code |= 4; else if (φ > r) code |= 8;\n return code;\n }\n }\n function d3_geom_clipLine(x0, y0, x1, y1) {\n return function(line) {\n var a = line.a, b = line.b, ax = a.x, ay = a.y, bx = b.x, by = b.y, t0 = 0, t1 = 1, dx = bx - ax, dy = by - ay, r;\n r = x0 - ax;\n if (!dx && r > 0) return;\n r /= dx;\n if (dx < 0) {\n if (r < t0) return;\n if (r < t1) t1 = r;\n } else if (dx > 0) {\n if (r > t1) return;\n if (r > t0) t0 = r;\n }\n r = x1 - ax;\n if (!dx && r < 0) return;\n r /= dx;\n if (dx < 0) {\n if (r > t1) return;\n if (r > t0) t0 = r;\n } else if (dx > 0) {\n if (r < t0) return;\n if (r < t1) t1 = r;\n }\n r = y0 - ay;\n if (!dy && r > 0) return;\n r /= dy;\n if (dy < 0) {\n if (r < t0) return;\n if (r < t1) t1 = r;\n } else if (dy > 0) {\n if (r > t1) return;\n if (r > t0) t0 = r;\n }\n r = y1 - ay;\n if (!dy && r < 0) return;\n r /= dy;\n if (dy < 0) {\n if (r > t1) return;\n if (r > t0) t0 = r;\n } else if (dy > 0) {\n if (r < t0) return;\n if (r < t1) t1 = r;\n }\n if (t0 > 0) line.a = {\n x: ax + t0 * dx,\n y: ay + t0 * dy\n };\n if (t1 < 1) line.b = {\n x: ax + t1 * dx,\n y: ay + t1 * dy\n };\n return line;\n };\n }\n var d3_geo_clipExtentMAX = 1e9;\n d3.geo.clipExtent = function() {\n var x0, y0, x1, y1, stream, clip, clipExtent = {\n stream: function(output) {\n if (stream) stream.valid = false;\n stream = clip(output);\n stream.valid = true;\n return stream;\n },\n extent: function(_) {\n if (!arguments.length) return [ [ x0, y0 ], [ x1, y1 ] ];\n clip = d3_geo_clipExtent(x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]);\n if (stream) stream.valid = false, stream = null;\n return clipExtent;\n }\n };\n return clipExtent.extent([ [ 0, 0 ], [ 960, 500 ] ]);\n };\n function d3_geo_clipExtent(x0, y0, x1, y1) {\n return function(listener) {\n var listener_ = listener, bufferListener = d3_geo_clipBufferListener(), clipLine = d3_geom_clipLine(x0, y0, x1, y1), segments, polygon, ring;\n var clip = {\n point: point,\n lineStart: lineStart,\n lineEnd: lineEnd,\n polygonStart: function() {\n listener = bufferListener;\n segments = [];\n polygon = [];\n clean = true;\n },\n polygonEnd: function() {\n listener = listener_;\n segments = d3.merge(segments);\n var clipStartInside = insidePolygon([ x0, y1 ]), inside = clean && clipStartInside, visible = segments.length;\n if (inside || visible) {\n listener.polygonStart();\n if (inside) {\n listener.lineStart();\n interpolate(null, null, 1, listener);\n listener.lineEnd();\n }\n if (visible) {\n d3_geo_clipPolygon(segments, compare, clipStartInside, interpolate, listener);\n }\n listener.polygonEnd();\n }\n segments = polygon = ring = null;\n }\n };\n function insidePolygon(p) {\n var wn = 0, n = polygon.length, y = p[1];\n for (var i = 0; i < n; ++i) {\n for (var j = 1, v = polygon[i], m = v.length, a = v[0], b; j < m; ++j) {\n b = v[j];\n if (a[1] <= y) {\n if (b[1] > y && d3_cross2d(a, b, p) > 0) ++wn;\n } else {\n if (b[1] <= y && d3_cross2d(a, b, p) < 0) --wn;\n }\n a = b;\n }\n }\n return wn !== 0;\n }\n function interpolate(from, to, direction, listener) {\n var a = 0, a1 = 0;\n if (from == null || (a = corner(from, direction)) !== (a1 = corner(to, direction)) || comparePoints(from, to) < 0 ^ direction > 0) {\n do {\n listener.point(a === 0 || a === 3 ? x0 : x1, a > 1 ? y1 : y0);\n } while ((a = (a + direction + 4) % 4) !== a1);\n } else {\n listener.point(to[0], to[1]);\n }\n }\n function pointVisible(x, y) {\n return x0 <= x && x <= x1 && y0 <= y && y <= y1;\n }\n function point(x, y) {\n if (pointVisible(x, y)) listener.point(x, y);\n }\n var x__, y__, v__, x_, y_, v_, first, clean;\n function lineStart() {\n clip.point = linePoint;\n if (polygon) polygon.push(ring = []);\n first = true;\n v_ = false;\n x_ = y_ = NaN;\n }\n function lineEnd() {\n if (segments) {\n linePoint(x__, y__);\n if (v__ && v_) bufferListener.rejoin();\n segments.push(bufferListener.buffer());\n }\n clip.point = point;\n if (v_) listener.lineEnd();\n }\n function linePoint(x, y) {\n x = Math.max(-d3_geo_clipExtentMAX, Math.min(d3_geo_clipExtentMAX, x));\n y = Math.max(-d3_geo_clipExtentMAX, Math.min(d3_geo_clipExtentMAX, y));\n var v = pointVisible(x, y);\n if (polygon) ring.push([ x, y ]);\n if (first) {\n x__ = x, y__ = y, v__ = v;\n first = false;\n if (v) {\n listener.lineStart();\n listener.point(x, y);\n }\n } else {\n if (v && v_) listener.point(x, y); else {\n var l = {\n a: {\n x: x_,\n y: y_\n },\n b: {\n x: x,\n y: y\n }\n };\n if (clipLine(l)) {\n if (!v_) {\n listener.lineStart();\n listener.point(l.a.x, l.a.y);\n }\n listener.point(l.b.x, l.b.y);\n if (!v) listener.lineEnd();\n clean = false;\n } else if (v) {\n listener.lineStart();\n listener.point(x, y);\n clean = false;\n }\n }\n }\n x_ = x, y_ = y, v_ = v;\n }\n return clip;\n };\n function corner(p, direction) {\n return abs(p[0] - x0) < ε ? direction > 0 ? 0 : 3 : abs(p[0] - x1) < ε ? direction > 0 ? 2 : 1 : abs(p[1] - y0) < ε ? direction > 0 ? 1 : 0 : direction > 0 ? 3 : 2;\n }\n function compare(a, b) {\n return comparePoints(a.x, b.x);\n }\n function comparePoints(a, b) {\n var ca = corner(a, 1), cb = corner(b, 1);\n return ca !== cb ? ca - cb : ca === 0 ? b[1] - a[1] : ca === 1 ? a[0] - b[0] : ca === 2 ? a[1] - b[1] : b[0] - a[0];\n }\n }\n function d3_geo_conic(projectAt) {\n var φ0 = 0, φ1 = π / 3, m = d3_geo_projectionMutator(projectAt), p = m(φ0, φ1);\n p.parallels = function(_) {\n if (!arguments.length) return [ φ0 / π * 180, φ1 / π * 180 ];\n return m(φ0 = _[0] * π / 180, φ1 = _[1] * π / 180);\n };\n return p;\n }\n function d3_geo_conicEqualArea(φ0, φ1) {\n var sinφ0 = Math.sin(φ0), n = (sinφ0 + Math.sin(φ1)) / 2, C = 1 + sinφ0 * (2 * n - sinφ0), ρ0 = Math.sqrt(C) / n;\n function forward(λ, φ) {\n var ρ = Math.sqrt(C - 2 * n * Math.sin(φ)) / n;\n return [ ρ * Math.sin(λ *= n), ρ0 - ρ * Math.cos(λ) ];\n }\n forward.invert = function(x, y) {\n var ρ0_y = ρ0 - y;\n return [ Math.atan2(x, ρ0_y) / n, d3_asin((C - (x * x + ρ0_y * ρ0_y) * n * n) / (2 * n)) ];\n };\n return forward;\n }\n (d3.geo.conicEqualArea = function() {\n return d3_geo_conic(d3_geo_conicEqualArea);\n }).raw = d3_geo_conicEqualArea;\n d3.geo.albers = function() {\n return d3.geo.conicEqualArea().rotate([ 96, 0 ]).center([ -.6, 38.7 ]).parallels([ 29.5, 45.5 ]).scale(1070);\n };\n d3.geo.albersUsa = function() {\n var lower48 = d3.geo.albers();\n var alaska = d3.geo.conicEqualArea().rotate([ 154, 0 ]).center([ -2, 58.5 ]).parallels([ 55, 65 ]);\n var hawaii = d3.geo.conicEqualArea().rotate([ 157, 0 ]).center([ -3, 19.9 ]).parallels([ 8, 18 ]);\n var point, pointStream = {\n point: function(x, y) {\n point = [ x, y ];\n }\n }, lower48Point, alaskaPoint, hawaiiPoint;\n function albersUsa(coordinates) {\n var x = coordinates[0], y = coordinates[1];\n point = null;\n (lower48Point(x, y), point) || (alaskaPoint(x, y), point) || hawaiiPoint(x, y);\n return point;\n }\n albersUsa.invert = function(coordinates) {\n var k = lower48.scale(), t = lower48.translate(), x = (coordinates[0] - t[0]) / k, y = (coordinates[1] - t[1]) / k;\n return (y >= .12 && y < .234 && x >= -.425 && x < -.214 ? alaska : y >= .166 && y < .234 && x >= -.214 && x < -.115 ? hawaii : lower48).invert(coordinates);\n };\n albersUsa.stream = function(stream) {\n var lower48Stream = lower48.stream(stream), alaskaStream = alaska.stream(stream), hawaiiStream = hawaii.stream(stream);\n return {\n point: function(x, y) {\n lower48Stream.point(x, y);\n alaskaStream.point(x, y);\n hawaiiStream.point(x, y);\n },\n sphere: function() {\n lower48Stream.sphere();\n alaskaStream.sphere();\n hawaiiStream.sphere();\n },\n lineStart: function() {\n lower48Stream.lineStart();\n alaskaStream.lineStart();\n hawaiiStream.lineStart();\n },\n lineEnd: function() {\n lower48Stream.lineEnd();\n alaskaStream.lineEnd();\n hawaiiStream.lineEnd();\n },\n polygonStart: function() {\n lower48Stream.polygonStart();\n alaskaStream.polygonStart();\n hawaiiStream.polygonStart();\n },\n polygonEnd: function() {\n lower48Stream.polygonEnd();\n alaskaStream.polygonEnd();\n hawaiiStream.polygonEnd();\n }\n };\n };\n albersUsa.precision = function(_) {\n if (!arguments.length) return lower48.precision();\n lower48.precision(_);\n alaska.precision(_);\n hawaii.precision(_);\n return albersUsa;\n };\n albersUsa.scale = function(_) {\n if (!arguments.length) return lower48.scale();\n lower48.scale(_);\n alaska.scale(_ * .35);\n hawaii.scale(_);\n return albersUsa.translate(lower48.translate());\n };\n albersUsa.translate = function(_) {\n if (!arguments.length) return lower48.translate();\n var k = lower48.scale(), x = +_[0], y = +_[1];\n lower48Point = lower48.translate(_).clipExtent([ [ x - .455 * k, y - .238 * k ], [ x + .455 * k, y + .238 * k ] ]).stream(pointStream).point;\n alaskaPoint = alaska.translate([ x - .307 * k, y + .201 * k ]).clipExtent([ [ x - .425 * k + ε, y + .12 * k + ε ], [ x - .214 * k - ε, y + .234 * k - ε ] ]).stream(pointStream).point;\n hawaiiPoint = hawaii.translate([ x - .205 * k, y + .212 * k ]).clipExtent([ [ x - .214 * k + ε, y + .166 * k + ε ], [ x - .115 * k - ε, y + .234 * k - ε ] ]).stream(pointStream).point;\n return albersUsa;\n };\n return albersUsa.scale(1070);\n };\n var d3_geo_pathAreaSum, d3_geo_pathAreaPolygon, d3_geo_pathArea = {\n point: d3_noop,\n lineStart: d3_noop,\n lineEnd: d3_noop,\n polygonStart: function() {\n d3_geo_pathAreaPolygon = 0;\n d3_geo_pathArea.lineStart = d3_geo_pathAreaRingStart;\n },\n polygonEnd: function() {\n d3_geo_pathArea.lineStart = d3_geo_pathArea.lineEnd = d3_geo_pathArea.point = d3_noop;\n d3_geo_pathAreaSum += abs(d3_geo_pathAreaPolygon / 2);\n }\n };\n function d3_geo_pathAreaRingStart() {\n var x00, y00, x0, y0;\n d3_geo_pathArea.point = function(x, y) {\n d3_geo_pathArea.point = nextPoint;\n x00 = x0 = x, y00 = y0 = y;\n };\n function nextPoint(x, y) {\n d3_geo_pathAreaPolygon += y0 * x - x0 * y;\n x0 = x, y0 = y;\n }\n d3_geo_pathArea.lineEnd = function() {\n nextPoint(x00, y00);\n };\n }\n var d3_geo_pathBoundsX0, d3_geo_pathBoundsY0, d3_geo_pathBoundsX1, d3_geo_pathBoundsY1;\n var d3_geo_pathBounds = {\n point: d3_geo_pathBoundsPoint,\n lineStart: d3_noop,\n lineEnd: d3_noop,\n polygonStart: d3_noop,\n polygonEnd: d3_noop\n };\n function d3_geo_pathBoundsPoint(x, y) {\n if (x < d3_geo_pathBoundsX0) d3_geo_pathBoundsX0 = x;\n if (x > d3_geo_pathBoundsX1) d3_geo_pathBoundsX1 = x;\n if (y < d3_geo_pathBoundsY0) d3_geo_pathBoundsY0 = y;\n if (y > d3_geo_pathBoundsY1) d3_geo_pathBoundsY1 = y;\n }\n function d3_geo_pathBuffer() {\n var pointCircle = d3_geo_pathBufferCircle(4.5), buffer = [];\n var stream = {\n point: point,\n lineStart: function() {\n stream.point = pointLineStart;\n },\n lineEnd: lineEnd,\n polygonStart: function() {\n stream.lineEnd = lineEndPolygon;\n },\n polygonEnd: function() {\n stream.lineEnd = lineEnd;\n stream.point = point;\n },\n pointRadius: function(_) {\n pointCircle = d3_geo_pathBufferCircle(_);\n return stream;\n },\n result: function() {\n if (buffer.length) {\n var result = buffer.join(\"\");\n buffer = [];\n return result;\n }\n }\n };\n function point(x, y) {\n buffer.push(\"M\", x, \",\", y, pointCircle);\n }\n function pointLineStart(x, y) {\n buffer.push(\"M\", x, \",\", y);\n stream.point = pointLine;\n }\n function pointLine(x, y) {\n buffer.push(\"L\", x, \",\", y);\n }\n function lineEnd() {\n stream.point = point;\n }\n function lineEndPolygon() {\n buffer.push(\"Z\");\n }\n return stream;\n }\n function d3_geo_pathBufferCircle(radius) {\n return \"m0,\" + radius + \"a\" + radius + \",\" + radius + \" 0 1,1 0,\" + -2 * radius + \"a\" + radius + \",\" + radius + \" 0 1,1 0,\" + 2 * radius + \"z\";\n }\n var d3_geo_pathCentroid = {\n point: d3_geo_pathCentroidPoint,\n lineStart: d3_geo_pathCentroidLineStart,\n lineEnd: d3_geo_pathCentroidLineEnd,\n polygonStart: function() {\n d3_geo_pathCentroid.lineStart = d3_geo_pathCentroidRingStart;\n },\n polygonEnd: function() {\n d3_geo_pathCentroid.point = d3_geo_pathCentroidPoint;\n d3_geo_pathCentroid.lineStart = d3_geo_pathCentroidLineStart;\n d3_geo_pathCentroid.lineEnd = d3_geo_pathCentroidLineEnd;\n }\n };\n function d3_geo_pathCentroidPoint(x, y) {\n d3_geo_centroidX0 += x;\n d3_geo_centroidY0 += y;\n ++d3_geo_centroidZ0;\n }\n function d3_geo_pathCentroidLineStart() {\n var x0, y0;\n d3_geo_pathCentroid.point = function(x, y) {\n d3_geo_pathCentroid.point = nextPoint;\n d3_geo_pathCentroidPoint(x0 = x, y0 = y);\n };\n function nextPoint(x, y) {\n var dx = x - x0, dy = y - y0, z = Math.sqrt(dx * dx + dy * dy);\n d3_geo_centroidX1 += z * (x0 + x) / 2;\n d3_geo_centroidY1 += z * (y0 + y) / 2;\n d3_geo_centroidZ1 += z;\n d3_geo_pathCentroidPoint(x0 = x, y0 = y);\n }\n }\n function d3_geo_pathCentroidLineEnd() {\n d3_geo_pathCentroid.point = d3_geo_pathCentroidPoint;\n }\n function d3_geo_pathCentroidRingStart() {\n var x00, y00, x0, y0;\n d3_geo_pathCentroid.point = function(x, y) {\n d3_geo_pathCentroid.point = nextPoint;\n d3_geo_pathCentroidPoint(x00 = x0 = x, y00 = y0 = y);\n };\n function nextPoint(x, y) {\n var dx = x - x0, dy = y - y0, z = Math.sqrt(dx * dx + dy * dy);\n d3_geo_centroidX1 += z * (x0 + x) / 2;\n d3_geo_centroidY1 += z * (y0 + y) / 2;\n d3_geo_centroidZ1 += z;\n z = y0 * x - x0 * y;\n d3_geo_centroidX2 += z * (x0 + x);\n d3_geo_centroidY2 += z * (y0 + y);\n d3_geo_centroidZ2 += z * 3;\n d3_geo_pathCentroidPoint(x0 = x, y0 = y);\n }\n d3_geo_pathCentroid.lineEnd = function() {\n nextPoint(x00, y00);\n };\n }\n function d3_geo_pathContext(context) {\n var pointRadius = 4.5;\n var stream = {\n point: point,\n lineStart: function() {\n stream.point = pointLineStart;\n },\n lineEnd: lineEnd,\n polygonStart: function() {\n stream.lineEnd = lineEndPolygon;\n },\n polygonEnd: function() {\n stream.lineEnd = lineEnd;\n stream.point = point;\n },\n pointRadius: function(_) {\n pointRadius = _;\n return stream;\n },\n result: d3_noop\n };\n function point(x, y) {\n context.moveTo(x + pointRadius, y);\n context.arc(x, y, pointRadius, 0, τ);\n }\n function pointLineStart(x, y) {\n context.moveTo(x, y);\n stream.point = pointLine;\n }\n function pointLine(x, y) {\n context.lineTo(x, y);\n }\n function lineEnd() {\n stream.point = point;\n }\n function lineEndPolygon() {\n context.closePath();\n }\n return stream;\n }\n function d3_geo_resample(project) {\n var δ2 = .5, cosMinDistance = Math.cos(30 * d3_radians), maxDepth = 16;\n function resample(stream) {\n return (maxDepth ? resampleRecursive : resampleNone)(stream);\n }\n function resampleNone(stream) {\n return d3_geo_transformPoint(stream, function(x, y) {\n x = project(x, y);\n stream.point(x[0], x[1]);\n });\n }\n function resampleRecursive(stream) {\n var λ00, φ00, x00, y00, a00, b00, c00, λ0, x0, y0, a0, b0, c0;\n var resample = {\n point: point,\n lineStart: lineStart,\n lineEnd: lineEnd,\n polygonStart: function() {\n stream.polygonStart();\n resample.lineStart = ringStart;\n },\n polygonEnd: function() {\n stream.polygonEnd();\n resample.lineStart = lineStart;\n }\n };\n function point(x, y) {\n x = project(x, y);\n stream.point(x[0], x[1]);\n }\n function lineStart() {\n x0 = NaN;\n resample.point = linePoint;\n stream.lineStart();\n }\n function linePoint(λ, φ) {\n var c = d3_geo_cartesian([ λ, φ ]), p = project(λ, φ);\n resampleLineTo(x0, y0, λ0, a0, b0, c0, x0 = p[0], y0 = p[1], λ0 = λ, a0 = c[0], b0 = c[1], c0 = c[2], maxDepth, stream);\n stream.point(x0, y0);\n }\n function lineEnd() {\n resample.point = point;\n stream.lineEnd();\n }\n function ringStart() {\n lineStart();\n resample.point = ringPoint;\n resample.lineEnd = ringEnd;\n }\n function ringPoint(λ, φ) {\n linePoint(λ00 = λ, φ00 = φ), x00 = x0, y00 = y0, a00 = a0, b00 = b0, c00 = c0;\n resample.point = linePoint;\n }\n function ringEnd() {\n resampleLineTo(x0, y0, λ0, a0, b0, c0, x00, y00, λ00, a00, b00, c00, maxDepth, stream);\n resample.lineEnd = lineEnd;\n lineEnd();\n }\n return resample;\n }\n function resampleLineTo(x0, y0, λ0, a0, b0, c0, x1, y1, λ1, a1, b1, c1, depth, stream) {\n var dx = x1 - x0, dy = y1 - y0, d2 = dx * dx + dy * dy;\n if (d2 > 4 * δ2 && depth--) {\n var a = a0 + a1, b = b0 + b1, c = c0 + c1, m = Math.sqrt(a * a + b * b + c * c), φ2 = Math.asin(c /= m), λ2 = abs(abs(c) - 1) < ε || abs(λ0 - λ1) < ε ? (λ0 + λ1) / 2 : Math.atan2(b, a), p = project(λ2, φ2), x2 = p[0], y2 = p[1], dx2 = x2 - x0, dy2 = y2 - y0, dz = dy * dx2 - dx * dy2;\n if (dz * dz / d2 > δ2 || abs((dx * dx2 + dy * dy2) / d2 - .5) > .3 || a0 * a1 + b0 * b1 + c0 * c1 < cosMinDistance) {\n resampleLineTo(x0, y0, λ0, a0, b0, c0, x2, y2, λ2, a /= m, b /= m, c, depth, stream);\n stream.point(x2, y2);\n resampleLineTo(x2, y2, λ2, a, b, c, x1, y1, λ1, a1, b1, c1, depth, stream);\n }\n }\n }\n resample.precision = function(_) {\n if (!arguments.length) return Math.sqrt(δ2);\n maxDepth = (δ2 = _ * _) > 0 && 16;\n return resample;\n };\n return resample;\n }\n d3.geo.path = function() {\n var pointRadius = 4.5, projection, context, projectStream, contextStream, cacheStream;\n function path(object) {\n if (object) {\n if (typeof pointRadius === \"function\") contextStream.pointRadius(+pointRadius.apply(this, arguments));\n if (!cacheStream || !cacheStream.valid) cacheStream = projectStream(contextStream);\n d3.geo.stream(object, cacheStream);\n }\n return contextStream.result();\n }\n path.area = function(object) {\n d3_geo_pathAreaSum = 0;\n d3.geo.stream(object, projectStream(d3_geo_pathArea));\n return d3_geo_pathAreaSum;\n };\n path.centroid = function(object) {\n d3_geo_centroidX0 = d3_geo_centroidY0 = d3_geo_centroidZ0 = d3_geo_centroidX1 = d3_geo_centroidY1 = d3_geo_centroidZ1 = d3_geo_centroidX2 = d3_geo_centroidY2 = d3_geo_centroidZ2 = 0;\n d3.geo.stream(object, projectStream(d3_geo_pathCentroid));\n return d3_geo_centroidZ2 ? [ d3_geo_centroidX2 / d3_geo_centroidZ2, d3_geo_centroidY2 / d3_geo_centroidZ2 ] : d3_geo_centroidZ1 ? [ d3_geo_centroidX1 / d3_geo_centroidZ1, d3_geo_centroidY1 / d3_geo_centroidZ1 ] : d3_geo_centroidZ0 ? [ d3_geo_centroidX0 / d3_geo_centroidZ0, d3_geo_centroidY0 / d3_geo_centroidZ0 ] : [ NaN, NaN ];\n };\n path.bounds = function(object) {\n d3_geo_pathBoundsX1 = d3_geo_pathBoundsY1 = -(d3_geo_pathBoundsX0 = d3_geo_pathBoundsY0 = Infinity);\n d3.geo.stream(object, projectStream(d3_geo_pathBounds));\n return [ [ d3_geo_pathBoundsX0, d3_geo_pathBoundsY0 ], [ d3_geo_pathBoundsX1, d3_geo_pathBoundsY1 ] ];\n };\n path.projection = function(_) {\n if (!arguments.length) return projection;\n projectStream = (projection = _) ? _.stream || d3_geo_pathProjectStream(_) : d3_identity;\n return reset();\n };\n path.context = function(_) {\n if (!arguments.length) return context;\n contextStream = (context = _) == null ? new d3_geo_pathBuffer() : new d3_geo_pathContext(_);\n if (typeof pointRadius !== \"function\") contextStream.pointRadius(pointRadius);\n return reset();\n };\n path.pointRadius = function(_) {\n if (!arguments.length) return pointRadius;\n pointRadius = typeof _ === \"function\" ? _ : (contextStream.pointRadius(+_), +_);\n return path;\n };\n function reset() {\n cacheStream = null;\n return path;\n }\n return path.projection(d3.geo.albersUsa()).context(null);\n };\n function d3_geo_pathProjectStream(project) {\n var resample = d3_geo_resample(function(x, y) {\n return project([ x * d3_degrees, y * d3_degrees ]);\n });\n return function(stream) {\n return d3_geo_projectionRadians(resample(stream));\n };\n }\n d3.geo.transform = function(methods) {\n return {\n stream: function(stream) {\n var transform = new d3_geo_transform(stream);\n for (var k in methods) transform[k] = methods[k];\n return transform;\n }\n };\n };\n function d3_geo_transform(stream) {\n this.stream = stream;\n }\n d3_geo_transform.prototype = {\n point: function(x, y) {\n this.stream.point(x, y);\n },\n sphere: function() {\n this.stream.sphere();\n },\n lineStart: function() {\n this.stream.lineStart();\n },\n lineEnd: function() {\n this.stream.lineEnd();\n },\n polygonStart: function() {\n this.stream.polygonStart();\n },\n polygonEnd: function() {\n this.stream.polygonEnd();\n }\n };\n function d3_geo_transformPoint(stream, point) {\n return {\n point: point,\n sphere: function() {\n stream.sphere();\n },\n lineStart: function() {\n stream.lineStart();\n },\n lineEnd: function() {\n stream.lineEnd();\n },\n polygonStart: function() {\n stream.polygonStart();\n },\n polygonEnd: function() {\n stream.polygonEnd();\n }\n };\n }\n d3.geo.projection = d3_geo_projection;\n d3.geo.projectionMutator = d3_geo_projectionMutator;\n function d3_geo_projection(project) {\n return d3_geo_projectionMutator(function() {\n return project;\n })();\n }\n function d3_geo_projectionMutator(projectAt) {\n var project, rotate, projectRotate, projectResample = d3_geo_resample(function(x, y) {\n x = project(x, y);\n return [ x[0] * k + δx, δy - x[1] * k ];\n }), k = 150, x = 480, y = 250, λ = 0, φ = 0, δλ = 0, δφ = 0, δγ = 0, δx, δy, preclip = d3_geo_clipAntimeridian, postclip = d3_identity, clipAngle = null, clipExtent = null, stream;\n function projection(point) {\n point = projectRotate(point[0] * d3_radians, point[1] * d3_radians);\n return [ point[0] * k + δx, δy - point[1] * k ];\n }\n function invert(point) {\n point = projectRotate.invert((point[0] - δx) / k, (δy - point[1]) / k);\n return point && [ point[0] * d3_degrees, point[1] * d3_degrees ];\n }\n projection.stream = function(output) {\n if (stream) stream.valid = false;\n stream = d3_geo_projectionRadians(preclip(rotate, projectResample(postclip(output))));\n stream.valid = true;\n return stream;\n };\n projection.clipAngle = function(_) {\n if (!arguments.length) return clipAngle;\n preclip = _ == null ? (clipAngle = _, d3_geo_clipAntimeridian) : d3_geo_clipCircle((clipAngle = +_) * d3_radians);\n return invalidate();\n };\n projection.clipExtent = function(_) {\n if (!arguments.length) return clipExtent;\n clipExtent = _;\n postclip = _ ? d3_geo_clipExtent(_[0][0], _[0][1], _[1][0], _[1][1]) : d3_identity;\n return invalidate();\n };\n projection.scale = function(_) {\n if (!arguments.length) return k;\n k = +_;\n return reset();\n };\n projection.translate = function(_) {\n if (!arguments.length) return [ x, y ];\n x = +_[0];\n y = +_[1];\n return reset();\n };\n projection.center = function(_) {\n if (!arguments.length) return [ λ * d3_degrees, φ * d3_degrees ];\n λ = _[0] % 360 * d3_radians;\n φ = _[1] % 360 * d3_radians;\n return reset();\n };\n projection.rotate = function(_) {\n if (!arguments.length) return [ δλ * d3_degrees, δφ * d3_degrees, δγ * d3_degrees ];\n δλ = _[0] % 360 * d3_radians;\n δφ = _[1] % 360 * d3_radians;\n δγ = _.length > 2 ? _[2] % 360 * d3_radians : 0;\n return reset();\n };\n d3.rebind(projection, projectResample, \"precision\");\n function reset() {\n projectRotate = d3_geo_compose(rotate = d3_geo_rotation(δλ, δφ, δγ), project);\n var center = project(λ, φ);\n δx = x - center[0] * k;\n δy = y + center[1] * k;\n return invalidate();\n }\n function invalidate() {\n if (stream) stream.valid = false, stream = null;\n return projection;\n }\n return function() {\n project = projectAt.apply(this, arguments);\n projection.invert = project.invert && invert;\n return reset();\n };\n }\n function d3_geo_projectionRadians(stream) {\n return d3_geo_transformPoint(stream, function(x, y) {\n stream.point(x * d3_radians, y * d3_radians);\n });\n }\n function d3_geo_equirectangular(λ, φ) {\n return [ λ, φ ];\n }\n (d3.geo.equirectangular = function() {\n return d3_geo_projection(d3_geo_equirectangular);\n }).raw = d3_geo_equirectangular.invert = d3_geo_equirectangular;\n d3.geo.rotation = function(rotate) {\n rotate = d3_geo_rotation(rotate[0] % 360 * d3_radians, rotate[1] * d3_radians, rotate.length > 2 ? rotate[2] * d3_radians : 0);\n function forward(coordinates) {\n coordinates = rotate(coordinates[0] * d3_radians, coordinates[1] * d3_radians);\n return coordinates[0] *= d3_degrees, coordinates[1] *= d3_degrees, coordinates;\n }\n forward.invert = function(coordinates) {\n coordinates = rotate.invert(coordinates[0] * d3_radians, coordinates[1] * d3_radians);\n return coordinates[0] *= d3_degrees, coordinates[1] *= d3_degrees, coordinates;\n };\n return forward;\n };\n function d3_geo_identityRotation(λ, φ) {\n return [ λ > π ? λ - τ : λ < -π ? λ + τ : λ, φ ];\n }\n d3_geo_identityRotation.invert = d3_geo_equirectangular;\n function d3_geo_rotation(δλ, δφ, δγ) {\n return δλ ? δφ || δγ ? d3_geo_compose(d3_geo_rotationλ(δλ), d3_geo_rotationφγ(δφ, δγ)) : d3_geo_rotationλ(δλ) : δφ || δγ ? d3_geo_rotationφγ(δφ, δγ) : d3_geo_identityRotation;\n }\n function d3_geo_forwardRotationλ(δλ) {\n return function(λ, φ) {\n return λ += δλ, [ λ > π ? λ - τ : λ < -π ? λ + τ : λ, φ ];\n };\n }\n function d3_geo_rotationλ(δλ) {\n var rotation = d3_geo_forwardRotationλ(δλ);\n rotation.invert = d3_geo_forwardRotationλ(-δλ);\n return rotation;\n }\n function d3_geo_rotationφγ(δφ, δγ) {\n var cosδφ = Math.cos(δφ), sinδφ = Math.sin(δφ), cosδγ = Math.cos(δγ), sinδγ = Math.sin(δγ);\n function rotation(λ, φ) {\n var cosφ = Math.cos(φ), x = Math.cos(λ) * cosφ, y = Math.sin(λ) * cosφ, z = Math.sin(φ), k = z * cosδφ + x * sinδφ;\n return [ Math.atan2(y * cosδγ - k * sinδγ, x * cosδφ - z * sinδφ), d3_asin(k * cosδγ + y * sinδγ) ];\n }\n rotation.invert = function(λ, φ) {\n var cosφ = Math.cos(φ), x = Math.cos(λ) * cosφ, y = Math.sin(λ) * cosφ, z = Math.sin(φ), k = z * cosδγ - y * sinδγ;\n return [ Math.atan2(y * cosδγ + z * sinδγ, x * cosδφ + k * sinδφ), d3_asin(k * cosδφ - x * sinδφ) ];\n };\n return rotation;\n }\n d3.geo.circle = function() {\n var origin = [ 0, 0 ], angle, precision = 6, interpolate;\n function circle() {\n var center = typeof origin === \"function\" ? origin.apply(this, arguments) : origin, rotate = d3_geo_rotation(-center[0] * d3_radians, -center[1] * d3_radians, 0).invert, ring = [];\n interpolate(null, null, 1, {\n point: function(x, y) {\n ring.push(x = rotate(x, y));\n x[0] *= d3_degrees, x[1] *= d3_degrees;\n }\n });\n return {\n type: \"Polygon\",\n coordinates: [ ring ]\n };\n }\n circle.origin = function(x) {\n if (!arguments.length) return origin;\n origin = x;\n return circle;\n };\n circle.angle = function(x) {\n if (!arguments.length) return angle;\n interpolate = d3_geo_circleInterpolate((angle = +x) * d3_radians, precision * d3_radians);\n return circle;\n };\n circle.precision = function(_) {\n if (!arguments.length) return precision;\n interpolate = d3_geo_circleInterpolate(angle * d3_radians, (precision = +_) * d3_radians);\n return circle;\n };\n return circle.angle(90);\n };\n function d3_geo_circleInterpolate(radius, precision) {\n var cr = Math.cos(radius), sr = Math.sin(radius);\n return function(from, to, direction, listener) {\n var step = direction * precision;\n if (from != null) {\n from = d3_geo_circleAngle(cr, from);\n to = d3_geo_circleAngle(cr, to);\n if (direction > 0 ? from < to : from > to) from += direction * τ;\n } else {\n from = radius + direction * τ;\n to = radius - .5 * step;\n }\n for (var point, t = from; direction > 0 ? t > to : t < to; t -= step) {\n listener.point((point = d3_geo_spherical([ cr, -sr * Math.cos(t), -sr * Math.sin(t) ]))[0], point[1]);\n }\n };\n }\n function d3_geo_circleAngle(cr, point) {\n var a = d3_geo_cartesian(point);\n a[0] -= cr;\n d3_geo_cartesianNormalize(a);\n var angle = d3_acos(-a[1]);\n return ((-a[2] < 0 ? -angle : angle) + 2 * Math.PI - ε) % (2 * Math.PI);\n }\n d3.geo.distance = function(a, b) {\n var Δλ = (b[0] - a[0]) * d3_radians, φ0 = a[1] * d3_radians, φ1 = b[1] * d3_radians, sinΔλ = Math.sin(Δλ), cosΔλ = Math.cos(Δλ), sinφ0 = Math.sin(φ0), cosφ0 = Math.cos(φ0), sinφ1 = Math.sin(φ1), cosφ1 = Math.cos(φ1), t;\n return Math.atan2(Math.sqrt((t = cosφ1 * sinΔλ) * t + (t = cosφ0 * sinφ1 - sinφ0 * cosφ1 * cosΔλ) * t), sinφ0 * sinφ1 + cosφ0 * cosφ1 * cosΔλ);\n };\n d3.geo.graticule = function() {\n var x1, x0, X1, X0, y1, y0, Y1, Y0, dx = 10, dy = dx, DX = 90, DY = 360, x, y, X, Y, precision = 2.5;\n function graticule() {\n return {\n type: \"MultiLineString\",\n coordinates: lines()\n };\n }\n function lines() {\n return d3.range(Math.ceil(X0 / DX) * DX, X1, DX).map(X).concat(d3.range(Math.ceil(Y0 / DY) * DY, Y1, DY).map(Y)).concat(d3.range(Math.ceil(x0 / dx) * dx, x1, dx).filter(function(x) {\n return abs(x % DX) > ε;\n }).map(x)).concat(d3.range(Math.ceil(y0 / dy) * dy, y1, dy).filter(function(y) {\n return abs(y % DY) > ε;\n }).map(y));\n }\n graticule.lines = function() {\n return lines().map(function(coordinates) {\n return {\n type: \"LineString\",\n coordinates: coordinates\n };\n });\n };\n graticule.outline = function() {\n return {\n type: \"Polygon\",\n coordinates: [ X(X0).concat(Y(Y1).slice(1), X(X1).reverse().slice(1), Y(Y0).reverse().slice(1)) ]\n };\n };\n graticule.extent = function(_) {\n if (!arguments.length) return graticule.minorExtent();\n return graticule.majorExtent(_).minorExtent(_);\n };\n graticule.majorExtent = function(_) {\n if (!arguments.length) return [ [ X0, Y0 ], [ X1, Y1 ] ];\n X0 = +_[0][0], X1 = +_[1][0];\n Y0 = +_[0][1], Y1 = +_[1][1];\n if (X0 > X1) _ = X0, X0 = X1, X1 = _;\n if (Y0 > Y1) _ = Y0, Y0 = Y1, Y1 = _;\n return graticule.precision(precision);\n };\n graticule.minorExtent = function(_) {\n if (!arguments.length) return [ [ x0, y0 ], [ x1, y1 ] ];\n x0 = +_[0][0], x1 = +_[1][0];\n y0 = +_[0][1], y1 = +_[1][1];\n if (x0 > x1) _ = x0, x0 = x1, x1 = _;\n if (y0 > y1) _ = y0, y0 = y1, y1 = _;\n return graticule.precision(precision);\n };\n graticule.step = function(_) {\n if (!arguments.length) return graticule.minorStep();\n return graticule.majorStep(_).minorStep(_);\n };\n graticule.majorStep = function(_) {\n if (!arguments.length) return [ DX, DY ];\n DX = +_[0], DY = +_[1];\n return graticule;\n };\n graticule.minorStep = function(_) {\n if (!arguments.length) return [ dx, dy ];\n dx = +_[0], dy = +_[1];\n return graticule;\n };\n graticule.precision = function(_) {\n if (!arguments.length) return precision;\n precision = +_;\n x = d3_geo_graticuleX(y0, y1, 90);\n y = d3_geo_graticuleY(x0, x1, precision);\n X = d3_geo_graticuleX(Y0, Y1, 90);\n Y = d3_geo_graticuleY(X0, X1, precision);\n return graticule;\n };\n return graticule.majorExtent([ [ -180, -90 + ε ], [ 180, 90 - ε ] ]).minorExtent([ [ -180, -80 - ε ], [ 180, 80 + ε ] ]);\n };\n function d3_geo_graticuleX(y0, y1, dy) {\n var y = d3.range(y0, y1 - ε, dy).concat(y1);\n return function(x) {\n return y.map(function(y) {\n return [ x, y ];\n });\n };\n }\n function d3_geo_graticuleY(x0, x1, dx) {\n var x = d3.range(x0, x1 - ε, dx).concat(x1);\n return function(y) {\n return x.map(function(x) {\n return [ x, y ];\n });\n };\n }\n function d3_source(d) {\n return d.source;\n }\n function d3_target(d) {\n return d.target;\n }\n d3.geo.greatArc = function() {\n var source = d3_source, source_, target = d3_target, target_;\n function greatArc() {\n return {\n type: \"LineString\",\n coordinates: [ source_ || source.apply(this, arguments), target_ || target.apply(this, arguments) ]\n };\n }\n greatArc.distance = function() {\n return d3.geo.distance(source_ || source.apply(this, arguments), target_ || target.apply(this, arguments));\n };\n greatArc.source = function(_) {\n if (!arguments.length) return source;\n source = _, source_ = typeof _ === \"function\" ? null : _;\n return greatArc;\n };\n greatArc.target = function(_) {\n if (!arguments.length) return target;\n target = _, target_ = typeof _ === \"function\" ? null : _;\n return greatArc;\n };\n greatArc.precision = function() {\n return arguments.length ? greatArc : 0;\n };\n return greatArc;\n };\n d3.geo.interpolate = function(source, target) {\n return d3_geo_interpolate(source[0] * d3_radians, source[1] * d3_radians, target[0] * d3_radians, target[1] * d3_radians);\n };\n function d3_geo_interpolate(x0, y0, x1, y1) {\n var cy0 = Math.cos(y0), sy0 = Math.sin(y0), cy1 = Math.cos(y1), sy1 = Math.sin(y1), kx0 = cy0 * Math.cos(x0), ky0 = cy0 * Math.sin(x0), kx1 = cy1 * Math.cos(x1), ky1 = cy1 * Math.sin(x1), d = 2 * Math.asin(Math.sqrt(d3_haversin(y1 - y0) + cy0 * cy1 * d3_haversin(x1 - x0))), k = 1 / Math.sin(d);\n var interpolate = d ? function(t) {\n var B = Math.sin(t *= d) * k, A = Math.sin(d - t) * k, x = A * kx0 + B * kx1, y = A * ky0 + B * ky1, z = A * sy0 + B * sy1;\n return [ Math.atan2(y, x) * d3_degrees, Math.atan2(z, Math.sqrt(x * x + y * y)) * d3_degrees ];\n } : function() {\n return [ x0 * d3_degrees, y0 * d3_degrees ];\n };\n interpolate.distance = d;\n return interpolate;\n }\n d3.geo.length = function(object) {\n d3_geo_lengthSum = 0;\n d3.geo.stream(object, d3_geo_length);\n return d3_geo_lengthSum;\n };\n var d3_geo_lengthSum;\n var d3_geo_length = {\n sphere: d3_noop,\n point: d3_noop,\n lineStart: d3_geo_lengthLineStart,\n lineEnd: d3_noop,\n polygonStart: d3_noop,\n polygonEnd: d3_noop\n };\n function d3_geo_lengthLineStart() {\n var λ0, sinφ0, cosφ0;\n d3_geo_length.point = function(λ, φ) {\n λ0 = λ * d3_radians, sinφ0 = Math.sin(φ *= d3_radians), cosφ0 = Math.cos(φ);\n d3_geo_length.point = nextPoint;\n };\n d3_geo_length.lineEnd = function() {\n d3_geo_length.point = d3_geo_length.lineEnd = d3_noop;\n };\n function nextPoint(λ, φ) {\n var sinφ = Math.sin(φ *= d3_radians), cosφ = Math.cos(φ), t = abs((λ *= d3_radians) - λ0), cosΔλ = Math.cos(t);\n d3_geo_lengthSum += Math.atan2(Math.sqrt((t = cosφ * Math.sin(t)) * t + (t = cosφ0 * sinφ - sinφ0 * cosφ * cosΔλ) * t), sinφ0 * sinφ + cosφ0 * cosφ * cosΔλ);\n λ0 = λ, sinφ0 = sinφ, cosφ0 = cosφ;\n }\n }\n function d3_geo_azimuthal(scale, angle) {\n function azimuthal(λ, φ) {\n var cosλ = Math.cos(λ), cosφ = Math.cos(φ), k = scale(cosλ * cosφ);\n return [ k * cosφ * Math.sin(λ), k * Math.sin(φ) ];\n }\n azimuthal.invert = function(x, y) {\n var ρ = Math.sqrt(x * x + y * y), c = angle(ρ), sinc = Math.sin(c), cosc = Math.cos(c);\n return [ Math.atan2(x * sinc, ρ * cosc), Math.asin(ρ && y * sinc / ρ) ];\n };\n return azimuthal;\n }\n var d3_geo_azimuthalEqualArea = d3_geo_azimuthal(function(cosλcosφ) {\n return Math.sqrt(2 / (1 + cosλcosφ));\n }, function(ρ) {\n return 2 * Math.asin(ρ / 2);\n });\n (d3.geo.azimuthalEqualArea = function() {\n return d3_geo_projection(d3_geo_azimuthalEqualArea);\n }).raw = d3_geo_azimuthalEqualArea;\n var d3_geo_azimuthalEquidistant = d3_geo_azimuthal(function(cosλcosφ) {\n var c = Math.acos(cosλcosφ);\n return c && c / Math.sin(c);\n }, d3_identity);\n (d3.geo.azimuthalEquidistant = function() {\n return d3_geo_projection(d3_geo_azimuthalEquidistant);\n }).raw = d3_geo_azimuthalEquidistant;\n function d3_geo_conicConformal(φ0, φ1) {\n var cosφ0 = Math.cos(φ0), t = function(φ) {\n return Math.tan(π / 4 + φ / 2);\n }, n = φ0 === φ1 ? Math.sin(φ0) : Math.log(cosφ0 / Math.cos(φ1)) / Math.log(t(φ1) / t(φ0)), F = cosφ0 * Math.pow(t(φ0), n) / n;\n if (!n) return d3_geo_mercator;\n function forward(λ, φ) {\n if (F > 0) {\n if (φ < -halfπ + ε) φ = -halfπ + ε;\n } else {\n if (φ > halfπ - ε) φ = halfπ - ε;\n }\n var ρ = F / Math.pow(t(φ), n);\n return [ ρ * Math.sin(n * λ), F - ρ * Math.cos(n * λ) ];\n }\n forward.invert = function(x, y) {\n var ρ0_y = F - y, ρ = d3_sgn(n) * Math.sqrt(x * x + ρ0_y * ρ0_y);\n return [ Math.atan2(x, ρ0_y) / n, 2 * Math.atan(Math.pow(F / ρ, 1 / n)) - halfπ ];\n };\n return forward;\n }\n (d3.geo.conicConformal = function() {\n return d3_geo_conic(d3_geo_conicConformal);\n }).raw = d3_geo_conicConformal;\n function d3_geo_conicEquidistant(φ0, φ1) {\n var cosφ0 = Math.cos(φ0), n = φ0 === φ1 ? Math.sin(φ0) : (cosφ0 - Math.cos(φ1)) / (φ1 - φ0), G = cosφ0 / n + φ0;\n if (abs(n) < ε) return d3_geo_equirectangular;\n function forward(λ, φ) {\n var ρ = G - φ;\n return [ ρ * Math.sin(n * λ), G - ρ * Math.cos(n * λ) ];\n }\n forward.invert = function(x, y) {\n var ρ0_y = G - y;\n return [ Math.atan2(x, ρ0_y) / n, G - d3_sgn(n) * Math.sqrt(x * x + ρ0_y * ρ0_y) ];\n };\n return forward;\n }\n (d3.geo.conicEquidistant = function() {\n return d3_geo_conic(d3_geo_conicEquidistant);\n }).raw = d3_geo_conicEquidistant;\n var d3_geo_gnomonic = d3_geo_azimuthal(function(cosλcosφ) {\n return 1 / cosλcosφ;\n }, Math.atan);\n (d3.geo.gnomonic = function() {\n return d3_geo_projection(d3_geo_gnomonic);\n }).raw = d3_geo_gnomonic;\n function d3_geo_mercator(λ, φ) {\n return [ λ, Math.log(Math.tan(π / 4 + φ / 2)) ];\n }\n d3_geo_mercator.invert = function(x, y) {\n return [ x, 2 * Math.atan(Math.exp(y)) - halfπ ];\n };\n function d3_geo_mercatorProjection(project) {\n var m = d3_geo_projection(project), scale = m.scale, translate = m.translate, clipExtent = m.clipExtent, clipAuto;\n m.scale = function() {\n var v = scale.apply(m, arguments);\n return v === m ? clipAuto ? m.clipExtent(null) : m : v;\n };\n m.translate = function() {\n var v = translate.apply(m, arguments);\n return v === m ? clipAuto ? m.clipExtent(null) : m : v;\n };\n m.clipExtent = function(_) {\n var v = clipExtent.apply(m, arguments);\n if (v === m) {\n if (clipAuto = _ == null) {\n var k = π * scale(), t = translate();\n clipExtent([ [ t[0] - k, t[1] - k ], [ t[0] + k, t[1] + k ] ]);\n }\n } else if (clipAuto) {\n v = null;\n }\n return v;\n };\n return m.clipExtent(null);\n }\n (d3.geo.mercator = function() {\n return d3_geo_mercatorProjection(d3_geo_mercator);\n }).raw = d3_geo_mercator;\n var d3_geo_orthographic = d3_geo_azimuthal(function() {\n return 1;\n }, Math.asin);\n (d3.geo.orthographic = function() {\n return d3_geo_projection(d3_geo_orthographic);\n }).raw = d3_geo_orthographic;\n var d3_geo_stereographic = d3_geo_azimuthal(function(cosλcosφ) {\n return 1 / (1 + cosλcosφ);\n }, function(ρ) {\n return 2 * Math.atan(ρ);\n });\n (d3.geo.stereographic = function() {\n return d3_geo_projection(d3_geo_stereographic);\n }).raw = d3_geo_stereographic;\n function d3_geo_transverseMercator(λ, φ) {\n return [ Math.log(Math.tan(π / 4 + φ / 2)), -λ ];\n }\n d3_geo_transverseMercator.invert = function(x, y) {\n return [ -y, 2 * Math.atan(Math.exp(x)) - halfπ ];\n };\n (d3.geo.transverseMercator = function() {\n var projection = d3_geo_mercatorProjection(d3_geo_transverseMercator), center = projection.center, rotate = projection.rotate;\n projection.center = function(_) {\n return _ ? center([ -_[1], _[0] ]) : (_ = center(), [ _[1], -_[0] ]);\n };\n projection.rotate = function(_) {\n return _ ? rotate([ _[0], _[1], _.length > 2 ? _[2] + 90 : 90 ]) : (_ = rotate(), \n [ _[0], _[1], _[2] - 90 ]);\n };\n return rotate([ 0, 0, 90 ]);\n }).raw = d3_geo_transverseMercator;\n d3.geom = {};\n function d3_geom_pointX(d) {\n return d[0];\n }\n function d3_geom_pointY(d) {\n return d[1];\n }\n d3.geom.hull = function(vertices) {\n var x = d3_geom_pointX, y = d3_geom_pointY;\n if (arguments.length) return hull(vertices);\n function hull(data) {\n if (data.length < 3) return [];\n var fx = d3_functor(x), fy = d3_functor(y), i, n = data.length, points = [], flippedPoints = [];\n for (i = 0; i < n; i++) {\n points.push([ +fx.call(this, data[i], i), +fy.call(this, data[i], i), i ]);\n }\n points.sort(d3_geom_hullOrder);\n for (i = 0; i < n; i++) flippedPoints.push([ points[i][0], -points[i][1] ]);\n var upper = d3_geom_hullUpper(points), lower = d3_geom_hullUpper(flippedPoints);\n var skipLeft = lower[0] === upper[0], skipRight = lower[lower.length - 1] === upper[upper.length - 1], polygon = [];\n for (i = upper.length - 1; i >= 0; --i) polygon.push(data[points[upper[i]][2]]);\n for (i = +skipLeft; i < lower.length - skipRight; ++i) polygon.push(data[points[lower[i]][2]]);\n return polygon;\n }\n hull.x = function(_) {\n return arguments.length ? (x = _, hull) : x;\n };\n hull.y = function(_) {\n return arguments.length ? (y = _, hull) : y;\n };\n return hull;\n };\n function d3_geom_hullUpper(points) {\n var n = points.length, hull = [ 0, 1 ], hs = 2;\n for (var i = 2; i < n; i++) {\n while (hs > 1 && d3_cross2d(points[hull[hs - 2]], points[hull[hs - 1]], points[i]) <= 0) --hs;\n hull[hs++] = i;\n }\n return hull.slice(0, hs);\n }\n function d3_geom_hullOrder(a, b) {\n return a[0] - b[0] || a[1] - b[1];\n }\n d3.geom.polygon = function(coordinates) {\n d3_subclass(coordinates, d3_geom_polygonPrototype);\n return coordinates;\n };\n var d3_geom_polygonPrototype = d3.geom.polygon.prototype = [];\n d3_geom_polygonPrototype.area = function() {\n var i = -1, n = this.length, a, b = this[n - 1], area = 0;\n while (++i < n) {\n a = b;\n b = this[i];\n area += a[1] * b[0] - a[0] * b[1];\n }\n return area * .5;\n };\n d3_geom_polygonPrototype.centroid = function(k) {\n var i = -1, n = this.length, x = 0, y = 0, a, b = this[n - 1], c;\n if (!arguments.length) k = -1 / (6 * this.area());\n while (++i < n) {\n a = b;\n b = this[i];\n c = a[0] * b[1] - b[0] * a[1];\n x += (a[0] + b[0]) * c;\n y += (a[1] + b[1]) * c;\n }\n return [ x * k, y * k ];\n };\n d3_geom_polygonPrototype.clip = function(subject) {\n var input, closed = d3_geom_polygonClosed(subject), i = -1, n = this.length - d3_geom_polygonClosed(this), j, m, a = this[n - 1], b, c, d;\n while (++i < n) {\n input = subject.slice();\n subject.length = 0;\n b = this[i];\n c = input[(m = input.length - closed) - 1];\n j = -1;\n while (++j < m) {\n d = input[j];\n if (d3_geom_polygonInside(d, a, b)) {\n if (!d3_geom_polygonInside(c, a, b)) {\n subject.push(d3_geom_polygonIntersect(c, d, a, b));\n }\n subject.push(d);\n } else if (d3_geom_polygonInside(c, a, b)) {\n subject.push(d3_geom_polygonIntersect(c, d, a, b));\n }\n c = d;\n }\n if (closed) subject.push(subject[0]);\n a = b;\n }\n return subject;\n };\n function d3_geom_polygonInside(p, a, b) {\n return (b[0] - a[0]) * (p[1] - a[1]) < (b[1] - a[1]) * (p[0] - a[0]);\n }\n function d3_geom_polygonIntersect(c, d, a, b) {\n var x1 = c[0], x3 = a[0], x21 = d[0] - x1, x43 = b[0] - x3, y1 = c[1], y3 = a[1], y21 = d[1] - y1, y43 = b[1] - y3, ua = (x43 * (y1 - y3) - y43 * (x1 - x3)) / (y43 * x21 - x43 * y21);\n return [ x1 + ua * x21, y1 + ua * y21 ];\n }\n function d3_geom_polygonClosed(coordinates) {\n var a = coordinates[0], b = coordinates[coordinates.length - 1];\n return !(a[0] - b[0] || a[1] - b[1]);\n }\n var d3_geom_voronoiEdges, d3_geom_voronoiCells, d3_geom_voronoiBeaches, d3_geom_voronoiBeachPool = [], d3_geom_voronoiFirstCircle, d3_geom_voronoiCircles, d3_geom_voronoiCirclePool = [];\n function d3_geom_voronoiBeach() {\n d3_geom_voronoiRedBlackNode(this);\n this.edge = this.site = this.circle = null;\n }\n function d3_geom_voronoiCreateBeach(site) {\n var beach = d3_geom_voronoiBeachPool.pop() || new d3_geom_voronoiBeach();\n beach.site = site;\n return beach;\n }\n function d3_geom_voronoiDetachBeach(beach) {\n d3_geom_voronoiDetachCircle(beach);\n d3_geom_voronoiBeaches.remove(beach);\n d3_geom_voronoiBeachPool.push(beach);\n d3_geom_voronoiRedBlackNode(beach);\n }\n function d3_geom_voronoiRemoveBeach(beach) {\n var circle = beach.circle, x = circle.x, y = circle.cy, vertex = {\n x: x,\n y: y\n }, previous = beach.P, next = beach.N, disappearing = [ beach ];\n d3_geom_voronoiDetachBeach(beach);\n var lArc = previous;\n while (lArc.circle && abs(x - lArc.circle.x) < ε && abs(y - lArc.circle.cy) < ε) {\n previous = lArc.P;\n disappearing.unshift(lArc);\n d3_geom_voronoiDetachBeach(lArc);\n lArc = previous;\n }\n disappearing.unshift(lArc);\n d3_geom_voronoiDetachCircle(lArc);\n var rArc = next;\n while (rArc.circle && abs(x - rArc.circle.x) < ε && abs(y - rArc.circle.cy) < ε) {\n next = rArc.N;\n disappearing.push(rArc);\n d3_geom_voronoiDetachBeach(rArc);\n rArc = next;\n }\n disappearing.push(rArc);\n d3_geom_voronoiDetachCircle(rArc);\n var nArcs = disappearing.length, iArc;\n for (iArc = 1; iArc < nArcs; ++iArc) {\n rArc = disappearing[iArc];\n lArc = disappearing[iArc - 1];\n d3_geom_voronoiSetEdgeEnd(rArc.edge, lArc.site, rArc.site, vertex);\n }\n lArc = disappearing[0];\n rArc = disappearing[nArcs - 1];\n rArc.edge = d3_geom_voronoiCreateEdge(lArc.site, rArc.site, null, vertex);\n d3_geom_voronoiAttachCircle(lArc);\n d3_geom_voronoiAttachCircle(rArc);\n }\n function d3_geom_voronoiAddBeach(site) {\n var x = site.x, directrix = site.y, lArc, rArc, dxl, dxr, node = d3_geom_voronoiBeaches._;\n while (node) {\n dxl = d3_geom_voronoiLeftBreakPoint(node, directrix) - x;\n if (dxl > ε) node = node.L; else {\n dxr = x - d3_geom_voronoiRightBreakPoint(node, directrix);\n if (dxr > ε) {\n if (!node.R) {\n lArc = node;\n break;\n }\n node = node.R;\n } else {\n if (dxl > -ε) {\n lArc = node.P;\n rArc = node;\n } else if (dxr > -ε) {\n lArc = node;\n rArc = node.N;\n } else {\n lArc = rArc = node;\n }\n break;\n }\n }\n }\n var newArc = d3_geom_voronoiCreateBeach(site);\n d3_geom_voronoiBeaches.insert(lArc, newArc);\n if (!lArc && !rArc) return;\n if (lArc === rArc) {\n d3_geom_voronoiDetachCircle(lArc);\n rArc = d3_geom_voronoiCreateBeach(lArc.site);\n d3_geom_voronoiBeaches.insert(newArc, rArc);\n newArc.edge = rArc.edge = d3_geom_voronoiCreateEdge(lArc.site, newArc.site);\n d3_geom_voronoiAttachCircle(lArc);\n d3_geom_voronoiAttachCircle(rArc);\n return;\n }\n if (!rArc) {\n newArc.edge = d3_geom_voronoiCreateEdge(lArc.site, newArc.site);\n return;\n }\n d3_geom_voronoiDetachCircle(lArc);\n d3_geom_voronoiDetachCircle(rArc);\n var lSite = lArc.site, ax = lSite.x, ay = lSite.y, bx = site.x - ax, by = site.y - ay, rSite = rArc.site, cx = rSite.x - ax, cy = rSite.y - ay, d = 2 * (bx * cy - by * cx), hb = bx * bx + by * by, hc = cx * cx + cy * cy, vertex = {\n x: (cy * hb - by * hc) / d + ax,\n y: (bx * hc - cx * hb) / d + ay\n };\n d3_geom_voronoiSetEdgeEnd(rArc.edge, lSite, rSite, vertex);\n newArc.edge = d3_geom_voronoiCreateEdge(lSite, site, null, vertex);\n rArc.edge = d3_geom_voronoiCreateEdge(site, rSite, null, vertex);\n d3_geom_voronoiAttachCircle(lArc);\n d3_geom_voronoiAttachCircle(rArc);\n }\n function d3_geom_voronoiLeftBreakPoint(arc, directrix) {\n var site = arc.site, rfocx = site.x, rfocy = site.y, pby2 = rfocy - directrix;\n if (!pby2) return rfocx;\n var lArc = arc.P;\n if (!lArc) return -Infinity;\n site = lArc.site;\n var lfocx = site.x, lfocy = site.y, plby2 = lfocy - directrix;\n if (!plby2) return lfocx;\n var hl = lfocx - rfocx, aby2 = 1 / pby2 - 1 / plby2, b = hl / plby2;\n if (aby2) return (-b + Math.sqrt(b * b - 2 * aby2 * (hl * hl / (-2 * plby2) - lfocy + plby2 / 2 + rfocy - pby2 / 2))) / aby2 + rfocx;\n return (rfocx + lfocx) / 2;\n }\n function d3_geom_voronoiRightBreakPoint(arc, directrix) {\n var rArc = arc.N;\n if (rArc) return d3_geom_voronoiLeftBreakPoint(rArc, directrix);\n var site = arc.site;\n return site.y === directrix ? site.x : Infinity;\n }\n function d3_geom_voronoiCell(site) {\n this.site = site;\n this.edges = [];\n }\n d3_geom_voronoiCell.prototype.prepare = function() {\n var halfEdges = this.edges, iHalfEdge = halfEdges.length, edge;\n while (iHalfEdge--) {\n edge = halfEdges[iHalfEdge].edge;\n if (!edge.b || !edge.a) halfEdges.splice(iHalfEdge, 1);\n }\n halfEdges.sort(d3_geom_voronoiHalfEdgeOrder);\n return halfEdges.length;\n };\n function d3_geom_voronoiCloseCells(extent) {\n var x0 = extent[0][0], x1 = extent[1][0], y0 = extent[0][1], y1 = extent[1][1], x2, y2, x3, y3, cells = d3_geom_voronoiCells, iCell = cells.length, cell, iHalfEdge, halfEdges, nHalfEdges, start, end;\n while (iCell--) {\n cell = cells[iCell];\n if (!cell || !cell.prepare()) continue;\n halfEdges = cell.edges;\n nHalfEdges = halfEdges.length;\n iHalfEdge = 0;\n while (iHalfEdge < nHalfEdges) {\n end = halfEdges[iHalfEdge].end(), x3 = end.x, y3 = end.y;\n start = halfEdges[++iHalfEdge % nHalfEdges].start(), x2 = start.x, y2 = start.y;\n if (abs(x3 - x2) > ε || abs(y3 - y2) > ε) {\n halfEdges.splice(iHalfEdge, 0, new d3_geom_voronoiHalfEdge(d3_geom_voronoiCreateBorderEdge(cell.site, end, abs(x3 - x0) < ε && y1 - y3 > ε ? {\n x: x0,\n y: abs(x2 - x0) < ε ? y2 : y1\n } : abs(y3 - y1) < ε && x1 - x3 > ε ? {\n x: abs(y2 - y1) < ε ? x2 : x1,\n y: y1\n } : abs(x3 - x1) < ε && y3 - y0 > ε ? {\n x: x1,\n y: abs(x2 - x1) < ε ? y2 : y0\n } : abs(y3 - y0) < ε && x3 - x0 > ε ? {\n x: abs(y2 - y0) < ε ? x2 : x0,\n y: y0\n } : null), cell.site, null));\n ++nHalfEdges;\n }\n }\n }\n }\n function d3_geom_voronoiHalfEdgeOrder(a, b) {\n return b.angle - a.angle;\n }\n function d3_geom_voronoiCircle() {\n d3_geom_voronoiRedBlackNode(this);\n this.x = this.y = this.arc = this.site = this.cy = null;\n }\n function d3_geom_voronoiAttachCircle(arc) {\n var lArc = arc.P, rArc = arc.N;\n if (!lArc || !rArc) return;\n var lSite = lArc.site, cSite = arc.site, rSite = rArc.site;\n if (lSite === rSite) return;\n var bx = cSite.x, by = cSite.y, ax = lSite.x - bx, ay = lSite.y - by, cx = rSite.x - bx, cy = rSite.y - by;\n var d = 2 * (ax * cy - ay * cx);\n if (d >= -ε2) return;\n var ha = ax * ax + ay * ay, hc = cx * cx + cy * cy, x = (cy * ha - ay * hc) / d, y = (ax * hc - cx * ha) / d, cy = y + by;\n var circle = d3_geom_voronoiCirclePool.pop() || new d3_geom_voronoiCircle();\n circle.arc = arc;\n circle.site = cSite;\n circle.x = x + bx;\n circle.y = cy + Math.sqrt(x * x + y * y);\n circle.cy = cy;\n arc.circle = circle;\n var before = null, node = d3_geom_voronoiCircles._;\n while (node) {\n if (circle.y < node.y || circle.y === node.y && circle.x <= node.x) {\n if (node.L) node = node.L; else {\n before = node.P;\n break;\n }\n } else {\n if (node.R) node = node.R; else {\n before = node;\n break;\n }\n }\n }\n d3_geom_voronoiCircles.insert(before, circle);\n if (!before) d3_geom_voronoiFirstCircle = circle;\n }\n function d3_geom_voronoiDetachCircle(arc) {\n var circle = arc.circle;\n if (circle) {\n if (!circle.P) d3_geom_voronoiFirstCircle = circle.N;\n d3_geom_voronoiCircles.remove(circle);\n d3_geom_voronoiCirclePool.push(circle);\n d3_geom_voronoiRedBlackNode(circle);\n arc.circle = null;\n }\n }\n function d3_geom_voronoiClipEdges(extent) {\n var edges = d3_geom_voronoiEdges, clip = d3_geom_clipLine(extent[0][0], extent[0][1], extent[1][0], extent[1][1]), i = edges.length, e;\n while (i--) {\n e = edges[i];\n if (!d3_geom_voronoiConnectEdge(e, extent) || !clip(e) || abs(e.a.x - e.b.x) < ε && abs(e.a.y - e.b.y) < ε) {\n e.a = e.b = null;\n edges.splice(i, 1);\n }\n }\n }\n function d3_geom_voronoiConnectEdge(edge, extent) {\n var vb = edge.b;\n if (vb) return true;\n var va = edge.a, x0 = extent[0][0], x1 = extent[1][0], y0 = extent[0][1], y1 = extent[1][1], lSite = edge.l, rSite = edge.r, lx = lSite.x, ly = lSite.y, rx = rSite.x, ry = rSite.y, fx = (lx + rx) / 2, fy = (ly + ry) / 2, fm, fb;\n if (ry === ly) {\n if (fx < x0 || fx >= x1) return;\n if (lx > rx) {\n if (!va) va = {\n x: fx,\n y: y0\n }; else if (va.y >= y1) return;\n vb = {\n x: fx,\n y: y1\n };\n } else {\n if (!va) va = {\n x: fx,\n y: y1\n }; else if (va.y < y0) return;\n vb = {\n x: fx,\n y: y0\n };\n }\n } else {\n fm = (lx - rx) / (ry - ly);\n fb = fy - fm * fx;\n if (fm < -1 || fm > 1) {\n if (lx > rx) {\n if (!va) va = {\n x: (y0 - fb) / fm,\n y: y0\n }; else if (va.y >= y1) return;\n vb = {\n x: (y1 - fb) / fm,\n y: y1\n };\n } else {\n if (!va) va = {\n x: (y1 - fb) / fm,\n y: y1\n }; else if (va.y < y0) return;\n vb = {\n x: (y0 - fb) / fm,\n y: y0\n };\n }\n } else {\n if (ly < ry) {\n if (!va) va = {\n x: x0,\n y: fm * x0 + fb\n }; else if (va.x >= x1) return;\n vb = {\n x: x1,\n y: fm * x1 + fb\n };\n } else {\n if (!va) va = {\n x: x1,\n y: fm * x1 + fb\n }; else if (va.x < x0) return;\n vb = {\n x: x0,\n y: fm * x0 + fb\n };\n }\n }\n }\n edge.a = va;\n edge.b = vb;\n return true;\n }\n function d3_geom_voronoiEdge(lSite, rSite) {\n this.l = lSite;\n this.r = rSite;\n this.a = this.b = null;\n }\n function d3_geom_voronoiCreateEdge(lSite, rSite, va, vb) {\n var edge = new d3_geom_voronoiEdge(lSite, rSite);\n d3_geom_voronoiEdges.push(edge);\n if (va) d3_geom_voronoiSetEdgeEnd(edge, lSite, rSite, va);\n if (vb) d3_geom_voronoiSetEdgeEnd(edge, rSite, lSite, vb);\n d3_geom_voronoiCells[lSite.i].edges.push(new d3_geom_voronoiHalfEdge(edge, lSite, rSite));\n d3_geom_voronoiCells[rSite.i].edges.push(new d3_geom_voronoiHalfEdge(edge, rSite, lSite));\n return edge;\n }\n function d3_geom_voronoiCreateBorderEdge(lSite, va, vb) {\n var edge = new d3_geom_voronoiEdge(lSite, null);\n edge.a = va;\n edge.b = vb;\n d3_geom_voronoiEdges.push(edge);\n return edge;\n }\n function d3_geom_voronoiSetEdgeEnd(edge, lSite, rSite, vertex) {\n if (!edge.a && !edge.b) {\n edge.a = vertex;\n edge.l = lSite;\n edge.r = rSite;\n } else if (edge.l === rSite) {\n edge.b = vertex;\n } else {\n edge.a = vertex;\n }\n }\n function d3_geom_voronoiHalfEdge(edge, lSite, rSite) {\n var va = edge.a, vb = edge.b;\n this.edge = edge;\n this.site = lSite;\n this.angle = rSite ? Math.atan2(rSite.y - lSite.y, rSite.x - lSite.x) : edge.l === lSite ? Math.atan2(vb.x - va.x, va.y - vb.y) : Math.atan2(va.x - vb.x, vb.y - va.y);\n }\n d3_geom_voronoiHalfEdge.prototype = {\n start: function() {\n return this.edge.l === this.site ? this.edge.a : this.edge.b;\n },\n end: function() {\n return this.edge.l === this.site ? this.edge.b : this.edge.a;\n }\n };\n function d3_geom_voronoiRedBlackTree() {\n this._ = null;\n }\n function d3_geom_voronoiRedBlackNode(node) {\n node.U = node.C = node.L = node.R = node.P = node.N = null;\n }\n d3_geom_voronoiRedBlackTree.prototype = {\n insert: function(after, node) {\n var parent, grandpa, uncle;\n if (after) {\n node.P = after;\n node.N = after.N;\n if (after.N) after.N.P = node;\n after.N = node;\n if (after.R) {\n after = after.R;\n while (after.L) after = after.L;\n after.L = node;\n } else {\n after.R = node;\n }\n parent = after;\n } else if (this._) {\n after = d3_geom_voronoiRedBlackFirst(this._);\n node.P = null;\n node.N = after;\n after.P = after.L = node;\n parent = after;\n } else {\n node.P = node.N = null;\n this._ = node;\n parent = null;\n }\n node.L = node.R = null;\n node.U = parent;\n node.C = true;\n after = node;\n while (parent && parent.C) {\n grandpa = parent.U;\n if (parent === grandpa.L) {\n uncle = grandpa.R;\n if (uncle && uncle.C) {\n parent.C = uncle.C = false;\n grandpa.C = true;\n after = grandpa;\n } else {\n if (after === parent.R) {\n d3_geom_voronoiRedBlackRotateLeft(this, parent);\n after = parent;\n parent = after.U;\n }\n parent.C = false;\n grandpa.C = true;\n d3_geom_voronoiRedBlackRotateRight(this, grandpa);\n }\n } else {\n uncle = grandpa.L;\n if (uncle && uncle.C) {\n parent.C = uncle.C = false;\n grandpa.C = true;\n after = grandpa;\n } else {\n if (after === parent.L) {\n d3_geom_voronoiRedBlackRotateRight(this, parent);\n after = parent;\n parent = after.U;\n }\n parent.C = false;\n grandpa.C = true;\n d3_geom_voronoiRedBlackRotateLeft(this, grandpa);\n }\n }\n parent = after.U;\n }\n this._.C = false;\n },\n remove: function(node) {\n if (node.N) node.N.P = node.P;\n if (node.P) node.P.N = node.N;\n node.N = node.P = null;\n var parent = node.U, sibling, left = node.L, right = node.R, next, red;\n if (!left) next = right; else if (!right) next = left; else next = d3_geom_voronoiRedBlackFirst(right);\n if (parent) {\n if (parent.L === node) parent.L = next; else parent.R = next;\n } else {\n this._ = next;\n }\n if (left && right) {\n red = next.C;\n next.C = node.C;\n next.L = left;\n left.U = next;\n if (next !== right) {\n parent = next.U;\n next.U = node.U;\n node = next.R;\n parent.L = node;\n next.R = right;\n right.U = next;\n } else {\n next.U = parent;\n parent = next;\n node = next.R;\n }\n } else {\n red = node.C;\n node = next;\n }\n if (node) node.U = parent;\n if (red) return;\n if (node && node.C) {\n node.C = false;\n return;\n }\n do {\n if (node === this._) break;\n if (node === parent.L) {\n sibling = parent.R;\n if (sibling.C) {\n sibling.C = false;\n parent.C = true;\n d3_geom_voronoiRedBlackRotateLeft(this, parent);\n sibling = parent.R;\n }\n if (sibling.L && sibling.L.C || sibling.R && sibling.R.C) {\n if (!sibling.R || !sibling.R.C) {\n sibling.L.C = false;\n sibling.C = true;\n d3_geom_voronoiRedBlackRotateRight(this, sibling);\n sibling = parent.R;\n }\n sibling.C = parent.C;\n parent.C = sibling.R.C = false;\n d3_geom_voronoiRedBlackRotateLeft(this, parent);\n node = this._;\n break;\n }\n } else {\n sibling = parent.L;\n if (sibling.C) {\n sibling.C = false;\n parent.C = true;\n d3_geom_voronoiRedBlackRotateRight(this, parent);\n sibling = parent.L;\n }\n if (sibling.L && sibling.L.C || sibling.R && sibling.R.C) {\n if (!sibling.L || !sibling.L.C) {\n sibling.R.C = false;\n sibling.C = true;\n d3_geom_voronoiRedBlackRotateLeft(this, sibling);\n sibling = parent.L;\n }\n sibling.C = parent.C;\n parent.C = sibling.L.C = false;\n d3_geom_voronoiRedBlackRotateRight(this, parent);\n node = this._;\n break;\n }\n }\n sibling.C = true;\n node = parent;\n parent = parent.U;\n } while (!node.C);\n if (node) node.C = false;\n }\n };\n function d3_geom_voronoiRedBlackRotateLeft(tree, node) {\n var p = node, q = node.R, parent = p.U;\n if (parent) {\n if (parent.L === p) parent.L = q; else parent.R = q;\n } else {\n tree._ = q;\n }\n q.U = parent;\n p.U = q;\n p.R = q.L;\n if (p.R) p.R.U = p;\n q.L = p;\n }\n function d3_geom_voronoiRedBlackRotateRight(tree, node) {\n var p = node, q = node.L, parent = p.U;\n if (parent) {\n if (parent.L === p) parent.L = q; else parent.R = q;\n } else {\n tree._ = q;\n }\n q.U = parent;\n p.U = q;\n p.L = q.R;\n if (p.L) p.L.U = p;\n q.R = p;\n }\n function d3_geom_voronoiRedBlackFirst(node) {\n while (node.L) node = node.L;\n return node;\n }\n function d3_geom_voronoi(sites, bbox) {\n var site = sites.sort(d3_geom_voronoiVertexOrder).pop(), x0, y0, circle;\n d3_geom_voronoiEdges = [];\n d3_geom_voronoiCells = new Array(sites.length);\n d3_geom_voronoiBeaches = new d3_geom_voronoiRedBlackTree();\n d3_geom_voronoiCircles = new d3_geom_voronoiRedBlackTree();\n while (true) {\n circle = d3_geom_voronoiFirstCircle;\n if (site && (!circle || site.y < circle.y || site.y === circle.y && site.x < circle.x)) {\n if (site.x !== x0 || site.y !== y0) {\n d3_geom_voronoiCells[site.i] = new d3_geom_voronoiCell(site);\n d3_geom_voronoiAddBeach(site);\n x0 = site.x, y0 = site.y;\n }\n site = sites.pop();\n } else if (circle) {\n d3_geom_voronoiRemoveBeach(circle.arc);\n } else {\n break;\n }\n }\n if (bbox) d3_geom_voronoiClipEdges(bbox), d3_geom_voronoiCloseCells(bbox);\n var diagram = {\n cells: d3_geom_voronoiCells,\n edges: d3_geom_voronoiEdges\n };\n d3_geom_voronoiBeaches = d3_geom_voronoiCircles = d3_geom_voronoiEdges = d3_geom_voronoiCells = null;\n return diagram;\n }\n function d3_geom_voronoiVertexOrder(a, b) {\n return b.y - a.y || b.x - a.x;\n }\n d3.geom.voronoi = function(points) {\n var x = d3_geom_pointX, y = d3_geom_pointY, fx = x, fy = y, clipExtent = d3_geom_voronoiClipExtent;\n if (points) return voronoi(points);\n function voronoi(data) {\n var polygons = new Array(data.length), x0 = clipExtent[0][0], y0 = clipExtent[0][1], x1 = clipExtent[1][0], y1 = clipExtent[1][1];\n d3_geom_voronoi(sites(data), clipExtent).cells.forEach(function(cell, i) {\n var edges = cell.edges, site = cell.site, polygon = polygons[i] = edges.length ? edges.map(function(e) {\n var s = e.start();\n return [ s.x, s.y ];\n }) : site.x >= x0 && site.x <= x1 && site.y >= y0 && site.y <= y1 ? [ [ x0, y1 ], [ x1, y1 ], [ x1, y0 ], [ x0, y0 ] ] : [];\n polygon.point = data[i];\n });\n return polygons;\n }\n function sites(data) {\n return data.map(function(d, i) {\n return {\n x: Math.round(fx(d, i) / ε) * ε,\n y: Math.round(fy(d, i) / ε) * ε,\n i: i\n };\n });\n }\n voronoi.links = function(data) {\n return d3_geom_voronoi(sites(data)).edges.filter(function(edge) {\n return edge.l && edge.r;\n }).map(function(edge) {\n return {\n source: data[edge.l.i],\n target: data[edge.r.i]\n };\n });\n };\n voronoi.triangles = function(data) {\n var triangles = [];\n d3_geom_voronoi(sites(data)).cells.forEach(function(cell, i) {\n var site = cell.site, edges = cell.edges.sort(d3_geom_voronoiHalfEdgeOrder), j = -1, m = edges.length, e0, s0, e1 = edges[m - 1].edge, s1 = e1.l === site ? e1.r : e1.l;\n while (++j < m) {\n e0 = e1;\n s0 = s1;\n e1 = edges[j].edge;\n s1 = e1.l === site ? e1.r : e1.l;\n if (i < s0.i && i < s1.i && d3_geom_voronoiTriangleArea(site, s0, s1) < 0) {\n triangles.push([ data[i], data[s0.i], data[s1.i] ]);\n }\n }\n });\n return triangles;\n };\n voronoi.x = function(_) {\n return arguments.length ? (fx = d3_functor(x = _), voronoi) : x;\n };\n voronoi.y = function(_) {\n return arguments.length ? (fy = d3_functor(y = _), voronoi) : y;\n };\n voronoi.clipExtent = function(_) {\n if (!arguments.length) return clipExtent === d3_geom_voronoiClipExtent ? null : clipExtent;\n clipExtent = _ == null ? d3_geom_voronoiClipExtent : _;\n return voronoi;\n };\n voronoi.size = function(_) {\n if (!arguments.length) return clipExtent === d3_geom_voronoiClipExtent ? null : clipExtent && clipExtent[1];\n return voronoi.clipExtent(_ && [ [ 0, 0 ], _ ]);\n };\n return voronoi;\n };\n var d3_geom_voronoiClipExtent = [ [ -1e6, -1e6 ], [ 1e6, 1e6 ] ];\n function d3_geom_voronoiTriangleArea(a, b, c) {\n return (a.x - c.x) * (b.y - a.y) - (a.x - b.x) * (c.y - a.y);\n }\n d3.geom.delaunay = function(vertices) {\n return d3.geom.voronoi().triangles(vertices);\n };\n d3.geom.quadtree = function(points, x1, y1, x2, y2) {\n var x = d3_geom_pointX, y = d3_geom_pointY, compat;\n if (compat = arguments.length) {\n x = d3_geom_quadtreeCompatX;\n y = d3_geom_quadtreeCompatY;\n if (compat === 3) {\n y2 = y1;\n x2 = x1;\n y1 = x1 = 0;\n }\n return quadtree(points);\n }\n function quadtree(data) {\n var d, fx = d3_functor(x), fy = d3_functor(y), xs, ys, i, n, x1_, y1_, x2_, y2_;\n if (x1 != null) {\n x1_ = x1, y1_ = y1, x2_ = x2, y2_ = y2;\n } else {\n x2_ = y2_ = -(x1_ = y1_ = Infinity);\n xs = [], ys = [];\n n = data.length;\n if (compat) for (i = 0; i < n; ++i) {\n d = data[i];\n if (d.x < x1_) x1_ = d.x;\n if (d.y < y1_) y1_ = d.y;\n if (d.x > x2_) x2_ = d.x;\n if (d.y > y2_) y2_ = d.y;\n xs.push(d.x);\n ys.push(d.y);\n } else for (i = 0; i < n; ++i) {\n var x_ = +fx(d = data[i], i), y_ = +fy(d, i);\n if (x_ < x1_) x1_ = x_;\n if (y_ < y1_) y1_ = y_;\n if (x_ > x2_) x2_ = x_;\n if (y_ > y2_) y2_ = y_;\n xs.push(x_);\n ys.push(y_);\n }\n }\n var dx = x2_ - x1_, dy = y2_ - y1_;\n if (dx > dy) y2_ = y1_ + dx; else x2_ = x1_ + dy;\n function insert(n, d, x, y, x1, y1, x2, y2) {\n if (isNaN(x) || isNaN(y)) return;\n if (n.leaf) {\n var nx = n.x, ny = n.y;\n if (nx != null) {\n if (abs(nx - x) + abs(ny - y) < .01) {\n insertChild(n, d, x, y, x1, y1, x2, y2);\n } else {\n var nPoint = n.point;\n n.x = n.y = n.point = null;\n insertChild(n, nPoint, nx, ny, x1, y1, x2, y2);\n insertChild(n, d, x, y, x1, y1, x2, y2);\n }\n } else {\n n.x = x, n.y = y, n.point = d;\n }\n } else {\n insertChild(n, d, x, y, x1, y1, x2, y2);\n }\n }\n function insertChild(n, d, x, y, x1, y1, x2, y2) {\n var xm = (x1 + x2) * .5, ym = (y1 + y2) * .5, right = x >= xm, below = y >= ym, i = below << 1 | right;\n n.leaf = false;\n n = n.nodes[i] || (n.nodes[i] = d3_geom_quadtreeNode());\n if (right) x1 = xm; else x2 = xm;\n if (below) y1 = ym; else y2 = ym;\n insert(n, d, x, y, x1, y1, x2, y2);\n }\n var root = d3_geom_quadtreeNode();\n root.add = function(d) {\n insert(root, d, +fx(d, ++i), +fy(d, i), x1_, y1_, x2_, y2_);\n };\n root.visit = function(f) {\n d3_geom_quadtreeVisit(f, root, x1_, y1_, x2_, y2_);\n };\n root.find = function(point) {\n return d3_geom_quadtreeFind(root, point[0], point[1], x1_, y1_, x2_, y2_);\n };\n i = -1;\n if (x1 == null) {\n while (++i < n) {\n insert(root, data[i], xs[i], ys[i], x1_, y1_, x2_, y2_);\n }\n --i;\n } else data.forEach(root.add);\n xs = ys = data = d = null;\n return root;\n }\n quadtree.x = function(_) {\n return arguments.length ? (x = _, quadtree) : x;\n };\n quadtree.y = function(_) {\n return arguments.length ? (y = _, quadtree) : y;\n };\n quadtree.extent = function(_) {\n if (!arguments.length) return x1 == null ? null : [ [ x1, y1 ], [ x2, y2 ] ];\n if (_ == null) x1 = y1 = x2 = y2 = null; else x1 = +_[0][0], y1 = +_[0][1], x2 = +_[1][0], \n y2 = +_[1][1];\n return quadtree;\n };\n quadtree.size = function(_) {\n if (!arguments.length) return x1 == null ? null : [ x2 - x1, y2 - y1 ];\n if (_ == null) x1 = y1 = x2 = y2 = null; else x1 = y1 = 0, x2 = +_[0], y2 = +_[1];\n return quadtree;\n };\n return quadtree;\n };\n function d3_geom_quadtreeCompatX(d) {\n return d.x;\n }\n function d3_geom_quadtreeCompatY(d) {\n return d.y;\n }\n function d3_geom_quadtreeNode() {\n return {\n leaf: true,\n nodes: [],\n point: null,\n x: null,\n y: null\n };\n }\n function d3_geom_quadtreeVisit(f, node, x1, y1, x2, y2) {\n if (!f(node, x1, y1, x2, y2)) {\n var sx = (x1 + x2) * .5, sy = (y1 + y2) * .5, children = node.nodes;\n if (children[0]) d3_geom_quadtreeVisit(f, children[0], x1, y1, sx, sy);\n if (children[1]) d3_geom_quadtreeVisit(f, children[1], sx, y1, x2, sy);\n if (children[2]) d3_geom_quadtreeVisit(f, children[2], x1, sy, sx, y2);\n if (children[3]) d3_geom_quadtreeVisit(f, children[3], sx, sy, x2, y2);\n }\n }\n function d3_geom_quadtreeFind(root, x, y, x0, y0, x3, y3) {\n var minDistance2 = Infinity, closestPoint;\n (function find(node, x1, y1, x2, y2) {\n if (x1 > x3 || y1 > y3 || x2 < x0 || y2 < y0) return;\n if (point = node.point) {\n var point, dx = x - node.x, dy = y - node.y, distance2 = dx * dx + dy * dy;\n if (distance2 < minDistance2) {\n var distance = Math.sqrt(minDistance2 = distance2);\n x0 = x - distance, y0 = y - distance;\n x3 = x + distance, y3 = y + distance;\n closestPoint = point;\n }\n }\n var children = node.nodes, xm = (x1 + x2) * .5, ym = (y1 + y2) * .5, right = x >= xm, below = y >= ym;\n for (var i = below << 1 | right, j = i + 4; i < j; ++i) {\n if (node = children[i & 3]) switch (i & 3) {\n case 0:\n find(node, x1, y1, xm, ym);\n break;\n\n case 1:\n find(node, xm, y1, x2, ym);\n break;\n\n case 2:\n find(node, x1, ym, xm, y2);\n break;\n\n case 3:\n find(node, xm, ym, x2, y2);\n break;\n }\n }\n })(root, x0, y0, x3, y3);\n return closestPoint;\n }\n d3.interpolateRgb = d3_interpolateRgb;\n function d3_interpolateRgb(a, b) {\n a = d3.rgb(a);\n b = d3.rgb(b);\n var ar = a.r, ag = a.g, ab = a.b, br = b.r - ar, bg = b.g - ag, bb = b.b - ab;\n return function(t) {\n return \"#\" + d3_rgb_hex(Math.round(ar + br * t)) + d3_rgb_hex(Math.round(ag + bg * t)) + d3_rgb_hex(Math.round(ab + bb * t));\n };\n }\n d3.interpolateObject = d3_interpolateObject;\n function d3_interpolateObject(a, b) {\n var i = {}, c = {}, k;\n for (k in a) {\n if (k in b) {\n i[k] = d3_interpolate(a[k], b[k]);\n } else {\n c[k] = a[k];\n }\n }\n for (k in b) {\n if (!(k in a)) {\n c[k] = b[k];\n }\n }\n return function(t) {\n for (k in i) c[k] = i[k](t);\n return c;\n };\n }\n d3.interpolateNumber = d3_interpolateNumber;\n function d3_interpolateNumber(a, b) {\n a = +a, b = +b;\n return function(t) {\n return a * (1 - t) + b * t;\n };\n }\n d3.interpolateString = d3_interpolateString;\n function d3_interpolateString(a, b) {\n var bi = d3_interpolate_numberA.lastIndex = d3_interpolate_numberB.lastIndex = 0, am, bm, bs, i = -1, s = [], q = [];\n a = a + \"\", b = b + \"\";\n while ((am = d3_interpolate_numberA.exec(a)) && (bm = d3_interpolate_numberB.exec(b))) {\n if ((bs = bm.index) > bi) {\n bs = b.slice(bi, bs);\n if (s[i]) s[i] += bs; else s[++i] = bs;\n }\n if ((am = am[0]) === (bm = bm[0])) {\n if (s[i]) s[i] += bm; else s[++i] = bm;\n } else {\n s[++i] = null;\n q.push({\n i: i,\n x: d3_interpolateNumber(am, bm)\n });\n }\n bi = d3_interpolate_numberB.lastIndex;\n }\n if (bi < b.length) {\n bs = b.slice(bi);\n if (s[i]) s[i] += bs; else s[++i] = bs;\n }\n return s.length < 2 ? q[0] ? (b = q[0].x, function(t) {\n return b(t) + \"\";\n }) : function() {\n return b;\n } : (b = q.length, function(t) {\n for (var i = 0, o; i < b; ++i) s[(o = q[i]).i] = o.x(t);\n return s.join(\"\");\n });\n }\n var d3_interpolate_numberA = /[-+]?(?:\\d+\\.?\\d*|\\.?\\d+)(?:[eE][-+]?\\d+)?/g, d3_interpolate_numberB = new RegExp(d3_interpolate_numberA.source, \"g\");\n d3.interpolate = d3_interpolate;\n function d3_interpolate(a, b) {\n var i = d3.interpolators.length, f;\n while (--i >= 0 && !(f = d3.interpolators[i](a, b))) ;\n return f;\n }\n d3.interpolators = [ function(a, b) {\n var t = typeof b;\n return (t === \"string\" ? d3_rgb_names.has(b.toLowerCase()) || /^(#|rgb\\(|hsl\\()/i.test(b) ? d3_interpolateRgb : d3_interpolateString : b instanceof d3_color ? d3_interpolateRgb : Array.isArray(b) ? d3_interpolateArray : t === \"object\" && isNaN(b) ? d3_interpolateObject : d3_interpolateNumber)(a, b);\n } ];\n d3.interpolateArray = d3_interpolateArray;\n function d3_interpolateArray(a, b) {\n var x = [], c = [], na = a.length, nb = b.length, n0 = Math.min(a.length, b.length), i;\n for (i = 0; i < n0; ++i) x.push(d3_interpolate(a[i], b[i]));\n for (;i < na; ++i) c[i] = a[i];\n for (;i < nb; ++i) c[i] = b[i];\n return function(t) {\n for (i = 0; i < n0; ++i) c[i] = x[i](t);\n return c;\n };\n }\n var d3_ease_default = function() {\n return d3_identity;\n };\n var d3_ease = d3.map({\n linear: d3_ease_default,\n poly: d3_ease_poly,\n quad: function() {\n return d3_ease_quad;\n },\n cubic: function() {\n return d3_ease_cubic;\n },\n sin: function() {\n return d3_ease_sin;\n },\n exp: function() {\n return d3_ease_exp;\n },\n circle: function() {\n return d3_ease_circle;\n },\n elastic: d3_ease_elastic,\n back: d3_ease_back,\n bounce: function() {\n return d3_ease_bounce;\n }\n });\n var d3_ease_mode = d3.map({\n \"in\": d3_identity,\n out: d3_ease_reverse,\n \"in-out\": d3_ease_reflect,\n \"out-in\": function(f) {\n return d3_ease_reflect(d3_ease_reverse(f));\n }\n });\n d3.ease = function(name) {\n var i = name.indexOf(\"-\"), t = i >= 0 ? name.slice(0, i) : name, m = i >= 0 ? name.slice(i + 1) : \"in\";\n t = d3_ease.get(t) || d3_ease_default;\n m = d3_ease_mode.get(m) || d3_identity;\n return d3_ease_clamp(m(t.apply(null, d3_arraySlice.call(arguments, 1))));\n };\n function d3_ease_clamp(f) {\n return function(t) {\n return t <= 0 ? 0 : t >= 1 ? 1 : f(t);\n };\n }\n function d3_ease_reverse(f) {\n return function(t) {\n return 1 - f(1 - t);\n };\n }\n function d3_ease_reflect(f) {\n return function(t) {\n return .5 * (t < .5 ? f(2 * t) : 2 - f(2 - 2 * t));\n };\n }\n function d3_ease_quad(t) {\n return t * t;\n }\n function d3_ease_cubic(t) {\n return t * t * t;\n }\n function d3_ease_cubicInOut(t) {\n if (t <= 0) return 0;\n if (t >= 1) return 1;\n var t2 = t * t, t3 = t2 * t;\n return 4 * (t < .5 ? t3 : 3 * (t - t2) + t3 - .75);\n }\n function d3_ease_poly(e) {\n return function(t) {\n return Math.pow(t, e);\n };\n }\n function d3_ease_sin(t) {\n return 1 - Math.cos(t * halfπ);\n }\n function d3_ease_exp(t) {\n return Math.pow(2, 10 * (t - 1));\n }\n function d3_ease_circle(t) {\n return 1 - Math.sqrt(1 - t * t);\n }\n function d3_ease_elastic(a, p) {\n var s;\n if (arguments.length < 2) p = .45;\n if (arguments.length) s = p / τ * Math.asin(1 / a); else a = 1, s = p / 4;\n return function(t) {\n return 1 + a * Math.pow(2, -10 * t) * Math.sin((t - s) * τ / p);\n };\n }\n function d3_ease_back(s) {\n if (!s) s = 1.70158;\n return function(t) {\n return t * t * ((s + 1) * t - s);\n };\n }\n function d3_ease_bounce(t) {\n return t < 1 / 2.75 ? 7.5625 * t * t : t < 2 / 2.75 ? 7.5625 * (t -= 1.5 / 2.75) * t + .75 : t < 2.5 / 2.75 ? 7.5625 * (t -= 2.25 / 2.75) * t + .9375 : 7.5625 * (t -= 2.625 / 2.75) * t + .984375;\n }\n d3.interpolateHcl = d3_interpolateHcl;\n function d3_interpolateHcl(a, b) {\n a = d3.hcl(a);\n b = d3.hcl(b);\n var ah = a.h, ac = a.c, al = a.l, bh = b.h - ah, bc = b.c - ac, bl = b.l - al;\n if (isNaN(bc)) bc = 0, ac = isNaN(ac) ? b.c : ac;\n if (isNaN(bh)) bh = 0, ah = isNaN(ah) ? b.h : ah; else if (bh > 180) bh -= 360; else if (bh < -180) bh += 360;\n return function(t) {\n return d3_hcl_lab(ah + bh * t, ac + bc * t, al + bl * t) + \"\";\n };\n }\n d3.interpolateHsl = d3_interpolateHsl;\n function d3_interpolateHsl(a, b) {\n a = d3.hsl(a);\n b = d3.hsl(b);\n var ah = a.h, as = a.s, al = a.l, bh = b.h - ah, bs = b.s - as, bl = b.l - al;\n if (isNaN(bs)) bs = 0, as = isNaN(as) ? b.s : as;\n if (isNaN(bh)) bh = 0, ah = isNaN(ah) ? b.h : ah; else if (bh > 180) bh -= 360; else if (bh < -180) bh += 360;\n return function(t) {\n return d3_hsl_rgb(ah + bh * t, as + bs * t, al + bl * t) + \"\";\n };\n }\n d3.interpolateLab = d3_interpolateLab;\n function d3_interpolateLab(a, b) {\n a = d3.lab(a);\n b = d3.lab(b);\n var al = a.l, aa = a.a, ab = a.b, bl = b.l - al, ba = b.a - aa, bb = b.b - ab;\n return function(t) {\n return d3_lab_rgb(al + bl * t, aa + ba * t, ab + bb * t) + \"\";\n };\n }\n d3.interpolateRound = d3_interpolateRound;\n function d3_interpolateRound(a, b) {\n b -= a;\n return function(t) {\n return Math.round(a + b * t);\n };\n }\n d3.transform = function(string) {\n var g = d3_document.createElementNS(d3.ns.prefix.svg, \"g\");\n return (d3.transform = function(string) {\n if (string != null) {\n g.setAttribute(\"transform\", string);\n var t = g.transform.baseVal.consolidate();\n }\n return new d3_transform(t ? t.matrix : d3_transformIdentity);\n })(string);\n };\n function d3_transform(m) {\n var r0 = [ m.a, m.b ], r1 = [ m.c, m.d ], kx = d3_transformNormalize(r0), kz = d3_transformDot(r0, r1), ky = d3_transformNormalize(d3_transformCombine(r1, r0, -kz)) || 0;\n if (r0[0] * r1[1] < r1[0] * r0[1]) {\n r0[0] *= -1;\n r0[1] *= -1;\n kx *= -1;\n kz *= -1;\n }\n this.rotate = (kx ? Math.atan2(r0[1], r0[0]) : Math.atan2(-r1[0], r1[1])) * d3_degrees;\n this.translate = [ m.e, m.f ];\n this.scale = [ kx, ky ];\n this.skew = ky ? Math.atan2(kz, ky) * d3_degrees : 0;\n }\n d3_transform.prototype.toString = function() {\n return \"translate(\" + this.translate + \")rotate(\" + this.rotate + \")skewX(\" + this.skew + \")scale(\" + this.scale + \")\";\n };\n function d3_transformDot(a, b) {\n return a[0] * b[0] + a[1] * b[1];\n }\n function d3_transformNormalize(a) {\n var k = Math.sqrt(d3_transformDot(a, a));\n if (k) {\n a[0] /= k;\n a[1] /= k;\n }\n return k;\n }\n function d3_transformCombine(a, b, k) {\n a[0] += k * b[0];\n a[1] += k * b[1];\n return a;\n }\n var d3_transformIdentity = {\n a: 1,\n b: 0,\n c: 0,\n d: 1,\n e: 0,\n f: 0\n };\n d3.interpolateTransform = d3_interpolateTransform;\n function d3_interpolateTransformPop(s) {\n return s.length ? s.pop() + \",\" : \"\";\n }\n function d3_interpolateTranslate(ta, tb, s, q) {\n if (ta[0] !== tb[0] || ta[1] !== tb[1]) {\n var i = s.push(\"translate(\", null, \",\", null, \")\");\n q.push({\n i: i - 4,\n x: d3_interpolateNumber(ta[0], tb[0])\n }, {\n i: i - 2,\n x: d3_interpolateNumber(ta[1], tb[1])\n });\n } else if (tb[0] || tb[1]) {\n s.push(\"translate(\" + tb + \")\");\n }\n }\n function d3_interpolateRotate(ra, rb, s, q) {\n if (ra !== rb) {\n if (ra - rb > 180) rb += 360; else if (rb - ra > 180) ra += 360;\n q.push({\n i: s.push(d3_interpolateTransformPop(s) + \"rotate(\", null, \")\") - 2,\n x: d3_interpolateNumber(ra, rb)\n });\n } else if (rb) {\n s.push(d3_interpolateTransformPop(s) + \"rotate(\" + rb + \")\");\n }\n }\n function d3_interpolateSkew(wa, wb, s, q) {\n if (wa !== wb) {\n q.push({\n i: s.push(d3_interpolateTransformPop(s) + \"skewX(\", null, \")\") - 2,\n x: d3_interpolateNumber(wa, wb)\n });\n } else if (wb) {\n s.push(d3_interpolateTransformPop(s) + \"skewX(\" + wb + \")\");\n }\n }\n function d3_interpolateScale(ka, kb, s, q) {\n if (ka[0] !== kb[0] || ka[1] !== kb[1]) {\n var i = s.push(d3_interpolateTransformPop(s) + \"scale(\", null, \",\", null, \")\");\n q.push({\n i: i - 4,\n x: d3_interpolateNumber(ka[0], kb[0])\n }, {\n i: i - 2,\n x: d3_interpolateNumber(ka[1], kb[1])\n });\n } else if (kb[0] !== 1 || kb[1] !== 1) {\n s.push(d3_interpolateTransformPop(s) + \"scale(\" + kb + \")\");\n }\n }\n function d3_interpolateTransform(a, b) {\n var s = [], q = [];\n a = d3.transform(a), b = d3.transform(b);\n d3_interpolateTranslate(a.translate, b.translate, s, q);\n d3_interpolateRotate(a.rotate, b.rotate, s, q);\n d3_interpolateSkew(a.skew, b.skew, s, q);\n d3_interpolateScale(a.scale, b.scale, s, q);\n a = b = null;\n return function(t) {\n var i = -1, n = q.length, o;\n while (++i < n) s[(o = q[i]).i] = o.x(t);\n return s.join(\"\");\n };\n }\n function d3_uninterpolateNumber(a, b) {\n b = (b -= a = +a) || 1 / b;\n return function(x) {\n return (x - a) / b;\n };\n }\n function d3_uninterpolateClamp(a, b) {\n b = (b -= a = +a) || 1 / b;\n return function(x) {\n return Math.max(0, Math.min(1, (x - a) / b));\n };\n }\n d3.layout = {};\n d3.layout.bundle = function() {\n return function(links) {\n var paths = [], i = -1, n = links.length;\n while (++i < n) paths.push(d3_layout_bundlePath(links[i]));\n return paths;\n };\n };\n function d3_layout_bundlePath(link) {\n var start = link.source, end = link.target, lca = d3_layout_bundleLeastCommonAncestor(start, end), points = [ start ];\n while (start !== lca) {\n start = start.parent;\n points.push(start);\n }\n var k = points.length;\n while (end !== lca) {\n points.splice(k, 0, end);\n end = end.parent;\n }\n return points;\n }\n function d3_layout_bundleAncestors(node) {\n var ancestors = [], parent = node.parent;\n while (parent != null) {\n ancestors.push(node);\n node = parent;\n parent = parent.parent;\n }\n ancestors.push(node);\n return ancestors;\n }\n function d3_layout_bundleLeastCommonAncestor(a, b) {\n if (a === b) return a;\n var aNodes = d3_layout_bundleAncestors(a), bNodes = d3_layout_bundleAncestors(b), aNode = aNodes.pop(), bNode = bNodes.pop(), sharedNode = null;\n while (aNode === bNode) {\n sharedNode = aNode;\n aNode = aNodes.pop();\n bNode = bNodes.pop();\n }\n return sharedNode;\n }\n d3.layout.chord = function() {\n var chord = {}, chords, groups, matrix, n, padding = 0, sortGroups, sortSubgroups, sortChords;\n function relayout() {\n var subgroups = {}, groupSums = [], groupIndex = d3.range(n), subgroupIndex = [], k, x, x0, i, j;\n chords = [];\n groups = [];\n k = 0, i = -1;\n while (++i < n) {\n x = 0, j = -1;\n while (++j < n) {\n x += matrix[i][j];\n }\n groupSums.push(x);\n subgroupIndex.push(d3.range(n));\n k += x;\n }\n if (sortGroups) {\n groupIndex.sort(function(a, b) {\n return sortGroups(groupSums[a], groupSums[b]);\n });\n }\n if (sortSubgroups) {\n subgroupIndex.forEach(function(d, i) {\n d.sort(function(a, b) {\n return sortSubgroups(matrix[i][a], matrix[i][b]);\n });\n });\n }\n k = (τ - padding * n) / k;\n x = 0, i = -1;\n while (++i < n) {\n x0 = x, j = -1;\n while (++j < n) {\n var di = groupIndex[i], dj = subgroupIndex[di][j], v = matrix[di][dj], a0 = x, a1 = x += v * k;\n subgroups[di + \"-\" + dj] = {\n index: di,\n subindex: dj,\n startAngle: a0,\n endAngle: a1,\n value: v\n };\n }\n groups[di] = {\n index: di,\n startAngle: x0,\n endAngle: x,\n value: groupSums[di]\n };\n x += padding;\n }\n i = -1;\n while (++i < n) {\n j = i - 1;\n while (++j < n) {\n var source = subgroups[i + \"-\" + j], target = subgroups[j + \"-\" + i];\n if (source.value || target.value) {\n chords.push(source.value < target.value ? {\n source: target,\n target: source\n } : {\n source: source,\n target: target\n });\n }\n }\n }\n if (sortChords) resort();\n }\n function resort() {\n chords.sort(function(a, b) {\n return sortChords((a.source.value + a.target.value) / 2, (b.source.value + b.target.value) / 2);\n });\n }\n chord.matrix = function(x) {\n if (!arguments.length) return matrix;\n n = (matrix = x) && matrix.length;\n chords = groups = null;\n return chord;\n };\n chord.padding = function(x) {\n if (!arguments.length) return padding;\n padding = x;\n chords = groups = null;\n return chord;\n };\n chord.sortGroups = function(x) {\n if (!arguments.length) return sortGroups;\n sortGroups = x;\n chords = groups = null;\n return chord;\n };\n chord.sortSubgroups = function(x) {\n if (!arguments.length) return sortSubgroups;\n sortSubgroups = x;\n chords = null;\n return chord;\n };\n chord.sortChords = function(x) {\n if (!arguments.length) return sortChords;\n sortChords = x;\n if (chords) resort();\n return chord;\n };\n chord.chords = function() {\n if (!chords) relayout();\n return chords;\n };\n chord.groups = function() {\n if (!groups) relayout();\n return groups;\n };\n return chord;\n };\n d3.layout.force = function() {\n var force = {}, event = d3.dispatch(\"start\", \"tick\", \"end\"), timer, size = [ 1, 1 ], drag, alpha, friction = .9, linkDistance = d3_layout_forceLinkDistance, linkStrength = d3_layout_forceLinkStrength, charge = -30, chargeDistance2 = d3_layout_forceChargeDistance2, gravity = .1, theta2 = .64, nodes = [], links = [], distances, strengths, charges;\n function repulse(node) {\n return function(quad, x1, _, x2) {\n if (quad.point !== node) {\n var dx = quad.cx - node.x, dy = quad.cy - node.y, dw = x2 - x1, dn = dx * dx + dy * dy;\n if (dw * dw / theta2 < dn) {\n if (dn < chargeDistance2) {\n var k = quad.charge / dn;\n node.px -= dx * k;\n node.py -= dy * k;\n }\n return true;\n }\n if (quad.point && dn && dn < chargeDistance2) {\n var k = quad.pointCharge / dn;\n node.px -= dx * k;\n node.py -= dy * k;\n }\n }\n return !quad.charge;\n };\n }\n force.tick = function() {\n if ((alpha *= .99) < .005) {\n timer = null;\n event.end({\n type: \"end\",\n alpha: alpha = 0\n });\n return true;\n }\n var n = nodes.length, m = links.length, q, i, o, s, t, l, k, x, y;\n for (i = 0; i < m; ++i) {\n o = links[i];\n s = o.source;\n t = o.target;\n x = t.x - s.x;\n y = t.y - s.y;\n if (l = x * x + y * y) {\n l = alpha * strengths[i] * ((l = Math.sqrt(l)) - distances[i]) / l;\n x *= l;\n y *= l;\n t.x -= x * (k = s.weight + t.weight ? s.weight / (s.weight + t.weight) : .5);\n t.y -= y * k;\n s.x += x * (k = 1 - k);\n s.y += y * k;\n }\n }\n if (k = alpha * gravity) {\n x = size[0] / 2;\n y = size[1] / 2;\n i = -1;\n if (k) while (++i < n) {\n o = nodes[i];\n o.x += (x - o.x) * k;\n o.y += (y - o.y) * k;\n }\n }\n if (charge) {\n d3_layout_forceAccumulate(q = d3.geom.quadtree(nodes), alpha, charges);\n i = -1;\n while (++i < n) {\n if (!(o = nodes[i]).fixed) {\n q.visit(repulse(o));\n }\n }\n }\n i = -1;\n while (++i < n) {\n o = nodes[i];\n if (o.fixed) {\n o.x = o.px;\n o.y = o.py;\n } else {\n o.x -= (o.px - (o.px = o.x)) * friction;\n o.y -= (o.py - (o.py = o.y)) * friction;\n }\n }\n event.tick({\n type: \"tick\",\n alpha: alpha\n });\n };\n force.nodes = function(x) {\n if (!arguments.length) return nodes;\n nodes = x;\n return force;\n };\n force.links = function(x) {\n if (!arguments.length) return links;\n links = x;\n return force;\n };\n force.size = function(x) {\n if (!arguments.length) return size;\n size = x;\n return force;\n };\n force.linkDistance = function(x) {\n if (!arguments.length) return linkDistance;\n linkDistance = typeof x === \"function\" ? x : +x;\n return force;\n };\n force.distance = force.linkDistance;\n force.linkStrength = function(x) {\n if (!arguments.length) return linkStrength;\n linkStrength = typeof x === \"function\" ? x : +x;\n return force;\n };\n force.friction = function(x) {\n if (!arguments.length) return friction;\n friction = +x;\n return force;\n };\n force.charge = function(x) {\n if (!arguments.length) return charge;\n charge = typeof x === \"function\" ? x : +x;\n return force;\n };\n force.chargeDistance = function(x) {\n if (!arguments.length) return Math.sqrt(chargeDistance2);\n chargeDistance2 = x * x;\n return force;\n };\n force.gravity = function(x) {\n if (!arguments.length) return gravity;\n gravity = +x;\n return force;\n };\n force.theta = function(x) {\n if (!arguments.length) return Math.sqrt(theta2);\n theta2 = x * x;\n return force;\n };\n force.alpha = function(x) {\n if (!arguments.length) return alpha;\n x = +x;\n if (alpha) {\n if (x > 0) {\n alpha = x;\n } else {\n timer.c = null, timer.t = NaN, timer = null;\n event.end({\n type: \"end\",\n alpha: alpha = 0\n });\n }\n } else if (x > 0) {\n event.start({\n type: \"start\",\n alpha: alpha = x\n });\n timer = d3_timer(force.tick);\n }\n return force;\n };\n force.start = function() {\n var i, n = nodes.length, m = links.length, w = size[0], h = size[1], neighbors, o;\n for (i = 0; i < n; ++i) {\n (o = nodes[i]).index = i;\n o.weight = 0;\n }\n for (i = 0; i < m; ++i) {\n o = links[i];\n if (typeof o.source == \"number\") o.source = nodes[o.source];\n if (typeof o.target == \"number\") o.target = nodes[o.target];\n ++o.source.weight;\n ++o.target.weight;\n }\n for (i = 0; i < n; ++i) {\n o = nodes[i];\n if (isNaN(o.x)) o.x = position(\"x\", w);\n if (isNaN(o.y)) o.y = position(\"y\", h);\n if (isNaN(o.px)) o.px = o.x;\n if (isNaN(o.py)) o.py = o.y;\n }\n distances = [];\n if (typeof linkDistance === \"function\") for (i = 0; i < m; ++i) distances[i] = +linkDistance.call(this, links[i], i); else for (i = 0; i < m; ++i) distances[i] = linkDistance;\n strengths = [];\n if (typeof linkStrength === \"function\") for (i = 0; i < m; ++i) strengths[i] = +linkStrength.call(this, links[i], i); else for (i = 0; i < m; ++i) strengths[i] = linkStrength;\n charges = [];\n if (typeof charge === \"function\") for (i = 0; i < n; ++i) charges[i] = +charge.call(this, nodes[i], i); else for (i = 0; i < n; ++i) charges[i] = charge;\n function position(dimension, size) {\n if (!neighbors) {\n neighbors = new Array(n);\n for (j = 0; j < n; ++j) {\n neighbors[j] = [];\n }\n for (j = 0; j < m; ++j) {\n var o = links[j];\n neighbors[o.source.index].push(o.target);\n neighbors[o.target.index].push(o.source);\n }\n }\n var candidates = neighbors[i], j = -1, l = candidates.length, x;\n while (++j < l) if (!isNaN(x = candidates[j][dimension])) return x;\n return Math.random() * size;\n }\n return force.resume();\n };\n force.resume = function() {\n return force.alpha(.1);\n };\n force.stop = function() {\n return force.alpha(0);\n };\n force.drag = function() {\n if (!drag) drag = d3.behavior.drag().origin(d3_identity).on(\"dragstart.force\", d3_layout_forceDragstart).on(\"drag.force\", dragmove).on(\"dragend.force\", d3_layout_forceDragend);\n if (!arguments.length) return drag;\n this.on(\"mouseover.force\", d3_layout_forceMouseover).on(\"mouseout.force\", d3_layout_forceMouseout).call(drag);\n };\n function dragmove(d) {\n d.px = d3.event.x, d.py = d3.event.y;\n force.resume();\n }\n return d3.rebind(force, event, \"on\");\n };\n function d3_layout_forceDragstart(d) {\n d.fixed |= 2;\n }\n function d3_layout_forceDragend(d) {\n d.fixed &= ~6;\n }\n function d3_layout_forceMouseover(d) {\n d.fixed |= 4;\n d.px = d.x, d.py = d.y;\n }\n function d3_layout_forceMouseout(d) {\n d.fixed &= ~4;\n }\n function d3_layout_forceAccumulate(quad, alpha, charges) {\n var cx = 0, cy = 0;\n quad.charge = 0;\n if (!quad.leaf) {\n var nodes = quad.nodes, n = nodes.length, i = -1, c;\n while (++i < n) {\n c = nodes[i];\n if (c == null) continue;\n d3_layout_forceAccumulate(c, alpha, charges);\n quad.charge += c.charge;\n cx += c.charge * c.cx;\n cy += c.charge * c.cy;\n }\n }\n if (quad.point) {\n if (!quad.leaf) {\n quad.point.x += Math.random() - .5;\n quad.point.y += Math.random() - .5;\n }\n var k = alpha * charges[quad.point.index];\n quad.charge += quad.pointCharge = k;\n cx += k * quad.point.x;\n cy += k * quad.point.y;\n }\n quad.cx = cx / quad.charge;\n quad.cy = cy / quad.charge;\n }\n var d3_layout_forceLinkDistance = 20, d3_layout_forceLinkStrength = 1, d3_layout_forceChargeDistance2 = Infinity;\n d3.layout.hierarchy = function() {\n var sort = d3_layout_hierarchySort, children = d3_layout_hierarchyChildren, value = d3_layout_hierarchyValue;\n function hierarchy(root) {\n var stack = [ root ], nodes = [], node;\n root.depth = 0;\n while ((node = stack.pop()) != null) {\n nodes.push(node);\n if ((childs = children.call(hierarchy, node, node.depth)) && (n = childs.length)) {\n var n, childs, child;\n while (--n >= 0) {\n stack.push(child = childs[n]);\n child.parent = node;\n child.depth = node.depth + 1;\n }\n if (value) node.value = 0;\n node.children = childs;\n } else {\n if (value) node.value = +value.call(hierarchy, node, node.depth) || 0;\n delete node.children;\n }\n }\n d3_layout_hierarchyVisitAfter(root, function(node) {\n var childs, parent;\n if (sort && (childs = node.children)) childs.sort(sort);\n if (value && (parent = node.parent)) parent.value += node.value;\n });\n return nodes;\n }\n hierarchy.sort = function(x) {\n if (!arguments.length) return sort;\n sort = x;\n return hierarchy;\n };\n hierarchy.children = function(x) {\n if (!arguments.length) return children;\n children = x;\n return hierarchy;\n };\n hierarchy.value = function(x) {\n if (!arguments.length) return value;\n value = x;\n return hierarchy;\n };\n hierarchy.revalue = function(root) {\n if (value) {\n d3_layout_hierarchyVisitBefore(root, function(node) {\n if (node.children) node.value = 0;\n });\n d3_layout_hierarchyVisitAfter(root, function(node) {\n var parent;\n if (!node.children) node.value = +value.call(hierarchy, node, node.depth) || 0;\n if (parent = node.parent) parent.value += node.value;\n });\n }\n return root;\n };\n return hierarchy;\n };\n function d3_layout_hierarchyRebind(object, hierarchy) {\n d3.rebind(object, hierarchy, \"sort\", \"children\", \"value\");\n object.nodes = object;\n object.links = d3_layout_hierarchyLinks;\n return object;\n }\n function d3_layout_hierarchyVisitBefore(node, callback) {\n var nodes = [ node ];\n while ((node = nodes.pop()) != null) {\n callback(node);\n if ((children = node.children) && (n = children.length)) {\n var n, children;\n while (--n >= 0) nodes.push(children[n]);\n }\n }\n }\n function d3_layout_hierarchyVisitAfter(node, callback) {\n var nodes = [ node ], nodes2 = [];\n while ((node = nodes.pop()) != null) {\n nodes2.push(node);\n if ((children = node.children) && (n = children.length)) {\n var i = -1, n, children;\n while (++i < n) nodes.push(children[i]);\n }\n }\n while ((node = nodes2.pop()) != null) {\n callback(node);\n }\n }\n function d3_layout_hierarchyChildren(d) {\n return d.children;\n }\n function d3_layout_hierarchyValue(d) {\n return d.value;\n }\n function d3_layout_hierarchySort(a, b) {\n return b.value - a.value;\n }\n function d3_layout_hierarchyLinks(nodes) {\n return d3.merge(nodes.map(function(parent) {\n return (parent.children || []).map(function(child) {\n return {\n source: parent,\n target: child\n };\n });\n }));\n }\n d3.layout.partition = function() {\n var hierarchy = d3.layout.hierarchy(), size = [ 1, 1 ];\n function position(node, x, dx, dy) {\n var children = node.children;\n node.x = x;\n node.y = node.depth * dy;\n node.dx = dx;\n node.dy = dy;\n if (children && (n = children.length)) {\n var i = -1, n, c, d;\n dx = node.value ? dx / node.value : 0;\n while (++i < n) {\n position(c = children[i], x, d = c.value * dx, dy);\n x += d;\n }\n }\n }\n function depth(node) {\n var children = node.children, d = 0;\n if (children && (n = children.length)) {\n var i = -1, n;\n while (++i < n) d = Math.max(d, depth(children[i]));\n }\n return 1 + d;\n }\n function partition(d, i) {\n var nodes = hierarchy.call(this, d, i);\n position(nodes[0], 0, size[0], size[1] / depth(nodes[0]));\n return nodes;\n }\n partition.size = function(x) {\n if (!arguments.length) return size;\n size = x;\n return partition;\n };\n return d3_layout_hierarchyRebind(partition, hierarchy);\n };\n d3.layout.pie = function() {\n var value = Number, sort = d3_layout_pieSortByValue, startAngle = 0, endAngle = τ, padAngle = 0;\n function pie(data) {\n var n = data.length, values = data.map(function(d, i) {\n return +value.call(pie, d, i);\n }), a = +(typeof startAngle === \"function\" ? startAngle.apply(this, arguments) : startAngle), da = (typeof endAngle === \"function\" ? endAngle.apply(this, arguments) : endAngle) - a, p = Math.min(Math.abs(da) / n, +(typeof padAngle === \"function\" ? padAngle.apply(this, arguments) : padAngle)), pa = p * (da < 0 ? -1 : 1), sum = d3.sum(values), k = sum ? (da - n * pa) / sum : 0, index = d3.range(n), arcs = [], v;\n if (sort != null) index.sort(sort === d3_layout_pieSortByValue ? function(i, j) {\n return values[j] - values[i];\n } : function(i, j) {\n return sort(data[i], data[j]);\n });\n index.forEach(function(i) {\n arcs[i] = {\n data: data[i],\n value: v = values[i],\n startAngle: a,\n endAngle: a += v * k + pa,\n padAngle: p\n };\n });\n return arcs;\n }\n pie.value = function(_) {\n if (!arguments.length) return value;\n value = _;\n return pie;\n };\n pie.sort = function(_) {\n if (!arguments.length) return sort;\n sort = _;\n return pie;\n };\n pie.startAngle = function(_) {\n if (!arguments.length) return startAngle;\n startAngle = _;\n return pie;\n };\n pie.endAngle = function(_) {\n if (!arguments.length) return endAngle;\n endAngle = _;\n return pie;\n };\n pie.padAngle = function(_) {\n if (!arguments.length) return padAngle;\n padAngle = _;\n return pie;\n };\n return pie;\n };\n var d3_layout_pieSortByValue = {};\n d3.layout.stack = function() {\n var values = d3_identity, order = d3_layout_stackOrderDefault, offset = d3_layout_stackOffsetZero, out = d3_layout_stackOut, x = d3_layout_stackX, y = d3_layout_stackY;\n function stack(data, index) {\n if (!(n = data.length)) return data;\n var series = data.map(function(d, i) {\n return values.call(stack, d, i);\n });\n var points = series.map(function(d) {\n return d.map(function(v, i) {\n return [ x.call(stack, v, i), y.call(stack, v, i) ];\n });\n });\n var orders = order.call(stack, points, index);\n series = d3.permute(series, orders);\n points = d3.permute(points, orders);\n var offsets = offset.call(stack, points, index);\n var m = series[0].length, n, i, j, o;\n for (j = 0; j < m; ++j) {\n out.call(stack, series[0][j], o = offsets[j], points[0][j][1]);\n for (i = 1; i < n; ++i) {\n out.call(stack, series[i][j], o += points[i - 1][j][1], points[i][j][1]);\n }\n }\n return data;\n }\n stack.values = function(x) {\n if (!arguments.length) return values;\n values = x;\n return stack;\n };\n stack.order = function(x) {\n if (!arguments.length) return order;\n order = typeof x === \"function\" ? x : d3_layout_stackOrders.get(x) || d3_layout_stackOrderDefault;\n return stack;\n };\n stack.offset = function(x) {\n if (!arguments.length) return offset;\n offset = typeof x === \"function\" ? x : d3_layout_stackOffsets.get(x) || d3_layout_stackOffsetZero;\n return stack;\n };\n stack.x = function(z) {\n if (!arguments.length) return x;\n x = z;\n return stack;\n };\n stack.y = function(z) {\n if (!arguments.length) return y;\n y = z;\n return stack;\n };\n stack.out = function(z) {\n if (!arguments.length) return out;\n out = z;\n return stack;\n };\n return stack;\n };\n function d3_layout_stackX(d) {\n return d.x;\n }\n function d3_layout_stackY(d) {\n return d.y;\n }\n function d3_layout_stackOut(d, y0, y) {\n d.y0 = y0;\n d.y = y;\n }\n var d3_layout_stackOrders = d3.map({\n \"inside-out\": function(data) {\n var n = data.length, i, j, max = data.map(d3_layout_stackMaxIndex), sums = data.map(d3_layout_stackReduceSum), index = d3.range(n).sort(function(a, b) {\n return max[a] - max[b];\n }), top = 0, bottom = 0, tops = [], bottoms = [];\n for (i = 0; i < n; ++i) {\n j = index[i];\n if (top < bottom) {\n top += sums[j];\n tops.push(j);\n } else {\n bottom += sums[j];\n bottoms.push(j);\n }\n }\n return bottoms.reverse().concat(tops);\n },\n reverse: function(data) {\n return d3.range(data.length).reverse();\n },\n \"default\": d3_layout_stackOrderDefault\n });\n var d3_layout_stackOffsets = d3.map({\n silhouette: function(data) {\n var n = data.length, m = data[0].length, sums = [], max = 0, i, j, o, y0 = [];\n for (j = 0; j < m; ++j) {\n for (i = 0, o = 0; i < n; i++) o += data[i][j][1];\n if (o > max) max = o;\n sums.push(o);\n }\n for (j = 0; j < m; ++j) {\n y0[j] = (max - sums[j]) / 2;\n }\n return y0;\n },\n wiggle: function(data) {\n var n = data.length, x = data[0], m = x.length, i, j, k, s1, s2, s3, dx, o, o0, y0 = [];\n y0[0] = o = o0 = 0;\n for (j = 1; j < m; ++j) {\n for (i = 0, s1 = 0; i < n; ++i) s1 += data[i][j][1];\n for (i = 0, s2 = 0, dx = x[j][0] - x[j - 1][0]; i < n; ++i) {\n for (k = 0, s3 = (data[i][j][1] - data[i][j - 1][1]) / (2 * dx); k < i; ++k) {\n s3 += (data[k][j][1] - data[k][j - 1][1]) / dx;\n }\n s2 += s3 * data[i][j][1];\n }\n y0[j] = o -= s1 ? s2 / s1 * dx : 0;\n if (o < o0) o0 = o;\n }\n for (j = 0; j < m; ++j) y0[j] -= o0;\n return y0;\n },\n expand: function(data) {\n var n = data.length, m = data[0].length, k = 1 / n, i, j, o, y0 = [];\n for (j = 0; j < m; ++j) {\n for (i = 0, o = 0; i < n; i++) o += data[i][j][1];\n if (o) for (i = 0; i < n; i++) data[i][j][1] /= o; else for (i = 0; i < n; i++) data[i][j][1] = k;\n }\n for (j = 0; j < m; ++j) y0[j] = 0;\n return y0;\n },\n zero: d3_layout_stackOffsetZero\n });\n function d3_layout_stackOrderDefault(data) {\n return d3.range(data.length);\n }\n function d3_layout_stackOffsetZero(data) {\n var j = -1, m = data[0].length, y0 = [];\n while (++j < m) y0[j] = 0;\n return y0;\n }\n function d3_layout_stackMaxIndex(array) {\n var i = 1, j = 0, v = array[0][1], k, n = array.length;\n for (;i < n; ++i) {\n if ((k = array[i][1]) > v) {\n j = i;\n v = k;\n }\n }\n return j;\n }\n function d3_layout_stackReduceSum(d) {\n return d.reduce(d3_layout_stackSum, 0);\n }\n function d3_layout_stackSum(p, d) {\n return p + d[1];\n }\n d3.layout.histogram = function() {\n var frequency = true, valuer = Number, ranger = d3_layout_histogramRange, binner = d3_layout_histogramBinSturges;\n function histogram(data, i) {\n var bins = [], values = data.map(valuer, this), range = ranger.call(this, values, i), thresholds = binner.call(this, range, values, i), bin, i = -1, n = values.length, m = thresholds.length - 1, k = frequency ? 1 : 1 / n, x;\n while (++i < m) {\n bin = bins[i] = [];\n bin.dx = thresholds[i + 1] - (bin.x = thresholds[i]);\n bin.y = 0;\n }\n if (m > 0) {\n i = -1;\n while (++i < n) {\n x = values[i];\n if (x >= range[0] && x <= range[1]) {\n bin = bins[d3.bisect(thresholds, x, 1, m) - 1];\n bin.y += k;\n bin.push(data[i]);\n }\n }\n }\n return bins;\n }\n histogram.value = function(x) {\n if (!arguments.length) return valuer;\n valuer = x;\n return histogram;\n };\n histogram.range = function(x) {\n if (!arguments.length) return ranger;\n ranger = d3_functor(x);\n return histogram;\n };\n histogram.bins = function(x) {\n if (!arguments.length) return binner;\n binner = typeof x === \"number\" ? function(range) {\n return d3_layout_histogramBinFixed(range, x);\n } : d3_functor(x);\n return histogram;\n };\n histogram.frequency = function(x) {\n if (!arguments.length) return frequency;\n frequency = !!x;\n return histogram;\n };\n return histogram;\n };\n function d3_layout_histogramBinSturges(range, values) {\n return d3_layout_histogramBinFixed(range, Math.ceil(Math.log(values.length) / Math.LN2 + 1));\n }\n function d3_layout_histogramBinFixed(range, n) {\n var x = -1, b = +range[0], m = (range[1] - b) / n, f = [];\n while (++x <= n) f[x] = m * x + b;\n return f;\n }\n function d3_layout_histogramRange(values) {\n return [ d3.min(values), d3.max(values) ];\n }\n d3.layout.pack = function() {\n var hierarchy = d3.layout.hierarchy().sort(d3_layout_packSort), padding = 0, size = [ 1, 1 ], radius;\n function pack(d, i) {\n var nodes = hierarchy.call(this, d, i), root = nodes[0], w = size[0], h = size[1], r = radius == null ? Math.sqrt : typeof radius === \"function\" ? radius : function() {\n return radius;\n };\n root.x = root.y = 0;\n d3_layout_hierarchyVisitAfter(root, function(d) {\n d.r = +r(d.value);\n });\n d3_layout_hierarchyVisitAfter(root, d3_layout_packSiblings);\n if (padding) {\n var dr = padding * (radius ? 1 : Math.max(2 * root.r / w, 2 * root.r / h)) / 2;\n d3_layout_hierarchyVisitAfter(root, function(d) {\n d.r += dr;\n });\n d3_layout_hierarchyVisitAfter(root, d3_layout_packSiblings);\n d3_layout_hierarchyVisitAfter(root, function(d) {\n d.r -= dr;\n });\n }\n d3_layout_packTransform(root, w / 2, h / 2, radius ? 1 : 1 / Math.max(2 * root.r / w, 2 * root.r / h));\n return nodes;\n }\n pack.size = function(_) {\n if (!arguments.length) return size;\n size = _;\n return pack;\n };\n pack.radius = function(_) {\n if (!arguments.length) return radius;\n radius = _ == null || typeof _ === \"function\" ? _ : +_;\n return pack;\n };\n pack.padding = function(_) {\n if (!arguments.length) return padding;\n padding = +_;\n return pack;\n };\n return d3_layout_hierarchyRebind(pack, hierarchy);\n };\n function d3_layout_packSort(a, b) {\n return a.value - b.value;\n }\n function d3_layout_packInsert(a, b) {\n var c = a._pack_next;\n a._pack_next = b;\n b._pack_prev = a;\n b._pack_next = c;\n c._pack_prev = b;\n }\n function d3_layout_packSplice(a, b) {\n a._pack_next = b;\n b._pack_prev = a;\n }\n function d3_layout_packIntersects(a, b) {\n var dx = b.x - a.x, dy = b.y - a.y, dr = a.r + b.r;\n return .999 * dr * dr > dx * dx + dy * dy;\n }\n function d3_layout_packSiblings(node) {\n if (!(nodes = node.children) || !(n = nodes.length)) return;\n var nodes, xMin = Infinity, xMax = -Infinity, yMin = Infinity, yMax = -Infinity, a, b, c, i, j, k, n;\n function bound(node) {\n xMin = Math.min(node.x - node.r, xMin);\n xMax = Math.max(node.x + node.r, xMax);\n yMin = Math.min(node.y - node.r, yMin);\n yMax = Math.max(node.y + node.r, yMax);\n }\n nodes.forEach(d3_layout_packLink);\n a = nodes[0];\n a.x = -a.r;\n a.y = 0;\n bound(a);\n if (n > 1) {\n b = nodes[1];\n b.x = b.r;\n b.y = 0;\n bound(b);\n if (n > 2) {\n c = nodes[2];\n d3_layout_packPlace(a, b, c);\n bound(c);\n d3_layout_packInsert(a, c);\n a._pack_prev = c;\n d3_layout_packInsert(c, b);\n b = a._pack_next;\n for (i = 3; i < n; i++) {\n d3_layout_packPlace(a, b, c = nodes[i]);\n var isect = 0, s1 = 1, s2 = 1;\n for (j = b._pack_next; j !== b; j = j._pack_next, s1++) {\n if (d3_layout_packIntersects(j, c)) {\n isect = 1;\n break;\n }\n }\n if (isect == 1) {\n for (k = a._pack_prev; k !== j._pack_prev; k = k._pack_prev, s2++) {\n if (d3_layout_packIntersects(k, c)) {\n break;\n }\n }\n }\n if (isect) {\n if (s1 < s2 || s1 == s2 && b.r < a.r) d3_layout_packSplice(a, b = j); else d3_layout_packSplice(a = k, b);\n i--;\n } else {\n d3_layout_packInsert(a, c);\n b = c;\n bound(c);\n }\n }\n }\n }\n var cx = (xMin + xMax) / 2, cy = (yMin + yMax) / 2, cr = 0;\n for (i = 0; i < n; i++) {\n c = nodes[i];\n c.x -= cx;\n c.y -= cy;\n cr = Math.max(cr, c.r + Math.sqrt(c.x * c.x + c.y * c.y));\n }\n node.r = cr;\n nodes.forEach(d3_layout_packUnlink);\n }\n function d3_layout_packLink(node) {\n node._pack_next = node._pack_prev = node;\n }\n function d3_layout_packUnlink(node) {\n delete node._pack_next;\n delete node._pack_prev;\n }\n function d3_layout_packTransform(node, x, y, k) {\n var children = node.children;\n node.x = x += k * node.x;\n node.y = y += k * node.y;\n node.r *= k;\n if (children) {\n var i = -1, n = children.length;\n while (++i < n) d3_layout_packTransform(children[i], x, y, k);\n }\n }\n function d3_layout_packPlace(a, b, c) {\n var db = a.r + c.r, dx = b.x - a.x, dy = b.y - a.y;\n if (db && (dx || dy)) {\n var da = b.r + c.r, dc = dx * dx + dy * dy;\n da *= da;\n db *= db;\n var x = .5 + (db - da) / (2 * dc), y = Math.sqrt(Math.max(0, 2 * da * (db + dc) - (db -= dc) * db - da * da)) / (2 * dc);\n c.x = a.x + x * dx + y * dy;\n c.y = a.y + x * dy - y * dx;\n } else {\n c.x = a.x + db;\n c.y = a.y;\n }\n }\n d3.layout.tree = function() {\n var hierarchy = d3.layout.hierarchy().sort(null).value(null), separation = d3_layout_treeSeparation, size = [ 1, 1 ], nodeSize = null;\n function tree(d, i) {\n var nodes = hierarchy.call(this, d, i), root0 = nodes[0], root1 = wrapTree(root0);\n d3_layout_hierarchyVisitAfter(root1, firstWalk), root1.parent.m = -root1.z;\n d3_layout_hierarchyVisitBefore(root1, secondWalk);\n if (nodeSize) d3_layout_hierarchyVisitBefore(root0, sizeNode); else {\n var left = root0, right = root0, bottom = root0;\n d3_layout_hierarchyVisitBefore(root0, function(node) {\n if (node.x < left.x) left = node;\n if (node.x > right.x) right = node;\n if (node.depth > bottom.depth) bottom = node;\n });\n var tx = separation(left, right) / 2 - left.x, kx = size[0] / (right.x + separation(right, left) / 2 + tx), ky = size[1] / (bottom.depth || 1);\n d3_layout_hierarchyVisitBefore(root0, function(node) {\n node.x = (node.x + tx) * kx;\n node.y = node.depth * ky;\n });\n }\n return nodes;\n }\n function wrapTree(root0) {\n var root1 = {\n A: null,\n children: [ root0 ]\n }, queue = [ root1 ], node1;\n while ((node1 = queue.pop()) != null) {\n for (var children = node1.children, child, i = 0, n = children.length; i < n; ++i) {\n queue.push((children[i] = child = {\n _: children[i],\n parent: node1,\n children: (child = children[i].children) && child.slice() || [],\n A: null,\n a: null,\n z: 0,\n m: 0,\n c: 0,\n s: 0,\n t: null,\n i: i\n }).a = child);\n }\n }\n return root1.children[0];\n }\n function firstWalk(v) {\n var children = v.children, siblings = v.parent.children, w = v.i ? siblings[v.i - 1] : null;\n if (children.length) {\n d3_layout_treeShift(v);\n var midpoint = (children[0].z + children[children.length - 1].z) / 2;\n if (w) {\n v.z = w.z + separation(v._, w._);\n v.m = v.z - midpoint;\n } else {\n v.z = midpoint;\n }\n } else if (w) {\n v.z = w.z + separation(v._, w._);\n }\n v.parent.A = apportion(v, w, v.parent.A || siblings[0]);\n }\n function secondWalk(v) {\n v._.x = v.z + v.parent.m;\n v.m += v.parent.m;\n }\n function apportion(v, w, ancestor) {\n if (w) {\n var vip = v, vop = v, vim = w, vom = vip.parent.children[0], sip = vip.m, sop = vop.m, sim = vim.m, som = vom.m, shift;\n while (vim = d3_layout_treeRight(vim), vip = d3_layout_treeLeft(vip), vim && vip) {\n vom = d3_layout_treeLeft(vom);\n vop = d3_layout_treeRight(vop);\n vop.a = v;\n shift = vim.z + sim - vip.z - sip + separation(vim._, vip._);\n if (shift > 0) {\n d3_layout_treeMove(d3_layout_treeAncestor(vim, v, ancestor), v, shift);\n sip += shift;\n sop += shift;\n }\n sim += vim.m;\n sip += vip.m;\n som += vom.m;\n sop += vop.m;\n }\n if (vim && !d3_layout_treeRight(vop)) {\n vop.t = vim;\n vop.m += sim - sop;\n }\n if (vip && !d3_layout_treeLeft(vom)) {\n vom.t = vip;\n vom.m += sip - som;\n ancestor = v;\n }\n }\n return ancestor;\n }\n function sizeNode(node) {\n node.x *= size[0];\n node.y = node.depth * size[1];\n }\n tree.separation = function(x) {\n if (!arguments.length) return separation;\n separation = x;\n return tree;\n };\n tree.size = function(x) {\n if (!arguments.length) return nodeSize ? null : size;\n nodeSize = (size = x) == null ? sizeNode : null;\n return tree;\n };\n tree.nodeSize = function(x) {\n if (!arguments.length) return nodeSize ? size : null;\n nodeSize = (size = x) == null ? null : sizeNode;\n return tree;\n };\n return d3_layout_hierarchyRebind(tree, hierarchy);\n };\n function d3_layout_treeSeparation(a, b) {\n return a.parent == b.parent ? 1 : 2;\n }\n function d3_layout_treeLeft(v) {\n var children = v.children;\n return children.length ? children[0] : v.t;\n }\n function d3_layout_treeRight(v) {\n var children = v.children, n;\n return (n = children.length) ? children[n - 1] : v.t;\n }\n function d3_layout_treeMove(wm, wp, shift) {\n var change = shift / (wp.i - wm.i);\n wp.c -= change;\n wp.s += shift;\n wm.c += change;\n wp.z += shift;\n wp.m += shift;\n }\n function d3_layout_treeShift(v) {\n var shift = 0, change = 0, children = v.children, i = children.length, w;\n while (--i >= 0) {\n w = children[i];\n w.z += shift;\n w.m += shift;\n shift += w.s + (change += w.c);\n }\n }\n function d3_layout_treeAncestor(vim, v, ancestor) {\n return vim.a.parent === v.parent ? vim.a : ancestor;\n }\n d3.layout.cluster = function() {\n var hierarchy = d3.layout.hierarchy().sort(null).value(null), separation = d3_layout_treeSeparation, size = [ 1, 1 ], nodeSize = false;\n function cluster(d, i) {\n var nodes = hierarchy.call(this, d, i), root = nodes[0], previousNode, x = 0;\n d3_layout_hierarchyVisitAfter(root, function(node) {\n var children = node.children;\n if (children && children.length) {\n node.x = d3_layout_clusterX(children);\n node.y = d3_layout_clusterY(children);\n } else {\n node.x = previousNode ? x += separation(node, previousNode) : 0;\n node.y = 0;\n previousNode = node;\n }\n });\n var left = d3_layout_clusterLeft(root), right = d3_layout_clusterRight(root), x0 = left.x - separation(left, right) / 2, x1 = right.x + separation(right, left) / 2;\n d3_layout_hierarchyVisitAfter(root, nodeSize ? function(node) {\n node.x = (node.x - root.x) * size[0];\n node.y = (root.y - node.y) * size[1];\n } : function(node) {\n node.x = (node.x - x0) / (x1 - x0) * size[0];\n node.y = (1 - (root.y ? node.y / root.y : 1)) * size[1];\n });\n return nodes;\n }\n cluster.separation = function(x) {\n if (!arguments.length) return separation;\n separation = x;\n return cluster;\n };\n cluster.size = function(x) {\n if (!arguments.length) return nodeSize ? null : size;\n nodeSize = (size = x) == null;\n return cluster;\n };\n cluster.nodeSize = function(x) {\n if (!arguments.length) return nodeSize ? size : null;\n nodeSize = (size = x) != null;\n return cluster;\n };\n return d3_layout_hierarchyRebind(cluster, hierarchy);\n };\n function d3_layout_clusterY(children) {\n return 1 + d3.max(children, function(child) {\n return child.y;\n });\n }\n function d3_layout_clusterX(children) {\n return children.reduce(function(x, child) {\n return x + child.x;\n }, 0) / children.length;\n }\n function d3_layout_clusterLeft(node) {\n var children = node.children;\n return children && children.length ? d3_layout_clusterLeft(children[0]) : node;\n }\n function d3_layout_clusterRight(node) {\n var children = node.children, n;\n return children && (n = children.length) ? d3_layout_clusterRight(children[n - 1]) : node;\n }\n d3.layout.treemap = function() {\n var hierarchy = d3.layout.hierarchy(), round = Math.round, size = [ 1, 1 ], padding = null, pad = d3_layout_treemapPadNull, sticky = false, stickies, mode = \"squarify\", ratio = .5 * (1 + Math.sqrt(5));\n function scale(children, k) {\n var i = -1, n = children.length, child, area;\n while (++i < n) {\n area = (child = children[i]).value * (k < 0 ? 0 : k);\n child.area = isNaN(area) || area <= 0 ? 0 : area;\n }\n }\n function squarify(node) {\n var children = node.children;\n if (children && children.length) {\n var rect = pad(node), row = [], remaining = children.slice(), child, best = Infinity, score, u = mode === \"slice\" ? rect.dx : mode === \"dice\" ? rect.dy : mode === \"slice-dice\" ? node.depth & 1 ? rect.dy : rect.dx : Math.min(rect.dx, rect.dy), n;\n scale(remaining, rect.dx * rect.dy / node.value);\n row.area = 0;\n while ((n = remaining.length) > 0) {\n row.push(child = remaining[n - 1]);\n row.area += child.area;\n if (mode !== \"squarify\" || (score = worst(row, u)) <= best) {\n remaining.pop();\n best = score;\n } else {\n row.area -= row.pop().area;\n position(row, u, rect, false);\n u = Math.min(rect.dx, rect.dy);\n row.length = row.area = 0;\n best = Infinity;\n }\n }\n if (row.length) {\n position(row, u, rect, true);\n row.length = row.area = 0;\n }\n children.forEach(squarify);\n }\n }\n function stickify(node) {\n var children = node.children;\n if (children && children.length) {\n var rect = pad(node), remaining = children.slice(), child, row = [];\n scale(remaining, rect.dx * rect.dy / node.value);\n row.area = 0;\n while (child = remaining.pop()) {\n row.push(child);\n row.area += child.area;\n if (child.z != null) {\n position(row, child.z ? rect.dx : rect.dy, rect, !remaining.length);\n row.length = row.area = 0;\n }\n }\n children.forEach(stickify);\n }\n }\n function worst(row, u) {\n var s = row.area, r, rmax = 0, rmin = Infinity, i = -1, n = row.length;\n while (++i < n) {\n if (!(r = row[i].area)) continue;\n if (r < rmin) rmin = r;\n if (r > rmax) rmax = r;\n }\n s *= s;\n u *= u;\n return s ? Math.max(u * rmax * ratio / s, s / (u * rmin * ratio)) : Infinity;\n }\n function position(row, u, rect, flush) {\n var i = -1, n = row.length, x = rect.x, y = rect.y, v = u ? round(row.area / u) : 0, o;\n if (u == rect.dx) {\n if (flush || v > rect.dy) v = rect.dy;\n while (++i < n) {\n o = row[i];\n o.x = x;\n o.y = y;\n o.dy = v;\n x += o.dx = Math.min(rect.x + rect.dx - x, v ? round(o.area / v) : 0);\n }\n o.z = true;\n o.dx += rect.x + rect.dx - x;\n rect.y += v;\n rect.dy -= v;\n } else {\n if (flush || v > rect.dx) v = rect.dx;\n while (++i < n) {\n o = row[i];\n o.x = x;\n o.y = y;\n o.dx = v;\n y += o.dy = Math.min(rect.y + rect.dy - y, v ? round(o.area / v) : 0);\n }\n o.z = false;\n o.dy += rect.y + rect.dy - y;\n rect.x += v;\n rect.dx -= v;\n }\n }\n function treemap(d) {\n var nodes = stickies || hierarchy(d), root = nodes[0];\n root.x = root.y = 0;\n if (root.value) root.dx = size[0], root.dy = size[1]; else root.dx = root.dy = 0;\n if (stickies) hierarchy.revalue(root);\n scale([ root ], root.dx * root.dy / root.value);\n (stickies ? stickify : squarify)(root);\n if (sticky) stickies = nodes;\n return nodes;\n }\n treemap.size = function(x) {\n if (!arguments.length) return size;\n size = x;\n return treemap;\n };\n treemap.padding = function(x) {\n if (!arguments.length) return padding;\n function padFunction(node) {\n var p = x.call(treemap, node, node.depth);\n return p == null ? d3_layout_treemapPadNull(node) : d3_layout_treemapPad(node, typeof p === \"number\" ? [ p, p, p, p ] : p);\n }\n function padConstant(node) {\n return d3_layout_treemapPad(node, x);\n }\n var type;\n pad = (padding = x) == null ? d3_layout_treemapPadNull : (type = typeof x) === \"function\" ? padFunction : type === \"number\" ? (x = [ x, x, x, x ], \n padConstant) : padConstant;\n return treemap;\n };\n treemap.round = function(x) {\n if (!arguments.length) return round != Number;\n round = x ? Math.round : Number;\n return treemap;\n };\n treemap.sticky = function(x) {\n if (!arguments.length) return sticky;\n sticky = x;\n stickies = null;\n return treemap;\n };\n treemap.ratio = function(x) {\n if (!arguments.length) return ratio;\n ratio = x;\n return treemap;\n };\n treemap.mode = function(x) {\n if (!arguments.length) return mode;\n mode = x + \"\";\n return treemap;\n };\n return d3_layout_hierarchyRebind(treemap, hierarchy);\n };\n function d3_layout_treemapPadNull(node) {\n return {\n x: node.x,\n y: node.y,\n dx: node.dx,\n dy: node.dy\n };\n }\n function d3_layout_treemapPad(node, padding) {\n var x = node.x + padding[3], y = node.y + padding[0], dx = node.dx - padding[1] - padding[3], dy = node.dy - padding[0] - padding[2];\n if (dx < 0) {\n x += dx / 2;\n dx = 0;\n }\n if (dy < 0) {\n y += dy / 2;\n dy = 0;\n }\n return {\n x: x,\n y: y,\n dx: dx,\n dy: dy\n };\n }\n d3.random = {\n normal: function(µ, σ) {\n var n = arguments.length;\n if (n < 2) σ = 1;\n if (n < 1) µ = 0;\n return function() {\n var x, y, r;\n do {\n x = Math.random() * 2 - 1;\n y = Math.random() * 2 - 1;\n r = x * x + y * y;\n } while (!r || r > 1);\n return µ + σ * x * Math.sqrt(-2 * Math.log(r) / r);\n };\n },\n logNormal: function() {\n var random = d3.random.normal.apply(d3, arguments);\n return function() {\n return Math.exp(random());\n };\n },\n bates: function(m) {\n var random = d3.random.irwinHall(m);\n return function() {\n return random() / m;\n };\n },\n irwinHall: function(m) {\n return function() {\n for (var s = 0, j = 0; j < m; j++) s += Math.random();\n return s;\n };\n }\n };\n d3.scale = {};\n function d3_scaleExtent(domain) {\n var start = domain[0], stop = domain[domain.length - 1];\n return start < stop ? [ start, stop ] : [ stop, start ];\n }\n function d3_scaleRange(scale) {\n return scale.rangeExtent ? scale.rangeExtent() : d3_scaleExtent(scale.range());\n }\n function d3_scale_bilinear(domain, range, uninterpolate, interpolate) {\n var u = uninterpolate(domain[0], domain[1]), i = interpolate(range[0], range[1]);\n return function(x) {\n return i(u(x));\n };\n }\n function d3_scale_nice(domain, nice) {\n var i0 = 0, i1 = domain.length - 1, x0 = domain[i0], x1 = domain[i1], dx;\n if (x1 < x0) {\n dx = i0, i0 = i1, i1 = dx;\n dx = x0, x0 = x1, x1 = dx;\n }\n domain[i0] = nice.floor(x0);\n domain[i1] = nice.ceil(x1);\n return domain;\n }\n function d3_scale_niceStep(step) {\n return step ? {\n floor: function(x) {\n return Math.floor(x / step) * step;\n },\n ceil: function(x) {\n return Math.ceil(x / step) * step;\n }\n } : d3_scale_niceIdentity;\n }\n var d3_scale_niceIdentity = {\n floor: d3_identity,\n ceil: d3_identity\n };\n function d3_scale_polylinear(domain, range, uninterpolate, interpolate) {\n var u = [], i = [], j = 0, k = Math.min(domain.length, range.length) - 1;\n if (domain[k] < domain[0]) {\n domain = domain.slice().reverse();\n range = range.slice().reverse();\n }\n while (++j <= k) {\n u.push(uninterpolate(domain[j - 1], domain[j]));\n i.push(interpolate(range[j - 1], range[j]));\n }\n return function(x) {\n var j = d3.bisect(domain, x, 1, k) - 1;\n return i[j](u[j](x));\n };\n }\n d3.scale.linear = function() {\n return d3_scale_linear([ 0, 1 ], [ 0, 1 ], d3_interpolate, false);\n };\n function d3_scale_linear(domain, range, interpolate, clamp) {\n var output, input;\n function rescale() {\n var linear = Math.min(domain.length, range.length) > 2 ? d3_scale_polylinear : d3_scale_bilinear, uninterpolate = clamp ? d3_uninterpolateClamp : d3_uninterpolateNumber;\n output = linear(domain, range, uninterpolate, interpolate);\n input = linear(range, domain, uninterpolate, d3_interpolate);\n return scale;\n }\n function scale(x) {\n return output(x);\n }\n scale.invert = function(y) {\n return input(y);\n };\n scale.domain = function(x) {\n if (!arguments.length) return domain;\n domain = x.map(Number);\n return rescale();\n };\n scale.range = function(x) {\n if (!arguments.length) return range;\n range = x;\n return rescale();\n };\n scale.rangeRound = function(x) {\n return scale.range(x).interpolate(d3_interpolateRound);\n };\n scale.clamp = function(x) {\n if (!arguments.length) return clamp;\n clamp = x;\n return rescale();\n };\n scale.interpolate = function(x) {\n if (!arguments.length) return interpolate;\n interpolate = x;\n return rescale();\n };\n scale.ticks = function(m) {\n return d3_scale_linearTicks(domain, m);\n };\n scale.tickFormat = function(m, format) {\n return d3_scale_linearTickFormat(domain, m, format);\n };\n scale.nice = function(m) {\n d3_scale_linearNice(domain, m);\n return rescale();\n };\n scale.copy = function() {\n return d3_scale_linear(domain, range, interpolate, clamp);\n };\n return rescale();\n }\n function d3_scale_linearRebind(scale, linear) {\n return d3.rebind(scale, linear, \"range\", \"rangeRound\", \"interpolate\", \"clamp\");\n }\n function d3_scale_linearNice(domain, m) {\n d3_scale_nice(domain, d3_scale_niceStep(d3_scale_linearTickRange(domain, m)[2]));\n d3_scale_nice(domain, d3_scale_niceStep(d3_scale_linearTickRange(domain, m)[2]));\n return domain;\n }\n function d3_scale_linearTickRange(domain, m) {\n if (m == null) m = 10;\n var extent = d3_scaleExtent(domain), span = extent[1] - extent[0], step = Math.pow(10, Math.floor(Math.log(span / m) / Math.LN10)), err = m / span * step;\n if (err <= .15) step *= 10; else if (err <= .35) step *= 5; else if (err <= .75) step *= 2;\n extent[0] = Math.ceil(extent[0] / step) * step;\n extent[1] = Math.floor(extent[1] / step) * step + step * .5;\n extent[2] = step;\n return extent;\n }\n function d3_scale_linearTicks(domain, m) {\n return d3.range.apply(d3, d3_scale_linearTickRange(domain, m));\n }\n function d3_scale_linearTickFormat(domain, m, format) {\n var range = d3_scale_linearTickRange(domain, m);\n if (format) {\n var match = d3_format_re.exec(format);\n match.shift();\n if (match[8] === \"s\") {\n var prefix = d3.formatPrefix(Math.max(abs(range[0]), abs(range[1])));\n if (!match[7]) match[7] = \".\" + d3_scale_linearPrecision(prefix.scale(range[2]));\n match[8] = \"f\";\n format = d3.format(match.join(\"\"));\n return function(d) {\n return format(prefix.scale(d)) + prefix.symbol;\n };\n }\n if (!match[7]) match[7] = \".\" + d3_scale_linearFormatPrecision(match[8], range);\n format = match.join(\"\");\n } else {\n format = \",.\" + d3_scale_linearPrecision(range[2]) + \"f\";\n }\n return d3.format(format);\n }\n var d3_scale_linearFormatSignificant = {\n s: 1,\n g: 1,\n p: 1,\n r: 1,\n e: 1\n };\n function d3_scale_linearPrecision(value) {\n return -Math.floor(Math.log(value) / Math.LN10 + .01);\n }\n function d3_scale_linearFormatPrecision(type, range) {\n var p = d3_scale_linearPrecision(range[2]);\n return type in d3_scale_linearFormatSignificant ? Math.abs(p - d3_scale_linearPrecision(Math.max(abs(range[0]), abs(range[1])))) + +(type !== \"e\") : p - (type === \"%\") * 2;\n }\n d3.scale.log = function() {\n return d3_scale_log(d3.scale.linear().domain([ 0, 1 ]), 10, true, [ 1, 10 ]);\n };\n function d3_scale_log(linear, base, positive, domain) {\n function log(x) {\n return (positive ? Math.log(x < 0 ? 0 : x) : -Math.log(x > 0 ? 0 : -x)) / Math.log(base);\n }\n function pow(x) {\n return positive ? Math.pow(base, x) : -Math.pow(base, -x);\n }\n function scale(x) {\n return linear(log(x));\n }\n scale.invert = function(x) {\n return pow(linear.invert(x));\n };\n scale.domain = function(x) {\n if (!arguments.length) return domain;\n positive = x[0] >= 0;\n linear.domain((domain = x.map(Number)).map(log));\n return scale;\n };\n scale.base = function(_) {\n if (!arguments.length) return base;\n base = +_;\n linear.domain(domain.map(log));\n return scale;\n };\n scale.nice = function() {\n var niced = d3_scale_nice(domain.map(log), positive ? Math : d3_scale_logNiceNegative);\n linear.domain(niced);\n domain = niced.map(pow);\n return scale;\n };\n scale.ticks = function() {\n var extent = d3_scaleExtent(domain), ticks = [], u = extent[0], v = extent[1], i = Math.floor(log(u)), j = Math.ceil(log(v)), n = base % 1 ? 2 : base;\n if (isFinite(j - i)) {\n if (positive) {\n for (;i < j; i++) for (var k = 1; k < n; k++) ticks.push(pow(i) * k);\n ticks.push(pow(i));\n } else {\n ticks.push(pow(i));\n for (;i++ < j; ) for (var k = n - 1; k > 0; k--) ticks.push(pow(i) * k);\n }\n for (i = 0; ticks[i] < u; i++) {}\n for (j = ticks.length; ticks[j - 1] > v; j--) {}\n ticks = ticks.slice(i, j);\n }\n return ticks;\n };\n scale.tickFormat = function(n, format) {\n if (!arguments.length) return d3_scale_logFormat;\n if (arguments.length < 2) format = d3_scale_logFormat; else if (typeof format !== \"function\") format = d3.format(format);\n var k = Math.max(1, base * n / scale.ticks().length);\n return function(d) {\n var i = d / pow(Math.round(log(d)));\n if (i * base < base - .5) i *= base;\n return i <= k ? format(d) : \"\";\n };\n };\n scale.copy = function() {\n return d3_scale_log(linear.copy(), base, positive, domain);\n };\n return d3_scale_linearRebind(scale, linear);\n }\n var d3_scale_logFormat = d3.format(\".0e\"), d3_scale_logNiceNegative = {\n floor: function(x) {\n return -Math.ceil(-x);\n },\n ceil: function(x) {\n return -Math.floor(-x);\n }\n };\n d3.scale.pow = function() {\n return d3_scale_pow(d3.scale.linear(), 1, [ 0, 1 ]);\n };\n function d3_scale_pow(linear, exponent, domain) {\n var powp = d3_scale_powPow(exponent), powb = d3_scale_powPow(1 / exponent);\n function scale(x) {\n return linear(powp(x));\n }\n scale.invert = function(x) {\n return powb(linear.invert(x));\n };\n scale.domain = function(x) {\n if (!arguments.length) return domain;\n linear.domain((domain = x.map(Number)).map(powp));\n return scale;\n };\n scale.ticks = function(m) {\n return d3_scale_linearTicks(domain, m);\n };\n scale.tickFormat = function(m, format) {\n return d3_scale_linearTickFormat(domain, m, format);\n };\n scale.nice = function(m) {\n return scale.domain(d3_scale_linearNice(domain, m));\n };\n scale.exponent = function(x) {\n if (!arguments.length) return exponent;\n powp = d3_scale_powPow(exponent = x);\n powb = d3_scale_powPow(1 / exponent);\n linear.domain(domain.map(powp));\n return scale;\n };\n scale.copy = function() {\n return d3_scale_pow(linear.copy(), exponent, domain);\n };\n return d3_scale_linearRebind(scale, linear);\n }\n function d3_scale_powPow(e) {\n return function(x) {\n return x < 0 ? -Math.pow(-x, e) : Math.pow(x, e);\n };\n }\n d3.scale.sqrt = function() {\n return d3.scale.pow().exponent(.5);\n };\n d3.scale.ordinal = function() {\n return d3_scale_ordinal([], {\n t: \"range\",\n a: [ [] ]\n });\n };\n function d3_scale_ordinal(domain, ranger) {\n var index, range, rangeBand;\n function scale(x) {\n return range[((index.get(x) || (ranger.t === \"range\" ? index.set(x, domain.push(x)) : NaN)) - 1) % range.length];\n }\n function steps(start, step) {\n return d3.range(domain.length).map(function(i) {\n return start + step * i;\n });\n }\n scale.domain = function(x) {\n if (!arguments.length) return domain;\n domain = [];\n index = new d3_Map();\n var i = -1, n = x.length, xi;\n while (++i < n) if (!index.has(xi = x[i])) index.set(xi, domain.push(xi));\n return scale[ranger.t].apply(scale, ranger.a);\n };\n scale.range = function(x) {\n if (!arguments.length) return range;\n range = x;\n rangeBand = 0;\n ranger = {\n t: \"range\",\n a: arguments\n };\n return scale;\n };\n scale.rangePoints = function(x, padding) {\n if (arguments.length < 2) padding = 0;\n var start = x[0], stop = x[1], step = domain.length < 2 ? (start = (start + stop) / 2, \n 0) : (stop - start) / (domain.length - 1 + padding);\n range = steps(start + step * padding / 2, step);\n rangeBand = 0;\n ranger = {\n t: \"rangePoints\",\n a: arguments\n };\n return scale;\n };\n scale.rangeRoundPoints = function(x, padding) {\n if (arguments.length < 2) padding = 0;\n var start = x[0], stop = x[1], step = domain.length < 2 ? (start = stop = Math.round((start + stop) / 2), \n 0) : (stop - start) / (domain.length - 1 + padding) | 0;\n range = steps(start + Math.round(step * padding / 2 + (stop - start - (domain.length - 1 + padding) * step) / 2), step);\n rangeBand = 0;\n ranger = {\n t: \"rangeRoundPoints\",\n a: arguments\n };\n return scale;\n };\n scale.rangeBands = function(x, padding, outerPadding) {\n if (arguments.length < 2) padding = 0;\n if (arguments.length < 3) outerPadding = padding;\n var reverse = x[1] < x[0], start = x[reverse - 0], stop = x[1 - reverse], step = (stop - start) / (domain.length - padding + 2 * outerPadding);\n range = steps(start + step * outerPadding, step);\n if (reverse) range.reverse();\n rangeBand = step * (1 - padding);\n ranger = {\n t: \"rangeBands\",\n a: arguments\n };\n return scale;\n };\n scale.rangeRoundBands = function(x, padding, outerPadding) {\n if (arguments.length < 2) padding = 0;\n if (arguments.length < 3) outerPadding = padding;\n var reverse = x[1] < x[0], start = x[reverse - 0], stop = x[1 - reverse], step = Math.floor((stop - start) / (domain.length - padding + 2 * outerPadding));\n range = steps(start + Math.round((stop - start - (domain.length - padding) * step) / 2), step);\n if (reverse) range.reverse();\n rangeBand = Math.round(step * (1 - padding));\n ranger = {\n t: \"rangeRoundBands\",\n a: arguments\n };\n return scale;\n };\n scale.rangeBand = function() {\n return rangeBand;\n };\n scale.rangeExtent = function() {\n return d3_scaleExtent(ranger.a[0]);\n };\n scale.copy = function() {\n return d3_scale_ordinal(domain, ranger);\n };\n return scale.domain(domain);\n }\n d3.scale.category10 = function() {\n return d3.scale.ordinal().range(d3_category10);\n };\n d3.scale.category20 = function() {\n return d3.scale.ordinal().range(d3_category20);\n };\n d3.scale.category20b = function() {\n return d3.scale.ordinal().range(d3_category20b);\n };\n d3.scale.category20c = function() {\n return d3.scale.ordinal().range(d3_category20c);\n };\n var d3_category10 = [ 2062260, 16744206, 2924588, 14034728, 9725885, 9197131, 14907330, 8355711, 12369186, 1556175 ].map(d3_rgbString);\n var d3_category20 = [ 2062260, 11454440, 16744206, 16759672, 2924588, 10018698, 14034728, 16750742, 9725885, 12955861, 9197131, 12885140, 14907330, 16234194, 8355711, 13092807, 12369186, 14408589, 1556175, 10410725 ].map(d3_rgbString);\n var d3_category20b = [ 3750777, 5395619, 7040719, 10264286, 6519097, 9216594, 11915115, 13556636, 9202993, 12426809, 15186514, 15190932, 8666169, 11356490, 14049643, 15177372, 8077683, 10834324, 13528509, 14589654 ].map(d3_rgbString);\n var d3_category20c = [ 3244733, 7057110, 10406625, 13032431, 15095053, 16616764, 16625259, 16634018, 3253076, 7652470, 10607003, 13101504, 7695281, 10394312, 12369372, 14342891, 6513507, 9868950, 12434877, 14277081 ].map(d3_rgbString);\n d3.scale.quantile = function() {\n return d3_scale_quantile([], []);\n };\n function d3_scale_quantile(domain, range) {\n var thresholds;\n function rescale() {\n var k = 0, q = range.length;\n thresholds = [];\n while (++k < q) thresholds[k - 1] = d3.quantile(domain, k / q);\n return scale;\n }\n function scale(x) {\n if (!isNaN(x = +x)) return range[d3.bisect(thresholds, x)];\n }\n scale.domain = function(x) {\n if (!arguments.length) return domain;\n domain = x.map(d3_number).filter(d3_numeric).sort(d3_ascending);\n return rescale();\n };\n scale.range = function(x) {\n if (!arguments.length) return range;\n range = x;\n return rescale();\n };\n scale.quantiles = function() {\n return thresholds;\n };\n scale.invertExtent = function(y) {\n y = range.indexOf(y);\n return y < 0 ? [ NaN, NaN ] : [ y > 0 ? thresholds[y - 1] : domain[0], y < thresholds.length ? thresholds[y] : domain[domain.length - 1] ];\n };\n scale.copy = function() {\n return d3_scale_quantile(domain, range);\n };\n return rescale();\n }\n d3.scale.quantize = function() {\n return d3_scale_quantize(0, 1, [ 0, 1 ]);\n };\n function d3_scale_quantize(x0, x1, range) {\n var kx, i;\n function scale(x) {\n return range[Math.max(0, Math.min(i, Math.floor(kx * (x - x0))))];\n }\n function rescale() {\n kx = range.length / (x1 - x0);\n i = range.length - 1;\n return scale;\n }\n scale.domain = function(x) {\n if (!arguments.length) return [ x0, x1 ];\n x0 = +x[0];\n x1 = +x[x.length - 1];\n return rescale();\n };\n scale.range = function(x) {\n if (!arguments.length) return range;\n range = x;\n return rescale();\n };\n scale.invertExtent = function(y) {\n y = range.indexOf(y);\n y = y < 0 ? NaN : y / kx + x0;\n return [ y, y + 1 / kx ];\n };\n scale.copy = function() {\n return d3_scale_quantize(x0, x1, range);\n };\n return rescale();\n }\n d3.scale.threshold = function() {\n return d3_scale_threshold([ .5 ], [ 0, 1 ]);\n };\n function d3_scale_threshold(domain, range) {\n function scale(x) {\n if (x <= x) return range[d3.bisect(domain, x)];\n }\n scale.domain = function(_) {\n if (!arguments.length) return domain;\n domain = _;\n return scale;\n };\n scale.range = function(_) {\n if (!arguments.length) return range;\n range = _;\n return scale;\n };\n scale.invertExtent = function(y) {\n y = range.indexOf(y);\n return [ domain[y - 1], domain[y] ];\n };\n scale.copy = function() {\n return d3_scale_threshold(domain, range);\n };\n return scale;\n }\n d3.scale.identity = function() {\n return d3_scale_identity([ 0, 1 ]);\n };\n function d3_scale_identity(domain) {\n function identity(x) {\n return +x;\n }\n identity.invert = identity;\n identity.domain = identity.range = function(x) {\n if (!arguments.length) return domain;\n domain = x.map(identity);\n return identity;\n };\n identity.ticks = function(m) {\n return d3_scale_linearTicks(domain, m);\n };\n identity.tickFormat = function(m, format) {\n return d3_scale_linearTickFormat(domain, m, format);\n };\n identity.copy = function() {\n return d3_scale_identity(domain);\n };\n return identity;\n }\n d3.svg = {};\n function d3_zero() {\n return 0;\n }\n d3.svg.arc = function() {\n var innerRadius = d3_svg_arcInnerRadius, outerRadius = d3_svg_arcOuterRadius, cornerRadius = d3_zero, padRadius = d3_svg_arcAuto, startAngle = d3_svg_arcStartAngle, endAngle = d3_svg_arcEndAngle, padAngle = d3_svg_arcPadAngle;\n function arc() {\n var r0 = Math.max(0, +innerRadius.apply(this, arguments)), r1 = Math.max(0, +outerRadius.apply(this, arguments)), a0 = startAngle.apply(this, arguments) - halfπ, a1 = endAngle.apply(this, arguments) - halfπ, da = Math.abs(a1 - a0), cw = a0 > a1 ? 0 : 1;\n if (r1 < r0) rc = r1, r1 = r0, r0 = rc;\n if (da >= τε) return circleSegment(r1, cw) + (r0 ? circleSegment(r0, 1 - cw) : \"\") + \"Z\";\n var rc, cr, rp, ap, p0 = 0, p1 = 0, x0, y0, x1, y1, x2, y2, x3, y3, path = [];\n if (ap = (+padAngle.apply(this, arguments) || 0) / 2) {\n rp = padRadius === d3_svg_arcAuto ? Math.sqrt(r0 * r0 + r1 * r1) : +padRadius.apply(this, arguments);\n if (!cw) p1 *= -1;\n if (r1) p1 = d3_asin(rp / r1 * Math.sin(ap));\n if (r0) p0 = d3_asin(rp / r0 * Math.sin(ap));\n }\n if (r1) {\n x0 = r1 * Math.cos(a0 + p1);\n y0 = r1 * Math.sin(a0 + p1);\n x1 = r1 * Math.cos(a1 - p1);\n y1 = r1 * Math.sin(a1 - p1);\n var l1 = Math.abs(a1 - a0 - 2 * p1) <= π ? 0 : 1;\n if (p1 && d3_svg_arcSweep(x0, y0, x1, y1) === cw ^ l1) {\n var h1 = (a0 + a1) / 2;\n x0 = r1 * Math.cos(h1);\n y0 = r1 * Math.sin(h1);\n x1 = y1 = null;\n }\n } else {\n x0 = y0 = 0;\n }\n if (r0) {\n x2 = r0 * Math.cos(a1 - p0);\n y2 = r0 * Math.sin(a1 - p0);\n x3 = r0 * Math.cos(a0 + p0);\n y3 = r0 * Math.sin(a0 + p0);\n var l0 = Math.abs(a0 - a1 + 2 * p0) <= π ? 0 : 1;\n if (p0 && d3_svg_arcSweep(x2, y2, x3, y3) === 1 - cw ^ l0) {\n var h0 = (a0 + a1) / 2;\n x2 = r0 * Math.cos(h0);\n y2 = r0 * Math.sin(h0);\n x3 = y3 = null;\n }\n } else {\n x2 = y2 = 0;\n }\n if (da > ε && (rc = Math.min(Math.abs(r1 - r0) / 2, +cornerRadius.apply(this, arguments))) > .001) {\n cr = r0 < r1 ^ cw ? 0 : 1;\n var rc1 = rc, rc0 = rc;\n if (da < π) {\n var oc = x3 == null ? [ x2, y2 ] : x1 == null ? [ x0, y0 ] : d3_geom_polygonIntersect([ x0, y0 ], [ x3, y3 ], [ x1, y1 ], [ x2, y2 ]), ax = x0 - oc[0], ay = y0 - oc[1], bx = x1 - oc[0], by = y1 - oc[1], kc = 1 / Math.sin(Math.acos((ax * bx + ay * by) / (Math.sqrt(ax * ax + ay * ay) * Math.sqrt(bx * bx + by * by))) / 2), lc = Math.sqrt(oc[0] * oc[0] + oc[1] * oc[1]);\n rc0 = Math.min(rc, (r0 - lc) / (kc - 1));\n rc1 = Math.min(rc, (r1 - lc) / (kc + 1));\n }\n if (x1 != null) {\n var t30 = d3_svg_arcCornerTangents(x3 == null ? [ x2, y2 ] : [ x3, y3 ], [ x0, y0 ], r1, rc1, cw), t12 = d3_svg_arcCornerTangents([ x1, y1 ], [ x2, y2 ], r1, rc1, cw);\n if (rc === rc1) {\n path.push(\"M\", t30[0], \"A\", rc1, \",\", rc1, \" 0 0,\", cr, \" \", t30[1], \"A\", r1, \",\", r1, \" 0 \", 1 - cw ^ d3_svg_arcSweep(t30[1][0], t30[1][1], t12[1][0], t12[1][1]), \",\", cw, \" \", t12[1], \"A\", rc1, \",\", rc1, \" 0 0,\", cr, \" \", t12[0]);\n } else {\n path.push(\"M\", t30[0], \"A\", rc1, \",\", rc1, \" 0 1,\", cr, \" \", t12[0]);\n }\n } else {\n path.push(\"M\", x0, \",\", y0);\n }\n if (x3 != null) {\n var t03 = d3_svg_arcCornerTangents([ x0, y0 ], [ x3, y3 ], r0, -rc0, cw), t21 = d3_svg_arcCornerTangents([ x2, y2 ], x1 == null ? [ x0, y0 ] : [ x1, y1 ], r0, -rc0, cw);\n if (rc === rc0) {\n path.push(\"L\", t21[0], \"A\", rc0, \",\", rc0, \" 0 0,\", cr, \" \", t21[1], \"A\", r0, \",\", r0, \" 0 \", cw ^ d3_svg_arcSweep(t21[1][0], t21[1][1], t03[1][0], t03[1][1]), \",\", 1 - cw, \" \", t03[1], \"A\", rc0, \",\", rc0, \" 0 0,\", cr, \" \", t03[0]);\n } else {\n path.push(\"L\", t21[0], \"A\", rc0, \",\", rc0, \" 0 0,\", cr, \" \", t03[0]);\n }\n } else {\n path.push(\"L\", x2, \",\", y2);\n }\n } else {\n path.push(\"M\", x0, \",\", y0);\n if (x1 != null) path.push(\"A\", r1, \",\", r1, \" 0 \", l1, \",\", cw, \" \", x1, \",\", y1);\n path.push(\"L\", x2, \",\", y2);\n if (x3 != null) path.push(\"A\", r0, \",\", r0, \" 0 \", l0, \",\", 1 - cw, \" \", x3, \",\", y3);\n }\n path.push(\"Z\");\n return path.join(\"\");\n }\n function circleSegment(r1, cw) {\n return \"M0,\" + r1 + \"A\" + r1 + \",\" + r1 + \" 0 1,\" + cw + \" 0,\" + -r1 + \"A\" + r1 + \",\" + r1 + \" 0 1,\" + cw + \" 0,\" + r1;\n }\n arc.innerRadius = function(v) {\n if (!arguments.length) return innerRadius;\n innerRadius = d3_functor(v);\n return arc;\n };\n arc.outerRadius = function(v) {\n if (!arguments.length) return outerRadius;\n outerRadius = d3_functor(v);\n return arc;\n };\n arc.cornerRadius = function(v) {\n if (!arguments.length) return cornerRadius;\n cornerRadius = d3_functor(v);\n return arc;\n };\n arc.padRadius = function(v) {\n if (!arguments.length) return padRadius;\n padRadius = v == d3_svg_arcAuto ? d3_svg_arcAuto : d3_functor(v);\n return arc;\n };\n arc.startAngle = function(v) {\n if (!arguments.length) return startAngle;\n startAngle = d3_functor(v);\n return arc;\n };\n arc.endAngle = function(v) {\n if (!arguments.length) return endAngle;\n endAngle = d3_functor(v);\n return arc;\n };\n arc.padAngle = function(v) {\n if (!arguments.length) return padAngle;\n padAngle = d3_functor(v);\n return arc;\n };\n arc.centroid = function() {\n var r = (+innerRadius.apply(this, arguments) + +outerRadius.apply(this, arguments)) / 2, a = (+startAngle.apply(this, arguments) + +endAngle.apply(this, arguments)) / 2 - halfπ;\n return [ Math.cos(a) * r, Math.sin(a) * r ];\n };\n return arc;\n };\n var d3_svg_arcAuto = \"auto\";\n function d3_svg_arcInnerRadius(d) {\n return d.innerRadius;\n }\n function d3_svg_arcOuterRadius(d) {\n return d.outerRadius;\n }\n function d3_svg_arcStartAngle(d) {\n return d.startAngle;\n }\n function d3_svg_arcEndAngle(d) {\n return d.endAngle;\n }\n function d3_svg_arcPadAngle(d) {\n return d && d.padAngle;\n }\n function d3_svg_arcSweep(x0, y0, x1, y1) {\n return (x0 - x1) * y0 - (y0 - y1) * x0 > 0 ? 0 : 1;\n }\n function d3_svg_arcCornerTangents(p0, p1, r1, rc, cw) {\n var x01 = p0[0] - p1[0], y01 = p0[1] - p1[1], lo = (cw ? rc : -rc) / Math.sqrt(x01 * x01 + y01 * y01), ox = lo * y01, oy = -lo * x01, x1 = p0[0] + ox, y1 = p0[1] + oy, x2 = p1[0] + ox, y2 = p1[1] + oy, x3 = (x1 + x2) / 2, y3 = (y1 + y2) / 2, dx = x2 - x1, dy = y2 - y1, d2 = dx * dx + dy * dy, r = r1 - rc, D = x1 * y2 - x2 * y1, d = (dy < 0 ? -1 : 1) * Math.sqrt(Math.max(0, r * r * d2 - D * D)), cx0 = (D * dy - dx * d) / d2, cy0 = (-D * dx - dy * d) / d2, cx1 = (D * dy + dx * d) / d2, cy1 = (-D * dx + dy * d) / d2, dx0 = cx0 - x3, dy0 = cy0 - y3, dx1 = cx1 - x3, dy1 = cy1 - y3;\n if (dx0 * dx0 + dy0 * dy0 > dx1 * dx1 + dy1 * dy1) cx0 = cx1, cy0 = cy1;\n return [ [ cx0 - ox, cy0 - oy ], [ cx0 * r1 / r, cy0 * r1 / r ] ];\n }\n function d3_svg_line(projection) {\n var x = d3_geom_pointX, y = d3_geom_pointY, defined = d3_true, interpolate = d3_svg_lineLinear, interpolateKey = interpolate.key, tension = .7;\n function line(data) {\n var segments = [], points = [], i = -1, n = data.length, d, fx = d3_functor(x), fy = d3_functor(y);\n function segment() {\n segments.push(\"M\", interpolate(projection(points), tension));\n }\n while (++i < n) {\n if (defined.call(this, d = data[i], i)) {\n points.push([ +fx.call(this, d, i), +fy.call(this, d, i) ]);\n } else if (points.length) {\n segment();\n points = [];\n }\n }\n if (points.length) segment();\n return segments.length ? segments.join(\"\") : null;\n }\n line.x = function(_) {\n if (!arguments.length) return x;\n x = _;\n return line;\n };\n line.y = function(_) {\n if (!arguments.length) return y;\n y = _;\n return line;\n };\n line.defined = function(_) {\n if (!arguments.length) return defined;\n defined = _;\n return line;\n };\n line.interpolate = function(_) {\n if (!arguments.length) return interpolateKey;\n if (typeof _ === \"function\") interpolateKey = interpolate = _; else interpolateKey = (interpolate = d3_svg_lineInterpolators.get(_) || d3_svg_lineLinear).key;\n return line;\n };\n line.tension = function(_) {\n if (!arguments.length) return tension;\n tension = _;\n return line;\n };\n return line;\n }\n d3.svg.line = function() {\n return d3_svg_line(d3_identity);\n };\n var d3_svg_lineInterpolators = d3.map({\n linear: d3_svg_lineLinear,\n \"linear-closed\": d3_svg_lineLinearClosed,\n step: d3_svg_lineStep,\n \"step-before\": d3_svg_lineStepBefore,\n \"step-after\": d3_svg_lineStepAfter,\n basis: d3_svg_lineBasis,\n \"basis-open\": d3_svg_lineBasisOpen,\n \"basis-closed\": d3_svg_lineBasisClosed,\n bundle: d3_svg_lineBundle,\n cardinal: d3_svg_lineCardinal,\n \"cardinal-open\": d3_svg_lineCardinalOpen,\n \"cardinal-closed\": d3_svg_lineCardinalClosed,\n monotone: d3_svg_lineMonotone\n });\n d3_svg_lineInterpolators.forEach(function(key, value) {\n value.key = key;\n value.closed = /-closed$/.test(key);\n });\n function d3_svg_lineLinear(points) {\n return points.length > 1 ? points.join(\"L\") : points + \"Z\";\n }\n function d3_svg_lineLinearClosed(points) {\n return points.join(\"L\") + \"Z\";\n }\n function d3_svg_lineStep(points) {\n var i = 0, n = points.length, p = points[0], path = [ p[0], \",\", p[1] ];\n while (++i < n) path.push(\"H\", (p[0] + (p = points[i])[0]) / 2, \"V\", p[1]);\n if (n > 1) path.push(\"H\", p[0]);\n return path.join(\"\");\n }\n function d3_svg_lineStepBefore(points) {\n var i = 0, n = points.length, p = points[0], path = [ p[0], \",\", p[1] ];\n while (++i < n) path.push(\"V\", (p = points[i])[1], \"H\", p[0]);\n return path.join(\"\");\n }\n function d3_svg_lineStepAfter(points) {\n var i = 0, n = points.length, p = points[0], path = [ p[0], \",\", p[1] ];\n while (++i < n) path.push(\"H\", (p = points[i])[0], \"V\", p[1]);\n return path.join(\"\");\n }\n function d3_svg_lineCardinalOpen(points, tension) {\n return points.length < 4 ? d3_svg_lineLinear(points) : points[1] + d3_svg_lineHermite(points.slice(1, -1), d3_svg_lineCardinalTangents(points, tension));\n }\n function d3_svg_lineCardinalClosed(points, tension) {\n return points.length < 3 ? d3_svg_lineLinearClosed(points) : points[0] + d3_svg_lineHermite((points.push(points[0]), \n points), d3_svg_lineCardinalTangents([ points[points.length - 2] ].concat(points, [ points[1] ]), tension));\n }\n function d3_svg_lineCardinal(points, tension) {\n return points.length < 3 ? d3_svg_lineLinear(points) : points[0] + d3_svg_lineHermite(points, d3_svg_lineCardinalTangents(points, tension));\n }\n function d3_svg_lineHermite(points, tangents) {\n if (tangents.length < 1 || points.length != tangents.length && points.length != tangents.length + 2) {\n return d3_svg_lineLinear(points);\n }\n var quad = points.length != tangents.length, path = \"\", p0 = points[0], p = points[1], t0 = tangents[0], t = t0, pi = 1;\n if (quad) {\n path += \"Q\" + (p[0] - t0[0] * 2 / 3) + \",\" + (p[1] - t0[1] * 2 / 3) + \",\" + p[0] + \",\" + p[1];\n p0 = points[1];\n pi = 2;\n }\n if (tangents.length > 1) {\n t = tangents[1];\n p = points[pi];\n pi++;\n path += \"C\" + (p0[0] + t0[0]) + \",\" + (p0[1] + t0[1]) + \",\" + (p[0] - t[0]) + \",\" + (p[1] - t[1]) + \",\" + p[0] + \",\" + p[1];\n for (var i = 2; i < tangents.length; i++, pi++) {\n p = points[pi];\n t = tangents[i];\n path += \"S\" + (p[0] - t[0]) + \",\" + (p[1] - t[1]) + \",\" + p[0] + \",\" + p[1];\n }\n }\n if (quad) {\n var lp = points[pi];\n path += \"Q\" + (p[0] + t[0] * 2 / 3) + \",\" + (p[1] + t[1] * 2 / 3) + \",\" + lp[0] + \",\" + lp[1];\n }\n return path;\n }\n function d3_svg_lineCardinalTangents(points, tension) {\n var tangents = [], a = (1 - tension) / 2, p0, p1 = points[0], p2 = points[1], i = 1, n = points.length;\n while (++i < n) {\n p0 = p1;\n p1 = p2;\n p2 = points[i];\n tangents.push([ a * (p2[0] - p0[0]), a * (p2[1] - p0[1]) ]);\n }\n return tangents;\n }\n function d3_svg_lineBasis(points) {\n if (points.length < 3) return d3_svg_lineLinear(points);\n var i = 1, n = points.length, pi = points[0], x0 = pi[0], y0 = pi[1], px = [ x0, x0, x0, (pi = points[1])[0] ], py = [ y0, y0, y0, pi[1] ], path = [ x0, \",\", y0, \"L\", d3_svg_lineDot4(d3_svg_lineBasisBezier3, px), \",\", d3_svg_lineDot4(d3_svg_lineBasisBezier3, py) ];\n points.push(points[n - 1]);\n while (++i <= n) {\n pi = points[i];\n px.shift();\n px.push(pi[0]);\n py.shift();\n py.push(pi[1]);\n d3_svg_lineBasisBezier(path, px, py);\n }\n points.pop();\n path.push(\"L\", pi);\n return path.join(\"\");\n }\n function d3_svg_lineBasisOpen(points) {\n if (points.length < 4) return d3_svg_lineLinear(points);\n var path = [], i = -1, n = points.length, pi, px = [ 0 ], py = [ 0 ];\n while (++i < 3) {\n pi = points[i];\n px.push(pi[0]);\n py.push(pi[1]);\n }\n path.push(d3_svg_lineDot4(d3_svg_lineBasisBezier3, px) + \",\" + d3_svg_lineDot4(d3_svg_lineBasisBezier3, py));\n --i;\n while (++i < n) {\n pi = points[i];\n px.shift();\n px.push(pi[0]);\n py.shift();\n py.push(pi[1]);\n d3_svg_lineBasisBezier(path, px, py);\n }\n return path.join(\"\");\n }\n function d3_svg_lineBasisClosed(points) {\n var path, i = -1, n = points.length, m = n + 4, pi, px = [], py = [];\n while (++i < 4) {\n pi = points[i % n];\n px.push(pi[0]);\n py.push(pi[1]);\n }\n path = [ d3_svg_lineDot4(d3_svg_lineBasisBezier3, px), \",\", d3_svg_lineDot4(d3_svg_lineBasisBezier3, py) ];\n --i;\n while (++i < m) {\n pi = points[i % n];\n px.shift();\n px.push(pi[0]);\n py.shift();\n py.push(pi[1]);\n d3_svg_lineBasisBezier(path, px, py);\n }\n return path.join(\"\");\n }\n function d3_svg_lineBundle(points, tension) {\n var n = points.length - 1;\n if (n) {\n var x0 = points[0][0], y0 = points[0][1], dx = points[n][0] - x0, dy = points[n][1] - y0, i = -1, p, t;\n while (++i <= n) {\n p = points[i];\n t = i / n;\n p[0] = tension * p[0] + (1 - tension) * (x0 + t * dx);\n p[1] = tension * p[1] + (1 - tension) * (y0 + t * dy);\n }\n }\n return d3_svg_lineBasis(points);\n }\n function d3_svg_lineDot4(a, b) {\n return a[0] * b[0] + a[1] * b[1] + a[2] * b[2] + a[3] * b[3];\n }\n var d3_svg_lineBasisBezier1 = [ 0, 2 / 3, 1 / 3, 0 ], d3_svg_lineBasisBezier2 = [ 0, 1 / 3, 2 / 3, 0 ], d3_svg_lineBasisBezier3 = [ 0, 1 / 6, 2 / 3, 1 / 6 ];\n function d3_svg_lineBasisBezier(path, x, y) {\n path.push(\"C\", d3_svg_lineDot4(d3_svg_lineBasisBezier1, x), \",\", d3_svg_lineDot4(d3_svg_lineBasisBezier1, y), \",\", d3_svg_lineDot4(d3_svg_lineBasisBezier2, x), \",\", d3_svg_lineDot4(d3_svg_lineBasisBezier2, y), \",\", d3_svg_lineDot4(d3_svg_lineBasisBezier3, x), \",\", d3_svg_lineDot4(d3_svg_lineBasisBezier3, y));\n }\n function d3_svg_lineSlope(p0, p1) {\n return (p1[1] - p0[1]) / (p1[0] - p0[0]);\n }\n function d3_svg_lineFiniteDifferences(points) {\n var i = 0, j = points.length - 1, m = [], p0 = points[0], p1 = points[1], d = m[0] = d3_svg_lineSlope(p0, p1);\n while (++i < j) {\n m[i] = (d + (d = d3_svg_lineSlope(p0 = p1, p1 = points[i + 1]))) / 2;\n }\n m[i] = d;\n return m;\n }\n function d3_svg_lineMonotoneTangents(points) {\n var tangents = [], d, a, b, s, m = d3_svg_lineFiniteDifferences(points), i = -1, j = points.length - 1;\n while (++i < j) {\n d = d3_svg_lineSlope(points[i], points[i + 1]);\n if (abs(d) < ε) {\n m[i] = m[i + 1] = 0;\n } else {\n a = m[i] / d;\n b = m[i + 1] / d;\n s = a * a + b * b;\n if (s > 9) {\n s = d * 3 / Math.sqrt(s);\n m[i] = s * a;\n m[i + 1] = s * b;\n }\n }\n }\n i = -1;\n while (++i <= j) {\n s = (points[Math.min(j, i + 1)][0] - points[Math.max(0, i - 1)][0]) / (6 * (1 + m[i] * m[i]));\n tangents.push([ s || 0, m[i] * s || 0 ]);\n }\n return tangents;\n }\n function d3_svg_lineMonotone(points) {\n return points.length < 3 ? d3_svg_lineLinear(points) : points[0] + d3_svg_lineHermite(points, d3_svg_lineMonotoneTangents(points));\n }\n d3.svg.line.radial = function() {\n var line = d3_svg_line(d3_svg_lineRadial);\n line.radius = line.x, delete line.x;\n line.angle = line.y, delete line.y;\n return line;\n };\n function d3_svg_lineRadial(points) {\n var point, i = -1, n = points.length, r, a;\n while (++i < n) {\n point = points[i];\n r = point[0];\n a = point[1] - halfπ;\n point[0] = r * Math.cos(a);\n point[1] = r * Math.sin(a);\n }\n return points;\n }\n function d3_svg_area(projection) {\n var x0 = d3_geom_pointX, x1 = d3_geom_pointX, y0 = 0, y1 = d3_geom_pointY, defined = d3_true, interpolate = d3_svg_lineLinear, interpolateKey = interpolate.key, interpolateReverse = interpolate, L = \"L\", tension = .7;\n function area(data) {\n var segments = [], points0 = [], points1 = [], i = -1, n = data.length, d, fx0 = d3_functor(x0), fy0 = d3_functor(y0), fx1 = x0 === x1 ? function() {\n return x;\n } : d3_functor(x1), fy1 = y0 === y1 ? function() {\n return y;\n } : d3_functor(y1), x, y;\n function segment() {\n segments.push(\"M\", interpolate(projection(points1), tension), L, interpolateReverse(projection(points0.reverse()), tension), \"Z\");\n }\n while (++i < n) {\n if (defined.call(this, d = data[i], i)) {\n points0.push([ x = +fx0.call(this, d, i), y = +fy0.call(this, d, i) ]);\n points1.push([ +fx1.call(this, d, i), +fy1.call(this, d, i) ]);\n } else if (points0.length) {\n segment();\n points0 = [];\n points1 = [];\n }\n }\n if (points0.length) segment();\n return segments.length ? segments.join(\"\") : null;\n }\n area.x = function(_) {\n if (!arguments.length) return x1;\n x0 = x1 = _;\n return area;\n };\n area.x0 = function(_) {\n if (!arguments.length) return x0;\n x0 = _;\n return area;\n };\n area.x1 = function(_) {\n if (!arguments.length) return x1;\n x1 = _;\n return area;\n };\n area.y = function(_) {\n if (!arguments.length) return y1;\n y0 = y1 = _;\n return area;\n };\n area.y0 = function(_) {\n if (!arguments.length) return y0;\n y0 = _;\n return area;\n };\n area.y1 = function(_) {\n if (!arguments.length) return y1;\n y1 = _;\n return area;\n };\n area.defined = function(_) {\n if (!arguments.length) return defined;\n defined = _;\n return area;\n };\n area.interpolate = function(_) {\n if (!arguments.length) return interpolateKey;\n if (typeof _ === \"function\") interpolateKey = interpolate = _; else interpolateKey = (interpolate = d3_svg_lineInterpolators.get(_) || d3_svg_lineLinear).key;\n interpolateReverse = interpolate.reverse || interpolate;\n L = interpolate.closed ? \"M\" : \"L\";\n return area;\n };\n area.tension = function(_) {\n if (!arguments.length) return tension;\n tension = _;\n return area;\n };\n return area;\n }\n d3_svg_lineStepBefore.reverse = d3_svg_lineStepAfter;\n d3_svg_lineStepAfter.reverse = d3_svg_lineStepBefore;\n d3.svg.area = function() {\n return d3_svg_area(d3_identity);\n };\n d3.svg.area.radial = function() {\n var area = d3_svg_area(d3_svg_lineRadial);\n area.radius = area.x, delete area.x;\n area.innerRadius = area.x0, delete area.x0;\n area.outerRadius = area.x1, delete area.x1;\n area.angle = area.y, delete area.y;\n area.startAngle = area.y0, delete area.y0;\n area.endAngle = area.y1, delete area.y1;\n return area;\n };\n d3.svg.chord = function() {\n var source = d3_source, target = d3_target, radius = d3_svg_chordRadius, startAngle = d3_svg_arcStartAngle, endAngle = d3_svg_arcEndAngle;\n function chord(d, i) {\n var s = subgroup(this, source, d, i), t = subgroup(this, target, d, i);\n return \"M\" + s.p0 + arc(s.r, s.p1, s.a1 - s.a0) + (equals(s, t) ? curve(s.r, s.p1, s.r, s.p0) : curve(s.r, s.p1, t.r, t.p0) + arc(t.r, t.p1, t.a1 - t.a0) + curve(t.r, t.p1, s.r, s.p0)) + \"Z\";\n }\n function subgroup(self, f, d, i) {\n var subgroup = f.call(self, d, i), r = radius.call(self, subgroup, i), a0 = startAngle.call(self, subgroup, i) - halfπ, a1 = endAngle.call(self, subgroup, i) - halfπ;\n return {\n r: r,\n a0: a0,\n a1: a1,\n p0: [ r * Math.cos(a0), r * Math.sin(a0) ],\n p1: [ r * Math.cos(a1), r * Math.sin(a1) ]\n };\n }\n function equals(a, b) {\n return a.a0 == b.a0 && a.a1 == b.a1;\n }\n function arc(r, p, a) {\n return \"A\" + r + \",\" + r + \" 0 \" + +(a > π) + \",1 \" + p;\n }\n function curve(r0, p0, r1, p1) {\n return \"Q 0,0 \" + p1;\n }\n chord.radius = function(v) {\n if (!arguments.length) return radius;\n radius = d3_functor(v);\n return chord;\n };\n chord.source = function(v) {\n if (!arguments.length) return source;\n source = d3_functor(v);\n return chord;\n };\n chord.target = function(v) {\n if (!arguments.length) return target;\n target = d3_functor(v);\n return chord;\n };\n chord.startAngle = function(v) {\n if (!arguments.length) return startAngle;\n startAngle = d3_functor(v);\n return chord;\n };\n chord.endAngle = function(v) {\n if (!arguments.length) return endAngle;\n endAngle = d3_functor(v);\n return chord;\n };\n return chord;\n };\n function d3_svg_chordRadius(d) {\n return d.radius;\n }\n d3.svg.diagonal = function() {\n var source = d3_source, target = d3_target, projection = d3_svg_diagonalProjection;\n function diagonal(d, i) {\n var p0 = source.call(this, d, i), p3 = target.call(this, d, i), m = (p0.y + p3.y) / 2, p = [ p0, {\n x: p0.x,\n y: m\n }, {\n x: p3.x,\n y: m\n }, p3 ];\n p = p.map(projection);\n return \"M\" + p[0] + \"C\" + p[1] + \" \" + p[2] + \" \" + p[3];\n }\n diagonal.source = function(x) {\n if (!arguments.length) return source;\n source = d3_functor(x);\n return diagonal;\n };\n diagonal.target = function(x) {\n if (!arguments.length) return target;\n target = d3_functor(x);\n return diagonal;\n };\n diagonal.projection = function(x) {\n if (!arguments.length) return projection;\n projection = x;\n return diagonal;\n };\n return diagonal;\n };\n function d3_svg_diagonalProjection(d) {\n return [ d.x, d.y ];\n }\n d3.svg.diagonal.radial = function() {\n var diagonal = d3.svg.diagonal(), projection = d3_svg_diagonalProjection, projection_ = diagonal.projection;\n diagonal.projection = function(x) {\n return arguments.length ? projection_(d3_svg_diagonalRadialProjection(projection = x)) : projection;\n };\n return diagonal;\n };\n function d3_svg_diagonalRadialProjection(projection) {\n return function() {\n var d = projection.apply(this, arguments), r = d[0], a = d[1] - halfπ;\n return [ r * Math.cos(a), r * Math.sin(a) ];\n };\n }\n d3.svg.symbol = function() {\n var type = d3_svg_symbolType, size = d3_svg_symbolSize;\n function symbol(d, i) {\n return (d3_svg_symbols.get(type.call(this, d, i)) || d3_svg_symbolCircle)(size.call(this, d, i));\n }\n symbol.type = function(x) {\n if (!arguments.length) return type;\n type = d3_functor(x);\n return symbol;\n };\n symbol.size = function(x) {\n if (!arguments.length) return size;\n size = d3_functor(x);\n return symbol;\n };\n return symbol;\n };\n function d3_svg_symbolSize() {\n return 64;\n }\n function d3_svg_symbolType() {\n return \"circle\";\n }\n function d3_svg_symbolCircle(size) {\n var r = Math.sqrt(size / π);\n return \"M0,\" + r + \"A\" + r + \",\" + r + \" 0 1,1 0,\" + -r + \"A\" + r + \",\" + r + \" 0 1,1 0,\" + r + \"Z\";\n }\n var d3_svg_symbols = d3.map({\n circle: d3_svg_symbolCircle,\n cross: function(size) {\n var r = Math.sqrt(size / 5) / 2;\n return \"M\" + -3 * r + \",\" + -r + \"H\" + -r + \"V\" + -3 * r + \"H\" + r + \"V\" + -r + \"H\" + 3 * r + \"V\" + r + \"H\" + r + \"V\" + 3 * r + \"H\" + -r + \"V\" + r + \"H\" + -3 * r + \"Z\";\n },\n diamond: function(size) {\n var ry = Math.sqrt(size / (2 * d3_svg_symbolTan30)), rx = ry * d3_svg_symbolTan30;\n return \"M0,\" + -ry + \"L\" + rx + \",0\" + \" 0,\" + ry + \" \" + -rx + \",0\" + \"Z\";\n },\n square: function(size) {\n var r = Math.sqrt(size) / 2;\n return \"M\" + -r + \",\" + -r + \"L\" + r + \",\" + -r + \" \" + r + \",\" + r + \" \" + -r + \",\" + r + \"Z\";\n },\n \"triangle-down\": function(size) {\n var rx = Math.sqrt(size / d3_svg_symbolSqrt3), ry = rx * d3_svg_symbolSqrt3 / 2;\n return \"M0,\" + ry + \"L\" + rx + \",\" + -ry + \" \" + -rx + \",\" + -ry + \"Z\";\n },\n \"triangle-up\": function(size) {\n var rx = Math.sqrt(size / d3_svg_symbolSqrt3), ry = rx * d3_svg_symbolSqrt3 / 2;\n return \"M0,\" + -ry + \"L\" + rx + \",\" + ry + \" \" + -rx + \",\" + ry + \"Z\";\n }\n });\n d3.svg.symbolTypes = d3_svg_symbols.keys();\n var d3_svg_symbolSqrt3 = Math.sqrt(3), d3_svg_symbolTan30 = Math.tan(30 * d3_radians);\n d3_selectionPrototype.transition = function(name) {\n var id = d3_transitionInheritId || ++d3_transitionId, ns = d3_transitionNamespace(name), subgroups = [], subgroup, node, transition = d3_transitionInherit || {\n time: Date.now(),\n ease: d3_ease_cubicInOut,\n delay: 0,\n duration: 250\n };\n for (var j = -1, m = this.length; ++j < m; ) {\n subgroups.push(subgroup = []);\n for (var group = this[j], i = -1, n = group.length; ++i < n; ) {\n if (node = group[i]) d3_transitionNode(node, i, ns, id, transition);\n subgroup.push(node);\n }\n }\n return d3_transition(subgroups, ns, id);\n };\n d3_selectionPrototype.interrupt = function(name) {\n return this.each(name == null ? d3_selection_interrupt : d3_selection_interruptNS(d3_transitionNamespace(name)));\n };\n var d3_selection_interrupt = d3_selection_interruptNS(d3_transitionNamespace());\n function d3_selection_interruptNS(ns) {\n return function() {\n var lock, activeId, active;\n if ((lock = this[ns]) && (active = lock[activeId = lock.active])) {\n active.timer.c = null;\n active.timer.t = NaN;\n if (--lock.count) delete lock[activeId]; else delete this[ns];\n lock.active += .5;\n active.event && active.event.interrupt.call(this, this.__data__, active.index);\n }\n };\n }\n function d3_transition(groups, ns, id) {\n d3_subclass(groups, d3_transitionPrototype);\n groups.namespace = ns;\n groups.id = id;\n return groups;\n }\n var d3_transitionPrototype = [], d3_transitionId = 0, d3_transitionInheritId, d3_transitionInherit;\n d3_transitionPrototype.call = d3_selectionPrototype.call;\n d3_transitionPrototype.empty = d3_selectionPrototype.empty;\n d3_transitionPrototype.node = d3_selectionPrototype.node;\n d3_transitionPrototype.size = d3_selectionPrototype.size;\n d3.transition = function(selection, name) {\n return selection && selection.transition ? d3_transitionInheritId ? selection.transition(name) : selection : d3.selection().transition(selection);\n };\n d3.transition.prototype = d3_transitionPrototype;\n d3_transitionPrototype.select = function(selector) {\n var id = this.id, ns = this.namespace, subgroups = [], subgroup, subnode, node;\n selector = d3_selection_selector(selector);\n for (var j = -1, m = this.length; ++j < m; ) {\n subgroups.push(subgroup = []);\n for (var group = this[j], i = -1, n = group.length; ++i < n; ) {\n if ((node = group[i]) && (subnode = selector.call(node, node.__data__, i, j))) {\n if (\"__data__\" in node) subnode.__data__ = node.__data__;\n d3_transitionNode(subnode, i, ns, id, node[ns][id]);\n subgroup.push(subnode);\n } else {\n subgroup.push(null);\n }\n }\n }\n return d3_transition(subgroups, ns, id);\n };\n d3_transitionPrototype.selectAll = function(selector) {\n var id = this.id, ns = this.namespace, subgroups = [], subgroup, subnodes, node, subnode, transition;\n selector = d3_selection_selectorAll(selector);\n for (var j = -1, m = this.length; ++j < m; ) {\n for (var group = this[j], i = -1, n = group.length; ++i < n; ) {\n if (node = group[i]) {\n transition = node[ns][id];\n subnodes = selector.call(node, node.__data__, i, j);\n subgroups.push(subgroup = []);\n for (var k = -1, o = subnodes.length; ++k < o; ) {\n if (subnode = subnodes[k]) d3_transitionNode(subnode, k, ns, id, transition);\n subgroup.push(subnode);\n }\n }\n }\n }\n return d3_transition(subgroups, ns, id);\n };\n d3_transitionPrototype.filter = function(filter) {\n var subgroups = [], subgroup, group, node;\n if (typeof filter !== \"function\") filter = d3_selection_filter(filter);\n for (var j = 0, m = this.length; j < m; j++) {\n subgroups.push(subgroup = []);\n for (var group = this[j], i = 0, n = group.length; i < n; i++) {\n if ((node = group[i]) && filter.call(node, node.__data__, i, j)) {\n subgroup.push(node);\n }\n }\n }\n return d3_transition(subgroups, this.namespace, this.id);\n };\n d3_transitionPrototype.tween = function(name, tween) {\n var id = this.id, ns = this.namespace;\n if (arguments.length < 2) return this.node()[ns][id].tween.get(name);\n return d3_selection_each(this, tween == null ? function(node) {\n node[ns][id].tween.remove(name);\n } : function(node) {\n node[ns][id].tween.set(name, tween);\n });\n };\n function d3_transition_tween(groups, name, value, tween) {\n var id = groups.id, ns = groups.namespace;\n return d3_selection_each(groups, typeof value === \"function\" ? function(node, i, j) {\n node[ns][id].tween.set(name, tween(value.call(node, node.__data__, i, j)));\n } : (value = tween(value), function(node) {\n node[ns][id].tween.set(name, value);\n }));\n }\n d3_transitionPrototype.attr = function(nameNS, value) {\n if (arguments.length < 2) {\n for (value in nameNS) this.attr(value, nameNS[value]);\n return this;\n }\n var interpolate = nameNS == \"transform\" ? d3_interpolateTransform : d3_interpolate, name = d3.ns.qualify(nameNS);\n function attrNull() {\n this.removeAttribute(name);\n }\n function attrNullNS() {\n this.removeAttributeNS(name.space, name.local);\n }\n function attrTween(b) {\n return b == null ? attrNull : (b += \"\", function() {\n var a = this.getAttribute(name), i;\n return a !== b && (i = interpolate(a, b), function(t) {\n this.setAttribute(name, i(t));\n });\n });\n }\n function attrTweenNS(b) {\n return b == null ? attrNullNS : (b += \"\", function() {\n var a = this.getAttributeNS(name.space, name.local), i;\n return a !== b && (i = interpolate(a, b), function(t) {\n this.setAttributeNS(name.space, name.local, i(t));\n });\n });\n }\n return d3_transition_tween(this, \"attr.\" + nameNS, value, name.local ? attrTweenNS : attrTween);\n };\n d3_transitionPrototype.attrTween = function(nameNS, tween) {\n var name = d3.ns.qualify(nameNS);\n function attrTween(d, i) {\n var f = tween.call(this, d, i, this.getAttribute(name));\n return f && function(t) {\n this.setAttribute(name, f(t));\n };\n }\n function attrTweenNS(d, i) {\n var f = tween.call(this, d, i, this.getAttributeNS(name.space, name.local));\n return f && function(t) {\n this.setAttributeNS(name.space, name.local, f(t));\n };\n }\n return this.tween(\"attr.\" + nameNS, name.local ? attrTweenNS : attrTween);\n };\n d3_transitionPrototype.style = function(name, value, priority) {\n var n = arguments.length;\n if (n < 3) {\n if (typeof name !== \"string\") {\n if (n < 2) value = \"\";\n for (priority in name) this.style(priority, name[priority], value);\n return this;\n }\n priority = \"\";\n }\n function styleNull() {\n this.style.removeProperty(name);\n }\n function styleString(b) {\n return b == null ? styleNull : (b += \"\", function() {\n var a = d3_window(this).getComputedStyle(this, null).getPropertyValue(name), i;\n return a !== b && (i = d3_interpolate(a, b), function(t) {\n this.style.setProperty(name, i(t), priority);\n });\n });\n }\n return d3_transition_tween(this, \"style.\" + name, value, styleString);\n };\n d3_transitionPrototype.styleTween = function(name, tween, priority) {\n if (arguments.length < 3) priority = \"\";\n function styleTween(d, i) {\n var f = tween.call(this, d, i, d3_window(this).getComputedStyle(this, null).getPropertyValue(name));\n return f && function(t) {\n this.style.setProperty(name, f(t), priority);\n };\n }\n return this.tween(\"style.\" + name, styleTween);\n };\n d3_transitionPrototype.text = function(value) {\n return d3_transition_tween(this, \"text\", value, d3_transition_text);\n };\n function d3_transition_text(b) {\n if (b == null) b = \"\";\n return function() {\n this.textContent = b;\n };\n }\n d3_transitionPrototype.remove = function() {\n var ns = this.namespace;\n return this.each(\"end.transition\", function() {\n var p;\n if (this[ns].count < 2 && (p = this.parentNode)) p.removeChild(this);\n });\n };\n d3_transitionPrototype.ease = function(value) {\n var id = this.id, ns = this.namespace;\n if (arguments.length < 1) return this.node()[ns][id].ease;\n if (typeof value !== \"function\") value = d3.ease.apply(d3, arguments);\n return d3_selection_each(this, function(node) {\n node[ns][id].ease = value;\n });\n };\n d3_transitionPrototype.delay = function(value) {\n var id = this.id, ns = this.namespace;\n if (arguments.length < 1) return this.node()[ns][id].delay;\n return d3_selection_each(this, typeof value === \"function\" ? function(node, i, j) {\n node[ns][id].delay = +value.call(node, node.__data__, i, j);\n } : (value = +value, function(node) {\n node[ns][id].delay = value;\n }));\n };\n d3_transitionPrototype.duration = function(value) {\n var id = this.id, ns = this.namespace;\n if (arguments.length < 1) return this.node()[ns][id].duration;\n return d3_selection_each(this, typeof value === \"function\" ? function(node, i, j) {\n node[ns][id].duration = Math.max(1, value.call(node, node.__data__, i, j));\n } : (value = Math.max(1, value), function(node) {\n node[ns][id].duration = value;\n }));\n };\n d3_transitionPrototype.each = function(type, listener) {\n var id = this.id, ns = this.namespace;\n if (arguments.length < 2) {\n var inherit = d3_transitionInherit, inheritId = d3_transitionInheritId;\n try {\n d3_transitionInheritId = id;\n d3_selection_each(this, function(node, i, j) {\n d3_transitionInherit = node[ns][id];\n type.call(node, node.__data__, i, j);\n });\n } finally {\n d3_transitionInherit = inherit;\n d3_transitionInheritId = inheritId;\n }\n } else {\n d3_selection_each(this, function(node) {\n var transition = node[ns][id];\n (transition.event || (transition.event = d3.dispatch(\"start\", \"end\", \"interrupt\"))).on(type, listener);\n });\n }\n return this;\n };\n d3_transitionPrototype.transition = function() {\n var id0 = this.id, id1 = ++d3_transitionId, ns = this.namespace, subgroups = [], subgroup, group, node, transition;\n for (var j = 0, m = this.length; j < m; j++) {\n subgroups.push(subgroup = []);\n for (var group = this[j], i = 0, n = group.length; i < n; i++) {\n if (node = group[i]) {\n transition = node[ns][id0];\n d3_transitionNode(node, i, ns, id1, {\n time: transition.time,\n ease: transition.ease,\n delay: transition.delay + transition.duration,\n duration: transition.duration\n });\n }\n subgroup.push(node);\n }\n }\n return d3_transition(subgroups, ns, id1);\n };\n function d3_transitionNamespace(name) {\n return name == null ? \"__transition__\" : \"__transition_\" + name + \"__\";\n }\n function d3_transitionNode(node, i, ns, id, inherit) {\n var lock = node[ns] || (node[ns] = {\n active: 0,\n count: 0\n }), transition = lock[id], time, timer, duration, ease, tweens;\n function schedule(elapsed) {\n var delay = transition.delay;\n timer.t = delay + time;\n if (delay <= elapsed) return start(elapsed - delay);\n timer.c = start;\n }\n function start(elapsed) {\n var activeId = lock.active, active = lock[activeId];\n if (active) {\n active.timer.c = null;\n active.timer.t = NaN;\n --lock.count;\n delete lock[activeId];\n active.event && active.event.interrupt.call(node, node.__data__, active.index);\n }\n for (var cancelId in lock) {\n if (+cancelId < id) {\n var cancel = lock[cancelId];\n cancel.timer.c = null;\n cancel.timer.t = NaN;\n --lock.count;\n delete lock[cancelId];\n }\n }\n timer.c = tick;\n d3_timer(function() {\n if (timer.c && tick(elapsed || 1)) {\n timer.c = null;\n timer.t = NaN;\n }\n return 1;\n }, 0, time);\n lock.active = id;\n transition.event && transition.event.start.call(node, node.__data__, i);\n tweens = [];\n transition.tween.forEach(function(key, value) {\n if (value = value.call(node, node.__data__, i)) {\n tweens.push(value);\n }\n });\n ease = transition.ease;\n duration = transition.duration;\n }\n function tick(elapsed) {\n var t = elapsed / duration, e = ease(t), n = tweens.length;\n while (n > 0) {\n tweens[--n].call(node, e);\n }\n if (t >= 1) {\n transition.event && transition.event.end.call(node, node.__data__, i);\n if (--lock.count) delete lock[id]; else delete node[ns];\n return 1;\n }\n }\n if (!transition) {\n time = inherit.time;\n timer = d3_timer(schedule, 0, time);\n transition = lock[id] = {\n tween: new d3_Map(),\n time: time,\n timer: timer,\n delay: inherit.delay,\n duration: inherit.duration,\n ease: inherit.ease,\n index: i\n };\n inherit = null;\n ++lock.count;\n }\n }\n d3.svg.axis = function() {\n var scale = d3.scale.linear(), orient = d3_svg_axisDefaultOrient, innerTickSize = 6, outerTickSize = 6, tickPadding = 3, tickArguments_ = [ 10 ], tickValues = null, tickFormat_;\n function axis(g) {\n g.each(function() {\n var g = d3.select(this);\n var scale0 = this.__chart__ || scale, scale1 = this.__chart__ = scale.copy();\n var ticks = tickValues == null ? scale1.ticks ? scale1.ticks.apply(scale1, tickArguments_) : scale1.domain() : tickValues, tickFormat = tickFormat_ == null ? scale1.tickFormat ? scale1.tickFormat.apply(scale1, tickArguments_) : d3_identity : tickFormat_, tick = g.selectAll(\".tick\").data(ticks, scale1), tickEnter = tick.enter().insert(\"g\", \".domain\").attr(\"class\", \"tick\").style(\"opacity\", ε), tickExit = d3.transition(tick.exit()).style(\"opacity\", ε).remove(), tickUpdate = d3.transition(tick.order()).style(\"opacity\", 1), tickSpacing = Math.max(innerTickSize, 0) + tickPadding, tickTransform;\n var range = d3_scaleRange(scale1), path = g.selectAll(\".domain\").data([ 0 ]), pathUpdate = (path.enter().append(\"path\").attr(\"class\", \"domain\"), \n d3.transition(path));\n tickEnter.append(\"line\");\n tickEnter.append(\"text\");\n var lineEnter = tickEnter.select(\"line\"), lineUpdate = tickUpdate.select(\"line\"), text = tick.select(\"text\").text(tickFormat), textEnter = tickEnter.select(\"text\"), textUpdate = tickUpdate.select(\"text\"), sign = orient === \"top\" || orient === \"left\" ? -1 : 1, x1, x2, y1, y2;\n if (orient === \"bottom\" || orient === \"top\") {\n tickTransform = d3_svg_axisX, x1 = \"x\", y1 = \"y\", x2 = \"x2\", y2 = \"y2\";\n text.attr(\"dy\", sign < 0 ? \"0em\" : \".71em\").style(\"text-anchor\", \"middle\");\n pathUpdate.attr(\"d\", \"M\" + range[0] + \",\" + sign * outerTickSize + \"V0H\" + range[1] + \"V\" + sign * outerTickSize);\n } else {\n tickTransform = d3_svg_axisY, x1 = \"y\", y1 = \"x\", x2 = \"y2\", y2 = \"x2\";\n text.attr(\"dy\", \".32em\").style(\"text-anchor\", sign < 0 ? \"end\" : \"start\");\n pathUpdate.attr(\"d\", \"M\" + sign * outerTickSize + \",\" + range[0] + \"H0V\" + range[1] + \"H\" + sign * outerTickSize);\n }\n lineEnter.attr(y2, sign * innerTickSize);\n textEnter.attr(y1, sign * tickSpacing);\n lineUpdate.attr(x2, 0).attr(y2, sign * innerTickSize);\n textUpdate.attr(x1, 0).attr(y1, sign * tickSpacing);\n if (scale1.rangeBand) {\n var x = scale1, dx = x.rangeBand() / 2;\n scale0 = scale1 = function(d) {\n return x(d) + dx;\n };\n } else if (scale0.rangeBand) {\n scale0 = scale1;\n } else {\n tickExit.call(tickTransform, scale1, scale0);\n }\n tickEnter.call(tickTransform, scale0, scale1);\n tickUpdate.call(tickTransform, scale1, scale1);\n });\n }\n axis.scale = function(x) {\n if (!arguments.length) return scale;\n scale = x;\n return axis;\n };\n axis.orient = function(x) {\n if (!arguments.length) return orient;\n orient = x in d3_svg_axisOrients ? x + \"\" : d3_svg_axisDefaultOrient;\n return axis;\n };\n axis.ticks = function() {\n if (!arguments.length) return tickArguments_;\n tickArguments_ = d3_array(arguments);\n return axis;\n };\n axis.tickValues = function(x) {\n if (!arguments.length) return tickValues;\n tickValues = x;\n return axis;\n };\n axis.tickFormat = function(x) {\n if (!arguments.length) return tickFormat_;\n tickFormat_ = x;\n return axis;\n };\n axis.tickSize = function(x) {\n var n = arguments.length;\n if (!n) return innerTickSize;\n innerTickSize = +x;\n outerTickSize = +arguments[n - 1];\n return axis;\n };\n axis.innerTickSize = function(x) {\n if (!arguments.length) return innerTickSize;\n innerTickSize = +x;\n return axis;\n };\n axis.outerTickSize = function(x) {\n if (!arguments.length) return outerTickSize;\n outerTickSize = +x;\n return axis;\n };\n axis.tickPadding = function(x) {\n if (!arguments.length) return tickPadding;\n tickPadding = +x;\n return axis;\n };\n axis.tickSubdivide = function() {\n return arguments.length && axis;\n };\n return axis;\n };\n var d3_svg_axisDefaultOrient = \"bottom\", d3_svg_axisOrients = {\n top: 1,\n right: 1,\n bottom: 1,\n left: 1\n };\n function d3_svg_axisX(selection, x0, x1) {\n selection.attr(\"transform\", function(d) {\n var v0 = x0(d);\n return \"translate(\" + (isFinite(v0) ? v0 : x1(d)) + \",0)\";\n });\n }\n function d3_svg_axisY(selection, y0, y1) {\n selection.attr(\"transform\", function(d) {\n var v0 = y0(d);\n return \"translate(0,\" + (isFinite(v0) ? v0 : y1(d)) + \")\";\n });\n }\n d3.svg.brush = function() {\n var event = d3_eventDispatch(brush, \"brushstart\", \"brush\", \"brushend\"), x = null, y = null, xExtent = [ 0, 0 ], yExtent = [ 0, 0 ], xExtentDomain, yExtentDomain, xClamp = true, yClamp = true, resizes = d3_svg_brushResizes[0];\n function brush(g) {\n g.each(function() {\n var g = d3.select(this).style(\"pointer-events\", \"all\").style(\"-webkit-tap-highlight-color\", \"rgba(0,0,0,0)\").on(\"mousedown.brush\", brushstart).on(\"touchstart.brush\", brushstart);\n var background = g.selectAll(\".background\").data([ 0 ]);\n background.enter().append(\"rect\").attr(\"class\", \"background\").style(\"visibility\", \"hidden\").style(\"cursor\", \"crosshair\");\n g.selectAll(\".extent\").data([ 0 ]).enter().append(\"rect\").attr(\"class\", \"extent\").style(\"cursor\", \"move\");\n var resize = g.selectAll(\".resize\").data(resizes, d3_identity);\n resize.exit().remove();\n resize.enter().append(\"g\").attr(\"class\", function(d) {\n return \"resize \" + d;\n }).style(\"cursor\", function(d) {\n return d3_svg_brushCursor[d];\n }).append(\"rect\").attr(\"x\", function(d) {\n return /[ew]$/.test(d) ? -3 : null;\n }).attr(\"y\", function(d) {\n return /^[ns]/.test(d) ? -3 : null;\n }).attr(\"width\", 6).attr(\"height\", 6).style(\"visibility\", \"hidden\");\n resize.style(\"display\", brush.empty() ? \"none\" : null);\n var gUpdate = d3.transition(g), backgroundUpdate = d3.transition(background), range;\n if (x) {\n range = d3_scaleRange(x);\n backgroundUpdate.attr(\"x\", range[0]).attr(\"width\", range[1] - range[0]);\n redrawX(gUpdate);\n }\n if (y) {\n range = d3_scaleRange(y);\n backgroundUpdate.attr(\"y\", range[0]).attr(\"height\", range[1] - range[0]);\n redrawY(gUpdate);\n }\n redraw(gUpdate);\n });\n }\n brush.event = function(g) {\n g.each(function() {\n var event_ = event.of(this, arguments), extent1 = {\n x: xExtent,\n y: yExtent,\n i: xExtentDomain,\n j: yExtentDomain\n }, extent0 = this.__chart__ || extent1;\n this.__chart__ = extent1;\n if (d3_transitionInheritId) {\n d3.select(this).transition().each(\"start.brush\", function() {\n xExtentDomain = extent0.i;\n yExtentDomain = extent0.j;\n xExtent = extent0.x;\n yExtent = extent0.y;\n event_({\n type: \"brushstart\"\n });\n }).tween(\"brush:brush\", function() {\n var xi = d3_interpolateArray(xExtent, extent1.x), yi = d3_interpolateArray(yExtent, extent1.y);\n xExtentDomain = yExtentDomain = null;\n return function(t) {\n xExtent = extent1.x = xi(t);\n yExtent = extent1.y = yi(t);\n event_({\n type: \"brush\",\n mode: \"resize\"\n });\n };\n }).each(\"end.brush\", function() {\n xExtentDomain = extent1.i;\n yExtentDomain = extent1.j;\n event_({\n type: \"brush\",\n mode: \"resize\"\n });\n event_({\n type: \"brushend\"\n });\n });\n } else {\n event_({\n type: \"brushstart\"\n });\n event_({\n type: \"brush\",\n mode: \"resize\"\n });\n event_({\n type: \"brushend\"\n });\n }\n });\n };\n function redraw(g) {\n g.selectAll(\".resize\").attr(\"transform\", function(d) {\n return \"translate(\" + xExtent[+/e$/.test(d)] + \",\" + yExtent[+/^s/.test(d)] + \")\";\n });\n }\n function redrawX(g) {\n g.select(\".extent\").attr(\"x\", xExtent[0]);\n g.selectAll(\".extent,.n>rect,.s>rect\").attr(\"width\", xExtent[1] - xExtent[0]);\n }\n function redrawY(g) {\n g.select(\".extent\").attr(\"y\", yExtent[0]);\n g.selectAll(\".extent,.e>rect,.w>rect\").attr(\"height\", yExtent[1] - yExtent[0]);\n }\n function brushstart() {\n var target = this, eventTarget = d3.select(d3.event.target), event_ = event.of(target, arguments), g = d3.select(target), resizing = eventTarget.datum(), resizingX = !/^(n|s)$/.test(resizing) && x, resizingY = !/^(e|w)$/.test(resizing) && y, dragging = eventTarget.classed(\"extent\"), dragRestore = d3_event_dragSuppress(target), center, origin = d3.mouse(target), offset;\n var w = d3.select(d3_window(target)).on(\"keydown.brush\", keydown).on(\"keyup.brush\", keyup);\n if (d3.event.changedTouches) {\n w.on(\"touchmove.brush\", brushmove).on(\"touchend.brush\", brushend);\n } else {\n w.on(\"mousemove.brush\", brushmove).on(\"mouseup.brush\", brushend);\n }\n g.interrupt().selectAll(\"*\").interrupt();\n if (dragging) {\n origin[0] = xExtent[0] - origin[0];\n origin[1] = yExtent[0] - origin[1];\n } else if (resizing) {\n var ex = +/w$/.test(resizing), ey = +/^n/.test(resizing);\n offset = [ xExtent[1 - ex] - origin[0], yExtent[1 - ey] - origin[1] ];\n origin[0] = xExtent[ex];\n origin[1] = yExtent[ey];\n } else if (d3.event.altKey) center = origin.slice();\n g.style(\"pointer-events\", \"none\").selectAll(\".resize\").style(\"display\", null);\n d3.select(\"body\").style(\"cursor\", eventTarget.style(\"cursor\"));\n event_({\n type: \"brushstart\"\n });\n brushmove();\n function keydown() {\n if (d3.event.keyCode == 32) {\n if (!dragging) {\n center = null;\n origin[0] -= xExtent[1];\n origin[1] -= yExtent[1];\n dragging = 2;\n }\n d3_eventPreventDefault();\n }\n }\n function keyup() {\n if (d3.event.keyCode == 32 && dragging == 2) {\n origin[0] += xExtent[1];\n origin[1] += yExtent[1];\n dragging = 0;\n d3_eventPreventDefault();\n }\n }\n function brushmove() {\n var point = d3.mouse(target), moved = false;\n if (offset) {\n point[0] += offset[0];\n point[1] += offset[1];\n }\n if (!dragging) {\n if (d3.event.altKey) {\n if (!center) center = [ (xExtent[0] + xExtent[1]) / 2, (yExtent[0] + yExtent[1]) / 2 ];\n origin[0] = xExtent[+(point[0] < center[0])];\n origin[1] = yExtent[+(point[1] < center[1])];\n } else center = null;\n }\n if (resizingX && move1(point, x, 0)) {\n redrawX(g);\n moved = true;\n }\n if (resizingY && move1(point, y, 1)) {\n redrawY(g);\n moved = true;\n }\n if (moved) {\n redraw(g);\n event_({\n type: \"brush\",\n mode: dragging ? \"move\" : \"resize\"\n });\n }\n }\n function move1(point, scale, i) {\n var range = d3_scaleRange(scale), r0 = range[0], r1 = range[1], position = origin[i], extent = i ? yExtent : xExtent, size = extent[1] - extent[0], min, max;\n if (dragging) {\n r0 -= position;\n r1 -= size + position;\n }\n min = (i ? yClamp : xClamp) ? Math.max(r0, Math.min(r1, point[i])) : point[i];\n if (dragging) {\n max = (min += position) + size;\n } else {\n if (center) position = Math.max(r0, Math.min(r1, 2 * center[i] - min));\n if (position < min) {\n max = min;\n min = position;\n } else {\n max = position;\n }\n }\n if (extent[0] != min || extent[1] != max) {\n if (i) yExtentDomain = null; else xExtentDomain = null;\n extent[0] = min;\n extent[1] = max;\n return true;\n }\n }\n function brushend() {\n brushmove();\n g.style(\"pointer-events\", \"all\").selectAll(\".resize\").style(\"display\", brush.empty() ? \"none\" : null);\n d3.select(\"body\").style(\"cursor\", null);\n w.on(\"mousemove.brush\", null).on(\"mouseup.brush\", null).on(\"touchmove.brush\", null).on(\"touchend.brush\", null).on(\"keydown.brush\", null).on(\"keyup.brush\", null);\n dragRestore();\n event_({\n type: \"brushend\"\n });\n }\n }\n brush.x = function(z) {\n if (!arguments.length) return x;\n x = z;\n resizes = d3_svg_brushResizes[!x << 1 | !y];\n return brush;\n };\n brush.y = function(z) {\n if (!arguments.length) return y;\n y = z;\n resizes = d3_svg_brushResizes[!x << 1 | !y];\n return brush;\n };\n brush.clamp = function(z) {\n if (!arguments.length) return x && y ? [ xClamp, yClamp ] : x ? xClamp : y ? yClamp : null;\n if (x && y) xClamp = !!z[0], yClamp = !!z[1]; else if (x) xClamp = !!z; else if (y) yClamp = !!z;\n return brush;\n };\n brush.extent = function(z) {\n var x0, x1, y0, y1, t;\n if (!arguments.length) {\n if (x) {\n if (xExtentDomain) {\n x0 = xExtentDomain[0], x1 = xExtentDomain[1];\n } else {\n x0 = xExtent[0], x1 = xExtent[1];\n if (x.invert) x0 = x.invert(x0), x1 = x.invert(x1);\n if (x1 < x0) t = x0, x0 = x1, x1 = t;\n }\n }\n if (y) {\n if (yExtentDomain) {\n y0 = yExtentDomain[0], y1 = yExtentDomain[1];\n } else {\n y0 = yExtent[0], y1 = yExtent[1];\n if (y.invert) y0 = y.invert(y0), y1 = y.invert(y1);\n if (y1 < y0) t = y0, y0 = y1, y1 = t;\n }\n }\n return x && y ? [ [ x0, y0 ], [ x1, y1 ] ] : x ? [ x0, x1 ] : y && [ y0, y1 ];\n }\n if (x) {\n x0 = z[0], x1 = z[1];\n if (y) x0 = x0[0], x1 = x1[0];\n xExtentDomain = [ x0, x1 ];\n if (x.invert) x0 = x(x0), x1 = x(x1);\n if (x1 < x0) t = x0, x0 = x1, x1 = t;\n if (x0 != xExtent[0] || x1 != xExtent[1]) xExtent = [ x0, x1 ];\n }\n if (y) {\n y0 = z[0], y1 = z[1];\n if (x) y0 = y0[1], y1 = y1[1];\n yExtentDomain = [ y0, y1 ];\n if (y.invert) y0 = y(y0), y1 = y(y1);\n if (y1 < y0) t = y0, y0 = y1, y1 = t;\n if (y0 != yExtent[0] || y1 != yExtent[1]) yExtent = [ y0, y1 ];\n }\n return brush;\n };\n brush.clear = function() {\n if (!brush.empty()) {\n xExtent = [ 0, 0 ], yExtent = [ 0, 0 ];\n xExtentDomain = yExtentDomain = null;\n }\n return brush;\n };\n brush.empty = function() {\n return !!x && xExtent[0] == xExtent[1] || !!y && yExtent[0] == yExtent[1];\n };\n return d3.rebind(brush, event, \"on\");\n };\n var d3_svg_brushCursor = {\n n: \"ns-resize\",\n e: \"ew-resize\",\n s: \"ns-resize\",\n w: \"ew-resize\",\n nw: \"nwse-resize\",\n ne: \"nesw-resize\",\n se: \"nwse-resize\",\n sw: \"nesw-resize\"\n };\n var d3_svg_brushResizes = [ [ \"n\", \"e\", \"s\", \"w\", \"nw\", \"ne\", \"se\", \"sw\" ], [ \"e\", \"w\" ], [ \"n\", \"s\" ], [] ];\n var d3_time_format = d3_time.format = d3_locale_enUS.timeFormat;\n var d3_time_formatUtc = d3_time_format.utc;\n var d3_time_formatIso = d3_time_formatUtc(\"%Y-%m-%dT%H:%M:%S.%LZ\");\n d3_time_format.iso = Date.prototype.toISOString && +new Date(\"2000-01-01T00:00:00.000Z\") ? d3_time_formatIsoNative : d3_time_formatIso;\n function d3_time_formatIsoNative(date) {\n return date.toISOString();\n }\n d3_time_formatIsoNative.parse = function(string) {\n var date = new Date(string);\n return isNaN(date) ? null : date;\n };\n d3_time_formatIsoNative.toString = d3_time_formatIso.toString;\n d3_time.second = d3_time_interval(function(date) {\n return new d3_date(Math.floor(date / 1e3) * 1e3);\n }, function(date, offset) {\n date.setTime(date.getTime() + Math.floor(offset) * 1e3);\n }, function(date) {\n return date.getSeconds();\n });\n d3_time.seconds = d3_time.second.range;\n d3_time.seconds.utc = d3_time.second.utc.range;\n d3_time.minute = d3_time_interval(function(date) {\n return new d3_date(Math.floor(date / 6e4) * 6e4);\n }, function(date, offset) {\n date.setTime(date.getTime() + Math.floor(offset) * 6e4);\n }, function(date) {\n return date.getMinutes();\n });\n d3_time.minutes = d3_time.minute.range;\n d3_time.minutes.utc = d3_time.minute.utc.range;\n d3_time.hour = d3_time_interval(function(date) {\n var timezone = date.getTimezoneOffset() / 60;\n return new d3_date((Math.floor(date / 36e5 - timezone) + timezone) * 36e5);\n }, function(date, offset) {\n date.setTime(date.getTime() + Math.floor(offset) * 36e5);\n }, function(date) {\n return date.getHours();\n });\n d3_time.hours = d3_time.hour.range;\n d3_time.hours.utc = d3_time.hour.utc.range;\n d3_time.month = d3_time_interval(function(date) {\n date = d3_time.day(date);\n date.setDate(1);\n return date;\n }, function(date, offset) {\n date.setMonth(date.getMonth() + offset);\n }, function(date) {\n return date.getMonth();\n });\n d3_time.months = d3_time.month.range;\n d3_time.months.utc = d3_time.month.utc.range;\n function d3_time_scale(linear, methods, format) {\n function scale(x) {\n return linear(x);\n }\n scale.invert = function(x) {\n return d3_time_scaleDate(linear.invert(x));\n };\n scale.domain = function(x) {\n if (!arguments.length) return linear.domain().map(d3_time_scaleDate);\n linear.domain(x);\n return scale;\n };\n function tickMethod(extent, count) {\n var span = extent[1] - extent[0], target = span / count, i = d3.bisect(d3_time_scaleSteps, target);\n return i == d3_time_scaleSteps.length ? [ methods.year, d3_scale_linearTickRange(extent.map(function(d) {\n return d / 31536e6;\n }), count)[2] ] : !i ? [ d3_time_scaleMilliseconds, d3_scale_linearTickRange(extent, count)[2] ] : methods[target / d3_time_scaleSteps[i - 1] < d3_time_scaleSteps[i] / target ? i - 1 : i];\n }\n scale.nice = function(interval, skip) {\n var domain = scale.domain(), extent = d3_scaleExtent(domain), method = interval == null ? tickMethod(extent, 10) : typeof interval === \"number\" && tickMethod(extent, interval);\n if (method) interval = method[0], skip = method[1];\n function skipped(date) {\n return !isNaN(date) && !interval.range(date, d3_time_scaleDate(+date + 1), skip).length;\n }\n return scale.domain(d3_scale_nice(domain, skip > 1 ? {\n floor: function(date) {\n while (skipped(date = interval.floor(date))) date = d3_time_scaleDate(date - 1);\n return date;\n },\n ceil: function(date) {\n while (skipped(date = interval.ceil(date))) date = d3_time_scaleDate(+date + 1);\n return date;\n }\n } : interval));\n };\n scale.ticks = function(interval, skip) {\n var extent = d3_scaleExtent(scale.domain()), method = interval == null ? tickMethod(extent, 10) : typeof interval === \"number\" ? tickMethod(extent, interval) : !interval.range && [ {\n range: interval\n }, skip ];\n if (method) interval = method[0], skip = method[1];\n return interval.range(extent[0], d3_time_scaleDate(+extent[1] + 1), skip < 1 ? 1 : skip);\n };\n scale.tickFormat = function() {\n return format;\n };\n scale.copy = function() {\n return d3_time_scale(linear.copy(), methods, format);\n };\n return d3_scale_linearRebind(scale, linear);\n }\n function d3_time_scaleDate(t) {\n return new Date(t);\n }\n var d3_time_scaleSteps = [ 1e3, 5e3, 15e3, 3e4, 6e4, 3e5, 9e5, 18e5, 36e5, 108e5, 216e5, 432e5, 864e5, 1728e5, 6048e5, 2592e6, 7776e6, 31536e6 ];\n var d3_time_scaleLocalMethods = [ [ d3_time.second, 1 ], [ d3_time.second, 5 ], [ d3_time.second, 15 ], [ d3_time.second, 30 ], [ d3_time.minute, 1 ], [ d3_time.minute, 5 ], [ d3_time.minute, 15 ], [ d3_time.minute, 30 ], [ d3_time.hour, 1 ], [ d3_time.hour, 3 ], [ d3_time.hour, 6 ], [ d3_time.hour, 12 ], [ d3_time.day, 1 ], [ d3_time.day, 2 ], [ d3_time.week, 1 ], [ d3_time.month, 1 ], [ d3_time.month, 3 ], [ d3_time.year, 1 ] ];\n var d3_time_scaleLocalFormat = d3_time_format.multi([ [ \".%L\", function(d) {\n return d.getMilliseconds();\n } ], [ \":%S\", function(d) {\n return d.getSeconds();\n } ], [ \"%I:%M\", function(d) {\n return d.getMinutes();\n } ], [ \"%I %p\", function(d) {\n return d.getHours();\n } ], [ \"%a %d\", function(d) {\n return d.getDay() && d.getDate() != 1;\n } ], [ \"%b %d\", function(d) {\n return d.getDate() != 1;\n } ], [ \"%B\", function(d) {\n return d.getMonth();\n } ], [ \"%Y\", d3_true ] ]);\n var d3_time_scaleMilliseconds = {\n range: function(start, stop, step) {\n return d3.range(Math.ceil(start / step) * step, +stop, step).map(d3_time_scaleDate);\n },\n floor: d3_identity,\n ceil: d3_identity\n };\n d3_time_scaleLocalMethods.year = d3_time.year;\n d3_time.scale = function() {\n return d3_time_scale(d3.scale.linear(), d3_time_scaleLocalMethods, d3_time_scaleLocalFormat);\n };\n var d3_time_scaleUtcMethods = d3_time_scaleLocalMethods.map(function(m) {\n return [ m[0].utc, m[1] ];\n });\n var d3_time_scaleUtcFormat = d3_time_formatUtc.multi([ [ \".%L\", function(d) {\n return d.getUTCMilliseconds();\n } ], [ \":%S\", function(d) {\n return d.getUTCSeconds();\n } ], [ \"%I:%M\", function(d) {\n return d.getUTCMinutes();\n } ], [ \"%I %p\", function(d) {\n return d.getUTCHours();\n } ], [ \"%a %d\", function(d) {\n return d.getUTCDay() && d.getUTCDate() != 1;\n } ], [ \"%b %d\", function(d) {\n return d.getUTCDate() != 1;\n } ], [ \"%B\", function(d) {\n return d.getUTCMonth();\n } ], [ \"%Y\", d3_true ] ]);\n d3_time_scaleUtcMethods.year = d3_time.year.utc;\n d3_time.scale.utc = function() {\n return d3_time_scale(d3.scale.linear(), d3_time_scaleUtcMethods, d3_time_scaleUtcFormat);\n };\n d3.text = d3_xhrType(function(request) {\n return request.responseText;\n });\n d3.json = function(url, callback) {\n return d3_xhr(url, \"application/json\", d3_json, callback);\n };\n function d3_json(request) {\n return JSON.parse(request.responseText);\n }\n d3.html = function(url, callback) {\n return d3_xhr(url, \"text/html\", d3_html, callback);\n };\n function d3_html(request) {\n var range = d3_document.createRange();\n range.selectNode(d3_document.body);\n return range.createContextualFragment(request.responseText);\n }\n d3.xml = d3_xhrType(function(request) {\n return request.responseXML;\n });\n if (true) this.d3 = d3, !(__WEBPACK_AMD_DEFINE_FACTORY__ = (d3),\n\t\t__WEBPACK_AMD_DEFINE_RESULT__ = (typeof __WEBPACK_AMD_DEFINE_FACTORY__ === 'function' ?\n\t\t(__WEBPACK_AMD_DEFINE_FACTORY__.call(exports, __webpack_require__, exports, module)) :\n\t\t__WEBPACK_AMD_DEFINE_FACTORY__),\n\t\t__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__)); else {}\n}();\n\n//# sourceURL=webpack://SequenceServer/./node_modules/d3/d3.js?");
/***/ }),
/***/ "./node_modules/jquery/dist/jquery.js":
/*!********************************************!*\
!*** ./node_modules/jquery/dist/jquery.js ***!
\********************************************/
/***/ (function(module, exports) {
eval("var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!\n * jQuery JavaScript Library v2.1.4\n * http://jquery.com/\n *\n * Includes Sizzle.js\n * http://sizzlejs.com/\n *\n * Copyright 2005, 2014 jQuery Foundation, Inc. and other contributors\n * Released under the MIT license\n * http://jquery.org/license\n *\n * Date: 2015-04-28T16:01Z\n */\n\n(function( global, factory ) {\n\n\tif ( true && typeof module.exports === \"object\" ) {\n\t\t// For CommonJS and CommonJS-like environments where a proper `window`\n\t\t// is present, execute the factory and get jQuery.\n\t\t// For environments that do not have a `window` with a `document`\n\t\t// (such as Node.js), expose a factory as module.exports.\n\t\t// This accentuates the need for the creation of a real `window`.\n\t\t// e.g. var jQuery = require(\"jquery\")(window);\n\t\t// See ticket #14549 for more info.\n\t\tmodule.exports = global.document ?\n\t\t\tfactory( global, true ) :\n\t\t\tfunction( w ) {\n\t\t\t\tif ( !w.document ) {\n\t\t\t\t\tthrow new Error( \"jQuery requires a window with a document\" );\n\t\t\t\t}\n\t\t\t\treturn factory( w );\n\t\t\t};\n\t} else {\n\t\tfactory( global );\n\t}\n\n// Pass this if window is not defined yet\n}(typeof window !== \"undefined\" ? window : this, function( window, noGlobal ) {\n\n// Support: Firefox 18+\n// Can't be in strict mode, several libs including ASP.NET trace\n// the stack via arguments.caller.callee and Firefox dies if\n// you try to trace through \"use strict\" call chains. (#13335)\n//\n\nvar arr = [];\n\nvar slice = arr.slice;\n\nvar concat = arr.concat;\n\nvar push = arr.push;\n\nvar indexOf = arr.indexOf;\n\nvar class2type = {};\n\nvar toString = class2type.toString;\n\nvar hasOwn = class2type.hasOwnProperty;\n\nvar support = {};\n\n\n\nvar\n\t// Use the correct document accordingly with window argument (sandbox)\n\tdocument = window.document,\n\n\tversion = \"2.1.4\",\n\n\t// Define a local copy of jQuery\n\tjQuery = function( selector, context ) {\n\t\t// The jQuery object is actually just the init constructor 'enhanced'\n\t\t// Need init if jQuery is called (just allow error to be thrown if not included)\n\t\treturn new jQuery.fn.init( selector, context );\n\t},\n\n\t// Support: Android<4.1\n\t// Make sure we trim BOM and NBSP\n\trtrim = /^[\\s\\uFEFF\\xA0]+|[\\s\\uFEFF\\xA0]+$/g,\n\n\t// Matches dashed string for camelizing\n\trmsPrefix = /^-ms-/,\n\trdashAlpha = /-([\\da-z])/gi,\n\n\t// Used by jQuery.camelCase as callback to replace()\n\tfcamelCase = function( all, letter ) {\n\t\treturn letter.toUpperCase();\n\t};\n\njQuery.fn = jQuery.prototype = {\n\t// The current version of jQuery being used\n\tjquery: version,\n\n\tconstructor: jQuery,\n\n\t// Start with an empty selector\n\tselector: \"\",\n\n\t// The default length of a jQuery object is 0\n\tlength: 0,\n\n\ttoArray: function() {\n\t\treturn slice.call( this );\n\t},\n\n\t// Get the Nth element in the matched element set OR\n\t// Get the whole matched element set as a clean array\n\tget: function( num ) {\n\t\treturn num != null ?\n\n\t\t\t// Return just the one element from the set\n\t\t\t( num < 0 ? this[ num + this.length ] : this[ num ] ) :\n\n\t\t\t// Return all the elements in a clean array\n\t\t\tslice.call( this );\n\t},\n\n\t// Take an array of elements and push it onto the stack\n\t// (returning the new matched element set)\n\tpushStack: function( elems ) {\n\n\t\t// Build a new jQuery matched element set\n\t\tvar ret = jQuery.merge( this.constructor(), elems );\n\n\t\t// Add the old object onto the stack (as a reference)\n\t\tret.prevObject = this;\n\t\tret.context = this.context;\n\n\t\t// Return the newly-formed element set\n\t\treturn ret;\n\t},\n\n\t// Execute a callback for every element in the matched set.\n\t// (You can seed the arguments with an array of args, but this is\n\t// only used internally.)\n\teach: function( callback, args ) {\n\t\treturn jQuery.each( this, callback, args );\n\t},\n\n\tmap: function( callback ) {\n\t\treturn this.pushStack( jQuery.map(this, function( elem, i ) {\n\t\t\treturn callback.call( elem, i, elem );\n\t\t}));\n\t},\n\n\tslice: function() {\n\t\treturn this.pushStack( slice.apply( this, arguments ) );\n\t},\n\n\tfirst: function() {\n\t\treturn this.eq( 0 );\n\t},\n\n\tlast: function() {\n\t\treturn this.eq( -1 );\n\t},\n\n\teq: function( i ) {\n\t\tvar len = this.length,\n\t\t\tj = +i + ( i < 0 ? len : 0 );\n\t\treturn this.pushStack( j >= 0 && j < len ? [ this[j] ] : [] );\n\t},\n\n\tend: function() {\n\t\treturn this.prevObject || this.constructor(null);\n\t},\n\n\t// For internal use only.\n\t// Behaves like an Array's method, not like a jQuery method.\n\tpush: push,\n\tsort: arr.sort,\n\tsplice: arr.splice\n};\n\njQuery.extend = jQuery.fn.extend = function() {\n\tvar options, name, src, copy, copyIsArray, clone,\n\t\ttarget = arguments[0] || {},\n\t\ti = 1,\n\t\tlength = arguments.length,\n\t\tdeep = false;\n\n\t// Handle a deep copy situation\n\tif ( typeof target === \"boolean\" ) {\n\t\tdeep = target;\n\n\t\t// Skip the boolean and the target\n\t\ttarget = arguments[ i ] || {};\n\t\ti++;\n\t}\n\n\t// Handle case when target is a string or something (possible in deep copy)\n\tif ( typeof target !== \"object\" && !jQuery.isFunction(target) ) {\n\t\ttarget = {};\n\t}\n\n\t// Extend jQuery itself if only one argument is passed\n\tif ( i === length ) {\n\t\ttarget = this;\n\t\ti--;\n\t}\n\n\tfor ( ; i < length; i++ ) {\n\t\t// Only deal with non-null/undefined values\n\t\tif ( (options = arguments[ i ]) != null ) {\n\t\t\t// Extend the base object\n\t\t\tfor ( name in options ) {\n\t\t\t\tsrc = target[ name ];\n\t\t\t\tcopy = options[ name ];\n\n\t\t\t\t// Prevent never-ending loop\n\t\t\t\tif ( target === copy ) {\n\t\t\t\t\tcontinue;\n\t\t\t\t}\n\n\t\t\t\t// Recurse if we're merging plain objects or arrays\n\t\t\t\tif ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {\n\t\t\t\t\tif ( copyIsArray ) {\n\t\t\t\t\t\tcopyIsArray = false;\n\t\t\t\t\t\tclone = src && jQuery.isArray(src) ? src : [];\n\n\t\t\t\t\t} else {\n\t\t\t\t\t\tclone = src && jQuery.isPlainObject(src) ? src : {};\n\t\t\t\t\t}\n\n\t\t\t\t\t// Never move original objects, clone them\n\t\t\t\t\ttarget[ name ] = jQuery.extend( deep, clone, copy );\n\n\t\t\t\t// Don't bring in undefined values\n\t\t\t\t} else if ( copy !== undefined ) {\n\t\t\t\t\ttarget[ name ] = copy;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// Return the modified object\n\treturn target;\n};\n\njQuery.extend({\n\t// Unique for each copy of jQuery on the page\n\texpando: \"jQuery\" + ( version + Math.random() ).replace( /\\D/g, \"\" ),\n\n\t// Assume jQuery is ready without the ready module\n\tisReady: true,\n\n\terror: function( msg ) {\n\t\tthrow new Error( msg );\n\t},\n\n\tnoop: function() {},\n\n\tisFunction: function( obj ) {\n\t\treturn jQuery.type(obj) === \"function\";\n\t},\n\n\tisArray: Array.isArray,\n\n\tisWindow: function( obj ) {\n\t\treturn obj != null && obj === obj.window;\n\t},\n\n\tisNumeric: function( obj ) {\n\t\t// parseFloat NaNs numeric-cast false positives (null|true|false|\"\")\n\t\t// ...but misinterprets leading-number strings, particularly hex literals (\"0x...\")\n\t\t// subtraction forces infinities to NaN\n\t\t// adding 1 corrects loss of precision from parseFloat (#15100)\n\t\treturn !jQuery.isArray( obj ) && (obj - parseFloat( obj ) + 1) >= 0;\n\t},\n\n\tisPlainObject: function( obj ) {\n\t\t// Not plain objects:\n\t\t// - Any object or value whose internal [[Class]] property is not \"[object Object]\"\n\t\t// - DOM nodes\n\t\t// - window\n\t\tif ( jQuery.type( obj ) !== \"object\" || obj.nodeType || jQuery.isWindow( obj ) ) {\n\t\t\treturn false;\n\t\t}\n\n\t\tif ( obj.constructor &&\n\t\t\t\t!hasOwn.call( obj.constructor.prototype, \"isPrototypeOf\" ) ) {\n\t\t\treturn false;\n\t\t}\n\n\t\t// If the function hasn't returned already, we're confident that\n\t\t// |obj| is a plain object, created by {} or constructed with new Object\n\t\treturn true;\n\t},\n\n\tisEmptyObject: function( obj ) {\n\t\tvar name;\n\t\tfor ( name in obj ) {\n\t\t\treturn false;\n\t\t}\n\t\treturn true;\n\t},\n\n\ttype: function( obj ) {\n\t\tif ( obj == null ) {\n\t\t\treturn obj + \"\";\n\t\t}\n\t\t// Support: Android<4.0, iOS<6 (functionish RegExp)\n\t\treturn typeof obj === \"object\" || typeof obj === \"function\" ?\n\t\t\tclass2type[ toString.call(obj) ] || \"object\" :\n\t\t\ttypeof obj;\n\t},\n\n\t// Evaluates a script in a global context\n\tglobalEval: function( code ) {\n\t\tvar script,\n\t\t\tindirect = eval;\n\n\t\tcode = jQuery.trim( code );\n\n\t\tif ( code ) {\n\t\t\t// If the code includes a valid, prologue position\n\t\t\t// strict mode pragma, execute code by injecting a\n\t\t\t// script tag into the document.\n\t\t\tif ( code.indexOf(\"use strict\") === 1 ) {\n\t\t\t\tscript = document.createElement(\"script\");\n\t\t\t\tscript.text = code;\n\t\t\t\tdocument.head.appendChild( script ).parentNode.removeChild( script );\n\t\t\t} else {\n\t\t\t// Otherwise, avoid the DOM node creation, insertion\n\t\t\t// and removal by using an indirect global eval\n\t\t\t\tindirect( code );\n\t\t\t}\n\t\t}\n\t},\n\n\t// Convert dashed to camelCase; used by the css and data modules\n\t// Support: IE9-11+\n\t// Microsoft forgot to hump their vendor prefix (#9572)\n\tcamelCase: function( string ) {\n\t\treturn string.replace( rmsPrefix, \"ms-\" ).replace( rdashAlpha, fcamelCase );\n\t},\n\n\tnodeName: function( elem, name ) {\n\t\treturn elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();\n\t},\n\n\t// args is for internal usage only\n\teach: function( obj, callback, args ) {\n\t\tvar value,\n\t\t\ti = 0,\n\t\t\tlength = obj.length,\n\t\t\tisArray = isArraylike( obj );\n\n\t\tif ( args ) {\n\t\t\tif ( isArray ) {\n\t\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\t\tvalue = callback.apply( obj[ i ], args );\n\n\t\t\t\t\tif ( value === false ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tfor ( i in obj ) {\n\t\t\t\t\tvalue = callback.apply( obj[ i ], args );\n\n\t\t\t\t\tif ( value === false ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t// A special, fast, case for the most common use of each\n\t\t} else {\n\t\t\tif ( isArray ) {\n\t\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\t\tvalue = callback.call( obj[ i ], i, obj[ i ] );\n\n\t\t\t\t\tif ( value === false ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tfor ( i in obj ) {\n\t\t\t\t\tvalue = callback.call( obj[ i ], i, obj[ i ] );\n\n\t\t\t\t\tif ( value === false ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn obj;\n\t},\n\n\t// Support: Android<4.1\n\ttrim: function( text ) {\n\t\treturn text == null ?\n\t\t\t\"\" :\n\t\t\t( text + \"\" ).replace( rtrim, \"\" );\n\t},\n\n\t// results is for internal usage only\n\tmakeArray: function( arr, results ) {\n\t\tvar ret = results || [];\n\n\t\tif ( arr != null ) {\n\t\t\tif ( isArraylike( Object(arr) ) ) {\n\t\t\t\tjQuery.merge( ret,\n\t\t\t\t\ttypeof arr === \"string\" ?\n\t\t\t\t\t[ arr ] : arr\n\t\t\t\t);\n\t\t\t} else {\n\t\t\t\tpush.call( ret, arr );\n\t\t\t}\n\t\t}\n\n\t\treturn ret;\n\t},\n\n\tinArray: function( elem, arr, i ) {\n\t\treturn arr == null ? -1 : indexOf.call( arr, elem, i );\n\t},\n\n\tmerge: function( first, second ) {\n\t\tvar len = +second.length,\n\t\t\tj = 0,\n\t\t\ti = first.length;\n\n\t\tfor ( ; j < len; j++ ) {\n\t\t\tfirst[ i++ ] = second[ j ];\n\t\t}\n\n\t\tfirst.length = i;\n\n\t\treturn first;\n\t},\n\n\tgrep: function( elems, callback, invert ) {\n\t\tvar callbackInverse,\n\t\t\tmatches = [],\n\t\t\ti = 0,\n\t\t\tlength = elems.length,\n\t\t\tcallbackExpect = !invert;\n\n\t\t// Go through the array, only saving the items\n\t\t// that pass the validator function\n\t\tfor ( ; i < length; i++ ) {\n\t\t\tcallbackInverse = !callback( elems[ i ], i );\n\t\t\tif ( callbackInverse !== callbackExpect ) {\n\t\t\t\tmatches.push( elems[ i ] );\n\t\t\t}\n\t\t}\n\n\t\treturn matches;\n\t},\n\n\t// arg is for internal usage only\n\tmap: function( elems, callback, arg ) {\n\t\tvar value,\n\t\t\ti = 0,\n\t\t\tlength = elems.length,\n\t\t\tisArray = isArraylike( elems ),\n\t\t\tret = [];\n\n\t\t// Go through the array, translating each of the items to their new values\n\t\tif ( isArray ) {\n\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\tvalue = callback( elems[ i ], i, arg );\n\n\t\t\t\tif ( value != null ) {\n\t\t\t\t\tret.push( value );\n\t\t\t\t}\n\t\t\t}\n\n\t\t// Go through every key on the object,\n\t\t} else {\n\t\t\tfor ( i in elems ) {\n\t\t\t\tvalue = callback( elems[ i ], i, arg );\n\n\t\t\t\tif ( value != null ) {\n\t\t\t\t\tret.push( value );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Flatten any nested arrays\n\t\treturn concat.apply( [], ret );\n\t},\n\n\t// A global GUID counter for objects\n\tguid: 1,\n\n\t// Bind a function to a context, optionally partially applying any\n\t// arguments.\n\tproxy: function( fn, context ) {\n\t\tvar tmp, args, proxy;\n\n\t\tif ( typeof context === \"string\" ) {\n\t\t\ttmp = fn[ context ];\n\t\t\tcontext = fn;\n\t\t\tfn = tmp;\n\t\t}\n\n\t\t// Quick check to determine if target is callable, in the spec\n\t\t// this throws a TypeError, but we will just return undefined.\n\t\tif ( !jQuery.isFunction( fn ) ) {\n\t\t\treturn undefined;\n\t\t}\n\n\t\t// Simulated bind\n\t\targs = slice.call( arguments, 2 );\n\t\tproxy = function() {\n\t\t\treturn fn.apply( context || this, args.concat( slice.call( arguments ) ) );\n\t\t};\n\n\t\t// Set the guid of unique handler to the same of original handler, so it can be removed\n\t\tproxy.guid = fn.guid = fn.guid || jQuery.guid++;\n\n\t\treturn proxy;\n\t},\n\n\tnow: Date.now,\n\n\t// jQuery.support is not used in Core but other projects attach their\n\t// properties to it so it needs to exist.\n\tsupport: support\n});\n\n// Populate the class2type map\njQuery.each(\"Boolean Number String Function Array Date RegExp Object Error\".split(\" \"), function(i, name) {\n\tclass2type[ \"[object \" + name + \"]\" ] = name.toLowerCase();\n});\n\nfunction isArraylike( obj ) {\n\n\t// Support: iOS 8.2 (not reproducible in simulator)\n\t// `in` check used to prevent JIT error (gh-2145)\n\t// hasOwn isn't used here due to false negatives\n\t// regarding Nodelist length in IE\n\tvar length = \"length\" in obj && obj.length,\n\t\ttype = jQuery.type( obj );\n\n\tif ( type === \"function\" || jQuery.isWindow( obj ) ) {\n\t\treturn false;\n\t}\n\n\tif ( obj.nodeType === 1 && length ) {\n\t\treturn true;\n\t}\n\n\treturn type === \"array\" || length === 0 ||\n\t\ttypeof length === \"number\" && length > 0 && ( length - 1 ) in obj;\n}\nvar Sizzle =\n/*!\n * Sizzle CSS Selector Engine v2.2.0-pre\n * http://sizzlejs.com/\n *\n * Copyright 2008, 2014 jQuery Foundation, Inc. and other contributors\n * Released under the MIT license\n * http://jquery.org/license\n *\n * Date: 2014-12-16\n */\n(function( window ) {\n\nvar i,\n\tsupport,\n\tExpr,\n\tgetText,\n\tisXML,\n\ttokenize,\n\tcompile,\n\tselect,\n\toutermostContext,\n\tsortInput,\n\thasDuplicate,\n\n\t// Local document vars\n\tsetDocument,\n\tdocument,\n\tdocElem,\n\tdocumentIsHTML,\n\trbuggyQSA,\n\trbuggyMatches,\n\tmatches,\n\tcontains,\n\n\t// Instance-specific data\n\texpando = \"sizzle\" + 1 * new Date(),\n\tpreferredDoc = window.document,\n\tdirruns = 0,\n\tdone = 0,\n\tclassCache = createCache(),\n\ttokenCache = createCache(),\n\tcompilerCache = createCache(),\n\tsortOrder = function( a, b ) {\n\t\tif ( a === b ) {\n\t\t\thasDuplicate = true;\n\t\t}\n\t\treturn 0;\n\t},\n\n\t// General-purpose constants\n\tMAX_NEGATIVE = 1 << 31,\n\n\t// Instance methods\n\thasOwn = ({}).hasOwnProperty,\n\tarr = [],\n\tpop = arr.pop,\n\tpush_native = arr.push,\n\tpush = arr.push,\n\tslice = arr.slice,\n\t// Use a stripped-down indexOf as it's faster than native\n\t// http://jsperf.com/thor-indexof-vs-for/5\n\tindexOf = function( list, elem ) {\n\t\tvar i = 0,\n\t\t\tlen = list.length;\n\t\tfor ( ; i < len; i++ ) {\n\t\t\tif ( list[i] === elem ) {\n\t\t\t\treturn i;\n\t\t\t}\n\t\t}\n\t\treturn -1;\n\t},\n\n\tbooleans = \"checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped\",\n\n\t// Regular expressions\n\n\t// Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace\n\twhitespace = \"[\\\\x20\\\\t\\\\r\\\\n\\\\f]\",\n\t// http://www.w3.org/TR/css3-syntax/#characters\n\tcharacterEncoding = \"(?:\\\\\\\\.|[\\\\w-]|[^\\\\x00-\\\\xa0])+\",\n\n\t// Loosely modeled on CSS identifier characters\n\t// An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors\n\t// Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier\n\tidentifier = characterEncoding.replace( \"w\", \"w#\" ),\n\n\t// Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors\n\tattributes = \"\\\\[\" + whitespace + \"*(\" + characterEncoding + \")(?:\" + whitespace +\n\t\t// Operator (capture 2)\n\t\t\"*([*^$|!~]?=)\" + whitespace +\n\t\t// \"Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]\"\n\t\t\"*(?:'((?:\\\\\\\\.|[^\\\\\\\\'])*)'|\\\"((?:\\\\\\\\.|[^\\\\\\\\\\\"])*)\\\"|(\" + identifier + \"))|)\" + whitespace +\n\t\t\"*\\\\]\",\n\n\tpseudos = \":(\" + characterEncoding + \")(?:\\\\((\" +\n\t\t// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:\n\t\t// 1. quoted (capture 3; capture 4 or capture 5)\n\t\t\"('((?:\\\\\\\\.|[^\\\\\\\\'])*)'|\\\"((?:\\\\\\\\.|[^\\\\\\\\\\\"])*)\\\")|\" +\n\t\t// 2. simple (capture 6)\n\t\t\"((?:\\\\\\\\.|[^\\\\\\\\()[\\\\]]|\" + attributes + \")*)|\" +\n\t\t// 3. anything else (capture 2)\n\t\t\".*\" +\n\t\t\")\\\\)|)\",\n\n\t// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter\n\trwhitespace = new RegExp( whitespace + \"+\", \"g\" ),\n\trtrim = new RegExp( \"^\" + whitespace + \"+|((?:^|[^\\\\\\\\])(?:\\\\\\\\.)*)\" + whitespace + \"+$\", \"g\" ),\n\n\trcomma = new RegExp( \"^\" + whitespace + \"*,\" + whitespace + \"*\" ),\n\trcombinators = new RegExp( \"^\" + whitespace + \"*([>+~]|\" + whitespace + \")\" + whitespace + \"*\" ),\n\n\trattributeQuotes = new RegExp( \"=\" + whitespace + \"*([^\\\\]'\\\"]*?)\" + whitespace + \"*\\\\]\", \"g\" ),\n\n\trpseudo = new RegExp( pseudos ),\n\tridentifier = new RegExp( \"^\" + identifier + \"$\" ),\n\n\tmatchExpr = {\n\t\t\"ID\": new RegExp( \"^#(\" + characterEncoding + \")\" ),\n\t\t\"CLASS\": new RegExp( \"^\\\\.(\" + characterEncoding + \")\" ),\n\t\t\"TAG\": new RegExp( \"^(\" + characterEncoding.replace( \"w\", \"w*\" ) + \")\" ),\n\t\t\"ATTR\": new RegExp( \"^\" + attributes ),\n\t\t\"PSEUDO\": new RegExp( \"^\" + pseudos ),\n\t\t\"CHILD\": new RegExp( \"^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\\\(\" + whitespace +\n\t\t\t\"*(even|odd|(([+-]|)(\\\\d*)n|)\" + whitespace + \"*(?:([+-]|)\" + whitespace +\n\t\t\t\"*(\\\\d+)|))\" + whitespace + \"*\\\\)|)\", \"i\" ),\n\t\t\"bool\": new RegExp( \"^(?:\" + booleans + \")$\", \"i\" ),\n\t\t// For use in libraries implementing .is()\n\t\t// We use this for POS matching in `select`\n\t\t\"needsContext\": new RegExp( \"^\" + whitespace + \"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\\\(\" +\n\t\t\twhitespace + \"*((?:-\\\\d)?\\\\d*)\" + whitespace + \"*\\\\)|)(?=[^-]|$)\", \"i\" )\n\t},\n\n\trinputs = /^(?:input|select|textarea|button)$/i,\n\trheader = /^h\\d$/i,\n\n\trnative = /^[^{]+\\{\\s*\\[native \\w/,\n\n\t// Easily-parseable/retrievable ID or TAG or CLASS selectors\n\trquickExpr = /^(?:#([\\w-]+)|(\\w+)|\\.([\\w-]+))$/,\n\n\trsibling = /[+~]/,\n\trescape = /'|\\\\/g,\n\n\t// CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters\n\trunescape = new RegExp( \"\\\\\\\\([\\\\da-f]{1,6}\" + whitespace + \"?|(\" + whitespace + \")|.)\", \"ig\" ),\n\tfunescape = function( _, escaped, escapedWhitespace ) {\n\t\tvar high = \"0x\" + escaped - 0x10000;\n\t\t// NaN means non-codepoint\n\t\t// Support: Firefox<24\n\t\t// Workaround erroneous numeric interpretation of +\"0x\"\n\t\treturn high !== high || escapedWhitespace ?\n\t\t\tescaped :\n\t\t\thigh < 0 ?\n\t\t\t\t// BMP codepoint\n\t\t\t\tString.fromCharCode( high + 0x10000 ) :\n\t\t\t\t// Supplemental Plane codepoint (surrogate pair)\n\t\t\t\tString.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );\n\t},\n\n\t// Used for iframes\n\t// See setDocument()\n\t// Removing the function wrapper causes a \"Permission Denied\"\n\t// error in IE\n\tunloadHandler = function() {\n\t\tsetDocument();\n\t};\n\n// Optimize for push.apply( _, NodeList )\ntry {\n\tpush.apply(\n\t\t(arr = slice.call( preferredDoc.childNodes )),\n\t\tpreferredDoc.childNodes\n\t);\n\t// Support: Android<4.0\n\t// Detect silently failing push.apply\n\tarr[ preferredDoc.childNodes.length ].nodeType;\n} catch ( e ) {\n\tpush = { apply: arr.length ?\n\n\t\t// Leverage slice if possible\n\t\tfunction( target, els ) {\n\t\t\tpush_native.apply( target, slice.call(els) );\n\t\t} :\n\n\t\t// Support: IE<9\n\t\t// Otherwise append directly\n\t\tfunction( target, els ) {\n\t\t\tvar j = target.length,\n\t\t\t\ti = 0;\n\t\t\t// Can't trust NodeList.length\n\t\t\twhile ( (target[j++] = els[i++]) ) {}\n\t\t\ttarget.length = j - 1;\n\t\t}\n\t};\n}\n\nfunction Sizzle( selector, context, results, seed ) {\n\tvar match, elem, m, nodeType,\n\t\t// QSA vars\n\t\ti, groups, old, nid, newContext, newSelector;\n\n\tif ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) {\n\t\tsetDocument( context );\n\t}\n\n\tcontext = context || document;\n\tresults = results || [];\n\tnodeType = context.nodeType;\n\n\tif ( typeof selector !== \"string\" || !selector ||\n\t\tnodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {\n\n\t\treturn results;\n\t}\n\n\tif ( !seed && documentIsHTML ) {\n\n\t\t// Try to shortcut find operations when possible (e.g., not under DocumentFragment)\n\t\tif ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) {\n\t\t\t// Speed-up: Sizzle(\"#ID\")\n\t\t\tif ( (m = match[1]) ) {\n\t\t\t\tif ( nodeType === 9 ) {\n\t\t\t\t\telem = context.getElementById( m );\n\t\t\t\t\t// Check parentNode to catch when Blackberry 4.6 returns\n\t\t\t\t\t// nodes that are no longer in the document (jQuery #6963)\n\t\t\t\t\tif ( elem && elem.parentNode ) {\n\t\t\t\t\t\t// Handle the case where IE, Opera, and Webkit return items\n\t\t\t\t\t\t// by name instead of ID\n\t\t\t\t\t\tif ( elem.id === m ) {\n\t\t\t\t\t\t\tresults.push( elem );\n\t\t\t\t\t\t\treturn results;\n\t\t\t\t\t\t}\n\t\t\t\t\t} else {\n\t\t\t\t\t\treturn results;\n\t\t\t\t\t}\n\t\t\t\t} else {\n\t\t\t\t\t// Context is not a document\n\t\t\t\t\tif ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) &&\n\t\t\t\t\t\tcontains( context, elem ) && elem.id === m ) {\n\t\t\t\t\t\tresults.push( elem );\n\t\t\t\t\t\treturn results;\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t// Speed-up: Sizzle(\"TAG\")\n\t\t\t} else if ( match[2] ) {\n\t\t\t\tpush.apply( results, context.getElementsByTagName( selector ) );\n\t\t\t\treturn results;\n\n\t\t\t// Speed-up: Sizzle(\".CLASS\")\n\t\t\t} else if ( (m = match[3]) && support.getElementsByClassName ) {\n\t\t\t\tpush.apply( results, context.getElementsByClassName( m ) );\n\t\t\t\treturn results;\n\t\t\t}\n\t\t}\n\n\t\t// QSA path\n\t\tif ( support.qsa && (!rbuggyQSA || !rbuggyQSA.test( selector )) ) {\n\t\t\tnid = old = expando;\n\t\t\tnewContext = context;\n\t\t\tnewSelector = nodeType !== 1 && selector;\n\n\t\t\t// qSA works strangely on Element-rooted queries\n\t\t\t// We can work around this by specifying an extra ID on the root\n\t\t\t// and working up from there (Thanks to Andrew Dupont for the technique)\n\t\t\t// IE 8 doesn't work on object elements\n\t\t\tif ( nodeType === 1 && context.nodeName.toLowerCase() !== \"object\" ) {\n\t\t\t\tgroups = tokenize( selector );\n\n\t\t\t\tif ( (old = context.getAttribute(\"id\")) ) {\n\t\t\t\t\tnid = old.replace( rescape, \"\\\\$&\" );\n\t\t\t\t} else {\n\t\t\t\t\tcontext.setAttribute( \"id\", nid );\n\t\t\t\t}\n\t\t\t\tnid = \"[id='\" + nid + \"'] \";\n\n\t\t\t\ti = groups.length;\n\t\t\t\twhile ( i-- ) {\n\t\t\t\t\tgroups[i] = nid + toSelector( groups[i] );\n\t\t\t\t}\n\t\t\t\tnewContext = rsibling.test( selector ) && testContext( context.parentNode ) || context;\n\t\t\t\tnewSelector = groups.join(\",\");\n\t\t\t}\n\n\t\t\tif ( newSelector ) {\n\t\t\t\ttry {\n\t\t\t\t\tpush.apply( results,\n\t\t\t\t\t\tnewContext.querySelectorAll( newSelector )\n\t\t\t\t\t);\n\t\t\t\t\treturn results;\n\t\t\t\t} catch(qsaError) {\n\t\t\t\t} finally {\n\t\t\t\t\tif ( !old ) {\n\t\t\t\t\t\tcontext.removeAttribute(\"id\");\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// All others\n\treturn select( selector.replace( rtrim, \"$1\" ), context, results, seed );\n}\n\n/**\n * Create key-value caches of limited size\n * @returns {Function(string, Object)} Returns the Object data after storing it on itself with\n *\tproperty name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)\n *\tdeleting the oldest entry\n */\nfunction createCache() {\n\tvar keys = [];\n\n\tfunction cache( key, value ) {\n\t\t// Use (key + \" \") to avoid collision with native prototype properties (see Issue #157)\n\t\tif ( keys.push( key + \" \" ) > Expr.cacheLength ) {\n\t\t\t// Only keep the most recent entries\n\t\t\tdelete cache[ keys.shift() ];\n\t\t}\n\t\treturn (cache[ key + \" \" ] = value);\n\t}\n\treturn cache;\n}\n\n/**\n * Mark a function for special use by Sizzle\n * @param {Function} fn The function to mark\n */\nfunction markFunction( fn ) {\n\tfn[ expando ] = true;\n\treturn fn;\n}\n\n/**\n * Support testing using an element\n * @param {Function} fn Passed the created div and expects a boolean result\n */\nfunction assert( fn ) {\n\tvar div = document.createElement(\"div\");\n\n\ttry {\n\t\treturn !!fn( div );\n\t} catch (e) {\n\t\treturn false;\n\t} finally {\n\t\t// Remove from its parent by default\n\t\tif ( div.parentNode ) {\n\t\t\tdiv.parentNode.removeChild( div );\n\t\t}\n\t\t// release memory in IE\n\t\tdiv = null;\n\t}\n}\n\n/**\n * Adds the same handler for all of the specified attrs\n * @param {String} attrs Pipe-separated list of attributes\n * @param {Function} handler The method that will be applied\n */\nfunction addHandle( attrs, handler ) {\n\tvar arr = attrs.split(\"|\"),\n\t\ti = attrs.length;\n\n\twhile ( i-- ) {\n\t\tExpr.attrHandle[ arr[i] ] = handler;\n\t}\n}\n\n/**\n * Checks document order of two siblings\n * @param {Element} a\n * @param {Element} b\n * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b\n */\nfunction siblingCheck( a, b ) {\n\tvar cur = b && a,\n\t\tdiff = cur && a.nodeType === 1 && b.nodeType === 1 &&\n\t\t\t( ~b.sourceIndex || MAX_NEGATIVE ) -\n\t\t\t( ~a.sourceIndex || MAX_NEGATIVE );\n\n\t// Use IE sourceIndex if available on both nodes\n\tif ( diff ) {\n\t\treturn diff;\n\t}\n\n\t// Check if b follows a\n\tif ( cur ) {\n\t\twhile ( (cur = cur.nextSibling) ) {\n\t\t\tif ( cur === b ) {\n\t\t\t\treturn -1;\n\t\t\t}\n\t\t}\n\t}\n\n\treturn a ? 1 : -1;\n}\n\n/**\n * Returns a function to use in pseudos for input types\n * @param {String} type\n */\nfunction createInputPseudo( type ) {\n\treturn function( elem ) {\n\t\tvar name = elem.nodeName.toLowerCase();\n\t\treturn name === \"input\" && elem.type === type;\n\t};\n}\n\n/**\n * Returns a function to use in pseudos for buttons\n * @param {String} type\n */\nfunction createButtonPseudo( type ) {\n\treturn function( elem ) {\n\t\tvar name = elem.nodeName.toLowerCase();\n\t\treturn (name === \"input\" || name === \"button\") && elem.type === type;\n\t};\n}\n\n/**\n * Returns a function to use in pseudos for positionals\n * @param {Function} fn\n */\nfunction createPositionalPseudo( fn ) {\n\treturn markFunction(function( argument ) {\n\t\targument = +argument;\n\t\treturn markFunction(function( seed, matches ) {\n\t\t\tvar j,\n\t\t\t\tmatchIndexes = fn( [], seed.length, argument ),\n\t\t\t\ti = matchIndexes.length;\n\n\t\t\t// Match elements found at the specified indexes\n\t\t\twhile ( i-- ) {\n\t\t\t\tif ( seed[ (j = matchIndexes[i]) ] ) {\n\t\t\t\t\tseed[j] = !(matches[j] = seed[j]);\n\t\t\t\t}\n\t\t\t}\n\t\t});\n\t});\n}\n\n/**\n * Checks a node for validity as a Sizzle context\n * @param {Element|Object=} context\n * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value\n */\nfunction testContext( context ) {\n\treturn context && typeof context.getElementsByTagName !== \"undefined\" && context;\n}\n\n// Expose support vars for convenience\nsupport = Sizzle.support = {};\n\n/**\n * Detects XML nodes\n * @param {Element|Object} elem An element or a document\n * @returns {Boolean} True iff elem is a non-HTML XML node\n */\nisXML = Sizzle.isXML = function( elem ) {\n\t// documentElement is verified for cases where it doesn't yet exist\n\t// (such as loading iframes in IE - #4833)\n\tvar documentElement = elem && (elem.ownerDocument || elem).documentElement;\n\treturn documentElement ? documentElement.nodeName !== \"HTML\" : false;\n};\n\n/**\n * Sets document-related variables once based on the current document\n * @param {Element|Object} [doc] An element or document object to use to set the document\n * @returns {Object} Returns the current document\n */\nsetDocument = Sizzle.setDocument = function( node ) {\n\tvar hasCompare, parent,\n\t\tdoc = node ? node.ownerDocument || node : preferredDoc;\n\n\t// If no document and documentElement is available, return\n\tif ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) {\n\t\treturn document;\n\t}\n\n\t// Set our document\n\tdocument = doc;\n\tdocElem = doc.documentElement;\n\tparent = doc.defaultView;\n\n\t// Support: IE>8\n\t// If iframe document is assigned to \"document\" variable and if iframe has been reloaded,\n\t// IE will throw \"permission denied\" error when accessing \"document\" variable, see jQuery #13936\n\t// IE6-8 do not support the defaultView property so parent will be undefined\n\tif ( parent && parent !== parent.top ) {\n\t\t// IE11 does not have attachEvent, so all must suffer\n\t\tif ( parent.addEventListener ) {\n\t\t\tparent.addEventListener( \"unload\", unloadHandler, false );\n\t\t} else if ( parent.attachEvent ) {\n\t\t\tparent.attachEvent( \"onunload\", unloadHandler );\n\t\t}\n\t}\n\n\t/* Support tests\n\t---------------------------------------------------------------------- */\n\tdocumentIsHTML = !isXML( doc );\n\n\t/* Attributes\n\t---------------------------------------------------------------------- */\n\n\t// Support: IE<8\n\t// Verify that getAttribute really returns attributes and not properties\n\t// (excepting IE8 booleans)\n\tsupport.attributes = assert(function( div ) {\n\t\tdiv.className = \"i\";\n\t\treturn !div.getAttribute(\"className\");\n\t});\n\n\t/* getElement(s)By*\n\t---------------------------------------------------------------------- */\n\n\t// Check if getElementsByTagName(\"*\") returns only elements\n\tsupport.getElementsByTagName = assert(function( div ) {\n\t\tdiv.appendChild( doc.createComment(\"\") );\n\t\treturn !div.getElementsByTagName(\"*\").length;\n\t});\n\n\t// Support: IE<9\n\tsupport.getElementsByClassName = rnative.test( doc.getElementsByClassName );\n\n\t// Support: IE<10\n\t// Check if getElementById returns elements by name\n\t// The broken getElementById methods don't pick up programatically-set names,\n\t// so use a roundabout getElementsByName test\n\tsupport.getById = assert(function( div ) {\n\t\tdocElem.appendChild( div ).id = expando;\n\t\treturn !doc.getElementsByName || !doc.getElementsByName( expando ).length;\n\t});\n\n\t// ID find and filter\n\tif ( support.getById ) {\n\t\tExpr.find[\"ID\"] = function( id, context ) {\n\t\t\tif ( typeof context.getElementById !== \"undefined\" && documentIsHTML ) {\n\t\t\t\tvar m = context.getElementById( id );\n\t\t\t\t// Check parentNode to catch when Blackberry 4.6 returns\n\t\t\t\t// nodes that are no longer in the document #6963\n\t\t\t\treturn m && m.parentNode ? [ m ] : [];\n\t\t\t}\n\t\t};\n\t\tExpr.filter[\"ID\"] = function( id ) {\n\t\t\tvar attrId = id.replace( runescape, funescape );\n\t\t\treturn function( elem ) {\n\t\t\t\treturn elem.getAttribute(\"id\") === attrId;\n\t\t\t};\n\t\t};\n\t} else {\n\t\t// Support: IE6/7\n\t\t// getElementById is not reliable as a find shortcut\n\t\tdelete Expr.find[\"ID\"];\n\n\t\tExpr.filter[\"ID\"] = function( id ) {\n\t\t\tvar attrId = id.replace( runescape, funescape );\n\t\t\treturn function( elem ) {\n\t\t\t\tvar node = typeof elem.getAttributeNode !== \"undefined\" && elem.getAttributeNode(\"id\");\n\t\t\t\treturn node && node.value === attrId;\n\t\t\t};\n\t\t};\n\t}\n\n\t// Tag\n\tExpr.find[\"TAG\"] = support.getElementsByTagName ?\n\t\tfunction( tag, context ) {\n\t\t\tif ( typeof context.getElementsByTagName !== \"undefined\" ) {\n\t\t\t\treturn context.getElementsByTagName( tag );\n\n\t\t\t// DocumentFragment nodes don't have gEBTN\n\t\t\t} else if ( support.qsa ) {\n\t\t\t\treturn context.querySelectorAll( tag );\n\t\t\t}\n\t\t} :\n\n\t\tfunction( tag, context ) {\n\t\t\tvar elem,\n\t\t\t\ttmp = [],\n\t\t\t\ti = 0,\n\t\t\t\t// By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too\n\t\t\t\tresults = context.getElementsByTagName( tag );\n\n\t\t\t// Filter out possible comments\n\t\t\tif ( tag === \"*\" ) {\n\t\t\t\twhile ( (elem = results[i++]) ) {\n\t\t\t\t\tif ( elem.nodeType === 1 ) {\n\t\t\t\t\t\ttmp.push( elem );\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\treturn tmp;\n\t\t\t}\n\t\t\treturn results;\n\t\t};\n\n\t// Class\n\tExpr.find[\"CLASS\"] = support.getElementsByClassName && function( className, context ) {\n\t\tif ( documentIsHTML ) {\n\t\t\treturn context.getElementsByClassName( className );\n\t\t}\n\t};\n\n\t/* QSA/matchesSelector\n\t---------------------------------------------------------------------- */\n\n\t// QSA and matchesSelector support\n\n\t// matchesSelector(:active) reports false when true (IE9/Opera 11.5)\n\trbuggyMatches = [];\n\n\t// qSa(:focus) reports false when true (Chrome 21)\n\t// We allow this because of a bug in IE8/9 that throws an error\n\t// whenever `document.activeElement` is accessed on an iframe\n\t// So, we allow :focus to pass through QSA all the time to avoid the IE error\n\t// See http://bugs.jquery.com/ticket/13378\n\trbuggyQSA = [];\n\n\tif ( (support.qsa = rnative.test( doc.querySelectorAll )) ) {\n\t\t// Build QSA regex\n\t\t// Regex strategy adopted from Diego Perini\n\t\tassert(function( div ) {\n\t\t\t// Select is set to empty string on purpose\n\t\t\t// This is to test IE's treatment of not explicitly\n\t\t\t// setting a boolean content attribute,\n\t\t\t// since its presence should be enough\n\t\t\t// http://bugs.jquery.com/ticket/12359\n\t\t\tdocElem.appendChild( div ).innerHTML = \"\" +\n\t\t\t\t\"\";\n\n\t\t\t// Support: IE8, Opera 11-12.16\n\t\t\t// Nothing should be selected when empty strings follow ^= or $= or *=\n\t\t\t// The test attribute must be unknown in Opera but \"safe\" for WinRT\n\t\t\t// http://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section\n\t\t\tif ( div.querySelectorAll(\"[msallowcapture^='']\").length ) {\n\t\t\t\trbuggyQSA.push( \"[*^$]=\" + whitespace + \"*(?:''|\\\"\\\")\" );\n\t\t\t}\n\n\t\t\t// Support: IE8\n\t\t\t// Boolean attributes and \"value\" are not treated correctly\n\t\t\tif ( !div.querySelectorAll(\"[selected]\").length ) {\n\t\t\t\trbuggyQSA.push( \"\\\\[\" + whitespace + \"*(?:value|\" + booleans + \")\" );\n\t\t\t}\n\n\t\t\t// Support: Chrome<29, Android<4.2+, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.7+\n\t\t\tif ( !div.querySelectorAll( \"[id~=\" + expando + \"-]\" ).length ) {\n\t\t\t\trbuggyQSA.push(\"~=\");\n\t\t\t}\n\n\t\t\t// Webkit/Opera - :checked should return selected option elements\n\t\t\t// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked\n\t\t\t// IE8 throws error here and will not see later tests\n\t\t\tif ( !div.querySelectorAll(\":checked\").length ) {\n\t\t\t\trbuggyQSA.push(\":checked\");\n\t\t\t}\n\n\t\t\t// Support: Safari 8+, iOS 8+\n\t\t\t// https://bugs.webkit.org/show_bug.cgi?id=136851\n\t\t\t// In-page `selector#id sibing-combinator selector` fails\n\t\t\tif ( !div.querySelectorAll( \"a#\" + expando + \"+*\" ).length ) {\n\t\t\t\trbuggyQSA.push(\".#.+[+~]\");\n\t\t\t}\n\t\t});\n\n\t\tassert(function( div ) {\n\t\t\t// Support: Windows 8 Native Apps\n\t\t\t// The type and name attributes are restricted during .innerHTML assignment\n\t\t\tvar input = doc.createElement(\"input\");\n\t\t\tinput.setAttribute( \"type\", \"hidden\" );\n\t\t\tdiv.appendChild( input ).setAttribute( \"name\", \"D\" );\n\n\t\t\t// Support: IE8\n\t\t\t// Enforce case-sensitivity of name attribute\n\t\t\tif ( div.querySelectorAll(\"[name=d]\").length ) {\n\t\t\t\trbuggyQSA.push( \"name\" + whitespace + \"*[*^$|!~]?=\" );\n\t\t\t}\n\n\t\t\t// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)\n\t\t\t// IE8 throws error here and will not see later tests\n\t\t\tif ( !div.querySelectorAll(\":enabled\").length ) {\n\t\t\t\trbuggyQSA.push( \":enabled\", \":disabled\" );\n\t\t\t}\n\n\t\t\t// Opera 10-11 does not throw on post-comma invalid pseudos\n\t\t\tdiv.querySelectorAll(\"*,:x\");\n\t\t\trbuggyQSA.push(\",.*:\");\n\t\t});\n\t}\n\n\tif ( (support.matchesSelector = rnative.test( (matches = docElem.matches ||\n\t\tdocElem.webkitMatchesSelector ||\n\t\tdocElem.mozMatchesSelector ||\n\t\tdocElem.oMatchesSelector ||\n\t\tdocElem.msMatchesSelector) )) ) {\n\n\t\tassert(function( div ) {\n\t\t\t// Check to see if it's possible to do matchesSelector\n\t\t\t// on a disconnected node (IE 9)\n\t\t\tsupport.disconnectedMatch = matches.call( div, \"div\" );\n\n\t\t\t// This should fail with an exception\n\t\t\t// Gecko does not error, returns false instead\n\t\t\tmatches.call( div, \"[s!='']:x\" );\n\t\t\trbuggyMatches.push( \"!=\", pseudos );\n\t\t});\n\t}\n\n\trbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join(\"|\") );\n\trbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join(\"|\") );\n\n\t/* Contains\n\t---------------------------------------------------------------------- */\n\thasCompare = rnative.test( docElem.compareDocumentPosition );\n\n\t// Element contains another\n\t// Purposefully does not implement inclusive descendent\n\t// As in, an element does not contain itself\n\tcontains = hasCompare || rnative.test( docElem.contains ) ?\n\t\tfunction( a, b ) {\n\t\t\tvar adown = a.nodeType === 9 ? a.documentElement : a,\n\t\t\t\tbup = b && b.parentNode;\n\t\t\treturn a === bup || !!( bup && bup.nodeType === 1 && (\n\t\t\t\tadown.contains ?\n\t\t\t\t\tadown.contains( bup ) :\n\t\t\t\t\ta.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16\n\t\t\t));\n\t\t} :\n\t\tfunction( a, b ) {\n\t\t\tif ( b ) {\n\t\t\t\twhile ( (b = b.parentNode) ) {\n\t\t\t\t\tif ( b === a ) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn false;\n\t\t};\n\n\t/* Sorting\n\t---------------------------------------------------------------------- */\n\n\t// Document order sorting\n\tsortOrder = hasCompare ?\n\tfunction( a, b ) {\n\n\t\t// Flag for duplicate removal\n\t\tif ( a === b ) {\n\t\t\thasDuplicate = true;\n\t\t\treturn 0;\n\t\t}\n\n\t\t// Sort on method existence if only one input has compareDocumentPosition\n\t\tvar compare = !a.compareDocumentPosition - !b.compareDocumentPosition;\n\t\tif ( compare ) {\n\t\t\treturn compare;\n\t\t}\n\n\t\t// Calculate position if both inputs belong to the same document\n\t\tcompare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ?\n\t\t\ta.compareDocumentPosition( b ) :\n\n\t\t\t// Otherwise we know they are disconnected\n\t\t\t1;\n\n\t\t// Disconnected nodes\n\t\tif ( compare & 1 ||\n\t\t\t(!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) {\n\n\t\t\t// Choose the first element that is related to our preferred document\n\t\t\tif ( a === doc || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) {\n\t\t\t\treturn -1;\n\t\t\t}\n\t\t\tif ( b === doc || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) {\n\t\t\t\treturn 1;\n\t\t\t}\n\n\t\t\t// Maintain original order\n\t\t\treturn sortInput ?\n\t\t\t\t( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :\n\t\t\t\t0;\n\t\t}\n\n\t\treturn compare & 4 ? -1 : 1;\n\t} :\n\tfunction( a, b ) {\n\t\t// Exit early if the nodes are identical\n\t\tif ( a === b ) {\n\t\t\thasDuplicate = true;\n\t\t\treturn 0;\n\t\t}\n\n\t\tvar cur,\n\t\t\ti = 0,\n\t\t\taup = a.parentNode,\n\t\t\tbup = b.parentNode,\n\t\t\tap = [ a ],\n\t\t\tbp = [ b ];\n\n\t\t// Parentless nodes are either documents or disconnected\n\t\tif ( !aup || !bup ) {\n\t\t\treturn a === doc ? -1 :\n\t\t\t\tb === doc ? 1 :\n\t\t\t\taup ? -1 :\n\t\t\t\tbup ? 1 :\n\t\t\t\tsortInput ?\n\t\t\t\t( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :\n\t\t\t\t0;\n\n\t\t// If the nodes are siblings, we can do a quick check\n\t\t} else if ( aup === bup ) {\n\t\t\treturn siblingCheck( a, b );\n\t\t}\n\n\t\t// Otherwise we need full lists of their ancestors for comparison\n\t\tcur = a;\n\t\twhile ( (cur = cur.parentNode) ) {\n\t\t\tap.unshift( cur );\n\t\t}\n\t\tcur = b;\n\t\twhile ( (cur = cur.parentNode) ) {\n\t\t\tbp.unshift( cur );\n\t\t}\n\n\t\t// Walk down the tree looking for a discrepancy\n\t\twhile ( ap[i] === bp[i] ) {\n\t\t\ti++;\n\t\t}\n\n\t\treturn i ?\n\t\t\t// Do a sibling check if the nodes have a common ancestor\n\t\t\tsiblingCheck( ap[i], bp[i] ) :\n\n\t\t\t// Otherwise nodes in our document sort first\n\t\t\tap[i] === preferredDoc ? -1 :\n\t\t\tbp[i] === preferredDoc ? 1 :\n\t\t\t0;\n\t};\n\n\treturn doc;\n};\n\nSizzle.matches = function( expr, elements ) {\n\treturn Sizzle( expr, null, null, elements );\n};\n\nSizzle.matchesSelector = function( elem, expr ) {\n\t// Set document vars if needed\n\tif ( ( elem.ownerDocument || elem ) !== document ) {\n\t\tsetDocument( elem );\n\t}\n\n\t// Make sure that attribute selectors are quoted\n\texpr = expr.replace( rattributeQuotes, \"='$1']\" );\n\n\tif ( support.matchesSelector && documentIsHTML &&\n\t\t( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&\n\t\t( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {\n\n\t\ttry {\n\t\t\tvar ret = matches.call( elem, expr );\n\n\t\t\t// IE 9's matchesSelector returns false on disconnected nodes\n\t\t\tif ( ret || support.disconnectedMatch ||\n\t\t\t\t\t// As well, disconnected nodes are said to be in a document\n\t\t\t\t\t// fragment in IE 9\n\t\t\t\t\telem.document && elem.document.nodeType !== 11 ) {\n\t\t\t\treturn ret;\n\t\t\t}\n\t\t} catch (e) {}\n\t}\n\n\treturn Sizzle( expr, document, null, [ elem ] ).length > 0;\n};\n\nSizzle.contains = function( context, elem ) {\n\t// Set document vars if needed\n\tif ( ( context.ownerDocument || context ) !== document ) {\n\t\tsetDocument( context );\n\t}\n\treturn contains( context, elem );\n};\n\nSizzle.attr = function( elem, name ) {\n\t// Set document vars if needed\n\tif ( ( elem.ownerDocument || elem ) !== document ) {\n\t\tsetDocument( elem );\n\t}\n\n\tvar fn = Expr.attrHandle[ name.toLowerCase() ],\n\t\t// Don't get fooled by Object.prototype properties (jQuery #13807)\n\t\tval = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?\n\t\t\tfn( elem, name, !documentIsHTML ) :\n\t\t\tundefined;\n\n\treturn val !== undefined ?\n\t\tval :\n\t\tsupport.attributes || !documentIsHTML ?\n\t\t\telem.getAttribute( name ) :\n\t\t\t(val = elem.getAttributeNode(name)) && val.specified ?\n\t\t\t\tval.value :\n\t\t\t\tnull;\n};\n\nSizzle.error = function( msg ) {\n\tthrow new Error( \"Syntax error, unrecognized expression: \" + msg );\n};\n\n/**\n * Document sorting and removing duplicates\n * @param {ArrayLike} results\n */\nSizzle.uniqueSort = function( results ) {\n\tvar elem,\n\t\tduplicates = [],\n\t\tj = 0,\n\t\ti = 0;\n\n\t// Unless we *know* we can detect duplicates, assume their presence\n\thasDuplicate = !support.detectDuplicates;\n\tsortInput = !support.sortStable && results.slice( 0 );\n\tresults.sort( sortOrder );\n\n\tif ( hasDuplicate ) {\n\t\twhile ( (elem = results[i++]) ) {\n\t\t\tif ( elem === results[ i ] ) {\n\t\t\t\tj = duplicates.push( i );\n\t\t\t}\n\t\t}\n\t\twhile ( j-- ) {\n\t\t\tresults.splice( duplicates[ j ], 1 );\n\t\t}\n\t}\n\n\t// Clear input after sorting to release objects\n\t// See https://github.com/jquery/sizzle/pull/225\n\tsortInput = null;\n\n\treturn results;\n};\n\n/**\n * Utility function for retrieving the text value of an array of DOM nodes\n * @param {Array|Element} elem\n */\ngetText = Sizzle.getText = function( elem ) {\n\tvar node,\n\t\tret = \"\",\n\t\ti = 0,\n\t\tnodeType = elem.nodeType;\n\n\tif ( !nodeType ) {\n\t\t// If no nodeType, this is expected to be an array\n\t\twhile ( (node = elem[i++]) ) {\n\t\t\t// Do not traverse comment nodes\n\t\t\tret += getText( node );\n\t\t}\n\t} else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {\n\t\t// Use textContent for elements\n\t\t// innerText usage removed for consistency of new lines (jQuery #11153)\n\t\tif ( typeof elem.textContent === \"string\" ) {\n\t\t\treturn elem.textContent;\n\t\t} else {\n\t\t\t// Traverse its children\n\t\t\tfor ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {\n\t\t\t\tret += getText( elem );\n\t\t\t}\n\t\t}\n\t} else if ( nodeType === 3 || nodeType === 4 ) {\n\t\treturn elem.nodeValue;\n\t}\n\t// Do not include comment or processing instruction nodes\n\n\treturn ret;\n};\n\nExpr = Sizzle.selectors = {\n\n\t// Can be adjusted by the user\n\tcacheLength: 50,\n\n\tcreatePseudo: markFunction,\n\n\tmatch: matchExpr,\n\n\tattrHandle: {},\n\n\tfind: {},\n\n\trelative: {\n\t\t\">\": { dir: \"parentNode\", first: true },\n\t\t\" \": { dir: \"parentNode\" },\n\t\t\"+\": { dir: \"previousSibling\", first: true },\n\t\t\"~\": { dir: \"previousSibling\" }\n\t},\n\n\tpreFilter: {\n\t\t\"ATTR\": function( match ) {\n\t\t\tmatch[1] = match[1].replace( runescape, funescape );\n\n\t\t\t// Move the given value to match[3] whether quoted or unquoted\n\t\t\tmatch[3] = ( match[3] || match[4] || match[5] || \"\" ).replace( runescape, funescape );\n\n\t\t\tif ( match[2] === \"~=\" ) {\n\t\t\t\tmatch[3] = \" \" + match[3] + \" \";\n\t\t\t}\n\n\t\t\treturn match.slice( 0, 4 );\n\t\t},\n\n\t\t\"CHILD\": function( match ) {\n\t\t\t/* matches from matchExpr[\"CHILD\"]\n\t\t\t\t1 type (only|nth|...)\n\t\t\t\t2 what (child|of-type)\n\t\t\t\t3 argument (even|odd|\\d*|\\d*n([+-]\\d+)?|...)\n\t\t\t\t4 xn-component of xn+y argument ([+-]?\\d*n|)\n\t\t\t\t5 sign of xn-component\n\t\t\t\t6 x of xn-component\n\t\t\t\t7 sign of y-component\n\t\t\t\t8 y of y-component\n\t\t\t*/\n\t\t\tmatch[1] = match[1].toLowerCase();\n\n\t\t\tif ( match[1].slice( 0, 3 ) === \"nth\" ) {\n\t\t\t\t// nth-* requires argument\n\t\t\t\tif ( !match[3] ) {\n\t\t\t\t\tSizzle.error( match[0] );\n\t\t\t\t}\n\n\t\t\t\t// numeric x and y parameters for Expr.filter.CHILD\n\t\t\t\t// remember that false/true cast respectively to 0/1\n\t\t\t\tmatch[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === \"even\" || match[3] === \"odd\" ) );\n\t\t\t\tmatch[5] = +( ( match[7] + match[8] ) || match[3] === \"odd\" );\n\n\t\t\t// other types prohibit arguments\n\t\t\t} else if ( match[3] ) {\n\t\t\t\tSizzle.error( match[0] );\n\t\t\t}\n\n\t\t\treturn match;\n\t\t},\n\n\t\t\"PSEUDO\": function( match ) {\n\t\t\tvar excess,\n\t\t\t\tunquoted = !match[6] && match[2];\n\n\t\t\tif ( matchExpr[\"CHILD\"].test( match[0] ) ) {\n\t\t\t\treturn null;\n\t\t\t}\n\n\t\t\t// Accept quoted arguments as-is\n\t\t\tif ( match[3] ) {\n\t\t\t\tmatch[2] = match[4] || match[5] || \"\";\n\n\t\t\t// Strip excess characters from unquoted arguments\n\t\t\t} else if ( unquoted && rpseudo.test( unquoted ) &&\n\t\t\t\t// Get excess from tokenize (recursively)\n\t\t\t\t(excess = tokenize( unquoted, true )) &&\n\t\t\t\t// advance to the next closing parenthesis\n\t\t\t\t(excess = unquoted.indexOf( \")\", unquoted.length - excess ) - unquoted.length) ) {\n\n\t\t\t\t// excess is a negative index\n\t\t\t\tmatch[0] = match[0].slice( 0, excess );\n\t\t\t\tmatch[2] = unquoted.slice( 0, excess );\n\t\t\t}\n\n\t\t\t// Return only captures needed by the pseudo filter method (type and argument)\n\t\t\treturn match.slice( 0, 3 );\n\t\t}\n\t},\n\n\tfilter: {\n\n\t\t\"TAG\": function( nodeNameSelector ) {\n\t\t\tvar nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();\n\t\t\treturn nodeNameSelector === \"*\" ?\n\t\t\t\tfunction() { return true; } :\n\t\t\t\tfunction( elem ) {\n\t\t\t\t\treturn elem.nodeName && elem.nodeName.toLowerCase() === nodeName;\n\t\t\t\t};\n\t\t},\n\n\t\t\"CLASS\": function( className ) {\n\t\t\tvar pattern = classCache[ className + \" \" ];\n\n\t\t\treturn pattern ||\n\t\t\t\t(pattern = new RegExp( \"(^|\" + whitespace + \")\" + className + \"(\" + whitespace + \"|$)\" )) &&\n\t\t\t\tclassCache( className, function( elem ) {\n\t\t\t\t\treturn pattern.test( typeof elem.className === \"string\" && elem.className || typeof elem.getAttribute !== \"undefined\" && elem.getAttribute(\"class\") || \"\" );\n\t\t\t\t});\n\t\t},\n\n\t\t\"ATTR\": function( name, operator, check ) {\n\t\t\treturn function( elem ) {\n\t\t\t\tvar result = Sizzle.attr( elem, name );\n\n\t\t\t\tif ( result == null ) {\n\t\t\t\t\treturn operator === \"!=\";\n\t\t\t\t}\n\t\t\t\tif ( !operator ) {\n\t\t\t\t\treturn true;\n\t\t\t\t}\n\n\t\t\t\tresult += \"\";\n\n\t\t\t\treturn operator === \"=\" ? result === check :\n\t\t\t\t\toperator === \"!=\" ? result !== check :\n\t\t\t\t\toperator === \"^=\" ? check && result.indexOf( check ) === 0 :\n\t\t\t\t\toperator === \"*=\" ? check && result.indexOf( check ) > -1 :\n\t\t\t\t\toperator === \"$=\" ? check && result.slice( -check.length ) === check :\n\t\t\t\t\toperator === \"~=\" ? ( \" \" + result.replace( rwhitespace, \" \" ) + \" \" ).indexOf( check ) > -1 :\n\t\t\t\t\toperator === \"|=\" ? result === check || result.slice( 0, check.length + 1 ) === check + \"-\" :\n\t\t\t\t\tfalse;\n\t\t\t};\n\t\t},\n\n\t\t\"CHILD\": function( type, what, argument, first, last ) {\n\t\t\tvar simple = type.slice( 0, 3 ) !== \"nth\",\n\t\t\t\tforward = type.slice( -4 ) !== \"last\",\n\t\t\t\tofType = what === \"of-type\";\n\n\t\t\treturn first === 1 && last === 0 ?\n\n\t\t\t\t// Shortcut for :nth-*(n)\n\t\t\t\tfunction( elem ) {\n\t\t\t\t\treturn !!elem.parentNode;\n\t\t\t\t} :\n\n\t\t\t\tfunction( elem, context, xml ) {\n\t\t\t\t\tvar cache, outerCache, node, diff, nodeIndex, start,\n\t\t\t\t\t\tdir = simple !== forward ? \"nextSibling\" : \"previousSibling\",\n\t\t\t\t\t\tparent = elem.parentNode,\n\t\t\t\t\t\tname = ofType && elem.nodeName.toLowerCase(),\n\t\t\t\t\t\tuseCache = !xml && !ofType;\n\n\t\t\t\t\tif ( parent ) {\n\n\t\t\t\t\t\t// :(first|last|only)-(child|of-type)\n\t\t\t\t\t\tif ( simple ) {\n\t\t\t\t\t\t\twhile ( dir ) {\n\t\t\t\t\t\t\t\tnode = elem;\n\t\t\t\t\t\t\t\twhile ( (node = node[ dir ]) ) {\n\t\t\t\t\t\t\t\t\tif ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) {\n\t\t\t\t\t\t\t\t\t\treturn false;\n\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t// Reverse direction for :only-* (if we haven't yet done so)\n\t\t\t\t\t\t\t\tstart = dir = type === \"only\" && !start && \"nextSibling\";\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\treturn true;\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\tstart = [ forward ? parent.firstChild : parent.lastChild ];\n\n\t\t\t\t\t\t// non-xml :nth-child(...) stores cache data on `parent`\n\t\t\t\t\t\tif ( forward && useCache ) {\n\t\t\t\t\t\t\t// Seek `elem` from a previously-cached index\n\t\t\t\t\t\t\touterCache = parent[ expando ] || (parent[ expando ] = {});\n\t\t\t\t\t\t\tcache = outerCache[ type ] || [];\n\t\t\t\t\t\t\tnodeIndex = cache[0] === dirruns && cache[1];\n\t\t\t\t\t\t\tdiff = cache[0] === dirruns && cache[2];\n\t\t\t\t\t\t\tnode = nodeIndex && parent.childNodes[ nodeIndex ];\n\n\t\t\t\t\t\t\twhile ( (node = ++nodeIndex && node && node[ dir ] ||\n\n\t\t\t\t\t\t\t\t// Fallback to seeking `elem` from the start\n\t\t\t\t\t\t\t\t(diff = nodeIndex = 0) || start.pop()) ) {\n\n\t\t\t\t\t\t\t\t// When found, cache indexes on `parent` and break\n\t\t\t\t\t\t\t\tif ( node.nodeType === 1 && ++diff && node === elem ) {\n\t\t\t\t\t\t\t\t\touterCache[ type ] = [ dirruns, nodeIndex, diff ];\n\t\t\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t// Use previously-cached element index if available\n\t\t\t\t\t\t} else if ( useCache && (cache = (elem[ expando ] || (elem[ expando ] = {}))[ type ]) && cache[0] === dirruns ) {\n\t\t\t\t\t\t\tdiff = cache[1];\n\n\t\t\t\t\t\t// xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...)\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t// Use the same loop as above to seek `elem` from the start\n\t\t\t\t\t\t\twhile ( (node = ++nodeIndex && node && node[ dir ] ||\n\t\t\t\t\t\t\t\t(diff = nodeIndex = 0) || start.pop()) ) {\n\n\t\t\t\t\t\t\t\tif ( ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) && ++diff ) {\n\t\t\t\t\t\t\t\t\t// Cache the index of each encountered element\n\t\t\t\t\t\t\t\t\tif ( useCache ) {\n\t\t\t\t\t\t\t\t\t\t(node[ expando ] || (node[ expando ] = {}))[ type ] = [ dirruns, diff ];\n\t\t\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t\t\tif ( node === elem ) {\n\t\t\t\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\t// Incorporate the offset, then check against cycle size\n\t\t\t\t\t\tdiff -= last;\n\t\t\t\t\t\treturn diff === first || ( diff % first === 0 && diff / first >= 0 );\n\t\t\t\t\t}\n\t\t\t\t};\n\t\t},\n\n\t\t\"PSEUDO\": function( pseudo, argument ) {\n\t\t\t// pseudo-class names are case-insensitive\n\t\t\t// http://www.w3.org/TR/selectors/#pseudo-classes\n\t\t\t// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters\n\t\t\t// Remember that setFilters inherits from pseudos\n\t\t\tvar args,\n\t\t\t\tfn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||\n\t\t\t\t\tSizzle.error( \"unsupported pseudo: \" + pseudo );\n\n\t\t\t// The user may use createPseudo to indicate that\n\t\t\t// arguments are needed to create the filter function\n\t\t\t// just as Sizzle does\n\t\t\tif ( fn[ expando ] ) {\n\t\t\t\treturn fn( argument );\n\t\t\t}\n\n\t\t\t// But maintain support for old signatures\n\t\t\tif ( fn.length > 1 ) {\n\t\t\t\targs = [ pseudo, pseudo, \"\", argument ];\n\t\t\t\treturn Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?\n\t\t\t\t\tmarkFunction(function( seed, matches ) {\n\t\t\t\t\t\tvar idx,\n\t\t\t\t\t\t\tmatched = fn( seed, argument ),\n\t\t\t\t\t\t\ti = matched.length;\n\t\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\t\tidx = indexOf( seed, matched[i] );\n\t\t\t\t\t\t\tseed[ idx ] = !( matches[ idx ] = matched[i] );\n\t\t\t\t\t\t}\n\t\t\t\t\t}) :\n\t\t\t\t\tfunction( elem ) {\n\t\t\t\t\t\treturn fn( elem, 0, args );\n\t\t\t\t\t};\n\t\t\t}\n\n\t\t\treturn fn;\n\t\t}\n\t},\n\n\tpseudos: {\n\t\t// Potentially complex pseudos\n\t\t\"not\": markFunction(function( selector ) {\n\t\t\t// Trim the selector passed to compile\n\t\t\t// to avoid treating leading and trailing\n\t\t\t// spaces as combinators\n\t\t\tvar input = [],\n\t\t\t\tresults = [],\n\t\t\t\tmatcher = compile( selector.replace( rtrim, \"$1\" ) );\n\n\t\t\treturn matcher[ expando ] ?\n\t\t\t\tmarkFunction(function( seed, matches, context, xml ) {\n\t\t\t\t\tvar elem,\n\t\t\t\t\t\tunmatched = matcher( seed, null, xml, [] ),\n\t\t\t\t\t\ti = seed.length;\n\n\t\t\t\t\t// Match elements unmatched by `matcher`\n\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\tif ( (elem = unmatched[i]) ) {\n\t\t\t\t\t\t\tseed[i] = !(matches[i] = elem);\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}) :\n\t\t\t\tfunction( elem, context, xml ) {\n\t\t\t\t\tinput[0] = elem;\n\t\t\t\t\tmatcher( input, null, xml, results );\n\t\t\t\t\t// Don't keep the element (issue #299)\n\t\t\t\t\tinput[0] = null;\n\t\t\t\t\treturn !results.pop();\n\t\t\t\t};\n\t\t}),\n\n\t\t\"has\": markFunction(function( selector ) {\n\t\t\treturn function( elem ) {\n\t\t\t\treturn Sizzle( selector, elem ).length > 0;\n\t\t\t};\n\t\t}),\n\n\t\t\"contains\": markFunction(function( text ) {\n\t\t\ttext = text.replace( runescape, funescape );\n\t\t\treturn function( elem ) {\n\t\t\t\treturn ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;\n\t\t\t};\n\t\t}),\n\n\t\t// \"Whether an element is represented by a :lang() selector\n\t\t// is based solely on the element's language value\n\t\t// being equal to the identifier C,\n\t\t// or beginning with the identifier C immediately followed by \"-\".\n\t\t// The matching of C against the element's language value is performed case-insensitively.\n\t\t// The identifier C does not have to be a valid language name.\"\n\t\t// http://www.w3.org/TR/selectors/#lang-pseudo\n\t\t\"lang\": markFunction( function( lang ) {\n\t\t\t// lang value must be a valid identifier\n\t\t\tif ( !ridentifier.test(lang || \"\") ) {\n\t\t\t\tSizzle.error( \"unsupported lang: \" + lang );\n\t\t\t}\n\t\t\tlang = lang.replace( runescape, funescape ).toLowerCase();\n\t\t\treturn function( elem ) {\n\t\t\t\tvar elemLang;\n\t\t\t\tdo {\n\t\t\t\t\tif ( (elemLang = documentIsHTML ?\n\t\t\t\t\t\telem.lang :\n\t\t\t\t\t\telem.getAttribute(\"xml:lang\") || elem.getAttribute(\"lang\")) ) {\n\n\t\t\t\t\t\telemLang = elemLang.toLowerCase();\n\t\t\t\t\t\treturn elemLang === lang || elemLang.indexOf( lang + \"-\" ) === 0;\n\t\t\t\t\t}\n\t\t\t\t} while ( (elem = elem.parentNode) && elem.nodeType === 1 );\n\t\t\t\treturn false;\n\t\t\t};\n\t\t}),\n\n\t\t// Miscellaneous\n\t\t\"target\": function( elem ) {\n\t\t\tvar hash = window.location && window.location.hash;\n\t\t\treturn hash && hash.slice( 1 ) === elem.id;\n\t\t},\n\n\t\t\"root\": function( elem ) {\n\t\t\treturn elem === docElem;\n\t\t},\n\n\t\t\"focus\": function( elem ) {\n\t\t\treturn elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);\n\t\t},\n\n\t\t// Boolean properties\n\t\t\"enabled\": function( elem ) {\n\t\t\treturn elem.disabled === false;\n\t\t},\n\n\t\t\"disabled\": function( elem ) {\n\t\t\treturn elem.disabled === true;\n\t\t},\n\n\t\t\"checked\": function( elem ) {\n\t\t\t// In CSS3, :checked should return both checked and selected elements\n\t\t\t// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked\n\t\t\tvar nodeName = elem.nodeName.toLowerCase();\n\t\t\treturn (nodeName === \"input\" && !!elem.checked) || (nodeName === \"option\" && !!elem.selected);\n\t\t},\n\n\t\t\"selected\": function( elem ) {\n\t\t\t// Accessing this property makes selected-by-default\n\t\t\t// options in Safari work properly\n\t\t\tif ( elem.parentNode ) {\n\t\t\t\telem.parentNode.selectedIndex;\n\t\t\t}\n\n\t\t\treturn elem.selected === true;\n\t\t},\n\n\t\t// Contents\n\t\t\"empty\": function( elem ) {\n\t\t\t// http://www.w3.org/TR/selectors/#empty-pseudo\n\t\t\t// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),\n\t\t\t// but not by others (comment: 8; processing instruction: 7; etc.)\n\t\t\t// nodeType < 6 works because attributes (2) do not appear as children\n\t\t\tfor ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {\n\t\t\t\tif ( elem.nodeType < 6 ) {\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn true;\n\t\t},\n\n\t\t\"parent\": function( elem ) {\n\t\t\treturn !Expr.pseudos[\"empty\"]( elem );\n\t\t},\n\n\t\t// Element/input types\n\t\t\"header\": function( elem ) {\n\t\t\treturn rheader.test( elem.nodeName );\n\t\t},\n\n\t\t\"input\": function( elem ) {\n\t\t\treturn rinputs.test( elem.nodeName );\n\t\t},\n\n\t\t\"button\": function( elem ) {\n\t\t\tvar name = elem.nodeName.toLowerCase();\n\t\t\treturn name === \"input\" && elem.type === \"button\" || name === \"button\";\n\t\t},\n\n\t\t\"text\": function( elem ) {\n\t\t\tvar attr;\n\t\t\treturn elem.nodeName.toLowerCase() === \"input\" &&\n\t\t\t\telem.type === \"text\" &&\n\n\t\t\t\t// Support: IE<8\n\t\t\t\t// New HTML5 attribute values (e.g., \"search\") appear with elem.type === \"text\"\n\t\t\t\t( (attr = elem.getAttribute(\"type\")) == null || attr.toLowerCase() === \"text\" );\n\t\t},\n\n\t\t// Position-in-collection\n\t\t\"first\": createPositionalPseudo(function() {\n\t\t\treturn [ 0 ];\n\t\t}),\n\n\t\t\"last\": createPositionalPseudo(function( matchIndexes, length ) {\n\t\t\treturn [ length - 1 ];\n\t\t}),\n\n\t\t\"eq\": createPositionalPseudo(function( matchIndexes, length, argument ) {\n\t\t\treturn [ argument < 0 ? argument + length : argument ];\n\t\t}),\n\n\t\t\"even\": createPositionalPseudo(function( matchIndexes, length ) {\n\t\t\tvar i = 0;\n\t\t\tfor ( ; i < length; i += 2 ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t}),\n\n\t\t\"odd\": createPositionalPseudo(function( matchIndexes, length ) {\n\t\t\tvar i = 1;\n\t\t\tfor ( ; i < length; i += 2 ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t}),\n\n\t\t\"lt\": createPositionalPseudo(function( matchIndexes, length, argument ) {\n\t\t\tvar i = argument < 0 ? argument + length : argument;\n\t\t\tfor ( ; --i >= 0; ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t}),\n\n\t\t\"gt\": createPositionalPseudo(function( matchIndexes, length, argument ) {\n\t\t\tvar i = argument < 0 ? argument + length : argument;\n\t\t\tfor ( ; ++i < length; ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t})\n\t}\n};\n\nExpr.pseudos[\"nth\"] = Expr.pseudos[\"eq\"];\n\n// Add button/input type pseudos\nfor ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {\n\tExpr.pseudos[ i ] = createInputPseudo( i );\n}\nfor ( i in { submit: true, reset: true } ) {\n\tExpr.pseudos[ i ] = createButtonPseudo( i );\n}\n\n// Easy API for creating new setFilters\nfunction setFilters() {}\nsetFilters.prototype = Expr.filters = Expr.pseudos;\nExpr.setFilters = new setFilters();\n\ntokenize = Sizzle.tokenize = function( selector, parseOnly ) {\n\tvar matched, match, tokens, type,\n\t\tsoFar, groups, preFilters,\n\t\tcached = tokenCache[ selector + \" \" ];\n\n\tif ( cached ) {\n\t\treturn parseOnly ? 0 : cached.slice( 0 );\n\t}\n\n\tsoFar = selector;\n\tgroups = [];\n\tpreFilters = Expr.preFilter;\n\n\twhile ( soFar ) {\n\n\t\t// Comma and first run\n\t\tif ( !matched || (match = rcomma.exec( soFar )) ) {\n\t\t\tif ( match ) {\n\t\t\t\t// Don't consume trailing commas as valid\n\t\t\t\tsoFar = soFar.slice( match[0].length ) || soFar;\n\t\t\t}\n\t\t\tgroups.push( (tokens = []) );\n\t\t}\n\n\t\tmatched = false;\n\n\t\t// Combinators\n\t\tif ( (match = rcombinators.exec( soFar )) ) {\n\t\t\tmatched = match.shift();\n\t\t\ttokens.push({\n\t\t\t\tvalue: matched,\n\t\t\t\t// Cast descendant combinators to space\n\t\t\t\ttype: match[0].replace( rtrim, \" \" )\n\t\t\t});\n\t\t\tsoFar = soFar.slice( matched.length );\n\t\t}\n\n\t\t// Filters\n\t\tfor ( type in Expr.filter ) {\n\t\t\tif ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||\n\t\t\t\t(match = preFilters[ type ]( match ))) ) {\n\t\t\t\tmatched = match.shift();\n\t\t\t\ttokens.push({\n\t\t\t\t\tvalue: matched,\n\t\t\t\t\ttype: type,\n\t\t\t\t\tmatches: match\n\t\t\t\t});\n\t\t\t\tsoFar = soFar.slice( matched.length );\n\t\t\t}\n\t\t}\n\n\t\tif ( !matched ) {\n\t\t\tbreak;\n\t\t}\n\t}\n\n\t// Return the length of the invalid excess\n\t// if we're just parsing\n\t// Otherwise, throw an error or return tokens\n\treturn parseOnly ?\n\t\tsoFar.length :\n\t\tsoFar ?\n\t\t\tSizzle.error( selector ) :\n\t\t\t// Cache the tokens\n\t\t\ttokenCache( selector, groups ).slice( 0 );\n};\n\nfunction toSelector( tokens ) {\n\tvar i = 0,\n\t\tlen = tokens.length,\n\t\tselector = \"\";\n\tfor ( ; i < len; i++ ) {\n\t\tselector += tokens[i].value;\n\t}\n\treturn selector;\n}\n\nfunction addCombinator( matcher, combinator, base ) {\n\tvar dir = combinator.dir,\n\t\tcheckNonElements = base && dir === \"parentNode\",\n\t\tdoneName = done++;\n\n\treturn combinator.first ?\n\t\t// Check against closest ancestor/preceding element\n\t\tfunction( elem, context, xml ) {\n\t\t\twhile ( (elem = elem[ dir ]) ) {\n\t\t\t\tif ( elem.nodeType === 1 || checkNonElements ) {\n\t\t\t\t\treturn matcher( elem, context, xml );\n\t\t\t\t}\n\t\t\t}\n\t\t} :\n\n\t\t// Check against all ancestor/preceding elements\n\t\tfunction( elem, context, xml ) {\n\t\t\tvar oldCache, outerCache,\n\t\t\t\tnewCache = [ dirruns, doneName ];\n\n\t\t\t// We can't set arbitrary data on XML nodes, so they don't benefit from dir caching\n\t\t\tif ( xml ) {\n\t\t\t\twhile ( (elem = elem[ dir ]) ) {\n\t\t\t\t\tif ( elem.nodeType === 1 || checkNonElements ) {\n\t\t\t\t\t\tif ( matcher( elem, context, xml ) ) {\n\t\t\t\t\t\t\treturn true;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\twhile ( (elem = elem[ dir ]) ) {\n\t\t\t\t\tif ( elem.nodeType === 1 || checkNonElements ) {\n\t\t\t\t\t\touterCache = elem[ expando ] || (elem[ expando ] = {});\n\t\t\t\t\t\tif ( (oldCache = outerCache[ dir ]) &&\n\t\t\t\t\t\t\toldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {\n\n\t\t\t\t\t\t\t// Assign to newCache so results back-propagate to previous elements\n\t\t\t\t\t\t\treturn (newCache[ 2 ] = oldCache[ 2 ]);\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t// Reuse newcache so results back-propagate to previous elements\n\t\t\t\t\t\t\touterCache[ dir ] = newCache;\n\n\t\t\t\t\t\t\t// A match means we're done; a fail means we have to keep checking\n\t\t\t\t\t\t\tif ( (newCache[ 2 ] = matcher( elem, context, xml )) ) {\n\t\t\t\t\t\t\t\treturn true;\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t};\n}\n\nfunction elementMatcher( matchers ) {\n\treturn matchers.length > 1 ?\n\t\tfunction( elem, context, xml ) {\n\t\t\tvar i = matchers.length;\n\t\t\twhile ( i-- ) {\n\t\t\t\tif ( !matchers[i]( elem, context, xml ) ) {\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn true;\n\t\t} :\n\t\tmatchers[0];\n}\n\nfunction multipleContexts( selector, contexts, results ) {\n\tvar i = 0,\n\t\tlen = contexts.length;\n\tfor ( ; i < len; i++ ) {\n\t\tSizzle( selector, contexts[i], results );\n\t}\n\treturn results;\n}\n\nfunction condense( unmatched, map, filter, context, xml ) {\n\tvar elem,\n\t\tnewUnmatched = [],\n\t\ti = 0,\n\t\tlen = unmatched.length,\n\t\tmapped = map != null;\n\n\tfor ( ; i < len; i++ ) {\n\t\tif ( (elem = unmatched[i]) ) {\n\t\t\tif ( !filter || filter( elem, context, xml ) ) {\n\t\t\t\tnewUnmatched.push( elem );\n\t\t\t\tif ( mapped ) {\n\t\t\t\t\tmap.push( i );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\treturn newUnmatched;\n}\n\nfunction setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {\n\tif ( postFilter && !postFilter[ expando ] ) {\n\t\tpostFilter = setMatcher( postFilter );\n\t}\n\tif ( postFinder && !postFinder[ expando ] ) {\n\t\tpostFinder = setMatcher( postFinder, postSelector );\n\t}\n\treturn markFunction(function( seed, results, context, xml ) {\n\t\tvar temp, i, elem,\n\t\t\tpreMap = [],\n\t\t\tpostMap = [],\n\t\t\tpreexisting = results.length,\n\n\t\t\t// Get initial elements from seed or context\n\t\t\telems = seed || multipleContexts( selector || \"*\", context.nodeType ? [ context ] : context, [] ),\n\n\t\t\t// Prefilter to get matcher input, preserving a map for seed-results synchronization\n\t\t\tmatcherIn = preFilter && ( seed || !selector ) ?\n\t\t\t\tcondense( elems, preMap, preFilter, context, xml ) :\n\t\t\t\telems,\n\n\t\t\tmatcherOut = matcher ?\n\t\t\t\t// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,\n\t\t\t\tpostFinder || ( seed ? preFilter : preexisting || postFilter ) ?\n\n\t\t\t\t\t// ...intermediate processing is necessary\n\t\t\t\t\t[] :\n\n\t\t\t\t\t// ...otherwise use results directly\n\t\t\t\t\tresults :\n\t\t\t\tmatcherIn;\n\n\t\t// Find primary matches\n\t\tif ( matcher ) {\n\t\t\tmatcher( matcherIn, matcherOut, context, xml );\n\t\t}\n\n\t\t// Apply postFilter\n\t\tif ( postFilter ) {\n\t\t\ttemp = condense( matcherOut, postMap );\n\t\t\tpostFilter( temp, [], context, xml );\n\n\t\t\t// Un-match failing elements by moving them back to matcherIn\n\t\t\ti = temp.length;\n\t\t\twhile ( i-- ) {\n\t\t\t\tif ( (elem = temp[i]) ) {\n\t\t\t\t\tmatcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\tif ( seed ) {\n\t\t\tif ( postFinder || preFilter ) {\n\t\t\t\tif ( postFinder ) {\n\t\t\t\t\t// Get the final matcherOut by condensing this intermediate into postFinder contexts\n\t\t\t\t\ttemp = [];\n\t\t\t\t\ti = matcherOut.length;\n\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\tif ( (elem = matcherOut[i]) ) {\n\t\t\t\t\t\t\t// Restore matcherIn since elem is not yet a final match\n\t\t\t\t\t\t\ttemp.push( (matcherIn[i] = elem) );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tpostFinder( null, (matcherOut = []), temp, xml );\n\t\t\t\t}\n\n\t\t\t\t// Move matched elements from seed to results to keep them synchronized\n\t\t\t\ti = matcherOut.length;\n\t\t\t\twhile ( i-- ) {\n\t\t\t\t\tif ( (elem = matcherOut[i]) &&\n\t\t\t\t\t\t(temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) {\n\n\t\t\t\t\t\tseed[temp] = !(results[temp] = elem);\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t// Add elements to results, through postFinder if defined\n\t\t} else {\n\t\t\tmatcherOut = condense(\n\t\t\t\tmatcherOut === results ?\n\t\t\t\t\tmatcherOut.splice( preexisting, matcherOut.length ) :\n\t\t\t\t\tmatcherOut\n\t\t\t);\n\t\t\tif ( postFinder ) {\n\t\t\t\tpostFinder( null, results, matcherOut, xml );\n\t\t\t} else {\n\t\t\t\tpush.apply( results, matcherOut );\n\t\t\t}\n\t\t}\n\t});\n}\n\nfunction matcherFromTokens( tokens ) {\n\tvar checkContext, matcher, j,\n\t\tlen = tokens.length,\n\t\tleadingRelative = Expr.relative[ tokens[0].type ],\n\t\timplicitRelative = leadingRelative || Expr.relative[\" \"],\n\t\ti = leadingRelative ? 1 : 0,\n\n\t\t// The foundational matcher ensures that elements are reachable from top-level context(s)\n\t\tmatchContext = addCombinator( function( elem ) {\n\t\t\treturn elem === checkContext;\n\t\t}, implicitRelative, true ),\n\t\tmatchAnyContext = addCombinator( function( elem ) {\n\t\t\treturn indexOf( checkContext, elem ) > -1;\n\t\t}, implicitRelative, true ),\n\t\tmatchers = [ function( elem, context, xml ) {\n\t\t\tvar ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || (\n\t\t\t\t(checkContext = context).nodeType ?\n\t\t\t\t\tmatchContext( elem, context, xml ) :\n\t\t\t\t\tmatchAnyContext( elem, context, xml ) );\n\t\t\t// Avoid hanging onto element (issue #299)\n\t\t\tcheckContext = null;\n\t\t\treturn ret;\n\t\t} ];\n\n\tfor ( ; i < len; i++ ) {\n\t\tif ( (matcher = Expr.relative[ tokens[i].type ]) ) {\n\t\t\tmatchers = [ addCombinator(elementMatcher( matchers ), matcher) ];\n\t\t} else {\n\t\t\tmatcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );\n\n\t\t\t// Return special upon seeing a positional matcher\n\t\t\tif ( matcher[ expando ] ) {\n\t\t\t\t// Find the next relative operator (if any) for proper handling\n\t\t\t\tj = ++i;\n\t\t\t\tfor ( ; j < len; j++ ) {\n\t\t\t\t\tif ( Expr.relative[ tokens[j].type ] ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\treturn setMatcher(\n\t\t\t\t\ti > 1 && elementMatcher( matchers ),\n\t\t\t\t\ti > 1 && toSelector(\n\t\t\t\t\t\t// If the preceding token was a descendant combinator, insert an implicit any-element `*`\n\t\t\t\t\t\ttokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === \" \" ? \"*\" : \"\" })\n\t\t\t\t\t).replace( rtrim, \"$1\" ),\n\t\t\t\t\tmatcher,\n\t\t\t\t\ti < j && matcherFromTokens( tokens.slice( i, j ) ),\n\t\t\t\t\tj < len && matcherFromTokens( (tokens = tokens.slice( j )) ),\n\t\t\t\t\tj < len && toSelector( tokens )\n\t\t\t\t);\n\t\t\t}\n\t\t\tmatchers.push( matcher );\n\t\t}\n\t}\n\n\treturn elementMatcher( matchers );\n}\n\nfunction matcherFromGroupMatchers( elementMatchers, setMatchers ) {\n\tvar bySet = setMatchers.length > 0,\n\t\tbyElement = elementMatchers.length > 0,\n\t\tsuperMatcher = function( seed, context, xml, results, outermost ) {\n\t\t\tvar elem, j, matcher,\n\t\t\t\tmatchedCount = 0,\n\t\t\t\ti = \"0\",\n\t\t\t\tunmatched = seed && [],\n\t\t\t\tsetMatched = [],\n\t\t\t\tcontextBackup = outermostContext,\n\t\t\t\t// We must always have either seed elements or outermost context\n\t\t\t\telems = seed || byElement && Expr.find[\"TAG\"]( \"*\", outermost ),\n\t\t\t\t// Use integer dirruns iff this is the outermost matcher\n\t\t\t\tdirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),\n\t\t\t\tlen = elems.length;\n\n\t\t\tif ( outermost ) {\n\t\t\t\toutermostContext = context !== document && context;\n\t\t\t}\n\n\t\t\t// Add elements passing elementMatchers directly to results\n\t\t\t// Keep `i` a string if there are no elements so `matchedCount` will be \"00\" below\n\t\t\t// Support: IE<9, Safari\n\t\t\t// Tolerate NodeList properties (IE: \"length\"; Safari: ) matching elements by id\n\t\t\tfor ( ; i !== len && (elem = elems[i]) != null; i++ ) {\n\t\t\t\tif ( byElement && elem ) {\n\t\t\t\t\tj = 0;\n\t\t\t\t\twhile ( (matcher = elementMatchers[j++]) ) {\n\t\t\t\t\t\tif ( matcher( elem, context, xml ) ) {\n\t\t\t\t\t\t\tresults.push( elem );\n\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tif ( outermost ) {\n\t\t\t\t\t\tdirruns = dirrunsUnique;\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\t// Track unmatched elements for set filters\n\t\t\t\tif ( bySet ) {\n\t\t\t\t\t// They will have gone through all possible matchers\n\t\t\t\t\tif ( (elem = !matcher && elem) ) {\n\t\t\t\t\t\tmatchedCount--;\n\t\t\t\t\t}\n\n\t\t\t\t\t// Lengthen the array for every element, matched or not\n\t\t\t\t\tif ( seed ) {\n\t\t\t\t\t\tunmatched.push( elem );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Apply set filters to unmatched elements\n\t\t\tmatchedCount += i;\n\t\t\tif ( bySet && i !== matchedCount ) {\n\t\t\t\tj = 0;\n\t\t\t\twhile ( (matcher = setMatchers[j++]) ) {\n\t\t\t\t\tmatcher( unmatched, setMatched, context, xml );\n\t\t\t\t}\n\n\t\t\t\tif ( seed ) {\n\t\t\t\t\t// Reintegrate element matches to eliminate the need for sorting\n\t\t\t\t\tif ( matchedCount > 0 ) {\n\t\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\t\tif ( !(unmatched[i] || setMatched[i]) ) {\n\t\t\t\t\t\t\t\tsetMatched[i] = pop.call( results );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\t// Discard index placeholder values to get only actual matches\n\t\t\t\t\tsetMatched = condense( setMatched );\n\t\t\t\t}\n\n\t\t\t\t// Add matches to results\n\t\t\t\tpush.apply( results, setMatched );\n\n\t\t\t\t// Seedless set matches succeeding multiple successful matchers stipulate sorting\n\t\t\t\tif ( outermost && !seed && setMatched.length > 0 &&\n\t\t\t\t\t( matchedCount + setMatchers.length ) > 1 ) {\n\n\t\t\t\t\tSizzle.uniqueSort( results );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Override manipulation of globals by nested matchers\n\t\t\tif ( outermost ) {\n\t\t\t\tdirruns = dirrunsUnique;\n\t\t\t\toutermostContext = contextBackup;\n\t\t\t}\n\n\t\t\treturn unmatched;\n\t\t};\n\n\treturn bySet ?\n\t\tmarkFunction( superMatcher ) :\n\t\tsuperMatcher;\n}\n\ncompile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {\n\tvar i,\n\t\tsetMatchers = [],\n\t\telementMatchers = [],\n\t\tcached = compilerCache[ selector + \" \" ];\n\n\tif ( !cached ) {\n\t\t// Generate a function of recursive functions that can be used to check each element\n\t\tif ( !match ) {\n\t\t\tmatch = tokenize( selector );\n\t\t}\n\t\ti = match.length;\n\t\twhile ( i-- ) {\n\t\t\tcached = matcherFromTokens( match[i] );\n\t\t\tif ( cached[ expando ] ) {\n\t\t\t\tsetMatchers.push( cached );\n\t\t\t} else {\n\t\t\t\telementMatchers.push( cached );\n\t\t\t}\n\t\t}\n\n\t\t// Cache the compiled function\n\t\tcached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );\n\n\t\t// Save selector and tokenization\n\t\tcached.selector = selector;\n\t}\n\treturn cached;\n};\n\n/**\n * A low-level selection function that works with Sizzle's compiled\n * selector functions\n * @param {String|Function} selector A selector or a pre-compiled\n * selector function built with Sizzle.compile\n * @param {Element} context\n * @param {Array} [results]\n * @param {Array} [seed] A set of elements to match against\n */\nselect = Sizzle.select = function( selector, context, results, seed ) {\n\tvar i, tokens, token, type, find,\n\t\tcompiled = typeof selector === \"function\" && selector,\n\t\tmatch = !seed && tokenize( (selector = compiled.selector || selector) );\n\n\tresults = results || [];\n\n\t// Try to minimize operations if there is no seed and only one group\n\tif ( match.length === 1 ) {\n\n\t\t// Take a shortcut and set the context if the root selector is an ID\n\t\ttokens = match[0] = match[0].slice( 0 );\n\t\tif ( tokens.length > 2 && (token = tokens[0]).type === \"ID\" &&\n\t\t\t\tsupport.getById && context.nodeType === 9 && documentIsHTML &&\n\t\t\t\tExpr.relative[ tokens[1].type ] ) {\n\n\t\t\tcontext = ( Expr.find[\"ID\"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0];\n\t\t\tif ( !context ) {\n\t\t\t\treturn results;\n\n\t\t\t// Precompiled matchers will still verify ancestry, so step up a level\n\t\t\t} else if ( compiled ) {\n\t\t\t\tcontext = context.parentNode;\n\t\t\t}\n\n\t\t\tselector = selector.slice( tokens.shift().value.length );\n\t\t}\n\n\t\t// Fetch a seed set for right-to-left matching\n\t\ti = matchExpr[\"needsContext\"].test( selector ) ? 0 : tokens.length;\n\t\twhile ( i-- ) {\n\t\t\ttoken = tokens[i];\n\n\t\t\t// Abort if we hit a combinator\n\t\t\tif ( Expr.relative[ (type = token.type) ] ) {\n\t\t\t\tbreak;\n\t\t\t}\n\t\t\tif ( (find = Expr.find[ type ]) ) {\n\t\t\t\t// Search, expanding context for leading sibling combinators\n\t\t\t\tif ( (seed = find(\n\t\t\t\t\ttoken.matches[0].replace( runescape, funescape ),\n\t\t\t\t\trsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context\n\t\t\t\t)) ) {\n\n\t\t\t\t\t// If seed is empty or no tokens remain, we can return early\n\t\t\t\t\ttokens.splice( i, 1 );\n\t\t\t\t\tselector = seed.length && toSelector( tokens );\n\t\t\t\t\tif ( !selector ) {\n\t\t\t\t\t\tpush.apply( results, seed );\n\t\t\t\t\t\treturn results;\n\t\t\t\t\t}\n\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// Compile and execute a filtering function if one is not provided\n\t// Provide `match` to avoid retokenization if we modified the selector above\n\t( compiled || compile( selector, match ) )(\n\t\tseed,\n\t\tcontext,\n\t\t!documentIsHTML,\n\t\tresults,\n\t\trsibling.test( selector ) && testContext( context.parentNode ) || context\n\t);\n\treturn results;\n};\n\n// One-time assignments\n\n// Sort stability\nsupport.sortStable = expando.split(\"\").sort( sortOrder ).join(\"\") === expando;\n\n// Support: Chrome 14-35+\n// Always assume duplicates if they aren't passed to the comparison function\nsupport.detectDuplicates = !!hasDuplicate;\n\n// Initialize against the default document\nsetDocument();\n\n// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)\n// Detached nodes confoundingly follow *each other*\nsupport.sortDetached = assert(function( div1 ) {\n\t// Should return 1, but returns 4 (following)\n\treturn div1.compareDocumentPosition( document.createElement(\"div\") ) & 1;\n});\n\n// Support: IE<8\n// Prevent attribute/property \"interpolation\"\n// http://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx\nif ( !assert(function( div ) {\n\tdiv.innerHTML = \"\";\n\treturn div.firstChild.getAttribute(\"href\") === \"#\" ;\n}) ) {\n\taddHandle( \"type|href|height|width\", function( elem, name, isXML ) {\n\t\tif ( !isXML ) {\n\t\t\treturn elem.getAttribute( name, name.toLowerCase() === \"type\" ? 1 : 2 );\n\t\t}\n\t});\n}\n\n// Support: IE<9\n// Use defaultValue in place of getAttribute(\"value\")\nif ( !support.attributes || !assert(function( div ) {\n\tdiv.innerHTML = \"\";\n\tdiv.firstChild.setAttribute( \"value\", \"\" );\n\treturn div.firstChild.getAttribute( \"value\" ) === \"\";\n}) ) {\n\taddHandle( \"value\", function( elem, name, isXML ) {\n\t\tif ( !isXML && elem.nodeName.toLowerCase() === \"input\" ) {\n\t\t\treturn elem.defaultValue;\n\t\t}\n\t});\n}\n\n// Support: IE<9\n// Use getAttributeNode to fetch booleans when getAttribute lies\nif ( !assert(function( div ) {\n\treturn div.getAttribute(\"disabled\") == null;\n}) ) {\n\taddHandle( booleans, function( elem, name, isXML ) {\n\t\tvar val;\n\t\tif ( !isXML ) {\n\t\t\treturn elem[ name ] === true ? name.toLowerCase() :\n\t\t\t\t\t(val = elem.getAttributeNode( name )) && val.specified ?\n\t\t\t\t\tval.value :\n\t\t\t\tnull;\n\t\t}\n\t});\n}\n\nreturn Sizzle;\n\n})( window );\n\n\n\njQuery.find = Sizzle;\njQuery.expr = Sizzle.selectors;\njQuery.expr[\":\"] = jQuery.expr.pseudos;\njQuery.unique = Sizzle.uniqueSort;\njQuery.text = Sizzle.getText;\njQuery.isXMLDoc = Sizzle.isXML;\njQuery.contains = Sizzle.contains;\n\n\n\nvar rneedsContext = jQuery.expr.match.needsContext;\n\nvar rsingleTag = (/^<(\\w+)\\s*\\/?>(?:<\\/\\1>|)$/);\n\n\n\nvar risSimple = /^.[^:#\\[\\.,]*$/;\n\n// Implement the identical functionality for filter and not\nfunction winnow( elements, qualifier, not ) {\n\tif ( jQuery.isFunction( qualifier ) ) {\n\t\treturn jQuery.grep( elements, function( elem, i ) {\n\t\t\t/* jshint -W018 */\n\t\t\treturn !!qualifier.call( elem, i, elem ) !== not;\n\t\t});\n\n\t}\n\n\tif ( qualifier.nodeType ) {\n\t\treturn jQuery.grep( elements, function( elem ) {\n\t\t\treturn ( elem === qualifier ) !== not;\n\t\t});\n\n\t}\n\n\tif ( typeof qualifier === \"string\" ) {\n\t\tif ( risSimple.test( qualifier ) ) {\n\t\t\treturn jQuery.filter( qualifier, elements, not );\n\t\t}\n\n\t\tqualifier = jQuery.filter( qualifier, elements );\n\t}\n\n\treturn jQuery.grep( elements, function( elem ) {\n\t\treturn ( indexOf.call( qualifier, elem ) >= 0 ) !== not;\n\t});\n}\n\njQuery.filter = function( expr, elems, not ) {\n\tvar elem = elems[ 0 ];\n\n\tif ( not ) {\n\t\texpr = \":not(\" + expr + \")\";\n\t}\n\n\treturn elems.length === 1 && elem.nodeType === 1 ?\n\t\tjQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [] :\n\t\tjQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {\n\t\t\treturn elem.nodeType === 1;\n\t\t}));\n};\n\njQuery.fn.extend({\n\tfind: function( selector ) {\n\t\tvar i,\n\t\t\tlen = this.length,\n\t\t\tret = [],\n\t\t\tself = this;\n\n\t\tif ( typeof selector !== \"string\" ) {\n\t\t\treturn this.pushStack( jQuery( selector ).filter(function() {\n\t\t\t\tfor ( i = 0; i < len; i++ ) {\n\t\t\t\t\tif ( jQuery.contains( self[ i ], this ) ) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}) );\n\t\t}\n\n\t\tfor ( i = 0; i < len; i++ ) {\n\t\t\tjQuery.find( selector, self[ i ], ret );\n\t\t}\n\n\t\t// Needed because $( selector, context ) becomes $( context ).find( selector )\n\t\tret = this.pushStack( len > 1 ? jQuery.unique( ret ) : ret );\n\t\tret.selector = this.selector ? this.selector + \" \" + selector : selector;\n\t\treturn ret;\n\t},\n\tfilter: function( selector ) {\n\t\treturn this.pushStack( winnow(this, selector || [], false) );\n\t},\n\tnot: function( selector ) {\n\t\treturn this.pushStack( winnow(this, selector || [], true) );\n\t},\n\tis: function( selector ) {\n\t\treturn !!winnow(\n\t\t\tthis,\n\n\t\t\t// If this is a positional/relative selector, check membership in the returned set\n\t\t\t// so $(\"p:first\").is(\"p:last\") won't return true for a doc with two \"p\".\n\t\t\ttypeof selector === \"string\" && rneedsContext.test( selector ) ?\n\t\t\t\tjQuery( selector ) :\n\t\t\t\tselector || [],\n\t\t\tfalse\n\t\t).length;\n\t}\n});\n\n\n// Initialize a jQuery object\n\n\n// A central reference to the root jQuery(document)\nvar rootjQuery,\n\n\t// A simple way to check for HTML strings\n\t// Prioritize #id over to avoid XSS via location.hash (#9521)\n\t// Strict HTML recognition (#11290: must start with <)\n\trquickExpr = /^(?:\\s*(<[\\w\\W]+>)[^>]*|#([\\w-]*))$/,\n\n\tinit = jQuery.fn.init = function( selector, context ) {\n\t\tvar match, elem;\n\n\t\t// HANDLE: $(\"\"), $(null), $(undefined), $(false)\n\t\tif ( !selector ) {\n\t\t\treturn this;\n\t\t}\n\n\t\t// Handle HTML strings\n\t\tif ( typeof selector === \"string\" ) {\n\t\t\tif ( selector[0] === \"<\" && selector[ selector.length - 1 ] === \">\" && selector.length >= 3 ) {\n\t\t\t\t// Assume that strings that start and end with <> are HTML and skip the regex check\n\t\t\t\tmatch = [ null, selector, null ];\n\n\t\t\t} else {\n\t\t\t\tmatch = rquickExpr.exec( selector );\n\t\t\t}\n\n\t\t\t// Match html or make sure no context is specified for #id\n\t\t\tif ( match && (match[1] || !context) ) {\n\n\t\t\t\t// HANDLE: $(html) -> $(array)\n\t\t\t\tif ( match[1] ) {\n\t\t\t\t\tcontext = context instanceof jQuery ? context[0] : context;\n\n\t\t\t\t\t// Option to run scripts is true for back-compat\n\t\t\t\t\t// Intentionally let the error be thrown if parseHTML is not present\n\t\t\t\t\tjQuery.merge( this, jQuery.parseHTML(\n\t\t\t\t\t\tmatch[1],\n\t\t\t\t\t\tcontext && context.nodeType ? context.ownerDocument || context : document,\n\t\t\t\t\t\ttrue\n\t\t\t\t\t) );\n\n\t\t\t\t\t// HANDLE: $(html, props)\n\t\t\t\t\tif ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) {\n\t\t\t\t\t\tfor ( match in context ) {\n\t\t\t\t\t\t\t// Properties of context are called as methods if possible\n\t\t\t\t\t\t\tif ( jQuery.isFunction( this[ match ] ) ) {\n\t\t\t\t\t\t\t\tthis[ match ]( context[ match ] );\n\n\t\t\t\t\t\t\t// ...and otherwise set as attributes\n\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\tthis.attr( match, context[ match ] );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\treturn this;\n\n\t\t\t\t// HANDLE: $(#id)\n\t\t\t\t} else {\n\t\t\t\t\telem = document.getElementById( match[2] );\n\n\t\t\t\t\t// Support: Blackberry 4.6\n\t\t\t\t\t// gEBID returns nodes no longer in the document (#6963)\n\t\t\t\t\tif ( elem && elem.parentNode ) {\n\t\t\t\t\t\t// Inject the element directly into the jQuery object\n\t\t\t\t\t\tthis.length = 1;\n\t\t\t\t\t\tthis[0] = elem;\n\t\t\t\t\t}\n\n\t\t\t\t\tthis.context = document;\n\t\t\t\t\tthis.selector = selector;\n\t\t\t\t\treturn this;\n\t\t\t\t}\n\n\t\t\t// HANDLE: $(expr, $(...))\n\t\t\t} else if ( !context || context.jquery ) {\n\t\t\t\treturn ( context || rootjQuery ).find( selector );\n\n\t\t\t// HANDLE: $(expr, context)\n\t\t\t// (which is just equivalent to: $(context).find(expr)\n\t\t\t} else {\n\t\t\t\treturn this.constructor( context ).find( selector );\n\t\t\t}\n\n\t\t// HANDLE: $(DOMElement)\n\t\t} else if ( selector.nodeType ) {\n\t\t\tthis.context = this[0] = selector;\n\t\t\tthis.length = 1;\n\t\t\treturn this;\n\n\t\t// HANDLE: $(function)\n\t\t// Shortcut for document ready\n\t\t} else if ( jQuery.isFunction( selector ) ) {\n\t\t\treturn typeof rootjQuery.ready !== \"undefined\" ?\n\t\t\t\trootjQuery.ready( selector ) :\n\t\t\t\t// Execute immediately if ready is not present\n\t\t\t\tselector( jQuery );\n\t\t}\n\n\t\tif ( selector.selector !== undefined ) {\n\t\t\tthis.selector = selector.selector;\n\t\t\tthis.context = selector.context;\n\t\t}\n\n\t\treturn jQuery.makeArray( selector, this );\n\t};\n\n// Give the init function the jQuery prototype for later instantiation\ninit.prototype = jQuery.fn;\n\n// Initialize central reference\nrootjQuery = jQuery( document );\n\n\nvar rparentsprev = /^(?:parents|prev(?:Until|All))/,\n\t// Methods guaranteed to produce a unique set when starting from a unique set\n\tguaranteedUnique = {\n\t\tchildren: true,\n\t\tcontents: true,\n\t\tnext: true,\n\t\tprev: true\n\t};\n\njQuery.extend({\n\tdir: function( elem, dir, until ) {\n\t\tvar matched = [],\n\t\t\ttruncate = until !== undefined;\n\n\t\twhile ( (elem = elem[ dir ]) && elem.nodeType !== 9 ) {\n\t\t\tif ( elem.nodeType === 1 ) {\n\t\t\t\tif ( truncate && jQuery( elem ).is( until ) ) {\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t\tmatched.push( elem );\n\t\t\t}\n\t\t}\n\t\treturn matched;\n\t},\n\n\tsibling: function( n, elem ) {\n\t\tvar matched = [];\n\n\t\tfor ( ; n; n = n.nextSibling ) {\n\t\t\tif ( n.nodeType === 1 && n !== elem ) {\n\t\t\t\tmatched.push( n );\n\t\t\t}\n\t\t}\n\n\t\treturn matched;\n\t}\n});\n\njQuery.fn.extend({\n\thas: function( target ) {\n\t\tvar targets = jQuery( target, this ),\n\t\t\tl = targets.length;\n\n\t\treturn this.filter(function() {\n\t\t\tvar i = 0;\n\t\t\tfor ( ; i < l; i++ ) {\n\t\t\t\tif ( jQuery.contains( this, targets[i] ) ) {\n\t\t\t\t\treturn true;\n\t\t\t\t}\n\t\t\t}\n\t\t});\n\t},\n\n\tclosest: function( selectors, context ) {\n\t\tvar cur,\n\t\t\ti = 0,\n\t\t\tl = this.length,\n\t\t\tmatched = [],\n\t\t\tpos = rneedsContext.test( selectors ) || typeof selectors !== \"string\" ?\n\t\t\t\tjQuery( selectors, context || this.context ) :\n\t\t\t\t0;\n\n\t\tfor ( ; i < l; i++ ) {\n\t\t\tfor ( cur = this[i]; cur && cur !== context; cur = cur.parentNode ) {\n\t\t\t\t// Always skip document fragments\n\t\t\t\tif ( cur.nodeType < 11 && (pos ?\n\t\t\t\t\tpos.index(cur) > -1 :\n\n\t\t\t\t\t// Don't pass non-elements to Sizzle\n\t\t\t\t\tcur.nodeType === 1 &&\n\t\t\t\t\t\tjQuery.find.matchesSelector(cur, selectors)) ) {\n\n\t\t\t\t\tmatched.push( cur );\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn this.pushStack( matched.length > 1 ? jQuery.unique( matched ) : matched );\n\t},\n\n\t// Determine the position of an element within the set\n\tindex: function( elem ) {\n\n\t\t// No argument, return index in parent\n\t\tif ( !elem ) {\n\t\t\treturn ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;\n\t\t}\n\n\t\t// Index in selector\n\t\tif ( typeof elem === \"string\" ) {\n\t\t\treturn indexOf.call( jQuery( elem ), this[ 0 ] );\n\t\t}\n\n\t\t// Locate the position of the desired element\n\t\treturn indexOf.call( this,\n\n\t\t\t// If it receives a jQuery object, the first element is used\n\t\t\telem.jquery ? elem[ 0 ] : elem\n\t\t);\n\t},\n\n\tadd: function( selector, context ) {\n\t\treturn this.pushStack(\n\t\t\tjQuery.unique(\n\t\t\t\tjQuery.merge( this.get(), jQuery( selector, context ) )\n\t\t\t)\n\t\t);\n\t},\n\n\taddBack: function( selector ) {\n\t\treturn this.add( selector == null ?\n\t\t\tthis.prevObject : this.prevObject.filter(selector)\n\t\t);\n\t}\n});\n\nfunction sibling( cur, dir ) {\n\twhile ( (cur = cur[dir]) && cur.nodeType !== 1 ) {}\n\treturn cur;\n}\n\njQuery.each({\n\tparent: function( elem ) {\n\t\tvar parent = elem.parentNode;\n\t\treturn parent && parent.nodeType !== 11 ? parent : null;\n\t},\n\tparents: function( elem ) {\n\t\treturn jQuery.dir( elem, \"parentNode\" );\n\t},\n\tparentsUntil: function( elem, i, until ) {\n\t\treturn jQuery.dir( elem, \"parentNode\", until );\n\t},\n\tnext: function( elem ) {\n\t\treturn sibling( elem, \"nextSibling\" );\n\t},\n\tprev: function( elem ) {\n\t\treturn sibling( elem, \"previousSibling\" );\n\t},\n\tnextAll: function( elem ) {\n\t\treturn jQuery.dir( elem, \"nextSibling\" );\n\t},\n\tprevAll: function( elem ) {\n\t\treturn jQuery.dir( elem, \"previousSibling\" );\n\t},\n\tnextUntil: function( elem, i, until ) {\n\t\treturn jQuery.dir( elem, \"nextSibling\", until );\n\t},\n\tprevUntil: function( elem, i, until ) {\n\t\treturn jQuery.dir( elem, \"previousSibling\", until );\n\t},\n\tsiblings: function( elem ) {\n\t\treturn jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem );\n\t},\n\tchildren: function( elem ) {\n\t\treturn jQuery.sibling( elem.firstChild );\n\t},\n\tcontents: function( elem ) {\n\t\treturn elem.contentDocument || jQuery.merge( [], elem.childNodes );\n\t}\n}, function( name, fn ) {\n\tjQuery.fn[ name ] = function( until, selector ) {\n\t\tvar matched = jQuery.map( this, fn, until );\n\n\t\tif ( name.slice( -5 ) !== \"Until\" ) {\n\t\t\tselector = until;\n\t\t}\n\n\t\tif ( selector && typeof selector === \"string\" ) {\n\t\t\tmatched = jQuery.filter( selector, matched );\n\t\t}\n\n\t\tif ( this.length > 1 ) {\n\t\t\t// Remove duplicates\n\t\t\tif ( !guaranteedUnique[ name ] ) {\n\t\t\t\tjQuery.unique( matched );\n\t\t\t}\n\n\t\t\t// Reverse order for parents* and prev-derivatives\n\t\t\tif ( rparentsprev.test( name ) ) {\n\t\t\t\tmatched.reverse();\n\t\t\t}\n\t\t}\n\n\t\treturn this.pushStack( matched );\n\t};\n});\nvar rnotwhite = (/\\S+/g);\n\n\n\n// String to Object options format cache\nvar optionsCache = {};\n\n// Convert String-formatted options into Object-formatted ones and store in cache\nfunction createOptions( options ) {\n\tvar object = optionsCache[ options ] = {};\n\tjQuery.each( options.match( rnotwhite ) || [], function( _, flag ) {\n\t\tobject[ flag ] = true;\n\t});\n\treturn object;\n}\n\n/*\n * Create a callback list using the following parameters:\n *\n *\toptions: an optional list of space-separated options that will change how\n *\t\t\tthe callback list behaves or a more traditional option object\n *\n * By default a callback list will act like an event callback list and can be\n * \"fired\" multiple times.\n *\n * Possible options:\n *\n *\tonce:\t\t\twill ensure the callback list can only be fired once (like a Deferred)\n *\n *\tmemory:\t\t\twill keep track of previous values and will call any callback added\n *\t\t\t\t\tafter the list has been fired right away with the latest \"memorized\"\n *\t\t\t\t\tvalues (like a Deferred)\n *\n *\tunique:\t\t\twill ensure a callback can only be added once (no duplicate in the list)\n *\n *\tstopOnFalse:\tinterrupt callings when a callback returns false\n *\n */\njQuery.Callbacks = function( options ) {\n\n\t// Convert options from String-formatted to Object-formatted if needed\n\t// (we check in cache first)\n\toptions = typeof options === \"string\" ?\n\t\t( optionsCache[ options ] || createOptions( options ) ) :\n\t\tjQuery.extend( {}, options );\n\n\tvar // Last fire value (for non-forgettable lists)\n\t\tmemory,\n\t\t// Flag to know if list was already fired\n\t\tfired,\n\t\t// Flag to know if list is currently firing\n\t\tfiring,\n\t\t// First callback to fire (used internally by add and fireWith)\n\t\tfiringStart,\n\t\t// End of the loop when firing\n\t\tfiringLength,\n\t\t// Index of currently firing callback (modified by remove if needed)\n\t\tfiringIndex,\n\t\t// Actual callback list\n\t\tlist = [],\n\t\t// Stack of fire calls for repeatable lists\n\t\tstack = !options.once && [],\n\t\t// Fire callbacks\n\t\tfire = function( data ) {\n\t\t\tmemory = options.memory && data;\n\t\t\tfired = true;\n\t\t\tfiringIndex = firingStart || 0;\n\t\t\tfiringStart = 0;\n\t\t\tfiringLength = list.length;\n\t\t\tfiring = true;\n\t\t\tfor ( ; list && firingIndex < firingLength; firingIndex++ ) {\n\t\t\t\tif ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) {\n\t\t\t\t\tmemory = false; // To prevent further calls using add\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t\tfiring = false;\n\t\t\tif ( list ) {\n\t\t\t\tif ( stack ) {\n\t\t\t\t\tif ( stack.length ) {\n\t\t\t\t\t\tfire( stack.shift() );\n\t\t\t\t\t}\n\t\t\t\t} else if ( memory ) {\n\t\t\t\t\tlist = [];\n\t\t\t\t} else {\n\t\t\t\t\tself.disable();\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\t\t// Actual Callbacks object\n\t\tself = {\n\t\t\t// Add a callback or a collection of callbacks to the list\n\t\t\tadd: function() {\n\t\t\t\tif ( list ) {\n\t\t\t\t\t// First, we save the current length\n\t\t\t\t\tvar start = list.length;\n\t\t\t\t\t(function add( args ) {\n\t\t\t\t\t\tjQuery.each( args, function( _, arg ) {\n\t\t\t\t\t\t\tvar type = jQuery.type( arg );\n\t\t\t\t\t\t\tif ( type === \"function\" ) {\n\t\t\t\t\t\t\t\tif ( !options.unique || !self.has( arg ) ) {\n\t\t\t\t\t\t\t\t\tlist.push( arg );\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t} else if ( arg && arg.length && type !== \"string\" ) {\n\t\t\t\t\t\t\t\t// Inspect recursively\n\t\t\t\t\t\t\t\tadd( arg );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t});\n\t\t\t\t\t})( arguments );\n\t\t\t\t\t// Do we need to add the callbacks to the\n\t\t\t\t\t// current firing batch?\n\t\t\t\t\tif ( firing ) {\n\t\t\t\t\t\tfiringLength = list.length;\n\t\t\t\t\t// With memory, if we're not firing then\n\t\t\t\t\t// we should call right away\n\t\t\t\t\t} else if ( memory ) {\n\t\t\t\t\t\tfiringStart = start;\n\t\t\t\t\t\tfire( memory );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Remove a callback from the list\n\t\t\tremove: function() {\n\t\t\t\tif ( list ) {\n\t\t\t\t\tjQuery.each( arguments, function( _, arg ) {\n\t\t\t\t\t\tvar index;\n\t\t\t\t\t\twhile ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {\n\t\t\t\t\t\t\tlist.splice( index, 1 );\n\t\t\t\t\t\t\t// Handle firing indexes\n\t\t\t\t\t\t\tif ( firing ) {\n\t\t\t\t\t\t\t\tif ( index <= firingLength ) {\n\t\t\t\t\t\t\t\t\tfiringLength--;\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\tif ( index <= firingIndex ) {\n\t\t\t\t\t\t\t\t\tfiringIndex--;\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t});\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Check if a given callback is in the list.\n\t\t\t// If no argument is given, return whether or not list has callbacks attached.\n\t\t\thas: function( fn ) {\n\t\t\t\treturn fn ? jQuery.inArray( fn, list ) > -1 : !!( list && list.length );\n\t\t\t},\n\t\t\t// Remove all callbacks from the list\n\t\t\tempty: function() {\n\t\t\t\tlist = [];\n\t\t\t\tfiringLength = 0;\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Have the list do nothing anymore\n\t\t\tdisable: function() {\n\t\t\t\tlist = stack = memory = undefined;\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Is it disabled?\n\t\t\tdisabled: function() {\n\t\t\t\treturn !list;\n\t\t\t},\n\t\t\t// Lock the list in its current state\n\t\t\tlock: function() {\n\t\t\t\tstack = undefined;\n\t\t\t\tif ( !memory ) {\n\t\t\t\t\tself.disable();\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Is it locked?\n\t\t\tlocked: function() {\n\t\t\t\treturn !stack;\n\t\t\t},\n\t\t\t// Call all callbacks with the given context and arguments\n\t\t\tfireWith: function( context, args ) {\n\t\t\t\tif ( list && ( !fired || stack ) ) {\n\t\t\t\t\targs = args || [];\n\t\t\t\t\targs = [ context, args.slice ? args.slice() : args ];\n\t\t\t\t\tif ( firing ) {\n\t\t\t\t\t\tstack.push( args );\n\t\t\t\t\t} else {\n\t\t\t\t\t\tfire( args );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// Call all the callbacks with the given arguments\n\t\t\tfire: function() {\n\t\t\t\tself.fireWith( this, arguments );\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\t// To know if the callbacks have already been called at least once\n\t\t\tfired: function() {\n\t\t\t\treturn !!fired;\n\t\t\t}\n\t\t};\n\n\treturn self;\n};\n\n\njQuery.extend({\n\n\tDeferred: function( func ) {\n\t\tvar tuples = [\n\t\t\t\t// action, add listener, listener list, final state\n\t\t\t\t[ \"resolve\", \"done\", jQuery.Callbacks(\"once memory\"), \"resolved\" ],\n\t\t\t\t[ \"reject\", \"fail\", jQuery.Callbacks(\"once memory\"), \"rejected\" ],\n\t\t\t\t[ \"notify\", \"progress\", jQuery.Callbacks(\"memory\") ]\n\t\t\t],\n\t\t\tstate = \"pending\",\n\t\t\tpromise = {\n\t\t\t\tstate: function() {\n\t\t\t\t\treturn state;\n\t\t\t\t},\n\t\t\t\talways: function() {\n\t\t\t\t\tdeferred.done( arguments ).fail( arguments );\n\t\t\t\t\treturn this;\n\t\t\t\t},\n\t\t\t\tthen: function( /* fnDone, fnFail, fnProgress */ ) {\n\t\t\t\t\tvar fns = arguments;\n\t\t\t\t\treturn jQuery.Deferred(function( newDefer ) {\n\t\t\t\t\t\tjQuery.each( tuples, function( i, tuple ) {\n\t\t\t\t\t\t\tvar fn = jQuery.isFunction( fns[ i ] ) && fns[ i ];\n\t\t\t\t\t\t\t// deferred[ done | fail | progress ] for forwarding actions to newDefer\n\t\t\t\t\t\t\tdeferred[ tuple[1] ](function() {\n\t\t\t\t\t\t\t\tvar returned = fn && fn.apply( this, arguments );\n\t\t\t\t\t\t\t\tif ( returned && jQuery.isFunction( returned.promise ) ) {\n\t\t\t\t\t\t\t\t\treturned.promise()\n\t\t\t\t\t\t\t\t\t\t.done( newDefer.resolve )\n\t\t\t\t\t\t\t\t\t\t.fail( newDefer.reject )\n\t\t\t\t\t\t\t\t\t\t.progress( newDefer.notify );\n\t\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\t\tnewDefer[ tuple[ 0 ] + \"With\" ]( this === promise ? newDefer.promise() : this, fn ? [ returned ] : arguments );\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t});\n\t\t\t\t\t\t});\n\t\t\t\t\t\tfns = null;\n\t\t\t\t\t}).promise();\n\t\t\t\t},\n\t\t\t\t// Get a promise for this deferred\n\t\t\t\t// If obj is provided, the promise aspect is added to the object\n\t\t\t\tpromise: function( obj ) {\n\t\t\t\t\treturn obj != null ? jQuery.extend( obj, promise ) : promise;\n\t\t\t\t}\n\t\t\t},\n\t\t\tdeferred = {};\n\n\t\t// Keep pipe for back-compat\n\t\tpromise.pipe = promise.then;\n\n\t\t// Add list-specific methods\n\t\tjQuery.each( tuples, function( i, tuple ) {\n\t\t\tvar list = tuple[ 2 ],\n\t\t\t\tstateString = tuple[ 3 ];\n\n\t\t\t// promise[ done | fail | progress ] = list.add\n\t\t\tpromise[ tuple[1] ] = list.add;\n\n\t\t\t// Handle state\n\t\t\tif ( stateString ) {\n\t\t\t\tlist.add(function() {\n\t\t\t\t\t// state = [ resolved | rejected ]\n\t\t\t\t\tstate = stateString;\n\n\t\t\t\t// [ reject_list | resolve_list ].disable; progress_list.lock\n\t\t\t\t}, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock );\n\t\t\t}\n\n\t\t\t// deferred[ resolve | reject | notify ]\n\t\t\tdeferred[ tuple[0] ] = function() {\n\t\t\t\tdeferred[ tuple[0] + \"With\" ]( this === deferred ? promise : this, arguments );\n\t\t\t\treturn this;\n\t\t\t};\n\t\t\tdeferred[ tuple[0] + \"With\" ] = list.fireWith;\n\t\t});\n\n\t\t// Make the deferred a promise\n\t\tpromise.promise( deferred );\n\n\t\t// Call given func if any\n\t\tif ( func ) {\n\t\t\tfunc.call( deferred, deferred );\n\t\t}\n\n\t\t// All done!\n\t\treturn deferred;\n\t},\n\n\t// Deferred helper\n\twhen: function( subordinate /* , ..., subordinateN */ ) {\n\t\tvar i = 0,\n\t\t\tresolveValues = slice.call( arguments ),\n\t\t\tlength = resolveValues.length,\n\n\t\t\t// the count of uncompleted subordinates\n\t\t\tremaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0,\n\n\t\t\t// the master Deferred. If resolveValues consist of only a single Deferred, just use that.\n\t\t\tdeferred = remaining === 1 ? subordinate : jQuery.Deferred(),\n\n\t\t\t// Update function for both resolve and progress values\n\t\t\tupdateFunc = function( i, contexts, values ) {\n\t\t\t\treturn function( value ) {\n\t\t\t\t\tcontexts[ i ] = this;\n\t\t\t\t\tvalues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;\n\t\t\t\t\tif ( values === progressValues ) {\n\t\t\t\t\t\tdeferred.notifyWith( contexts, values );\n\t\t\t\t\t} else if ( !( --remaining ) ) {\n\t\t\t\t\t\tdeferred.resolveWith( contexts, values );\n\t\t\t\t\t}\n\t\t\t\t};\n\t\t\t},\n\n\t\t\tprogressValues, progressContexts, resolveContexts;\n\n\t\t// Add listeners to Deferred subordinates; treat others as resolved\n\t\tif ( length > 1 ) {\n\t\t\tprogressValues = new Array( length );\n\t\t\tprogressContexts = new Array( length );\n\t\t\tresolveContexts = new Array( length );\n\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\tif ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) {\n\t\t\t\t\tresolveValues[ i ].promise()\n\t\t\t\t\t\t.done( updateFunc( i, resolveContexts, resolveValues ) )\n\t\t\t\t\t\t.fail( deferred.reject )\n\t\t\t\t\t\t.progress( updateFunc( i, progressContexts, progressValues ) );\n\t\t\t\t} else {\n\t\t\t\t\t--remaining;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// If we're not waiting on anything, resolve the master\n\t\tif ( !remaining ) {\n\t\t\tdeferred.resolveWith( resolveContexts, resolveValues );\n\t\t}\n\n\t\treturn deferred.promise();\n\t}\n});\n\n\n// The deferred used on DOM ready\nvar readyList;\n\njQuery.fn.ready = function( fn ) {\n\t// Add the callback\n\tjQuery.ready.promise().done( fn );\n\n\treturn this;\n};\n\njQuery.extend({\n\t// Is the DOM ready to be used? Set to true once it occurs.\n\tisReady: false,\n\n\t// A counter to track how many items to wait for before\n\t// the ready event fires. See #6781\n\treadyWait: 1,\n\n\t// Hold (or release) the ready event\n\tholdReady: function( hold ) {\n\t\tif ( hold ) {\n\t\t\tjQuery.readyWait++;\n\t\t} else {\n\t\t\tjQuery.ready( true );\n\t\t}\n\t},\n\n\t// Handle when the DOM is ready\n\tready: function( wait ) {\n\n\t\t// Abort if there are pending holds or we're already ready\n\t\tif ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Remember that the DOM is ready\n\t\tjQuery.isReady = true;\n\n\t\t// If a normal DOM Ready event fired, decrement, and wait if need be\n\t\tif ( wait !== true && --jQuery.readyWait > 0 ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// If there are functions bound, to execute\n\t\treadyList.resolveWith( document, [ jQuery ] );\n\n\t\t// Trigger any bound ready events\n\t\tif ( jQuery.fn.triggerHandler ) {\n\t\t\tjQuery( document ).triggerHandler( \"ready\" );\n\t\t\tjQuery( document ).off( \"ready\" );\n\t\t}\n\t}\n});\n\n/**\n * The ready event handler and self cleanup method\n */\nfunction completed() {\n\tdocument.removeEventListener( \"DOMContentLoaded\", completed, false );\n\twindow.removeEventListener( \"load\", completed, false );\n\tjQuery.ready();\n}\n\njQuery.ready.promise = function( obj ) {\n\tif ( !readyList ) {\n\n\t\treadyList = jQuery.Deferred();\n\n\t\t// Catch cases where $(document).ready() is called after the browser event has already occurred.\n\t\t// We once tried to use readyState \"interactive\" here, but it caused issues like the one\n\t\t// discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15\n\t\tif ( document.readyState === \"complete\" ) {\n\t\t\t// Handle it asynchronously to allow scripts the opportunity to delay ready\n\t\t\tsetTimeout( jQuery.ready );\n\n\t\t} else {\n\n\t\t\t// Use the handy event callback\n\t\t\tdocument.addEventListener( \"DOMContentLoaded\", completed, false );\n\n\t\t\t// A fallback to window.onload, that will always work\n\t\t\twindow.addEventListener( \"load\", completed, false );\n\t\t}\n\t}\n\treturn readyList.promise( obj );\n};\n\n// Kick off the DOM ready check even if the user does not\njQuery.ready.promise();\n\n\n\n\n// Multifunctional method to get and set values of a collection\n// The value/s can optionally be executed if it's a function\nvar access = jQuery.access = function( elems, fn, key, value, chainable, emptyGet, raw ) {\n\tvar i = 0,\n\t\tlen = elems.length,\n\t\tbulk = key == null;\n\n\t// Sets many values\n\tif ( jQuery.type( key ) === \"object\" ) {\n\t\tchainable = true;\n\t\tfor ( i in key ) {\n\t\t\tjQuery.access( elems, fn, i, key[i], true, emptyGet, raw );\n\t\t}\n\n\t// Sets one value\n\t} else if ( value !== undefined ) {\n\t\tchainable = true;\n\n\t\tif ( !jQuery.isFunction( value ) ) {\n\t\t\traw = true;\n\t\t}\n\n\t\tif ( bulk ) {\n\t\t\t// Bulk operations run against the entire set\n\t\t\tif ( raw ) {\n\t\t\t\tfn.call( elems, value );\n\t\t\t\tfn = null;\n\n\t\t\t// ...except when executing function values\n\t\t\t} else {\n\t\t\t\tbulk = fn;\n\t\t\t\tfn = function( elem, key, value ) {\n\t\t\t\t\treturn bulk.call( jQuery( elem ), value );\n\t\t\t\t};\n\t\t\t}\n\t\t}\n\n\t\tif ( fn ) {\n\t\t\tfor ( ; i < len; i++ ) {\n\t\t\t\tfn( elems[i], key, raw ? value : value.call( elems[i], i, fn( elems[i], key ) ) );\n\t\t\t}\n\t\t}\n\t}\n\n\treturn chainable ?\n\t\telems :\n\n\t\t// Gets\n\t\tbulk ?\n\t\t\tfn.call( elems ) :\n\t\t\tlen ? fn( elems[0], key ) : emptyGet;\n};\n\n\n/**\n * Determines whether an object can have data\n */\njQuery.acceptData = function( owner ) {\n\t// Accepts only:\n\t// - Node\n\t// - Node.ELEMENT_NODE\n\t// - Node.DOCUMENT_NODE\n\t// - Object\n\t// - Any\n\t/* jshint -W018 */\n\treturn owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType );\n};\n\n\nfunction Data() {\n\t// Support: Android<4,\n\t// Old WebKit does not have Object.preventExtensions/freeze method,\n\t// return new empty object instead with no [[set]] accessor\n\tObject.defineProperty( this.cache = {}, 0, {\n\t\tget: function() {\n\t\t\treturn {};\n\t\t}\n\t});\n\n\tthis.expando = jQuery.expando + Data.uid++;\n}\n\nData.uid = 1;\nData.accepts = jQuery.acceptData;\n\nData.prototype = {\n\tkey: function( owner ) {\n\t\t// We can accept data for non-element nodes in modern browsers,\n\t\t// but we should not, see #8335.\n\t\t// Always return the key for a frozen object.\n\t\tif ( !Data.accepts( owner ) ) {\n\t\t\treturn 0;\n\t\t}\n\n\t\tvar descriptor = {},\n\t\t\t// Check if the owner object already has a cache key\n\t\t\tunlock = owner[ this.expando ];\n\n\t\t// If not, create one\n\t\tif ( !unlock ) {\n\t\t\tunlock = Data.uid++;\n\n\t\t\t// Secure it in a non-enumerable, non-writable property\n\t\t\ttry {\n\t\t\t\tdescriptor[ this.expando ] = { value: unlock };\n\t\t\t\tObject.defineProperties( owner, descriptor );\n\n\t\t\t// Support: Android<4\n\t\t\t// Fallback to a less secure definition\n\t\t\t} catch ( e ) {\n\t\t\t\tdescriptor[ this.expando ] = unlock;\n\t\t\t\tjQuery.extend( owner, descriptor );\n\t\t\t}\n\t\t}\n\n\t\t// Ensure the cache object\n\t\tif ( !this.cache[ unlock ] ) {\n\t\t\tthis.cache[ unlock ] = {};\n\t\t}\n\n\t\treturn unlock;\n\t},\n\tset: function( owner, data, value ) {\n\t\tvar prop,\n\t\t\t// There may be an unlock assigned to this node,\n\t\t\t// if there is no entry for this \"owner\", create one inline\n\t\t\t// and set the unlock as though an owner entry had always existed\n\t\t\tunlock = this.key( owner ),\n\t\t\tcache = this.cache[ unlock ];\n\n\t\t// Handle: [ owner, key, value ] args\n\t\tif ( typeof data === \"string\" ) {\n\t\t\tcache[ data ] = value;\n\n\t\t// Handle: [ owner, { properties } ] args\n\t\t} else {\n\t\t\t// Fresh assignments by object are shallow copied\n\t\t\tif ( jQuery.isEmptyObject( cache ) ) {\n\t\t\t\tjQuery.extend( this.cache[ unlock ], data );\n\t\t\t// Otherwise, copy the properties one-by-one to the cache object\n\t\t\t} else {\n\t\t\t\tfor ( prop in data ) {\n\t\t\t\t\tcache[ prop ] = data[ prop ];\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\treturn cache;\n\t},\n\tget: function( owner, key ) {\n\t\t// Either a valid cache is found, or will be created.\n\t\t// New caches will be created and the unlock returned,\n\t\t// allowing direct access to the newly created\n\t\t// empty data object. A valid owner object must be provided.\n\t\tvar cache = this.cache[ this.key( owner ) ];\n\n\t\treturn key === undefined ?\n\t\t\tcache : cache[ key ];\n\t},\n\taccess: function( owner, key, value ) {\n\t\tvar stored;\n\t\t// In cases where either:\n\t\t//\n\t\t// 1. No key was specified\n\t\t// 2. A string key was specified, but no value provided\n\t\t//\n\t\t// Take the \"read\" path and allow the get method to determine\n\t\t// which value to return, respectively either:\n\t\t//\n\t\t// 1. The entire cache object\n\t\t// 2. The data stored at the key\n\t\t//\n\t\tif ( key === undefined ||\n\t\t\t\t((key && typeof key === \"string\") && value === undefined) ) {\n\n\t\t\tstored = this.get( owner, key );\n\n\t\t\treturn stored !== undefined ?\n\t\t\t\tstored : this.get( owner, jQuery.camelCase(key) );\n\t\t}\n\n\t\t// [*]When the key is not a string, or both a key and value\n\t\t// are specified, set or extend (existing objects) with either:\n\t\t//\n\t\t// 1. An object of properties\n\t\t// 2. A key and value\n\t\t//\n\t\tthis.set( owner, key, value );\n\n\t\t// Since the \"set\" path can have two possible entry points\n\t\t// return the expected data based on which path was taken[*]\n\t\treturn value !== undefined ? value : key;\n\t},\n\tremove: function( owner, key ) {\n\t\tvar i, name, camel,\n\t\t\tunlock = this.key( owner ),\n\t\t\tcache = this.cache[ unlock ];\n\n\t\tif ( key === undefined ) {\n\t\t\tthis.cache[ unlock ] = {};\n\n\t\t} else {\n\t\t\t// Support array or space separated string of keys\n\t\t\tif ( jQuery.isArray( key ) ) {\n\t\t\t\t// If \"name\" is an array of keys...\n\t\t\t\t// When data is initially created, via (\"key\", \"val\") signature,\n\t\t\t\t// keys will be converted to camelCase.\n\t\t\t\t// Since there is no way to tell _how_ a key was added, remove\n\t\t\t\t// both plain key and camelCase key. #12786\n\t\t\t\t// This will only penalize the array argument path.\n\t\t\t\tname = key.concat( key.map( jQuery.camelCase ) );\n\t\t\t} else {\n\t\t\t\tcamel = jQuery.camelCase( key );\n\t\t\t\t// Try the string as a key before any manipulation\n\t\t\t\tif ( key in cache ) {\n\t\t\t\t\tname = [ key, camel ];\n\t\t\t\t} else {\n\t\t\t\t\t// If a key with the spaces exists, use it.\n\t\t\t\t\t// Otherwise, create an array by matching non-whitespace\n\t\t\t\t\tname = camel;\n\t\t\t\t\tname = name in cache ?\n\t\t\t\t\t\t[ name ] : ( name.match( rnotwhite ) || [] );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\ti = name.length;\n\t\t\twhile ( i-- ) {\n\t\t\t\tdelete cache[ name[ i ] ];\n\t\t\t}\n\t\t}\n\t},\n\thasData: function( owner ) {\n\t\treturn !jQuery.isEmptyObject(\n\t\t\tthis.cache[ owner[ this.expando ] ] || {}\n\t\t);\n\t},\n\tdiscard: function( owner ) {\n\t\tif ( owner[ this.expando ] ) {\n\t\t\tdelete this.cache[ owner[ this.expando ] ];\n\t\t}\n\t}\n};\nvar data_priv = new Data();\n\nvar data_user = new Data();\n\n\n\n//\tImplementation Summary\n//\n//\t1. Enforce API surface and semantic compatibility with 1.9.x branch\n//\t2. Improve the module's maintainability by reducing the storage\n//\t\tpaths to a single mechanism.\n//\t3. Use the same single mechanism to support \"private\" and \"user\" data.\n//\t4. _Never_ expose \"private\" data to user code (TODO: Drop _data, _removeData)\n//\t5. Avoid exposing implementation details on user objects (eg. expando properties)\n//\t6. Provide a clear path for implementation upgrade to WeakMap in 2014\n\nvar rbrace = /^(?:\\{[\\w\\W]*\\}|\\[[\\w\\W]*\\])$/,\n\trmultiDash = /([A-Z])/g;\n\nfunction dataAttr( elem, key, data ) {\n\tvar name;\n\n\t// If nothing was found internally, try to fetch any\n\t// data from the HTML5 data-* attribute\n\tif ( data === undefined && elem.nodeType === 1 ) {\n\t\tname = \"data-\" + key.replace( rmultiDash, \"-$1\" ).toLowerCase();\n\t\tdata = elem.getAttribute( name );\n\n\t\tif ( typeof data === \"string\" ) {\n\t\t\ttry {\n\t\t\t\tdata = data === \"true\" ? true :\n\t\t\t\t\tdata === \"false\" ? false :\n\t\t\t\t\tdata === \"null\" ? null :\n\t\t\t\t\t// Only convert to a number if it doesn't change the string\n\t\t\t\t\t+data + \"\" === data ? +data :\n\t\t\t\t\trbrace.test( data ) ? jQuery.parseJSON( data ) :\n\t\t\t\t\tdata;\n\t\t\t} catch( e ) {}\n\n\t\t\t// Make sure we set the data so it isn't changed later\n\t\t\tdata_user.set( elem, key, data );\n\t\t} else {\n\t\t\tdata = undefined;\n\t\t}\n\t}\n\treturn data;\n}\n\njQuery.extend({\n\thasData: function( elem ) {\n\t\treturn data_user.hasData( elem ) || data_priv.hasData( elem );\n\t},\n\n\tdata: function( elem, name, data ) {\n\t\treturn data_user.access( elem, name, data );\n\t},\n\n\tremoveData: function( elem, name ) {\n\t\tdata_user.remove( elem, name );\n\t},\n\n\t// TODO: Now that all calls to _data and _removeData have been replaced\n\t// with direct calls to data_priv methods, these can be deprecated.\n\t_data: function( elem, name, data ) {\n\t\treturn data_priv.access( elem, name, data );\n\t},\n\n\t_removeData: function( elem, name ) {\n\t\tdata_priv.remove( elem, name );\n\t}\n});\n\njQuery.fn.extend({\n\tdata: function( key, value ) {\n\t\tvar i, name, data,\n\t\t\telem = this[ 0 ],\n\t\t\tattrs = elem && elem.attributes;\n\n\t\t// Gets all values\n\t\tif ( key === undefined ) {\n\t\t\tif ( this.length ) {\n\t\t\t\tdata = data_user.get( elem );\n\n\t\t\t\tif ( elem.nodeType === 1 && !data_priv.get( elem, \"hasDataAttrs\" ) ) {\n\t\t\t\t\ti = attrs.length;\n\t\t\t\t\twhile ( i-- ) {\n\n\t\t\t\t\t\t// Support: IE11+\n\t\t\t\t\t\t// The attrs elements can be null (#14894)\n\t\t\t\t\t\tif ( attrs[ i ] ) {\n\t\t\t\t\t\t\tname = attrs[ i ].name;\n\t\t\t\t\t\t\tif ( name.indexOf( \"data-\" ) === 0 ) {\n\t\t\t\t\t\t\t\tname = jQuery.camelCase( name.slice(5) );\n\t\t\t\t\t\t\t\tdataAttr( elem, name, data[ name ] );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tdata_priv.set( elem, \"hasDataAttrs\", true );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\treturn data;\n\t\t}\n\n\t\t// Sets multiple values\n\t\tif ( typeof key === \"object\" ) {\n\t\t\treturn this.each(function() {\n\t\t\t\tdata_user.set( this, key );\n\t\t\t});\n\t\t}\n\n\t\treturn access( this, function( value ) {\n\t\t\tvar data,\n\t\t\t\tcamelKey = jQuery.camelCase( key );\n\n\t\t\t// The calling jQuery object (element matches) is not empty\n\t\t\t// (and therefore has an element appears at this[ 0 ]) and the\n\t\t\t// `value` parameter was not undefined. An empty jQuery object\n\t\t\t// will result in `undefined` for elem = this[ 0 ] which will\n\t\t\t// throw an exception if an attempt to read a data cache is made.\n\t\t\tif ( elem && value === undefined ) {\n\t\t\t\t// Attempt to get data from the cache\n\t\t\t\t// with the key as-is\n\t\t\t\tdata = data_user.get( elem, key );\n\t\t\t\tif ( data !== undefined ) {\n\t\t\t\t\treturn data;\n\t\t\t\t}\n\n\t\t\t\t// Attempt to get data from the cache\n\t\t\t\t// with the key camelized\n\t\t\t\tdata = data_user.get( elem, camelKey );\n\t\t\t\tif ( data !== undefined ) {\n\t\t\t\t\treturn data;\n\t\t\t\t}\n\n\t\t\t\t// Attempt to \"discover\" the data in\n\t\t\t\t// HTML5 custom data-* attrs\n\t\t\t\tdata = dataAttr( elem, camelKey, undefined );\n\t\t\t\tif ( data !== undefined ) {\n\t\t\t\t\treturn data;\n\t\t\t\t}\n\n\t\t\t\t// We tried really hard, but the data doesn't exist.\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\t// Set the data...\n\t\t\tthis.each(function() {\n\t\t\t\t// First, attempt to store a copy or reference of any\n\t\t\t\t// data that might've been store with a camelCased key.\n\t\t\t\tvar data = data_user.get( this, camelKey );\n\n\t\t\t\t// For HTML5 data-* attribute interop, we have to\n\t\t\t\t// store property names with dashes in a camelCase form.\n\t\t\t\t// This might not apply to all properties...*\n\t\t\t\tdata_user.set( this, camelKey, value );\n\n\t\t\t\t// *... In the case of properties that might _actually_\n\t\t\t\t// have dashes, we need to also store a copy of that\n\t\t\t\t// unchanged property.\n\t\t\t\tif ( key.indexOf(\"-\") !== -1 && data !== undefined ) {\n\t\t\t\t\tdata_user.set( this, key, value );\n\t\t\t\t}\n\t\t\t});\n\t\t}, null, value, arguments.length > 1, null, true );\n\t},\n\n\tremoveData: function( key ) {\n\t\treturn this.each(function() {\n\t\t\tdata_user.remove( this, key );\n\t\t});\n\t}\n});\n\n\njQuery.extend({\n\tqueue: function( elem, type, data ) {\n\t\tvar queue;\n\n\t\tif ( elem ) {\n\t\t\ttype = ( type || \"fx\" ) + \"queue\";\n\t\t\tqueue = data_priv.get( elem, type );\n\n\t\t\t// Speed up dequeue by getting out quickly if this is just a lookup\n\t\t\tif ( data ) {\n\t\t\t\tif ( !queue || jQuery.isArray( data ) ) {\n\t\t\t\t\tqueue = data_priv.access( elem, type, jQuery.makeArray(data) );\n\t\t\t\t} else {\n\t\t\t\t\tqueue.push( data );\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn queue || [];\n\t\t}\n\t},\n\n\tdequeue: function( elem, type ) {\n\t\ttype = type || \"fx\";\n\n\t\tvar queue = jQuery.queue( elem, type ),\n\t\t\tstartLength = queue.length,\n\t\t\tfn = queue.shift(),\n\t\t\thooks = jQuery._queueHooks( elem, type ),\n\t\t\tnext = function() {\n\t\t\t\tjQuery.dequeue( elem, type );\n\t\t\t};\n\n\t\t// If the fx queue is dequeued, always remove the progress sentinel\n\t\tif ( fn === \"inprogress\" ) {\n\t\t\tfn = queue.shift();\n\t\t\tstartLength--;\n\t\t}\n\n\t\tif ( fn ) {\n\n\t\t\t// Add a progress sentinel to prevent the fx queue from being\n\t\t\t// automatically dequeued\n\t\t\tif ( type === \"fx\" ) {\n\t\t\t\tqueue.unshift( \"inprogress\" );\n\t\t\t}\n\n\t\t\t// Clear up the last queue stop function\n\t\t\tdelete hooks.stop;\n\t\t\tfn.call( elem, next, hooks );\n\t\t}\n\n\t\tif ( !startLength && hooks ) {\n\t\t\thooks.empty.fire();\n\t\t}\n\t},\n\n\t// Not public - generate a queueHooks object, or return the current one\n\t_queueHooks: function( elem, type ) {\n\t\tvar key = type + \"queueHooks\";\n\t\treturn data_priv.get( elem, key ) || data_priv.access( elem, key, {\n\t\t\tempty: jQuery.Callbacks(\"once memory\").add(function() {\n\t\t\t\tdata_priv.remove( elem, [ type + \"queue\", key ] );\n\t\t\t})\n\t\t});\n\t}\n});\n\njQuery.fn.extend({\n\tqueue: function( type, data ) {\n\t\tvar setter = 2;\n\n\t\tif ( typeof type !== \"string\" ) {\n\t\t\tdata = type;\n\t\t\ttype = \"fx\";\n\t\t\tsetter--;\n\t\t}\n\n\t\tif ( arguments.length < setter ) {\n\t\t\treturn jQuery.queue( this[0], type );\n\t\t}\n\n\t\treturn data === undefined ?\n\t\t\tthis :\n\t\t\tthis.each(function() {\n\t\t\t\tvar queue = jQuery.queue( this, type, data );\n\n\t\t\t\t// Ensure a hooks for this queue\n\t\t\t\tjQuery._queueHooks( this, type );\n\n\t\t\t\tif ( type === \"fx\" && queue[0] !== \"inprogress\" ) {\n\t\t\t\t\tjQuery.dequeue( this, type );\n\t\t\t\t}\n\t\t\t});\n\t},\n\tdequeue: function( type ) {\n\t\treturn this.each(function() {\n\t\t\tjQuery.dequeue( this, type );\n\t\t});\n\t},\n\tclearQueue: function( type ) {\n\t\treturn this.queue( type || \"fx\", [] );\n\t},\n\t// Get a promise resolved when queues of a certain type\n\t// are emptied (fx is the type by default)\n\tpromise: function( type, obj ) {\n\t\tvar tmp,\n\t\t\tcount = 1,\n\t\t\tdefer = jQuery.Deferred(),\n\t\t\telements = this,\n\t\t\ti = this.length,\n\t\t\tresolve = function() {\n\t\t\t\tif ( !( --count ) ) {\n\t\t\t\t\tdefer.resolveWith( elements, [ elements ] );\n\t\t\t\t}\n\t\t\t};\n\n\t\tif ( typeof type !== \"string\" ) {\n\t\t\tobj = type;\n\t\t\ttype = undefined;\n\t\t}\n\t\ttype = type || \"fx\";\n\n\t\twhile ( i-- ) {\n\t\t\ttmp = data_priv.get( elements[ i ], type + \"queueHooks\" );\n\t\t\tif ( tmp && tmp.empty ) {\n\t\t\t\tcount++;\n\t\t\t\ttmp.empty.add( resolve );\n\t\t\t}\n\t\t}\n\t\tresolve();\n\t\treturn defer.promise( obj );\n\t}\n});\nvar pnum = (/[+-]?(?:\\d*\\.|)\\d+(?:[eE][+-]?\\d+|)/).source;\n\nvar cssExpand = [ \"Top\", \"Right\", \"Bottom\", \"Left\" ];\n\nvar isHidden = function( elem, el ) {\n\t\t// isHidden might be called from jQuery#filter function;\n\t\t// in that case, element will be second argument\n\t\telem = el || elem;\n\t\treturn jQuery.css( elem, \"display\" ) === \"none\" || !jQuery.contains( elem.ownerDocument, elem );\n\t};\n\nvar rcheckableType = (/^(?:checkbox|radio)$/i);\n\n\n\n(function() {\n\tvar fragment = document.createDocumentFragment(),\n\t\tdiv = fragment.appendChild( document.createElement( \"div\" ) ),\n\t\tinput = document.createElement( \"input\" );\n\n\t// Support: Safari<=5.1\n\t// Check state lost if the name is set (#11217)\n\t// Support: Windows Web Apps (WWA)\n\t// `name` and `type` must use .setAttribute for WWA (#14901)\n\tinput.setAttribute( \"type\", \"radio\" );\n\tinput.setAttribute( \"checked\", \"checked\" );\n\tinput.setAttribute( \"name\", \"t\" );\n\n\tdiv.appendChild( input );\n\n\t// Support: Safari<=5.1, Android<4.2\n\t// Older WebKit doesn't clone checked state correctly in fragments\n\tsupport.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;\n\n\t// Support: IE<=11+\n\t// Make sure textarea (and checkbox) defaultValue is properly cloned\n\tdiv.innerHTML = \"\";\n\tsupport.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;\n})();\nvar strundefined = typeof undefined;\n\n\n\nsupport.focusinBubbles = \"onfocusin\" in window;\n\n\nvar\n\trkeyEvent = /^key/,\n\trmouseEvent = /^(?:mouse|pointer|contextmenu)|click/,\n\trfocusMorph = /^(?:focusinfocus|focusoutblur)$/,\n\trtypenamespace = /^([^.]*)(?:\\.(.+)|)$/;\n\nfunction returnTrue() {\n\treturn true;\n}\n\nfunction returnFalse() {\n\treturn false;\n}\n\nfunction safeActiveElement() {\n\ttry {\n\t\treturn document.activeElement;\n\t} catch ( err ) { }\n}\n\n/*\n * Helper functions for managing events -- not part of the public interface.\n * Props to Dean Edwards' addEvent library for many of the ideas.\n */\njQuery.event = {\n\n\tglobal: {},\n\n\tadd: function( elem, types, handler, data, selector ) {\n\n\t\tvar handleObjIn, eventHandle, tmp,\n\t\t\tevents, t, handleObj,\n\t\t\tspecial, handlers, type, namespaces, origType,\n\t\t\telemData = data_priv.get( elem );\n\n\t\t// Don't attach events to noData or text/comment nodes (but allow plain objects)\n\t\tif ( !elemData ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Caller can pass in an object of custom data in lieu of the handler\n\t\tif ( handler.handler ) {\n\t\t\thandleObjIn = handler;\n\t\t\thandler = handleObjIn.handler;\n\t\t\tselector = handleObjIn.selector;\n\t\t}\n\n\t\t// Make sure that the handler has a unique ID, used to find/remove it later\n\t\tif ( !handler.guid ) {\n\t\t\thandler.guid = jQuery.guid++;\n\t\t}\n\n\t\t// Init the element's event structure and main handler, if this is the first\n\t\tif ( !(events = elemData.events) ) {\n\t\t\tevents = elemData.events = {};\n\t\t}\n\t\tif ( !(eventHandle = elemData.handle) ) {\n\t\t\teventHandle = elemData.handle = function( e ) {\n\t\t\t\t// Discard the second event of a jQuery.event.trigger() and\n\t\t\t\t// when an event is called after a page has unloaded\n\t\t\t\treturn typeof jQuery !== strundefined && jQuery.event.triggered !== e.type ?\n\t\t\t\t\tjQuery.event.dispatch.apply( elem, arguments ) : undefined;\n\t\t\t};\n\t\t}\n\n\t\t// Handle multiple events separated by a space\n\t\ttypes = ( types || \"\" ).match( rnotwhite ) || [ \"\" ];\n\t\tt = types.length;\n\t\twhile ( t-- ) {\n\t\t\ttmp = rtypenamespace.exec( types[t] ) || [];\n\t\t\ttype = origType = tmp[1];\n\t\t\tnamespaces = ( tmp[2] || \"\" ).split( \".\" ).sort();\n\n\t\t\t// There *must* be a type, no attaching namespace-only handlers\n\t\t\tif ( !type ) {\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\t// If event changes its type, use the special event handlers for the changed type\n\t\t\tspecial = jQuery.event.special[ type ] || {};\n\n\t\t\t// If selector defined, determine special event api type, otherwise given type\n\t\t\ttype = ( selector ? special.delegateType : special.bindType ) || type;\n\n\t\t\t// Update special based on newly reset type\n\t\t\tspecial = jQuery.event.special[ type ] || {};\n\n\t\t\t// handleObj is passed to all event handlers\n\t\t\thandleObj = jQuery.extend({\n\t\t\t\ttype: type,\n\t\t\t\torigType: origType,\n\t\t\t\tdata: data,\n\t\t\t\thandler: handler,\n\t\t\t\tguid: handler.guid,\n\t\t\t\tselector: selector,\n\t\t\t\tneedsContext: selector && jQuery.expr.match.needsContext.test( selector ),\n\t\t\t\tnamespace: namespaces.join(\".\")\n\t\t\t}, handleObjIn );\n\n\t\t\t// Init the event handler queue if we're the first\n\t\t\tif ( !(handlers = events[ type ]) ) {\n\t\t\t\thandlers = events[ type ] = [];\n\t\t\t\thandlers.delegateCount = 0;\n\n\t\t\t\t// Only use addEventListener if the special events handler returns false\n\t\t\t\tif ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {\n\t\t\t\t\tif ( elem.addEventListener ) {\n\t\t\t\t\t\telem.addEventListener( type, eventHandle, false );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif ( special.add ) {\n\t\t\t\tspecial.add.call( elem, handleObj );\n\n\t\t\t\tif ( !handleObj.handler.guid ) {\n\t\t\t\t\thandleObj.handler.guid = handler.guid;\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Add to the element's handler list, delegates in front\n\t\t\tif ( selector ) {\n\t\t\t\thandlers.splice( handlers.delegateCount++, 0, handleObj );\n\t\t\t} else {\n\t\t\t\thandlers.push( handleObj );\n\t\t\t}\n\n\t\t\t// Keep track of which events have ever been used, for event optimization\n\t\t\tjQuery.event.global[ type ] = true;\n\t\t}\n\n\t},\n\n\t// Detach an event or set of events from an element\n\tremove: function( elem, types, handler, selector, mappedTypes ) {\n\n\t\tvar j, origCount, tmp,\n\t\t\tevents, t, handleObj,\n\t\t\tspecial, handlers, type, namespaces, origType,\n\t\t\telemData = data_priv.hasData( elem ) && data_priv.get( elem );\n\n\t\tif ( !elemData || !(events = elemData.events) ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Once for each type.namespace in types; type may be omitted\n\t\ttypes = ( types || \"\" ).match( rnotwhite ) || [ \"\" ];\n\t\tt = types.length;\n\t\twhile ( t-- ) {\n\t\t\ttmp = rtypenamespace.exec( types[t] ) || [];\n\t\t\ttype = origType = tmp[1];\n\t\t\tnamespaces = ( tmp[2] || \"\" ).split( \".\" ).sort();\n\n\t\t\t// Unbind all events (on this namespace, if provided) for the element\n\t\t\tif ( !type ) {\n\t\t\t\tfor ( type in events ) {\n\t\t\t\t\tjQuery.event.remove( elem, type + types[ t ], handler, selector, true );\n\t\t\t\t}\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\tspecial = jQuery.event.special[ type ] || {};\n\t\t\ttype = ( selector ? special.delegateType : special.bindType ) || type;\n\t\t\thandlers = events[ type ] || [];\n\t\t\ttmp = tmp[2] && new RegExp( \"(^|\\\\.)\" + namespaces.join(\"\\\\.(?:.*\\\\.|)\") + \"(\\\\.|$)\" );\n\n\t\t\t// Remove matching events\n\t\t\torigCount = j = handlers.length;\n\t\t\twhile ( j-- ) {\n\t\t\t\thandleObj = handlers[ j ];\n\n\t\t\t\tif ( ( mappedTypes || origType === handleObj.origType ) &&\n\t\t\t\t\t( !handler || handler.guid === handleObj.guid ) &&\n\t\t\t\t\t( !tmp || tmp.test( handleObj.namespace ) ) &&\n\t\t\t\t\t( !selector || selector === handleObj.selector || selector === \"**\" && handleObj.selector ) ) {\n\t\t\t\t\thandlers.splice( j, 1 );\n\n\t\t\t\t\tif ( handleObj.selector ) {\n\t\t\t\t\t\thandlers.delegateCount--;\n\t\t\t\t\t}\n\t\t\t\t\tif ( special.remove ) {\n\t\t\t\t\t\tspecial.remove.call( elem, handleObj );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Remove generic event handler if we removed something and no more handlers exist\n\t\t\t// (avoids potential for endless recursion during removal of special event handlers)\n\t\t\tif ( origCount && !handlers.length ) {\n\t\t\t\tif ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) {\n\t\t\t\t\tjQuery.removeEvent( elem, type, elemData.handle );\n\t\t\t\t}\n\n\t\t\t\tdelete events[ type ];\n\t\t\t}\n\t\t}\n\n\t\t// Remove the expando if it's no longer used\n\t\tif ( jQuery.isEmptyObject( events ) ) {\n\t\t\tdelete elemData.handle;\n\t\t\tdata_priv.remove( elem, \"events\" );\n\t\t}\n\t},\n\n\ttrigger: function( event, data, elem, onlyHandlers ) {\n\n\t\tvar i, cur, tmp, bubbleType, ontype, handle, special,\n\t\t\teventPath = [ elem || document ],\n\t\t\ttype = hasOwn.call( event, \"type\" ) ? event.type : event,\n\t\t\tnamespaces = hasOwn.call( event, \"namespace\" ) ? event.namespace.split(\".\") : [];\n\n\t\tcur = tmp = elem = elem || document;\n\n\t\t// Don't do events on text and comment nodes\n\t\tif ( elem.nodeType === 3 || elem.nodeType === 8 ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// focus/blur morphs to focusin/out; ensure we're not firing them right now\n\t\tif ( rfocusMorph.test( type + jQuery.event.triggered ) ) {\n\t\t\treturn;\n\t\t}\n\n\t\tif ( type.indexOf(\".\") >= 0 ) {\n\t\t\t// Namespaced trigger; create a regexp to match event type in handle()\n\t\t\tnamespaces = type.split(\".\");\n\t\t\ttype = namespaces.shift();\n\t\t\tnamespaces.sort();\n\t\t}\n\t\tontype = type.indexOf(\":\") < 0 && \"on\" + type;\n\n\t\t// Caller can pass in a jQuery.Event object, Object, or just an event type string\n\t\tevent = event[ jQuery.expando ] ?\n\t\t\tevent :\n\t\t\tnew jQuery.Event( type, typeof event === \"object\" && event );\n\n\t\t// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)\n\t\tevent.isTrigger = onlyHandlers ? 2 : 3;\n\t\tevent.namespace = namespaces.join(\".\");\n\t\tevent.namespace_re = event.namespace ?\n\t\t\tnew RegExp( \"(^|\\\\.)\" + namespaces.join(\"\\\\.(?:.*\\\\.|)\") + \"(\\\\.|$)\" ) :\n\t\t\tnull;\n\n\t\t// Clean up the event in case it is being reused\n\t\tevent.result = undefined;\n\t\tif ( !event.target ) {\n\t\t\tevent.target = elem;\n\t\t}\n\n\t\t// Clone any incoming data and prepend the event, creating the handler arg list\n\t\tdata = data == null ?\n\t\t\t[ event ] :\n\t\t\tjQuery.makeArray( data, [ event ] );\n\n\t\t// Allow special events to draw outside the lines\n\t\tspecial = jQuery.event.special[ type ] || {};\n\t\tif ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Determine event propagation path in advance, per W3C events spec (#9951)\n\t\t// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)\n\t\tif ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {\n\n\t\t\tbubbleType = special.delegateType || type;\n\t\t\tif ( !rfocusMorph.test( bubbleType + type ) ) {\n\t\t\t\tcur = cur.parentNode;\n\t\t\t}\n\t\t\tfor ( ; cur; cur = cur.parentNode ) {\n\t\t\t\teventPath.push( cur );\n\t\t\t\ttmp = cur;\n\t\t\t}\n\n\t\t\t// Only add window if we got to document (e.g., not plain obj or detached DOM)\n\t\t\tif ( tmp === (elem.ownerDocument || document) ) {\n\t\t\t\teventPath.push( tmp.defaultView || tmp.parentWindow || window );\n\t\t\t}\n\t\t}\n\n\t\t// Fire handlers on the event path\n\t\ti = 0;\n\t\twhile ( (cur = eventPath[i++]) && !event.isPropagationStopped() ) {\n\n\t\t\tevent.type = i > 1 ?\n\t\t\t\tbubbleType :\n\t\t\t\tspecial.bindType || type;\n\n\t\t\t// jQuery handler\n\t\t\thandle = ( data_priv.get( cur, \"events\" ) || {} )[ event.type ] && data_priv.get( cur, \"handle\" );\n\t\t\tif ( handle ) {\n\t\t\t\thandle.apply( cur, data );\n\t\t\t}\n\n\t\t\t// Native handler\n\t\t\thandle = ontype && cur[ ontype ];\n\t\t\tif ( handle && handle.apply && jQuery.acceptData( cur ) ) {\n\t\t\t\tevent.result = handle.apply( cur, data );\n\t\t\t\tif ( event.result === false ) {\n\t\t\t\t\tevent.preventDefault();\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\tevent.type = type;\n\n\t\t// If nobody prevented the default action, do it now\n\t\tif ( !onlyHandlers && !event.isDefaultPrevented() ) {\n\n\t\t\tif ( (!special._default || special._default.apply( eventPath.pop(), data ) === false) &&\n\t\t\t\tjQuery.acceptData( elem ) ) {\n\n\t\t\t\t// Call a native DOM method on the target with the same name name as the event.\n\t\t\t\t// Don't do default actions on window, that's where global variables be (#6170)\n\t\t\t\tif ( ontype && jQuery.isFunction( elem[ type ] ) && !jQuery.isWindow( elem ) ) {\n\n\t\t\t\t\t// Don't re-trigger an onFOO event when we call its FOO() method\n\t\t\t\t\ttmp = elem[ ontype ];\n\n\t\t\t\t\tif ( tmp ) {\n\t\t\t\t\t\telem[ ontype ] = null;\n\t\t\t\t\t}\n\n\t\t\t\t\t// Prevent re-triggering of the same event, since we already bubbled it above\n\t\t\t\t\tjQuery.event.triggered = type;\n\t\t\t\t\telem[ type ]();\n\t\t\t\t\tjQuery.event.triggered = undefined;\n\n\t\t\t\t\tif ( tmp ) {\n\t\t\t\t\t\telem[ ontype ] = tmp;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn event.result;\n\t},\n\n\tdispatch: function( event ) {\n\n\t\t// Make a writable jQuery.Event from the native event object\n\t\tevent = jQuery.event.fix( event );\n\n\t\tvar i, j, ret, matched, handleObj,\n\t\t\thandlerQueue = [],\n\t\t\targs = slice.call( arguments ),\n\t\t\thandlers = ( data_priv.get( this, \"events\" ) || {} )[ event.type ] || [],\n\t\t\tspecial = jQuery.event.special[ event.type ] || {};\n\n\t\t// Use the fix-ed jQuery.Event rather than the (read-only) native event\n\t\targs[0] = event;\n\t\tevent.delegateTarget = this;\n\n\t\t// Call the preDispatch hook for the mapped type, and let it bail if desired\n\t\tif ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Determine handlers\n\t\thandlerQueue = jQuery.event.handlers.call( this, event, handlers );\n\n\t\t// Run delegates first; they may want to stop propagation beneath us\n\t\ti = 0;\n\t\twhile ( (matched = handlerQueue[ i++ ]) && !event.isPropagationStopped() ) {\n\t\t\tevent.currentTarget = matched.elem;\n\n\t\t\tj = 0;\n\t\t\twhile ( (handleObj = matched.handlers[ j++ ]) && !event.isImmediatePropagationStopped() ) {\n\n\t\t\t\t// Triggered event must either 1) have no namespace, or 2) have namespace(s)\n\t\t\t\t// a subset or equal to those in the bound event (both can have no namespace).\n\t\t\t\tif ( !event.namespace_re || event.namespace_re.test( handleObj.namespace ) ) {\n\n\t\t\t\t\tevent.handleObj = handleObj;\n\t\t\t\t\tevent.data = handleObj.data;\n\n\t\t\t\t\tret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler )\n\t\t\t\t\t\t\t.apply( matched.elem, args );\n\n\t\t\t\t\tif ( ret !== undefined ) {\n\t\t\t\t\t\tif ( (event.result = ret) === false ) {\n\t\t\t\t\t\t\tevent.preventDefault();\n\t\t\t\t\t\t\tevent.stopPropagation();\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Call the postDispatch hook for the mapped type\n\t\tif ( special.postDispatch ) {\n\t\t\tspecial.postDispatch.call( this, event );\n\t\t}\n\n\t\treturn event.result;\n\t},\n\n\thandlers: function( event, handlers ) {\n\t\tvar i, matches, sel, handleObj,\n\t\t\thandlerQueue = [],\n\t\t\tdelegateCount = handlers.delegateCount,\n\t\t\tcur = event.target;\n\n\t\t// Find delegate handlers\n\t\t// Black-hole SVG